Upload testing game

author: Ray <[email protected]> 2018-11-17 09:59:52 +0100
committer: Ray <[email protected]> 2018-11-17 09:59:52 +0100
commit: ea1963b411f686e7703a85e8844c6d02e7c5da1b (patch)
tree: 19854186c4a4fe1ba5e2929d30fd1256f882b5e7
parent: fd8498b57e1fdb87096a264aa6d4c71700340300 (diff)
download: raylib.com-ea1963b411f686e7703a85e8844c6d02e7c5da1b.tar.gz
raylib.com-ea1963b411f686e7703a85e8844c6d02e7c5da1b.zip
4 files changed, 14208 insertions, 0 deletions
diff --git a/games/money.data b/games/money.data
new file mode 100644
index 0000000..337c3b7
--- /dev/null
+++ b/games/money.data
diff --git a/games/money.html b/games/money.html
new file mode 100644
index 0000000..4e6aa1b
--- /dev/null
+++ b/games/money.html
@@ -0,0 +1,241 @@
+<!doctype html>
+<html lang="en-us">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="Content-Type" content="text/html; charset=utf-8">
+    
+    <title>raylib HTML5 GAME</title>
+    
+    <meta name="title" content="raylib HTML5 GAME">
+    <meta name="description" content="New HTML5 videogame, developed using raylib videogames library">
+    <meta name="keywords" content="raylib, games, html5, programming, C, C++, library, learn, videogames">
+    <meta name="viewport" content="width=device-width">
+    
+    <!-- Facebook metatags for sharing -->
+    <meta property="og:title" content="raylib HTML5 GAME">
+    <meta property="og:image:type" content="image/png">
+    <meta property="og:image" content="http://www.raylib.com/common/img/raylib_logo.png">
+    <meta property="og:image" content="http://www.raylib.com/common/img/raylib_logo.png">
+    <meta property="og:url" content="http://www.raylib.com/games">
+    <meta property="og:site_name" content="raylib.com">
+    <meta property="og:description" content="New hmtl5 videogame, developed using raylib videogames library">
+
+    <!-- Twitter metatags for sharing -->
+    <meta name="twitter:card" content="summary">
+    <meta name="twitter:site" content="@raysan5">
+    <meta name="twitter:title" content="raylib HTML5 GAME">
+    <meta name="twitter:description" content="New HTML5 videogame, developed using raylib videogames library">
+    <meta name="twitter:image" content="http://www.raylib.com/common/img/raylib_logo.png">
+    <meta name="twitter:url" content="http://www.raylib.com/common/img/raylib_logo.png">
+    
+    <!--<link rel="stylesheet" href="./Koala Seasons by emegeme_files/main.css">-->
+    <link rel="shortcut icon" href="http://www.raylib.com/favicon.ico">
+    
+    <style>
+      body {
+        font-family: arial;
+        margin: 0;
+        padding: none;
+      }
+      
+      #header_part {
+        width: 100%;
+        height: 80px;
+        background-color: #888888;
+      }
+      
+      #logo {
+        width:64px; 
+        height:64px; 
+        float:left; 
+        position:relative; 
+        margin:10px; 
+        background-image:url(http://www.raylib.com/common/img/raylib_logo_64x64.png);
+      }
+      
+      .emscripten { padding-right: 0; margin-left: auto; margin-right: auto; display: block; }
+      div.emscripten { text-align: center; }      
+      div.emscripten_border { border: 1px solid black; }
+      
+      /* the canvas *must not* have any border or padding, or mouse coords will be wrong */
+      canvas.emscripten { border: 0px none; background: black; width: 100% }
+      
+      #emscripten_logo {
+        display: inline-block;
+        margin: 0;
+      }
+      
+      .spinner {
+        height: 30px;
+        width: 30px;
+        margin: 0;
+        margin-top: 20px;
+        margin-left: 20px;
+        display: inline-block;
+        vertical-align: top;
+        -webkit-animation: rotation .8s linear infinite;
+        -moz-animation: rotation .8s linear infinite;
+        -o-animation: rotation .8s linear infinite;
+        animation: rotation 0.8s linear infinite;
+        border-left: 5px solid black;
+        border-right: 5px solid black;
+        border-bottom: 5px solid black;
+        border-top: 5px solid red;
+        
+        border-radius: 100%;
+        background-color: rgb(245, 245, 245);
+      }
+      @-webkit-keyframes rotation {
+        from {-webkit-transform: rotate(0deg);}
+        to {-webkit-transform: rotate(360deg);}
+      }
+      @-moz-keyframes rotation {
+        from {-moz-transform: rotate(0deg);}
+        to {-moz-transform: rotate(360deg);}
+      }
+      @-o-keyframes rotation {
+        from {-o-transform: rotate(0deg);}
+        to {-o-transform: rotate(360deg);}
+      }
+      @keyframes rotation {
+        from {transform: rotate(0deg);}
+        to {transform: rotate(360deg);}
+      }
+      
+      #status {
+        display: inline-block;
+        vertical-align: top;
+        margin-top: 30px;
+        margin-left: 20px;
+        font-weight: bold;
+        color: rgb(40, 40, 40);
+      }
+      
+      #progress {
+        height: 20px;
+        width: 30px;
+      }
+      
+      #controls {
+        display: inline-block;
+        float: right;
+        vertical-align: top;
+        margin-top: 30px;
+        margin-right: 20px;
+      }
+      
+      #output {
+        width: 100%;
+        height: 140px;
+        margin: 0 auto;
+        margin-top: 10px;
+        display: block;
+        background-color: black;
+        color: rgb(37, 174, 38);
+        font-family: 'Lucida Console', Monaco, monospace;
+        outline: none;
+      }
+    </style>
+  </head>
+  <body>
+    <div id="header_part">
+        <a id="logo" href="http://www.raylib.com"></a>
+        
+        <div class="spinner" id='spinner'></div>
+        <div class="emscripten" id="status">Downloading...</div>
+
+        <span id='controls'>
+          <span><input type="button" value="Fullscreen" onclick="Module.requestFullscreen(false, false)"></span>
+        </span>
+
+        <div class="emscripten">
+          <progress value="0" max="100" id="progress" hidden=1></progress>
+        </div>
+    </div>
+    
+    <div class="emscripten_border">
+      <canvas class="emscripten" id="canvas" oncontextmenu="event.preventDefault()"></canvas>
+    </div>
+    
+    <textarea id="output" rows="8"></textarea>
+
+    <script type='text/javascript'>
+      var statusElement = document.getElementById('status');
+      var progressElement = document.getElementById('progress');
+      var spinnerElement = document.getElementById('spinner');
+      var Module = {
+        preRun: [],
+        postRun: [],
+        print: (function() {
+          var element = document.getElementById('output');
+          if (element) element.value = ''; // clear browser cache
+          return function(text) {
+            if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' ');
+            // These replacements are necessary if you render to raw HTML
+            //text = text.replace(/&/g, "&amp;");
+            //text = text.replace(/</g, "&lt;");
+            //text = text.replace(/>/g, "&gt;");
+            //text = text.replace('\n', '<br>', 'g');
+            console.log(text);
+            if (element) {
+              element.value += text + "\n";
+              element.scrollTop = element.scrollHeight; // focus on bottom
+            }
+          };
+        })(),
+        printErr: function(text) {
+          if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' ');
+          if (0) { // XXX disabled for safety typeof dump == 'function') {
+            dump(text + '\n'); // fast, straight to the real console
+          } else {
+            console.error(text);
+          }
+        },
+        canvas: (function() {
+          var canvas = document.getElementById('canvas');
+          // As a default initial behavior, pop up an alert when webgl context is lost. To make your
+          // application robust, you may want to override this behavior before shipping!
+          // See http://www.khronos.org/registry/webgl/specs/latest/1.0/#5.15.2
+          canvas.addEventListener("webglcontextlost", function(e) { alert('WebGL context lost. You will need to reload the page.'); e.preventDefault(); }, false);
+          return canvas;
+        })(),
+        setStatus: function(text) {
+          if (!Module.setStatus.last) Module.setStatus.last = { time: Date.now(), text: '' };
+          if (text === Module.setStatus.text) return;
+          var m = text.match(/([^(]+)\((\d+(\.\d+)?)\/(\d+)\)/);
+          var now = Date.now();
+          if (m && now - Date.now() < 30) return; // if this is a progress update, skip it if too soon
+          if (m) {
+            text = m[1];
+            progressElement.value = parseInt(m[2])*100;
+            progressElement.max = parseInt(m[4])*100;
+            progressElement.hidden = false;
+            spinnerElement.hidden = false;
+          } else {
+            progressElement.value = null;
+            progressElement.max = null;
+            progressElement.hidden = true;
+            if (!text) spinnerElement.style.display = 'none';
+          }
+          statusElement.innerHTML = text;
+        },
+        totalDependencies: 0,
+        monitorRunDependencies: function(left) {
+          this.totalDependencies = Math.max(this.totalDependencies, left);
+          Module.setStatus(left ? 'Preparing... (' + (this.totalDependencies-left) + '/' + this.totalDependencies + ')' : 'All downloads complete.');
+        }
+      };
+      Module.setStatus('Downloading...');
+      window.onerror = function(event) {
+        // TODO: do not warn on ok events like simulating an infinite loop or exitStatus
+        Module.setStatus('Exception thrown, see JavaScript console');
+        spinnerElement.style.display = 'none';
+        Module.setStatus = function(text) {
+          if (text) Module.printErr('[post-exception status] ' + text);
+        };
+      };
+    </script>
+    <script async type="text/javascript" src="money.js"></script>
+  </body>
+</html>
+
diff --git a/games/money.js b/games/money.js
new file mode 100644
index 0000000..8a20dbb
--- /dev/null
+++ b/games/money.js
@@ -0,0 +1,13967 @@
+// Copyright 2010 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define   var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof Module !== 'undefined' ? Module : {};
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+
+if (!Module.expectedDataFileDownloads) {
+  Module.expectedDataFileDownloads = 0;
+  Module.finishedDataFileDownloads = 0;
+}
+Module.expectedDataFileDownloads++;
+(function() {
+ var loadPackage = function(metadata) {
+
+    var PACKAGE_PATH;
+    if (typeof window === 'object') {
+      PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
+    } else if (typeof location !== 'undefined') {
+      // worker
+      PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
+    } else {
+      throw 'using preloaded data can only be done on a web page or in a web worker';
+    }
+    var PACKAGE_NAME = 'money.data';
+    var REMOTE_PACKAGE_BASE = 'money.data';
+    if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
+      Module['locateFile'] = Module['locateFilePackage'];
+      err('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
+    }
+    var REMOTE_PACKAGE_NAME = Module['locateFile'] ? Module['locateFile'](REMOTE_PACKAGE_BASE, '') : REMOTE_PACKAGE_BASE;
+  
+    var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
+    var PACKAGE_UUID = metadata.package_uuid;
+  
+    function fetchRemotePackage(packageName, packageSize, callback, errback) {
+      var xhr = new XMLHttpRequest();
+      xhr.open('GET', packageName, true);
+      xhr.responseType = 'arraybuffer';
+      xhr.onprogress = function(event) {
+        var url = packageName;
+        var size = packageSize;
+        if (event.total) size = event.total;
+        if (event.loaded) {
+          if (!xhr.addedTotal) {
+            xhr.addedTotal = true;
+            if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
+            Module.dataFileDownloads[url] = {
+              loaded: event.loaded,
+              total: size
+            };
+          } else {
+            Module.dataFileDownloads[url].loaded = event.loaded;
+          }
+          var total = 0;
+          var loaded = 0;
+          var num = 0;
+          for (var download in Module.dataFileDownloads) {
+          var data = Module.dataFileDownloads[download];
+            total += data.total;
+            loaded += data.loaded;
+            num++;
+          }
+          total = Math.ceil(total * Module.expectedDataFileDownloads/num);
+          if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
+        } else if (!Module.dataFileDownloads) {
+          if (Module['setStatus']) Module['setStatus']('Downloading data...');
+        }
+      };
+      xhr.onerror = function(event) {
+        throw new Error("NetworkError for: " + packageName);
+      }
+      xhr.onload = function(event) {
+        if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+          var packageData = xhr.response;
+          callback(packageData);
+        } else {
+          throw new Error(xhr.statusText + " : " + xhr.responseURL);
+        }
+      };
+      xhr.send(null);
+    };
+
+    function handleError(error) {
+      console.error('package error:', error);
+    };
+  
+      var fetchedCallback = null;
+      var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;
+
+      if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
+        if (fetchedCallback) {
+          fetchedCallback(data);
+          fetchedCallback = null;
+        } else {
+          fetched = data;
+        }
+      }, handleError);
+    
+  function runWithFS() {
+
+    function assert(check, msg) {
+      if (!check) throw msg + new Error().stack;
+    }
+Module['FS_createPath']('/', 'resources', true, true);
+Module['FS_createPath']('/resources', 'audio', true, true);
+
+    function DataRequest(start, end, audio) {
+      this.start = start;
+      this.end = end;
+      this.audio = audio;
+    }
+    DataRequest.prototype = {
+      requests: {},
+      open: function(mode, name) {
+        this.name = name;
+        this.requests[name] = this;
+        Module['addRunDependency']('fp ' + this.name);
+      },
+      send: function() {},
+      onload: function() {
+        var byteArray = this.byteArray.subarray(this.start, this.end);
+        this.finish(byteArray);
+      },
+      finish: function(byteArray) {
+        var that = this;
+
+        Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
+        Module['removeRunDependency']('fp ' + that.name);
+
+        this.requests[this.name] = null;
+      }
+    };
+
+        var files = metadata.files;
+        for (var i = 0; i < files.length; ++i) {
+          new DataRequest(files[i].start, files[i].end, files[i].audio).open('GET', files[i].filename);
+        }
+
+  
+    function processPackageData(arrayBuffer) {
+      Module.finishedDataFileDownloads++;
+      assert(arrayBuffer, 'Loading data file failed.');
+      assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
+      var byteArray = new Uint8Array(arrayBuffer);
+      var curr;
+      
+        // Reuse the bytearray from the XHR as the source for file reads.
+        DataRequest.prototype.byteArray = byteArray;
+  
+          var files = metadata.files;
+          for (var i = 0; i < files.length; ++i) {
+            DataRequest.prototype.requests[files[i].filename].onload();
+          }
+              Module['removeRunDependency']('datafile_money.data');
+
+    };
+    Module['addRunDependency']('datafile_money.data');
+  
+    if (!Module.preloadResults) Module.preloadResults = {};
+  
+      Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
+      if (fetched) {
+        processPackageData(fetched);
+        fetched = null;
+      } else {
+        fetchedCallback = processPackageData;
+      }
+    
+  }
+  if (Module['calledRun']) {
+    runWithFS();
+  } else {
+    if (!Module['preRun']) Module['preRun'] = [];
+    Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
+  }
+
+ }
+ loadPackage({"files": [{"start": 0, "audio": 0, "end": 94360, "filename": "/resources/answers_back.png"}, {"start": 94360, "audio": 0, "end": 1137122, "filename": "/resources/background.png"}, {"start": 1137122, "audio": 0, "end": 1165010, "filename": "/resources/helper_fifty.png"}, {"start": 1165010, "audio": 0, "end": 1192371, "filename": "/resources/helper_people.png"}, {"start": 1192371, "audio": 0, "end": 1220213, "filename": "/resources/helper_phone.png"}, {"start": 1220213, "audio": 0, "end": 1242287, "filename": "/resources/keepcalm.fnt"}, {"start": 1242287, "audio": 0, "end": 1335011, "filename": "/resources/keepcalm.png"}, {"start": 1335011, "audio": 0, "end": 1336298, "filename": "/resources/money_bars_off.png"}, {"start": 1336298, "audio": 0, "end": 1340296, "filename": "/resources/money_bars_on.png"}, {"start": 1340296, "audio": 0, "end": 1377541, "filename": "/resources/money_prize.png"}, {"start": 1377541, "audio": 0, "end": 1377734, "filename": "/resources/money_rec.png"}, {"start": 1377734, "audio": 0, "end": 1381231, "filename": "/resources/money_slider_back.png"}, {"start": 1381231, "audio": 0, "end": 1411403, "filename": "/resources/questions_back.png"}, {"start": 1411403, "audio": 0, "end": 1507150, "filename": "/resources/spinning_coin.png"}, {"start": 1507150, "audio": 0, "end": 1692559, "filename": "/resources/title_back.png"}, {"start": 1692559, "audio": 0, "end": 1704090, "filename": "/resources/title_boda.png"}, {"start": 1704090, "audio": 0, "end": 1724989, "filename": "/resources/title_menu_back.png"}, {"start": 1724989, "audio": 0, "end": 1776863, "filename": "/resources/title_pasta.png"}, {"start": 1776863, "audio": 1, "end": 1890839, "filename": "/resources/audio/checking.mp3"}, {"start": 1890839, "audio": 1, "end": 1949226, "filename": "/resources/audio/fail.mp3"}, {"start": 1949226, "audio": 1, "end": 3491651, "filename": "/resources/audio/game.mp3"}, {"start": 3491651, "audio": 1, "end": 3578877, "filename": "/resources/audio/interludio.mp3"}, {"start": 3578877, "audio": 1, "end": 4266785, "filename": "/resources/audio/main.mp3"}, {"start": 4266785, "audio": 1, "end": 4471950, "filename": "/resources/audio/perfect.mp3"}, {"start": 4471950, "audio": 1, "end": 4514037, "filename": "/resources/audio/success.mp3"}], "remote_package_size": 4514037, "package_uuid": "f100c444-786a-4c02-84f7-609c5f17e856"});
+
+})();
+
+
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+var key;
+for (key in Module) {
+  if (Module.hasOwnProperty(key)) {
+    moduleOverrides[key] = Module[key];
+  }
+}
+
+Module['arguments'] = [];
+Module['thisProgram'] = './this.program';
+Module['quit'] = function(status, toThrow) {
+  throw toThrow;
+};
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = false;
+var ENVIRONMENT_IS_SHELL = false;
+ENVIRONMENT_IS_WEB = typeof window === 'object';
+ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+  if (Module['locateFile']) {
+    return Module['locateFile'](path, scriptDirectory);
+  } else {
+    return scriptDirectory + path;
+  }
+}
+
+if (ENVIRONMENT_IS_NODE) {
+  scriptDirectory = __dirname + '/';
+
+  // Expose functionality in the same simple way that the shells work
+  // Note that we pollute the global namespace here, otherwise we break in node
+  var nodeFS;
+  var nodePath;
+
+  Module['read'] = function shell_read(filename, binary) {
+    var ret;
+      if (!nodeFS) nodeFS = require('fs');
+      if (!nodePath) nodePath = require('path');
+      filename = nodePath['normalize'](filename);
+      ret = nodeFS['readFileSync'](filename);
+    return binary ? ret : ret.toString();
+  };
+
+  Module['readBinary'] = function readBinary(filename) {
+    var ret = Module['read'](filename, true);
+    if (!ret.buffer) {
+      ret = new Uint8Array(ret);
+    }
+    assert(ret.buffer);
+    return ret;
+  };
+
+  if (process['argv'].length > 1) {
+    Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+  }
+
+  Module['arguments'] = process['argv'].slice(2);
+
+  if (typeof module !== 'undefined') {
+    module['exports'] = Module;
+  }
+
+  process['on']('uncaughtException', function(ex) {
+    // suppress ExitStatus exceptions from showing an error
+    if (!(ex instanceof ExitStatus)) {
+      throw ex;
+    }
+  });
+  // Currently node will swallow unhandled rejections, but this behavior is
+  // deprecated, and in the future it will exit with error status.
+  process['on']('unhandledRejection', abort);
+
+  Module['quit'] = function(status) {
+    process['exit'](status);
+  };
+
+  Module['inspect'] = function () { return '[Emscripten Module object]'; };
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+
+  if (typeof read != 'undefined') {
+    Module['read'] = function shell_read(f) {
+      return read(f);
+    };
+  }
+
+  Module['readBinary'] = function readBinary(f) {
+    var data;
+    if (typeof readbuffer === 'function') {
+      return new Uint8Array(readbuffer(f));
+    }
+    data = read(f, 'binary');
+    assert(typeof data === 'object');
+    return data;
+  };
+
+  if (typeof scriptArgs != 'undefined') {
+    Module['arguments'] = scriptArgs;
+  } else if (typeof arguments != 'undefined') {
+    Module['arguments'] = arguments;
+  }
+
+  if (typeof quit === 'function') {
+    Module['quit'] = function(status) {
+      quit(status);
+    }
+  }
+} else
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+  if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
+    scriptDirectory = self.location.href;
+  } else if (document.currentScript) { // web
+    scriptDirectory = document.currentScript.src;
+  }
+  // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+  // otherwise, slice off the final part of the url to find the script directory.
+  // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+  // and scriptDirectory will correctly be replaced with an empty string.
+  if (scriptDirectory.indexOf('blob:') !== 0) {
+    scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1);
+  } else {
+    scriptDirectory = '';
+  }
+
+
+  Module['read'] = function shell_read(url) {
+      var xhr = new XMLHttpRequest();
+      xhr.open('GET', url, false);
+      xhr.send(null);
+      return xhr.responseText;
+  };
+
+  if (ENVIRONMENT_IS_WORKER) {
+    Module['readBinary'] = function readBinary(url) {
+        var xhr = new XMLHttpRequest();
+        xhr.open('GET', url, false);
+        xhr.responseType = 'arraybuffer';
+        xhr.send(null);
+        return new Uint8Array(xhr.response);
+    };
+  }
+
+  Module['readAsync'] = function readAsync(url, onload, onerror) {
+    var xhr = new XMLHttpRequest();
+    xhr.open('GET', url, true);
+    xhr.responseType = 'arraybuffer';
+    xhr.onload = function xhr_onload() {
+      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+        onload(xhr.response);
+        return;
+      }
+      onerror();
+    };
+    xhr.onerror = onerror;
+    xhr.send(null);
+  };
+
+  Module['setWindowTitle'] = function(title) { document.title = title };
+} else
+{
+}
+
+// Set up the out() and err() hooks, which are how we can print to stdout or
+// stderr, respectively.
+// If the user provided Module.print or printErr, use that. Otherwise,
+// console.log is checked first, as 'print' on the web will open a print dialogue
+// printErr is preferable to console.warn (works better in shells)
+// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior.
+var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null));
+var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out));
+
+// Merge back in the overrides
+for (key in moduleOverrides) {
+  if (moduleOverrides.hasOwnProperty(key)) {
+    Module[key] = moduleOverrides[key];
+  }
+}
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = undefined;
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+
+
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// {{PREAMBLE_ADDITIONS}}
+
+var STACK_ALIGN = 16;
+
+
+function staticAlloc(size) {
+  var ret = STATICTOP;
+  STATICTOP = (STATICTOP + size + 15) & -16;
+  return ret;
+}
+
+function dynamicAlloc(size) {
+  var ret = HEAP32[DYNAMICTOP_PTR>>2];
+  var end = (ret + size + 15) & -16;
+  HEAP32[DYNAMICTOP_PTR>>2] = end;
+  if (end >= TOTAL_MEMORY) {
+    var success = enlargeMemory();
+    if (!success) {
+      HEAP32[DYNAMICTOP_PTR>>2] = ret;
+      return 0;
+    }
+  }
+  return ret;
+}
+
+function alignMemory(size, factor) {
+  if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default
+  var ret = size = Math.ceil(size / factor) * factor;
+  return ret;
+}
+
+function getNativeTypeSize(type) {
+  switch (type) {
+    case 'i1': case 'i8': return 1;
+    case 'i16': return 2;
+    case 'i32': return 4;
+    case 'i64': return 8;
+    case 'float': return 4;
+    case 'double': return 8;
+    default: {
+      if (type[type.length-1] === '*') {
+        return 4; // A pointer
+      } else if (type[0] === 'i') {
+        var bits = parseInt(type.substr(1));
+        assert(bits % 8 === 0);
+        return bits / 8;
+      } else {
+        return 0;
+      }
+    }
+  }
+}
+
+function warnOnce(text) {
+  if (!warnOnce.shown) warnOnce.shown = {};
+  if (!warnOnce.shown[text]) {
+    warnOnce.shown[text] = 1;
+    err(text);
+  }
+}
+
+var asm2wasmImports = { // special asm2wasm imports
+    "f64-rem": function(x, y) {
+        return x % y;
+    },
+    "debugger": function() {
+        debugger;
+    }
+};
+
+
+
+var jsCallStartIndex = 1;
+var functionPointers = new Array(0);
+
+// 'sig' parameter is only used on LLVM wasm backend
+function addFunction(func, sig) {
+  var base = 0;
+  for (var i = base; i < base + 0; i++) {
+    if (!functionPointers[i]) {
+      functionPointers[i] = func;
+      return jsCallStartIndex + i;
+    }
+  }
+  throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+}
+
+function removeFunction(index) {
+  functionPointers[index-jsCallStartIndex] = null;
+}
+
+var funcWrappers = {};
+
+function getFuncWrapper(func, sig) {
+  if (!func) return; // on null pointer, return undefined
+  assert(sig);
+  if (!funcWrappers[sig]) {
+    funcWrappers[sig] = {};
+  }
+  var sigCache = funcWrappers[sig];
+  if (!sigCache[func]) {
+    // optimize away arguments usage in common cases
+    if (sig.length === 1) {
+      sigCache[func] = function dynCall_wrapper() {
+        return dynCall(sig, func);
+      };
+    } else if (sig.length === 2) {
+      sigCache[func] = function dynCall_wrapper(arg) {
+        return dynCall(sig, func, [arg]);
+      };
+    } else {
+      // general case
+      sigCache[func] = function dynCall_wrapper() {
+        return dynCall(sig, func, Array.prototype.slice.call(arguments));
+      };
+    }
+  }
+  return sigCache[func];
+}
+
+
+function makeBigInt(low, high, unsigned) {
+  return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0));
+}
+
+function dynCall(sig, ptr, args) {
+  if (args && args.length) {
+    return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
+  } else {
+    return Module['dynCall_' + sig].call(null, ptr);
+  }
+}
+
+
+
+var Runtime = {
+  // FIXME backwards compatibility layer for ports. Support some Runtime.*
+  //       for now, fix it there, then remove it from here. That way we
+  //       can minimize any period of breakage.
+  dynCall: dynCall, // for SDL2 port
+};
+
+// The address globals begin at. Very low in memory, for code size and optimization opportunities.
+// Above 0 is static memory, starting with globals.
+// Then the stack.
+// Then 'dynamic' memory for sbrk.
+var GLOBAL_BASE = 1024;
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+//    site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+//    site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort().  Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS = 0;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+  if (!condition) {
+    abort('Assertion failed: ' + text);
+  }
+}
+
+var globalScope = this;
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+  var func = Module['_' + ident]; // closure exported function
+  assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+  return func;
+}
+
+var JSfuncs = {
+  // Helpers for cwrap -- it can't refer to Runtime directly because it might
+  // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
+  // out what the minified function name is.
+  'stackSave': function() {
+    stackSave()
+  },
+  'stackRestore': function() {
+    stackRestore()
+  },
+  // type conversion from js to c
+  'arrayToC' : function(arr) {
+    var ret = stackAlloc(arr.length);
+    writeArrayToMemory(arr, ret);
+    return ret;
+  },
+  'stringToC' : function(str) {
+    var ret = 0;
+    if (str !== null && str !== undefined && str !== 0) { // null string
+      // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+      var len = (str.length << 2) + 1;
+      ret = stackAlloc(len);
+      stringToUTF8(str, ret, len);
+    }
+    return ret;
+  }
+};
+
+// For fast lookup of conversion functions
+var toC = {
+  'string': JSfuncs['stringToC'], 'array': JSfuncs['arrayToC']
+};
+
+
+// C calling interface.
+function ccall(ident, returnType, argTypes, args, opts) {
+  function convertReturnValue(ret) {
+    if (returnType === 'string') return Pointer_stringify(ret);
+    if (returnType === 'boolean') return Boolean(ret);
+    return ret;
+  }
+
+  var func = getCFunc(ident);
+  var cArgs = [];
+  var stack = 0;
+  if (args) {
+    for (var i = 0; i < args.length; i++) {
+      var converter = toC[argTypes[i]];
+      if (converter) {
+        if (stack === 0) stack = stackSave();
+        cArgs[i] = converter(args[i]);
+      } else {
+        cArgs[i] = args[i];
+      }
+    }
+  }
+  var ret = func.apply(null, cArgs);
+  ret = convertReturnValue(ret);
+  if (stack !== 0) stackRestore(stack);
+  return ret;
+}
+
+function cwrap(ident, returnType, argTypes, opts) {
+  argTypes = argTypes || [];
+  // When the function takes numbers and returns a number, we can just return
+  // the original function
+  var numericArgs = argTypes.every(function(type){ return type === 'number'});
+  var numericRet = returnType !== 'string';
+  if (numericRet && numericArgs && !opts) {
+    return getCFunc(ident);
+  }
+  return function() {
+    return ccall(ident, returnType, argTypes, arguments, opts);
+  }
+}
+
+/** @type {function(number, number, string, boolean=)} */
+function setValue(ptr, value, type, noSafe) {
+  type = type || 'i8';
+  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+    switch(type) {
+      case 'i1': HEAP8[((ptr)>>0)]=value; break;
+      case 'i8': HEAP8[((ptr)>>0)]=value; break;
+      case 'i16': HEAP16[((ptr)>>1)]=value; break;
+      case 'i32': HEAP32[((ptr)>>2)]=value; break;
+      case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+      case 'float': HEAPF32[((ptr)>>2)]=value; break;
+      case 'double': HEAPF64[((ptr)>>3)]=value; break;
+      default: abort('invalid type for setValue: ' + type);
+    }
+}
+
+/** @type {function(number, string, boolean=)} */
+function getValue(ptr, type, noSafe) {
+  type = type || 'i8';
+  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+    switch(type) {
+      case 'i1': return HEAP8[((ptr)>>0)];
+      case 'i8': return HEAP8[((ptr)>>0)];
+      case 'i16': return HEAP16[((ptr)>>1)];
+      case 'i32': return HEAP32[((ptr)>>2)];
+      case 'i64': return HEAP32[((ptr)>>2)];
+      case 'float': return HEAPF32[((ptr)>>2)];
+      case 'double': return HEAPF64[((ptr)>>3)];
+      default: abort('invalid type for getValue: ' + type);
+    }
+  return null;
+}
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_STATIC = 2; // Cannot be freed
+var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
+var ALLOC_NONE = 4; // Do not allocate
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+//             is a little tricky (see docs right below). The reason is that it is optimized
+//             for multiple syntaxes to save space in generated code. So you should
+//             normally not use allocate(), and instead allocate memory using _malloc(),
+//             initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+//        in *bytes* (note that this is sometimes confusing: the next parameter does not
+//        affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+//         or a single type which is used for the entire block. This only matters if there
+//         is initial data - if @slab is a number, then this does not matter at all and is
+//         ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */
+function allocate(slab, types, allocator, ptr) {
+  var zeroinit, size;
+  if (typeof slab === 'number') {
+    zeroinit = true;
+    size = slab;
+  } else {
+    zeroinit = false;
+    size = slab.length;
+  }
+
+  var singleType = typeof types === 'string' ? types : null;
+
+  var ret;
+  if (allocator == ALLOC_NONE) {
+    ret = ptr;
+  } else {
+    ret = [typeof _malloc === 'function' ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
+  }
+
+  if (zeroinit) {
+    var stop;
+    ptr = ret;
+    assert((ret & 3) == 0);
+    stop = ret + (size & ~3);
+    for (; ptr < stop; ptr += 4) {
+      HEAP32[((ptr)>>2)]=0;
+    }
+    stop = ret + size;
+    while (ptr < stop) {
+      HEAP8[((ptr++)>>0)]=0;
+    }
+    return ret;
+  }
+
+  if (singleType === 'i8') {
+    if (slab.subarray || slab.slice) {
+      HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret);
+    } else {
+      HEAPU8.set(new Uint8Array(slab), ret);
+    }
+    return ret;
+  }
+
+  var i = 0, type, typeSize, previousType;
+  while (i < size) {
+    var curr = slab[i];
+
+    type = singleType || types[i];
+    if (type === 0) {
+      i++;
+      continue;
+    }
+
+    if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+    setValue(ret+i, curr, type);
+
+    // no need to look up size unless type changes, so cache it
+    if (previousType !== type) {
+      typeSize = getNativeTypeSize(type);
+      previousType = type;
+    }
+    i += typeSize;
+  }
+
+  return ret;
+}
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+  if (!staticSealed) return staticAlloc(size);
+  if (!runtimeInitialized) return dynamicAlloc(size);
+  return _malloc(size);
+}
+
+/** @type {function(number, number=)} */
+function Pointer_stringify(ptr, length) {
+  if (length === 0 || !ptr) return '';
+  // Find the length, and check for UTF while doing so
+  var hasUtf = 0;
+  var t;
+  var i = 0;
+  while (1) {
+    t = HEAPU8[(((ptr)+(i))>>0)];
+    hasUtf |= t;
+    if (t == 0 && !length) break;
+    i++;
+    if (length && i == length) break;
+  }
+  if (!length) length = i;
+
+  var ret = '';
+
+  if (hasUtf < 128) {
+    var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
+    var curr;
+    while (length > 0) {
+      curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
+      ret = ret ? ret + curr : curr;
+      ptr += MAX_CHUNK;
+      length -= MAX_CHUNK;
+    }
+    return ret;
+  }
+  return UTF8ToString(ptr);
+}
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+  var str = '';
+  while (1) {
+    var ch = HEAP8[((ptr++)>>0)];
+    if (!ch) return str;
+    str += String.fromCharCode(ch);
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+  return writeAsciiToMemory(str, outPtr, false);
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
+function UTF8ArrayToString(u8Array, idx) {
+  var endPtr = idx;
+  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+  while (u8Array[endPtr]) ++endPtr;
+
+  if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
+    return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
+  } else {
+    var u0, u1, u2, u3, u4, u5;
+
+    var str = '';
+    while (1) {
+      // For UTF8 byte structure, see:
+      // http://en.wikipedia.org/wiki/UTF-8#Description
+      // https://www.ietf.org/rfc/rfc2279.txt
+      // https://tools.ietf.org/html/rfc3629
+      u0 = u8Array[idx++];
+      if (!u0) return str;
+      if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+      u1 = u8Array[idx++] & 63;
+      if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+      u2 = u8Array[idx++] & 63;
+      if ((u0 & 0xF0) == 0xE0) {
+        u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+      } else {
+        u3 = u8Array[idx++] & 63;
+        if ((u0 & 0xF8) == 0xF0) {
+          u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
+        } else {
+          u4 = u8Array[idx++] & 63;
+          if ((u0 & 0xFC) == 0xF8) {
+            u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
+          } else {
+            u5 = u8Array[idx++] & 63;
+            u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
+          }
+        }
+      }
+      if (u0 < 0x10000) {
+        str += String.fromCharCode(u0);
+      } else {
+        var ch = u0 - 0x10000;
+        str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+      }
+    }
+  }
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ToString(ptr) {
+  return UTF8ArrayToString(HEAPU8,ptr);
+}
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+//   outIdx: The starting offset in the array to begin the copying.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array.
+//                    This count should include the null terminator,
+//                    i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+  if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+    return 0;
+
+  var startIdx = outIdx;
+  var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+    var u = str.charCodeAt(i); // possibly a lead surrogate
+    if (u >= 0xD800 && u <= 0xDFFF) {
+      var u1 = str.charCodeAt(++i);
+      u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+    }
+    if (u <= 0x7F) {
+      if (outIdx >= endIdx) break;
+      outU8Array[outIdx++] = u;
+    } else if (u <= 0x7FF) {
+      if (outIdx + 1 >= endIdx) break;
+      outU8Array[outIdx++] = 0xC0 | (u >> 6);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else if (u <= 0xFFFF) {
+      if (outIdx + 2 >= endIdx) break;
+      outU8Array[outIdx++] = 0xE0 | (u >> 12);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else if (u <= 0x1FFFFF) {
+      if (outIdx + 3 >= endIdx) break;
+      outU8Array[outIdx++] = 0xF0 | (u >> 18);
+      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else if (u <= 0x3FFFFFF) {
+      if (outIdx + 4 >= endIdx) break;
+      outU8Array[outIdx++] = 0xF8 | (u >> 24);
+      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else {
+      if (outIdx + 5 >= endIdx) break;
+      outU8Array[outIdx++] = 0xFC | (u >> 30);
+      outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    }
+  }
+  // Null-terminate the pointer to the buffer.
+  outU8Array[outIdx] = 0;
+  return outIdx - startIdx;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+  return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF8(str) {
+  var len = 0;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var u = str.charCodeAt(i); // possibly a lead surrogate
+    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+    if (u <= 0x7F) {
+      ++len;
+    } else if (u <= 0x7FF) {
+      len += 2;
+    } else if (u <= 0xFFFF) {
+      len += 3;
+    } else if (u <= 0x1FFFFF) {
+      len += 4;
+    } else if (u <= 0x3FFFFFF) {
+      len += 5;
+    } else {
+      len += 6;
+    }
+  }
+  return len;
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
+function UTF16ToString(ptr) {
+  var endPtr = ptr;
+  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+  var idx = endPtr >> 1;
+  while (HEAP16[idx]) ++idx;
+  endPtr = idx << 1;
+
+  if (endPtr - ptr > 32 && UTF16Decoder) {
+    return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
+  } else {
+    var i = 0;
+
+    var str = '';
+    while (1) {
+      var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+      if (codeUnit == 0) return str;
+      ++i;
+      // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+      str += String.fromCharCode(codeUnit);
+    }
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outPtr: Byte address in Emscripten HEAP where to write the string to.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+//                    terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+  if (maxBytesToWrite === undefined) {
+    maxBytesToWrite = 0x7FFFFFFF;
+  }
+  if (maxBytesToWrite < 2) return 0;
+  maxBytesToWrite -= 2; // Null terminator.
+  var startPtr = outPtr;
+  var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+  for (var i = 0; i < numCharsToWrite; ++i) {
+    // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+    HEAP16[((outPtr)>>1)]=codeUnit;
+    outPtr += 2;
+  }
+  // Null-terminate the pointer to the HEAP.
+  HEAP16[((outPtr)>>1)]=0;
+  return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+  return str.length*2;
+}
+
+function UTF32ToString(ptr) {
+  var i = 0;
+
+  var str = '';
+  while (1) {
+    var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+    if (utf32 == 0)
+      return str;
+    ++i;
+    // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    if (utf32 >= 0x10000) {
+      var ch = utf32 - 0x10000;
+      str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+    } else {
+      str += String.fromCharCode(utf32);
+    }
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outPtr: Byte address in Emscripten HEAP where to write the string to.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+//                    terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+  if (maxBytesToWrite === undefined) {
+    maxBytesToWrite = 0x7FFFFFFF;
+  }
+  if (maxBytesToWrite < 4) return 0;
+  var startPtr = outPtr;
+  var endPtr = startPtr + maxBytesToWrite - 4;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+      var trailSurrogate = str.charCodeAt(++i);
+      codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+    }
+    HEAP32[((outPtr)>>2)]=codeUnit;
+    outPtr += 4;
+    if (outPtr + 4 > endPtr) break;
+  }
+  // Null-terminate the pointer to the HEAP.
+  HEAP32[((outPtr)>>2)]=0;
+  return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+  var len = 0;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var codeUnit = str.charCodeAt(i);
+    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+    len += 4;
+  }
+
+  return len;
+}
+
+// Allocate heap space for a JS string, and write it there.
+// It is the responsibility of the caller to free() that memory.
+function allocateUTF8(str) {
+  var size = lengthBytesUTF8(str) + 1;
+  var ret = _malloc(size);
+  if (ret) stringToUTF8Array(str, HEAP8, ret, size);
+  return ret;
+}
+
+// Allocate stack space for a JS string, and write it there.
+function allocateUTF8OnStack(str) {
+  var size = lengthBytesUTF8(str) + 1;
+  var ret = stackAlloc(size);
+  stringToUTF8Array(str, HEAP8, ret, size);
+  return ret;
+}
+
+function demangle(func) {
+  return func;
+}
+
+function demangleAll(text) {
+  var regex =
+    /__Z[\w\d_]+/g;
+  return text.replace(regex,
+    function(x) {
+      var y = demangle(x);
+      return x === y ? x : (y + ' [' + x + ']');
+    });
+}
+
+function jsStackTrace() {
+  var err = new Error();
+  if (!err.stack) {
+    // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+    // so try that as a special-case.
+    try {
+      throw new Error(0);
+    } catch(e) {
+      err = e;
+    }
+    if (!err.stack) {
+      return '(no stack trace available)';
+    }
+  }
+  return err.stack.toString();
+}
+
+function stackTrace() {
+  var js = jsStackTrace();
+  if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+  return demangleAll(js);
+}
+
+// Memory management
+
+var PAGE_SIZE = 16384;
+var WASM_PAGE_SIZE = 65536;
+var ASMJS_PAGE_SIZE = 16777216;
+var MIN_TOTAL_MEMORY = 16777216;
+
+function alignUp(x, multiple) {
+  if (x % multiple > 0) {
+    x += multiple - (x % multiple);
+  }
+  return x;
+}
+
+var HEAP,
+/** @type {ArrayBuffer} */
+  buffer,
+/** @type {Int8Array} */
+  HEAP8,
+/** @type {Uint8Array} */
+  HEAPU8,
+/** @type {Int16Array} */
+  HEAP16,
+/** @type {Uint16Array} */
+  HEAPU16,
+/** @type {Int32Array} */
+  HEAP32,
+/** @type {Uint32Array} */
+  HEAPU32,
+/** @type {Float32Array} */
+  HEAPF32,
+/** @type {Float64Array} */
+  HEAPF64;
+
+function updateGlobalBuffer(buf) {
+  Module['buffer'] = buffer = buf;
+}
+
+function updateGlobalBufferViews() {
+  Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
+  Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
+  Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
+  Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
+  Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
+  Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
+  Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
+  Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
+}
+
+var STATIC_BASE, STATICTOP, staticSealed; // static area
+var STACK_BASE, STACKTOP, STACK_MAX; // stack area
+var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
+
+  STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
+  staticSealed = false;
+
+
+
+
+function abortOnCannotGrowMemory() {
+  abort('Cannot enlarge memory arrays. Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ');
+}
+
+if (!Module['reallocBuffer']) Module['reallocBuffer'] = function(size) {
+  var ret;
+  try {
+    var oldHEAP8 = HEAP8;
+    ret = new ArrayBuffer(size);
+    var temp = new Int8Array(ret);
+    temp.set(oldHEAP8);
+  } catch(e) {
+    return false;
+  }
+  var success = _emscripten_replace_memory(ret);
+  if (!success) return false;
+  return ret;
+};
+
+function enlargeMemory() {
+  // TOTAL_MEMORY is the current size of the actual array, and DYNAMICTOP is the new top.
+
+
+  var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB.
+  var LIMIT = 2147483648 - PAGE_MULTIPLE; // We can do one page short of 2GB as theoretical maximum.
+
+  if (HEAP32[DYNAMICTOP_PTR>>2] > LIMIT) {
+    return false;
+  }
+
+  var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
+  TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY); // So the loop below will not be infinite, and minimum asm.js memory size is 16MB.
+
+  while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR>>2]) { // Keep incrementing the heap size as long as it's less than what is requested.
+    if (TOTAL_MEMORY <= 536870912) {
+      TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE); // Simple heuristic: double until 1GB...
+    } else {
+      // ..., but after that, add smaller increments towards 2GB, which we cannot reach
+      TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT);
+    }
+  }
+
+
+
+  var replacement = Module['reallocBuffer'](TOTAL_MEMORY);
+  if (!replacement || replacement.byteLength != TOTAL_MEMORY) {
+    // restore the state to before this call, we failed
+    TOTAL_MEMORY = OLD_TOTAL_MEMORY;
+    return false;
+  }
+
+  // everything worked
+
+  updateGlobalBuffer(replacement);
+  updateGlobalBufferViews();
+
+
+
+  return true;
+}
+
+var byteLength;
+try {
+  byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, 'byteLength').get);
+  byteLength(new ArrayBuffer(4)); // can fail on older ie
+} catch(e) { // can fail on older node/v8
+  byteLength = function(buffer) { return buffer.byteLength; };
+}
+
+var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
+var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
+if (TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
+
+// Initialize the runtime's memory
+
+
+
+// Use a provided buffer, if there is one, or else allocate a new one
+if (Module['buffer']) {
+  buffer = Module['buffer'];
+} else {
+  // Use a WebAssembly memory where available
+  if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') {
+    Module['wasmMemory'] = new WebAssembly.Memory({ 'initial': TOTAL_MEMORY / WASM_PAGE_SIZE });
+    buffer = Module['wasmMemory'].buffer;
+  } else
+  {
+    buffer = new ArrayBuffer(TOTAL_MEMORY);
+  }
+  Module['buffer'] = buffer;
+}
+updateGlobalBufferViews();
+
+
+function getTotalMemory() {
+  return TOTAL_MEMORY;
+}
+
+// Endianness check (note: assumes compiler arch was little-endian)
+
+function callRuntimeCallbacks(callbacks) {
+  while(callbacks.length > 0) {
+    var callback = callbacks.shift();
+    if (typeof callback == 'function') {
+      callback();
+      continue;
+    }
+    var func = callback.func;
+    if (typeof func === 'number') {
+      if (callback.arg === undefined) {
+        Module['dynCall_v'](func);
+      } else {
+        Module['dynCall_vi'](func, callback.arg);
+      }
+    } else {
+      func(callback.arg === undefined ? null : callback.arg);
+    }
+  }
+}
+
+var __ATPRERUN__  = []; // functions called before the runtime is initialized
+var __ATINIT__    = []; // functions called during startup
+var __ATMAIN__    = []; // functions called when main() is to be run
+var __ATEXIT__    = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+
+function preRun() {
+  // compatibility - merge in anything from Module['preRun'] at this time
+  if (Module['preRun']) {
+    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+    while (Module['preRun'].length) {
+      addOnPreRun(Module['preRun'].shift());
+    }
+  }
+  callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+  if (runtimeInitialized) return;
+  runtimeInitialized = true;
+  callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+  callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+  callRuntimeCallbacks(__ATEXIT__);
+  runtimeExited = true;
+}
+
+function postRun() {
+  // compatibility - merge in anything from Module['postRun'] at this time
+  if (Module['postRun']) {
+    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+    while (Module['postRun'].length) {
+      addOnPostRun(Module['postRun'].shift());
+    }
+  }
+  callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+  __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+  __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+  __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {
+  __ATEXIT__.unshift(cb);
+}
+
+function addOnPostRun(cb) {
+  __ATPOSTRUN__.unshift(cb);
+}
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+/** @deprecated */
+function writeStringToMemory(string, buffer, dontAddNull) {
+  warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+  var /** @type {number} */ lastChar, /** @type {number} */ end;
+  if (dontAddNull) {
+    // stringToUTF8Array always appends null. If we don't want to do that, remember the
+    // character that existed at the location where the null will be placed, and restore
+    // that after the write (below).
+    end = buffer + lengthBytesUTF8(string);
+    lastChar = HEAP8[end];
+  }
+  stringToUTF8(string, buffer, Infinity);
+  if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+
+function writeArrayToMemory(array, buffer) {
+  HEAP8.set(array, buffer);
+}
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+  for (var i = 0; i < str.length; ++i) {
+    HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+  }
+  // Null-terminate the pointer to the HEAP.
+  if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+
+function unSign(value, bits, ignore) {
+  if (value >= 0) {
+    return value;
+  }
+  return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+                    : Math.pow(2, bits)         + value;
+}
+function reSign(value, bits, ignore) {
+  if (value <= 0) {
+    return value;
+  }
+  var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+                        : Math.pow(2, bits-1);
+  if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+                                                       // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+                                                       // TODO: In i64 mode 1, resign the two parts separately and safely
+    value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+  }
+  return value;
+}
+
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_round = Math.round;
+var Math_min = Math.min;
+var Math_max = Math.max;
+var Math_clz32 = Math.clz32;
+var Math_trunc = Math.trunc;
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+
+function getUniqueRunDependency(id) {
+  return id;
+}
+
+function addRunDependency(id) {
+  runDependencies++;
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+}
+
+function removeRunDependency(id) {
+  runDependencies--;
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+  if (runDependencies == 0) {
+    if (runDependencyWatcher !== null) {
+      clearInterval(runDependencyWatcher);
+      runDependencyWatcher = null;
+    }
+    if (dependenciesFulfilled) {
+      var callback = dependenciesFulfilled;
+      dependenciesFulfilled = null;
+      callback(); // can add another dependenciesFulfilled
+    }
+  }
+}
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+
+var memoryInitializer = null;
+
+
+
+
+
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+  return String.prototype.startsWith ?
+      filename.startsWith(dataURIPrefix) :
+      filename.indexOf(dataURIPrefix) === 0;
+}
+
+
+
+
+function integrateWasmJS() {
+  // wasm.js has several methods for creating the compiled code module here:
+  //  * 'native-wasm' : use native WebAssembly support in the browser
+  //  * 'interpret-s-expr': load s-expression code from a .wast and interpret
+  //  * 'interpret-binary': load binary wasm and interpret
+  //  * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret
+  //  * 'asmjs': no wasm, just load the asm.js code and use that (good for testing)
+  // The method is set at compile time (BINARYEN_METHOD)
+  // The method can be a comma-separated list, in which case, we will try the
+  // options one by one. Some of them can fail gracefully, and then we can try
+  // the next.
+
+  // inputs
+
+  var method = 'native-wasm';
+
+  var wasmTextFile = 'money.wast';
+  var wasmBinaryFile = 'money.wasm';
+  var asmjsCodeFile = 'money.temp.asm.js';
+
+  if (!isDataURI(wasmTextFile)) {
+    wasmTextFile = locateFile(wasmTextFile);
+  }
+  if (!isDataURI(wasmBinaryFile)) {
+    wasmBinaryFile = locateFile(wasmBinaryFile);
+  }
+  if (!isDataURI(asmjsCodeFile)) {
+    asmjsCodeFile = locateFile(asmjsCodeFile);
+  }
+
+  // utilities
+
+  var wasmPageSize = 64*1024;
+
+  var info = {
+    'global': null,
+    'env': null,
+    'asm2wasm': asm2wasmImports,
+    'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program.
+  };
+
+  var exports = null;
+
+
+  function mergeMemory(newBuffer) {
+    // The wasm instance creates its memory. But static init code might have written to
+    // buffer already, including the mem init file, and we must copy it over in a proper merge.
+    // TODO: avoid this copy, by avoiding such static init writes
+    // TODO: in shorter term, just copy up to the last static init write
+    var oldBuffer = Module['buffer'];
+    if (newBuffer.byteLength < oldBuffer.byteLength) {
+      err('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here');
+    }
+    var oldView = new Int8Array(oldBuffer);
+    var newView = new Int8Array(newBuffer);
+
+
+    newView.set(oldView);
+    updateGlobalBuffer(newBuffer);
+    updateGlobalBufferViews();
+  }
+
+  function getBinary() {
+    try {
+      if (Module['wasmBinary']) {
+        return new Uint8Array(Module['wasmBinary']);
+      }
+      if (Module['readBinary']) {
+        return Module['readBinary'](wasmBinaryFile);
+      } else {
+        throw "both async and sync fetching of the wasm failed";
+      }
+    }
+    catch (err) {
+      abort(err);
+    }
+  }
+
+  function getBinaryPromise() {
+    // if we don't have the binary yet, and have the Fetch api, use that
+    // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web
+    if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') {
+      return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+        if (!response['ok']) {
+          throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
+        }
+        return response['arrayBuffer']();
+      }).catch(function () {
+        return getBinary();
+      });
+    }
+    // Otherwise, getBinary should be able to get it synchronously
+    return new Promise(function(resolve, reject) {
+      resolve(getBinary());
+    });
+  }
+
+  // do-method functions
+
+
+  function doNativeWasm(global, env, providedBuffer) {
+    if (typeof WebAssembly !== 'object') {
+      err('no native wasm support detected');
+      return false;
+    }
+    // prepare memory import
+    if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) {
+      err('no native wasm Memory in use');
+      return false;
+    }
+    env['memory'] = Module['wasmMemory'];
+    // Load the wasm module and create an instance of using native support in the JS engine.
+    info['global'] = {
+      'NaN': NaN,
+      'Infinity': Infinity
+    };
+    info['global.Math'] = Math;
+    info['env'] = env;
+    // handle a generated wasm instance, receiving its exports and
+    // performing other necessary setup
+    function receiveInstance(instance, module) {
+      exports = instance.exports;
+      if (exports.memory) mergeMemory(exports.memory);
+      Module['asm'] = exports;
+      Module["usingWasm"] = true;
+      removeRunDependency('wasm-instantiate');
+    }
+    addRunDependency('wasm-instantiate');
+
+    // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+    // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel
+    // to any other async startup actions they are performing.
+    if (Module['instantiateWasm']) {
+      try {
+        return Module['instantiateWasm'](info, receiveInstance);
+      } catch(e) {
+        err('Module.instantiateWasm callback failed with error: ' + e);
+        return false;
+      }
+    }
+
+    function receiveInstantiatedSource(output) {
+      // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance.
+      // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+      receiveInstance(output['instance'], output['module']);
+    }
+    function instantiateArrayBuffer(receiver) {
+      getBinaryPromise().then(function(binary) {
+        return WebAssembly.instantiate(binary, info);
+      }).then(receiver, function(reason) {
+        err('failed to asynchronously prepare wasm: ' + reason);
+        abort(reason);
+      });
+    }
+    // Prefer streaming instantiation if available.
+    if (!Module['wasmBinary'] &&
+        typeof WebAssembly.instantiateStreaming === 'function' &&
+        !isDataURI(wasmBinaryFile) &&
+        typeof fetch === 'function') {
+      WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info)
+        .then(receiveInstantiatedSource, function(reason) {
+          // We expect the most common failure cause to be a bad MIME type for the binary,
+          // in which case falling back to ArrayBuffer instantiation should work.
+          err('wasm streaming compile failed: ' + reason);
+          err('falling back to ArrayBuffer instantiation');
+          instantiateArrayBuffer(receiveInstantiatedSource);
+        });
+    } else {
+      instantiateArrayBuffer(receiveInstantiatedSource);
+    }
+    return {}; // no exports yet; we'll fill them in later
+  }
+
+
+  // We may have a preloaded value in Module.asm, save it
+  Module['asmPreload'] = Module['asm'];
+
+  // Memory growth integration code
+
+  var asmjsReallocBuffer = Module['reallocBuffer'];
+
+  var wasmReallocBuffer = function(size) {
+    var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB.
+    size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size
+    var old = Module['buffer'];
+    var oldSize = old.byteLength;
+    if (Module["usingWasm"]) {
+      // native wasm support
+      try {
+        var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size
+        if (result !== (-1 | 0)) {
+          // success in native wasm memory growth, get the buffer from the memory
+          return Module['buffer'] = Module['wasmMemory'].buffer;
+        } else {
+          return null;
+        }
+      } catch(e) {
+        return null;
+      }
+    }
+  };
+
+  Module['reallocBuffer'] = function(size) {
+    if (finalMethod === 'asmjs') {
+      return asmjsReallocBuffer(size);
+    } else {
+      return wasmReallocBuffer(size);
+    }
+  };
+
+  // we may try more than one; this is the final one, that worked and we are using
+  var finalMethod = '';
+
+  // Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate
+  // the wasm module at that time, and it receives imports and provides exports and so forth, the app
+  // doesn't need to care that it is wasm or olyfilled wasm or asm.js.
+
+  Module['asm'] = function(global, env, providedBuffer) {
+    // import table
+    if (!env['table']) {
+      var TABLE_SIZE = Module['wasmTableSize'];
+      if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; // works in binaryen interpreter at least
+      var MAX_TABLE_SIZE = Module['wasmMaxTableSize'];
+      if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') {
+        if (MAX_TABLE_SIZE !== undefined) {
+          env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, 'maximum': MAX_TABLE_SIZE, 'element': 'anyfunc' });
+        } else {
+          env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, element: 'anyfunc' });
+        }
+      } else {
+        env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least
+      }
+      Module['wasmTable'] = env['table'];
+    }
+
+    if (!env['__memory_base']) {
+      env['__memory_base'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves
+    }
+    if (!env['__table_base']) {
+      env['__table_base'] = 0; // table starts at 0 by default, in dynamic linking this will change
+    }
+
+    // try the methods. each should return the exports if it succeeded
+
+    var exports;
+    exports = doNativeWasm(global, env, providedBuffer);
+
+    assert(exports, 'no binaryen method succeeded.');
+
+
+    return exports;
+  };
+
+  var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later
+}
+
+integrateWasmJS();
+
+// === Body ===
+
+var ASM_CONSTS = [];
+
+
+
+
+
+STATIC_BASE = GLOBAL_BASE;
+
+STATICTOP = STATIC_BASE + 110048;
+/* global initializers */  __ATINIT__.push();
+
+
+
+
+
+
+
+var STATIC_BUMP = 110048;
+Module["STATIC_BASE"] = STATIC_BASE;
+Module["STATIC_BUMP"] = STATIC_BUMP;
+
+/* no memory initializer */
+var tempDoublePtr = STATICTOP; STATICTOP += 16;
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+
+  HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+}
+
+function copyTempDouble(ptr) {
+
+  HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+  HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+
+  HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+
+  HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+
+  HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+
+}
+
+// {{PRE_LIBRARY}}
+
+
+  
+  
+  
+  
+  var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
+  
+  var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+  
+  function ___setErrNo(value) {
+      if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+      return value;
+    }
+  
+  var PATH={splitPath:function (filename) {
+        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+        return splitPathRe.exec(filename).slice(1);
+      },normalizeArray:function (parts, allowAboveRoot) {
+        // if the path tries to go above the root, `up` ends up > 0
+        var up = 0;
+        for (var i = parts.length - 1; i >= 0; i--) {
+          var last = parts[i];
+          if (last === '.') {
+            parts.splice(i, 1);
+          } else if (last === '..') {
+            parts.splice(i, 1);
+            up++;
+          } else if (up) {
+            parts.splice(i, 1);
+            up--;
+          }
+        }
+        // if the path is allowed to go above the root, restore leading ..s
+        if (allowAboveRoot) {
+          for (; up; up--) {
+            parts.unshift('..');
+          }
+        }
+        return parts;
+      },normalize:function (path) {
+        var isAbsolute = path.charAt(0) === '/',
+            trailingSlash = path.substr(-1) === '/';
+        // Normalize the path
+        path = PATH.normalizeArray(path.split('/').filter(function(p) {
+          return !!p;
+        }), !isAbsolute).join('/');
+        if (!path && !isAbsolute) {
+          path = '.';
+        }
+        if (path && trailingSlash) {
+          path += '/';
+        }
+        return (isAbsolute ? '/' : '') + path;
+      },dirname:function (path) {
+        var result = PATH.splitPath(path),
+            root = result[0],
+            dir = result[1];
+        if (!root && !dir) {
+          // No dirname whatsoever
+          return '.';
+        }
+        if (dir) {
+          // It has a dirname, strip trailing slash
+          dir = dir.substr(0, dir.length - 1);
+        }
+        return root + dir;
+      },basename:function (path) {
+        // EMSCRIPTEN return '/'' for '/', not an empty string
+        if (path === '/') return '/';
+        var lastSlash = path.lastIndexOf('/');
+        if (lastSlash === -1) return path;
+        return path.substr(lastSlash+1);
+      },extname:function (path) {
+        return PATH.splitPath(path)[3];
+      },join:function () {
+        var paths = Array.prototype.slice.call(arguments, 0);
+        return PATH.normalize(paths.join('/'));
+      },join2:function (l, r) {
+        return PATH.normalize(l + '/' + r);
+      },resolve:function () {
+        var resolvedPath = '',
+          resolvedAbsolute = false;
+        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+          var path = (i >= 0) ? arguments[i] : FS.cwd();
+          // Skip empty and invalid entries
+          if (typeof path !== 'string') {
+            throw new TypeError('Arguments to path.resolve must be strings');
+          } else if (!path) {
+            return ''; // an invalid portion invalidates the whole thing
+          }
+          resolvedPath = path + '/' + resolvedPath;
+          resolvedAbsolute = path.charAt(0) === '/';
+        }
+        // At this point the path should be resolved to a full absolute path, but
+        // handle relative paths to be safe (might happen when process.cwd() fails)
+        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+          return !!p;
+        }), !resolvedAbsolute).join('/');
+        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+      },relative:function (from, to) {
+        from = PATH.resolve(from).substr(1);
+        to = PATH.resolve(to).substr(1);
+        function trim(arr) {
+          var start = 0;
+          for (; start < arr.length; start++) {
+            if (arr[start] !== '') break;
+          }
+          var end = arr.length - 1;
+          for (; end >= 0; end--) {
+            if (arr[end] !== '') break;
+          }
+          if (start > end) return [];
+          return arr.slice(start, end - start + 1);
+        }
+        var fromParts = trim(from.split('/'));
+        var toParts = trim(to.split('/'));
+        var length = Math.min(fromParts.length, toParts.length);
+        var samePartsLength = length;
+        for (var i = 0; i < length; i++) {
+          if (fromParts[i] !== toParts[i]) {
+            samePartsLength = i;
+            break;
+          }
+        }
+        var outputParts = [];
+        for (var i = samePartsLength; i < fromParts.length; i++) {
+          outputParts.push('..');
+        }
+        outputParts = outputParts.concat(toParts.slice(samePartsLength));
+        return outputParts.join('/');
+      }};
+  
+  var TTY={ttys:[],init:function () {
+        // https://github.com/kripken/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
+        //   // device, it always assumes it's a TTY device. because of this, we're forcing
+        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
+        //   // with text files until FS.init can be refactored.
+        //   process['stdin']['setEncoding']('utf8');
+        // }
+      },shutdown:function () {
+        // https://github.com/kripken/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+        //   process['stdin']['pause']();
+        // }
+      },register:function (dev, ops) {
+        TTY.ttys[dev] = { input: [], output: [], ops: ops };
+        FS.registerDevice(dev, TTY.stream_ops);
+      },stream_ops:{open:function (stream) {
+          var tty = TTY.ttys[stream.node.rdev];
+          if (!tty) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+          }
+          stream.tty = tty;
+          stream.seekable = false;
+        },close:function (stream) {
+          // flush any pending line data
+          stream.tty.ops.flush(stream.tty);
+        },flush:function (stream) {
+          stream.tty.ops.flush(stream.tty);
+        },read:function (stream, buffer, offset, length, pos /* ignored */) {
+          if (!stream.tty || !stream.tty.ops.get_char) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+          }
+          var bytesRead = 0;
+          for (var i = 0; i < length; i++) {
+            var result;
+            try {
+              result = stream.tty.ops.get_char(stream.tty);
+            } catch (e) {
+              throw new FS.ErrnoError(ERRNO_CODES.EIO);
+            }
+            if (result === undefined && bytesRead === 0) {
+              throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+            }
+            if (result === null || result === undefined) break;
+            bytesRead++;
+            buffer[offset+i] = result;
+          }
+          if (bytesRead) {
+            stream.node.timestamp = Date.now();
+          }
+          return bytesRead;
+        },write:function (stream, buffer, offset, length, pos) {
+          if (!stream.tty || !stream.tty.ops.put_char) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+          }
+          var i = 0;
+          try {
+            if (offset === 0 && length === 0) {
+              // musl implements an fflush using a write of a NULL buffer of size 0
+              stream.tty.ops.flush(stream.tty);
+            } else {
+              while (i < length) {
+                stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+                i++;
+              }
+            }
+          } catch (e) {
+            throw new FS.ErrnoError(ERRNO_CODES.EIO);
+          }
+          if (length) {
+            stream.node.timestamp = Date.now();
+          }
+          return i;
+        }},default_tty_ops:{get_char:function (tty) {
+          if (!tty.input.length) {
+            var result = null;
+            if (ENVIRONMENT_IS_NODE) {
+              // we will read data by chunks of BUFSIZE
+              var BUFSIZE = 256;
+              var buf = new Buffer(BUFSIZE);
+              var bytesRead = 0;
+  
+              var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
+  
+              var fd = process.stdin.fd;
+              if (isPosixPlatform) {
+                // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+                var usingDevice = false;
+                try {
+                  fd = fs.openSync('/dev/stdin', 'r');
+                  usingDevice = true;
+                } catch (e) {}
+              }
+  
+              try {
+                bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+              } catch(e) {
+                // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+                // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+                if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
+                else throw e;
+              }
+  
+              if (usingDevice) { fs.closeSync(fd); }
+              if (bytesRead > 0) {
+                result = buf.slice(0, bytesRead).toString('utf-8');
+              } else {
+                result = null;
+              }
+  
+            } else if (typeof window != 'undefined' &&
+              typeof window.prompt == 'function') {
+              // Browser.
+              result = window.prompt('Input: ');  // returns null on cancel
+              if (result !== null) {
+                result += '\n';
+              }
+            } else if (typeof readline == 'function') {
+              // Command line.
+              result = readline();
+              if (result !== null) {
+                result += '\n';
+              }
+            }
+            if (!result) {
+              return null;
+            }
+            tty.input = intArrayFromString(result, true);
+          }
+          return tty.input.shift();
+        },put_char:function (tty, val) {
+          if (val === null || val === 10) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+          }
+        },flush:function (tty) {
+          if (tty.output && tty.output.length > 0) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        }},default_tty1_ops:{put_char:function (tty, val) {
+          if (val === null || val === 10) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val);
+          }
+        },flush:function (tty) {
+          if (tty.output && tty.output.length > 0) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        }}};
+  
+  var MEMFS={ops_table:null,mount:function (mount) {
+        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+      },createNode:function (parent, name, mode, dev) {
+        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+          // no supported
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        if (!MEMFS.ops_table) {
+          MEMFS.ops_table = {
+            dir: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                lookup: MEMFS.node_ops.lookup,
+                mknod: MEMFS.node_ops.mknod,
+                rename: MEMFS.node_ops.rename,
+                unlink: MEMFS.node_ops.unlink,
+                rmdir: MEMFS.node_ops.rmdir,
+                readdir: MEMFS.node_ops.readdir,
+                symlink: MEMFS.node_ops.symlink
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek
+              }
+            },
+            file: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek,
+                read: MEMFS.stream_ops.read,
+                write: MEMFS.stream_ops.write,
+                allocate: MEMFS.stream_ops.allocate,
+                mmap: MEMFS.stream_ops.mmap,
+                msync: MEMFS.stream_ops.msync
+              }
+            },
+            link: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                readlink: MEMFS.node_ops.readlink
+              },
+              stream: {}
+            },
+            chrdev: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: FS.chrdev_stream_ops
+            }
+          };
+        }
+        var node = FS.createNode(parent, name, mode, dev);
+        if (FS.isDir(node.mode)) {
+          node.node_ops = MEMFS.ops_table.dir.node;
+          node.stream_ops = MEMFS.ops_table.dir.stream;
+          node.contents = {};
+        } else if (FS.isFile(node.mode)) {
+          node.node_ops = MEMFS.ops_table.file.node;
+          node.stream_ops = MEMFS.ops_table.file.stream;
+          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+          node.contents = null; 
+        } else if (FS.isLink(node.mode)) {
+          node.node_ops = MEMFS.ops_table.link.node;
+          node.stream_ops = MEMFS.ops_table.link.stream;
+        } else if (FS.isChrdev(node.mode)) {
+          node.node_ops = MEMFS.ops_table.chrdev.node;
+          node.stream_ops = MEMFS.ops_table.chrdev.stream;
+        }
+        node.timestamp = Date.now();
+        // add the new node to the parent
+        if (parent) {
+          parent.contents[name] = node;
+        }
+        return node;
+      },getFileDataAsRegularArray:function (node) {
+        if (node.contents && node.contents.subarray) {
+          var arr = [];
+          for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+          return arr; // Returns a copy of the original data.
+        }
+        return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+      },getFileDataAsTypedArray:function (node) {
+        if (!node.contents) return new Uint8Array;
+        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+        return new Uint8Array(node.contents);
+      },expandFileStorage:function (node, newCapacity) {
+        // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
+        // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
+        // increase the size.
+        if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
+          node.contents = MEMFS.getFileDataAsRegularArray(node);
+          node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
+        }
+  
+        if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
+          var prevCapacity = node.contents ? node.contents.length : 0;
+          if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+          // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+          // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+          // avoid overshooting the allocation cap by a very large margin.
+          var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+          newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+          if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+          var oldContents = node.contents;
+          node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+          if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+          return;
+        }
+        // Not using a typed array to back the file storage. Use a standard JS array instead.
+        if (!node.contents && newCapacity > 0) node.contents = [];
+        while (node.contents.length < newCapacity) node.contents.push(0);
+      },resizeFileStorage:function (node, newSize) {
+        if (node.usedBytes == newSize) return;
+        if (newSize == 0) {
+          node.contents = null; // Fully decommit when requesting a resize to zero.
+          node.usedBytes = 0;
+          return;
+        }
+        if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+          var oldContents = node.contents;
+          node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+          if (oldContents) {
+            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+          }
+          node.usedBytes = newSize;
+          return;
+        }
+        // Backing with a JS array.
+        if (!node.contents) node.contents = [];
+        if (node.contents.length > newSize) node.contents.length = newSize;
+        else while (node.contents.length < newSize) node.contents.push(0);
+        node.usedBytes = newSize;
+      },node_ops:{getattr:function (node) {
+          var attr = {};
+          // device numbers reuse inode numbers.
+          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+          attr.ino = node.id;
+          attr.mode = node.mode;
+          attr.nlink = 1;
+          attr.uid = 0;
+          attr.gid = 0;
+          attr.rdev = node.rdev;
+          if (FS.isDir(node.mode)) {
+            attr.size = 4096;
+          } else if (FS.isFile(node.mode)) {
+            attr.size = node.usedBytes;
+          } else if (FS.isLink(node.mode)) {
+            attr.size = node.link.length;
+          } else {
+            attr.size = 0;
+          }
+          attr.atime = new Date(node.timestamp);
+          attr.mtime = new Date(node.timestamp);
+          attr.ctime = new Date(node.timestamp);
+          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+          //       but this is not required by the standard.
+          attr.blksize = 4096;
+          attr.blocks = Math.ceil(attr.size / attr.blksize);
+          return attr;
+        },setattr:function (node, attr) {
+          if (attr.mode !== undefined) {
+            node.mode = attr.mode;
+          }
+          if (attr.timestamp !== undefined) {
+            node.timestamp = attr.timestamp;
+          }
+          if (attr.size !== undefined) {
+            MEMFS.resizeFileStorage(node, attr.size);
+          }
+        },lookup:function (parent, name) {
+          throw FS.genericErrors[ERRNO_CODES.ENOENT];
+        },mknod:function (parent, name, mode, dev) {
+          return MEMFS.createNode(parent, name, mode, dev);
+        },rename:function (old_node, new_dir, new_name) {
+          // if we're overwriting a directory at new_name, make sure it's empty.
+          if (FS.isDir(old_node.mode)) {
+            var new_node;
+            try {
+              new_node = FS.lookupNode(new_dir, new_name);
+            } catch (e) {
+            }
+            if (new_node) {
+              for (var i in new_node.contents) {
+                throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+              }
+            }
+          }
+          // do the internal rewiring
+          delete old_node.parent.contents[old_node.name];
+          old_node.name = new_name;
+          new_dir.contents[new_name] = old_node;
+          old_node.parent = new_dir;
+        },unlink:function (parent, name) {
+          delete parent.contents[name];
+        },rmdir:function (parent, name) {
+          var node = FS.lookupNode(parent, name);
+          for (var i in node.contents) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+          }
+          delete parent.contents[name];
+        },readdir:function (node) {
+          var entries = ['.', '..']
+          for (var key in node.contents) {
+            if (!node.contents.hasOwnProperty(key)) {
+              continue;
+            }
+            entries.push(key);
+          }
+          return entries;
+        },symlink:function (parent, newname, oldpath) {
+          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+          node.link = oldpath;
+          return node;
+        },readlink:function (node) {
+          if (!FS.isLink(node.mode)) {
+            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+          }
+          return node.link;
+        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+          var contents = stream.node.contents;
+          if (position >= stream.node.usedBytes) return 0;
+          var size = Math.min(stream.node.usedBytes - position, length);
+          assert(size >= 0);
+          if (size > 8 && contents.subarray) { // non-trivial, and typed array
+            buffer.set(contents.subarray(position, position + size), offset);
+          } else {
+            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+          }
+          return size;
+        },write:function (stream, buffer, offset, length, position, canOwn) {
+          // If memory can grow, we don't want to hold on to references of
+          // the memory Buffer, as they may get invalidated. That means
+          // we need to do a copy here.
+          canOwn = false;
+  
+          if (!length) return 0;
+          var node = stream.node;
+          node.timestamp = Date.now();
+  
+          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+            if (canOwn) {
+              node.contents = buffer.subarray(offset, offset + length);
+              node.usedBytes = length;
+              return length;
+            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+              node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+              node.usedBytes = length;
+              return length;
+            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+              node.contents.set(buffer.subarray(offset, offset + length), position);
+              return length;
+            }
+          }
+  
+          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+          MEMFS.expandFileStorage(node, position+length);
+          if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+          else {
+            for (var i = 0; i < length; i++) {
+             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+            }
+          }
+          node.usedBytes = Math.max(node.usedBytes, position+length);
+          return length;
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              position += stream.node.usedBytes;
+            }
+          }
+          if (position < 0) {
+            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+          }
+          return position;
+        },allocate:function (stream, offset, length) {
+          MEMFS.expandFileStorage(stream.node, offset + length);
+          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+        },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+          if (!FS.isFile(stream.node.mode)) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+          }
+          var ptr;
+          var allocated;
+          var contents = stream.node.contents;
+          // Only make a new copy when MAP_PRIVATE is specified.
+          if ( !(flags & 2) &&
+                (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+            // We can't emulate MAP_SHARED when the file is not backed by the buffer
+            // we're mapping to (e.g. the HEAP buffer).
+            allocated = false;
+            ptr = contents.byteOffset;
+          } else {
+            // Try to avoid unnecessary slices.
+            if (position > 0 || position + length < stream.node.usedBytes) {
+              if (contents.subarray) {
+                contents = contents.subarray(position, position + length);
+              } else {
+                contents = Array.prototype.slice.call(contents, position, position + length);
+              }
+            }
+            allocated = true;
+            ptr = _malloc(length);
+            if (!ptr) {
+              throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
+            }
+            buffer.set(contents, ptr);
+          }
+          return { ptr: ptr, allocated: allocated };
+        },msync:function (stream, buffer, offset, length, mmapFlags) {
+          if (!FS.isFile(stream.node.mode)) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+          }
+          if (mmapFlags & 2) {
+            // MAP_PRIVATE calls need not to be synced back to underlying fs
+            return 0;
+          }
+  
+          var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+          // should we check if bytesWritten and length are the same?
+          return 0;
+        }}};
+  
+  var IDBFS={dbs:{},indexedDB:function () {
+        if (typeof indexedDB !== 'undefined') return indexedDB;
+        var ret = null;
+        if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+        assert(ret, 'IDBFS used, but indexedDB not supported');
+        return ret;
+      },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+        // reuse all of the core MEMFS functionality
+        return MEMFS.mount.apply(null, arguments);
+      },syncfs:function (mount, populate, callback) {
+        IDBFS.getLocalSet(mount, function(err, local) {
+          if (err) return callback(err);
+  
+          IDBFS.getRemoteSet(mount, function(err, remote) {
+            if (err) return callback(err);
+  
+            var src = populate ? remote : local;
+            var dst = populate ? local : remote;
+  
+            IDBFS.reconcile(src, dst, callback);
+          });
+        });
+      },getDB:function (name, callback) {
+        // check the cache first
+        var db = IDBFS.dbs[name];
+        if (db) {
+          return callback(null, db);
+        }
+  
+        var req;
+        try {
+          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+        } catch (e) {
+          return callback(e);
+        }
+        if (!req) {
+          return callback("Unable to connect to IndexedDB");
+        }
+        req.onupgradeneeded = function(e) {
+          var db = e.target.result;
+          var transaction = e.target.transaction;
+  
+          var fileStore;
+  
+          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+          } else {
+            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+          }
+  
+          if (!fileStore.indexNames.contains('timestamp')) {
+            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+          }
+        };
+        req.onsuccess = function() {
+          db = req.result;
+  
+          // add to the cache
+          IDBFS.dbs[name] = db;
+          callback(null, db);
+        };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },getLocalSet:function (mount, callback) {
+        var entries = {};
+  
+        function isRealDir(p) {
+          return p !== '.' && p !== '..';
+        };
+        function toAbsolute(root) {
+          return function(p) {
+            return PATH.join2(root, p);
+          }
+        };
+  
+        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+  
+        while (check.length) {
+          var path = check.pop();
+          var stat;
+  
+          try {
+            stat = FS.stat(path);
+          } catch (e) {
+            return callback(e);
+          }
+  
+          if (FS.isDir(stat.mode)) {
+            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+          }
+  
+          entries[path] = { timestamp: stat.mtime };
+        }
+  
+        return callback(null, { type: 'local', entries: entries });
+      },getRemoteSet:function (mount, callback) {
+        var entries = {};
+  
+        IDBFS.getDB(mount.mountpoint, function(err, db) {
+          if (err) return callback(err);
+  
+          try {
+            var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+            transaction.onerror = function(e) {
+              callback(this.error);
+              e.preventDefault();
+            };
+  
+            var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+            var index = store.index('timestamp');
+  
+            index.openKeyCursor().onsuccess = function(event) {
+              var cursor = event.target.result;
+  
+              if (!cursor) {
+                return callback(null, { type: 'remote', db: db, entries: entries });
+              }
+  
+              entries[cursor.primaryKey] = { timestamp: cursor.key };
+  
+              cursor.continue();
+            };
+          } catch (e) {
+            return callback(e);
+          }
+        });
+      },loadLocalEntry:function (path, callback) {
+        var stat, node;
+  
+        try {
+          var lookup = FS.lookupPath(path);
+          node = lookup.node;
+          stat = FS.stat(path);
+        } catch (e) {
+          return callback(e);
+        }
+  
+        if (FS.isDir(stat.mode)) {
+          return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+        } else if (FS.isFile(stat.mode)) {
+          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+          node.contents = MEMFS.getFileDataAsTypedArray(node);
+          return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+        } else {
+          return callback(new Error('node type not supported'));
+        }
+      },storeLocalEntry:function (path, entry, callback) {
+        try {
+          if (FS.isDir(entry.mode)) {
+            FS.mkdir(path, entry.mode);
+          } else if (FS.isFile(entry.mode)) {
+            FS.writeFile(path, entry.contents, { canOwn: true });
+          } else {
+            return callback(new Error('node type not supported'));
+          }
+  
+          FS.chmod(path, entry.mode);
+          FS.utime(path, entry.timestamp, entry.timestamp);
+        } catch (e) {
+          return callback(e);
+        }
+  
+        callback(null);
+      },removeLocalEntry:function (path, callback) {
+        try {
+          var lookup = FS.lookupPath(path);
+          var stat = FS.stat(path);
+  
+          if (FS.isDir(stat.mode)) {
+            FS.rmdir(path);
+          } else if (FS.isFile(stat.mode)) {
+            FS.unlink(path);
+          }
+        } catch (e) {
+          return callback(e);
+        }
+  
+        callback(null);
+      },loadRemoteEntry:function (store, path, callback) {
+        var req = store.get(path);
+        req.onsuccess = function(event) { callback(null, event.target.result); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },storeRemoteEntry:function (store, path, entry, callback) {
+        var req = store.put(entry, path);
+        req.onsuccess = function() { callback(null); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },removeRemoteEntry:function (store, path, callback) {
+        var req = store.delete(path);
+        req.onsuccess = function() { callback(null); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },reconcile:function (src, dst, callback) {
+        var total = 0;
+  
+        var create = [];
+        Object.keys(src.entries).forEach(function (key) {
+          var e = src.entries[key];
+          var e2 = dst.entries[key];
+          if (!e2 || e.timestamp > e2.timestamp) {
+            create.push(key);
+            total++;
+          }
+        });
+  
+        var remove = [];
+        Object.keys(dst.entries).forEach(function (key) {
+          var e = dst.entries[key];
+          var e2 = src.entries[key];
+          if (!e2) {
+            remove.push(key);
+            total++;
+          }
+        });
+  
+        if (!total) {
+          return callback(null);
+        }
+  
+        var errored = false;
+        var completed = 0;
+        var db = src.type === 'remote' ? src.db : dst.db;
+        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+  
+        function done(err) {
+          if (err) {
+            if (!done.errored) {
+              done.errored = true;
+              return callback(err);
+            }
+            return;
+          }
+          if (++completed >= total) {
+            return callback(null);
+          }
+        };
+  
+        transaction.onerror = function(e) {
+          done(this.error);
+          e.preventDefault();
+        };
+  
+        // sort paths in ascending order so directory entries are created
+        // before the files inside them
+        create.sort().forEach(function (path) {
+          if (dst.type === 'local') {
+            IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+              if (err) return done(err);
+              IDBFS.storeLocalEntry(path, entry, done);
+            });
+          } else {
+            IDBFS.loadLocalEntry(path, function (err, entry) {
+              if (err) return done(err);
+              IDBFS.storeRemoteEntry(store, path, entry, done);
+            });
+          }
+        });
+  
+        // sort paths in descending order so files are deleted before their
+        // parent directories
+        remove.sort().reverse().forEach(function(path) {
+          if (dst.type === 'local') {
+            IDBFS.removeLocalEntry(path, done);
+          } else {
+            IDBFS.removeRemoteEntry(store, path, done);
+          }
+        });
+      }};
+  
+  var NODEFS={isWindows:false,staticInit:function () {
+        NODEFS.isWindows = !!process.platform.match(/^win/);
+        var flags = process["binding"]("constants");
+        // Node.js 4 compatibility: it has no namespaces for constants
+        if (flags["fs"]) {
+          flags = flags["fs"];
+        }
+        NODEFS.flagsForNodeMap = {
+          "1024": flags["O_APPEND"],
+          "64": flags["O_CREAT"],
+          "128": flags["O_EXCL"],
+          "0": flags["O_RDONLY"],
+          "2": flags["O_RDWR"],
+          "4096": flags["O_SYNC"],
+          "512": flags["O_TRUNC"],
+          "1": flags["O_WRONLY"]
+        };
+      },bufferFrom:function (arrayBuffer) {
+        // Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer
+        // Buffer.from before 4.5 was just a method inherited from Uint8Array
+        // Buffer.alloc has been added with Buffer.from together, so check it instead
+        return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer);
+      },mount:function (mount) {
+        assert(ENVIRONMENT_IS_NODE);
+        return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+      },createNode:function (parent, name, mode, dev) {
+        if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        var node = FS.createNode(parent, name, mode);
+        node.node_ops = NODEFS.node_ops;
+        node.stream_ops = NODEFS.stream_ops;
+        return node;
+      },getMode:function (path) {
+        var stat;
+        try {
+          stat = fs.lstatSync(path);
+          if (NODEFS.isWindows) {
+            // Node.js on Windows never represents permission bit 'x', so
+            // propagate read bits to execute bits
+            stat.mode = stat.mode | ((stat.mode & 292) >> 2);
+          }
+        } catch (e) {
+          if (!e.code) throw e;
+          throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+        }
+        return stat.mode;
+      },realPath:function (node) {
+        var parts = [];
+        while (node.parent !== node) {
+          parts.push(node.name);
+          node = node.parent;
+        }
+        parts.push(node.mount.opts.root);
+        parts.reverse();
+        return PATH.join.apply(null, parts);
+      },flagsForNode:function (flags) {
+        flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
+        var newFlags = 0;
+        for (var k in NODEFS.flagsForNodeMap) {
+          if (flags & k) {
+            newFlags |= NODEFS.flagsForNodeMap[k];
+            flags ^= k;
+          }
+        }
+  
+        if (!flags) {
+          return newFlags;
+        } else {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+      },node_ops:{getattr:function (node) {
+          var path = NODEFS.realPath(node);
+          var stat;
+          try {
+            stat = fs.lstatSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+          // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+          // See http://support.microsoft.com/kb/140365
+          if (NODEFS.isWindows && !stat.blksize) {
+            stat.blksize = 4096;
+          }
+          if (NODEFS.isWindows && !stat.blocks) {
+            stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+          }
+          return {
+            dev: stat.dev,
+            ino: stat.ino,
+            mode: stat.mode,
+            nlink: stat.nlink,
+            uid: stat.uid,
+            gid: stat.gid,
+            rdev: stat.rdev,
+            size: stat.size,
+            atime: stat.atime,
+            mtime: stat.mtime,
+            ctime: stat.ctime,
+            blksize: stat.blksize,
+            blocks: stat.blocks
+          };
+        },setattr:function (node, attr) {
+          var path = NODEFS.realPath(node);
+          try {
+            if (attr.mode !== undefined) {
+              fs.chmodSync(path, attr.mode);
+              // update the common node structure mode as well
+              node.mode = attr.mode;
+            }
+            if (attr.timestamp !== undefined) {
+              var date = new Date(attr.timestamp);
+              fs.utimesSync(path, date, date);
+            }
+            if (attr.size !== undefined) {
+              fs.truncateSync(path, attr.size);
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },lookup:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          var mode = NODEFS.getMode(path);
+          return NODEFS.createNode(parent, name, mode);
+        },mknod:function (parent, name, mode, dev) {
+          var node = NODEFS.createNode(parent, name, mode, dev);
+          // create the backing node for this in the fs root as well
+          var path = NODEFS.realPath(node);
+          try {
+            if (FS.isDir(node.mode)) {
+              fs.mkdirSync(path, node.mode);
+            } else {
+              fs.writeFileSync(path, '', { mode: node.mode });
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+          return node;
+        },rename:function (oldNode, newDir, newName) {
+          var oldPath = NODEFS.realPath(oldNode);
+          var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+          try {
+            fs.renameSync(oldPath, newPath);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },unlink:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          try {
+            fs.unlinkSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },rmdir:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          try {
+            fs.rmdirSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },readdir:function (node) {
+          var path = NODEFS.realPath(node);
+          try {
+            return fs.readdirSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },symlink:function (parent, newName, oldPath) {
+          var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+          try {
+            fs.symlinkSync(oldPath, newPath);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },readlink:function (node) {
+          var path = NODEFS.realPath(node);
+          try {
+            path = fs.readlinkSync(path);
+            path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+            return path;
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        }},stream_ops:{open:function (stream) {
+          var path = NODEFS.realPath(stream.node);
+          try {
+            if (FS.isFile(stream.node.mode)) {
+              stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags));
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },close:function (stream) {
+          try {
+            if (FS.isFile(stream.node.mode) && stream.nfd) {
+              fs.closeSync(stream.nfd);
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },read:function (stream, buffer, offset, length, position) {
+          // Node.js < 6 compatibility: node errors on 0 length reads
+          if (length === 0) return 0;
+          try {
+            return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+          } catch (e) {
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },write:function (stream, buffer, offset, length, position) {
+          try {
+            return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+          } catch (e) {
+            throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+          }
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              try {
+                var stat = fs.fstatSync(stream.nfd);
+                position += stat.size;
+              } catch (e) {
+                throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+              }
+            }
+          }
+  
+          if (position < 0) {
+            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+          }
+  
+          return position;
+        }}};
+  
+  var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+        assert(ENVIRONMENT_IS_WORKER);
+        if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+        var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+        var createdParents = {};
+        function ensureParent(path) {
+          // return the parent node, creating subdirs as necessary
+          var parts = path.split('/');
+          var parent = root;
+          for (var i = 0; i < parts.length-1; i++) {
+            var curr = parts.slice(0, i+1).join('/');
+            // Issue 4254: Using curr as a node name will prevent the node
+            // from being found in FS.nameTable when FS.open is called on
+            // a path which holds a child of this node,
+            // given that all FS functions assume node names
+            // are just their corresponding parts within their given path,
+            // rather than incremental aggregates which include their parent's
+            // directories.
+            if (!createdParents[curr]) {
+              createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
+            }
+            parent = createdParents[curr];
+          }
+          return parent;
+        }
+        function base(path) {
+          var parts = path.split('/');
+          return parts[parts.length-1];
+        }
+        // We also accept FileList here, by using Array.prototype
+        Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+          WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+        });
+        (mount.opts["blobs"] || []).forEach(function(obj) {
+          WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+        });
+        (mount.opts["packages"] || []).forEach(function(pack) {
+          pack['metadata'].files.forEach(function(file) {
+            var name = file.filename.substr(1); // remove initial slash
+            WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+          });
+        });
+        return root;
+      },createNode:function (parent, name, mode, dev, contents, mtime) {
+        var node = FS.createNode(parent, name, mode);
+        node.mode = mode;
+        node.node_ops = WORKERFS.node_ops;
+        node.stream_ops = WORKERFS.stream_ops;
+        node.timestamp = (mtime || new Date).getTime();
+        assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+        if (mode === WORKERFS.FILE_MODE) {
+          node.size = contents.size;
+          node.contents = contents;
+        } else {
+          node.size = 4096;
+          node.contents = {};
+        }
+        if (parent) {
+          parent.contents[name] = node;
+        }
+        return node;
+      },node_ops:{getattr:function (node) {
+          return {
+            dev: 1,
+            ino: undefined,
+            mode: node.mode,
+            nlink: 1,
+            uid: 0,
+            gid: 0,
+            rdev: undefined,
+            size: node.size,
+            atime: new Date(node.timestamp),
+            mtime: new Date(node.timestamp),
+            ctime: new Date(node.timestamp),
+            blksize: 4096,
+            blocks: Math.ceil(node.size / 4096),
+          };
+        },setattr:function (node, attr) {
+          if (attr.mode !== undefined) {
+            node.mode = attr.mode;
+          }
+          if (attr.timestamp !== undefined) {
+            node.timestamp = attr.timestamp;
+          }
+        },lookup:function (parent, name) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        },mknod:function (parent, name, mode, dev) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        },rename:function (oldNode, newDir, newName) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        },unlink:function (parent, name) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        },rmdir:function (parent, name) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        },readdir:function (node) {
+          var entries = ['.', '..'];
+          for (var key in node.contents) {
+            if (!node.contents.hasOwnProperty(key)) {
+              continue;
+            }
+            entries.push(key);
+          }
+          return entries;
+        },symlink:function (parent, newName, oldPath) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        },readlink:function (node) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+          if (position >= stream.node.size) return 0;
+          var chunk = stream.node.contents.slice(position, position + length);
+          var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+          buffer.set(new Uint8Array(ab), offset);
+          return chunk.size;
+        },write:function (stream, buffer, offset, length, position) {
+          throw new FS.ErrnoError(ERRNO_CODES.EIO);
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              position += stream.node.size;
+            }
+          }
+          if (position < 0) {
+            throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+          }
+          return position;
+        }}};
+  
+  var _stdin=STATICTOP; STATICTOP += 16;;
+  
+  var _stdout=STATICTOP; STATICTOP += 16;;
+  
+  var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
+        if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+        return ___setErrNo(e.errno);
+      },lookupPath:function (path, opts) {
+        path = PATH.resolve(FS.cwd(), path);
+        opts = opts || {};
+  
+        if (!path) return { path: '', node: null };
+  
+        var defaults = {
+          follow_mount: true,
+          recurse_count: 0
+        };
+        for (var key in defaults) {
+          if (opts[key] === undefined) {
+            opts[key] = defaults[key];
+          }
+        }
+  
+        if (opts.recurse_count > 8) {  // max recursive lookup of 8
+          throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+        }
+  
+        // split the path
+        var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+          return !!p;
+        }), false);
+  
+        // start at the root
+        var current = FS.root;
+        var current_path = '/';
+  
+        for (var i = 0; i < parts.length; i++) {
+          var islast = (i === parts.length-1);
+          if (islast && opts.parent) {
+            // stop resolving
+            break;
+          }
+  
+          current = FS.lookupNode(current, parts[i]);
+          current_path = PATH.join2(current_path, parts[i]);
+  
+          // jump to the mount's root node if this is a mountpoint
+          if (FS.isMountpoint(current)) {
+            if (!islast || (islast && opts.follow_mount)) {
+              current = current.mounted.root;
+            }
+          }
+  
+          // by default, lookupPath will not follow a symlink if it is the final path component.
+          // setting opts.follow = true will override this behavior.
+          if (!islast || opts.follow) {
+            var count = 0;
+            while (FS.isLink(current.mode)) {
+              var link = FS.readlink(current_path);
+              current_path = PATH.resolve(PATH.dirname(current_path), link);
+  
+              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+              current = lookup.node;
+  
+              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+                throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+              }
+            }
+          }
+        }
+  
+        return { path: current_path, node: current };
+      },getPath:function (node) {
+        var path;
+        while (true) {
+          if (FS.isRoot(node)) {
+            var mount = node.mount.mountpoint;
+            if (!path) return mount;
+            return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+          }
+          path = path ? node.name + '/' + path : node.name;
+          node = node.parent;
+        }
+      },hashName:function (parentid, name) {
+        var hash = 0;
+  
+  
+        for (var i = 0; i < name.length; i++) {
+          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+        }
+        return ((parentid + hash) >>> 0) % FS.nameTable.length;
+      },hashAddNode:function (node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        node.name_next = FS.nameTable[hash];
+        FS.nameTable[hash] = node;
+      },hashRemoveNode:function (node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        if (FS.nameTable[hash] === node) {
+          FS.nameTable[hash] = node.name_next;
+        } else {
+          var current = FS.nameTable[hash];
+          while (current) {
+            if (current.name_next === node) {
+              current.name_next = node.name_next;
+              break;
+            }
+            current = current.name_next;
+          }
+        }
+      },lookupNode:function (parent, name) {
+        var err = FS.mayLookup(parent);
+        if (err) {
+          throw new FS.ErrnoError(err, parent);
+        }
+        var hash = FS.hashName(parent.id, name);
+        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+          var nodeName = node.name;
+          if (node.parent.id === parent.id && nodeName === name) {
+            return node;
+          }
+        }
+        // if we failed to find it in the cache, call into the VFS
+        return FS.lookup(parent, name);
+      },createNode:function (parent, name, mode, rdev) {
+        if (!FS.FSNode) {
+          FS.FSNode = function(parent, name, mode, rdev) {
+            if (!parent) {
+              parent = this;  // root node sets parent to itself
+            }
+            this.parent = parent;
+            this.mount = parent.mount;
+            this.mounted = null;
+            this.id = FS.nextInode++;
+            this.name = name;
+            this.mode = mode;
+            this.node_ops = {};
+            this.stream_ops = {};
+            this.rdev = rdev;
+          };
+  
+          FS.FSNode.prototype = {};
+  
+          // compatibility
+          var readMode = 292 | 73;
+          var writeMode = 146;
+  
+          // NOTE we must use Object.defineProperties instead of individual calls to
+          // Object.defineProperty in order to make closure compiler happy
+          Object.defineProperties(FS.FSNode.prototype, {
+            read: {
+              get: function() { return (this.mode & readMode) === readMode; },
+              set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+            },
+            write: {
+              get: function() { return (this.mode & writeMode) === writeMode; },
+              set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+            },
+            isFolder: {
+              get: function() { return FS.isDir(this.mode); }
+            },
+            isDevice: {
+              get: function() { return FS.isChrdev(this.mode); }
+            }
+          });
+        }
+  
+        var node = new FS.FSNode(parent, name, mode, rdev);
+  
+        FS.hashAddNode(node);
+  
+        return node;
+      },destroyNode:function (node) {
+        FS.hashRemoveNode(node);
+      },isRoot:function (node) {
+        return node === node.parent;
+      },isMountpoint:function (node) {
+        return !!node.mounted;
+      },isFile:function (mode) {
+        return (mode & 61440) === 32768;
+      },isDir:function (mode) {
+        return (mode & 61440) === 16384;
+      },isLink:function (mode) {
+        return (mode & 61440) === 40960;
+      },isChrdev:function (mode) {
+        return (mode & 61440) === 8192;
+      },isBlkdev:function (mode) {
+        return (mode & 61440) === 24576;
+      },isFIFO:function (mode) {
+        return (mode & 61440) === 4096;
+      },isSocket:function (mode) {
+        return (mode & 49152) === 49152;
+      },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+        var flags = FS.flagModes[str];
+        if (typeof flags === 'undefined') {
+          throw new Error('Unknown file open mode: ' + str);
+        }
+        return flags;
+      },flagsToPermissionString:function (flag) {
+        var perms = ['r', 'w', 'rw'][flag & 3];
+        if ((flag & 512)) {
+          perms += 'w';
+        }
+        return perms;
+      },nodePermissions:function (node, perms) {
+        if (FS.ignorePermissions) {
+          return 0;
+        }
+        // return 0 if any user, group or owner bits are set.
+        if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+          return ERRNO_CODES.EACCES;
+        } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+          return ERRNO_CODES.EACCES;
+        } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+          return ERRNO_CODES.EACCES;
+        }
+        return 0;
+      },mayLookup:function (dir) {
+        var err = FS.nodePermissions(dir, 'x');
+        if (err) return err;
+        if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
+        return 0;
+      },mayCreate:function (dir, name) {
+        try {
+          var node = FS.lookupNode(dir, name);
+          return ERRNO_CODES.EEXIST;
+        } catch (e) {
+        }
+        return FS.nodePermissions(dir, 'wx');
+      },mayDelete:function (dir, name, isdir) {
+        var node;
+        try {
+          node = FS.lookupNode(dir, name);
+        } catch (e) {
+          return e.errno;
+        }
+        var err = FS.nodePermissions(dir, 'wx');
+        if (err) {
+          return err;
+        }
+        if (isdir) {
+          if (!FS.isDir(node.mode)) {
+            return ERRNO_CODES.ENOTDIR;
+          }
+          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+            return ERRNO_CODES.EBUSY;
+          }
+        } else {
+          if (FS.isDir(node.mode)) {
+            return ERRNO_CODES.EISDIR;
+          }
+        }
+        return 0;
+      },mayOpen:function (node, flags) {
+        if (!node) {
+          return ERRNO_CODES.ENOENT;
+        }
+        if (FS.isLink(node.mode)) {
+          return ERRNO_CODES.ELOOP;
+        } else if (FS.isDir(node.mode)) {
+          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+            return ERRNO_CODES.EISDIR;
+          }
+        }
+        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+      },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+        fd_start = fd_start || 0;
+        fd_end = fd_end || FS.MAX_OPEN_FDS;
+        for (var fd = fd_start; fd <= fd_end; fd++) {
+          if (!FS.streams[fd]) {
+            return fd;
+          }
+        }
+        throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
+      },getStream:function (fd) {
+        return FS.streams[fd];
+      },createStream:function (stream, fd_start, fd_end) {
+        if (!FS.FSStream) {
+          FS.FSStream = function(){};
+          FS.FSStream.prototype = {};
+          // compatibility
+          Object.defineProperties(FS.FSStream.prototype, {
+            object: {
+              get: function() { return this.node; },
+              set: function(val) { this.node = val; }
+            },
+            isRead: {
+              get: function() { return (this.flags & 2097155) !== 1; }
+            },
+            isWrite: {
+              get: function() { return (this.flags & 2097155) !== 0; }
+            },
+            isAppend: {
+              get: function() { return (this.flags & 1024); }
+            }
+          });
+        }
+        // clone it, so we can return an instance of FSStream
+        var newStream = new FS.FSStream();
+        for (var p in stream) {
+          newStream[p] = stream[p];
+        }
+        stream = newStream;
+        var fd = FS.nextfd(fd_start, fd_end);
+        stream.fd = fd;
+        FS.streams[fd] = stream;
+        return stream;
+      },closeStream:function (fd) {
+        FS.streams[fd] = null;
+      },chrdev_stream_ops:{open:function (stream) {
+          var device = FS.getDevice(stream.node.rdev);
+          // override node's stream ops with the device's
+          stream.stream_ops = device.stream_ops;
+          // forward the open call
+          if (stream.stream_ops.open) {
+            stream.stream_ops.open(stream);
+          }
+        },llseek:function () {
+          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+        }},major:function (dev) {
+        return ((dev) >> 8);
+      },minor:function (dev) {
+        return ((dev) & 0xff);
+      },makedev:function (ma, mi) {
+        return ((ma) << 8 | (mi));
+      },registerDevice:function (dev, ops) {
+        FS.devices[dev] = { stream_ops: ops };
+      },getDevice:function (dev) {
+        return FS.devices[dev];
+      },getMounts:function (mount) {
+        var mounts = [];
+        var check = [mount];
+  
+        while (check.length) {
+          var m = check.pop();
+  
+          mounts.push(m);
+  
+          check.push.apply(check, m.mounts);
+        }
+  
+        return mounts;
+      },syncfs:function (populate, callback) {
+        if (typeof(populate) === 'function') {
+          callback = populate;
+          populate = false;
+        }
+  
+        FS.syncFSRequests++;
+  
+        if (FS.syncFSRequests > 1) {
+          console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+        }
+  
+        var mounts = FS.getMounts(FS.root.mount);
+        var completed = 0;
+  
+        function doCallback(err) {
+          assert(FS.syncFSRequests > 0);
+          FS.syncFSRequests--;
+          return callback(err);
+        }
+  
+        function done(err) {
+          if (err) {
+            if (!done.errored) {
+              done.errored = true;
+              return doCallback(err);
+            }
+            return;
+          }
+          if (++completed >= mounts.length) {
+            doCallback(null);
+          }
+        };
+  
+        // sync all mounts
+        mounts.forEach(function (mount) {
+          if (!mount.type.syncfs) {
+            return done(null);
+          }
+          mount.type.syncfs(mount, populate, done);
+        });
+      },mount:function (type, opts, mountpoint) {
+        var root = mountpoint === '/';
+        var pseudo = !mountpoint;
+        var node;
+  
+        if (root && FS.root) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+        } else if (!root && !pseudo) {
+          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+          mountpoint = lookup.path;  // use the absolute path
+          node = lookup.node;
+  
+          if (FS.isMountpoint(node)) {
+            throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+          }
+  
+          if (!FS.isDir(node.mode)) {
+            throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+          }
+        }
+  
+        var mount = {
+          type: type,
+          opts: opts,
+          mountpoint: mountpoint,
+          mounts: []
+        };
+  
+        // create a root node for the fs
+        var mountRoot = type.mount(mount);
+        mountRoot.mount = mount;
+        mount.root = mountRoot;
+  
+        if (root) {
+          FS.root = mountRoot;
+        } else if (node) {
+          // set as a mountpoint
+          node.mounted = mount;
+  
+          // add the new mount to the current mount's children
+          if (node.mount) {
+            node.mount.mounts.push(mount);
+          }
+        }
+  
+        return mountRoot;
+      },unmount:function (mountpoint) {
+        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+        if (!FS.isMountpoint(lookup.node)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+  
+        // destroy the nodes for this mount, and all its child mounts
+        var node = lookup.node;
+        var mount = node.mounted;
+        var mounts = FS.getMounts(mount);
+  
+        Object.keys(FS.nameTable).forEach(function (hash) {
+          var current = FS.nameTable[hash];
+  
+          while (current) {
+            var next = current.name_next;
+  
+            if (mounts.indexOf(current.mount) !== -1) {
+              FS.destroyNode(current);
+            }
+  
+            current = next;
+          }
+        });
+  
+        // no longer a mountpoint
+        node.mounted = null;
+  
+        // remove this mount from the child mounts
+        var idx = node.mount.mounts.indexOf(mount);
+        assert(idx !== -1);
+        node.mount.mounts.splice(idx, 1);
+      },lookup:function (parent, name) {
+        return parent.node_ops.lookup(parent, name);
+      },mknod:function (path, mode, dev) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        if (!name || name === '.' || name === '..') {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        var err = FS.mayCreate(parent, name);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.mknod) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        return parent.node_ops.mknod(parent, name, mode, dev);
+      },create:function (path, mode) {
+        mode = mode !== undefined ? mode : 438 /* 0666 */;
+        mode &= 4095;
+        mode |= 32768;
+        return FS.mknod(path, mode, 0);
+      },mkdir:function (path, mode) {
+        mode = mode !== undefined ? mode : 511 /* 0777 */;
+        mode &= 511 | 512;
+        mode |= 16384;
+        return FS.mknod(path, mode, 0);
+      },mkdirTree:function (path, mode) {
+        var dirs = path.split('/');
+        var d = '';
+        for (var i = 0; i < dirs.length; ++i) {
+          if (!dirs[i]) continue;
+          d += '/' + dirs[i];
+          try {
+            FS.mkdir(d, mode);
+          } catch(e) {
+            if (e.errno != ERRNO_CODES.EEXIST) throw e;
+          }
+        }
+      },mkdev:function (path, mode, dev) {
+        if (typeof(dev) === 'undefined') {
+          dev = mode;
+          mode = 438 /* 0666 */;
+        }
+        mode |= 8192;
+        return FS.mknod(path, mode, dev);
+      },symlink:function (oldpath, newpath) {
+        if (!PATH.resolve(oldpath)) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        var lookup = FS.lookupPath(newpath, { parent: true });
+        var parent = lookup.node;
+        if (!parent) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        var newname = PATH.basename(newpath);
+        var err = FS.mayCreate(parent, newname);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.symlink) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        return parent.node_ops.symlink(parent, newname, oldpath);
+      },rename:function (old_path, new_path) {
+        var old_dirname = PATH.dirname(old_path);
+        var new_dirname = PATH.dirname(new_path);
+        var old_name = PATH.basename(old_path);
+        var new_name = PATH.basename(new_path);
+        // parents must exist
+        var lookup, old_dir, new_dir;
+        try {
+          lookup = FS.lookupPath(old_path, { parent: true });
+          old_dir = lookup.node;
+          lookup = FS.lookupPath(new_path, { parent: true });
+          new_dir = lookup.node;
+        } catch (e) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+        }
+        if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        // need to be part of the same mount
+        if (old_dir.mount !== new_dir.mount) {
+          throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
+        }
+        // source must exist
+        var old_node = FS.lookupNode(old_dir, old_name);
+        // old path should not be an ancestor of the new path
+        var relative = PATH.relative(old_path, new_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        // new path should not be an ancestor of the old path
+        relative = PATH.relative(new_path, old_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+        }
+        // see if the new path already exists
+        var new_node;
+        try {
+          new_node = FS.lookupNode(new_dir, new_name);
+        } catch (e) {
+          // not fatal
+        }
+        // early out if nothing needs to change
+        if (old_node === new_node) {
+          return;
+        }
+        // we'll need to delete the old entry
+        var isdir = FS.isDir(old_node.mode);
+        var err = FS.mayDelete(old_dir, old_name, isdir);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        // need delete permissions if we'll be overwriting.
+        // need create permissions if new doesn't already exist.
+        err = new_node ?
+          FS.mayDelete(new_dir, new_name, isdir) :
+          FS.mayCreate(new_dir, new_name);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!old_dir.node_ops.rename) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+        }
+        // if we are going to change the parent, check write permissions
+        if (new_dir !== old_dir) {
+          err = FS.nodePermissions(old_dir, 'w');
+          if (err) {
+            throw new FS.ErrnoError(err);
+          }
+        }
+        try {
+          if (FS.trackingDelegate['willMovePath']) {
+            FS.trackingDelegate['willMovePath'](old_path, new_path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+        }
+        // remove the node from the lookup hash
+        FS.hashRemoveNode(old_node);
+        // do the underlying fs rename
+        try {
+          old_dir.node_ops.rename(old_node, new_dir, new_name);
+        } catch (e) {
+          throw e;
+        } finally {
+          // add the node back to the hash (in case node_ops.rename
+          // changed its name)
+          FS.hashAddNode(old_node);
+        }
+        try {
+          if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+        }
+      },rmdir:function (path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var err = FS.mayDelete(parent, name, true);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.rmdir) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+        }
+        try {
+          if (FS.trackingDelegate['willDeletePath']) {
+            FS.trackingDelegate['willDeletePath'](path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+        parent.node_ops.rmdir(parent, name);
+        FS.destroyNode(node);
+        try {
+          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+      },readdir:function (path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        if (!node.node_ops.readdir) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+        }
+        return node.node_ops.readdir(node);
+      },unlink:function (path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var err = FS.mayDelete(parent, name, false);
+        if (err) {
+          // According to POSIX, we should map EISDIR to EPERM, but
+          // we instead do what Linux does (and we must, as we use
+          // the musl linux libc).
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.unlink) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+        }
+        try {
+          if (FS.trackingDelegate['willDeletePath']) {
+            FS.trackingDelegate['willDeletePath'](path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+        parent.node_ops.unlink(parent, name);
+        FS.destroyNode(node);
+        try {
+          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+      },readlink:function (path) {
+        var lookup = FS.lookupPath(path);
+        var link = lookup.node;
+        if (!link) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        if (!link.node_ops.readlink) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+      },stat:function (path, dontFollow) {
+        var lookup = FS.lookupPath(path, { follow: !dontFollow });
+        var node = lookup.node;
+        if (!node) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        if (!node.node_ops.getattr) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        return node.node_ops.getattr(node);
+      },lstat:function (path) {
+        return FS.stat(path, true);
+      },chmod:function (path, mode, dontFollow) {
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        node.node_ops.setattr(node, {
+          mode: (mode & 4095) | (node.mode & ~4095),
+          timestamp: Date.now()
+        });
+      },lchmod:function (path, mode) {
+        FS.chmod(path, mode, true);
+      },fchmod:function (fd, mode) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        FS.chmod(stream.node, mode);
+      },chown:function (path, uid, gid, dontFollow) {
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        node.node_ops.setattr(node, {
+          timestamp: Date.now()
+          // we ignore the uid / gid for now
+        });
+      },lchown:function (path, uid, gid) {
+        FS.chown(path, uid, gid, true);
+      },fchown:function (fd, uid, gid) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        FS.chown(stream.node, uid, gid);
+      },truncate:function (path, len) {
+        if (len < 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: true });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+        }
+        if (FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+        }
+        if (!FS.isFile(node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        var err = FS.nodePermissions(node, 'w');
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        node.node_ops.setattr(node, {
+          size: len,
+          timestamp: Date.now()
+        });
+      },ftruncate:function (fd, len) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        FS.truncate(stream.node, len);
+      },utime:function (path, atime, mtime) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        node.node_ops.setattr(node, {
+          timestamp: Math.max(atime, mtime)
+        });
+      },open:function (path, flags, mode, fd_start, fd_end) {
+        if (path === "") {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+        mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+        if ((flags & 64)) {
+          mode = (mode & 4095) | 32768;
+        } else {
+          mode = 0;
+        }
+        var node;
+        if (typeof path === 'object') {
+          node = path;
+        } else {
+          path = PATH.normalize(path);
+          try {
+            var lookup = FS.lookupPath(path, {
+              follow: !(flags & 131072)
+            });
+            node = lookup.node;
+          } catch (e) {
+            // ignore
+          }
+        }
+        // perhaps we need to create the node
+        var created = false;
+        if ((flags & 64)) {
+          if (node) {
+            // if O_CREAT and O_EXCL are set, error out if the node already exists
+            if ((flags & 128)) {
+              throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
+            }
+          } else {
+            // node doesn't exist, try to create it
+            node = FS.mknod(path, mode, 0);
+            created = true;
+          }
+        }
+        if (!node) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        // can't truncate a device
+        if (FS.isChrdev(node.mode)) {
+          flags &= ~512;
+        }
+        // if asked only for a directory, then this must be one
+        if ((flags & 65536) && !FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+        }
+        // check permissions, if this is not a file we just created now (it is ok to
+        // create and write to a file with read-only permissions; it is read-only
+        // for later use)
+        if (!created) {
+          var err = FS.mayOpen(node, flags);
+          if (err) {
+            throw new FS.ErrnoError(err);
+          }
+        }
+        // do truncation if necessary
+        if ((flags & 512)) {
+          FS.truncate(node, 0);
+        }
+        // we've already handled these, don't pass down to the underlying vfs
+        flags &= ~(128 | 512);
+  
+        // register the stream with the filesystem
+        var stream = FS.createStream({
+          node: node,
+          path: FS.getPath(node),  // we want the absolute path to the node
+          flags: flags,
+          seekable: true,
+          position: 0,
+          stream_ops: node.stream_ops,
+          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+          ungotten: [],
+          error: false
+        }, fd_start, fd_end);
+        // call the new stream's open function
+        if (stream.stream_ops.open) {
+          stream.stream_ops.open(stream);
+        }
+        if (Module['logReadFiles'] && !(flags & 1)) {
+          if (!FS.readFiles) FS.readFiles = {};
+          if (!(path in FS.readFiles)) {
+            FS.readFiles[path] = 1;
+            console.log("FS.trackingDelegate error on read file: " + path);
+          }
+        }
+        try {
+          if (FS.trackingDelegate['onOpenFile']) {
+            var trackingFlags = 0;
+            if ((flags & 2097155) !== 1) {
+              trackingFlags |= FS.tracking.openFlags.READ;
+            }
+            if ((flags & 2097155) !== 0) {
+              trackingFlags |= FS.tracking.openFlags.WRITE;
+            }
+            FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+        }
+        return stream;
+      },close:function (stream) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (stream.getdents) stream.getdents = null; // free readdir state
+        try {
+          if (stream.stream_ops.close) {
+            stream.stream_ops.close(stream);
+          }
+        } catch (e) {
+          throw e;
+        } finally {
+          FS.closeStream(stream.fd);
+        }
+        stream.fd = null;
+      },isClosed:function (stream) {
+        return stream.fd === null;
+      },llseek:function (stream, offset, whence) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (!stream.seekable || !stream.stream_ops.llseek) {
+          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+        }
+        stream.position = stream.stream_ops.llseek(stream, offset, whence);
+        stream.ungotten = [];
+        return stream.position;
+      },read:function (stream, buffer, offset, length, position) {
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+        }
+        if (!stream.stream_ops.read) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        var seeking = typeof position !== 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+        }
+        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+        if (!seeking) stream.position += bytesRead;
+        return bytesRead;
+      },write:function (stream, buffer, offset, length, position, canOwn) {
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+        }
+        if (!stream.stream_ops.write) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        if (stream.flags & 1024) {
+          // seek to the end before writing in append mode
+          FS.llseek(stream, 0, 2);
+        }
+        var seeking = typeof position !== 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+        }
+        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+        if (!seeking) stream.position += bytesWritten;
+        try {
+          if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
+        }
+        return bytesWritten;
+      },allocate:function (stream, offset, length) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (offset < 0 || length <= 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        }
+        if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+        }
+        if (!stream.stream_ops.allocate) {
+          throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+        }
+        stream.stream_ops.allocate(stream, offset, length);
+      },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+        // TODO if PROT is PROT_WRITE, make sure we have write access
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(ERRNO_CODES.EACCES);
+        }
+        if (!stream.stream_ops.mmap) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+        }
+        return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+      },msync:function (stream, buffer, offset, length, mmapFlags) {
+        if (!stream || !stream.stream_ops.msync) {
+          return 0;
+        }
+        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+      },munmap:function (stream) {
+        return 0;
+      },ioctl:function (stream, cmd, arg) {
+        if (!stream.stream_ops.ioctl) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
+        }
+        return stream.stream_ops.ioctl(stream, cmd, arg);
+      },readFile:function (path, opts) {
+        opts = opts || {};
+        opts.flags = opts.flags || 'r';
+        opts.encoding = opts.encoding || 'binary';
+        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+          throw new Error('Invalid encoding type "' + opts.encoding + '"');
+        }
+        var ret;
+        var stream = FS.open(path, opts.flags);
+        var stat = FS.stat(path);
+        var length = stat.size;
+        var buf = new Uint8Array(length);
+        FS.read(stream, buf, 0, length, 0);
+        if (opts.encoding === 'utf8') {
+          ret = UTF8ArrayToString(buf, 0);
+        } else if (opts.encoding === 'binary') {
+          ret = buf;
+        }
+        FS.close(stream);
+        return ret;
+      },writeFile:function (path, data, opts) {
+        opts = opts || {};
+        opts.flags = opts.flags || 'w';
+        var stream = FS.open(path, opts.flags, opts.mode);
+        if (typeof data === 'string') {
+          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+          FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+        } else if (ArrayBuffer.isView(data)) {
+          FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+        } else {
+          throw new Error('Unsupported data type');
+        }
+        FS.close(stream);
+      },cwd:function () {
+        return FS.currentPath;
+      },chdir:function (path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        if (lookup.node === null) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+        }
+        if (!FS.isDir(lookup.node.mode)) {
+          throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+        }
+        var err = FS.nodePermissions(lookup.node, 'x');
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        FS.currentPath = lookup.path;
+      },createDefaultDirectories:function () {
+        FS.mkdir('/tmp');
+        FS.mkdir('/home');
+        FS.mkdir('/home/web_user');
+      },createDefaultDevices:function () {
+        // create /dev
+        FS.mkdir('/dev');
+        // setup /dev/null
+        FS.registerDevice(FS.makedev(1, 3), {
+          read: function() { return 0; },
+          write: function(stream, buffer, offset, length, pos) { return length; }
+        });
+        FS.mkdev('/dev/null', FS.makedev(1, 3));
+        // setup /dev/tty and /dev/tty1
+        // stderr needs to print output using Module['printErr']
+        // so we register a second tty just for it.
+        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+        FS.mkdev('/dev/tty', FS.makedev(5, 0));
+        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+        // setup /dev/[u]random
+        var random_device;
+        if (typeof crypto !== 'undefined') {
+          // for modern web browsers
+          var randomBuffer = new Uint8Array(1);
+          random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+        } else if (ENVIRONMENT_IS_NODE) {
+          // for nodejs
+          random_device = function() { return require('crypto')['randomBytes'](1)[0]; };
+        } else {
+          // default for ES5 platforms
+          random_device = function() { abort("random_device"); /*Math.random() is not safe for random number generation, so this fallback random_device implementation aborts... see kripken/emscripten/pull/7096 */ };
+        }
+        FS.createDevice('/dev', 'random', random_device);
+        FS.createDevice('/dev', 'urandom', random_device);
+        // we're not going to emulate the actual shm device,
+        // just create the tmp dirs that reside in it commonly
+        FS.mkdir('/dev/shm');
+        FS.mkdir('/dev/shm/tmp');
+      },createSpecialDirectories:function () {
+        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+        FS.mkdir('/proc');
+        FS.mkdir('/proc/self');
+        FS.mkdir('/proc/self/fd');
+        FS.mount({
+          mount: function() {
+            var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
+            node.node_ops = {
+              lookup: function(parent, name) {
+                var fd = +name;
+                var stream = FS.getStream(fd);
+                if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+                var ret = {
+                  parent: null,
+                  mount: { mountpoint: 'fake' },
+                  node_ops: { readlink: function() { return stream.path } }
+                };
+                ret.parent = ret; // make it look like a simple root node
+                return ret;
+              }
+            };
+            return node;
+          }
+        }, {}, '/proc/self/fd');
+      },createStandardStreams:function () {
+        // TODO deprecate the old functionality of a single
+        // input / output callback and that utilizes FS.createDevice
+        // and instead require a unique set of stream ops
+  
+        // by default, we symlink the standard streams to the
+        // default tty devices. however, if the standard streams
+        // have been overwritten we create a unique device for
+        // them instead.
+        if (Module['stdin']) {
+          FS.createDevice('/dev', 'stdin', Module['stdin']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdin');
+        }
+        if (Module['stdout']) {
+          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdout');
+        }
+        if (Module['stderr']) {
+          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+        } else {
+          FS.symlink('/dev/tty1', '/dev/stderr');
+        }
+  
+        // open default streams for the stdin, stdout and stderr devices
+        var stdin = FS.open('/dev/stdin', 'r');
+        assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+  
+        var stdout = FS.open('/dev/stdout', 'w');
+        assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+  
+        var stderr = FS.open('/dev/stderr', 'w');
+        assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+      },ensureErrnoError:function () {
+        if (FS.ErrnoError) return;
+        FS.ErrnoError = function ErrnoError(errno, node) {
+          this.node = node;
+          this.setErrno = function(errno) {
+            this.errno = errno;
+            for (var key in ERRNO_CODES) {
+              if (ERRNO_CODES[key] === errno) {
+                this.code = key;
+                break;
+              }
+            }
+          };
+          this.setErrno(errno);
+          this.message = ERRNO_MESSAGES[errno];
+          // Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8)
+          if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+        };
+        FS.ErrnoError.prototype = new Error();
+        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+        [ERRNO_CODES.ENOENT].forEach(function(code) {
+          FS.genericErrors[code] = new FS.ErrnoError(code);
+          FS.genericErrors[code].stack = '<generic error, no stack>';
+        });
+      },staticInit:function () {
+        FS.ensureErrnoError();
+  
+        FS.nameTable = new Array(4096);
+  
+        FS.mount(MEMFS, {}, '/');
+  
+        FS.createDefaultDirectories();
+        FS.createDefaultDevices();
+        FS.createSpecialDirectories();
+  
+        FS.filesystems = {
+          'MEMFS': MEMFS,
+          'IDBFS': IDBFS,
+          'NODEFS': NODEFS,
+          'WORKERFS': WORKERFS,
+        };
+      },init:function (input, output, error) {
+        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+        FS.init.initialized = true;
+  
+        FS.ensureErrnoError();
+  
+        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+        Module['stdin'] = input || Module['stdin'];
+        Module['stdout'] = output || Module['stdout'];
+        Module['stderr'] = error || Module['stderr'];
+  
+        FS.createStandardStreams();
+      },quit:function () {
+        FS.init.initialized = false;
+        // force-flush all streams, so we get musl std streams printed out
+        var fflush = Module['_fflush'];
+        if (fflush) fflush(0);
+        // close all of our streams
+        for (var i = 0; i < FS.streams.length; i++) {
+          var stream = FS.streams[i];
+          if (!stream) {
+            continue;
+          }
+          FS.close(stream);
+        }
+      },getMode:function (canRead, canWrite) {
+        var mode = 0;
+        if (canRead) mode |= 292 | 73;
+        if (canWrite) mode |= 146;
+        return mode;
+      },joinPath:function (parts, forceRelative) {
+        var path = PATH.join.apply(null, parts);
+        if (forceRelative && path[0] == '/') path = path.substr(1);
+        return path;
+      },absolutePath:function (relative, base) {
+        return PATH.resolve(base, relative);
+      },standardizePath:function (path) {
+        return PATH.normalize(path);
+      },findObject:function (path, dontResolveLastLink) {
+        var ret = FS.analyzePath(path, dontResolveLastLink);
+        if (ret.exists) {
+          return ret.object;
+        } else {
+          ___setErrNo(ret.error);
+          return null;
+        }
+      },analyzePath:function (path, dontResolveLastLink) {
+        // operate from within the context of the symlink's target
+        try {
+          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          path = lookup.path;
+        } catch (e) {
+        }
+        var ret = {
+          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+          parentExists: false, parentPath: null, parentObject: null
+        };
+        try {
+          var lookup = FS.lookupPath(path, { parent: true });
+          ret.parentExists = true;
+          ret.parentPath = lookup.path;
+          ret.parentObject = lookup.node;
+          ret.name = PATH.basename(path);
+          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          ret.exists = true;
+          ret.path = lookup.path;
+          ret.object = lookup.node;
+          ret.name = lookup.node.name;
+          ret.isRoot = lookup.path === '/';
+        } catch (e) {
+          ret.error = e.errno;
+        };
+        return ret;
+      },createFolder:function (parent, name, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(canRead, canWrite);
+        return FS.mkdir(path, mode);
+      },createPath:function (parent, path, canRead, canWrite) {
+        parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+        var parts = path.split('/').reverse();
+        while (parts.length) {
+          var part = parts.pop();
+          if (!part) continue;
+          var current = PATH.join2(parent, part);
+          try {
+            FS.mkdir(current);
+          } catch (e) {
+            // ignore EEXIST
+          }
+          parent = current;
+        }
+        return current;
+      },createFile:function (parent, name, properties, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(canRead, canWrite);
+        return FS.create(path, mode);
+      },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+        var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+        var mode = FS.getMode(canRead, canWrite);
+        var node = FS.create(path, mode);
+        if (data) {
+          if (typeof data === 'string') {
+            var arr = new Array(data.length);
+            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+            data = arr;
+          }
+          // make sure we can write to the file
+          FS.chmod(node, mode | 146);
+          var stream = FS.open(node, 'w');
+          FS.write(stream, data, 0, data.length, 0, canOwn);
+          FS.close(stream);
+          FS.chmod(node, mode);
+        }
+        return node;
+      },createDevice:function (parent, name, input, output) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(!!input, !!output);
+        if (!FS.createDevice.major) FS.createDevice.major = 64;
+        var dev = FS.makedev(FS.createDevice.major++, 0);
+        // Create a fake device that a set of stream ops to emulate
+        // the old behavior.
+        FS.registerDevice(dev, {
+          open: function(stream) {
+            stream.seekable = false;
+          },
+          close: function(stream) {
+            // flush any pending line data
+            if (output && output.buffer && output.buffer.length) {
+              output(10);
+            }
+          },
+          read: function(stream, buffer, offset, length, pos /* ignored */) {
+            var bytesRead = 0;
+            for (var i = 0; i < length; i++) {
+              var result;
+              try {
+                result = input();
+              } catch (e) {
+                throw new FS.ErrnoError(ERRNO_CODES.EIO);
+              }
+              if (result === undefined && bytesRead === 0) {
+                throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+              }
+              if (result === null || result === undefined) break;
+              bytesRead++;
+              buffer[offset+i] = result;
+            }
+            if (bytesRead) {
+              stream.node.timestamp = Date.now();
+            }
+            return bytesRead;
+          },
+          write: function(stream, buffer, offset, length, pos) {
+            for (var i = 0; i < length; i++) {
+              try {
+                output(buffer[offset+i]);
+              } catch (e) {
+                throw new FS.ErrnoError(ERRNO_CODES.EIO);
+              }
+            }
+            if (length) {
+              stream.node.timestamp = Date.now();
+            }
+            return i;
+          }
+        });
+        return FS.mkdev(path, mode, dev);
+      },createLink:function (parent, name, target, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        return FS.symlink(target, path);
+      },forceLoadFile:function (obj) {
+        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+        var success = true;
+        if (typeof XMLHttpRequest !== 'undefined') {
+          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+        } else if (Module['read']) {
+          // Command-line.
+          try {
+            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+            //          read() will try to parse UTF8.
+            obj.contents = intArrayFromString(Module['read'](obj.url), true);
+            obj.usedBytes = obj.contents.length;
+          } catch (e) {
+            success = false;
+          }
+        } else {
+          throw new Error('Cannot load without read() or XMLHttpRequest.');
+        }
+        if (!success) ___setErrNo(ERRNO_CODES.EIO);
+        return success;
+      },createLazyFile:function (parent, name, url, canRead, canWrite) {
+        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+        function LazyUint8Array() {
+          this.lengthKnown = false;
+          this.chunks = []; // Loaded chunks. Index is the chunk number
+        }
+        LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+          if (idx > this.length-1 || idx < 0) {
+            return undefined;
+          }
+          var chunkOffset = idx % this.chunkSize;
+          var chunkNum = (idx / this.chunkSize)|0;
+          return this.getter(chunkNum)[chunkOffset];
+        }
+        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+          this.getter = getter;
+        }
+        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+          // Find length
+          var xhr = new XMLHttpRequest();
+          xhr.open('HEAD', url, false);
+          xhr.send(null);
+          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+          var datalength = Number(xhr.getResponseHeader("Content-length"));
+          var header;
+          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+  
+          var chunkSize = 1024*1024; // Chunk size in bytes
+  
+          if (!hasByteServing) chunkSize = datalength;
+  
+          // Function to get a range from the remote URL.
+          var doXHR = (function(from, to) {
+            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+  
+            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+            var xhr = new XMLHttpRequest();
+            xhr.open('GET', url, false);
+            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+  
+            // Some hints to the browser that we want binary data.
+            if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+            if (xhr.overrideMimeType) {
+              xhr.overrideMimeType('text/plain; charset=x-user-defined');
+            }
+  
+            xhr.send(null);
+            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+            if (xhr.response !== undefined) {
+              return new Uint8Array(xhr.response || []);
+            } else {
+              return intArrayFromString(xhr.responseText || '', true);
+            }
+          });
+          var lazyArray = this;
+          lazyArray.setDataGetter(function(chunkNum) {
+            var start = chunkNum * chunkSize;
+            var end = (chunkNum+1) * chunkSize - 1; // including this byte
+            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+              lazyArray.chunks[chunkNum] = doXHR(start, end);
+            }
+            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+            return lazyArray.chunks[chunkNum];
+          });
+  
+          if (usesGzip || !datalength) {
+            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+            datalength = this.getter(0).length;
+            chunkSize = datalength;
+            console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
+          }
+  
+          this._length = datalength;
+          this._chunkSize = chunkSize;
+          this.lengthKnown = true;
+        }
+        if (typeof XMLHttpRequest !== 'undefined') {
+          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+          var lazyArray = new LazyUint8Array();
+          Object.defineProperties(lazyArray, {
+            length: {
+              get: function() {
+                if(!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._length;
+              }
+            },
+            chunkSize: {
+              get: function() {
+                if(!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._chunkSize;
+              }
+            }
+          });
+  
+          var properties = { isDevice: false, contents: lazyArray };
+        } else {
+          var properties = { isDevice: false, url: url };
+        }
+  
+        var node = FS.createFile(parent, name, properties, canRead, canWrite);
+        // This is a total hack, but I want to get this lazy file code out of the
+        // core of MEMFS. If we want to keep this lazy file concept I feel it should
+        // be its own thin LAZYFS proxying calls to MEMFS.
+        if (properties.contents) {
+          node.contents = properties.contents;
+        } else if (properties.url) {
+          node.contents = null;
+          node.url = properties.url;
+        }
+        // Add a function that defers querying the file size until it is asked the first time.
+        Object.defineProperties(node, {
+          usedBytes: {
+            get: function() { return this.contents.length; }
+          }
+        });
+        // override each stream op with one that tries to force load the lazy file first
+        var stream_ops = {};
+        var keys = Object.keys(node.stream_ops);
+        keys.forEach(function(key) {
+          var fn = node.stream_ops[key];
+          stream_ops[key] = function forceLoadLazyFile() {
+            if (!FS.forceLoadFile(node)) {
+              throw new FS.ErrnoError(ERRNO_CODES.EIO);
+            }
+            return fn.apply(null, arguments);
+          };
+        });
+        // use a custom read function
+        stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+          if (!FS.forceLoadFile(node)) {
+            throw new FS.ErrnoError(ERRNO_CODES.EIO);
+          }
+          var contents = stream.node.contents;
+          if (position >= contents.length)
+            return 0;
+          var size = Math.min(contents.length - position, length);
+          assert(size >= 0);
+          if (contents.slice) { // normal array
+            for (var i = 0; i < size; i++) {
+              buffer[offset + i] = contents[position + i];
+            }
+          } else {
+            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+              buffer[offset + i] = contents.get(position + i);
+            }
+          }
+          return size;
+        };
+        node.stream_ops = stream_ops;
+        return node;
+      },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+        Browser.init(); // XXX perhaps this method should move onto Browser?
+        // TODO we should allow people to just pass in a complete filename instead
+        // of parent and name being that we just join them anyways
+        var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+        var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+        function processData(byteArray) {
+          function finish(byteArray) {
+            if (preFinish) preFinish();
+            if (!dontCreateFile) {
+              FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+            }
+            if (onload) onload();
+            removeRunDependency(dep);
+          }
+          var handled = false;
+          Module['preloadPlugins'].forEach(function(plugin) {
+            if (handled) return;
+            if (plugin['canHandle'](fullname)) {
+              plugin['handle'](byteArray, fullname, finish, function() {
+                if (onerror) onerror();
+                removeRunDependency(dep);
+              });
+              handled = true;
+            }
+          });
+          if (!handled) finish(byteArray);
+        }
+        addRunDependency(dep);
+        if (typeof url == 'string') {
+          Browser.asyncLoad(url, function(byteArray) {
+            processData(byteArray);
+          }, onerror);
+        } else {
+          processData(url);
+        }
+      },indexedDB:function () {
+        return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+      },DB_NAME:function () {
+        return 'EM_FS_' + window.location.pathname;
+      },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+        onload = onload || function(){};
+        onerror = onerror || function(){};
+        var indexedDB = FS.indexedDB();
+        try {
+          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+        } catch (e) {
+          return onerror(e);
+        }
+        openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+          console.log('creating db');
+          var db = openRequest.result;
+          db.createObjectStore(FS.DB_STORE_NAME);
+        };
+        openRequest.onsuccess = function openRequest_onsuccess() {
+          var db = openRequest.result;
+          var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+          var files = transaction.objectStore(FS.DB_STORE_NAME);
+          var ok = 0, fail = 0, total = paths.length;
+          function finish() {
+            if (fail == 0) onload(); else onerror();
+          }
+          paths.forEach(function(path) {
+            var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+            putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+            putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+          });
+          transaction.onerror = onerror;
+        };
+        openRequest.onerror = onerror;
+      },loadFilesFromDB:function (paths, onload, onerror) {
+        onload = onload || function(){};
+        onerror = onerror || function(){};
+        var indexedDB = FS.indexedDB();
+        try {
+          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+        } catch (e) {
+          return onerror(e);
+        }
+        openRequest.onupgradeneeded = onerror; // no database to load from
+        openRequest.onsuccess = function openRequest_onsuccess() {
+          var db = openRequest.result;
+          try {
+            var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+          } catch(e) {
+            onerror(e);
+            return;
+          }
+          var files = transaction.objectStore(FS.DB_STORE_NAME);
+          var ok = 0, fail = 0, total = paths.length;
+          function finish() {
+            if (fail == 0) onload(); else onerror();
+          }
+          paths.forEach(function(path) {
+            var getRequest = files.get(path);
+            getRequest.onsuccess = function getRequest_onsuccess() {
+              if (FS.analyzePath(path).exists) {
+                FS.unlink(path);
+              }
+              FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+              ok++;
+              if (ok + fail == total) finish();
+            };
+            getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+          });
+          transaction.onerror = onerror;
+        };
+        openRequest.onerror = onerror;
+      }};
+  
+  
+  
+  function _emscripten_set_main_loop_timing(mode, value) {
+      Browser.mainLoop.timingMode = mode;
+      Browser.mainLoop.timingValue = value;
+  
+      if (!Browser.mainLoop.func) {
+        return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
+      }
+  
+      if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
+          var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
+          setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
+        };
+        Browser.mainLoop.method = 'timeout';
+      } else if (mode == 1 /*EM_TIMING_RAF*/) {
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
+          Browser.requestAnimationFrame(Browser.mainLoop.runner);
+        };
+        Browser.mainLoop.method = 'rAF';
+      } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
+        if (typeof setImmediate === 'undefined') {
+          // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
+          var setImmediates = [];
+          var emscriptenMainLoopMessageId = 'setimmediate';
+          function Browser_setImmediate_messageHandler(event) {
+            // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events,
+            // so check for both cases.
+            if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
+              event.stopPropagation();
+              setImmediates.shift()();
+            }
+          }
+          addEventListener("message", Browser_setImmediate_messageHandler, true);
+          setImmediate = function Browser_emulated_setImmediate(func) {
+            setImmediates.push(func);
+            if (ENVIRONMENT_IS_WORKER) {
+              if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
+              Module['setImmediates'].push(func);
+              postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
+            } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
+          }
+        }
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
+          setImmediate(Browser.mainLoop.runner);
+        };
+        Browser.mainLoop.method = 'immediate';
+      }
+      return 0;
+    }
+  
+  function _emscripten_get_now() { abort() }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
+      Module['noExitRuntime'] = true;
+  
+      assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
+  
+      Browser.mainLoop.func = func;
+      Browser.mainLoop.arg = arg;
+  
+      var browserIterationFunc;
+      if (typeof arg !== 'undefined') {
+        browserIterationFunc = function() {
+          Module['dynCall_vi'](func, arg);
+        };
+      } else {
+        browserIterationFunc = function() {
+          Module['dynCall_v'](func);
+        };
+      }
+  
+      var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
+  
+      Browser.mainLoop.runner = function Browser_mainLoop_runner() {
+        if (ABORT) return;
+        if (Browser.mainLoop.queue.length > 0) {
+          var start = Date.now();
+          var blocker = Browser.mainLoop.queue.shift();
+          blocker.func(blocker.arg);
+          if (Browser.mainLoop.remainingBlockers) {
+            var remaining = Browser.mainLoop.remainingBlockers;
+            var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
+            if (blocker.counted) {
+              Browser.mainLoop.remainingBlockers = next;
+            } else {
+              // not counted, but move the progress along a tiny bit
+              next = next + 0.5; // do not steal all the next one's progress
+              Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
+            }
+          }
+          console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
+          Browser.mainLoop.updateStatus();
+  
+          // catches pause/resume main loop from blocker execution
+          if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+          setTimeout(Browser.mainLoop.runner, 0);
+          return;
+        }
+  
+        // catch pauses from non-main loop sources
+        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+        // Implement very basic swap interval control
+        Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
+        if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
+          // Not the scheduled time to render this frame - skip.
+          Browser.mainLoop.scheduler();
+          return;
+        } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
+          Browser.mainLoop.tickStartTime = _emscripten_get_now();
+        }
+  
+        // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
+        // VBO double-buffering and reduce GPU stalls.
+  
+  
+  
+        if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
+          err('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
+          Browser.mainLoop.method = ''; // just warn once per call to set main loop
+        }
+  
+        Browser.mainLoop.runIter(browserIterationFunc);
+  
+  
+        // catch pauses from the main loop itself
+        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+        // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
+        // to queue the newest produced audio samples.
+        // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
+        //       do not need to be hardcoded into this function, but can be more generic.
+        if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
+  
+        Browser.mainLoop.scheduler();
+      }
+  
+      if (!noSetTiming) {
+        if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
+        else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
+  
+        Browser.mainLoop.scheduler();
+      }
+  
+      if (simulateInfiniteLoop) {
+        throw 'SimulateInfiniteLoop';
+      }
+    }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
+          Browser.mainLoop.scheduler = null;
+          Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
+        },resume:function () {
+          Browser.mainLoop.currentlyRunningMainloop++;
+          var timingMode = Browser.mainLoop.timingMode;
+          var timingValue = Browser.mainLoop.timingValue;
+          var func = Browser.mainLoop.func;
+          Browser.mainLoop.func = null;
+          _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
+          _emscripten_set_main_loop_timing(timingMode, timingValue);
+          Browser.mainLoop.scheduler();
+        },updateStatus:function () {
+          if (Module['setStatus']) {
+            var message = Module['statusMessage'] || 'Please wait...';
+            var remaining = Browser.mainLoop.remainingBlockers;
+            var expected = Browser.mainLoop.expectedBlockers;
+            if (remaining) {
+              if (remaining < expected) {
+                Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
+              } else {
+                Module['setStatus'](message);
+              }
+            } else {
+              Module['setStatus']('');
+            }
+          }
+        },runIter:function (func) {
+          if (ABORT) return;
+          if (Module['preMainLoop']) {
+            var preRet = Module['preMainLoop']();
+            if (preRet === false) {
+              return; // |return false| skips a frame
+            }
+          }
+          try {
+            func();
+          } catch (e) {
+            if (e instanceof ExitStatus) {
+              return;
+            } else {
+              if (e && typeof e === 'object' && e.stack) err('exception thrown: ' + [e, e.stack]);
+              throw e;
+            }
+          }
+          if (Module['postMainLoop']) Module['postMainLoop']();
+        }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
+        if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
+  
+        if (Browser.initted) return;
+        Browser.initted = true;
+  
+        try {
+          new Blob();
+          Browser.hasBlobConstructor = true;
+        } catch(e) {
+          Browser.hasBlobConstructor = false;
+          console.log("warning: no blob constructor, cannot create blobs with mimetypes");
+        }
+        Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
+        Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
+        if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
+          console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
+          Module.noImageDecoding = true;
+        }
+  
+        // Support for plugins that can process preloaded files. You can add more of these to
+        // your app by creating and appending to Module.preloadPlugins.
+        //
+        // Each plugin is asked if it can handle a file based on the file's name. If it can,
+        // it is given the file's raw data. When it is done, it calls a callback with the file's
+        // (possibly modified) data. For example, a plugin might decompress a file, or it
+        // might create some side data structure for use later (like an Image element, etc.).
+  
+        var imagePlugin = {};
+        imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
+          return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
+        };
+        imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+          var b = null;
+          if (Browser.hasBlobConstructor) {
+            try {
+              b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+              if (b.size !== byteArray.length) { // Safari bug #118630
+                // Safari's Blob can only take an ArrayBuffer
+                b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
+              }
+            } catch(e) {
+              warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
+            }
+          }
+          if (!b) {
+            var bb = new Browser.BlobBuilder();
+            bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
+            b = bb.getBlob();
+          }
+          var url = Browser.URLObject.createObjectURL(b);
+          var img = new Image();
+          img.onload = function img_onload() {
+            assert(img.complete, 'Image ' + name + ' could not be decoded');
+            var canvas = document.createElement('canvas');
+            canvas.width = img.width;
+            canvas.height = img.height;
+            var ctx = canvas.getContext('2d');
+            ctx.drawImage(img, 0, 0);
+            Module["preloadedImages"][name] = canvas;
+            Browser.URLObject.revokeObjectURL(url);
+            if (onload) onload(byteArray);
+          };
+          img.onerror = function img_onerror(event) {
+            console.log('Image ' + url + ' could not be decoded');
+            if (onerror) onerror();
+          };
+          img.src = url;
+        };
+        Module['preloadPlugins'].push(imagePlugin);
+  
+        var audioPlugin = {};
+        audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
+          return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
+        };
+        audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+          var done = false;
+          function finish(audio) {
+            if (done) return;
+            done = true;
+            Module["preloadedAudios"][name] = audio;
+            if (onload) onload(byteArray);
+          }
+          function fail() {
+            if (done) return;
+            done = true;
+            Module["preloadedAudios"][name] = new Audio(); // empty shim
+            if (onerror) onerror();
+          }
+          if (Browser.hasBlobConstructor) {
+            try {
+              var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+            } catch(e) {
+              return fail();
+            }
+            var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
+            var audio = new Audio();
+            audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
+            audio.onerror = function audio_onerror(event) {
+              if (done) return;
+              console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
+              function encode64(data) {
+                var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+                var PAD = '=';
+                var ret = '';
+                var leftchar = 0;
+                var leftbits = 0;
+                for (var i = 0; i < data.length; i++) {
+                  leftchar = (leftchar << 8) | data[i];
+                  leftbits += 8;
+                  while (leftbits >= 6) {
+                    var curr = (leftchar >> (leftbits-6)) & 0x3f;
+                    leftbits -= 6;
+                    ret += BASE[curr];
+                  }
+                }
+                if (leftbits == 2) {
+                  ret += BASE[(leftchar&3) << 4];
+                  ret += PAD + PAD;
+                } else if (leftbits == 4) {
+                  ret += BASE[(leftchar&0xf) << 2];
+                  ret += PAD;
+                }
+                return ret;
+              }
+              audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
+              finish(audio); // we don't wait for confirmation this worked - but it's worth trying
+            };
+            audio.src = url;
+            // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
+            Browser.safeSetTimeout(function() {
+              finish(audio); // try to use it even though it is not necessarily ready to play
+            }, 10000);
+          } else {
+            return fail();
+          }
+        };
+        Module['preloadPlugins'].push(audioPlugin);
+  
+  
+        // Canvas event setup
+  
+        function pointerLockChange() {
+          Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
+                                document['mozPointerLockElement'] === Module['canvas'] ||
+                                document['webkitPointerLockElement'] === Module['canvas'] ||
+                                document['msPointerLockElement'] === Module['canvas'];
+        }
+        var canvas = Module['canvas'];
+        if (canvas) {
+          // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
+          // Module['forcedAspectRatio'] = 4 / 3;
+  
+          canvas.requestPointerLock = canvas['requestPointerLock'] ||
+                                      canvas['mozRequestPointerLock'] ||
+                                      canvas['webkitRequestPointerLock'] ||
+                                      canvas['msRequestPointerLock'] ||
+                                      function(){};
+          canvas.exitPointerLock = document['exitPointerLock'] ||
+                                   document['mozExitPointerLock'] ||
+                                   document['webkitExitPointerLock'] ||
+                                   document['msExitPointerLock'] ||
+                                   function(){}; // no-op if function does not exist
+          canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+  
+          document.addEventListener('pointerlockchange', pointerLockChange, false);
+          document.addEventListener('mozpointerlockchange', pointerLockChange, false);
+          document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
+          document.addEventListener('mspointerlockchange', pointerLockChange, false);
+  
+          if (Module['elementPointerLock']) {
+            canvas.addEventListener("click", function(ev) {
+              if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+                Module['canvas'].requestPointerLock();
+                ev.preventDefault();
+              }
+            }, false);
+          }
+        }
+      },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
+        if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
+  
+        var ctx;
+        var contextHandle;
+        if (useWebGL) {
+          // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
+          var contextAttributes = {
+            antialias: false,
+            alpha: false
+          };
+  
+          if (webGLContextAttributes) {
+            for (var attribute in webGLContextAttributes) {
+              contextAttributes[attribute] = webGLContextAttributes[attribute];
+            }
+          }
+  
+          contextHandle = GL.createContext(canvas, contextAttributes);
+          if (contextHandle) {
+            ctx = GL.getContext(contextHandle).GLctx;
+          }
+        } else {
+          ctx = canvas.getContext('2d');
+        }
+  
+        if (!ctx) return null;
+  
+        if (setInModule) {
+          if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
+  
+          Module.ctx = ctx;
+          if (useWebGL) GL.makeContextCurrent(contextHandle);
+          Module.useWebGL = useWebGL;
+          Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
+          Browser.init();
+        }
+        return ctx;
+      },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
+        Browser.lockPointer = lockPointer;
+        Browser.resizeCanvas = resizeCanvas;
+        Browser.vrDevice = vrDevice;
+        if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
+        if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
+        if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
+  
+        var canvas = Module['canvas'];
+        function fullscreenChange() {
+          Browser.isFullscreen = false;
+          var canvasContainer = canvas.parentNode;
+          if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+               document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+               document['webkitCurrentFullScreenElement']) === canvasContainer) {
+            canvas.exitFullscreen = document['exitFullscreen'] ||
+                                    document['cancelFullScreen'] ||
+                                    document['mozCancelFullScreen'] ||
+                                    document['msExitFullscreen'] ||
+                                    document['webkitCancelFullScreen'] ||
+                                    function() {};
+            canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
+            if (Browser.lockPointer) canvas.requestPointerLock();
+            Browser.isFullscreen = true;
+            if (Browser.resizeCanvas) {
+              Browser.setFullscreenCanvasSize();
+            } else {
+              Browser.updateCanvasDimensions(canvas);
+            }
+          } else {
+            // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+            canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+            canvasContainer.parentNode.removeChild(canvasContainer);
+  
+            if (Browser.resizeCanvas) {
+              Browser.setWindowedCanvasSize();
+            } else {
+              Browser.updateCanvasDimensions(canvas);
+            }
+          }
+          if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
+          if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
+        }
+  
+        if (!Browser.fullscreenHandlersInstalled) {
+          Browser.fullscreenHandlersInstalled = true;
+          document.addEventListener('fullscreenchange', fullscreenChange, false);
+          document.addEventListener('mozfullscreenchange', fullscreenChange, false);
+          document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
+          document.addEventListener('MSFullscreenChange', fullscreenChange, false);
+        }
+  
+        // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+        var canvasContainer = document.createElement("div");
+        canvas.parentNode.insertBefore(canvasContainer, canvas);
+        canvasContainer.appendChild(canvas);
+  
+        // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+        canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
+                                            canvasContainer['mozRequestFullScreen'] ||
+                                            canvasContainer['msRequestFullscreen'] ||
+                                           (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
+                                           (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
+  
+        if (vrDevice) {
+          canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
+        } else {
+          canvasContainer.requestFullscreen();
+        }
+      },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
+          err('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
+          Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
+            return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+          }
+          return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+      },nextRAF:0,fakeRequestAnimationFrame:function (func) {
+        // try to keep 60fps between calls to here
+        var now = Date.now();
+        if (Browser.nextRAF === 0) {
+          Browser.nextRAF = now + 1000/60;
+        } else {
+          while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
+            Browser.nextRAF += 1000/60;
+          }
+        }
+        var delay = Math.max(Browser.nextRAF - now, 0);
+        setTimeout(func, delay);
+      },requestAnimationFrame:function requestAnimationFrame(func) {
+        if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
+          Browser.fakeRequestAnimationFrame(func);
+        } else {
+          if (!window.requestAnimationFrame) {
+            window.requestAnimationFrame = window['requestAnimationFrame'] ||
+                                           window['mozRequestAnimationFrame'] ||
+                                           window['webkitRequestAnimationFrame'] ||
+                                           window['msRequestAnimationFrame'] ||
+                                           window['oRequestAnimationFrame'] ||
+                                           Browser.fakeRequestAnimationFrame;
+          }
+          window.requestAnimationFrame(func);
+        }
+      },safeCallback:function (func) {
+        return function() {
+          if (!ABORT) return func.apply(null, arguments);
+        };
+      },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
+        Browser.allowAsyncCallbacks = false;
+      },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
+        Browser.allowAsyncCallbacks = true;
+        if (Browser.queuedAsyncCallbacks.length > 0) {
+          var callbacks = Browser.queuedAsyncCallbacks;
+          Browser.queuedAsyncCallbacks = [];
+          callbacks.forEach(function(func) {
+            func();
+          });
+        }
+      },safeRequestAnimationFrame:function (func) {
+        return Browser.requestAnimationFrame(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } else {
+            Browser.queuedAsyncCallbacks.push(func);
+          }
+        });
+      },safeSetTimeout:function (func, timeout) {
+        Module['noExitRuntime'] = true;
+        return setTimeout(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } else {
+            Browser.queuedAsyncCallbacks.push(func);
+          }
+        }, timeout);
+      },safeSetInterval:function (func, timeout) {
+        Module['noExitRuntime'] = true;
+        return setInterval(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } // drop it on the floor otherwise, next interval will kick in
+        }, timeout);
+      },getMimetype:function (name) {
+        return {
+          'jpg': 'image/jpeg',
+          'jpeg': 'image/jpeg',
+          'png': 'image/png',
+          'bmp': 'image/bmp',
+          'ogg': 'audio/ogg',
+          'wav': 'audio/wav',
+          'mp3': 'audio/mpeg'
+        }[name.substr(name.lastIndexOf('.')+1)];
+      },getUserMedia:function (func) {
+        if(!window.getUserMedia) {
+          window.getUserMedia = navigator['getUserMedia'] ||
+                                navigator['mozGetUserMedia'];
+        }
+        window.getUserMedia(func);
+      },getMovementX:function (event) {
+        return event['movementX'] ||
+               event['mozMovementX'] ||
+               event['webkitMovementX'] ||
+               0;
+      },getMovementY:function (event) {
+        return event['movementY'] ||
+               event['mozMovementY'] ||
+               event['webkitMovementY'] ||
+               0;
+      },getMouseWheelDelta:function (event) {
+        var delta = 0;
+        switch (event.type) {
+          case 'DOMMouseScroll':
+            delta = event.detail;
+            break;
+          case 'mousewheel':
+            delta = event.wheelDelta;
+            break;
+          case 'wheel':
+            delta = event['deltaY'];
+            break;
+          default:
+            throw 'unrecognized mouse wheel event: ' + event.type;
+        }
+        return delta;
+      },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
+        if (Browser.pointerLock) {
+          // When the pointer is locked, calculate the coordinates
+          // based on the movement of the mouse.
+          // Workaround for Firefox bug 764498
+          if (event.type != 'mousemove' &&
+              ('mozMovementX' in event)) {
+            Browser.mouseMovementX = Browser.mouseMovementY = 0;
+          } else {
+            Browser.mouseMovementX = Browser.getMovementX(event);
+            Browser.mouseMovementY = Browser.getMovementY(event);
+          }
+  
+          // check if SDL is available
+          if (typeof SDL != "undefined") {
+            Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
+            Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
+          } else {
+            // just add the mouse delta to the current absolut mouse position
+            // FIXME: ideally this should be clamped against the canvas size and zero
+            Browser.mouseX += Browser.mouseMovementX;
+            Browser.mouseY += Browser.mouseMovementY;
+          }
+        } else {
+          // Otherwise, calculate the movement based on the changes
+          // in the coordinates.
+          var rect = Module["canvas"].getBoundingClientRect();
+          var cw = Module["canvas"].width;
+          var ch = Module["canvas"].height;
+  
+          // Neither .scrollX or .pageXOffset are defined in a spec, but
+          // we prefer .scrollX because it is currently in a spec draft.
+          // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+          var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
+          var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
+  
+          if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
+            var touch = event.touch;
+            if (touch === undefined) {
+              return; // the "touch" property is only defined in SDL
+  
+            }
+            var adjustedX = touch.pageX - (scrollX + rect.left);
+            var adjustedY = touch.pageY - (scrollY + rect.top);
+  
+            adjustedX = adjustedX * (cw / rect.width);
+            adjustedY = adjustedY * (ch / rect.height);
+  
+            var coords = { x: adjustedX, y: adjustedY };
+  
+            if (event.type === 'touchstart') {
+              Browser.lastTouches[touch.identifier] = coords;
+              Browser.touches[touch.identifier] = coords;
+            } else if (event.type === 'touchend' || event.type === 'touchmove') {
+              var last = Browser.touches[touch.identifier];
+              if (!last) last = coords;
+              Browser.lastTouches[touch.identifier] = last;
+              Browser.touches[touch.identifier] = coords;
+            }
+            return;
+          }
+  
+          var x = event.pageX - (scrollX + rect.left);
+          var y = event.pageY - (scrollY + rect.top);
+  
+          // the canvas might be CSS-scaled compared to its backbuffer;
+          // SDL-using content will want mouse coordinates in terms
+          // of backbuffer units.
+          x = x * (cw / rect.width);
+          y = y * (ch / rect.height);
+  
+          Browser.mouseMovementX = x - Browser.mouseX;
+          Browser.mouseMovementY = y - Browser.mouseY;
+          Browser.mouseX = x;
+          Browser.mouseY = y;
+        }
+      },asyncLoad:function (url, onload, onerror, noRunDep) {
+        var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
+        Module['readAsync'](url, function(arrayBuffer) {
+          assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
+          onload(new Uint8Array(arrayBuffer));
+          if (dep) removeRunDependency(dep);
+        }, function(event) {
+          if (onerror) {
+            onerror();
+          } else {
+            throw 'Loading data file "' + url + '" failed.';
+          }
+        });
+        if (dep) addRunDependency(dep);
+      },resizeListeners:[],updateResizeListeners:function () {
+        var canvas = Module['canvas'];
+        Browser.resizeListeners.forEach(function(listener) {
+          listener(canvas.width, canvas.height);
+        });
+      },setCanvasSize:function (width, height, noUpdates) {
+        var canvas = Module['canvas'];
+        Browser.updateCanvasDimensions(canvas, width, height);
+        if (!noUpdates) Browser.updateResizeListeners();
+      },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
+        // check if SDL is available
+        if (typeof SDL != "undefined") {
+          var flags = HEAPU32[((SDL.screen)>>2)];
+          flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
+          HEAP32[((SDL.screen)>>2)]=flags
+        }
+        Browser.updateCanvasDimensions(Module['canvas']);
+        Browser.updateResizeListeners();
+      },setWindowedCanvasSize:function () {
+        // check if SDL is available
+        if (typeof SDL != "undefined") {
+          var flags = HEAPU32[((SDL.screen)>>2)];
+          flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
+          HEAP32[((SDL.screen)>>2)]=flags
+        }
+        Browser.updateCanvasDimensions(Module['canvas']);
+        Browser.updateResizeListeners();
+      },updateCanvasDimensions:function (canvas, wNative, hNative) {
+        if (wNative && hNative) {
+          canvas.widthNative = wNative;
+          canvas.heightNative = hNative;
+        } else {
+          wNative = canvas.widthNative;
+          hNative = canvas.heightNative;
+        }
+        var w = wNative;
+        var h = hNative;
+        if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
+          if (w/h < Module['forcedAspectRatio']) {
+            w = Math.round(h * Module['forcedAspectRatio']);
+          } else {
+            h = Math.round(w / Module['forcedAspectRatio']);
+          }
+        }
+        if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+             document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+             document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
+           var factor = Math.min(screen.width / w, screen.height / h);
+           w = Math.round(w * factor);
+           h = Math.round(h * factor);
+        }
+        if (Browser.resizeCanvas) {
+          if (canvas.width  != w) canvas.width  = w;
+          if (canvas.height != h) canvas.height = h;
+          if (typeof canvas.style != 'undefined') {
+            canvas.style.removeProperty( "width");
+            canvas.style.removeProperty("height");
+          }
+        } else {
+          if (canvas.width  != wNative) canvas.width  = wNative;
+          if (canvas.height != hNative) canvas.height = hNative;
+          if (typeof canvas.style != 'undefined') {
+            if (w != wNative || h != hNative) {
+              canvas.style.setProperty( "width", w + "px", "important");
+              canvas.style.setProperty("height", h + "px", "important");
+            } else {
+              canvas.style.removeProperty( "width");
+              canvas.style.removeProperty("height");
+            }
+          }
+        }
+      },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
+        var handle = Browser.nextWgetRequestHandle;
+        Browser.nextWgetRequestHandle++;
+        return handle;
+      }};
+  
+  function _SDL_GetTicks() {
+      return (Date.now() - SDL.startTime)|0;
+    }
+  
+  function _SDL_LockSurface(surf) {
+      var surfData = SDL.surfaces[surf];
+  
+      surfData.locked++;
+      if (surfData.locked > 1) return 0;
+  
+      if (!surfData.buffer) {
+        surfData.buffer = _malloc(surfData.width * surfData.height * 4);
+        HEAP32[(((surf)+(20))>>2)]=surfData.buffer;
+      }
+  
+      // Mark in C/C++-accessible SDL structure
+      // SDL_Surface has the following fields: Uint32 flags, SDL_PixelFormat *format; int w, h; Uint16 pitch; void *pixels; ...
+      // So we have fields all of the same size, and 5 of them before us.
+      // TODO: Use macros like in library.js
+      HEAP32[(((surf)+(20))>>2)]=surfData.buffer;
+  
+      if (surf == SDL.screen && Module.screenIsReadOnly && surfData.image) return 0;
+  
+      if (SDL.defaults.discardOnLock) {
+        if (!surfData.image) {
+          surfData.image = surfData.ctx.createImageData(surfData.width, surfData.height);
+        }
+        if (!SDL.defaults.opaqueFrontBuffer) return;
+      } else {
+        surfData.image = surfData.ctx.getImageData(0, 0, surfData.width, surfData.height);
+      }
+  
+      // Emulate desktop behavior and kill alpha values on the locked surface. (very costly!) Set SDL.defaults.opaqueFrontBuffer = false
+      // if you don't want this.
+      if (surf == SDL.screen && SDL.defaults.opaqueFrontBuffer) {
+        var data = surfData.image.data;
+        var num = data.length;
+        for (var i = 0; i < num/4; i++) {
+          data[i*4+3] = 255; // opacity, as canvases blend alpha
+        }
+      }
+  
+      if (SDL.defaults.copyOnLock && !SDL.defaults.discardOnLock) {
+        // Copy pixel data to somewhere accessible to 'C/C++'
+        if (surfData.isFlagSet(0x00200000 /* SDL_HWPALETTE */)) {
+          // If this is neaded then
+          // we should compact the data from 32bpp to 8bpp index.
+          // I think best way to implement this is use
+          // additional colorMap hash (color->index).
+          // Something like this:
+          //
+          // var size = surfData.width * surfData.height;
+          // var data = '';
+          // for (var i = 0; i<size; i++) {
+          //   var color = SDL.translateRGBAToColor(
+          //     surfData.image.data[i*4   ],
+          //     surfData.image.data[i*4 +1],
+          //     surfData.image.data[i*4 +2],
+          //     255);
+          //   var index = surfData.colorMap[color];
+          //   HEAP8[(((surfData.buffer)+(i))>>0)]=index;
+          // }
+          throw 'CopyOnLock is not supported for SDL_LockSurface with SDL_HWPALETTE flag set' + new Error().stack;
+        } else {
+          HEAPU8.set(surfData.image.data, surfData.buffer);
+        }
+      }
+  
+      return 0;
+    }var SDL={defaults:{width:320,height:200,copyOnLock:true,discardOnLock:false,opaqueFrontBuffer:true},version:null,surfaces:{},canvasPool:[],events:[],fonts:[null],audios:[null],rwops:[null],music:{audio:null,volume:1},mixerFrequency:22050,mixerFormat:32784,mixerNumChannels:2,mixerChunkSize:1024,channelMinimumNumber:0,GL:false,glAttributes:{0:3,1:3,2:2,3:0,4:0,5:1,6:16,7:0,8:0,9:0,10:0,11:0,12:0,13:0,14:0,15:1,16:0,17:0,18:0},keyboardState:null,keyboardMap:{},canRequestFullscreen:false,isRequestingFullscreen:false,textInput:false,startTime:null,initFlags:0,buttonState:0,modState:0,DOMButtons:[0,0,0],DOMEventToSDLEvent:{},TOUCH_DEFAULT_ID:0,eventHandler:null,eventHandlerContext:null,eventHandlerTemp:0,keyCodes:{16:1249,17:1248,18:1250,20:1081,33:1099,34:1102,35:1101,36:1098,37:1104,38:1106,39:1103,40:1105,44:316,45:1097,46:127,91:1251,93:1125,96:1122,97:1113,98:1114,99:1115,100:1116,101:1117,102:1118,103:1119,104:1120,105:1121,106:1109,107:1111,109:1110,110:1123,111:1108,112:1082,113:1083,114:1084,115:1085,116:1086,117:1087,118:1088,119:1089,120:1090,121:1091,122:1092,123:1093,124:1128,125:1129,126:1130,127:1131,128:1132,129:1133,130:1134,131:1135,132:1136,133:1137,134:1138,135:1139,144:1107,160:94,161:33,162:34,163:35,164:36,165:37,166:38,167:95,168:40,169:41,170:42,171:43,172:124,173:45,174:123,175:125,176:126,181:127,182:129,183:128,188:44,190:46,191:47,192:96,219:91,220:92,221:93,222:39,224:1251},scanCodes:{8:42,9:43,13:40,27:41,32:44,35:204,39:53,44:54,46:55,47:56,48:39,49:30,50:31,51:32,52:33,53:34,54:35,55:36,56:37,57:38,58:203,59:51,61:46,91:47,92:49,93:48,96:52,97:4,98:5,99:6,100:7,101:8,102:9,103:10,104:11,105:12,106:13,107:14,108:15,109:16,110:17,111:18,112:19,113:20,114:21,115:22,116:23,117:24,118:25,119:26,120:27,121:28,122:29,127:76,305:224,308:226,316:70},loadRect:function (rect) {
+        return {
+          x: HEAP32[((rect + 0)>>2)],
+          y: HEAP32[((rect + 4)>>2)],
+          w: HEAP32[((rect + 8)>>2)],
+          h: HEAP32[((rect + 12)>>2)]
+        };
+      },updateRect:function (rect, r) {
+        HEAP32[((rect)>>2)]=r.x;
+        HEAP32[(((rect)+(4))>>2)]=r.y;
+        HEAP32[(((rect)+(8))>>2)]=r.w;
+        HEAP32[(((rect)+(12))>>2)]=r.h;
+      },intersectionOfRects:function (first, second) {
+        var leftX = Math.max(first.x, second.x);
+        var leftY = Math.max(first.y, second.y);
+        var rightX = Math.min(first.x + first.w, second.x + second.w);
+        var rightY = Math.min(first.y + first.h, second.y + second.h);
+  
+        return {
+          x: leftX,
+          y: leftY,
+          w: Math.max(leftX, rightX) - leftX,
+          h: Math.max(leftY, rightY) - leftY
+        }
+      },checkPixelFormat:function (fmt) {
+      },loadColorToCSSRGB:function (color) {
+        var rgba = HEAP32[((color)>>2)];
+        return 'rgb(' + (rgba&255) + ',' + ((rgba >> 8)&255) + ',' + ((rgba >> 16)&255) + ')';
+      },loadColorToCSSRGBA:function (color) {
+        var rgba = HEAP32[((color)>>2)];
+        return 'rgba(' + (rgba&255) + ',' + ((rgba >> 8)&255) + ',' + ((rgba >> 16)&255) + ',' + (((rgba >> 24)&255)/255) + ')';
+      },translateColorToCSSRGBA:function (rgba) {
+        return 'rgba(' + (rgba&0xff) + ',' + (rgba>>8 & 0xff) + ',' + (rgba>>16 & 0xff) + ',' + (rgba>>>24)/0xff + ')';
+      },translateRGBAToCSSRGBA:function (r, g, b, a) {
+        return 'rgba(' + (r&0xff) + ',' + (g&0xff) + ',' + (b&0xff) + ',' + (a&0xff)/255 + ')';
+      },translateRGBAToColor:function (r, g, b, a) {
+        return r | g << 8 | b << 16 | a << 24;
+      },makeSurface:function (width, height, flags, usePageCanvas, source, rmask, gmask, bmask, amask) {
+        flags = flags || 0;
+        var is_SDL_HWSURFACE = flags & 0x00000001;
+        var is_SDL_HWPALETTE = flags & 0x00200000;
+        var is_SDL_OPENGL = flags & 0x04000000;
+  
+        var surf = _malloc(60);
+        var pixelFormat = _malloc(44);
+        //surface with SDL_HWPALETTE flag is 8bpp surface (1 byte)
+        var bpp = is_SDL_HWPALETTE ? 1 : 4;
+        var buffer = 0;
+  
+        // preemptively initialize this for software surfaces,
+        // otherwise it will be lazily initialized inside of SDL_LockSurface
+        if (!is_SDL_HWSURFACE && !is_SDL_OPENGL) {
+          buffer = _malloc(width * height * 4);
+        }
+  
+        HEAP32[((surf)>>2)]=flags;
+        HEAP32[(((surf)+(4))>>2)]=pixelFormat;
+        HEAP32[(((surf)+(8))>>2)]=width;
+        HEAP32[(((surf)+(12))>>2)]=height;
+        HEAP32[(((surf)+(16))>>2)]=width * bpp;  // assuming RGBA or indexed for now,
+                                                                                          // since that is what ImageData gives us in browsers
+        HEAP32[(((surf)+(20))>>2)]=buffer;
+  
+        HEAP32[(((surf)+(36))>>2)]=0;
+        HEAP32[(((surf)+(40))>>2)]=0;
+        HEAP32[(((surf)+(44))>>2)]=Module["canvas"].width;
+        HEAP32[(((surf)+(48))>>2)]=Module["canvas"].height;
+  
+        HEAP32[(((surf)+(56))>>2)]=1;
+  
+        HEAP32[((pixelFormat)>>2)]=-2042224636;
+        HEAP32[(((pixelFormat)+(4))>>2)]=0;// TODO
+        HEAP8[(((pixelFormat)+(8))>>0)]=bpp * 8;
+        HEAP8[(((pixelFormat)+(9))>>0)]=bpp;
+  
+        HEAP32[(((pixelFormat)+(12))>>2)]=rmask || 0x000000ff;
+        HEAP32[(((pixelFormat)+(16))>>2)]=gmask || 0x0000ff00;
+        HEAP32[(((pixelFormat)+(20))>>2)]=bmask || 0x00ff0000;
+        HEAP32[(((pixelFormat)+(24))>>2)]=amask || 0xff000000;
+  
+        // Decide if we want to use WebGL or not
+        SDL.GL = SDL.GL || is_SDL_OPENGL;
+        var canvas;
+        if (!usePageCanvas) {
+          if (SDL.canvasPool.length > 0) {
+            canvas = SDL.canvasPool.pop();
+          } else {
+            canvas = document.createElement('canvas');
+          }
+          canvas.width = width;
+          canvas.height = height;
+        } else {
+          canvas = Module['canvas'];
+        }
+  
+        var webGLContextAttributes = {
+          antialias: ((SDL.glAttributes[13 /*SDL_GL_MULTISAMPLEBUFFERS*/] != 0) && (SDL.glAttributes[14 /*SDL_GL_MULTISAMPLESAMPLES*/] > 1)),
+          depth: (SDL.glAttributes[6 /*SDL_GL_DEPTH_SIZE*/] > 0),
+          stencil: (SDL.glAttributes[7 /*SDL_GL_STENCIL_SIZE*/] > 0),
+          alpha: (SDL.glAttributes[3 /*SDL_GL_ALPHA_SIZE*/] > 0)
+        };
+  
+        var ctx = Browser.createContext(canvas, is_SDL_OPENGL, usePageCanvas, webGLContextAttributes);
+  
+        SDL.surfaces[surf] = {
+          width: width,
+          height: height,
+          canvas: canvas,
+          ctx: ctx,
+          surf: surf,
+          buffer: buffer,
+          pixelFormat: pixelFormat,
+          alpha: 255,
+          flags: flags,
+          locked: 0,
+          usePageCanvas: usePageCanvas,
+          source: source,
+  
+          isFlagSet: function(flag) {
+            return flags & flag;
+          }
+        };
+  
+        return surf;
+      },copyIndexedColorData:function (surfData, rX, rY, rW, rH) {
+        // HWPALETTE works with palette
+        // setted by SDL_SetColors
+        if (!surfData.colors) {
+          return;
+        }
+  
+        var fullWidth  = Module['canvas'].width;
+        var fullHeight = Module['canvas'].height;
+  
+        var startX  = rX || 0;
+        var startY  = rY || 0;
+        var endX    = (rW || (fullWidth - startX)) + startX;
+        var endY    = (rH || (fullHeight - startY)) + startY;
+  
+        var buffer  = surfData.buffer;
+  
+        if (!surfData.image.data32) {
+          surfData.image.data32 = new Uint32Array(surfData.image.data.buffer);
+        }
+        var data32   = surfData.image.data32;
+  
+        var colors32 = surfData.colors32;
+  
+        for (var y = startY; y < endY; ++y) {
+          var base = y * fullWidth;
+          for (var x = startX; x < endX; ++x) {
+            data32[base + x] = colors32[HEAPU8[((buffer + base + x)>>0)]];
+          }
+        }
+      },freeSurface:function (surf) {
+        var refcountPointer = surf + 56;
+        var refcount = HEAP32[((refcountPointer)>>2)];
+        if (refcount > 1) {
+          HEAP32[((refcountPointer)>>2)]=refcount - 1;
+          return;
+        }
+  
+        var info = SDL.surfaces[surf];
+        if (!info.usePageCanvas && info.canvas) SDL.canvasPool.push(info.canvas);
+        if (info.buffer) _free(info.buffer);
+        _free(info.pixelFormat);
+        _free(surf);
+        SDL.surfaces[surf] = null;
+  
+        if (surf === SDL.screen) {
+          SDL.screen = null;
+        }
+      },blitSurface:function (src, srcrect, dst, dstrect, scale) {
+        var srcData = SDL.surfaces[src];
+        var dstData = SDL.surfaces[dst];
+        var sr, dr;
+        if (srcrect) {
+          sr = SDL.loadRect(srcrect);
+        } else {
+          sr = { x: 0, y: 0, w: srcData.width, h: srcData.height };
+        }
+        if (dstrect) {
+          dr = SDL.loadRect(dstrect);
+        } else {
+          dr = { x: 0, y: 0, w: srcData.width, h: srcData.height };
+        }
+        if (dstData.clipRect) {
+          var widthScale = (!scale || sr.w === 0) ? 1 : sr.w / dr.w;
+          var heightScale = (!scale || sr.h === 0) ? 1 : sr.h / dr.h;
+  
+          dr = SDL.intersectionOfRects(dstData.clipRect, dr);
+  
+          sr.w = dr.w * widthScale;
+          sr.h = dr.h * heightScale;
+  
+          if (dstrect) {
+            SDL.updateRect(dstrect, dr);
+          }
+        }
+        var blitw, blith;
+        if (scale) {
+          blitw = dr.w; blith = dr.h;
+        } else {
+          blitw = sr.w; blith = sr.h;
+        }
+        if (sr.w === 0 || sr.h === 0 || blitw === 0 || blith === 0) {
+          return 0;
+        }
+        var oldAlpha = dstData.ctx.globalAlpha;
+        dstData.ctx.globalAlpha = srcData.alpha/255;
+        dstData.ctx.drawImage(srcData.canvas, sr.x, sr.y, sr.w, sr.h, dr.x, dr.y, blitw, blith);
+        dstData.ctx.globalAlpha = oldAlpha;
+        if (dst != SDL.screen) {
+          // XXX As in IMG_Load, for compatibility we write out |pixels|
+          warnOnce('WARNING: copying canvas data to memory for compatibility');
+          _SDL_LockSurface(dst);
+          dstData.locked--; // The surface is not actually locked in this hack
+        }
+        return 0;
+      },downFingers:{},savedKeydown:null,receiveEvent:function (event) {
+        function unpressAllPressedKeys() {
+          // Un-press all pressed keys: TODO
+          for (var code in SDL.keyboardMap) {
+            SDL.events.push({
+              type: 'keyup',
+              keyCode: SDL.keyboardMap[code]
+            });
+          }
+        };
+        switch(event.type) {
+          case 'touchstart': case 'touchmove': {
+            event.preventDefault();
+  
+            var touches = [];
+  
+            // Clear out any touchstart events that we've already processed
+            if (event.type === 'touchstart') {
+              for (var i = 0; i < event.touches.length; i++) {
+                var touch = event.touches[i];
+                if (SDL.downFingers[touch.identifier] != true) {
+                  SDL.downFingers[touch.identifier] = true;
+                  touches.push(touch);
+                }
+              }
+            } else {
+              touches = event.touches;
+            }
+  
+            var firstTouch = touches[0];
+            if (firstTouch) {
+              if (event.type == 'touchstart') {
+                SDL.DOMButtons[0] = 1;
+              }
+              var mouseEventType;
+              switch(event.type) {
+                case 'touchstart': mouseEventType = 'mousedown'; break;
+                case 'touchmove': mouseEventType = 'mousemove'; break;
+              }
+              var mouseEvent = {
+                type: mouseEventType,
+                button: 0,
+                pageX: firstTouch.clientX,
+                pageY: firstTouch.clientY
+              };
+              SDL.events.push(mouseEvent);
+            }
+  
+            for (var i = 0; i < touches.length; i++) {
+              var touch = touches[i];
+              SDL.events.push({
+                type: event.type,
+                touch: touch
+              });
+            };
+            break;
+          }
+          case 'touchend': {
+            event.preventDefault();
+  
+            // Remove the entry in the SDL.downFingers hash
+            // because the finger is no longer down.
+            for(var i = 0; i < event.changedTouches.length; i++) {
+              var touch = event.changedTouches[i];
+              if (SDL.downFingers[touch.identifier] === true) {
+                delete SDL.downFingers[touch.identifier];
+              }
+            }
+  
+            var mouseEvent = {
+              type: 'mouseup',
+              button: 0,
+              pageX: event.changedTouches[0].clientX,
+              pageY: event.changedTouches[0].clientY
+            };
+            SDL.DOMButtons[0] = 0;
+            SDL.events.push(mouseEvent);
+  
+            for (var i = 0; i < event.changedTouches.length; i++) {
+              var touch = event.changedTouches[i];
+              SDL.events.push({
+                type: 'touchend',
+                touch: touch
+              });
+            };
+            break;
+          }
+          case 'DOMMouseScroll': case 'mousewheel': case 'wheel':
+            var delta = -Browser.getMouseWheelDelta(event); // Flip the wheel direction to translate from browser wheel direction (+:down) to SDL direction (+:up)
+            delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
+  
+            // Simulate old-style SDL events representing mouse wheel input as buttons
+            var button = delta > 0 ? 3 /*SDL_BUTTON_WHEELUP-1*/ : 4 /*SDL_BUTTON_WHEELDOWN-1*/; // Subtract one since JS->C marshalling is defined to add one back.
+            SDL.events.push({ type: 'mousedown', button: button, pageX: event.pageX, pageY: event.pageY });
+            SDL.events.push({ type: 'mouseup', button: button, pageX: event.pageX, pageY: event.pageY });
+  
+            // Pass a delta motion event.
+            SDL.events.push({ type: 'wheel', deltaX: 0, deltaY: delta });
+            event.preventDefault(); // If we don't prevent this, then 'wheel' event will be sent again by the browser as 'DOMMouseScroll' and we will receive this same event the second time.
+            break;
+          case 'mousemove':
+            if (SDL.DOMButtons[0] === 1) {
+              SDL.events.push({
+                type: 'touchmove',
+                touch: {
+                  identifier: 0,
+                  deviceID: -1,
+                  pageX: event.pageX,
+                  pageY: event.pageY
+                }
+              });
+            }
+            if (Browser.pointerLock) {
+              // workaround for firefox bug 750111
+              if ('mozMovementX' in event) {
+                event['movementX'] = event['mozMovementX'];
+                event['movementY'] = event['mozMovementY'];
+              }
+              // workaround for Firefox bug 782777
+              if (event['movementX'] == 0 && event['movementY'] == 0) {
+                // ignore a mousemove event if it doesn't contain any movement info
+                // (without pointer lock, we infer movement from pageX/pageY, so this check is unnecessary)
+                event.preventDefault();
+                return;
+              }
+            }
+            // fall through
+          case 'keydown': case 'keyup': case 'keypress': case 'mousedown': case 'mouseup':
+            // If we preventDefault on keydown events, the subsequent keypress events
+            // won't fire. However, it's fine (and in some cases necessary) to
+            // preventDefault for keys that don't generate a character. Otherwise,
+            // preventDefault is the right thing to do in general.
+            if (event.type !== 'keydown' || (!SDL.unicode && !SDL.textInput) || (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */)) {
+              event.preventDefault();
+            }
+  
+            if (event.type == 'mousedown') {
+              SDL.DOMButtons[event.button] = 1;
+              SDL.events.push({
+                type: 'touchstart',
+                touch: {
+                  identifier: 0,
+                  deviceID: -1,
+                  pageX: event.pageX,
+                  pageY: event.pageY
+                }
+              });
+            } else if (event.type == 'mouseup') {
+              // ignore extra ups, can happen if we leave the canvas while pressing down, then return,
+              // since we add a mouseup in that case
+              if (!SDL.DOMButtons[event.button]) {
+                return;
+              }
+  
+              SDL.events.push({
+                type: 'touchend',
+                touch: {
+                  identifier: 0,
+                  deviceID: -1,
+                  pageX: event.pageX,
+                  pageY: event.pageY
+                }
+              });
+              SDL.DOMButtons[event.button] = 0;
+            }
+  
+            // We can only request fullscreen as the result of user input.
+            // Due to this limitation, we toggle a boolean on keydown which
+            // SDL_WM_ToggleFullScreen will check and subsequently set another
+            // flag indicating for us to request fullscreen on the following
+            // keyup. This isn't perfect, but it enables SDL_WM_ToggleFullScreen
+            // to work as the result of a keypress (which is an extremely
+            // common use case).
+            if (event.type === 'keydown' || event.type === 'mousedown') {
+              SDL.canRequestFullscreen = true;
+            } else if (event.type === 'keyup' || event.type === 'mouseup') {
+              if (SDL.isRequestingFullscreen) {
+                Module['requestFullscreen'](/*lockPointer=*/true, /*resizeCanvas=*/true);
+                SDL.isRequestingFullscreen = false;
+              }
+              SDL.canRequestFullscreen = false;
+            }
+  
+            // SDL expects a unicode character to be passed to its keydown events.
+            // Unfortunately, the browser APIs only provide a charCode property on
+            // keypress events, so we must backfill in keydown events with their
+            // subsequent keypress event's charCode.
+            if (event.type === 'keypress' && SDL.savedKeydown) {
+              // charCode is read-only
+              SDL.savedKeydown.keypressCharCode = event.charCode;
+              SDL.savedKeydown = null;
+            } else if (event.type === 'keydown') {
+              SDL.savedKeydown = event;
+            }
+  
+            // Don't push keypress events unless SDL_StartTextInput has been called.
+            if (event.type !== 'keypress' || SDL.textInput) {
+              SDL.events.push(event);
+            }
+            break;
+          case 'mouseout':
+            // Un-press all pressed mouse buttons, because we might miss the release outside of the canvas
+            for (var i = 0; i < 3; i++) {
+              if (SDL.DOMButtons[i]) {
+                SDL.events.push({
+                  type: 'mouseup',
+                  button: i,
+                  pageX: event.pageX,
+                  pageY: event.pageY
+                });
+                SDL.DOMButtons[i] = 0;
+              }
+            }
+            event.preventDefault();
+            break;
+          case 'focus':
+            SDL.events.push(event);
+            event.preventDefault();
+            break;
+          case 'blur':
+            SDL.events.push(event);
+            unpressAllPressedKeys();
+            event.preventDefault();
+            break;
+          case 'visibilitychange':
+            SDL.events.push({
+              type: 'visibilitychange',
+              visible: !document.hidden
+            });
+            unpressAllPressedKeys();
+            event.preventDefault();
+            break;
+          case 'unload':
+            if (Browser.mainLoop.runner) {
+              SDL.events.push(event);
+              // Force-run a main event loop, since otherwise this event will never be caught!
+              Browser.mainLoop.runner();
+            }
+            return;
+          case 'resize':
+            SDL.events.push(event);
+            // manually triggered resize event doesn't have a preventDefault member
+            if (event.preventDefault) {
+              event.preventDefault();
+            }
+            break;
+        }
+        if (SDL.events.length >= 10000) {
+          err('SDL event queue full, dropping events');
+          SDL.events = SDL.events.slice(0, 10000);
+        }
+        // If we have a handler installed, this will push the events to the app
+        // instead of the app polling for them.
+        SDL.flushEventsToHandler();
+        return;
+      },lookupKeyCodeForEvent:function (event) {
+          var code = event.keyCode;
+          if (code >= 65 && code <= 90) {
+            code += 32; // make lowercase for SDL
+          } else {
+            code = SDL.keyCodes[event.keyCode] || event.keyCode;
+            // If this is one of the modifier keys (224 | 1<<10 - 227 | 1<<10), and the event specifies that it is
+            // a right key, add 4 to get the right key SDL key code.
+            if (event.location === KeyboardEvent.DOM_KEY_LOCATION_RIGHT && code >= (224 | 1<<10) && code <= (227 | 1<<10)) {
+              code += 4;
+            }
+          }
+          return code;
+      },handleEvent:function (event) {
+        if (event.handled) return;
+        event.handled = true;
+  
+        switch (event.type) {
+          case 'touchstart': case 'touchend': case 'touchmove': {
+            Browser.calculateMouseEvent(event);
+            break;
+          }
+          case 'keydown': case 'keyup': {
+            var down = event.type === 'keydown';
+            var code = SDL.lookupKeyCodeForEvent(event);
+            HEAP8[(((SDL.keyboardState)+(code))>>0)]=down;
+            // TODO: lmeta, rmeta, numlock, capslock, KMOD_MODE, KMOD_RESERVED
+            SDL.modState = (HEAP8[(((SDL.keyboardState)+(1248))>>0)] ? 0x0040 : 0) | // KMOD_LCTRL
+              (HEAP8[(((SDL.keyboardState)+(1249))>>0)] ? 0x0001 : 0) | // KMOD_LSHIFT
+              (HEAP8[(((SDL.keyboardState)+(1250))>>0)] ? 0x0100 : 0) | // KMOD_LALT
+              (HEAP8[(((SDL.keyboardState)+(1252))>>0)] ? 0x0080 : 0) | // KMOD_RCTRL
+              (HEAP8[(((SDL.keyboardState)+(1253))>>0)] ? 0x0002 : 0) | // KMOD_RSHIFT
+              (HEAP8[(((SDL.keyboardState)+(1254))>>0)] ? 0x0200 : 0); //  KMOD_RALT
+            if (down) {
+              SDL.keyboardMap[code] = event.keyCode; // save the DOM input, which we can use to unpress it during blur
+            } else {
+              delete SDL.keyboardMap[code];
+            }
+  
+            break;
+          }
+          case 'mousedown': case 'mouseup':
+            if (event.type == 'mousedown') {
+              // SDL_BUTTON(x) is defined as (1 << ((x)-1)).  SDL buttons are 1-3,
+              // and DOM buttons are 0-2, so this means that the below formula is
+              // correct.
+              SDL.buttonState |= 1 << event.button;
+            } else if (event.type == 'mouseup') {
+              SDL.buttonState &= ~(1 << event.button);
+            }
+            // fall through
+          case 'mousemove': {
+            Browser.calculateMouseEvent(event);
+            break;
+          }
+        }
+      },flushEventsToHandler:function () {
+        if (!SDL.eventHandler) return;
+  
+        while (SDL.pollEvent(SDL.eventHandlerTemp)) {
+          Module['dynCall_iii'](SDL.eventHandler, SDL.eventHandlerContext, SDL.eventHandlerTemp);
+        }
+      },pollEvent:function (ptr) {
+        if (SDL.initFlags & 0x200 && SDL.joystickEventState) {
+          // If SDL_INIT_JOYSTICK was supplied AND the joystick system is configured
+          // to automatically query for events, query for joystick events.
+          SDL.queryJoysticks();
+        }
+        if (ptr) {
+          while (SDL.events.length > 0) {
+            if (SDL.makeCEvent(SDL.events.shift(), ptr) !== false) return 1;
+          }
+          return 0;
+        } else {
+          // XXX: somewhat risky in that we do not check if the event is real or not (makeCEvent returns false) if no pointer supplied
+          return SDL.events.length > 0;
+        }
+      },makeCEvent:function (event, ptr) {
+        if (typeof event === 'number') {
+          // This is a pointer to a copy of a native C event that was SDL_PushEvent'ed
+          _memcpy(ptr, event, 28);
+          _free(event); // the copy is no longer needed
+          return;
+        }
+  
+        SDL.handleEvent(event);
+  
+        switch (event.type) {
+          case 'keydown': case 'keyup': {
+            var down = event.type === 'keydown';
+            //out('Received key event: ' + event.keyCode);
+            var key = SDL.lookupKeyCodeForEvent(event);
+            var scan;
+            if (key >= 1024) {
+              scan = key - 1024;
+            } else {
+              scan = SDL.scanCodes[key] || key;
+            }
+  
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP8[(((ptr)+(8))>>0)]=down ? 1 : 0;
+            HEAP8[(((ptr)+(9))>>0)]=0; // TODO
+            HEAP32[(((ptr)+(12))>>2)]=scan;
+            HEAP32[(((ptr)+(16))>>2)]=key;
+            HEAP16[(((ptr)+(20))>>1)]=SDL.modState;
+            // some non-character keys (e.g. backspace and tab) won't have keypressCharCode set, fill in with the keyCode.
+            HEAP32[(((ptr)+(24))>>2)]=event.keypressCharCode || key;
+  
+            break;
+          }
+          case 'keypress': {
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            // Not filling in windowID for now
+            var cStr = intArrayFromString(String.fromCharCode(event.charCode));
+            for (var i = 0; i < cStr.length; ++i) {
+              HEAP8[(((ptr)+(8 + i))>>0)]=cStr[i];
+            }
+            break;
+          }
+          case 'mousedown': case 'mouseup': case 'mousemove': {
+            if (event.type != 'mousemove') {
+              var down = event.type === 'mousedown';
+              HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+              HEAP32[(((ptr)+(4))>>2)]=0;
+              HEAP32[(((ptr)+(8))>>2)]=0;
+              HEAP32[(((ptr)+(12))>>2)]=0;
+              HEAP8[(((ptr)+(16))>>0)]=event.button+1; // DOM buttons are 0-2, SDL 1-3
+              HEAP8[(((ptr)+(17))>>0)]=down ? 1 : 0;
+              HEAP32[(((ptr)+(20))>>2)]=Browser.mouseX;
+              HEAP32[(((ptr)+(24))>>2)]=Browser.mouseY;
+            } else {
+              HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+              HEAP32[(((ptr)+(4))>>2)]=0;
+              HEAP32[(((ptr)+(8))>>2)]=0;
+              HEAP32[(((ptr)+(12))>>2)]=0;
+              HEAP32[(((ptr)+(16))>>2)]=SDL.buttonState;
+              HEAP32[(((ptr)+(20))>>2)]=Browser.mouseX;
+              HEAP32[(((ptr)+(24))>>2)]=Browser.mouseY;
+              HEAP32[(((ptr)+(28))>>2)]=Browser.mouseMovementX;
+              HEAP32[(((ptr)+(32))>>2)]=Browser.mouseMovementY;
+            }
+            break;
+          }
+          case 'wheel': {
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(16))>>2)]=event.deltaX;
+            HEAP32[(((ptr)+(20))>>2)]=event.deltaY;
+            break;
+          }
+          case 'touchstart': case 'touchend': case 'touchmove': {
+            var touch = event.touch;
+            if (!Browser.touches[touch.identifier]) break;
+            var w = Module['canvas'].width;
+            var h = Module['canvas'].height;
+            var x = Browser.touches[touch.identifier].x / w;
+            var y = Browser.touches[touch.identifier].y / h;
+            var lx = Browser.lastTouches[touch.identifier].x / w;
+            var ly = Browser.lastTouches[touch.identifier].y / h;
+            var dx = x - lx;
+            var dy = y - ly;
+            if (touch['deviceID'] === undefined) touch.deviceID = SDL.TOUCH_DEFAULT_ID;
+            if (dx === 0 && dy === 0 && event.type === 'touchmove') return false; // don't send these if nothing happened
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(4))>>2)]=_SDL_GetTicks();
+            (tempI64 = [touch.deviceID>>>0,(tempDouble=touch.deviceID,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((ptr)+(8))>>2)]=tempI64[0],HEAP32[(((ptr)+(12))>>2)]=tempI64[1]);
+            (tempI64 = [touch.identifier>>>0,(tempDouble=touch.identifier,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((ptr)+(16))>>2)]=tempI64[0],HEAP32[(((ptr)+(20))>>2)]=tempI64[1]);
+            HEAPF32[(((ptr)+(24))>>2)]=x;
+            HEAPF32[(((ptr)+(28))>>2)]=y;
+            HEAPF32[(((ptr)+(32))>>2)]=dx;
+            HEAPF32[(((ptr)+(36))>>2)]=dy;
+            if (touch.force !== undefined) {
+              HEAPF32[(((ptr)+(40))>>2)]=touch.force;
+            } else { // No pressure data, send a digital 0/1 pressure.
+              HEAPF32[(((ptr)+(40))>>2)]=event.type == "touchend" ? 0 : 1;
+            }
+            break;
+          }
+          case 'unload': {
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            break;
+          }
+          case 'resize': {
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(4))>>2)]=event.w;
+            HEAP32[(((ptr)+(8))>>2)]=event.h;
+            break;
+          }
+          case 'joystick_button_up': case 'joystick_button_down': {
+            var state = event.type === 'joystick_button_up' ? 0 : 1;
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP8[(((ptr)+(4))>>0)]=event.index;
+            HEAP8[(((ptr)+(5))>>0)]=event.button;
+            HEAP8[(((ptr)+(6))>>0)]=state;
+            break;
+          }
+          case 'joystick_axis_motion': {
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP8[(((ptr)+(4))>>0)]=event.index;
+            HEAP8[(((ptr)+(5))>>0)]=event.axis;
+            HEAP32[(((ptr)+(8))>>2)]=SDL.joystickAxisValueConversion(event.value);
+            break;
+          }
+          case 'focus': {
+            var SDL_WINDOWEVENT_FOCUS_GAINED = 12 /* SDL_WINDOWEVENT_FOCUS_GAINED */;
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(4))>>2)]=0;
+            HEAP8[(((ptr)+(8))>>0)]=SDL_WINDOWEVENT_FOCUS_GAINED;
+            break;
+          }
+          case 'blur': {
+            var SDL_WINDOWEVENT_FOCUS_LOST = 13 /* SDL_WINDOWEVENT_FOCUS_LOST */;
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(4))>>2)]=0;
+            HEAP8[(((ptr)+(8))>>0)]=SDL_WINDOWEVENT_FOCUS_LOST;
+            break;
+          }
+          case 'visibilitychange': {
+            var SDL_WINDOWEVENT_SHOWN  = 1 /* SDL_WINDOWEVENT_SHOWN */;
+            var SDL_WINDOWEVENT_HIDDEN = 2 /* SDL_WINDOWEVENT_HIDDEN */;
+            var visibilityEventID = event.visible ? SDL_WINDOWEVENT_SHOWN : SDL_WINDOWEVENT_HIDDEN;
+            HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type];
+            HEAP32[(((ptr)+(4))>>2)]=0;
+            HEAP8[(((ptr)+(8))>>0)]=visibilityEventID;
+            break;
+          }
+          default: throw 'Unhandled SDL event: ' + event.type;
+        }
+      },makeFontString:function (height, fontName) {
+        if (fontName.charAt(0) != "'" && fontName.charAt(0) != '"') {
+          // https://developer.mozilla.org/ru/docs/Web/CSS/font-family
+          // Font family names containing whitespace should be quoted.
+          // BTW, quote all font names is easier than searching spaces
+          fontName = '"' + fontName + '"';
+        }
+        return height + 'px ' + fontName + ', serif';
+      },estimateTextWidth:function (fontData, text) {
+        var h = fontData.size;
+        var fontString = SDL.makeFontString(h, fontData.name);
+        var tempCtx = SDL.ttfContext;
+        tempCtx.save();
+        tempCtx.font = fontString;
+        var ret = tempCtx.measureText(text).width | 0;
+        tempCtx.restore();
+        return ret;
+      },allocateChannels:function (num) { // called from Mix_AllocateChannels and init
+        if (SDL.numChannels && SDL.numChannels >= num && num != 0) return;
+        SDL.numChannels = num;
+        SDL.channels = [];
+        for (var i = 0; i < num; i++) {
+          SDL.channels[i] = {
+            audio: null,
+            volume: 1.0
+          };
+        }
+      },setGetVolume:function (info, volume) {
+        if (!info) return 0;
+        var ret = info.volume * 128; // MIX_MAX_VOLUME
+        if (volume != -1) {
+          info.volume = Math.min(Math.max(volume, 0), 128) / 128;
+          if (info.audio) {
+            try {
+              info.audio.volume = info.volume; // For <audio> element
+              if (info.audio.webAudioGainNode) info.audio.webAudioGainNode['gain']['value'] = info.volume; // For WebAudio playback
+            } catch(e) {
+              err('setGetVolume failed to set audio volume: ' + e);
+            }
+          }
+        }
+        return ret;
+      },setPannerPosition:function (info, x, y, z) {
+        if (!info) return;
+        if (info.audio) {
+          if (info.audio.webAudioPannerNode) {
+            info.audio.webAudioPannerNode['setPosition'](x, y, z);
+          }
+        }
+      },playWebAudio:function (audio) {
+        if (!audio) return;
+        if (audio.webAudioNode) return; // This instance is already playing, don't start again.
+        if (!SDL.webAudioAvailable()) return;
+        try {
+          var webAudio = audio.resource.webAudio;
+          audio.paused = false;
+          if (!webAudio.decodedBuffer) {
+            if (webAudio.onDecodeComplete === undefined) abort("Cannot play back audio object that was not loaded");
+            webAudio.onDecodeComplete.push(function() { if (!audio.paused) SDL.playWebAudio(audio); });
+            return;
+          }
+          audio.webAudioNode = SDL.audioContext['createBufferSource']();
+          audio.webAudioNode['buffer'] = webAudio.decodedBuffer;
+          audio.webAudioNode['loop'] = audio.loop;
+          audio.webAudioNode['onended'] = function() { audio['onended'](); } // For <media> element compatibility, route the onended signal to the instance.
+  
+          audio.webAudioPannerNode = SDL.audioContext['createPanner']();
+          // avoid Chrome bug
+          // If posz = 0, the sound will come from only the right.
+          // By posz = -0.5 (slightly ahead), the sound will come from right and left correctly.
+          audio.webAudioPannerNode["setPosition"](0, 0, -.5);
+          audio.webAudioPannerNode['panningModel'] = 'equalpower';
+  
+          // Add an intermediate gain node to control volume.
+          audio.webAudioGainNode = SDL.audioContext['createGain']();
+          audio.webAudioGainNode['gain']['value'] = audio.volume;
+  
+          audio.webAudioNode['connect'](audio.webAudioPannerNode);
+          audio.webAudioPannerNode['connect'](audio.webAudioGainNode);
+          audio.webAudioGainNode['connect'](SDL.audioContext['destination']);
+  
+          audio.webAudioNode['start'](0, audio.currentPosition);
+          audio.startTime = SDL.audioContext['currentTime'] - audio.currentPosition;
+        } catch(e) {
+          err('playWebAudio failed: ' + e);
+        }
+      },pauseWebAudio:function (audio) {
+        if (!audio) return;
+        if (audio.webAudioNode) {
+          try {
+            // Remember where we left off, so that if/when we resume, we can restart the playback at a proper place.
+            audio.currentPosition = (SDL.audioContext['currentTime'] - audio.startTime) % audio.resource.webAudio.decodedBuffer.duration;
+            // Important: When we reach here, the audio playback is stopped by the user. But when calling .stop() below, the Web Audio
+            // graph will send the onended signal, but we don't want to process that, since pausing should not clear/destroy the audio
+            // channel.
+            audio.webAudioNode['onended'] = undefined;
+            audio.webAudioNode.stop(0); // 0 is a default parameter, but WebKit is confused by it #3861
+            audio.webAudioNode = undefined;
+          } catch(e) {
+            err('pauseWebAudio failed: ' + e);
+          }
+        }
+        audio.paused = true;
+      },openAudioContext:function () {
+        // Initialize Web Audio API if we haven't done so yet. Note: Only initialize Web Audio context ever once on the web page,
+        // since initializing multiple times fails on Chrome saying 'audio resources have been exhausted'.
+        if (!SDL.audioContext) {
+          if (typeof(AudioContext) !== 'undefined') SDL.audioContext = new AudioContext();
+          else if (typeof(webkitAudioContext) !== 'undefined') SDL.audioContext = new webkitAudioContext();
+        }
+      },webAudioAvailable:function () { return !!SDL.audioContext; },fillWebAudioBufferFromHeap:function (heapPtr, sizeSamplesPerChannel, dstAudioBuffer) {
+        // The input audio data is interleaved across the channels, i.e. [L, R, L, R, L, R, ...] and is either 8-bit, 16-bit or float as
+        // supported by the SDL API. The output audio wave data for Web Audio API must be in planar buffers of [-1,1]-normalized Float32 data,
+        // so perform a buffer conversion for the data.
+        var numChannels = SDL.audio.channels;
+        for(var c = 0; c < numChannels; ++c) {
+          var channelData = dstAudioBuffer['getChannelData'](c);
+          if (channelData.length != sizeSamplesPerChannel) {
+            throw 'Web Audio output buffer length mismatch! Destination size: ' + channelData.length + ' samples vs expected ' + sizeSamplesPerChannel + ' samples!';
+          }
+          if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) {
+            for(var j = 0; j < sizeSamplesPerChannel; ++j) {
+              channelData[j] = (HEAP16[(((heapPtr)+((j*numChannels + c)*2))>>1)]) / 0x8000;
+            }
+          } else if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) {
+            for(var j = 0; j < sizeSamplesPerChannel; ++j) {
+              var v = (HEAP8[(((heapPtr)+(j*numChannels + c))>>0)]);
+              channelData[j] = ((v >= 0) ? v-128 : v+128) /128;
+            }
+          } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) {
+            for(var j = 0; j < sizeSamplesPerChannel; ++j) {
+              channelData[j] = (HEAPF32[(((heapPtr)+((j*numChannels + c)*4))>>2)]);
+            }
+          } else {
+            throw 'Invalid SDL audio format ' + SDL.audio.format + '!';
+          }
+        }
+      },debugSurface:function (surfData) {
+        console.log('dumping surface ' + [surfData.surf, surfData.source, surfData.width, surfData.height]);
+        var image = surfData.ctx.getImageData(0, 0, surfData.width, surfData.height);
+        var data = image.data;
+        var num = Math.min(surfData.width, surfData.height);
+        for (var i = 0; i < num; i++) {
+          console.log('   diagonal ' + i + ':' + [data[i*surfData.width*4 + i*4 + 0], data[i*surfData.width*4 + i*4 + 1], data[i*surfData.width*4 + i*4 + 2], data[i*surfData.width*4 + i*4 + 3]]);
+        }
+      },joystickEventState:1,lastJoystickState:{},joystickNamePool:{},recordJoystickState:function (joystick, state) {
+        // Standardize button state.
+        var buttons = new Array(state.buttons.length);
+        for (var i = 0; i < state.buttons.length; i++) {
+          buttons[i] = SDL.getJoystickButtonState(state.buttons[i]);
+        }
+  
+        SDL.lastJoystickState[joystick] = {
+          buttons: buttons,
+          axes: state.axes.slice(0),
+          timestamp: state.timestamp,
+          index: state.index,
+          id: state.id
+        };
+      },getJoystickButtonState:function (button) {
+        if (typeof button === 'object') {
+          // Current gamepad API editor's draft (Firefox Nightly)
+          // https://dvcs.w3.org/hg/gamepad/raw-file/default/gamepad.html#idl-def-GamepadButton
+          return button['pressed'];
+        } else {
+          // Current gamepad API working draft (Firefox / Chrome Stable)
+          // http://www.w3.org/TR/2012/WD-gamepad-20120529/#gamepad-interface
+          return button > 0;
+        }
+      },queryJoysticks:function () {
+        for (var joystick in SDL.lastJoystickState) {
+          var state = SDL.getGamepad(joystick - 1);
+          var prevState = SDL.lastJoystickState[joystick];
+          // If joystick was removed, state returns null.
+          if (typeof state === 'undefined') return;
+          if (state === null) return;
+          // Check only if the timestamp has differed.
+          // NOTE: Timestamp is not available in Firefox.
+          // NOTE: Timestamp is currently not properly set for the GearVR controller
+          //       on Samsung Internet: it is always zero.
+          if (typeof state.timestamp !== 'number' || state.timestamp !== prevState.timestamp || !state.timestamp) {
+            var i;
+            for (i = 0; i < state.buttons.length; i++) {
+              var buttonState = SDL.getJoystickButtonState(state.buttons[i]);
+              // NOTE: The previous state already has a boolean representation of
+              //       its button, so no need to standardize its button state here.
+              if (buttonState !== prevState.buttons[i]) {
+                // Insert button-press event.
+                SDL.events.push({
+                  type: buttonState ? 'joystick_button_down' : 'joystick_button_up',
+                  joystick: joystick,
+                  index: joystick - 1,
+                  button: i
+                });
+              }
+            }
+            for (i = 0; i < state.axes.length; i++) {
+              if (state.axes[i] !== prevState.axes[i]) {
+                // Insert axes-change event.
+                SDL.events.push({
+                  type: 'joystick_axis_motion',
+                  joystick: joystick,
+                  index: joystick - 1,
+                  axis: i,
+                  value: state.axes[i]
+                });
+              }
+            }
+  
+            SDL.recordJoystickState(joystick, state);
+          }
+        }
+      },joystickAxisValueConversion:function (value) {
+        // Make sure value is properly clamped
+        value = Math.min(1, Math.max(value, -1));
+        // Ensures that 0 is 0, 1 is 32767, and -1 is 32768.
+        return Math.ceil(((value+1) * 32767.5) - 32768);
+      },getGamepads:function () {
+        var fcn = navigator.getGamepads || navigator.webkitGamepads || navigator.mozGamepads || navigator.gamepads || navigator.webkitGetGamepads;
+        if (fcn !== undefined) {
+          // The function must be applied on the navigator object.
+          return fcn.apply(navigator);
+        } else {
+          return [];
+        }
+      },getGamepad:function (deviceIndex) {
+        var gamepads = SDL.getGamepads();
+        if (gamepads.length > deviceIndex && deviceIndex >= 0) {
+          return gamepads[deviceIndex];
+        }
+        return null;
+      }};function _SDL_PauseAudio(pauseOn) {
+      if (!SDL.audio) {
+        return;
+      }
+      if (pauseOn) {
+        if (SDL.audio.timer !== undefined) {
+          clearTimeout(SDL.audio.timer);
+          SDL.audio.numAudioTimersPending = 0;
+          SDL.audio.timer = undefined;
+        }
+      } else if (!SDL.audio.timer) {
+        // Start the audio playback timer callback loop.
+        SDL.audio.numAudioTimersPending = 1;
+        SDL.audio.timer = Browser.safeSetTimeout(SDL.audio.caller, 1);
+      }
+      SDL.audio.paused = pauseOn;
+    }function _SDL_CloseAudio() {
+      if (SDL.audio) {
+        _SDL_PauseAudio(1);
+        _free(SDL.audio.buffer);
+        SDL.audio = null;
+        SDL.allocateChannels(0);
+      }
+    }
+
+  function _SDL_InitSubSystem(flags) { return 0 }
+
+  function _SDL_OpenAudio(desired, obtained) {
+      try {
+        SDL.audio = {
+          freq: HEAPU32[((desired)>>2)],
+          format: HEAPU16[(((desired)+(4))>>1)],
+          channels: HEAPU8[(((desired)+(6))>>0)],
+          samples: HEAPU16[(((desired)+(8))>>1)], // Samples in the CB buffer per single sound channel.
+          callback: HEAPU32[(((desired)+(16))>>2)],
+          userdata: HEAPU32[(((desired)+(20))>>2)],
+          paused: true,
+          timer: null
+        };
+        // The .silence field tells the constant sample value that corresponds to the safe un-skewed silence value for the wave data.
+        if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) {
+          SDL.audio.silence = 128; // Audio ranges in [0, 255], so silence is half-way in between.
+        } else if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) {
+          SDL.audio.silence = 0; // Signed data in range [-32768, 32767], silence is 0.
+        } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) {
+          SDL.audio.silence = 0.0; // Float data in range [-1.0, 1.0], silence is 0.0
+        } else {
+          throw 'Invalid SDL audio format ' + SDL.audio.format + '!';
+        }
+        // Round the desired audio frequency up to the next 'common' frequency value.
+        // Web Audio API spec states 'An implementation must support sample-rates in at least the range 22050 to 96000.'
+        if (SDL.audio.freq <= 0) {
+          throw 'Unsupported sound frequency ' + SDL.audio.freq + '!';
+        } else if (SDL.audio.freq <= 22050) {
+          SDL.audio.freq = 22050; // Take it safe and clamp everything lower than 22kHz to that.
+        } else if (SDL.audio.freq <= 32000) {
+          SDL.audio.freq = 32000;
+        } else if (SDL.audio.freq <= 44100) {
+          SDL.audio.freq = 44100;
+        } else if (SDL.audio.freq <= 48000) {
+          SDL.audio.freq = 48000;
+        } else if (SDL.audio.freq <= 96000) {
+          SDL.audio.freq = 96000;
+        } else {
+          throw 'Unsupported sound frequency ' + SDL.audio.freq + '!';
+        }
+        if (SDL.audio.channels == 0) {
+          SDL.audio.channels = 1; // In SDL both 0 and 1 mean mono.
+        } else if (SDL.audio.channels < 0 || SDL.audio.channels > 32) {
+          throw 'Unsupported number of audio channels for SDL audio: ' + SDL.audio.channels + '!';
+        } else if (SDL.audio.channels != 1 && SDL.audio.channels != 2) { // Unsure what SDL audio spec supports. Web Audio spec supports up to 32 channels.
+          console.log('Warning: Using untested number of audio channels ' + SDL.audio.channels);
+        }
+        if (SDL.audio.samples < 128 || SDL.audio.samples > 524288 /* arbitrary cap */) {
+          throw 'Unsupported audio callback buffer size ' + SDL.audio.samples + '!';
+        } else if ((SDL.audio.samples & (SDL.audio.samples-1)) != 0) {
+          throw 'Audio callback buffer size ' + SDL.audio.samples + ' must be a power-of-two!';
+        }
+  
+        var totalSamples = SDL.audio.samples*SDL.audio.channels;
+        if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) {
+          SDL.audio.bytesPerSample = 1;
+        } else if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) {
+          SDL.audio.bytesPerSample = 2;
+        } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) {
+          SDL.audio.bytesPerSample = 4;
+        } else {
+          throw 'Invalid SDL audio format ' + SDL.audio.format + '!';
+        }
+        SDL.audio.bufferSize = totalSamples*SDL.audio.bytesPerSample;
+        SDL.audio.bufferDurationSecs = SDL.audio.bufferSize / SDL.audio.bytesPerSample / SDL.audio.channels / SDL.audio.freq; // Duration of a single queued buffer in seconds.
+        SDL.audio.bufferingDelay = 50 / 1000; // Audio samples are played with a constant delay of this many seconds to account for browser and jitter.
+        SDL.audio.buffer = _malloc(SDL.audio.bufferSize);
+  
+        // To account for jittering in frametimes, always have multiple audio buffers queued up for the audio output device.
+        // This helps that we won't starve that easily if a frame takes long to complete.
+        SDL.audio.numSimultaneouslyQueuedBuffers = Module['SDL_numSimultaneouslyQueuedBuffers'] || 5;
+  
+        // Pulls and queues new audio data if appropriate. This function gets "over-called" in both requestAnimationFrames and
+        // setTimeouts to ensure that we get the finest granularity possible and as many chances from the browser to fill
+        // new audio data. This is because setTimeouts alone have very poor granularity for audio streaming purposes, but also
+        // the application might not be using emscripten_set_main_loop to drive the main loop, so we cannot rely on that alone.
+        SDL.audio.queueNewAudioData = function SDL_queueNewAudioData() {
+          if (!SDL.audio) return;
+  
+          for(var i = 0; i < SDL.audio.numSimultaneouslyQueuedBuffers; ++i) {
+            // Only queue new data if we don't have enough audio data already in queue. Otherwise skip this time slot
+            // and wait to queue more in the next time the callback is run.
+            var secsUntilNextPlayStart = SDL.audio.nextPlayTime - SDL.audioContext['currentTime'];
+            if (secsUntilNextPlayStart >= SDL.audio.bufferingDelay + SDL.audio.bufferDurationSecs*SDL.audio.numSimultaneouslyQueuedBuffers) return;
+  
+            // Ask SDL audio data from the user code.
+            Module['dynCall_viii'](SDL.audio.callback, SDL.audio.userdata, SDL.audio.buffer, SDL.audio.bufferSize);
+            // And queue it to be played after the currently playing audio stream.
+            SDL.audio.pushAudio(SDL.audio.buffer, SDL.audio.bufferSize);
+          }
+        }
+  
+  
+        // Create a callback function that will be routinely called to ask more audio data from the user application.
+        SDL.audio.caller = function SDL_audioCaller() {
+          if (!SDL.audio) return;
+  
+          --SDL.audio.numAudioTimersPending;
+  
+          SDL.audio.queueNewAudioData();
+  
+          // Queue this callback function to be called again later to pull more audio data.
+          var secsUntilNextPlayStart = SDL.audio.nextPlayTime - SDL.audioContext['currentTime'];
+  
+          // Queue the next audio frame push to be performed half-way when the previously queued buffer has finished playing.
+          var preemptBufferFeedSecs = SDL.audio.bufferDurationSecs/2.0;
+  
+          if (SDL.audio.numAudioTimersPending < SDL.audio.numSimultaneouslyQueuedBuffers) {
+            ++SDL.audio.numAudioTimersPending;
+            SDL.audio.timer = Browser.safeSetTimeout(SDL.audio.caller, Math.max(0.0, 1000.0*(secsUntilNextPlayStart-preemptBufferFeedSecs)));
+  
+            // If we are risking starving, immediately queue an extra buffer.
+            if (SDL.audio.numAudioTimersPending < SDL.audio.numSimultaneouslyQueuedBuffers) {
+              ++SDL.audio.numAudioTimersPending;
+              Browser.safeSetTimeout(SDL.audio.caller, 1.0);
+            }
+          }
+        };
+  
+        SDL.audio.audioOutput = new Audio();
+  
+        // Initialize Web Audio API if we haven't done so yet. Note: Only initialize Web Audio context ever once on the web page,
+        // since initializing multiple times fails on Chrome saying 'audio resources have been exhausted'.
+        SDL.openAudioContext();
+        if (!SDL.audioContext) throw 'Web Audio API is not available!';
+        SDL.audio.nextPlayTime = 0; // Time in seconds when the next audio block is due to start.
+  
+        // The pushAudio function with a new audio buffer whenever there is new audio data to schedule to be played back on the device.
+        SDL.audio.pushAudio=function(ptr,sizeBytes) {
+          try {
+            if (SDL.audio.paused) return;
+  
+            var sizeSamples = sizeBytes / SDL.audio.bytesPerSample; // How many samples fit in the callback buffer?
+            var sizeSamplesPerChannel = sizeSamples / SDL.audio.channels; // How many samples per a single channel fit in the cb buffer?
+            if (sizeSamplesPerChannel != SDL.audio.samples) {
+              throw 'Received mismatching audio buffer size!';
+            }
+            // Allocate new sound buffer to be played.
+            var source = SDL.audioContext['createBufferSource']();
+            var soundBuffer = SDL.audioContext['createBuffer'](SDL.audio.channels,sizeSamplesPerChannel,SDL.audio.freq);
+            source['connect'](SDL.audioContext['destination']);
+  
+            SDL.fillWebAudioBufferFromHeap(ptr, sizeSamplesPerChannel, soundBuffer);
+            // Workaround https://bugzilla.mozilla.org/show_bug.cgi?id=883675 by setting the buffer only after filling. The order is important here!
+            source['buffer'] = soundBuffer;
+  
+            // Schedule the generated sample buffer to be played out at the correct time right after the previously scheduled
+            // sample buffer has finished.
+            var curtime = SDL.audioContext['currentTime'];
+            // Don't ever start buffer playbacks earlier from current time than a given constant 'SDL.audio.bufferingDelay', since a browser
+            // may not be able to mix that audio clip in immediately, and there may be subsequent jitter that might cause the stream to starve.
+            var playtime = Math.max(curtime + SDL.audio.bufferingDelay, SDL.audio.nextPlayTime);
+            if (typeof source['start'] !== 'undefined') {
+              source['start'](playtime); // New Web Audio API: sound sources are started with a .start() call.
+            } else if (typeof source['noteOn'] !== 'undefined') {
+              source['noteOn'](playtime); // Support old Web Audio API specification which had the .noteOn() API.
+            }
+            /*
+            // Uncomment to debug SDL buffer feed starves.
+            if (SDL.audio.curBufferEnd) {
+              var thisBufferStart = Math.round(playtime * SDL.audio.freq);
+              if (thisBufferStart != SDL.audio.curBufferEnd) console.log('SDL starved ' + (thisBufferStart - SDL.audio.curBufferEnd) + ' samples!');
+            }
+            SDL.audio.curBufferEnd = Math.round(playtime * SDL.audio.freq + sizeSamplesPerChannel);
+            */
+  
+            SDL.audio.nextPlayTime = playtime + SDL.audio.bufferDurationSecs;
+          } catch(e) {
+            console.log('Web Audio API error playing back audio: ' + e.toString());
+          }
+        }
+  
+        if (obtained) {
+          // Report back the initialized audio parameters.
+          HEAP32[((obtained)>>2)]=SDL.audio.freq;
+          HEAP16[(((obtained)+(4))>>1)]=SDL.audio.format;
+          HEAP8[(((obtained)+(6))>>0)]=SDL.audio.channels;
+          HEAP8[(((obtained)+(7))>>0)]=SDL.audio.silence;
+          HEAP16[(((obtained)+(8))>>1)]=SDL.audio.samples;
+          HEAP32[(((obtained)+(16))>>2)]=SDL.audio.callback;
+          HEAP32[(((obtained)+(20))>>2)]=SDL.audio.userdata;
+        }
+        SDL.allocateChannels(32);
+  
+      } catch(e) {
+        console.log('Initializing SDL audio threw an exception: "' + e.toString() + '"! Continuing without audio.');
+        SDL.audio = null;
+        SDL.allocateChannels(0);
+        if (obtained) {
+          HEAP32[((obtained)>>2)]=0;
+          HEAP16[(((obtained)+(4))>>1)]=0;
+          HEAP8[(((obtained)+(6))>>0)]=0;
+          HEAP8[(((obtained)+(7))>>0)]=0;
+          HEAP16[(((obtained)+(8))>>1)]=0;
+          HEAP32[(((obtained)+(16))>>2)]=0;
+          HEAP32[(((obtained)+(20))>>2)]=0;
+        }
+      }
+      if (!SDL.audio) {
+        return -1;
+      }
+      return 0;
+    }
+
+
+  function _SDL_QuitSubSystem(flags) {
+      out('SDL_QuitSubSystem called (and ignored)');
+    }
+
+  function ___assert_fail(condition, filename, line, func) {
+      abort('Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function']);
+    }
+
+  function ___lock() {}
+
+  
+  var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+        if (path[0] !== '/') {
+          // relative path
+          var dir;
+          if (dirfd === -100) {
+            dir = FS.cwd();
+          } else {
+            var dirstream = FS.getStream(dirfd);
+            if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+            dir = dirstream.path;
+          }
+          path = PATH.join2(dir, path);
+        }
+        return path;
+      },doStat:function (func, path, buf) {
+        try {
+          var stat = func(path);
+        } catch (e) {
+          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+            // an error occurred while trying to look up the path; we should just report ENOTDIR
+            return -ERRNO_CODES.ENOTDIR;
+          }
+          throw e;
+        }
+        HEAP32[((buf)>>2)]=stat.dev;
+        HEAP32[(((buf)+(4))>>2)]=0;
+        HEAP32[(((buf)+(8))>>2)]=stat.ino;
+        HEAP32[(((buf)+(12))>>2)]=stat.mode;
+        HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+        HEAP32[(((buf)+(20))>>2)]=stat.uid;
+        HEAP32[(((buf)+(24))>>2)]=stat.gid;
+        HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+        HEAP32[(((buf)+(32))>>2)]=0;
+        HEAP32[(((buf)+(36))>>2)]=stat.size;
+        HEAP32[(((buf)+(40))>>2)]=4096;
+        HEAP32[(((buf)+(44))>>2)]=stat.blocks;
+        HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(52))>>2)]=0;
+        HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(60))>>2)]=0;
+        HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(68))>>2)]=0;
+        HEAP32[(((buf)+(72))>>2)]=stat.ino;
+        return 0;
+      },doMsync:function (addr, stream, len, flags) {
+        var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+        FS.msync(stream, buffer, 0, len, flags);
+      },doMkdir:function (path, mode) {
+        // remove a trailing slash, if one - /a/b/ has basename of '', but
+        // we want to create b in the context of this function
+        path = PATH.normalize(path);
+        if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+        FS.mkdir(path, mode, 0);
+        return 0;
+      },doMknod:function (path, mode, dev) {
+        // we don't want this in the JS API as it uses mknod to create all nodes.
+        switch (mode & 61440) {
+          case 32768:
+          case 8192:
+          case 24576:
+          case 4096:
+          case 49152:
+            break;
+          default: return -ERRNO_CODES.EINVAL;
+        }
+        FS.mknod(path, mode, dev);
+        return 0;
+      },doReadlink:function (path, buf, bufsize) {
+        if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+        var ret = FS.readlink(path);
+  
+        var len = Math.min(bufsize, lengthBytesUTF8(ret));
+        var endChar = HEAP8[buf+len];
+        stringToUTF8(ret, buf, bufsize+1);
+        // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+        // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+        HEAP8[buf+len] = endChar;
+  
+        return len;
+      },doAccess:function (path, amode) {
+        if (amode & ~7) {
+          // need a valid mode
+          return -ERRNO_CODES.EINVAL;
+        }
+        var node;
+        var lookup = FS.lookupPath(path, { follow: true });
+        node = lookup.node;
+        var perms = '';
+        if (amode & 4) perms += 'r';
+        if (amode & 2) perms += 'w';
+        if (amode & 1) perms += 'x';
+        if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+          return -ERRNO_CODES.EACCES;
+        }
+        return 0;
+      },doDup:function (path, flags, suggestFD) {
+        var suggest = FS.getStream(suggestFD);
+        if (suggest) FS.close(suggest);
+        return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+      },doReadv:function (stream, iov, iovcnt, offset) {
+        var ret = 0;
+        for (var i = 0; i < iovcnt; i++) {
+          var ptr = HEAP32[(((iov)+(i*8))>>2)];
+          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+          var curr = FS.read(stream, HEAP8,ptr, len, offset);
+          if (curr < 0) return -1;
+          ret += curr;
+          if (curr < len) break; // nothing more to read
+        }
+        return ret;
+      },doWritev:function (stream, iov, iovcnt, offset) {
+        var ret = 0;
+        for (var i = 0; i < iovcnt; i++) {
+          var ptr = HEAP32[(((iov)+(i*8))>>2)];
+          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+          var curr = FS.write(stream, HEAP8,ptr, len, offset);
+          if (curr < 0) return -1;
+          ret += curr;
+        }
+        return ret;
+      },varargs:0,get:function (varargs) {
+        SYSCALLS.varargs += 4;
+        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+        return ret;
+      },getStr:function () {
+        var ret = Pointer_stringify(SYSCALLS.get());
+        return ret;
+      },getStreamFromFD:function () {
+        var stream = FS.getStream(SYSCALLS.get());
+        if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        return stream;
+      },getSocketFromFD:function () {
+        var socket = SOCKFS.getSocket(SYSCALLS.get());
+        if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        return socket;
+      },getSocketAddress:function (allowNull) {
+        var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+        if (allowNull && addrp === 0) return null;
+        var info = __read_sockaddr(addrp, addrlen);
+        if (info.errno) throw new FS.ErrnoError(info.errno);
+        info.addr = DNS.lookup_addr(info.addr) || info.addr;
+        return info;
+      },get64:function () {
+        var low = SYSCALLS.get(), high = SYSCALLS.get();
+        if (low >= 0) assert(high === 0);
+        else assert(high === -1);
+        return low;
+      },getZero:function () {
+        assert(SYSCALLS.get() === 0);
+      }};function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // llseek
+      var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+      // NOTE: offset_high is unused - Emscripten's off_t is 32-bit
+      var offset = offset_low;
+      FS.llseek(stream, offset, whence);
+      HEAP32[((result)>>2)]=stream.position;
+      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+      return 0;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // readv
+      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+      return SYSCALLS.doReadv(stream, iov, iovcnt);
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // writev
+      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+      return SYSCALLS.doWritev(stream, iov, iovcnt);
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // fcntl64
+      var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+      switch (cmd) {
+        case 0: {
+          var arg = SYSCALLS.get();
+          if (arg < 0) {
+            return -ERRNO_CODES.EINVAL;
+          }
+          var newStream;
+          newStream = FS.open(stream.path, stream.flags, 0, arg);
+          return newStream.fd;
+        }
+        case 1:
+        case 2:
+          return 0;  // FD_CLOEXEC makes no sense for a single process.
+        case 3:
+          return stream.flags;
+        case 4: {
+          var arg = SYSCALLS.get();
+          stream.flags |= arg;
+          return 0;
+        }
+        case 12:
+        case 12: {
+          var arg = SYSCALLS.get();
+          var offset = 0;
+          // We're always unlocked.
+          HEAP16[(((arg)+(offset))>>1)]=2;
+          return 0;
+        }
+        case 13:
+        case 14:
+        case 13:
+        case 14:
+          return 0; // Pretend that the locking is successful.
+        case 16:
+        case 8:
+          return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+        case 9:
+          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+          ___setErrNo(ERRNO_CODES.EINVAL);
+          return -1;
+        default: {
+          return -ERRNO_CODES.EINVAL;
+        }
+      }
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // open
+      var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+      var stream = FS.open(pathname, flags, mode);
+      return stream.fd;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // ioctl
+      var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+      switch (op) {
+        case 21509:
+        case 21505: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        case 21510:
+        case 21511:
+        case 21512:
+        case 21506:
+        case 21507:
+        case 21508: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0; // no-op, not actually adjusting terminal settings
+        }
+        case 21519: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          var argp = SYSCALLS.get();
+          HEAP32[((argp)>>2)]=0;
+          return 0;
+        }
+        case 21520: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return -ERRNO_CODES.EINVAL; // not supported
+        }
+        case 21531: {
+          var argp = SYSCALLS.get();
+          return FS.ioctl(stream, op, argp);
+        }
+        case 21523: {
+          // TODO: in theory we should write to the winsize struct that gets
+          // passed in, but for now musl doesn't read anything on it
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        case 21524: {
+          // TODO: technically, this ioctl call should change the window size.
+          // but, since emscripten doesn't have any concept of a terminal window
+          // yet, we'll just silently throw it away as we do TIOCGWINSZ
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        default: abort('bad ioctl syscall ' + op);
+      }
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // close
+      var stream = SYSCALLS.getStreamFromFD();
+      FS.close(stream);
+      return 0;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___unlock() {}
+
+  
+  var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,alpha:false,depth:true,stencil:true,antialias:true,stringCache:{},setErrorCode:function (code) {
+        EGL.errorCode = code;
+      },chooseConfig:function (display, attribList, config, config_size, numConfigs) { 
+        if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
+          EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
+          return 0;
+        }
+  
+        if (attribList) {
+          // read attribList if it is non-null
+          for(;;) {
+            var param = HEAP32[((attribList)>>2)];
+            if (param == 0x3021 /*EGL_ALPHA_SIZE*/) {
+              var alphaSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.alpha = (alphaSize > 0);
+            } else if (param == 0x3025 /*EGL_DEPTH_SIZE*/) {
+              var depthSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.depth = (depthSize > 0);
+            } else if (param == 0x3026 /*EGL_STENCIL_SIZE*/) {
+              var stencilSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.stencil = (stencilSize > 0);
+            } else if (param == 0x3031 /*EGL_SAMPLES*/) {
+              var samples = HEAP32[(((attribList)+(4))>>2)];
+              EGL.antialias = (samples > 0);
+            } else if (param == 0x3032 /*EGL_SAMPLE_BUFFERS*/) {
+              var samples = HEAP32[(((attribList)+(4))>>2)];
+              EGL.antialias = (samples == 1);
+            } else if (param == 0x3038 /*EGL_NONE*/) {
+                break;
+            }
+            attribList += 8;
+          }
+        }
+  
+        if ((!config || !config_size) && !numConfigs) {
+          EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
+          return 0;
+        }
+        if (numConfigs) {
+          HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
+        }
+        if (config && config_size > 0) {
+          HEAP32[((config)>>2)]=62002; 
+        }
+        
+        EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
+        return 1;
+      }};function _eglGetProcAddress(name_) {
+      return _emscripten_GetProcAddress(name_);
+    }
+
+  
+  
+  
+  function _emscripten_get_canvas_element_size(target, width, height) {
+      var canvas = JSEvents.findCanvasEventTarget(target);
+      if (!canvas) return -4;
+      HEAP32[((width)>>2)]=canvas.width;
+      HEAP32[((height)>>2)]=canvas.height;
+    }function __get_canvas_element_size(target) {
+      var stackTop = stackSave();
+      var w = stackAlloc(8);
+      var h = w + 4;
+  
+      var targetInt = stackAlloc(target.id.length+1);
+      stringToUTF8(target.id, targetInt, target.id.length+1);
+      var ret = _emscripten_get_canvas_element_size(targetInt, w, h);
+      var size = [HEAP32[((w)>>2)], HEAP32[((h)>>2)]];
+      stackRestore(stackTop);
+      return size;
+    }
+  
+  
+  function _emscripten_set_canvas_element_size(target, width, height) {
+      var canvas = JSEvents.findCanvasEventTarget(target);
+      if (!canvas) return -4;
+      canvas.width = width;
+      canvas.height = height;
+      return 0;
+    }function __set_canvas_element_size(target, width, height) {
+      if (!target.controlTransferredOffscreen) {
+        target.width = width;
+        target.height = height;
+      } else {
+        // This function is being called from high-level JavaScript code instead of asm.js/Wasm,
+        // and it needs to synchronously proxy over to another thread, so marshal the string onto the heap to do the call.
+        var stackTop = stackSave();
+        var targetInt = stackAlloc(target.id.length+1);
+        stringToUTF8(target.id, targetInt, target.id.length+1);
+        _emscripten_set_canvas_element_size(targetInt, width, height);
+        stackRestore(stackTop);
+      }
+    }var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,_onGamepadConnected:function () { ++JSEvents.numGamepadsConnected; },_onGamepadDisconnected:function () { --JSEvents.numGamepadsConnected; },staticInit:function () {
+        if (typeof window !== 'undefined') {
+          window.addEventListener("gamepadconnected", JSEvents._onGamepadConnected);
+          window.addEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected);
+          
+          // Chromium does not fire the gamepadconnected event on reload, so we need to get the number of gamepads here as a workaround.
+          // See https://bugs.chromium.org/p/chromium/issues/detail?id=502824
+          var firstState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null);
+          if (firstState) {
+            JSEvents.numGamepadsConnected = firstState.length;
+          }
+        }
+      },removeAllEventListeners:function () {
+        for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
+          JSEvents._removeHandler(i);
+        }
+        JSEvents.eventHandlers = [];
+        JSEvents.deferredCalls = [];
+        if (typeof window !== 'undefined') {
+          window.removeEventListener("gamepadconnected", JSEvents._onGamepadConnected);
+          window.removeEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected);
+        }
+      },registerRemoveEventListeners:function () {
+        if (!JSEvents.removeEventListenersRegistered) {
+          __ATEXIT__.push(JSEvents.removeAllEventListeners);
+          JSEvents.removeEventListenersRegistered = true;
+        }
+      },findEventTarget:function (target) {
+        try {
+          // The sensible "default" target varies between events, but use window as the default
+          // since DOM events mostly can default to that. Specific callback registrations
+          // override their own defaults.
+          if (!target) return window;
+          if (typeof target === "number") target = Pointer_stringify(target);
+          if (target === '#window') return window;
+          else if (target === '#document') return document;
+          else if (target === '#screen') return window.screen;
+          else if (target === '#canvas') return Module['canvas'];
+          return (typeof target === 'string') ? document.getElementById(target) : target;
+        } catch(e) {
+          // In Web Workers, some objects above, such as '#document' do not exist. Gracefully
+          // return null for them.
+          return null;
+        }
+      },findCanvasEventTarget:function (target) {
+        if (typeof target === 'number') target = Pointer_stringify(target);
+        if (!target || target === '#canvas') {
+          if (typeof GL !== 'undefined' && GL.offscreenCanvases['canvas']) return GL.offscreenCanvases['canvas']; // TODO: Remove this line, target '#canvas' should refer only to Module['canvas'], not to GL.offscreenCanvases['canvas'] - but need stricter tests to be able to remove this line.
+          return Module['canvas'];
+        }
+        if (typeof GL !== 'undefined' && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target];
+        return JSEvents.findEventTarget(target);
+      },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
+        function arraysHaveEqualContent(arrA, arrB) {
+          if (arrA.length != arrB.length) return false;
+  
+          for(var i in arrA) {
+            if (arrA[i] != arrB[i]) return false;
+          }
+          return true;
+        }
+        // Test if the given call was already queued, and if so, don't add it again.
+        for(var i in JSEvents.deferredCalls) {
+          var call = JSEvents.deferredCalls[i];
+          if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+            return;
+          }
+        }
+        JSEvents.deferredCalls.push({
+          targetFunction: targetFunction,
+          precedence: precedence,
+          argsList: argsList
+        });
+  
+        JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
+      },removeDeferredCalls:function (targetFunction) {
+        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+          if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
+            JSEvents.deferredCalls.splice(i, 1);
+            --i;
+          }
+        }
+      },canPerformEventHandlerRequests:function () {
+        return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+      },runDeferredCalls:function () {
+        if (!JSEvents.canPerformEventHandlerRequests()) {
+          return;
+        }
+        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+          var call = JSEvents.deferredCalls[i];
+          JSEvents.deferredCalls.splice(i, 1);
+          --i;
+          call.targetFunction.apply(this, call.argsList);
+        }
+      },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
+        for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+          if (JSEvents.eventHandlers[i].target == target && 
+            (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+             JSEvents._removeHandler(i--);
+           }
+        }
+      },_removeHandler:function (i) {
+        var h = JSEvents.eventHandlers[i];
+        h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+        JSEvents.eventHandlers.splice(i, 1);
+      },registerOrRemoveHandler:function (eventHandler) {
+        var jsEventHandler = function jsEventHandler(event) {
+          // Increment nesting count for the event handler.
+          ++JSEvents.inEventHandler;
+          JSEvents.currentEventHandler = eventHandler;
+          // Process any old deferred calls the user has placed.
+          JSEvents.runDeferredCalls();
+          // Process the actual event, calls back to user C code handler.
+          eventHandler.handlerFunc(event);
+          // Process any new deferred calls that were placed right now from this event handler.
+          JSEvents.runDeferredCalls();
+          // Out of event handler - restore nesting count.
+          --JSEvents.inEventHandler;
+        }
+        
+        if (eventHandler.callbackfunc) {
+          eventHandler.eventListenerFunc = jsEventHandler;
+          eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
+          JSEvents.eventHandlers.push(eventHandler);
+          JSEvents.registerRemoveEventListeners();
+        } else {
+          for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+            if (JSEvents.eventHandlers[i].target == eventHandler.target
+             && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+               JSEvents._removeHandler(i--);
+             }
+          }
+        }
+      },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 164 );
+  
+        var keyEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var keyEventData = JSEvents.keyEvent;
+          stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32);
+          stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32);
+          HEAP32[(((keyEventData)+(64))>>2)]=e.location;
+          HEAP32[(((keyEventData)+(68))>>2)]=e.ctrlKey;
+          HEAP32[(((keyEventData)+(72))>>2)]=e.shiftKey;
+          HEAP32[(((keyEventData)+(76))>>2)]=e.altKey;
+          HEAP32[(((keyEventData)+(80))>>2)]=e.metaKey;
+          HEAP32[(((keyEventData)+(84))>>2)]=e.repeat;
+          stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32);
+          stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32);
+          HEAP32[(((keyEventData)+(152))>>2)]=e.charCode;
+          HEAP32[(((keyEventData)+(156))>>2)]=e.keyCode;
+          HEAP32[(((keyEventData)+(160))>>2)]=e.which;
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: keyEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },getBoundingClientRectOrZeros:function (target) {
+        return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
+      },fillMouseEventData:function (eventStruct, e, target) {
+        HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+        HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
+        HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
+        HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
+        HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
+        HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
+        HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
+        HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
+        HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
+        HEAP16[(((eventStruct)+(40))>>1)]=e.button;
+        HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
+        HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
+        HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
+  
+        if (Module['canvas']) {
+          var rect = Module['canvas'].getBoundingClientRect();
+          HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
+          HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
+        } else { // Canvas is not initialized, return 0.
+          HEAP32[(((eventStruct)+(60))>>2)]=0;
+          HEAP32[(((eventStruct)+(64))>>2)]=0;
+        }
+        if (target) {
+          var rect = JSEvents.getBoundingClientRectOrZeros(target);
+          HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
+          HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
+        } else { // No specific target passed, return 0.
+          HEAP32[(((eventStruct)+(52))>>2)]=0;
+          HEAP32[(((eventStruct)+(56))>>2)]=0;
+        }
+        // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
+        // https://github.com/kripken/emscripten/pull/4997
+        // https://bugs.chromium.org/p/chromium/issues/detail?id=699956
+        if (e.type !== 'wheel' && e.type !== 'mousewheel') {
+          JSEvents.previousScreenX = e.screenX;
+          JSEvents.previousScreenY = e.screenY;
+        }
+      },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 72 );
+        target = JSEvents.findEventTarget(target);
+  
+        var mouseEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          // TODO: Make this access thread safe, or this could update live while app is reading it.
+          JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: mouseEventHandlerFunc,
+          useCapture: useCapture
+        };
+        // In IE, mousedown events don't either allow deferred calls to be run!
+        if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc( 104 );
+        target = JSEvents.findEventTarget(target);
+  
+  
+        // The DOM Level 3 events spec event 'wheel'
+        var wheelHandlerFunc = function(event) {
+          var e = event || window.event;
+          var wheelEvent = JSEvents.wheelEvent;
+          JSEvents.fillMouseEventData(wheelEvent, e, target);
+          HEAPF64[(((wheelEvent)+(72))>>3)]=e["deltaX"];
+          HEAPF64[(((wheelEvent)+(80))>>3)]=e["deltaY"];
+          HEAPF64[(((wheelEvent)+(88))>>3)]=e["deltaZ"];
+          HEAP32[(((wheelEvent)+(96))>>2)]=e["deltaMode"];
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault();
+        };
+        // The 'mousewheel' event as implemented in Safari 6.0.5
+        var mouseWheelHandlerFunc = function(event) {
+          var e = event || window.event;
+          JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
+          HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0;
+          HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */;
+          HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
+          HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
+          var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
+          if (shouldCancel) {
+            e.preventDefault();
+          }
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: true,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },pageScrollPos:function () {
+        if (window.pageXOffset > 0 || window.pageYOffset > 0) {
+          return [window.pageXOffset, window.pageYOffset];
+        }
+        if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
+          return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
+        }
+        return [document.body.scrollLeft|0, document.body.scrollTop|0];
+      },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc( 36 );
+  
+        if (eventTypeString == "scroll" && !target) {
+          target = document; // By default read scroll events on document rather than window.
+        } else {
+          target = JSEvents.findEventTarget(target);
+        }
+  
+        var uiEventHandlerFunc = function(event) {
+          var e = event || window.event;
+          if (e.target != target) {
+            // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
+            // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
+            // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
+            // causing a new scroll, etc..
+            return;
+          }
+          var scrollPos = JSEvents.pageScrollPos();
+  
+          var uiEvent = JSEvents.uiEvent;
+          HEAP32[((uiEvent)>>2)]=e.detail;
+          HEAP32[(((uiEvent)+(4))>>2)]=document.body.clientWidth;
+          HEAP32[(((uiEvent)+(8))>>2)]=document.body.clientHeight;
+          HEAP32[(((uiEvent)+(12))>>2)]=window.innerWidth;
+          HEAP32[(((uiEvent)+(16))>>2)]=window.innerHeight;
+          HEAP32[(((uiEvent)+(20))>>2)]=window.outerWidth;
+          HEAP32[(((uiEvent)+(24))>>2)]=window.outerHeight;
+          HEAP32[(((uiEvent)+(28))>>2)]=scrollPos[0];
+          HEAP32[(((uiEvent)+(32))>>2)]=scrollPos[1];
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: uiEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },getNodeNameForTarget:function (target) {
+        if (!target) return '';
+        if (target == window) return '#window';
+        if (target == window.screen) return '#screen';
+        return (target && target.nodeName) ? target.nodeName : '';
+      },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc( 256 );
+  
+        var focusEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var nodeName = JSEvents.getNodeNameForTarget(e.target);
+          var id = e.target.id ? e.target.id : '';
+  
+          var focusEvent = JSEvents.focusEvent;
+          stringToUTF8(nodeName, focusEvent + 0, 128);
+          stringToUTF8(id, focusEvent + 128, 128);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: focusEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },tick:function () {
+        if (window['performance'] && window['performance']['now']) return window['performance']['now']();
+        else return Date.now();
+      },fillDeviceOrientationEventData:function (eventStruct, e, target) {
+        HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+        HEAPF64[(((eventStruct)+(8))>>3)]=e.alpha;
+        HEAPF64[(((eventStruct)+(16))>>3)]=e.beta;
+        HEAPF64[(((eventStruct)+(24))>>3)]=e.gamma;
+        HEAP32[(((eventStruct)+(32))>>2)]=e.absolute;
+      },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc( 40 );
+  
+        var deviceOrientationEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_deviceorientation_status()
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: deviceOrientationEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },fillDeviceMotionEventData:function (eventStruct, e, target) {
+        HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+        HEAPF64[(((eventStruct)+(8))>>3)]=e.acceleration.x;
+        HEAPF64[(((eventStruct)+(16))>>3)]=e.acceleration.y;
+        HEAPF64[(((eventStruct)+(24))>>3)]=e.acceleration.z;
+        HEAPF64[(((eventStruct)+(32))>>3)]=e.accelerationIncludingGravity.x;
+        HEAPF64[(((eventStruct)+(40))>>3)]=e.accelerationIncludingGravity.y;
+        HEAPF64[(((eventStruct)+(48))>>3)]=e.accelerationIncludingGravity.z;
+        HEAPF64[(((eventStruct)+(56))>>3)]=e.rotationRate.alpha;
+        HEAPF64[(((eventStruct)+(64))>>3)]=e.rotationRate.beta;
+        HEAPF64[(((eventStruct)+(72))>>3)]=e.rotationRate.gamma;
+      },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc( 80 );
+  
+        var deviceMotionEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_devicemotion_status()
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: deviceMotionEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },screenOrientation:function () {
+        if (!window.screen) return undefined;
+        return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
+      },fillOrientationChangeEventData:function (eventStruct, e) {
+        var orientations  = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
+        var orientations2 = ["portrait",         "portrait",           "landscape",         "landscape"];
+  
+        var orientationString = JSEvents.screenOrientation();
+        var orientation = orientations.indexOf(orientationString);
+        if (orientation == -1) {
+          orientation = orientations2.indexOf(orientationString);
+        }
+  
+        HEAP32[((eventStruct)>>2)]=1 << orientation;
+        HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
+      },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc( 8 );
+  
+        if (!target) {
+          target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
+        } else {
+          target = JSEvents.findEventTarget(target);
+        }
+  
+        var orientationChangeEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var orientationChangeEvent = JSEvents.orientationChangeEvent;
+  
+          JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault();
+        };
+  
+        if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
+          eventTypeString = "mozorientationchange";
+        }
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: orientationChangeEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },fullscreenEnabled:function () {
+        return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
+      },fillFullscreenChangeEventData:function (eventStruct, e) {
+        var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
+        var isFullscreen = !!fullscreenElement;
+        HEAP32[((eventStruct)>>2)]=isFullscreen;
+        HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
+        // If transitioning to fullscreen, report info about the element that is now fullscreen.
+        // If transitioning to windowed mode, report info about the element that just was fullscreen.
+        var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
+        var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
+        var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
+        stringToUTF8(nodeName, eventStruct + 8, 128);
+        stringToUTF8(id, eventStruct + 136, 128);
+        HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
+        HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
+        HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
+        HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
+        if (isFullscreen) {
+          JSEvents.previousFullscreenElement = fullscreenElement;
+        }
+      },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 );
+  
+        if (!target) target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
+        else target = JSEvents.findEventTarget(target);
+  
+        var fullscreenChangeEventhandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent;
+  
+          JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: fullscreenChangeEventhandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },resizeCanvasForFullscreen:function (target, strategy) {
+        var restoreOldStyle = __registerRestoreOldStyle(target);
+        var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
+        var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
+        var rect = target.getBoundingClientRect();
+        var windowedCssWidth = rect.right - rect.left;
+        var windowedCssHeight = rect.bottom - rect.top;
+        var canvasSize = __get_canvas_element_size(target);
+        var windowedRttWidth = canvasSize[0];
+        var windowedRttHeight = canvasSize[1];
+  
+        if (strategy.scaleMode == 3) {
+          __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
+          cssWidth = windowedCssWidth;
+          cssHeight = windowedCssHeight;
+        } else if (strategy.scaleMode == 2) {
+          if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
+            var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
+            __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
+            cssHeight = desiredCssHeight;
+          } else {
+            var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
+            __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
+            cssWidth = desiredCssWidth;
+          }
+        }
+  
+        // If we are adding padding, must choose a background color or otherwise Chrome will give the
+        // padding a default white color. Do it only if user has not customized their own background color.
+        if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
+        // IE11 does the same, but requires the color to be set in the document body.
+        if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
+        // Firefox always shows black letterboxes independent of style color.
+  
+        target.style.width = cssWidth + 'px';
+        target.style.height = cssHeight + 'px';
+  
+        if (strategy.filteringMode == 1) {
+          target.style.imageRendering = 'optimizeSpeed';
+          target.style.imageRendering = '-moz-crisp-edges';
+          target.style.imageRendering = '-o-crisp-edges';
+          target.style.imageRendering = '-webkit-optimize-contrast';
+          target.style.imageRendering = 'optimize-contrast';
+          target.style.imageRendering = 'crisp-edges';
+          target.style.imageRendering = 'pixelated';
+        }
+  
+        var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
+        if (strategy.canvasResolutionScaleMode != 0) {
+          var newWidth = (cssWidth * dpiScale)|0;
+          var newHeight = (cssHeight * dpiScale)|0;
+          __set_canvas_element_size(target, newWidth, newHeight);
+          if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight);
+        }
+        return restoreOldStyle;
+      },requestFullscreen:function (target, strategy) {
+        // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
+        if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
+          JSEvents.resizeCanvasForFullscreen(target, strategy);
+        }
+  
+        if (target.requestFullscreen) {
+          target.requestFullscreen();
+        } else if (target.msRequestFullscreen) {
+          target.msRequestFullscreen();
+        } else if (target.mozRequestFullScreen) {
+          target.mozRequestFullScreen();
+        } else if (target.mozRequestFullscreen) {
+          target.mozRequestFullscreen();
+        } else if (target.webkitRequestFullscreen) {
+          target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
+        } else {
+          if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
+            return -1;
+          } else {
+            return -3;
+          }
+        }
+  
+        if (strategy.canvasResizedCallback) {
+          Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
+        }
+  
+        return 0;
+      },fillPointerlockChangeEventData:function (eventStruct, e) {
+        var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
+        var isPointerlocked = !!pointerLockElement;
+        HEAP32[((eventStruct)>>2)]=isPointerlocked;
+        var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
+        var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
+        stringToUTF8(nodeName, eventStruct + 4, 128);
+        stringToUTF8(id, eventStruct + 132, 128);
+      },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc( 260 );
+  
+        if (!target) target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
+        else target = JSEvents.findEventTarget(target);
+  
+        var pointerlockChangeEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent;
+          JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: pointerlockChangeEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+        if (!target) target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window'
+        else target = JSEvents.findEventTarget(target);
+  
+        var pointerlockErrorEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: pointerlockErrorEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },requestPointerLock:function (target) {
+        if (target.requestPointerLock) {
+          target.requestPointerLock();
+        } else if (target.mozRequestPointerLock) {
+          target.mozRequestPointerLock();
+        } else if (target.webkitRequestPointerLock) {
+          target.webkitRequestPointerLock();
+        } else if (target.msRequestPointerLock) {
+          target.msRequestPointerLock();
+        } else {
+          // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
+          // or if the whole browser just doesn't support the feature.
+          if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
+            return -3;
+          } else {
+            return -1;
+          }
+        }
+        return 0;
+      },fillVisibilityChangeEventData:function (eventStruct, e) {
+        var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
+        var visibilityState = visibilityStates.indexOf(document.visibilityState);
+  
+        HEAP32[((eventStruct)>>2)]=document.hidden;
+        HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
+      },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc( 8 );
+  
+        if (!target) target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
+        else target = JSEvents.findEventTarget(target);
+  
+        var visibilityChangeEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var visibilityChangeEvent = JSEvents.visibilityChangeEvent;
+  
+          JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: visibilityChangeEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1684 );
+  
+        target = JSEvents.findEventTarget(target);
+  
+        var touchEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var touches = {};
+          for(var i = 0; i < e.touches.length; ++i) {
+            var touch = e.touches[i];
+            touches[touch.identifier] = touch;
+          }
+          for(var i = 0; i < e.changedTouches.length; ++i) {
+            var touch = e.changedTouches[i];
+            touches[touch.identifier] = touch;
+            touch.changed = true;
+          }
+          for(var i = 0; i < e.targetTouches.length; ++i) {
+            var touch = e.targetTouches[i];
+            touches[touch.identifier].onTarget = true;
+          }
+  
+          var touchEvent = JSEvents.touchEvent;
+          var ptr = touchEvent;
+          HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
+          HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
+          HEAP32[(((ptr)+(12))>>2)]=e.altKey;
+          HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
+          ptr += 20; // Advance to the start of the touch array.
+          var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
+          var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
+          var numTouches = 0;
+          for(var i in touches) {
+            var t = touches[i];
+            HEAP32[((ptr)>>2)]=t.identifier;
+            HEAP32[(((ptr)+(4))>>2)]=t.screenX;
+            HEAP32[(((ptr)+(8))>>2)]=t.screenY;
+            HEAP32[(((ptr)+(12))>>2)]=t.clientX;
+            HEAP32[(((ptr)+(16))>>2)]=t.clientY;
+            HEAP32[(((ptr)+(20))>>2)]=t.pageX;
+            HEAP32[(((ptr)+(24))>>2)]=t.pageY;
+            HEAP32[(((ptr)+(28))>>2)]=t.changed;
+            HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
+            if (canvasRect) {
+              HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
+              HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
+            } else {
+              HEAP32[(((ptr)+(44))>>2)]=0;
+              HEAP32[(((ptr)+(48))>>2)]=0;            
+            }
+            HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
+            HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
+            
+            ptr += 52;
+  
+            if (++numTouches >= 32) {
+              break;
+            }
+          }
+          HEAP32[((touchEvent)>>2)]=numTouches;
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: target,
+          allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend',
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: touchEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },fillGamepadEventData:function (eventStruct, e) {
+        HEAPF64[((eventStruct)>>3)]=e.timestamp;
+        for(var i = 0; i < e.axes.length; ++i) {
+          HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
+        }
+        for(var i = 0; i < e.buttons.length; ++i) {
+          if (typeof(e.buttons[i]) === 'object') {
+            HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
+          } else {
+            HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
+          }
+        }
+        for(var i = 0; i < e.buttons.length; ++i) {
+          if (typeof(e.buttons[i]) === 'object') {
+            HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
+          } else {
+            HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
+          }
+        }
+        HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
+        HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
+        HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
+        HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
+        stringToUTF8(e.id, eventStruct + 1304, 64);
+        stringToUTF8(e.mapping, eventStruct + 1368, 64);
+      },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 );
+  
+        var gamepadEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var gamepadEvent = JSEvents.gamepadEvent;
+          JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad);
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: true,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: gamepadEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+        var beforeUnloadEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          // Note: This is always called on the main browser thread, since it needs synchronously return a value!
+          var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
+          
+          if (confirmationMessage) {
+            confirmationMessage = Pointer_stringify(confirmationMessage);
+          }
+          if (confirmationMessage) {
+            e.preventDefault();
+            e.returnValue = confirmationMessage;
+            return confirmationMessage;
+          }
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: beforeUnloadEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
+        HEAPF64[((eventStruct)>>3)]=e.chargingTime;
+        HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
+        HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
+        HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
+      },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc( 32 );
+  
+        var batteryEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          var batteryEvent = JSEvents.batteryEvent;
+          JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery());
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: batteryEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+        if (!target) target = Module['canvas'];
+  
+        var webGlEventHandlerFunc = function(event) {
+          var e = event || window.event;
+  
+          if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault();
+        };
+  
+        var eventHandler = {
+          target: JSEvents.findEventTarget(target),
+          allowsDeferredCalls: false,
+          eventTypeString: eventTypeString,
+          callbackfunc: callbackfunc,
+          handlerFunc: webGlEventHandlerFunc,
+          useCapture: useCapture
+        };
+        JSEvents.registerOrRemoveHandler(eventHandler);
+      }};function _emscripten_exit_pointerlock() {
+      // Make sure no queued up calls will fire after this.
+      JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
+  
+      if (document.exitPointerLock) {
+        document.exitPointerLock();
+      } else if (document.msExitPointerLock) {
+        document.msExitPointerLock();
+      } else if (document.mozExitPointerLock) {
+        document.mozExitPointerLock();
+      } else if (document.webkitExitPointerLock) {
+        document.webkitExitPointerLock();
+      } else {
+        return -1;
+      }
+      return 0;
+    }
+
+  
+  function __emscripten_sample_gamepad_data() {
+      // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
+      if (!JSEvents.numGamepadsConnected) return;
+  
+      // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
+      if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
+        JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
+        JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
+      }
+    }function _emscripten_get_gamepad_status(index, gamepadState) {
+      __emscripten_sample_gamepad_data();
+      if (!JSEvents.lastGamepadState) return -1;
+  
+      // INVALID_PARAM is returned on a Gamepad index that never was there.
+      if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
+  
+      // NO_DATA is returned on a Gamepad index that was removed.
+      // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
+      // This is because gamepads must keep their original position in the array.
+      // For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
+      if (!JSEvents.lastGamepadState[index]) return -7;
+  
+      JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
+      return 0;
+    }
+
+  function _emscripten_get_num_gamepads() {
+      // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
+      if (!JSEvents.numGamepadsConnected) return 0;
+  
+      __emscripten_sample_gamepad_data();
+      if (!JSEvents.lastGamepadState) return -1;
+      return JSEvents.lastGamepadState.length;
+    }
+
+  function _emscripten_get_pointerlock_status(pointerlockStatus) {
+      if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus);
+      if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
+        return -1;
+      }
+      return 0;
+    }
+
+  function _emscripten_glAccum() {
+  err('missing function: emscripten_glAccum'); abort(-1);
+  }
+
+  
+  var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:{},currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
+        GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
+        for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
+          GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
+        }
+  
+        // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
+        // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
+        for (var i = 0; i < 32; i++) {
+          GL.tempFixedLengthArray.push(new Array(i));
+        }
+      },recordError:function recordError(errorCode) {
+        if (!GL.lastError) {
+          GL.lastError = errorCode;
+        }
+      },getNewId:function (table) {
+        var ret = GL.counter++;
+        for (var i = table.length; i < ret; i++) {
+          table[i] = null;
+        }
+        return ret;
+      },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
+        var source = '';
+        for (var i = 0; i < count; ++i) {
+          var frag;
+          if (length) {
+            var len = HEAP32[(((length)+(i*4))>>2)];
+            if (len < 0) {
+              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+            } else {
+              frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
+            }
+          } else {
+            frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+          }
+          source += frag;
+        }
+        return source;
+      },createContext:function (canvas, webGLContextAttributes) {
+        if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
+          webGLContextAttributes['majorVersion'] = 1;
+          webGLContextAttributes['minorVersion'] = 0;
+        }
+  
+  
+  
+        var ctx;
+        var errorInfo = '?';
+        function onContextCreationError(event) {
+          errorInfo = event.statusMessage || errorInfo;
+        }
+        try {
+          canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
+          try {
+            if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
+              ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
+            } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
+              ctx = canvas.getContext("webgl2", webGLContextAttributes);
+            } else {
+              throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
+            }
+          } finally {
+            canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
+          }
+          if (!ctx) throw ':(';
+        } catch (e) {
+          return 0;
+        }
+  
+        if (!ctx) return 0;
+        var context = GL.registerContext(ctx, webGLContextAttributes);
+        return context;
+      },registerContext:function (ctx, webGLContextAttributes) {
+        var handle = _malloc(8); // Make space on the heap to store GL context attributes that need to be accessible as shared between threads.
+        HEAP32[((handle)>>2)]=webGLContextAttributes["explicitSwapControl"]; // explicitSwapControl
+        var context = {
+          handle: handle,
+          attributes: webGLContextAttributes,
+          version: webGLContextAttributes['majorVersion'],
+          GLctx: ctx
+        };
+  
+  
+  
+        // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
+        if (ctx.canvas) ctx.canvas.GLctxObject = context;
+        GL.contexts[handle] = context;
+        if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
+          GL.initExtensions(context);
+        }
+  
+  
+  
+  
+        return handle;
+      },makeContextCurrent:function (contextHandle) {
+        // Deactivating current context?
+        if (!contextHandle) {
+          GLctx = Module.ctx = GL.currentContext = null;
+          return true;
+        }
+        var context = GL.contexts[contextHandle];
+        if (!context) {
+          return false;
+        }
+        GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
+        GL.currentContext = context; // Active Emscripten GL layer context object.
+        return true;
+      },getContext:function (contextHandle) {
+        return GL.contexts[contextHandle];
+      },deleteContext:function (contextHandle) {
+        if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+        if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
+        if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
+        _free(GL.contexts[contextHandle]);
+        GL.contexts[contextHandle] = null;
+      },initExtensions:function (context) {
+        // If this function is called without a specific context object, init the extensions of the currently active context.
+        if (!context) context = GL.currentContext;
+  
+        if (context.initExtensionsDone) return;
+        context.initExtensionsDone = true;
+  
+        var GLctx = context.GLctx;
+  
+        // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
+  
+        if (context.version < 2) {
+          // Extension available from Firefox 26 and Google Chrome 30
+          var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
+          if (instancedArraysExt) {
+            GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
+            GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
+            GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
+          }
+  
+          // Extension available from Firefox 25 and WebKit
+          var vaoExt = GLctx.getExtension('OES_vertex_array_object');
+          if (vaoExt) {
+            GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
+            GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
+            GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
+            GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
+          }
+  
+          var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
+          if (drawBuffersExt) {
+            GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
+          }
+        }
+  
+        GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+  
+        // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
+        // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
+        // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
+        // here, as long as they don't produce a performance impact for users that might not be using those extensions.
+        // E.g. debugging-related extensions should probably be off by default.
+        var automaticallyEnabledExtensions = [ // Khronos ratified WebGL extensions ordered by number (no debug extensions):
+                                               "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
+                                               "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
+                                               "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth",
+                                               "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear",
+                                               "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod",
+                                               // Community approved WebGL extensions ordered by number:
+                                               "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
+                                               "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query",
+                                               "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float",
+                                               "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2"];
+  
+        function shouldEnableAutomatically(extension) {
+          var ret = false;
+          automaticallyEnabledExtensions.forEach(function(include) {
+            if (extension.indexOf(include) != -1) {
+              ret = true;
+            }
+          });
+          return ret;
+        }
+  
+        var exts = GLctx.getSupportedExtensions();
+        if (exts && exts.length > 0) {
+          GLctx.getSupportedExtensions().forEach(function(ext) {
+            if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
+              GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
+            }
+          });
+        }
+      },populateUniformTable:function (program) {
+        var p = GL.programs[program];
+        GL.programInfos[program] = {
+          uniforms: {},
+          maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
+          maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
+          maxUniformBlockNameLength: -1 // Lazily computed as well
+        };
+  
+        var ptable = GL.programInfos[program];
+        var utable = ptable.uniforms;
+        // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
+        // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
+        var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
+        for (var i = 0; i < numUniforms; ++i) {
+          var u = GLctx.getActiveUniform(p, i);
+  
+          var name = u.name;
+          ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
+  
+          // Strip off any trailing array specifier we might have got, e.g. "[0]".
+          if (name.indexOf(']', name.length-1) !== -1) {
+            var ls = name.lastIndexOf('[');
+            name = name.slice(0, ls);
+          }
+  
+          // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
+          // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
+          // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
+          var loc = GLctx.getUniformLocation(p, name);
+          if (loc != null)
+          {
+            var id = GL.getNewId(GL.uniforms);
+            utable[name] = [u.size, id];
+            GL.uniforms[id] = loc;
+  
+            for (var j = 1; j < u.size; ++j) {
+              var n = name + '['+j+']';
+              loc = GLctx.getUniformLocation(p, n);
+              id = GL.getNewId(GL.uniforms);
+  
+              GL.uniforms[id] = loc;
+            }
+          }
+        }
+      }};function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+  function _emscripten_glAlphaFunc() {
+  err('missing function: emscripten_glAlphaFunc'); abort(-1);
+  }
+
+  function _emscripten_glAreTexturesResident() {
+  err('missing function: emscripten_glAreTexturesResident'); abort(-1);
+  }
+
+  function _emscripten_glArrayElement() {
+  err('missing function: emscripten_glArrayElement'); abort(-1);
+  }
+
+  function _emscripten_glAttachObjectARB() {
+  err('missing function: emscripten_glAttachObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glAttachShader(program, shader) {
+      GLctx.attachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _emscripten_glBegin(){ throw 'Legacy GL function (glBegin) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+  function _emscripten_glBeginConditionalRender() {
+  err('missing function: emscripten_glBeginConditionalRender'); abort(-1);
+  }
+
+  function _emscripten_glBeginQuery() {
+  err('missing function: emscripten_glBeginQuery'); abort(-1);
+  }
+
+  function _emscripten_glBeginTransformFeedback() {
+  err('missing function: emscripten_glBeginTransformFeedback'); abort(-1);
+  }
+
+  function _emscripten_glBindAttribLocation(program, index, name) {
+      name = Pointer_stringify(name);
+      GLctx.bindAttribLocation(GL.programs[program], index, name);
+    }
+
+  function _emscripten_glBindBuffer(target, buffer) {
+      var bufferObj = buffer ? GL.buffers[buffer] : null;
+  
+  
+      GLctx.bindBuffer(target, bufferObj);
+    }
+
+  function _emscripten_glBindBufferBase() {
+  err('missing function: emscripten_glBindBufferBase'); abort(-1);
+  }
+
+  function _emscripten_glBindBufferRange() {
+  err('missing function: emscripten_glBindBufferRange'); abort(-1);
+  }
+
+  function _emscripten_glBindFragDataLocation() {
+  err('missing function: emscripten_glBindFragDataLocation'); abort(-1);
+  }
+
+  function _emscripten_glBindFramebuffer(target, framebuffer) {
+  
+      GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
+  
+    }
+
+  function _emscripten_glBindProgramARB() {
+  err('missing function: emscripten_glBindProgramARB'); abort(-1);
+  }
+
+  function _emscripten_glBindRenderbuffer(target, renderbuffer) {
+      GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
+    }
+
+  function _emscripten_glBindTexture(target, texture) {
+      GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+    }
+
+  function _emscripten_glBindVertexArray(vao) {
+      GLctx['bindVertexArray'](GL.vaos[vao]);
+    }
+
+  function _emscripten_glBitmap() {
+  err('missing function: emscripten_glBitmap'); abort(-1);
+  }
+
+  function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
+
+  function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
+
+  function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
+
+  function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+  function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glBlitFramebuffer() {
+  err('missing function: emscripten_glBlitFramebuffer'); abort(-1);
+  }
+
+  function _emscripten_glBufferData(target, size, data, usage) {
+      if (!data) {
+        GLctx.bufferData(target, size, usage);
+      } else {
+        GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+      }
+    }
+
+  function _emscripten_glBufferSubData(target, offset, size, data) {
+      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+    }
+
+  function _emscripten_glCallList() {
+  err('missing function: emscripten_glCallList'); abort(-1);
+  }
+
+  function _emscripten_glCallLists() {
+  err('missing function: emscripten_glCallLists'); abort(-1);
+  }
+
+  function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
+
+  function _emscripten_glClampColor() {
+  err('missing function: emscripten_glClampColor'); abort(-1);
+  }
+
+  function _emscripten_glClear(x0) { GLctx['clear'](x0) }
+
+  function _emscripten_glClearAccum() {
+  err('missing function: emscripten_glClearAccum'); abort(-1);
+  }
+
+  function _emscripten_glClearBufferfi() {
+  err('missing function: emscripten_glClearBufferfi'); abort(-1);
+  }
+
+  function _emscripten_glClearBufferfv() {
+  err('missing function: emscripten_glClearBufferfv'); abort(-1);
+  }
+
+  function _emscripten_glClearBufferiv() {
+  err('missing function: emscripten_glClearBufferiv'); abort(-1);
+  }
+
+  function _emscripten_glClearBufferuiv() {
+  err('missing function: emscripten_glClearBufferuiv'); abort(-1);
+  }
+
+  function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+  function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }
+
+  function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+  function _emscripten_glClearIndex() {
+  err('missing function: emscripten_glClearIndex'); abort(-1);
+  }
+
+  function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
+
+  function _emscripten_glClientActiveTexture() {
+  err('missing function: emscripten_glClientActiveTexture'); abort(-1);
+  }
+
+  function _emscripten_glClipPlane() {
+  err('missing function: emscripten_glClipPlane'); abort(-1);
+  }
+
+  function _emscripten_glColor3b() {
+  err('missing function: emscripten_glColor3b'); abort(-1);
+  }
+
+  function _emscripten_glColor3bv() {
+  err('missing function: emscripten_glColor3bv'); abort(-1);
+  }
+
+  function _emscripten_glColor3d() {
+  err('missing function: emscripten_glColor3d'); abort(-1);
+  }
+
+  function _emscripten_glColor3dv() {
+  err('missing function: emscripten_glColor3dv'); abort(-1);
+  }
+
+  function _emscripten_glColor3f() {
+  err('missing function: emscripten_glColor3f'); abort(-1);
+  }
+
+  function _emscripten_glColor3fv() {
+  err('missing function: emscripten_glColor3fv'); abort(-1);
+  }
+
+  function _emscripten_glColor3i() {
+  err('missing function: emscripten_glColor3i'); abort(-1);
+  }
+
+  function _emscripten_glColor3iv() {
+  err('missing function: emscripten_glColor3iv'); abort(-1);
+  }
+
+  function _emscripten_glColor3s() {
+  err('missing function: emscripten_glColor3s'); abort(-1);
+  }
+
+  function _emscripten_glColor3sv() {
+  err('missing function: emscripten_glColor3sv'); abort(-1);
+  }
+
+  function _emscripten_glColor3ub() {
+  err('missing function: emscripten_glColor3ub'); abort(-1);
+  }
+
+  function _emscripten_glColor3ubv() {
+  err('missing function: emscripten_glColor3ubv'); abort(-1);
+  }
+
+  function _emscripten_glColor3ui() {
+  err('missing function: emscripten_glColor3ui'); abort(-1);
+  }
+
+  function _emscripten_glColor3uiv() {
+  err('missing function: emscripten_glColor3uiv'); abort(-1);
+  }
+
+  function _emscripten_glColor3us() {
+  err('missing function: emscripten_glColor3us'); abort(-1);
+  }
+
+  function _emscripten_glColor3usv() {
+  err('missing function: emscripten_glColor3usv'); abort(-1);
+  }
+
+  function _emscripten_glColor4b() {
+  err('missing function: emscripten_glColor4b'); abort(-1);
+  }
+
+  function _emscripten_glColor4bv() {
+  err('missing function: emscripten_glColor4bv'); abort(-1);
+  }
+
+  function _emscripten_glColor4d() {
+  err('missing function: emscripten_glColor4d'); abort(-1);
+  }
+
+  function _emscripten_glColor4dv() {
+  err('missing function: emscripten_glColor4dv'); abort(-1);
+  }
+
+  function _emscripten_glColor4f() {
+  err('missing function: emscripten_glColor4f'); abort(-1);
+  }
+
+  function _emscripten_glColor4fv() {
+  err('missing function: emscripten_glColor4fv'); abort(-1);
+  }
+
+  function _emscripten_glColor4i() {
+  err('missing function: emscripten_glColor4i'); abort(-1);
+  }
+
+  function _emscripten_glColor4iv() {
+  err('missing function: emscripten_glColor4iv'); abort(-1);
+  }
+
+  function _emscripten_glColor4s() {
+  err('missing function: emscripten_glColor4s'); abort(-1);
+  }
+
+  function _emscripten_glColor4sv() {
+  err('missing function: emscripten_glColor4sv'); abort(-1);
+  }
+
+  function _emscripten_glColor4ub() {
+  err('missing function: emscripten_glColor4ub'); abort(-1);
+  }
+
+  function _emscripten_glColor4ubv() {
+  err('missing function: emscripten_glColor4ubv'); abort(-1);
+  }
+
+  function _emscripten_glColor4ui() {
+  err('missing function: emscripten_glColor4ui'); abort(-1);
+  }
+
+  function _emscripten_glColor4uiv() {
+  err('missing function: emscripten_glColor4uiv'); abort(-1);
+  }
+
+  function _emscripten_glColor4us() {
+  err('missing function: emscripten_glColor4us'); abort(-1);
+  }
+
+  function _emscripten_glColor4usv() {
+  err('missing function: emscripten_glColor4usv'); abort(-1);
+  }
+
+  function _emscripten_glColorMask(red, green, blue, alpha) {
+      GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+    }
+
+  function _emscripten_glColorMaski() {
+  err('missing function: emscripten_glColorMaski'); abort(-1);
+  }
+
+  function _emscripten_glColorMaterial() {
+  err('missing function: emscripten_glColorMaterial'); abort(-1);
+  }
+
+  function _emscripten_glColorPointer() {
+  err('missing function: emscripten_glColorPointer'); abort(-1);
+  }
+
+  function _emscripten_glColorSubTable() {
+  err('missing function: emscripten_glColorSubTable'); abort(-1);
+  }
+
+  function _emscripten_glColorTable() {
+  err('missing function: emscripten_glColorTable'); abort(-1);
+  }
+
+  function _emscripten_glColorTableParameterfv() {
+  err('missing function: emscripten_glColorTableParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glColorTableParameteriv() {
+  err('missing function: emscripten_glColorTableParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glCompileShader(shader) {
+      GLctx.compileShader(GL.shaders[shader]);
+    }
+
+  function _emscripten_glCompressedTexImage1D() {
+  err('missing function: emscripten_glCompressedTexImage1D'); abort(-1);
+  }
+
+  function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _emscripten_glCompressedTexImage3D() {
+  err('missing function: emscripten_glCompressedTexImage3D'); abort(-1);
+  }
+
+  function _emscripten_glCompressedTexSubImage1D() {
+  err('missing function: emscripten_glCompressedTexSubImage1D'); abort(-1);
+  }
+
+  function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
+      GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _emscripten_glCompressedTexSubImage3D() {
+  err('missing function: emscripten_glCompressedTexSubImage3D'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionFilter1D() {
+  err('missing function: emscripten_glConvolutionFilter1D'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionFilter2D() {
+  err('missing function: emscripten_glConvolutionFilter2D'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionParameterf() {
+  err('missing function: emscripten_glConvolutionParameterf'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionParameterfv() {
+  err('missing function: emscripten_glConvolutionParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionParameteri() {
+  err('missing function: emscripten_glConvolutionParameteri'); abort(-1);
+  }
+
+  function _emscripten_glConvolutionParameteriv() {
+  err('missing function: emscripten_glConvolutionParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glCopyColorSubTable() {
+  err('missing function: emscripten_glCopyColorSubTable'); abort(-1);
+  }
+
+  function _emscripten_glCopyColorTable() {
+  err('missing function: emscripten_glCopyColorTable'); abort(-1);
+  }
+
+  function _emscripten_glCopyConvolutionFilter1D() {
+  err('missing function: emscripten_glCopyConvolutionFilter1D'); abort(-1);
+  }
+
+  function _emscripten_glCopyConvolutionFilter2D() {
+  err('missing function: emscripten_glCopyConvolutionFilter2D'); abort(-1);
+  }
+
+  function _emscripten_glCopyPixels() {
+  err('missing function: emscripten_glCopyPixels'); abort(-1);
+  }
+
+  function _emscripten_glCopyTexImage1D() {
+  err('missing function: emscripten_glCopyTexImage1D'); abort(-1);
+  }
+
+  function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+  function _emscripten_glCopyTexSubImage1D() {
+  err('missing function: emscripten_glCopyTexSubImage1D'); abort(-1);
+  }
+
+  function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+  function _emscripten_glCopyTexSubImage3D() {
+  err('missing function: emscripten_glCopyTexSubImage3D'); abort(-1);
+  }
+
+  function _emscripten_glCreateProgram() {
+      var id = GL.getNewId(GL.programs);
+      var program = GLctx.createProgram();
+      program.name = id;
+      GL.programs[id] = program;
+      return id;
+    }
+
+  function _emscripten_glCreateProgramObjectARB() {
+  err('missing function: emscripten_glCreateProgramObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glCreateShader(shaderType) {
+      var id = GL.getNewId(GL.shaders);
+      GL.shaders[id] = GLctx.createShader(shaderType);
+      return id;
+    }
+
+  function _emscripten_glCreateShaderObjectARB() {
+  err('missing function: emscripten_glCreateShaderObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
+
+  function _emscripten_glDeleteBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((buffers)+(i*4))>>2)];
+        var buffer = GL.buffers[id];
+  
+        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+        // correspond to existing buffer objects."
+        if (!buffer) continue;
+  
+        GLctx.deleteBuffer(buffer);
+        buffer.name = 0;
+        GL.buffers[id] = null;
+  
+        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+      }
+    }
+
+  function _emscripten_glDeleteFramebuffers(n, framebuffers) {
+      for (var i = 0; i < n; ++i) {
+        var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+        var framebuffer = GL.framebuffers[id];
+        if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+        GLctx.deleteFramebuffer(framebuffer);
+        framebuffer.name = 0;
+        GL.framebuffers[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteLists() {
+  err('missing function: emscripten_glDeleteLists'); abort(-1);
+  }
+
+  function _emscripten_glDeleteObjectARB() {
+  err('missing function: emscripten_glDeleteObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glDeleteProgram(id) {
+      if (!id) return;
+      var program = GL.programs[id];
+      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteProgram(program);
+      program.name = 0;
+      GL.programs[id] = null;
+      GL.programInfos[id] = null;
+    }
+
+  function _emscripten_glDeleteProgramsARB() {
+  err('missing function: emscripten_glDeleteProgramsARB'); abort(-1);
+  }
+
+  function _emscripten_glDeleteQueries() {
+  err('missing function: emscripten_glDeleteQueries'); abort(-1);
+  }
+
+  function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
+        var renderbuffer = GL.renderbuffers[id];
+        if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+        GLctx.deleteRenderbuffer(renderbuffer);
+        renderbuffer.name = 0;
+        GL.renderbuffers[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteShader(id) {
+      if (!id) return;
+      var shader = GL.shaders[id];
+      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteShader(shader);
+      GL.shaders[id] = null;
+    }
+
+  function _emscripten_glDeleteTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((textures)+(i*4))>>2)];
+        var texture = GL.textures[id];
+        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+        GLctx.deleteTexture(texture);
+        texture.name = 0;
+        GL.textures[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteVertexArrays(n, vaos) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((vaos)+(i*4))>>2)];
+        GLctx['deleteVertexArray'](GL.vaos[id]);
+        GL.vaos[id] = null;
+      }
+    }
+
+  function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+  function _emscripten_glDepthMask(flag) {
+      GLctx.depthMask(!!flag);
+    }
+
+  function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+  function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+  function _emscripten_glDetachObjectARB() {
+  err('missing function: emscripten_glDetachObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glDetachShader(program, shader) {
+      GLctx.detachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
+
+  function _emscripten_glDisableClientState() {
+  err('missing function: emscripten_glDisableClientState'); abort(-1);
+  }
+
+  function _emscripten_glDisableVertexAttribArray(index) {
+      GLctx.disableVertexAttribArray(index);
+    }
+
+  function _emscripten_glDisablei() {
+  err('missing function: emscripten_glDisablei'); abort(-1);
+  }
+
+  function _emscripten_glDrawArrays(mode, first, count) {
+  
+      GLctx.drawArrays(mode, first, count);
+  
+    }
+
+  function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
+      GLctx['drawArraysInstanced'](mode, first, count, primcount);
+    }
+
+  function _emscripten_glDrawBuffer() {
+  err('missing function: emscripten_glDrawBuffer'); abort(-1);
+  }
+
+  function _emscripten_glDrawBuffers(n, bufs) {
+  
+      var bufArray = GL.tempFixedLengthArray[n];
+      for (var i = 0; i < n; i++) {
+        bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
+      }
+  
+      GLctx['drawBuffers'](bufArray);
+    }
+
+  function _emscripten_glDrawElements(mode, count, type, indices) {
+  
+      GLctx.drawElements(mode, count, type, indices);
+  
+    }
+
+  function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
+      GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
+    }
+
+  function _emscripten_glDrawPixels() {
+  err('missing function: emscripten_glDrawPixels'); abort(-1);
+  }
+
+  function _emscripten_glDrawRangeElements() {
+  err('missing function: emscripten_glDrawRangeElements'); abort(-1);
+  }
+
+  function _emscripten_glEdgeFlag() {
+  err('missing function: emscripten_glEdgeFlag'); abort(-1);
+  }
+
+  function _emscripten_glEdgeFlagPointer() {
+  err('missing function: emscripten_glEdgeFlagPointer'); abort(-1);
+  }
+
+  function _emscripten_glEdgeFlagv() {
+  err('missing function: emscripten_glEdgeFlagv'); abort(-1);
+  }
+
+  function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
+
+  function _emscripten_glEnableClientState() {
+  err('missing function: emscripten_glEnableClientState'); abort(-1);
+  }
+
+  function _emscripten_glEnableVertexAttribArray(index) {
+      GLctx.enableVertexAttribArray(index);
+    }
+
+  function _emscripten_glEnablei() {
+  err('missing function: emscripten_glEnablei'); abort(-1);
+  }
+
+  function _emscripten_glEnd() {
+  err('missing function: emscripten_glEnd'); abort(-1);
+  }
+
+  function _emscripten_glEndConditionalRender() {
+  err('missing function: emscripten_glEndConditionalRender'); abort(-1);
+  }
+
+  function _emscripten_glEndList() {
+  err('missing function: emscripten_glEndList'); abort(-1);
+  }
+
+  function _emscripten_glEndQuery() {
+  err('missing function: emscripten_glEndQuery'); abort(-1);
+  }
+
+  function _emscripten_glEndTransformFeedback() {
+  err('missing function: emscripten_glEndTransformFeedback'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord1d() {
+  err('missing function: emscripten_glEvalCoord1d'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord1dv() {
+  err('missing function: emscripten_glEvalCoord1dv'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord1f() {
+  err('missing function: emscripten_glEvalCoord1f'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord1fv() {
+  err('missing function: emscripten_glEvalCoord1fv'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord2d() {
+  err('missing function: emscripten_glEvalCoord2d'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord2dv() {
+  err('missing function: emscripten_glEvalCoord2dv'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord2f() {
+  err('missing function: emscripten_glEvalCoord2f'); abort(-1);
+  }
+
+  function _emscripten_glEvalCoord2fv() {
+  err('missing function: emscripten_glEvalCoord2fv'); abort(-1);
+  }
+
+  function _emscripten_glEvalMesh1() {
+  err('missing function: emscripten_glEvalMesh1'); abort(-1);
+  }
+
+  function _emscripten_glEvalMesh2() {
+  err('missing function: emscripten_glEvalMesh2'); abort(-1);
+  }
+
+  function _emscripten_glEvalPoint1() {
+  err('missing function: emscripten_glEvalPoint1'); abort(-1);
+  }
+
+  function _emscripten_glEvalPoint2() {
+  err('missing function: emscripten_glEvalPoint2'); abort(-1);
+  }
+
+  function _emscripten_glFeedbackBuffer() {
+  err('missing function: emscripten_glFeedbackBuffer'); abort(-1);
+  }
+
+  function _emscripten_glFinish() { GLctx['finish']() }
+
+  function _emscripten_glFlush() { GLctx['flush']() }
+
+  function _emscripten_glFogCoordPointer() {
+  err('missing function: emscripten_glFogCoordPointer'); abort(-1);
+  }
+
+  function _emscripten_glFogCoordd() {
+  err('missing function: emscripten_glFogCoordd'); abort(-1);
+  }
+
+  function _emscripten_glFogCoorddv() {
+  err('missing function: emscripten_glFogCoorddv'); abort(-1);
+  }
+
+  function _emscripten_glFogCoordf() {
+  err('missing function: emscripten_glFogCoordf'); abort(-1);
+  }
+
+  function _emscripten_glFogCoordfv() {
+  err('missing function: emscripten_glFogCoordfv'); abort(-1);
+  }
+
+  function _emscripten_glFogf() {
+  err('missing function: emscripten_glFogf'); abort(-1);
+  }
+
+  function _emscripten_glFogfv() {
+  err('missing function: emscripten_glFogfv'); abort(-1);
+  }
+
+  function _emscripten_glFogi() {
+  err('missing function: emscripten_glFogi'); abort(-1);
+  }
+
+  function _emscripten_glFogiv() {
+  err('missing function: emscripten_glFogiv'); abort(-1);
+  }
+
+  function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+      GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+                                         GL.renderbuffers[renderbuffer]);
+    }
+
+  function _emscripten_glFramebufferTexture1D() {
+  err('missing function: emscripten_glFramebufferTexture1D'); abort(-1);
+  }
+
+  function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+      GLctx.framebufferTexture2D(target, attachment, textarget,
+                                      GL.textures[texture], level);
+    }
+
+  function _emscripten_glFramebufferTexture3D() {
+  err('missing function: emscripten_glFramebufferTexture3D'); abort(-1);
+  }
+
+  function _emscripten_glFramebufferTextureLayer() {
+  err('missing function: emscripten_glFramebufferTextureLayer'); abort(-1);
+  }
+
+  function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+  function _emscripten_glFrustum() {
+  err('missing function: emscripten_glFrustum'); abort(-1);
+  }
+
+  function _emscripten_glGenBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var buffer = GLctx.createBuffer();
+        if (!buffer) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.buffers);
+        buffer.name = id;
+        GL.buffers[id] = buffer;
+        HEAP32[(((buffers)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenFramebuffers(n, ids) {
+      for (var i = 0; i < n; ++i) {
+        var framebuffer = GLctx.createFramebuffer();
+        if (!framebuffer) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.framebuffers);
+        framebuffer.name = id;
+        GL.framebuffers[id] = framebuffer;
+        HEAP32[(((ids)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenLists() {
+  err('missing function: emscripten_glGenLists'); abort(-1);
+  }
+
+  function _emscripten_glGenProgramsARB() {
+  err('missing function: emscripten_glGenProgramsARB'); abort(-1);
+  }
+
+  function _emscripten_glGenQueries() {
+  err('missing function: emscripten_glGenQueries'); abort(-1);
+  }
+
+  function _emscripten_glGenRenderbuffers(n, renderbuffers) {
+      for (var i = 0; i < n; i++) {
+        var renderbuffer = GLctx.createRenderbuffer();
+        if (!renderbuffer) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.renderbuffers);
+        renderbuffer.name = id;
+        GL.renderbuffers[id] = renderbuffer;
+        HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var texture = GLctx.createTexture();
+        if (!texture) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+          while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.textures);
+        texture.name = id;
+        GL.textures[id] = texture;
+        HEAP32[(((textures)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenVertexArrays(n, arrays) {
+  
+      for (var i = 0; i < n; i++) {
+        var vao = GLctx['createVertexArray']();
+        if (!vao) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.vaos);
+        vao.name = id;
+        GL.vaos[id] = vao;
+        HEAP32[(((arrays)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
+
+  function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
+      program = GL.programs[program];
+      var info = GLctx.getActiveAttrib(program, index);
+      if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
+  
+      if (bufSize > 0 && name) {
+        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+  
+      if (size) HEAP32[((size)>>2)]=info.size;
+      if (type) HEAP32[((type)>>2)]=info.type;
+    }
+
+  function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
+      program = GL.programs[program];
+      var info = GLctx.getActiveUniform(program, index);
+      if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
+  
+      if (bufSize > 0 && name) {
+        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+  
+      if (size) HEAP32[((size)>>2)]=info.size;
+      if (type) HEAP32[((type)>>2)]=info.type;
+    }
+
+  function _emscripten_glGetActiveUniformBlockName() {
+  err('missing function: emscripten_glGetActiveUniformBlockName'); abort(-1);
+  }
+
+  function _emscripten_glGetActiveUniformBlockiv() {
+  err('missing function: emscripten_glGetActiveUniformBlockiv'); abort(-1);
+  }
+
+  function _emscripten_glGetActiveUniformName() {
+  err('missing function: emscripten_glGetActiveUniformName'); abort(-1);
+  }
+
+  function _emscripten_glGetActiveUniformsiv() {
+  err('missing function: emscripten_glGetActiveUniformsiv'); abort(-1);
+  }
+
+  function _emscripten_glGetAttachedObjectsARB() {
+  err('missing function: emscripten_glGetAttachedObjectsARB'); abort(-1);
+  }
+
+  function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
+      var result = GLctx.getAttachedShaders(GL.programs[program]);
+      var len = result.length;
+      if (len > maxCount) {
+        len = maxCount;
+      }
+      HEAP32[((count)>>2)]=len;
+      for (var i = 0; i < len; ++i) {
+        var id = GL.shaders.indexOf(result[i]);
+        HEAP32[(((shaders)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGetAttribLocation(program, name) {
+      return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name));
+    }
+
+  function _emscripten_glGetBooleani_v() {
+  err('missing function: emscripten_glGetBooleani_v'); abort(-1);
+  }
+
+  
+  function emscriptenWebGLGet(name_, p, type) {
+      // Guard against user passing a null pointer.
+      // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
+      // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
+      // better to report an error instead of doing anything random.
+      if (!p) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var ret = undefined;
+      switch(name_) { // Handle a few trivial GLES values
+        case 0x8DFA: // GL_SHADER_COMPILER
+          ret = 1;
+          break;
+        case 0x8DF8: // GL_SHADER_BINARY_FORMATS
+          if (type !== 'Integer' && type !== 'Integer64') {
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+          }
+          return; // Do not write anything to the out pointer, since no binary formats are supported.
+        case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
+          ret = 0;
+          break;
+        case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+          // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
+          // so implement it ourselves to allow C++ GLES2 code get the length.
+          var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
+          ret = formats ? formats.length : 0;
+          break;
+      }
+  
+      if (ret === undefined) {
+        var result = GLctx.getParameter(name_);
+        switch (typeof(result)) {
+          case "number":
+            ret = result;
+            break;
+          case "boolean":
+            ret = result ? 1 : 0;
+            break;
+          case "string":
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+            return;
+          case "object":
+            if (result === null) {
+              // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
+              // can mean an invalid name_, which we need to report as an error
+              switch(name_) {
+                case 0x8894: // ARRAY_BUFFER_BINDING
+                case 0x8B8D: // CURRENT_PROGRAM
+                case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
+                case 0x8CA6: // FRAMEBUFFER_BINDING
+                case 0x8CA7: // RENDERBUFFER_BINDING
+                case 0x8069: // TEXTURE_BINDING_2D
+                case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
+                  ret = 0;
+                  break;
+                }
+                default: {
+                  GL.recordError(0x0500); // GL_INVALID_ENUM
+                  return;
+                }
+              }
+            } else if (result instanceof Float32Array ||
+                       result instanceof Uint32Array ||
+                       result instanceof Int32Array ||
+                       result instanceof Array) {
+              for (var i = 0; i < result.length; ++i) {
+                switch (type) {
+                  case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i];   break;
+                  case 'Float':   HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
+                  case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0;    break;
+                  default: throw 'internal glGet error, bad type: ' + type;
+                }
+              }
+              return;
+            } else {
+              try {
+                ret = result.name | 0;
+              } catch(e) {
+                GL.recordError(0x0500); // GL_INVALID_ENUM
+                err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')');
+                return;
+              }
+            }
+            break;
+          default:
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+            return;
+        }
+      }
+  
+      switch (type) {
+        case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]);    break;
+        case 'Integer': HEAP32[((p)>>2)]=ret;    break;
+        case 'Float':   HEAPF32[((p)>>2)]=ret;  break;
+        case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
+        default: throw 'internal glGet error, bad type: ' + type;
+      }
+    }function _emscripten_glGetBooleanv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Boolean');
+    }
+
+  function _emscripten_glGetBufferParameteriv(target, value, data) {
+      if (!data) {
+        // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+        // if data == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
+    }
+
+  function _emscripten_glGetBufferPointerv() {
+  err('missing function: emscripten_glGetBufferPointerv'); abort(-1);
+  }
+
+  function _emscripten_glGetBufferSubData() {
+  err('missing function: emscripten_glGetBufferSubData'); abort(-1);
+  }
+
+  function _emscripten_glGetClipPlane() {
+  err('missing function: emscripten_glGetClipPlane'); abort(-1);
+  }
+
+  function _emscripten_glGetColorTable() {
+  err('missing function: emscripten_glGetColorTable'); abort(-1);
+  }
+
+  function _emscripten_glGetColorTableParameterfv() {
+  err('missing function: emscripten_glGetColorTableParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glGetColorTableParameteriv() {
+  err('missing function: emscripten_glGetColorTableParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glGetCompressedTexImage() {
+  err('missing function: emscripten_glGetCompressedTexImage'); abort(-1);
+  }
+
+  function _emscripten_glGetConvolutionFilter() {
+  err('missing function: emscripten_glGetConvolutionFilter'); abort(-1);
+  }
+
+  function _emscripten_glGetConvolutionParameterfv() {
+  err('missing function: emscripten_glGetConvolutionParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glGetConvolutionParameteriv() {
+  err('missing function: emscripten_glGetConvolutionParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glGetDoublev() {
+  err('missing function: emscripten_glGetDoublev'); abort(-1);
+  }
+
+  function _emscripten_glGetError() {
+      // First return any GL error generated by the emscripten library_gl.js interop layer.
+      if (GL.lastError) {
+        var error = GL.lastError;
+        GL.lastError = 0/*GL_NO_ERROR*/;
+        return error;
+      } else { // If there were none, return the GL error from the browser GL context.
+        return GLctx.getError();
+      }
+    }
+
+  function _emscripten_glGetFloatv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Float');
+    }
+
+  function _emscripten_glGetFragDataLocation() {
+  err('missing function: emscripten_glGetFragDataLocation'); abort(-1);
+  }
+
+  function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
+      var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+      if (result instanceof WebGLRenderbuffer ||
+          result instanceof WebGLTexture) {
+        result = result.name | 0;
+      }
+      HEAP32[((params)>>2)]=result;
+    }
+
+  function _emscripten_glGetHandleARB() {
+  err('missing function: emscripten_glGetHandleARB'); abort(-1);
+  }
+
+  function _emscripten_glGetHistogram() {
+  err('missing function: emscripten_glGetHistogram'); abort(-1);
+  }
+
+  function _emscripten_glGetHistogramParameterfv() {
+  err('missing function: emscripten_glGetHistogramParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glGetHistogramParameteriv() {
+  err('missing function: emscripten_glGetHistogramParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glGetInfoLogARB() {
+  err('missing function: emscripten_glGetInfoLogARB'); abort(-1);
+  }
+
+  function _emscripten_glGetIntegeri_v() {
+  err('missing function: emscripten_glGetIntegeri_v'); abort(-1);
+  }
+
+  function _emscripten_glGetIntegerv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Integer');
+    }
+
+  function _emscripten_glGetLightfv() {
+  err('missing function: emscripten_glGetLightfv'); abort(-1);
+  }
+
+  function _emscripten_glGetLightiv() {
+  err('missing function: emscripten_glGetLightiv'); abort(-1);
+  }
+
+  function _emscripten_glGetMapdv() {
+  err('missing function: emscripten_glGetMapdv'); abort(-1);
+  }
+
+  function _emscripten_glGetMapfv() {
+  err('missing function: emscripten_glGetMapfv'); abort(-1);
+  }
+
+  function _emscripten_glGetMapiv() {
+  err('missing function: emscripten_glGetMapiv'); abort(-1);
+  }
+
+  function _emscripten_glGetMaterialfv() {
+  err('missing function: emscripten_glGetMaterialfv'); abort(-1);
+  }
+
+  function _emscripten_glGetMaterialiv() {
+  err('missing function: emscripten_glGetMaterialiv'); abort(-1);
+  }
+
+  function _emscripten_glGetMinmax() {
+  err('missing function: emscripten_glGetMinmax'); abort(-1);
+  }
+
+  function _emscripten_glGetMinmaxParameterfv() {
+  err('missing function: emscripten_glGetMinmaxParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glGetMinmaxParameteriv() {
+  err('missing function: emscripten_glGetMinmaxParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glGetObjectParameterfvARB() {
+  err('missing function: emscripten_glGetObjectParameterfvARB'); abort(-1);
+  }
+
+  function _emscripten_glGetObjectParameterivARB() {
+  err('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
+  }
+
+  function _emscripten_glGetPixelMapfv() {
+  err('missing function: emscripten_glGetPixelMapfv'); abort(-1);
+  }
+
+  function _emscripten_glGetPixelMapuiv() {
+  err('missing function: emscripten_glGetPixelMapuiv'); abort(-1);
+  }
+
+  function _emscripten_glGetPixelMapusv() {
+  err('missing function: emscripten_glGetPixelMapusv'); abort(-1);
+  }
+
+  function _emscripten_glGetPointerv() {
+  err('missing function: emscripten_glGetPointerv'); abort(-1);
+  }
+
+  function _emscripten_glGetPolygonStipple() {
+  err('missing function: emscripten_glGetPolygonStipple'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramEnvParameterdvARB() {
+  err('missing function: emscripten_glGetProgramEnvParameterdvARB'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramEnvParameterfvARB() {
+  err('missing function: emscripten_glGetProgramEnvParameterfvARB'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
+      var log = GLctx.getProgramInfoLog(GL.programs[program]);
+      if (log === null) log = '(unknown error)';
+  
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetProgramLocalParameterdvARB() {
+  err('missing function: emscripten_glGetProgramLocalParameterdvARB'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramLocalParameterfvARB() {
+  err('missing function: emscripten_glGetProgramLocalParameterfvARB'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramStringARB() {
+  err('missing function: emscripten_glGetProgramStringARB'); abort(-1);
+  }
+
+  function _emscripten_glGetProgramiv(program, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      if (program >= GL.counter) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+        return;
+      }
+  
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getProgramInfoLog(GL.programs[program]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+        HEAP32[((p)>>2)]=ptable.maxUniformLength;
+      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+        if (ptable.maxAttributeLength == -1) {
+          program = GL.programs[program];
+          var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+          for (var i = 0; i < numAttribs; ++i) {
+            var activeAttrib = GLctx.getActiveAttrib(program, i);
+            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+        if (ptable.maxUniformBlockNameLength == -1) {
+          program = GL.programs[program];
+          var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
+          ptable.maxUniformBlockNameLength = 0;
+          for (var i = 0; i < numBlocks; ++i) {
+            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+      }
+    }
+
+  function _emscripten_glGetQueryObjectiv() {
+  err('missing function: emscripten_glGetQueryObjectiv'); abort(-1);
+  }
+
+  function _emscripten_glGetQueryObjectuiv() {
+  err('missing function: emscripten_glGetQueryObjectuiv'); abort(-1);
+  }
+
+  function _emscripten_glGetQueryiv() {
+  err('missing function: emscripten_glGetQueryiv'); abort(-1);
+  }
+
+  function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
+    }
+
+  function _emscripten_glGetSeparableFilter() {
+  err('missing function: emscripten_glGetSeparableFilter'); abort(-1);
+  }
+
+  function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+      if (log === null) log = '(unknown error)';
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
+      var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+      HEAP32[((range)>>2)]=result.rangeMin;
+      HEAP32[(((range)+(4))>>2)]=result.rangeMax;
+      HEAP32[((precision)>>2)]=result.precision;
+    }
+
+  function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
+      var result = GLctx.getShaderSource(GL.shaders[shader]);
+      if (!result) return; // If an error occurs, nothing will be written to length or source.
+      if (bufSize > 0 && source) {
+        var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetShaderiv(shader, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
+        var source = GLctx.getShaderSource(GL.shaders[shader]);
+        var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1;
+        HEAP32[((p)>>2)]=sourceLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+      }
+    }
+
+  function _emscripten_glGetString(name_) {
+      if (GL.stringCache[name_]) return GL.stringCache[name_];
+      var ret;
+      switch(name_) {
+        case 0x1F03 /* GL_EXTENSIONS */:
+          var exts = GLctx.getSupportedExtensions();
+          var gl_exts = [];
+          for (var i = 0; i < exts.length; ++i) {
+            gl_exts.push(exts[i]);
+            gl_exts.push("GL_" + exts[i]);
+          }
+          ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+          break;
+        case 0x1F00 /* GL_VENDOR */:
+        case 0x1F01 /* GL_RENDERER */:
+        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+          var s = GLctx.getParameter(name_);
+          if (!s) {
+            GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          }
+          ret = allocate(intArrayFromString(s), 'i8', ALLOC_NORMAL);
+          break;
+  
+        case 0x1F02 /* GL_VERSION */:
+          var glVersion = GLctx.getParameter(GLctx.VERSION);
+          // return GLES version string corresponding to the version of the WebGL context
+          {
+            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+          }
+          ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
+          break;
+        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+          var ver_num = glslVersion.match(ver_re);
+          if (ver_num !== null) {
+            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+          }
+          ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
+          break;
+        default:
+          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          return 0;
+      }
+      GL.stringCache[name_] = ret;
+      return ret;
+    }
+
+  function _emscripten_glGetStringi() {
+  err('missing function: emscripten_glGetStringi'); abort(-1);
+  }
+
+  function _emscripten_glGetTexEnvfv() {
+  err('missing function: emscripten_glGetTexEnvfv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexEnviv() {
+  err('missing function: emscripten_glGetTexEnviv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexGendv() {
+  err('missing function: emscripten_glGetTexGendv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexGenfv() {
+  err('missing function: emscripten_glGetTexGenfv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexGeniv() {
+  err('missing function: emscripten_glGetTexGeniv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexImage() {
+  err('missing function: emscripten_glGetTexImage'); abort(-1);
+  }
+
+  function _emscripten_glGetTexLevelParameterfv() {
+  err('missing function: emscripten_glGetTexLevelParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexLevelParameteriv() {
+  err('missing function: emscripten_glGetTexLevelParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexParameterIiv() {
+  err('missing function: emscripten_glGetTexParameterIiv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexParameterIuiv() {
+  err('missing function: emscripten_glGetTexParameterIuiv'); abort(-1);
+  }
+
+  function _emscripten_glGetTexParameterfv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+    }
+
+  function _emscripten_glGetTexParameteriv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+    }
+
+  function _emscripten_glGetTransformFeedbackVarying() {
+  err('missing function: emscripten_glGetTransformFeedbackVarying'); abort(-1);
+  }
+
+  function _emscripten_glGetUniformBlockIndex() {
+  err('missing function: emscripten_glGetUniformBlockIndex'); abort(-1);
+  }
+
+  function _emscripten_glGetUniformIndices() {
+  err('missing function: emscripten_glGetUniformIndices'); abort(-1);
+  }
+
+  function _emscripten_glGetUniformLocation(program, name) {
+      name = Pointer_stringify(name);
+  
+      var arrayOffset = 0;
+      // If user passed an array accessor "[index]", parse the array index off the accessor.
+      if (name.indexOf(']', name.length-1) !== -1) {
+        var ls = name.lastIndexOf('[');
+        var arrayIndex = name.slice(ls+1, -1);
+        if (arrayIndex.length > 0) {
+          arrayOffset = parseInt(arrayIndex);
+          if (arrayOffset < 0) {
+            return -1;
+          }
+        }
+        name = name.slice(0, ls);
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        return -1;
+      }
+      var utable = ptable.uniforms;
+      var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+      if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+        return uniformInfo[1]+arrayOffset;
+      } else {
+        return -1;
+      }
+    }
+
+  
+  function emscriptenWebGLGetUniform(program, location, params, type) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
+      if (typeof data == 'number' || typeof data == 'boolean') {
+        switch (type) {
+          case 'Integer': HEAP32[((params)>>2)]=data; break;
+          case 'Float': HEAPF32[((params)>>2)]=data; break;
+          default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+        }
+      } else {
+        for (var i = 0; i < data.length; i++) {
+          switch (type) {
+            case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break;
+            default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+          }
+        }
+      }
+    }function _emscripten_glGetUniformfv(program, location, params) {
+      emscriptenWebGLGetUniform(program, location, params, 'Float');
+    }
+
+  function _emscripten_glGetUniformiv(program, location, params) {
+      emscriptenWebGLGetUniform(program, location, params, 'Integer');
+    }
+
+  function _emscripten_glGetUniformuiv() {
+  err('missing function: emscripten_glGetUniformuiv'); abort(-1);
+  }
+
+  function _emscripten_glGetVertexAttribIiv() {
+  err('missing function: emscripten_glGetVertexAttribIiv'); abort(-1);
+  }
+
+  function _emscripten_glGetVertexAttribIuiv() {
+  err('missing function: emscripten_glGetVertexAttribIuiv'); abort(-1);
+  }
+
+  function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
+      if (!pointer) {
+        // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
+        // if pointer == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
+    }
+
+  function _emscripten_glGetVertexAttribdv() {
+  err('missing function: emscripten_glGetVertexAttribdv'); abort(-1);
+  }
+
+  
+  function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var data = GLctx.getVertexAttrib(index, pname);
+      if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
+        HEAP32[((params)>>2)]=data["name"];
+      } else if (typeof data == 'number' || typeof data == 'boolean') {
+        switch (type) {
+          case 'Integer': HEAP32[((params)>>2)]=data; break;
+          case 'Float': HEAPF32[((params)>>2)]=data; break;
+          case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
+          default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+        }
+      } else {
+        for (var i = 0; i < data.length; i++) {
+          switch (type) {
+            case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'FloatToInteger': HEAP32[(((params)+(i*4))>>2)]=Math.fround(data[i]); break;
+            default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+          }
+        }
+      }
+    }function _emscripten_glGetVertexAttribfv(index, pname, params) {
+      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+      // otherwise the results are undefined. (GLES3 spec 6.1.12)
+      emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
+    }
+
+  function _emscripten_glGetVertexAttribiv(index, pname, params) {
+      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+      // otherwise the results are undefined. (GLES3 spec 6.1.12)
+      emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
+    }
+
+  function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
+
+  function _emscripten_glHistogram() {
+  err('missing function: emscripten_glHistogram'); abort(-1);
+  }
+
+  function _emscripten_glIndexMask() {
+  err('missing function: emscripten_glIndexMask'); abort(-1);
+  }
+
+  function _emscripten_glIndexPointer() {
+  err('missing function: emscripten_glIndexPointer'); abort(-1);
+  }
+
+  function _emscripten_glIndexd() {
+  err('missing function: emscripten_glIndexd'); abort(-1);
+  }
+
+  function _emscripten_glIndexdv() {
+  err('missing function: emscripten_glIndexdv'); abort(-1);
+  }
+
+  function _emscripten_glIndexf() {
+  err('missing function: emscripten_glIndexf'); abort(-1);
+  }
+
+  function _emscripten_glIndexfv() {
+  err('missing function: emscripten_glIndexfv'); abort(-1);
+  }
+
+  function _emscripten_glIndexi() {
+  err('missing function: emscripten_glIndexi'); abort(-1);
+  }
+
+  function _emscripten_glIndexiv() {
+  err('missing function: emscripten_glIndexiv'); abort(-1);
+  }
+
+  function _emscripten_glIndexs() {
+  err('missing function: emscripten_glIndexs'); abort(-1);
+  }
+
+  function _emscripten_glIndexsv() {
+  err('missing function: emscripten_glIndexsv'); abort(-1);
+  }
+
+  function _emscripten_glIndexub() {
+  err('missing function: emscripten_glIndexub'); abort(-1);
+  }
+
+  function _emscripten_glIndexubv() {
+  err('missing function: emscripten_glIndexubv'); abort(-1);
+  }
+
+  function _emscripten_glInitNames() {
+  err('missing function: emscripten_glInitNames'); abort(-1);
+  }
+
+  function _emscripten_glInterleavedArrays() {
+  err('missing function: emscripten_glInterleavedArrays'); abort(-1);
+  }
+
+  function _emscripten_glIsBuffer(buffer) {
+      var b = GL.buffers[buffer];
+      if (!b) return 0;
+      return GLctx.isBuffer(b);
+    }
+
+  function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
+
+  function _emscripten_glIsEnabledi() {
+  err('missing function: emscripten_glIsEnabledi'); abort(-1);
+  }
+
+  function _emscripten_glIsFramebuffer(framebuffer) {
+      var fb = GL.framebuffers[framebuffer];
+      if (!fb) return 0;
+      return GLctx.isFramebuffer(fb);
+    }
+
+  function _emscripten_glIsList() {
+  err('missing function: emscripten_glIsList'); abort(-1);
+  }
+
+  function _emscripten_glIsProgram(program) {
+      program = GL.programs[program];
+      if (!program) return 0;
+      return GLctx.isProgram(program);
+    }
+
+  function _emscripten_glIsQuery() {
+  err('missing function: emscripten_glIsQuery'); abort(-1);
+  }
+
+  function _emscripten_glIsRenderbuffer(renderbuffer) {
+      var rb = GL.renderbuffers[renderbuffer];
+      if (!rb) return 0;
+      return GLctx.isRenderbuffer(rb);
+    }
+
+  function _emscripten_glIsShader(shader) {
+      var s = GL.shaders[shader];
+      if (!s) return 0;
+      return GLctx.isShader(s);
+    }
+
+  function _emscripten_glIsTexture(texture) {
+      var texture = GL.textures[texture];
+      if (!texture) return 0;
+      return GLctx.isTexture(texture);
+    }
+
+  function _emscripten_glIsVertexArray(array) {
+  
+      var vao = GL.vaos[array];
+      if (!vao) return 0;
+      return GLctx['isVertexArray'](vao);
+    }
+
+  function _emscripten_glLightModelf() {
+  err('missing function: emscripten_glLightModelf'); abort(-1);
+  }
+
+  function _emscripten_glLightModelfv() {
+  err('missing function: emscripten_glLightModelfv'); abort(-1);
+  }
+
+  function _emscripten_glLightModeli() {
+  err('missing function: emscripten_glLightModeli'); abort(-1);
+  }
+
+  function _emscripten_glLightModeliv() {
+  err('missing function: emscripten_glLightModeliv'); abort(-1);
+  }
+
+  function _emscripten_glLightf() {
+  err('missing function: emscripten_glLightf'); abort(-1);
+  }
+
+  function _emscripten_glLightfv() {
+  err('missing function: emscripten_glLightfv'); abort(-1);
+  }
+
+  function _emscripten_glLighti() {
+  err('missing function: emscripten_glLighti'); abort(-1);
+  }
+
+  function _emscripten_glLightiv() {
+  err('missing function: emscripten_glLightiv'); abort(-1);
+  }
+
+  function _emscripten_glLineStipple() {
+  err('missing function: emscripten_glLineStipple'); abort(-1);
+  }
+
+  function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
+
+  function _emscripten_glLinkProgram(program) {
+      GLctx.linkProgram(GL.programs[program]);
+      GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+      GL.populateUniformTable(program);
+    }
+
+  function _emscripten_glListBase() {
+  err('missing function: emscripten_glListBase'); abort(-1);
+  }
+
+  function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+  function _emscripten_glLoadMatrixd() {
+  err('missing function: emscripten_glLoadMatrixd'); abort(-1);
+  }
+
+  function _emscripten_glLoadMatrixf() {
+  err('missing function: emscripten_glLoadMatrixf'); abort(-1);
+  }
+
+  function _emscripten_glLoadName() {
+  err('missing function: emscripten_glLoadName'); abort(-1);
+  }
+
+  function _emscripten_glLoadTransposeMatrixd() {
+  err('missing function: emscripten_glLoadTransposeMatrixd'); abort(-1);
+  }
+
+  function _emscripten_glLoadTransposeMatrixf() {
+  err('missing function: emscripten_glLoadTransposeMatrixf'); abort(-1);
+  }
+
+  function _emscripten_glLogicOp() {
+  err('missing function: emscripten_glLogicOp'); abort(-1);
+  }
+
+  function _emscripten_glMap1d() {
+  err('missing function: emscripten_glMap1d'); abort(-1);
+  }
+
+  function _emscripten_glMap1f() {
+  err('missing function: emscripten_glMap1f'); abort(-1);
+  }
+
+  function _emscripten_glMap2d() {
+  err('missing function: emscripten_glMap2d'); abort(-1);
+  }
+
+  function _emscripten_glMap2f() {
+  err('missing function: emscripten_glMap2f'); abort(-1);
+  }
+
+  function _emscripten_glMapBuffer() {
+  err('missing function: emscripten_glMapBuffer'); abort(-1);
+  }
+
+  function _emscripten_glMapGrid1d() {
+  err('missing function: emscripten_glMapGrid1d'); abort(-1);
+  }
+
+  function _emscripten_glMapGrid1f() {
+  err('missing function: emscripten_glMapGrid1f'); abort(-1);
+  }
+
+  function _emscripten_glMapGrid2d() {
+  err('missing function: emscripten_glMapGrid2d'); abort(-1);
+  }
+
+  function _emscripten_glMapGrid2f() {
+  err('missing function: emscripten_glMapGrid2f'); abort(-1);
+  }
+
+  function _emscripten_glMaterialf() {
+  err('missing function: emscripten_glMaterialf'); abort(-1);
+  }
+
+  function _emscripten_glMaterialfv() {
+  err('missing function: emscripten_glMaterialfv'); abort(-1);
+  }
+
+  function _emscripten_glMateriali() {
+  err('missing function: emscripten_glMateriali'); abort(-1);
+  }
+
+  function _emscripten_glMaterialiv() {
+  err('missing function: emscripten_glMaterialiv'); abort(-1);
+  }
+
+  function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+  function _emscripten_glMinmax() {
+  err('missing function: emscripten_glMinmax'); abort(-1);
+  }
+
+  function _emscripten_glMultMatrixd() {
+  err('missing function: emscripten_glMultMatrixd'); abort(-1);
+  }
+
+  function _emscripten_glMultMatrixf() {
+  err('missing function: emscripten_glMultMatrixf'); abort(-1);
+  }
+
+  function _emscripten_glMultTransposeMatrixd() {
+  err('missing function: emscripten_glMultTransposeMatrixd'); abort(-1);
+  }
+
+  function _emscripten_glMultTransposeMatrixf() {
+  err('missing function: emscripten_glMultTransposeMatrixf'); abort(-1);
+  }
+
+  function _emscripten_glMultiDrawArrays() {
+  err('missing function: emscripten_glMultiDrawArrays'); abort(-1);
+  }
+
+  function _emscripten_glMultiDrawElements() {
+  err('missing function: emscripten_glMultiDrawElements'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1d() {
+  err('missing function: emscripten_glMultiTexCoord1d'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1dv() {
+  err('missing function: emscripten_glMultiTexCoord1dv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1f() {
+  err('missing function: emscripten_glMultiTexCoord1f'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1fv() {
+  err('missing function: emscripten_glMultiTexCoord1fv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1i() {
+  err('missing function: emscripten_glMultiTexCoord1i'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1iv() {
+  err('missing function: emscripten_glMultiTexCoord1iv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1s() {
+  err('missing function: emscripten_glMultiTexCoord1s'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord1sv() {
+  err('missing function: emscripten_glMultiTexCoord1sv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2d() {
+  err('missing function: emscripten_glMultiTexCoord2d'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2dv() {
+  err('missing function: emscripten_glMultiTexCoord2dv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2f() {
+  err('missing function: emscripten_glMultiTexCoord2f'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2fv() {
+  err('missing function: emscripten_glMultiTexCoord2fv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2i() {
+  err('missing function: emscripten_glMultiTexCoord2i'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2iv() {
+  err('missing function: emscripten_glMultiTexCoord2iv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2s() {
+  err('missing function: emscripten_glMultiTexCoord2s'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord2sv() {
+  err('missing function: emscripten_glMultiTexCoord2sv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3d() {
+  err('missing function: emscripten_glMultiTexCoord3d'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3dv() {
+  err('missing function: emscripten_glMultiTexCoord3dv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3f() {
+  err('missing function: emscripten_glMultiTexCoord3f'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3fv() {
+  err('missing function: emscripten_glMultiTexCoord3fv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3i() {
+  err('missing function: emscripten_glMultiTexCoord3i'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3iv() {
+  err('missing function: emscripten_glMultiTexCoord3iv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3s() {
+  err('missing function: emscripten_glMultiTexCoord3s'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord3sv() {
+  err('missing function: emscripten_glMultiTexCoord3sv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4d() {
+  err('missing function: emscripten_glMultiTexCoord4d'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4dv() {
+  err('missing function: emscripten_glMultiTexCoord4dv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4f() {
+  err('missing function: emscripten_glMultiTexCoord4f'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4fv() {
+  err('missing function: emscripten_glMultiTexCoord4fv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4i() {
+  err('missing function: emscripten_glMultiTexCoord4i'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4iv() {
+  err('missing function: emscripten_glMultiTexCoord4iv'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4s() {
+  err('missing function: emscripten_glMultiTexCoord4s'); abort(-1);
+  }
+
+  function _emscripten_glMultiTexCoord4sv() {
+  err('missing function: emscripten_glMultiTexCoord4sv'); abort(-1);
+  }
+
+  function _emscripten_glNewList() {
+  err('missing function: emscripten_glNewList'); abort(-1);
+  }
+
+  function _emscripten_glNormal3b() {
+  err('missing function: emscripten_glNormal3b'); abort(-1);
+  }
+
+  function _emscripten_glNormal3bv() {
+  err('missing function: emscripten_glNormal3bv'); abort(-1);
+  }
+
+  function _emscripten_glNormal3d() {
+  err('missing function: emscripten_glNormal3d'); abort(-1);
+  }
+
+  function _emscripten_glNormal3dv() {
+  err('missing function: emscripten_glNormal3dv'); abort(-1);
+  }
+
+  function _emscripten_glNormal3f() {
+  err('missing function: emscripten_glNormal3f'); abort(-1);
+  }
+
+  function _emscripten_glNormal3fv() {
+  err('missing function: emscripten_glNormal3fv'); abort(-1);
+  }
+
+  function _emscripten_glNormal3i() {
+  err('missing function: emscripten_glNormal3i'); abort(-1);
+  }
+
+  function _emscripten_glNormal3iv() {
+  err('missing function: emscripten_glNormal3iv'); abort(-1);
+  }
+
+  function _emscripten_glNormal3s() {
+  err('missing function: emscripten_glNormal3s'); abort(-1);
+  }
+
+  function _emscripten_glNormal3sv() {
+  err('missing function: emscripten_glNormal3sv'); abort(-1);
+  }
+
+  function _emscripten_glNormalPointer() {
+  err('missing function: emscripten_glNormalPointer'); abort(-1);
+  }
+
+  function _emscripten_glOrtho() {
+  err('missing function: emscripten_glOrtho'); abort(-1);
+  }
+
+  function _emscripten_glPassThrough() {
+  err('missing function: emscripten_glPassThrough'); abort(-1);
+  }
+
+  function _emscripten_glPixelMapfv() {
+  err('missing function: emscripten_glPixelMapfv'); abort(-1);
+  }
+
+  function _emscripten_glPixelMapuiv() {
+  err('missing function: emscripten_glPixelMapuiv'); abort(-1);
+  }
+
+  function _emscripten_glPixelMapusv() {
+  err('missing function: emscripten_glPixelMapusv'); abort(-1);
+  }
+
+  function _emscripten_glPixelStoref() {
+  err('missing function: emscripten_glPixelStoref'); abort(-1);
+  }
+
+  function _emscripten_glPixelStorei(pname, param) {
+      if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+        GL.packAlignment = param;
+      } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+        GL.unpackAlignment = param;
+      }
+      GLctx.pixelStorei(pname, param);
+    }
+
+  function _emscripten_glPixelTransferf() {
+  err('missing function: emscripten_glPixelTransferf'); abort(-1);
+  }
+
+  function _emscripten_glPixelTransferi() {
+  err('missing function: emscripten_glPixelTransferi'); abort(-1);
+  }
+
+  function _emscripten_glPixelZoom() {
+  err('missing function: emscripten_glPixelZoom'); abort(-1);
+  }
+
+  function _emscripten_glPointParameterf() {
+  err('missing function: emscripten_glPointParameterf'); abort(-1);
+  }
+
+  function _emscripten_glPointParameterfv() {
+  err('missing function: emscripten_glPointParameterfv'); abort(-1);
+  }
+
+  function _emscripten_glPointParameteri() {
+  err('missing function: emscripten_glPointParameteri'); abort(-1);
+  }
+
+  function _emscripten_glPointParameteriv() {
+  err('missing function: emscripten_glPointParameteriv'); abort(-1);
+  }
+
+  function _emscripten_glPointSize() {
+  err('missing function: emscripten_glPointSize'); abort(-1);
+  }
+
+  function _emscripten_glPolygonMode() {
+  err('missing function: emscripten_glPolygonMode'); abort(-1);
+  }
+
+  function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
+
+  function _emscripten_glPolygonStipple() {
+  err('missing function: emscripten_glPolygonStipple'); abort(-1);
+  }
+
+  function _emscripten_glPopAttrib() {
+  err('missing function: emscripten_glPopAttrib'); abort(-1);
+  }
+
+  function _emscripten_glPopClientAttrib() {
+  err('missing function: emscripten_glPopClientAttrib'); abort(-1);
+  }
+
+  function _emscripten_glPopMatrix() {
+  err('missing function: emscripten_glPopMatrix'); abort(-1);
+  }
+
+  function _emscripten_glPopName() {
+  err('missing function: emscripten_glPopName'); abort(-1);
+  }
+
+  function _emscripten_glPrimitiveRestartIndex() {
+  err('missing function: emscripten_glPrimitiveRestartIndex'); abort(-1);
+  }
+
+  function _emscripten_glPrioritizeTextures() {
+  err('missing function: emscripten_glPrioritizeTextures'); abort(-1);
+  }
+
+  function _emscripten_glProgramEnvParameter4dARB() {
+  err('missing function: emscripten_glProgramEnvParameter4dARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramEnvParameter4dvARB() {
+  err('missing function: emscripten_glProgramEnvParameter4dvARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramEnvParameter4fARB() {
+  err('missing function: emscripten_glProgramEnvParameter4fARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramEnvParameter4fvARB() {
+  err('missing function: emscripten_glProgramEnvParameter4fvARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramLocalParameter4dARB() {
+  err('missing function: emscripten_glProgramLocalParameter4dARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramLocalParameter4dvARB() {
+  err('missing function: emscripten_glProgramLocalParameter4dvARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramLocalParameter4fARB() {
+  err('missing function: emscripten_glProgramLocalParameter4fARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramLocalParameter4fvARB() {
+  err('missing function: emscripten_glProgramLocalParameter4fvARB'); abort(-1);
+  }
+
+  function _emscripten_glProgramStringARB() {
+  err('missing function: emscripten_glProgramStringARB'); abort(-1);
+  }
+
+  function _emscripten_glPushAttrib() {
+  err('missing function: emscripten_glPushAttrib'); abort(-1);
+  }
+
+  function _emscripten_glPushClientAttrib() {
+  err('missing function: emscripten_glPushClientAttrib'); abort(-1);
+  }
+
+  function _emscripten_glPushMatrix() {
+  err('missing function: emscripten_glPushMatrix'); abort(-1);
+  }
+
+  function _emscripten_glPushName() {
+  err('missing function: emscripten_glPushName'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2d() {
+  err('missing function: emscripten_glRasterPos2d'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2dv() {
+  err('missing function: emscripten_glRasterPos2dv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2f() {
+  err('missing function: emscripten_glRasterPos2f'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2fv() {
+  err('missing function: emscripten_glRasterPos2fv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2i() {
+  err('missing function: emscripten_glRasterPos2i'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2iv() {
+  err('missing function: emscripten_glRasterPos2iv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2s() {
+  err('missing function: emscripten_glRasterPos2s'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos2sv() {
+  err('missing function: emscripten_glRasterPos2sv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3d() {
+  err('missing function: emscripten_glRasterPos3d'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3dv() {
+  err('missing function: emscripten_glRasterPos3dv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3f() {
+  err('missing function: emscripten_glRasterPos3f'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3fv() {
+  err('missing function: emscripten_glRasterPos3fv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3i() {
+  err('missing function: emscripten_glRasterPos3i'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3iv() {
+  err('missing function: emscripten_glRasterPos3iv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3s() {
+  err('missing function: emscripten_glRasterPos3s'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos3sv() {
+  err('missing function: emscripten_glRasterPos3sv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4d() {
+  err('missing function: emscripten_glRasterPos4d'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4dv() {
+  err('missing function: emscripten_glRasterPos4dv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4f() {
+  err('missing function: emscripten_glRasterPos4f'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4fv() {
+  err('missing function: emscripten_glRasterPos4fv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4i() {
+  err('missing function: emscripten_glRasterPos4i'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4iv() {
+  err('missing function: emscripten_glRasterPos4iv'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4s() {
+  err('missing function: emscripten_glRasterPos4s'); abort(-1);
+  }
+
+  function _emscripten_glRasterPos4sv() {
+  err('missing function: emscripten_glRasterPos4sv'); abort(-1);
+  }
+
+  function _emscripten_glReadBuffer() {
+  err('missing function: emscripten_glReadBuffer'); abort(-1);
+  }
+
+  
+  
+  function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
+      function roundedToNextMultipleOf(x, y) {
+        return Math.floor((x + y - 1) / y) * y
+      }
+      var plainRowSize = width * sizePerPixel;
+      var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+      return (height <= 0) ? 0 :
+               ((height - 1) * alignedRowSize + plainRowSize);
+    }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+      var sizePerPixel;
+      var numChannels;
+      switch(format) {
+        case 0x1906 /* GL_ALPHA */:
+        case 0x1909 /* GL_LUMINANCE */:
+        case 0x1902 /* GL_DEPTH_COMPONENT */:
+          numChannels = 1;
+          break;
+        case 0x190A /* GL_LUMINANCE_ALPHA */:
+          numChannels = 2;
+          break;
+        case 0x1907 /* GL_RGB */:
+        case 0x8C40 /* GL_SRGB_EXT */:
+          numChannels = 3;
+          break;
+        case 0x1908 /* GL_RGBA */:
+        case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
+          numChannels = 4;
+          break;
+        default:
+          GL.recordError(0x0500); // GL_INVALID_ENUM
+          return null;
+      }
+      switch (type) {
+        case 0x1401 /* GL_UNSIGNED_BYTE */:
+          sizePerPixel = numChannels*1;
+          break;
+        case 0x1403 /* GL_UNSIGNED_SHORT */:
+        case 0x8D61 /* GL_HALF_FLOAT_OES */:
+          sizePerPixel = numChannels*2;
+          break;
+        case 0x1405 /* GL_UNSIGNED_INT */:
+        case 0x1406 /* GL_FLOAT */:
+          sizePerPixel = numChannels*4;
+          break;
+        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
+          sizePerPixel = 4;
+          break;
+        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+          sizePerPixel = 2;
+          break;
+        default:
+          GL.recordError(0x0500); // GL_INVALID_ENUM
+          return null;
+      }
+      var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
+      switch(type) {
+        case 0x1401 /* GL_UNSIGNED_BYTE */:
+          return HEAPU8.subarray((pixels),(pixels+bytes));
+        case 0x1406 /* GL_FLOAT */:
+          return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
+        case 0x1405 /* GL_UNSIGNED_INT */:
+        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
+          return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
+        case 0x1403 /* GL_UNSIGNED_SHORT */:
+        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+        case 0x8D61 /* GL_HALF_FLOAT_OES */:
+          return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
+        default:
+          GL.recordError(0x0500); // GL_INVALID_ENUM
+          return null;
+      }
+    }function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
+      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+      if (!pixelData) {
+        GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+        return;
+      }
+      GLctx.readPixels(x, y, width, height, format, type, pixelData);
+    }
+
+  function _emscripten_glRectd() {
+  err('missing function: emscripten_glRectd'); abort(-1);
+  }
+
+  function _emscripten_glRectdv() {
+  err('missing function: emscripten_glRectdv'); abort(-1);
+  }
+
+  function _emscripten_glRectf() {
+  err('missing function: emscripten_glRectf'); abort(-1);
+  }
+
+  function _emscripten_glRectfv() {
+  err('missing function: emscripten_glRectfv'); abort(-1);
+  }
+
+  function _emscripten_glRecti() {
+  err('missing function: emscripten_glRecti'); abort(-1);
+  }
+
+  function _emscripten_glRectiv() {
+  err('missing function: emscripten_glRectiv'); abort(-1);
+  }
+
+  function _emscripten_glRects() {
+  err('missing function: emscripten_glRects'); abort(-1);
+  }
+
+  function _emscripten_glRectsv() {
+  err('missing function: emscripten_glRectsv'); abort(-1);
+  }
+
+  function _emscripten_glReleaseShaderCompiler() {
+      // NOP (as allowed by GLES 2.0 spec)
+    }
+
+  function _emscripten_glRenderMode() {
+  err('missing function: emscripten_glRenderMode'); abort(-1);
+  }
+
+  function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
+
+  function _emscripten_glRenderbufferStorageMultisample() {
+  err('missing function: emscripten_glRenderbufferStorageMultisample'); abort(-1);
+  }
+
+  function _emscripten_glResetHistogram() {
+  err('missing function: emscripten_glResetHistogram'); abort(-1);
+  }
+
+  function _emscripten_glResetMinmax() {
+  err('missing function: emscripten_glResetMinmax'); abort(-1);
+  }
+
+  function _emscripten_glRotated() {
+  err('missing function: emscripten_glRotated'); abort(-1);
+  }
+
+  function _emscripten_glRotatef() {
+  err('missing function: emscripten_glRotatef'); abort(-1);
+  }
+
+  function _emscripten_glSampleCoverage(value, invert) {
+      GLctx.sampleCoverage(value, !!invert);
+    }
+
+  function _emscripten_glScaled() {
+  err('missing function: emscripten_glScaled'); abort(-1);
+  }
+
+  function _emscripten_glScalef() {
+  err('missing function: emscripten_glScalef'); abort(-1);
+  }
+
+  function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
+
+  function _emscripten_glSecondaryColor3b() {
+  err('missing function: emscripten_glSecondaryColor3b'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3bv() {
+  err('missing function: emscripten_glSecondaryColor3bv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3d() {
+  err('missing function: emscripten_glSecondaryColor3d'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3dv() {
+  err('missing function: emscripten_glSecondaryColor3dv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3f() {
+  err('missing function: emscripten_glSecondaryColor3f'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3fv() {
+  err('missing function: emscripten_glSecondaryColor3fv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3i() {
+  err('missing function: emscripten_glSecondaryColor3i'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3iv() {
+  err('missing function: emscripten_glSecondaryColor3iv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3s() {
+  err('missing function: emscripten_glSecondaryColor3s'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3sv() {
+  err('missing function: emscripten_glSecondaryColor3sv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3ub() {
+  err('missing function: emscripten_glSecondaryColor3ub'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3ubv() {
+  err('missing function: emscripten_glSecondaryColor3ubv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3ui() {
+  err('missing function: emscripten_glSecondaryColor3ui'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3uiv() {
+  err('missing function: emscripten_glSecondaryColor3uiv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3us() {
+  err('missing function: emscripten_glSecondaryColor3us'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColor3usv() {
+  err('missing function: emscripten_glSecondaryColor3usv'); abort(-1);
+  }
+
+  function _emscripten_glSecondaryColorPointer() {
+  err('missing function: emscripten_glSecondaryColorPointer'); abort(-1);
+  }
+
+  function _emscripten_glSelectBuffer() {
+  err('missing function: emscripten_glSelectBuffer'); abort(-1);
+  }
+
+  function _emscripten_glSeparableFilter2D() {
+  err('missing function: emscripten_glSeparableFilter2D'); abort(-1);
+  }
+
+  function _emscripten_glShadeModel() {
+  err('missing function: emscripten_glShadeModel'); abort(-1);
+  }
+
+  function _emscripten_glShaderBinary() {
+      GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+    }
+
+  function _emscripten_glShaderSource(shader, count, string, length) {
+      var source = GL.getSource(shader, count, string, length);
+  
+  
+      GLctx.shaderSource(GL.shaders[shader], source);
+    }
+
+  function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
+
+  function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
+
+  function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
+
+  function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
+
+  function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glTexBuffer() {
+  err('missing function: emscripten_glTexBuffer'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1d() {
+  err('missing function: emscripten_glTexCoord1d'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1dv() {
+  err('missing function: emscripten_glTexCoord1dv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1f() {
+  err('missing function: emscripten_glTexCoord1f'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1fv() {
+  err('missing function: emscripten_glTexCoord1fv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1i() {
+  err('missing function: emscripten_glTexCoord1i'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1iv() {
+  err('missing function: emscripten_glTexCoord1iv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1s() {
+  err('missing function: emscripten_glTexCoord1s'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord1sv() {
+  err('missing function: emscripten_glTexCoord1sv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2d() {
+  err('missing function: emscripten_glTexCoord2d'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2dv() {
+  err('missing function: emscripten_glTexCoord2dv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2f() {
+  err('missing function: emscripten_glTexCoord2f'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2fv() {
+  err('missing function: emscripten_glTexCoord2fv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2i() {
+  err('missing function: emscripten_glTexCoord2i'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2iv() {
+  err('missing function: emscripten_glTexCoord2iv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2s() {
+  err('missing function: emscripten_glTexCoord2s'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord2sv() {
+  err('missing function: emscripten_glTexCoord2sv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3d() {
+  err('missing function: emscripten_glTexCoord3d'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3dv() {
+  err('missing function: emscripten_glTexCoord3dv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3f() {
+  err('missing function: emscripten_glTexCoord3f'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3fv() {
+  err('missing function: emscripten_glTexCoord3fv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3i() {
+  err('missing function: emscripten_glTexCoord3i'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3iv() {
+  err('missing function: emscripten_glTexCoord3iv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3s() {
+  err('missing function: emscripten_glTexCoord3s'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord3sv() {
+  err('missing function: emscripten_glTexCoord3sv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4d() {
+  err('missing function: emscripten_glTexCoord4d'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4dv() {
+  err('missing function: emscripten_glTexCoord4dv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4f() {
+  err('missing function: emscripten_glTexCoord4f'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4fv() {
+  err('missing function: emscripten_glTexCoord4fv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4i() {
+  err('missing function: emscripten_glTexCoord4i'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4iv() {
+  err('missing function: emscripten_glTexCoord4iv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4s() {
+  err('missing function: emscripten_glTexCoord4s'); abort(-1);
+  }
+
+  function _emscripten_glTexCoord4sv() {
+  err('missing function: emscripten_glTexCoord4sv'); abort(-1);
+  }
+
+  function _emscripten_glTexCoordPointer() {
+  err('missing function: emscripten_glTexCoordPointer'); abort(-1);
+  }
+
+  function _emscripten_glTexEnvf() {
+  err('missing function: emscripten_glTexEnvf'); abort(-1);
+  }
+
+  function _emscripten_glTexEnvfv() {
+  err('missing function: emscripten_glTexEnvfv'); abort(-1);
+  }
+
+  function _emscripten_glTexEnvi() {
+  err('missing function: emscripten_glTexEnvi'); abort(-1);
+  }
+
+  function _emscripten_glTexEnviv() {
+  err('missing function: emscripten_glTexEnviv'); abort(-1);
+  }
+
+  function _emscripten_glTexGend() {
+  err('missing function: emscripten_glTexGend'); abort(-1);
+  }
+
+  function _emscripten_glTexGendv() {
+  err('missing function: emscripten_glTexGendv'); abort(-1);
+  }
+
+  function _emscripten_glTexGenf() {
+  err('missing function: emscripten_glTexGenf'); abort(-1);
+  }
+
+  function _emscripten_glTexGenfv() {
+  err('missing function: emscripten_glTexGenfv'); abort(-1);
+  }
+
+  function _emscripten_glTexGeni() {
+  err('missing function: emscripten_glTexGeni'); abort(-1);
+  }
+
+  function _emscripten_glTexGeniv() {
+  err('missing function: emscripten_glTexGeniv'); abort(-1);
+  }
+
+  function _emscripten_glTexImage1D() {
+  err('missing function: emscripten_glTexImage1D'); abort(-1);
+  }
+
+  function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+  
+      var pixelData = null;
+      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+    }
+
+  function _emscripten_glTexImage3D() {
+  err('missing function: emscripten_glTexImage3D'); abort(-1);
+  }
+
+  function _emscripten_glTexParameterIiv() {
+  err('missing function: emscripten_glTexParameterIiv'); abort(-1);
+  }
+
+  function _emscripten_glTexParameterIuiv() {
+  err('missing function: emscripten_glTexParameterIuiv'); abort(-1);
+  }
+
+  function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
+
+  function _emscripten_glTexParameterfv(target, pname, params) {
+      var param = HEAPF32[((params)>>2)];
+      GLctx.texParameterf(target, pname, param);
+    }
+
+  function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+  function _emscripten_glTexParameteriv(target, pname, params) {
+      var param = HEAP32[((params)>>2)];
+      GLctx.texParameteri(target, pname, param);
+    }
+
+  function _emscripten_glTexStorage2D() {
+  err('missing function: emscripten_glTexStorage2D'); abort(-1);
+  }
+
+  function _emscripten_glTexStorage3D() {
+  err('missing function: emscripten_glTexStorage3D'); abort(-1);
+  }
+
+  function _emscripten_glTexSubImage1D() {
+  err('missing function: emscripten_glTexSubImage1D'); abort(-1);
+  }
+
+  function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
+      var pixelData = null;
+      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
+      GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+    }
+
+  function _emscripten_glTexSubImage3D() {
+  err('missing function: emscripten_glTexSubImage3D'); abort(-1);
+  }
+
+  function _emscripten_glTransformFeedbackVaryings() {
+  err('missing function: emscripten_glTransformFeedbackVaryings'); abort(-1);
+  }
+
+  function _emscripten_glTranslated() {
+  err('missing function: emscripten_glTranslated'); abort(-1);
+  }
+
+  function _emscripten_glTranslatef() {
+  err('missing function: emscripten_glTranslatef'); abort(-1);
+  }
+
+  function _emscripten_glUniform1f(location, v0) {
+      GLctx.uniform1f(GL.uniforms[location], v0);
+    }
+
+  function _emscripten_glUniform1fv(location, count, value) {
+  
+  
+      var view;
+      if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[count-1];
+        for (var i = 0; i < count; ++i) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
+      }
+      GLctx.uniform1fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform1i(location, v0) {
+      GLctx.uniform1i(GL.uniforms[location], v0);
+    }
+
+  function _emscripten_glUniform1iv(location, count, value) {
+  
+  
+      GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
+    }
+
+  function _emscripten_glUniform1ui() {
+  err('missing function: emscripten_glUniform1ui'); abort(-1);
+  }
+
+  function _emscripten_glUniform1uiv() {
+  err('missing function: emscripten_glUniform1uiv'); abort(-1);
+  }
+
+  function _emscripten_glUniform2f(location, v0, v1) {
+      GLctx.uniform2f(GL.uniforms[location], v0, v1);
+    }
+
+  function _emscripten_glUniform2fv(location, count, value) {
+  
+  
+      var view;
+      if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[2*count-1];
+        for (var i = 0; i < 2*count; i += 2) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
+      }
+      GLctx.uniform2fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform2i(location, v0, v1) {
+      GLctx.uniform2i(GL.uniforms[location], v0, v1);
+    }
+
+  function _emscripten_glUniform2iv(location, count, value) {
+  
+  
+      GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
+    }
+
+  function _emscripten_glUniform2ui() {
+  err('missing function: emscripten_glUniform2ui'); abort(-1);
+  }
+
+  function _emscripten_glUniform2uiv() {
+  err('missing function: emscripten_glUniform2uiv'); abort(-1);
+  }
+
+  function _emscripten_glUniform3f(location, v0, v1, v2) {
+      GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
+    }
+
+  function _emscripten_glUniform3fv(location, count, value) {
+  
+  
+      var view;
+      if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[3*count-1];
+        for (var i = 0; i < 3*count; i += 3) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
+      }
+      GLctx.uniform3fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform3i(location, v0, v1, v2) {
+      GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
+    }
+
+  function _emscripten_glUniform3iv(location, count, value) {
+  
+  
+      GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
+    }
+
+  function _emscripten_glUniform3ui() {
+  err('missing function: emscripten_glUniform3ui'); abort(-1);
+  }
+
+  function _emscripten_glUniform3uiv() {
+  err('missing function: emscripten_glUniform3uiv'); abort(-1);
+  }
+
+  function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
+      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _emscripten_glUniform4fv(location, count, value) {
+  
+  
+      var view;
+      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[4*count-1];
+        for (var i = 0; i < 4*count; i += 4) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+      }
+      GLctx.uniform4fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
+      GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _emscripten_glUniform4iv(location, count, value) {
+  
+  
+      GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
+    }
+
+  function _emscripten_glUniform4ui() {
+  err('missing function: emscripten_glUniform4ui'); abort(-1);
+  }
+
+  function _emscripten_glUniform4uiv() {
+  err('missing function: emscripten_glUniform4uiv'); abort(-1);
+  }
+
+  function _emscripten_glUniformBlockBinding() {
+  err('missing function: emscripten_glUniformBlockBinding'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
+  
+  
+      var view;
+      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[4*count-1];
+        for (var i = 0; i < 4*count; i += 4) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+      }
+      GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUniformMatrix2x3fv() {
+  err('missing function: emscripten_glUniformMatrix2x3fv'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix2x4fv() {
+  err('missing function: emscripten_glUniformMatrix2x4fv'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
+  
+  
+      var view;
+      if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[9*count-1];
+        for (var i = 0; i < 9*count; i += 9) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
+      }
+      GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUniformMatrix3x2fv() {
+  err('missing function: emscripten_glUniformMatrix3x2fv'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix3x4fv() {
+  err('missing function: emscripten_glUniformMatrix3x4fv'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
+  
+  
+      var view;
+      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[16*count-1];
+        for (var i = 0; i < 16*count; i += 16) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+      }
+      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUniformMatrix4x2fv() {
+  err('missing function: emscripten_glUniformMatrix4x2fv'); abort(-1);
+  }
+
+  function _emscripten_glUniformMatrix4x3fv() {
+  err('missing function: emscripten_glUniformMatrix4x3fv'); abort(-1);
+  }
+
+  function _emscripten_glUnmapBuffer() {
+  err('missing function: emscripten_glUnmapBuffer'); abort(-1);
+  }
+
+  function _emscripten_glUseProgram(program) {
+      GLctx.useProgram(program ? GL.programs[program] : null);
+    }
+
+  function _emscripten_glUseProgramObjectARB() {
+  err('missing function: emscripten_glUseProgramObjectARB'); abort(-1);
+  }
+
+  function _emscripten_glValidateProgram(program) {
+      GLctx.validateProgram(GL.programs[program]);
+    }
+
+  function _emscripten_glVertex2d() {
+  err('missing function: emscripten_glVertex2d'); abort(-1);
+  }
+
+  function _emscripten_glVertex2dv() {
+  err('missing function: emscripten_glVertex2dv'); abort(-1);
+  }
+
+  function _emscripten_glVertex2f() {
+  err('missing function: emscripten_glVertex2f'); abort(-1);
+  }
+
+  function _emscripten_glVertex2fv() {
+  err('missing function: emscripten_glVertex2fv'); abort(-1);
+  }
+
+  function _emscripten_glVertex2i() {
+  err('missing function: emscripten_glVertex2i'); abort(-1);
+  }
+
+  function _emscripten_glVertex2iv() {
+  err('missing function: emscripten_glVertex2iv'); abort(-1);
+  }
+
+  function _emscripten_glVertex2s() {
+  err('missing function: emscripten_glVertex2s'); abort(-1);
+  }
+
+  function _emscripten_glVertex2sv() {
+  err('missing function: emscripten_glVertex2sv'); abort(-1);
+  }
+
+  function _emscripten_glVertex3d() {
+  err('missing function: emscripten_glVertex3d'); abort(-1);
+  }
+
+  function _emscripten_glVertex3dv() {
+  err('missing function: emscripten_glVertex3dv'); abort(-1);
+  }
+
+  function _emscripten_glVertex3f() {
+  err('missing function: emscripten_glVertex3f'); abort(-1);
+  }
+
+  function _emscripten_glVertex3fv() {
+  err('missing function: emscripten_glVertex3fv'); abort(-1);
+  }
+
+  function _emscripten_glVertex3i() {
+  err('missing function: emscripten_glVertex3i'); abort(-1);
+  }
+
+  function _emscripten_glVertex3iv() {
+  err('missing function: emscripten_glVertex3iv'); abort(-1);
+  }
+
+  function _emscripten_glVertex3s() {
+  err('missing function: emscripten_glVertex3s'); abort(-1);
+  }
+
+  function _emscripten_glVertex3sv() {
+  err('missing function: emscripten_glVertex3sv'); abort(-1);
+  }
+
+  function _emscripten_glVertex4d() {
+  err('missing function: emscripten_glVertex4d'); abort(-1);
+  }
+
+  function _emscripten_glVertex4dv() {
+  err('missing function: emscripten_glVertex4dv'); abort(-1);
+  }
+
+  function _emscripten_glVertex4f() {
+  err('missing function: emscripten_glVertex4f'); abort(-1);
+  }
+
+  function _emscripten_glVertex4fv() {
+  err('missing function: emscripten_glVertex4fv'); abort(-1);
+  }
+
+  function _emscripten_glVertex4i() {
+  err('missing function: emscripten_glVertex4i'); abort(-1);
+  }
+
+  function _emscripten_glVertex4iv() {
+  err('missing function: emscripten_glVertex4iv'); abort(-1);
+  }
+
+  function _emscripten_glVertex4s() {
+  err('missing function: emscripten_glVertex4s'); abort(-1);
+  }
+
+  function _emscripten_glVertex4sv() {
+  err('missing function: emscripten_glVertex4sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib1d() {
+  err('missing function: emscripten_glVertexAttrib1d'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib1dv() {
+  err('missing function: emscripten_glVertexAttrib1dv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
+
+  function _emscripten_glVertexAttrib1fv(index, v) {
+  
+      GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
+    }
+
+  function _emscripten_glVertexAttrib1s() {
+  err('missing function: emscripten_glVertexAttrib1s'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib1sv() {
+  err('missing function: emscripten_glVertexAttrib1sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib2d() {
+  err('missing function: emscripten_glVertexAttrib2d'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib2dv() {
+  err('missing function: emscripten_glVertexAttrib2dv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
+
+  function _emscripten_glVertexAttrib2fv(index, v) {
+  
+      GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
+    }
+
+  function _emscripten_glVertexAttrib2s() {
+  err('missing function: emscripten_glVertexAttrib2s'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib2sv() {
+  err('missing function: emscripten_glVertexAttrib2sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib3d() {
+  err('missing function: emscripten_glVertexAttrib3d'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib3dv() {
+  err('missing function: emscripten_glVertexAttrib3dv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
+
+  function _emscripten_glVertexAttrib3fv(index, v) {
+  
+      GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
+    }
+
+  function _emscripten_glVertexAttrib3s() {
+  err('missing function: emscripten_glVertexAttrib3s'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib3sv() {
+  err('missing function: emscripten_glVertexAttrib3sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nbv() {
+  err('missing function: emscripten_glVertexAttrib4Nbv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Niv() {
+  err('missing function: emscripten_glVertexAttrib4Niv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nsv() {
+  err('missing function: emscripten_glVertexAttrib4Nsv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nub() {
+  err('missing function: emscripten_glVertexAttrib4Nub'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nubv() {
+  err('missing function: emscripten_glVertexAttrib4Nubv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nuiv() {
+  err('missing function: emscripten_glVertexAttrib4Nuiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4Nusv() {
+  err('missing function: emscripten_glVertexAttrib4Nusv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4bv() {
+  err('missing function: emscripten_glVertexAttrib4bv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4d() {
+  err('missing function: emscripten_glVertexAttrib4d'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4dv() {
+  err('missing function: emscripten_glVertexAttrib4dv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
+
+  function _emscripten_glVertexAttrib4fv(index, v) {
+  
+      GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
+    }
+
+  function _emscripten_glVertexAttrib4iv() {
+  err('missing function: emscripten_glVertexAttrib4iv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4s() {
+  err('missing function: emscripten_glVertexAttrib4s'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4sv() {
+  err('missing function: emscripten_glVertexAttrib4sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4ubv() {
+  err('missing function: emscripten_glVertexAttrib4ubv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4uiv() {
+  err('missing function: emscripten_glVertexAttrib4uiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttrib4usv() {
+  err('missing function: emscripten_glVertexAttrib4usv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribDivisor(index, divisor) {
+      GLctx['vertexAttribDivisor'](index, divisor);
+    }
+
+  function _emscripten_glVertexAttribI1i() {
+  err('missing function: emscripten_glVertexAttribI1i'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI1iv() {
+  err('missing function: emscripten_glVertexAttribI1iv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI1ui() {
+  err('missing function: emscripten_glVertexAttribI1ui'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI1uiv() {
+  err('missing function: emscripten_glVertexAttribI1uiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI2i() {
+  err('missing function: emscripten_glVertexAttribI2i'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI2iv() {
+  err('missing function: emscripten_glVertexAttribI2iv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI2ui() {
+  err('missing function: emscripten_glVertexAttribI2ui'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI2uiv() {
+  err('missing function: emscripten_glVertexAttribI2uiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI3i() {
+  err('missing function: emscripten_glVertexAttribI3i'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI3iv() {
+  err('missing function: emscripten_glVertexAttribI3iv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI3ui() {
+  err('missing function: emscripten_glVertexAttribI3ui'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI3uiv() {
+  err('missing function: emscripten_glVertexAttribI3uiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4bv() {
+  err('missing function: emscripten_glVertexAttribI4bv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4i() {
+  err('missing function: emscripten_glVertexAttribI4i'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4iv() {
+  err('missing function: emscripten_glVertexAttribI4iv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4sv() {
+  err('missing function: emscripten_glVertexAttribI4sv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4ubv() {
+  err('missing function: emscripten_glVertexAttribI4ubv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4ui() {
+  err('missing function: emscripten_glVertexAttribI4ui'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4uiv() {
+  err('missing function: emscripten_glVertexAttribI4uiv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribI4usv() {
+  err('missing function: emscripten_glVertexAttribI4usv'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribIPointer() {
+  err('missing function: emscripten_glVertexAttribIPointer'); abort(-1);
+  }
+
+  function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+    }
+
+  function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+  function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+  function _emscripten_glWindowPos2d() {
+  err('missing function: emscripten_glWindowPos2d'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2dv() {
+  err('missing function: emscripten_glWindowPos2dv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2f() {
+  err('missing function: emscripten_glWindowPos2f'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2fv() {
+  err('missing function: emscripten_glWindowPos2fv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2i() {
+  err('missing function: emscripten_glWindowPos2i'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2iv() {
+  err('missing function: emscripten_glWindowPos2iv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2s() {
+  err('missing function: emscripten_glWindowPos2s'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos2sv() {
+  err('missing function: emscripten_glWindowPos2sv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3d() {
+  err('missing function: emscripten_glWindowPos3d'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3dv() {
+  err('missing function: emscripten_glWindowPos3dv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3f() {
+  err('missing function: emscripten_glWindowPos3f'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3fv() {
+  err('missing function: emscripten_glWindowPos3fv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3i() {
+  err('missing function: emscripten_glWindowPos3i'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3iv() {
+  err('missing function: emscripten_glWindowPos3iv'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3s() {
+  err('missing function: emscripten_glWindowPos3s'); abort(-1);
+  }
+
+  function _emscripten_glWindowPos3sv() {
+  err('missing function: emscripten_glWindowPos3sv'); abort(-1);
+  }
+
+  function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
+      if (!target) target = '#canvas';
+      target = JSEvents.findEventTarget(target);
+      if (!target) return -4;
+      if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
+        return -1;
+      }
+  
+      var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
+  
+      // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
+      if (!canPerformRequests) {
+        if (deferUntilInEventHandler) {
+          JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]);
+          return 1;
+        } else {
+          return -2;
+        }
+      }
+  
+      return JSEvents.requestPointerLock(target);
+    }
+
+  function _emscripten_set_click_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
+      if (!target) target = document;
+      else {
+        target = JSEvents.findEventTarget(target);
+        if (!target) return -4;
+      }
+      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread);
+      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread);
+      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread);
+      JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
+      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+      JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
+      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+      JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread);
+      return 0;
+   }
+
+  function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread);
+      return 0;
+    }
+
+
+  function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread);
+      return 0;
+    }
+
+  
+  function __exit(status) {
+      // void _exit(int status);
+      // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+      exit(status);
+    }function _exit(status) {
+      __exit(status);
+    }
+
+  function _glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+  function _glAttachShader(program, shader) {
+      GLctx.attachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _glBindAttribLocation(program, index, name) {
+      name = Pointer_stringify(name);
+      GLctx.bindAttribLocation(GL.programs[program], index, name);
+    }
+
+  function _glBindBuffer(target, buffer) {
+      var bufferObj = buffer ? GL.buffers[buffer] : null;
+  
+  
+      GLctx.bindBuffer(target, bufferObj);
+    }
+
+  function _glBindTexture(target, texture) {
+      GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+    }
+
+  function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+  function _glBufferData(target, size, data, usage) {
+      if (!data) {
+        GLctx.bufferData(target, size, usage);
+      } else {
+        GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+      }
+    }
+
+  function _glBufferSubData(target, offset, size, data) {
+      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+    }
+
+  function _glClear(x0) { GLctx['clear'](x0) }
+
+  function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+  function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+  function _glCompileShader(shader) {
+      GLctx.compileShader(GL.shaders[shader]);
+    }
+
+  function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _glCreateProgram() {
+      var id = GL.getNewId(GL.programs);
+      var program = GLctx.createProgram();
+      program.name = id;
+      GL.programs[id] = program;
+      return id;
+    }
+
+  function _glCreateShader(shaderType) {
+      var id = GL.getNewId(GL.shaders);
+      GL.shaders[id] = GLctx.createShader(shaderType);
+      return id;
+    }
+
+  function _glCullFace(x0) { GLctx['cullFace'](x0) }
+
+  function _glDeleteBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((buffers)+(i*4))>>2)];
+        var buffer = GL.buffers[id];
+  
+        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+        // correspond to existing buffer objects."
+        if (!buffer) continue;
+  
+        GLctx.deleteBuffer(buffer);
+        buffer.name = 0;
+        GL.buffers[id] = null;
+  
+        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+      }
+    }
+
+  function _glDeleteProgram(id) {
+      if (!id) return;
+      var program = GL.programs[id];
+      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteProgram(program);
+      program.name = 0;
+      GL.programs[id] = null;
+      GL.programInfos[id] = null;
+    }
+
+  function _glDeleteShader(id) {
+      if (!id) return;
+      var shader = GL.shaders[id];
+      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteShader(shader);
+      GL.shaders[id] = null;
+    }
+
+  function _glDeleteTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((textures)+(i*4))>>2)];
+        var texture = GL.textures[id];
+        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+        GLctx.deleteTexture(texture);
+        texture.name = 0;
+        GL.textures[id] = null;
+      }
+    }
+
+  function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+  function _glDetachShader(program, shader) {
+      GLctx.detachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _glDisable(x0) { GLctx['disable'](x0) }
+
+  function _glDisableVertexAttribArray(index) {
+      GLctx.disableVertexAttribArray(index);
+    }
+
+  function _glDrawArrays(mode, first, count) {
+  
+      GLctx.drawArrays(mode, first, count);
+  
+    }
+
+  function _glDrawElements(mode, count, type, indices) {
+  
+      GLctx.drawElements(mode, count, type, indices);
+  
+    }
+
+  function _glEnable(x0) { GLctx['enable'](x0) }
+
+  function _glEnableVertexAttribArray(index) {
+      GLctx.enableVertexAttribArray(index);
+    }
+
+  function _glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+  function _glGenBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var buffer = GLctx.createBuffer();
+        if (!buffer) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.buffers);
+        buffer.name = id;
+        GL.buffers[id] = buffer;
+        HEAP32[(((buffers)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _glGenTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var texture = GLctx.createTexture();
+        if (!texture) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+          while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.textures);
+        texture.name = id;
+        GL.textures[id] = texture;
+        HEAP32[(((textures)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _glGetAttribLocation(program, name) {
+      return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name));
+    }
+
+  function _glGetFloatv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Float');
+    }
+
+  function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
+      var log = GLctx.getProgramInfoLog(GL.programs[program]);
+      if (log === null) log = '(unknown error)';
+  
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _glGetProgramiv(program, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      if (program >= GL.counter) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+        return;
+      }
+  
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getProgramInfoLog(GL.programs[program]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+        HEAP32[((p)>>2)]=ptable.maxUniformLength;
+      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+        if (ptable.maxAttributeLength == -1) {
+          program = GL.programs[program];
+          var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+          for (var i = 0; i < numAttribs; ++i) {
+            var activeAttrib = GLctx.getActiveAttrib(program, i);
+            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+        if (ptable.maxUniformBlockNameLength == -1) {
+          program = GL.programs[program];
+          var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
+          ptable.maxUniformBlockNameLength = 0;
+          for (var i = 0; i < numBlocks; ++i) {
+            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+      }
+    }
+
+  function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+      if (log === null) log = '(unknown error)';
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _glGetShaderiv(shader, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
+        var source = GLctx.getShaderSource(GL.shaders[shader]);
+        var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1;
+        HEAP32[((p)>>2)]=sourceLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+      }
+    }
+
+  function _glGetString(name_) {
+      if (GL.stringCache[name_]) return GL.stringCache[name_];
+      var ret;
+      switch(name_) {
+        case 0x1F03 /* GL_EXTENSIONS */:
+          var exts = GLctx.getSupportedExtensions();
+          var gl_exts = [];
+          for (var i = 0; i < exts.length; ++i) {
+            gl_exts.push(exts[i]);
+            gl_exts.push("GL_" + exts[i]);
+          }
+          ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+          break;
+        case 0x1F00 /* GL_VENDOR */:
+        case 0x1F01 /* GL_RENDERER */:
+        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+          var s = GLctx.getParameter(name_);
+          if (!s) {
+            GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          }
+          ret = allocate(intArrayFromString(s), 'i8', ALLOC_NORMAL);
+          break;
+  
+        case 0x1F02 /* GL_VERSION */:
+          var glVersion = GLctx.getParameter(GLctx.VERSION);
+          // return GLES version string corresponding to the version of the WebGL context
+          {
+            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+          }
+          ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
+          break;
+        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+          var ver_num = glslVersion.match(ver_re);
+          if (ver_num !== null) {
+            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+          }
+          ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
+          break;
+        default:
+          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          return 0;
+      }
+      GL.stringCache[name_] = ret;
+      return ret;
+    }
+
+  function _glGetUniformLocation(program, name) {
+      name = Pointer_stringify(name);
+  
+      var arrayOffset = 0;
+      // If user passed an array accessor "[index]", parse the array index off the accessor.
+      if (name.indexOf(']', name.length-1) !== -1) {
+        var ls = name.lastIndexOf('[');
+        var arrayIndex = name.slice(ls+1, -1);
+        if (arrayIndex.length > 0) {
+          arrayOffset = parseInt(arrayIndex);
+          if (arrayOffset < 0) {
+            return -1;
+          }
+        }
+        name = name.slice(0, ls);
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        return -1;
+      }
+      var utable = ptable.uniforms;
+      var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+      if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+        return uniformInfo[1]+arrayOffset;
+      } else {
+        return -1;
+      }
+    }
+
+  function _glLinkProgram(program) {
+      GLctx.linkProgram(GL.programs[program]);
+      GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+      GL.populateUniformTable(program);
+    }
+
+  function _glPixelStorei(pname, param) {
+      if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+        GL.packAlignment = param;
+      } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+        GL.unpackAlignment = param;
+      }
+      GLctx.pixelStorei(pname, param);
+    }
+
+  function _glShaderSource(shader, count, string, length) {
+      var source = GL.getSource(shader, count, string, length);
+  
+  
+      GLctx.shaderSource(GL.shaders[shader], source);
+    }
+
+  function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+  
+      var pixelData = null;
+      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+    }
+
+  function _glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
+
+  function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+  function _glUniform1i(location, v0) {
+      GLctx.uniform1i(GL.uniforms[location], v0);
+    }
+
+  function _glUniform4f(location, v0, v1, v2, v3) {
+      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _glUniformMatrix4fv(location, count, transpose, value) {
+  
+  
+      var view;
+      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        view = GL.miniTempBufferViews[16*count-1];
+        for (var i = 0; i < 16*count; i += 16) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+        }
+      } else {
+        view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+      }
+      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _glUseProgram(program) {
+      GLctx.useProgram(program ? GL.programs[program] : null);
+    }
+
+  function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+    }
+
+  function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+  
+  var GLFW={Window:function (id, width, height, title, monitor, share) {
+        this.id = id;
+        this.x = 0;
+        this.y = 0;
+        this.fullscreen = false; // Used to determine if app in fullscreen mode
+        this.storedX = 0; // Used to store X before fullscreen
+        this.storedY = 0; // Used to store Y before fullscreen
+        this.width = width;
+        this.height = height;
+        this.storedWidth = width; // Used to store width before fullscreen
+        this.storedHeight = height; // Used to store height before fullscreen
+        this.title = title;
+        this.monitor = monitor;
+        this.share = share;
+        this.attributes = GLFW.hints;
+        this.inputModes = {
+          0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
+          0x00033002:0, // GLFW_STICKY_KEYS
+          0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
+        };
+        this.buttons = 0;
+        this.keys = new Array();
+        this.domKeys = new Array();
+        this.shouldClose = 0;
+        this.title = null;
+        this.windowPosFunc = null; // GLFWwindowposfun
+        this.windowSizeFunc = null; // GLFWwindowsizefun
+        this.windowCloseFunc = null; // GLFWwindowclosefun
+        this.windowRefreshFunc = null; // GLFWwindowrefreshfun
+        this.windowFocusFunc = null; // GLFWwindowfocusfun
+        this.windowIconifyFunc = null; // GLFWwindowiconifyfun
+        this.framebufferSizeFunc = null; // GLFWframebuffersizefun
+        this.mouseButtonFunc = null; // GLFWmousebuttonfun
+        this.cursorPosFunc = null; // GLFWcursorposfun
+        this.cursorEnterFunc = null; // GLFWcursorenterfun
+        this.scrollFunc = null; // GLFWscrollfun
+        this.dropFunc = null; // GLFWdropfun
+        this.keyFunc = null; // GLFWkeyfun
+        this.charFunc = null; // GLFWcharfun
+        this.userptr = null;
+      },WindowFromId:function (id) {
+        if (id <= 0 || !GLFW.windows) return null;
+        return GLFW.windows[id - 1];
+      },joystickFunc:null,errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
+        switch (keycode) {
+          // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
+          case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
+          case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
+          case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
+          case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
+          case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
+          case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
+          case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
+          case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
+          case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
+          case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
+          case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
+          case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
+          case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
+          case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
+          case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
+          case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
+          case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
+          case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
+          case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+          case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+          case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
+          case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
+          case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
+          case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
+          case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
+          case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
+          case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
+          case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
+          case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
+          case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
+          case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
+          case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
+          case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
+          case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
+          case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
+          case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
+          case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
+          case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
+          case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
+          case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
+          case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
+          case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
+          case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
+          case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
+          case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
+          case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
+          case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
+          case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
+          case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
+          case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
+          
+  
+          case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
+          case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
+          case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
+          case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
+          case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
+          case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
+          case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
+          case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
+          case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
+          case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
+          case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
+          case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
+          case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
+          case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
+          case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
+          case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
+          case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
+          case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
+          case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
+          case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
+          case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
+          case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
+          case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
+          case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
+          case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
+          case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
+          case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
+          case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
+          case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
+          case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
+          case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
+          case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
+          case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
+          case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
+          case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
+          case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
+          case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
+          case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
+          case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
+          case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
+          case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
+          case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
+          case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
+          case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
+          case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
+          case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
+          case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
+          case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
+          case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
+          case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
+          case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
+          case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
+          case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
+          case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
+          case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
+          case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
+          case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
+          case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
+          case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
+          // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
+          // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
+          case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
+          case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
+          case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
+          case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
+          // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
+          // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
+          // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
+          // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
+          case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
+          // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
+          default:return -1; // GLFW_KEY_UNKNOWN
+        };
+      },getModBits:function (win) {
+        var mod = 0;
+        if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
+        if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
+        if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
+        if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
+        return mod;
+      },onKeyPress:function (event) {
+        if (!GLFW.active || !GLFW.active.charFunc) return;
+        if (event.ctrlKey || event.metaKey) return;
+  
+        // correct unicode charCode is only available with onKeyPress event
+        var charCode = event.charCode;
+        if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
+  
+  
+        Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode);
+      },onKeyChanged:function (keyCode, status) {
+        if (!GLFW.active) return;
+  
+        var key = GLFW.DOMToGLFWKeyCode(keyCode);
+        if (key == -1) return;
+  
+        var repeat = status && GLFW.active.keys[key];
+        GLFW.active.keys[key] = status;
+        GLFW.active.domKeys[keyCode] = status;
+        if (!GLFW.active.keyFunc) return;
+  
+  
+        if (repeat) status = 2; // GLFW_REPEAT
+        Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, keyCode, status, GLFW.getModBits(GLFW.active));
+      },onGamepadConnected:function (event) {
+        GLFW.refreshJoysticks();
+      },onGamepadDisconnected:function (event) {
+        GLFW.refreshJoysticks();
+      },onKeydown:function (event) {
+        GLFW.onKeyChanged(event.keyCode, 1); // GLFW_PRESS or GLFW_REPEAT
+  
+        // This logic comes directly from the sdl implementation. We cannot
+        // call preventDefault on all keydown events otherwise onKeyPress will
+        // not get called
+        if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
+          event.preventDefault();
+        }
+      },onKeyup:function (event) {
+        GLFW.onKeyChanged(event.keyCode, 0); // GLFW_RELEASE
+      },onBlur:function (event) {
+        if (!GLFW.active) return;
+  
+        for (var i = 0; i < GLFW.active.domKeys.length; ++i) {
+          if (GLFW.active.domKeys[i]) {
+            GLFW.onKeyChanged(i, 0); // GLFW_RELEASE
+          }
+        }
+      },onMousemove:function (event) {
+        if (!GLFW.active) return;
+  
+        Browser.calculateMouseEvent(event);
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
+  
+  
+        Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
+      },DOMToGLFWMouseButton:function (event) {
+        // DOM and glfw have different button codes.
+        // See http://www.w3schools.com/jsref/event_button.asp.
+        var eventButton = event['button'];
+        if (eventButton > 0) {
+          if (eventButton == 1) {
+            eventButton = 2;
+          } else {
+            eventButton = 1;
+          }
+        }
+        return eventButton;
+      },onMouseenter:function (event) {
+        if (!GLFW.active) return;
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+  
+        Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
+      },onMouseleave:function (event) {
+        if (!GLFW.active) return;
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+  
+        Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
+      },onMouseButtonChanged:function (event, status) {
+        if (!GLFW.active) return;
+  
+        Browser.calculateMouseEvent(event);
+  
+        if (event.target != Module["canvas"]) return;
+  
+        var eventButton = GLFW.DOMToGLFWMouseButton(event);
+  
+        if (status == 1) { // GLFW_PRESS
+          GLFW.active.buttons |= (1 << eventButton);
+          try {
+            event.target.setCapture();
+          } catch (e) {}
+        } else {  // GLFW_RELEASE
+          GLFW.active.buttons &= ~(1 << eventButton);
+        }
+  
+        if (!GLFW.active.mouseButtonFunc) return;
+  
+  
+        Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
+      },onMouseButtonDown:function (event) {
+        if (!GLFW.active) return;
+        GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
+      },onMouseButtonUp:function (event) {
+        if (!GLFW.active) return;
+        GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
+      },onMouseWheel:function (event) {
+        // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
+        var delta = -Browser.getMouseWheelDelta(event);
+        delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
+        GLFW.wheelPos += delta;
+  
+        if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
+  
+  
+        var sx = 0;
+        var sy = 0;
+        if (event.type == 'mousewheel') {
+          sx = event.wheelDeltaX;
+          sy = event.wheelDeltaY;
+        } else {
+          sx = event.deltaX;
+          sy = event.deltaY;
+        }
+  
+        Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
+  
+        event.preventDefault();
+      },onCanvasResize:function (width, height) {
+        if (!GLFW.active) return;
+  
+        var resizeNeeded = true;
+  
+        // If the client is requesting fullscreen mode
+        if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
+          GLFW.active.storedX = GLFW.active.x;
+          GLFW.active.storedY = GLFW.active.y;
+          GLFW.active.storedWidth = GLFW.active.width;
+          GLFW.active.storedHeight = GLFW.active.height;
+          GLFW.active.x = GLFW.active.y = 0;
+          GLFW.active.width = screen.width;
+          GLFW.active.height = screen.height;
+          GLFW.active.fullscreen = true;
+  
+        // If the client is reverting from fullscreen mode
+        } else if (GLFW.active.fullscreen == true) {
+          GLFW.active.x = GLFW.active.storedX;
+          GLFW.active.y = GLFW.active.storedY;
+          GLFW.active.width = GLFW.active.storedWidth;
+          GLFW.active.height = GLFW.active.storedHeight;
+          GLFW.active.fullscreen = false;
+  
+        // If the width/height values do not match current active window sizes
+        } else if (GLFW.active.width != width || GLFW.active.height != height) {
+            GLFW.active.width = width;
+            GLFW.active.height = height;
+        } else {
+          resizeNeeded = false;
+        }
+  
+        // If any of the above conditions were true, we need to resize the canvas
+        if (resizeNeeded) {
+          // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
+          Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
+          // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
+          // the canvas should drive window and framebuffer size respectfully.
+          GLFW.onWindowSizeChanged();
+          GLFW.onFramebufferSizeChanged();
+        }
+      },onWindowSizeChanged:function () {
+        if (!GLFW.active) return;
+  
+        if (!GLFW.active.windowSizeFunc) return;
+  
+  
+        Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+      },onFramebufferSizeChanged:function () {
+        if (!GLFW.active) return;
+  
+        if (!GLFW.active.framebufferSizeFunc) return;
+  
+        Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+      },requestFullscreen:function () {
+        var RFS = Module["canvas"]['requestFullscreen'] ||
+                  Module["canvas"]['mozRequestFullScreen'] ||
+                  Module["canvas"]['webkitRequestFullScreen'] ||
+                  (function() {});
+        RFS.apply(Module["canvas"], []);
+      },requestFullScreen:function () {
+        err('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
+        GLFW.requestFullScreen = function() {
+          return GLFW.requestFullscreen();
+        }
+        return GLFW.requestFullscreen();
+      },exitFullscreen:function () {
+        var CFS = document['exitFullscreen'] ||
+                  document['cancelFullScreen'] ||
+                  document['mozCancelFullScreen'] ||
+                  document['webkitCancelFullScreen'] ||
+            (function() {});
+        CFS.apply(document, []);
+      },cancelFullScreen:function () {
+        err('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
+        GLFW.cancelFullScreen = function() {
+          return GLFW.exitFullscreen();
+        }
+        return GLFW.exitFullscreen();
+      },getTime:function () {
+        return _emscripten_get_now() / 1000;
+      },setWindowTitle:function (winid, title) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        win.title = Pointer_stringify(title);
+        if (GLFW.active.id == win.id) {
+          document.title = win.title;
+        }
+      },setJoystickCallback:function (cbfun) {
+        GLFW.joystickFunc = cbfun;
+        GLFW.refreshJoysticks();
+      },joys:{},lastGamepadState:null,lastGamepadStateFrame:null,refreshJoysticks:function () {
+        // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
+        if (Browser.mainLoop.currentFrameNumber !== GLFW.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
+          GLFW.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
+          GLFW.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
+  
+          for (var joy = 0; joy < GLFW.lastGamepadState.length; ++joy) {
+            var gamepad = GLFW.lastGamepadState[joy];
+  
+            if (gamepad) {
+              if (!GLFW.joys[joy]) {
+                console.log('glfw joystick connected:',joy);
+                GLFW.joys[joy] = {
+                  id: allocate(intArrayFromString(gamepad.id), 'i8', ALLOC_NORMAL),
+                  buttonsCount: gamepad.buttons.length,
+                  axesCount: gamepad.axes.length,
+                  buttons: allocate(new Array(gamepad.buttons.length), 'i8', ALLOC_NORMAL),
+                  axes: allocate(new Array(gamepad.axes.length*4), 'float', ALLOC_NORMAL)
+                };
+  
+                if (GLFW.joystickFunc) {
+                  Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040001); // GLFW_CONNECTED
+                }
+              }
+  
+              var data = GLFW.joys[joy];
+  
+              for (var i = 0; i < gamepad.buttons.length;  ++i) {
+                setValue(data.buttons + i, gamepad.buttons[i].pressed, 'i8');
+              }
+  
+              for (var i = 0; i < gamepad.axes.length; ++i) {
+                setValue(data.axes + i*4, gamepad.axes[i], 'float');
+              }
+            } else {
+              if (GLFW.joys[joy]) {
+                console.log('glfw joystick disconnected',joy);
+  
+                if (GLFW.joystickFunc) {
+                  Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040002); // GLFW_DISCONNECTED
+                }
+  
+                _free(GLFW.joys[joy].id);
+                _free(GLFW.joys[joy].buttons);
+                _free(GLFW.joys[joy].axes);
+  
+                delete GLFW.joys[joy];
+              }
+            }
+          }
+        }
+      },setKeyCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.keyFunc = cbfun;
+      },setCharCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.charFunc = cbfun;
+      },setMouseButtonCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.mouseButtonFunc = cbfun;
+      },setCursorPosCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.cursorPosFunc = cbfun;
+      },setScrollCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.scrollFunc = cbfun;
+      },setDropCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.dropFunc = cbfun;
+      },onDrop:function (event) {
+        if (!GLFW.active || !GLFW.active.dropFunc) return;
+        if (!event.dataTransfer || !event.dataTransfer.files || event.dataTransfer.files.length == 0) return;
+  
+        event.preventDefault();
+  
+        var filenames = allocate(new Array(event.dataTransfer.files.length*4), 'i8*', ALLOC_NORMAL);
+        var filenamesArray = [];
+        var count = event.dataTransfer.files.length;
+  
+        // Read and save the files to emscripten's FS
+        var written = 0;
+        var drop_dir = '.glfw_dropped_files';
+        FS.createPath('/', drop_dir);
+  
+        function save(file) {
+          var path = '/' + drop_dir + '/' + file.name.replace(/\//g, '_');
+          var reader = new FileReader();
+          reader.onloadend = function(e) {
+            if (reader.readyState != 2) { // not DONE
+              ++written;
+              console.log('failed to read dropped file: '+file.name+': '+reader.error);
+              return;
+            }
+  
+            var data = e.target.result;
+            FS.writeFile(path, new Uint8Array(data));
+            if (++written === count) {
+              Module['dynCall_viii'](GLFW.active.dropFunc, GLFW.active.id, count, filenames);
+  
+              for (var i = 0; i < filenamesArray.length; ++i) {
+                _free(filenamesArray[i]);
+              }
+              _free(filenames);
+            }
+          };
+          reader.readAsArrayBuffer(file);
+  
+          var filename = allocate(intArrayFromString(path), 'i8', ALLOC_NORMAL);
+          filenamesArray.push(filename);
+          setValue(filenames + i*4, filename, 'i8*');
+        }
+  
+        for (var i = 0; i < count; ++i) {
+          save(event.dataTransfer.files[i]);
+        }
+  
+        return false;
+      },onDragover:function (event) {
+        if (!GLFW.active || !GLFW.active.dropFunc) return;
+  
+        event.preventDefault();
+        return false;
+      },setWindowSizeCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowSizeFunc = cbfun;
+       
+      },setWindowCloseCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowCloseFunc = cbfun;
+      },setWindowRefreshCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowRefreshFunc = cbfun;
+      },onClickRequestPointerLock:function (e) {
+        if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+          Module['canvas'].requestPointerLock();
+          e.preventDefault();
+        }
+      },setInputMode:function (winid, mode, value) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        switch(mode) {
+          case 0x00033001: { // GLFW_CURSOR
+            switch(value) {
+              case 0x00034001: { // GLFW_CURSOR_NORMAL
+                win.inputModes[mode] = value;
+                Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
+                Module['canvas'].exitPointerLock();
+                break;
+              }
+              case 0x00034002: { // GLFW_CURSOR_HIDDEN
+                console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
+                break;
+              }
+              case 0x00034003: { // GLFW_CURSOR_DISABLED
+                win.inputModes[mode] = value;
+                Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
+                Module['canvas'].requestPointerLock();
+                break;
+              }
+              default: {
+                console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
+                break;
+              }
+            }
+            break;
+          }
+          case 0x00033002: { // GLFW_STICKY_KEYS
+            console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
+            break;
+          }
+          case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
+            console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
+            break;
+          }
+          default: {
+            console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
+            break;
+          }
+        }
+      },getKey:function (winid, key) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return 0;
+        return win.keys[key];
+      },getMouseButton:function (winid, button) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return 0;
+        return (win.buttons & (1 << button)) > 0;
+      },getCursorPos:function (winid, x, y) {
+        setValue(x, Browser.mouseX, 'double');
+        setValue(y, Browser.mouseY, 'double');
+      },getMousePos:function (winid, x, y) {
+        setValue(x, Browser.mouseX, 'i32');
+        setValue(y, Browser.mouseY, 'i32');
+      },setCursorPos:function (winid, x, y) {
+      },getWindowPos:function (winid, x, y) {
+        var wx = 0;
+        var wy = 0;
+  
+        var win = GLFW.WindowFromId(winid);
+        if (win) {
+          wx = win.x;
+          wy = win.y;
+        }
+  
+        setValue(x, wx, 'i32');
+        setValue(y, wy, 'i32');
+      },setWindowPos:function (winid, x, y) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.x = x;
+        win.y = y;
+      },getWindowSize:function (winid, width, height) {
+        var ww = 0;
+        var wh = 0;
+  
+        var win = GLFW.WindowFromId(winid);
+        if (win) {
+          ww = win.width;
+          wh = win.height;
+        }
+  
+        setValue(width, ww, 'i32');
+        setValue(height, wh, 'i32');
+      },setWindowSize:function (winid, width, height) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        if (GLFW.active.id == win.id) {
+          if (width == screen.width && height == screen.height) {
+            GLFW.requestFullscreen();
+          } else {
+            GLFW.exitFullscreen();
+            Browser.setCanvasSize(width, height);
+            win.width = width;
+            win.height = height;
+          }
+        }
+  
+        if (!win.windowSizeFunc) return;
+  
+  
+        Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height);
+      },createWindow:function (width, height, title, monitor, share) {
+        var i, id;
+        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
+        if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
+  
+        // id for window
+        id = i + 1;
+  
+        // not valid
+        if (width <= 0 || height <= 0) return 0;
+  
+        if (monitor) {
+          GLFW.requestFullscreen();
+        } else {
+          Browser.setCanvasSize(width, height);
+        }
+  
+        // Create context when there are no existing alive windows
+        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
+        if (i == GLFW.windows.length) {
+          var contextAttributes = {
+            antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
+            depth: (GLFW.hints[0x00021005] > 0),     // GLFW_DEPTH_BITS
+            stencil: (GLFW.hints[0x00021006] > 0),   // GLFW_STENCIL_BITS
+            alpha: (GLFW.hints[0x00021004] > 0)      // GLFW_ALPHA_BITS 
+          }
+          Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
+        }
+  
+        // If context creation failed, do not return a valid window
+        if (!Module.ctx) return 0;
+  
+        // Get non alive id
+        var win = new GLFW.Window(id, width, height, title, monitor, share);
+  
+        // Set window to array
+        if (id - 1 == GLFW.windows.length) {
+          GLFW.windows.push(win);
+        } else {
+          GLFW.windows[id - 1] = win;
+        }
+  
+        GLFW.active = win;
+        return win.id;
+      },destroyWindow:function (winid) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        if (win.windowCloseFunc)
+          Module['dynCall_vi'](win.windowCloseFunc, win.id);
+  
+        GLFW.windows[win.id - 1] = null;
+        if (GLFW.active.id == win.id)
+          GLFW.active = null;
+  
+        // Destroy context when no alive windows
+        for (var i = 0; i < GLFW.windows.length; i++)
+          if (GLFW.windows[i] !== null) return;
+  
+        Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
+      },swapBuffers:function (winid) {
+      },GLFW2ParamToGLFW3Param:function (param) {
+        var table = {
+          0x00030001:0, // GLFW_MOUSE_CURSOR
+          0x00030002:0, // GLFW_STICKY_KEYS
+          0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
+          0x00030004:0, // GLFW_SYSTEM_KEYS
+          0x00030005:0, // GLFW_KEY_REPEAT
+          0x00030006:0, // GLFW_AUTO_POLL_EVENTS
+          0x00020001:0, // GLFW_OPENED
+          0x00020002:0, // GLFW_ACTIVE
+          0x00020003:0, // GLFW_ICONIFIED
+          0x00020004:0, // GLFW_ACCELERATED
+          0x00020005:0x00021001, // GLFW_RED_BITS
+          0x00020006:0x00021002, // GLFW_GREEN_BITS
+          0x00020007:0x00021003, // GLFW_BLUE_BITS
+          0x00020008:0x00021004, // GLFW_ALPHA_BITS
+          0x00020009:0x00021005, // GLFW_DEPTH_BITS
+          0x0002000A:0x00021006, // GLFW_STENCIL_BITS
+          0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
+          0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
+          0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
+          0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
+          0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
+          0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
+          0x00020011:0x0002100C, // GLFW_STEREO
+          0x00020012:0, // GLFW_WINDOW_NO_RESIZE
+          0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
+          0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
+          0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
+          0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
+          0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
+          0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
+        };
+        return table[param];
+      }};function _glfwCreateWindow(width, height, title, monitor, share) {
+      return GLFW.createWindow(width, height, title, monitor, share);
+    }
+
+  function _glfwDefaultWindowHints() {
+      GLFW.hints = GLFW.defaultHints;
+    }
+
+  function _glfwDestroyWindow(winid) {
+      return GLFW.destroyWindow(winid);
+    }
+
+  function _glfwGetCursorPos(winid, x, y) {
+      GLFW.getCursorPos(winid, x, y);
+    }
+
+  function _glfwGetKey(winid, key) {
+      return GLFW.getKey(winid, key);
+    }
+
+  function _glfwGetPrimaryMonitor() {
+      return 1;
+    }
+
+  function _glfwGetTime() {
+      return GLFW.getTime() - GLFW.initialTime;
+    }
+
+  function _glfwGetVideoModes(monitor, count) {
+      setValue(count, 0, 'i32');
+      return 0;
+    }
+
+  function _glfwInit() {
+      if (GLFW.windows) return 1; // GL_TRUE
+  
+      GLFW.initialTime = GLFW.getTime();
+      GLFW.hints = GLFW.defaultHints;
+      GLFW.windows = new Array()
+      GLFW.active = null;
+  
+      window.addEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+      window.addEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+      window.addEventListener("keydown", GLFW.onKeydown, true);
+      window.addEventListener("keypress", GLFW.onKeyPress, true);
+      window.addEventListener("keyup", GLFW.onKeyup, true);
+      window.addEventListener("blur", GLFW.onBlur, true);
+      Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
+      Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
+      Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
+      Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
+      Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
+      Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
+      Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
+      Module["canvas"].addEventListener('drop', GLFW.onDrop, true);
+      Module["canvas"].addEventListener('dragover', GLFW.onDragover, true);
+  
+      Browser.resizeListeners.push(function(width, height) {
+         GLFW.onCanvasResize(width, height);
+      });
+      return 1; // GL_TRUE
+    }
+
+  function _glfwMakeContextCurrent(winid) {}
+
+  function _glfwSetCharCallback(winid, cbfun) {
+      GLFW.setCharCallback(winid, cbfun);
+    }
+
+  function _glfwSetCursorEnterCallback(winid, cbfun) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.cursorEnterFunc = cbfun;
+    }
+
+  function _glfwSetCursorPosCallback(winid, cbfun) {
+      GLFW.setCursorPosCallback(winid, cbfun);
+    }
+
+  function _glfwSetErrorCallback(cbfun) {
+      GLFW.errorFunc = cbfun;
+    }
+
+  function _glfwSetKeyCallback(winid, cbfun) {
+      GLFW.setKeyCallback(winid, cbfun);
+    }
+
+  function _glfwSetMouseButtonCallback(winid, cbfun) {
+      GLFW.setMouseButtonCallback(winid, cbfun);
+    }
+
+  function _glfwSetScrollCallback(winid, cbfun) {
+      GLFW.setScrollCallback(winid, cbfun);
+    }
+
+  function _glfwSetWindowIconifyCallback(winid, cbfun) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.windowIconifyFunc = cbfun;
+    }
+
+  function _glfwSetWindowShouldClose(winid, value) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.shouldClose = value;
+    }
+
+  function _glfwSetWindowSizeCallback(winid, cbfun) {
+      GLFW.setWindowSizeCallback(winid, cbfun);
+    }
+
+  function _glfwSwapBuffers(winid) {
+      GLFW.swapBuffers(winid);
+    }
+
+  function _glfwSwapInterval(interval) {
+      interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
+      if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
+      else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
+    }
+
+  function _glfwTerminate() {
+      window.removeEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+      window.removeEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+      window.removeEventListener("keydown", GLFW.onKeydown, true);
+      window.removeEventListener("keypress", GLFW.onKeyPress, true);
+      window.removeEventListener("keyup", GLFW.onKeyup, true);
+      window.removeEventListener("blur", GLFW.onBlur, true);
+      Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
+      Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
+      Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
+      Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
+      Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
+      Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
+      Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
+      Module["canvas"].removeEventListener('drop', GLFW.onDrop, true);
+      Module["canvas"].removeEventListener('dragover', GLFW.onDragover, true);
+  
+  
+      Module["canvas"].width = Module["canvas"].height = 1;
+      GLFW.windows = null;
+      GLFW.active = null;
+    }
+
+  function _glfwWindowHint(target, hint) {
+      GLFW.hints[target] = hint;
+    }
+
+   
+
+  function _llvm_exp2_f32(x) {
+      return Math.pow(2, x);
+    }
+
+   
+
+  function _llvm_stackrestore(p) {
+      var self = _llvm_stacksave;
+      var ret = self.LLVM_SAVEDSTACKS[p];
+      self.LLVM_SAVEDSTACKS.splice(p, 1);
+      stackRestore(ret);
+    }
+
+  function _llvm_stacksave() {
+      var self = _llvm_stacksave;
+      if (!self.LLVM_SAVEDSTACKS) {
+        self.LLVM_SAVEDSTACKS = [];
+      }
+      self.LLVM_SAVEDSTACKS.push(stackSave());
+      return self.LLVM_SAVEDSTACKS.length-1;
+    }
+
+  
+  function _emscripten_memcpy_big(dest, src, num) {
+      HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+      return dest;
+    } 
+
+   
+
+   
+
+  function _pthread_attr_destroy(attr) {
+      /* int pthread_attr_destroy(pthread_attr_t *attr); */
+      //FIXME: should destroy the pthread_attr_t struct
+      return 0;
+    }
+
+  function _pthread_attr_init(attr) {
+      /* int pthread_attr_init(pthread_attr_t *attr); */
+      //FIXME: should allocate a pthread_attr_t
+      return 0;
+    }
+
+  function _pthread_cond_destroy() { return 0; }
+
+  function _pthread_cond_init() { return 0; }
+
+  function _pthread_cond_signal() { return 0; }
+
+  function _pthread_cond_wait() { return 0; }
+
+  function _pthread_create() {
+      return 11;
+    }
+
+  function _pthread_join() {}
+
+  function _pthread_mutex_destroy() {}
+
+  function _pthread_mutex_init() {}
+
+   
+
+   
+
+   
+
+  function _time(ptr) {
+      var ret = (Date.now()/1000)|0;
+      if (ptr) {
+        HEAP32[((ptr)>>2)]=ret;
+      }
+      return ret;
+    }
+
+  function _usleep(useconds) {
+      // int usleep(useconds_t useconds);
+      // http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html
+      // We're single-threaded, so use a busy loop. Super-ugly.
+      var msec = useconds / 1000;
+      if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']) {
+        var start = self['performance']['now']();
+        while (self['performance']['now']() - start < msec) {
+          // Do nothing.
+        }
+      } else {
+        var start = Date.now();
+        while (Date.now() - start < msec) {
+          // Do nothing.
+        }
+      }
+      return 0;
+    }
+
+FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
+__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
+Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
+  Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
+  Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
+  Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
+  Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
+  Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
+  Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
+  Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
+if (ENVIRONMENT_IS_NODE) {
+    _emscripten_get_now = function _emscripten_get_now_actual() {
+      var t = process['hrtime']();
+      return t[0] * 1e3 + t[1] / 1e6;
+    };
+  } else if (typeof dateNow !== 'undefined') {
+    _emscripten_get_now = dateNow;
+  } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
+    _emscripten_get_now = function() { return self['performance']['now'](); };
+  } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
+    _emscripten_get_now = function() { return performance['now'](); };
+  } else {
+    _emscripten_get_now = Date.now;
+  };
+JSEvents.staticInit();;
+var GLctx; GL.init();
+DYNAMICTOP_PTR = staticAlloc(4);
+
+STACK_BASE = STACKTOP = alignMemory(STATICTOP);
+
+STACK_MAX = STACK_BASE + TOTAL_STACK;
+
+DYNAMIC_BASE = alignMemory(STACK_MAX);
+
+HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
+
+staticSealed = true; // seal the static portion of memory
+
+var ASSERTIONS = false;
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+/** @type {function(string, boolean=, number=)} */
+function intArrayFromString(stringy, dontAddNull, length) {
+  var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+  var u8array = new Array(len);
+  var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+  if (dontAddNull) u8array.length = numBytesWritten;
+  return u8array;
+}
+
+function intArrayToString(array) {
+  var ret = [];
+  for (var i = 0; i < array.length; i++) {
+    var chr = array[i];
+    if (chr > 0xFF) {
+      if (ASSERTIONS) {
+        assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ')  at offset ' + i + ' not in 0x00-0xFF.');
+      }
+      chr &= 0xFF;
+    }
+    ret.push(String.fromCharCode(chr));
+  }
+  return ret.join('');
+}
+
+
+
+Module['wasmTableSize'] = 1478;
+
+Module['wasmMaxTableSize'] = 1478;
+
+Module.asmGlobalArg = {};
+
+Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "_SDL_CloseAudio": _SDL_CloseAudio, "_SDL_GetTicks": _SDL_GetTicks, "_SDL_InitSubSystem": _SDL_InitSubSystem, "_SDL_LockSurface": _SDL_LockSurface, "_SDL_OpenAudio": _SDL_OpenAudio, "_SDL_PauseAudio": _SDL_PauseAudio, "_SDL_QuitSubSystem": _SDL_QuitSubSystem, "___assert_fail": ___assert_fail, "___lock": ___lock, "___setErrNo": ___setErrNo, "___syscall140": ___syscall140, "___syscall145": ___syscall145, "___syscall146": ___syscall146, "___syscall221": ___syscall221, "___syscall5": ___syscall5, "___syscall54": ___syscall54, "___syscall6": ___syscall6, "___unlock": ___unlock, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "__exit": __exit, "__get_canvas_element_size": __get_canvas_element_size, "__set_canvas_element_size": __set_canvas_element_size, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_emscripten_get_canvas_element_size": _emscripten_get_canvas_element_size, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_get_now": _emscripten_get_now, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_emscripten_glAccum": _emscripten_glAccum, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glAlphaFunc": _emscripten_glAlphaFunc, "_emscripten_glAreTexturesResident": _emscripten_glAreTexturesResident, "_emscripten_glArrayElement": _emscripten_glArrayElement, "_emscripten_glAttachObjectARB": _emscripten_glAttachObjectARB, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_emscripten_glBegin": _emscripten_glBegin, "_emscripten_glBeginConditionalRender": _emscripten_glBeginConditionalRender, "_emscripten_glBeginQuery": _emscripten_glBeginQuery, "_emscripten_glBeginTransformFeedback": _emscripten_glBeginTransformFeedback, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glBindBufferBase": _emscripten_glBindBufferBase, "_emscripten_glBindBufferRange": _emscripten_glBindBufferRange, "_emscripten_glBindFragDataLocation": _emscripten_glBindFragDataLocation, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glBitmap": _emscripten_glBitmap, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glBlitFramebuffer": _emscripten_glBlitFramebuffer, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glCallList": _emscripten_glCallList, "_emscripten_glCallLists": _emscripten_glCallLists, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glClampColor": _emscripten_glClampColor, "_emscripten_glClear": _emscripten_glClear, "_emscripten_glClearAccum": _emscripten_glClearAccum, "_emscripten_glClearBufferfi": _emscripten_glClearBufferfi, "_emscripten_glClearBufferfv": _emscripten_glClearBufferfv, "_emscripten_glClearBufferiv": _emscripten_glClearBufferiv, "_emscripten_glClearBufferuiv": _emscripten_glClearBufferuiv, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glClearDepth": _emscripten_glClearDepth, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glClearIndex": _emscripten_glClearIndex, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glClipPlane": _emscripten_glClipPlane, "_emscripten_glColor3b": _emscripten_glColor3b, "_emscripten_glColor3bv": _emscripten_glColor3bv, "_emscripten_glColor3d": _emscripten_glColor3d, "_emscripten_glColor3dv": _emscripten_glColor3dv, "_emscripten_glColor3f": _emscripten_glColor3f, "_emscripten_glColor3fv": _emscripten_glColor3fv, "_emscripten_glColor3i": _emscripten_glColor3i, "_emscripten_glColor3iv": _emscripten_glColor3iv, "_emscripten_glColor3s": _emscripten_glColor3s, "_emscripten_glColor3sv": _emscripten_glColor3sv, "_emscripten_glColor3ub": _emscripten_glColor3ub, "_emscripten_glColor3ubv": _emscripten_glColor3ubv, "_emscripten_glColor3ui": _emscripten_glColor3ui, "_emscripten_glColor3uiv": _emscripten_glColor3uiv, "_emscripten_glColor3us": _emscripten_glColor3us, "_emscripten_glColor3usv": _emscripten_glColor3usv, "_emscripten_glColor4b": _emscripten_glColor4b, "_emscripten_glColor4bv": _emscripten_glColor4bv, "_emscripten_glColor4d": _emscripten_glColor4d, "_emscripten_glColor4dv": _emscripten_glColor4dv, "_emscripten_glColor4f": _emscripten_glColor4f, "_emscripten_glColor4fv": _emscripten_glColor4fv, "_emscripten_glColor4i": _emscripten_glColor4i, "_emscripten_glColor4iv": _emscripten_glColor4iv, "_emscripten_glColor4s": _emscripten_glColor4s, "_emscripten_glColor4sv": _emscripten_glColor4sv, "_emscripten_glColor4ub": _emscripten_glColor4ub, "_emscripten_glColor4ubv": _emscripten_glColor4ubv, "_emscripten_glColor4ui": _emscripten_glColor4ui, "_emscripten_glColor4uiv": _emscripten_glColor4uiv, "_emscripten_glColor4us": _emscripten_glColor4us, "_emscripten_glColor4usv": _emscripten_glColor4usv, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glColorMaski": _emscripten_glColorMaski, "_emscripten_glColorMaterial": _emscripten_glColorMaterial, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glColorSubTable": _emscripten_glColorSubTable, "_emscripten_glColorTable": _emscripten_glColorTable, "_emscripten_glColorTableParameterfv": _emscripten_glColorTableParameterfv, "_emscripten_glColorTableParameteriv": _emscripten_glColorTableParameteriv, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_emscripten_glCompressedTexImage1D": _emscripten_glCompressedTexImage1D, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glCompressedTexImage3D": _emscripten_glCompressedTexImage3D, "_emscripten_glCompressedTexSubImage1D": _emscripten_glCompressedTexSubImage1D, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "_emscripten_glCompressedTexSubImage3D": _emscripten_glCompressedTexSubImage3D, "_emscripten_glConvolutionFilter1D": _emscripten_glConvolutionFilter1D, "_emscripten_glConvolutionFilter2D": _emscripten_glConvolutionFilter2D, "_emscripten_glConvolutionParameterf": _emscripten_glConvolutionParameterf, "_emscripten_glConvolutionParameterfv": _emscripten_glConvolutionParameterfv, "_emscripten_glConvolutionParameteri": _emscripten_glConvolutionParameteri, "_emscripten_glConvolutionParameteriv": _emscripten_glConvolutionParameteriv, "_emscripten_glCopyColorSubTable": _emscripten_glCopyColorSubTable, "_emscripten_glCopyColorTable": _emscripten_glCopyColorTable, "_emscripten_glCopyConvolutionFilter1D": _emscripten_glCopyConvolutionFilter1D, "_emscripten_glCopyConvolutionFilter2D": _emscripten_glCopyConvolutionFilter2D, "_emscripten_glCopyPixels": _emscripten_glCopyPixels, "_emscripten_glCopyTexImage1D": _emscripten_glCopyTexImage1D, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glCopyTexSubImage1D": _emscripten_glCopyTexSubImage1D, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glCopyTexSubImage3D": _emscripten_glCopyTexSubImage3D, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCreateProgramObjectARB": _emscripten_glCreateProgramObjectARB, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glCreateShaderObjectARB": _emscripten_glCreateShaderObjectARB, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_emscripten_glDeleteLists": _emscripten_glDeleteLists, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteProgramsARB": _emscripten_glDeleteProgramsARB, "_emscripten_glDeleteQueries": _emscripten_glDeleteQueries, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_emscripten_glDetachObjectARB": _emscripten_glDetachObjectARB, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDisableClientState": _emscripten_glDisableClientState, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_emscripten_glDisablei": _emscripten_glDisablei, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_glDrawBuffer": _emscripten_glDrawBuffer, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glDrawPixels": _emscripten_glDrawPixels, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_emscripten_glEdgeFlag": _emscripten_glEdgeFlag, "_emscripten_glEdgeFlagPointer": _emscripten_glEdgeFlagPointer, "_emscripten_glEdgeFlagv": _emscripten_glEdgeFlagv, "_emscripten_glEnable": _emscripten_glEnable, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glEnablei": _emscripten_glEnablei, "_emscripten_glEnd": _emscripten_glEnd, "_emscripten_glEndConditionalRender": _emscripten_glEndConditionalRender, "_emscripten_glEndList": _emscripten_glEndList, "_emscripten_glEndQuery": _emscripten_glEndQuery, "_emscripten_glEndTransformFeedback": _emscripten_glEndTransformFeedback, "_emscripten_glEvalCoord1d": _emscripten_glEvalCoord1d, "_emscripten_glEvalCoord1dv": _emscripten_glEvalCoord1dv, "_emscripten_glEvalCoord1f": _emscripten_glEvalCoord1f, "_emscripten_glEvalCoord1fv": _emscripten_glEvalCoord1fv, "_emscripten_glEvalCoord2d": _emscripten_glEvalCoord2d, "_emscripten_glEvalCoord2dv": _emscripten_glEvalCoord2dv, "_emscripten_glEvalCoord2f": _emscripten_glEvalCoord2f, "_emscripten_glEvalCoord2fv": _emscripten_glEvalCoord2fv, "_emscripten_glEvalMesh1": _emscripten_glEvalMesh1, "_emscripten_glEvalMesh2": _emscripten_glEvalMesh2, "_emscripten_glEvalPoint1": _emscripten_glEvalPoint1, "_emscripten_glEvalPoint2": _emscripten_glEvalPoint2, "_emscripten_glFeedbackBuffer": _emscripten_glFeedbackBuffer, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glFogCoordPointer": _emscripten_glFogCoordPointer, "_emscripten_glFogCoordd": _emscripten_glFogCoordd, "_emscripten_glFogCoorddv": _emscripten_glFogCoorddv, "_emscripten_glFogCoordf": _emscripten_glFogCoordf, "_emscripten_glFogCoordfv": _emscripten_glFogCoordfv, "_emscripten_glFogf": _emscripten_glFogf, "_emscripten_glFogfv": _emscripten_glFogfv, "_emscripten_glFogi": _emscripten_glFogi, "_emscripten_glFogiv": _emscripten_glFogiv, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "_emscripten_glFramebufferTexture1D": _emscripten_glFramebufferTexture1D, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glFramebufferTexture3D": _emscripten_glFramebufferTexture3D, "_emscripten_glFramebufferTextureLayer": _emscripten_glFramebufferTextureLayer, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_emscripten_glGenLists": _emscripten_glGenLists, "_emscripten_glGenProgramsARB": _emscripten_glGenProgramsARB, "_emscripten_glGenQueries": _emscripten_glGenQueries, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_emscripten_glGetActiveUniformBlockName": _emscripten_glGetActiveUniformBlockName, "_emscripten_glGetActiveUniformBlockiv": _emscripten_glGetActiveUniformBlockiv, "_emscripten_glGetActiveUniformName": _emscripten_glGetActiveUniformName, "_emscripten_glGetActiveUniformsiv": _emscripten_glGetActiveUniformsiv, "_emscripten_glGetAttachedObjectsARB": _emscripten_glGetAttachedObjectsARB, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_glGetBooleani_v": _emscripten_glGetBooleani_v, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glGetBufferPointerv": _emscripten_glGetBufferPointerv, "_emscripten_glGetBufferSubData": _emscripten_glGetBufferSubData, "_emscripten_glGetClipPlane": _emscripten_glGetClipPlane, "_emscripten_glGetColorTable": _emscripten_glGetColorTable, "_emscripten_glGetColorTableParameterfv": _emscripten_glGetColorTableParameterfv, "_emscripten_glGetColorTableParameteriv": _emscripten_glGetColorTableParameteriv, "_emscripten_glGetCompressedTexImage": _emscripten_glGetCompressedTexImage, "_emscripten_glGetConvolutionFilter": _emscripten_glGetConvolutionFilter, "_emscripten_glGetConvolutionParameterfv": _emscripten_glGetConvolutionParameterfv, "_emscripten_glGetConvolutionParameteriv": _emscripten_glGetConvolutionParameteriv, "_emscripten_glGetDoublev": _emscripten_glGetDoublev, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glGetFragDataLocation": _emscripten_glGetFragDataLocation, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glGetHandleARB": _emscripten_glGetHandleARB, "_emscripten_glGetHistogram": _emscripten_glGetHistogram, "_emscripten_glGetHistogramParameterfv": _emscripten_glGetHistogramParameterfv, "_emscripten_glGetHistogramParameteriv": _emscripten_glGetHistogramParameteriv, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glGetIntegeri_v": _emscripten_glGetIntegeri_v, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glGetLightfv": _emscripten_glGetLightfv, "_emscripten_glGetLightiv": _emscripten_glGetLightiv, "_emscripten_glGetMapdv": _emscripten_glGetMapdv, "_emscripten_glGetMapfv": _emscripten_glGetMapfv, "_emscripten_glGetMapiv": _emscripten_glGetMapiv, "_emscripten_glGetMaterialfv": _emscripten_glGetMaterialfv, "_emscripten_glGetMaterialiv": _emscripten_glGetMaterialiv, "_emscripten_glGetMinmax": _emscripten_glGetMinmax, "_emscripten_glGetMinmaxParameterfv": _emscripten_glGetMinmaxParameterfv, "_emscripten_glGetMinmaxParameteriv": _emscripten_glGetMinmaxParameteriv, "_emscripten_glGetObjectParameterfvARB": _emscripten_glGetObjectParameterfvARB, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glGetPixelMapfv": _emscripten_glGetPixelMapfv, "_emscripten_glGetPixelMapuiv": _emscripten_glGetPixelMapuiv, "_emscripten_glGetPixelMapusv": _emscripten_glGetPixelMapusv, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_glGetPolygonStipple": _emscripten_glGetPolygonStipple, "_emscripten_glGetProgramEnvParameterdvARB": _emscripten_glGetProgramEnvParameterdvARB, "_emscripten_glGetProgramEnvParameterfvARB": _emscripten_glGetProgramEnvParameterfvARB, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_emscripten_glGetProgramLocalParameterdvARB": _emscripten_glGetProgramLocalParameterdvARB, "_emscripten_glGetProgramLocalParameterfvARB": _emscripten_glGetProgramLocalParameterfvARB, "_emscripten_glGetProgramStringARB": _emscripten_glGetProgramStringARB, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glGetQueryObjectiv": _emscripten_glGetQueryObjectiv, "_emscripten_glGetQueryObjectuiv": _emscripten_glGetQueryObjectuiv, "_emscripten_glGetQueryiv": _emscripten_glGetQueryiv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glGetSeparableFilter": _emscripten_glGetSeparableFilter, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glGetStringi": _emscripten_glGetStringi, "_emscripten_glGetTexEnvfv": _emscripten_glGetTexEnvfv, "_emscripten_glGetTexEnviv": _emscripten_glGetTexEnviv, "_emscripten_glGetTexGendv": _emscripten_glGetTexGendv, "_emscripten_glGetTexGenfv": _emscripten_glGetTexGenfv, "_emscripten_glGetTexGeniv": _emscripten_glGetTexGeniv, "_emscripten_glGetTexImage": _emscripten_glGetTexImage, "_emscripten_glGetTexLevelParameterfv": _emscripten_glGetTexLevelParameterfv, "_emscripten_glGetTexLevelParameteriv": _emscripten_glGetTexLevelParameteriv, "_emscripten_glGetTexParameterIiv": _emscripten_glGetTexParameterIiv, "_emscripten_glGetTexParameterIuiv": _emscripten_glGetTexParameterIuiv, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "_emscripten_glGetTransformFeedbackVarying": _emscripten_glGetTransformFeedbackVarying, "_emscripten_glGetUniformBlockIndex": _emscripten_glGetUniformBlockIndex, "_emscripten_glGetUniformIndices": _emscripten_glGetUniformIndices, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_emscripten_glGetUniformuiv": _emscripten_glGetUniformuiv, "_emscripten_glGetVertexAttribIiv": _emscripten_glGetVertexAttribIiv, "_emscripten_glGetVertexAttribIuiv": _emscripten_glGetVertexAttribIuiv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_emscripten_glGetVertexAttribdv": _emscripten_glGetVertexAttribdv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glHistogram": _emscripten_glHistogram, "_emscripten_glIndexMask": _emscripten_glIndexMask, "_emscripten_glIndexPointer": _emscripten_glIndexPointer, "_emscripten_glIndexd": _emscripten_glIndexd, "_emscripten_glIndexdv": _emscripten_glIndexdv, "_emscripten_glIndexf": _emscripten_glIndexf, "_emscripten_glIndexfv": _emscripten_glIndexfv, "_emscripten_glIndexi": _emscripten_glIndexi, "_emscripten_glIndexiv": _emscripten_glIndexiv, "_emscripten_glIndexs": _emscripten_glIndexs, "_emscripten_glIndexsv": _emscripten_glIndexsv, "_emscripten_glIndexub": _emscripten_glIndexub, "_emscripten_glIndexubv": _emscripten_glIndexubv, "_emscripten_glInitNames": _emscripten_glInitNames, "_emscripten_glInterleavedArrays": _emscripten_glInterleavedArrays, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glIsEnabledi": _emscripten_glIsEnabledi, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsList": _emscripten_glIsList, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glIsQuery": _emscripten_glIsQuery, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glIsVertexArray": _emscripten_glIsVertexArray, "_emscripten_glLightModelf": _emscripten_glLightModelf, "_emscripten_glLightModelfv": _emscripten_glLightModelfv, "_emscripten_glLightModeli": _emscripten_glLightModeli, "_emscripten_glLightModeliv": _emscripten_glLightModeliv, "_emscripten_glLightf": _emscripten_glLightf, "_emscripten_glLightfv": _emscripten_glLightfv, "_emscripten_glLighti": _emscripten_glLighti, "_emscripten_glLightiv": _emscripten_glLightiv, "_emscripten_glLineStipple": _emscripten_glLineStipple, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glListBase": _emscripten_glListBase, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_emscripten_glLoadMatrixd": _emscripten_glLoadMatrixd, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glLoadName": _emscripten_glLoadName, "_emscripten_glLoadTransposeMatrixd": _emscripten_glLoadTransposeMatrixd, "_emscripten_glLoadTransposeMatrixf": _emscripten_glLoadTransposeMatrixf, "_emscripten_glLogicOp": _emscripten_glLogicOp, "_emscripten_glMap1d": _emscripten_glMap1d, "_emscripten_glMap1f": _emscripten_glMap1f, "_emscripten_glMap2d": _emscripten_glMap2d, "_emscripten_glMap2f": _emscripten_glMap2f, "_emscripten_glMapBuffer": _emscripten_glMapBuffer, "_emscripten_glMapGrid1d": _emscripten_glMapGrid1d, "_emscripten_glMapGrid1f": _emscripten_glMapGrid1f, "_emscripten_glMapGrid2d": _emscripten_glMapGrid2d, "_emscripten_glMapGrid2f": _emscripten_glMapGrid2f, "_emscripten_glMaterialf": _emscripten_glMaterialf, "_emscripten_glMaterialfv": _emscripten_glMaterialfv, "_emscripten_glMateriali": _emscripten_glMateriali, "_emscripten_glMaterialiv": _emscripten_glMaterialiv, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_emscripten_glMinmax": _emscripten_glMinmax, "_emscripten_glMultMatrixd": _emscripten_glMultMatrixd, "_emscripten_glMultMatrixf": _emscripten_glMultMatrixf, "_emscripten_glMultTransposeMatrixd": _emscripten_glMultTransposeMatrixd, "_emscripten_glMultTransposeMatrixf": _emscripten_glMultTransposeMatrixf, "_emscripten_glMultiDrawArrays": _emscripten_glMultiDrawArrays, "_emscripten_glMultiDrawElements": _emscripten_glMultiDrawElements, "_emscripten_glMultiTexCoord1d": _emscripten_glMultiTexCoord1d, "_emscripten_glMultiTexCoord1dv": _emscripten_glMultiTexCoord1dv, "_emscripten_glMultiTexCoord1f": _emscripten_glMultiTexCoord1f, "_emscripten_glMultiTexCoord1fv": _emscripten_glMultiTexCoord1fv, "_emscripten_glMultiTexCoord1i": _emscripten_glMultiTexCoord1i, "_emscripten_glMultiTexCoord1iv": _emscripten_glMultiTexCoord1iv, "_emscripten_glMultiTexCoord1s": _emscripten_glMultiTexCoord1s, "_emscripten_glMultiTexCoord1sv": _emscripten_glMultiTexCoord1sv, "_emscripten_glMultiTexCoord2d": _emscripten_glMultiTexCoord2d, "_emscripten_glMultiTexCoord2dv": _emscripten_glMultiTexCoord2dv, "_emscripten_glMultiTexCoord2f": _emscripten_glMultiTexCoord2f, "_emscripten_glMultiTexCoord2fv": _emscripten_glMultiTexCoord2fv, "_emscripten_glMultiTexCoord2i": _emscripten_glMultiTexCoord2i, "_emscripten_glMultiTexCoord2iv": _emscripten_glMultiTexCoord2iv, "_emscripten_glMultiTexCoord2s": _emscripten_glMultiTexCoord2s, "_emscripten_glMultiTexCoord2sv": _emscripten_glMultiTexCoord2sv, "_emscripten_glMultiTexCoord3d": _emscripten_glMultiTexCoord3d, "_emscripten_glMultiTexCoord3dv": _emscripten_glMultiTexCoord3dv, "_emscripten_glMultiTexCoord3f": _emscripten_glMultiTexCoord3f, "_emscripten_glMultiTexCoord3fv": _emscripten_glMultiTexCoord3fv, "_emscripten_glMultiTexCoord3i": _emscripten_glMultiTexCoord3i, "_emscripten_glMultiTexCoord3iv": _emscripten_glMultiTexCoord3iv, "_emscripten_glMultiTexCoord3s": _emscripten_glMultiTexCoord3s, "_emscripten_glMultiTexCoord3sv": _emscripten_glMultiTexCoord3sv, "_emscripten_glMultiTexCoord4d": _emscripten_glMultiTexCoord4d, "_emscripten_glMultiTexCoord4dv": _emscripten_glMultiTexCoord4dv, "_emscripten_glMultiTexCoord4f": _emscripten_glMultiTexCoord4f, "_emscripten_glMultiTexCoord4fv": _emscripten_glMultiTexCoord4fv, "_emscripten_glMultiTexCoord4i": _emscripten_glMultiTexCoord4i, "_emscripten_glMultiTexCoord4iv": _emscripten_glMultiTexCoord4iv, "_emscripten_glMultiTexCoord4s": _emscripten_glMultiTexCoord4s, "_emscripten_glMultiTexCoord4sv": _emscripten_glMultiTexCoord4sv, "_emscripten_glNewList": _emscripten_glNewList, "_emscripten_glNormal3b": _emscripten_glNormal3b, "_emscripten_glNormal3bv": _emscripten_glNormal3bv, "_emscripten_glNormal3d": _emscripten_glNormal3d, "_emscripten_glNormal3dv": _emscripten_glNormal3dv, "_emscripten_glNormal3f": _emscripten_glNormal3f, "_emscripten_glNormal3fv": _emscripten_glNormal3fv, "_emscripten_glNormal3i": _emscripten_glNormal3i, "_emscripten_glNormal3iv": _emscripten_glNormal3iv, "_emscripten_glNormal3s": _emscripten_glNormal3s, "_emscripten_glNormal3sv": _emscripten_glNormal3sv, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_emscripten_glOrtho": _emscripten_glOrtho, "_emscripten_glPassThrough": _emscripten_glPassThrough, "_emscripten_glPixelMapfv": _emscripten_glPixelMapfv, "_emscripten_glPixelMapuiv": _emscripten_glPixelMapuiv, "_emscripten_glPixelMapusv": _emscripten_glPixelMapusv, "_emscripten_glPixelStoref": _emscripten_glPixelStoref, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_emscripten_glPixelTransferf": _emscripten_glPixelTransferf, "_emscripten_glPixelTransferi": _emscripten_glPixelTransferi, "_emscripten_glPixelZoom": _emscripten_glPixelZoom, "_emscripten_glPointParameterf": _emscripten_glPointParameterf, "_emscripten_glPointParameterfv": _emscripten_glPointParameterfv, "_emscripten_glPointParameteri": _emscripten_glPointParameteri, "_emscripten_glPointParameteriv": _emscripten_glPointParameteriv, "_emscripten_glPointSize": _emscripten_glPointSize, "_emscripten_glPolygonMode": _emscripten_glPolygonMode, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glPolygonStipple": _emscripten_glPolygonStipple, "_emscripten_glPopAttrib": _emscripten_glPopAttrib, "_emscripten_glPopClientAttrib": _emscripten_glPopClientAttrib, "_emscripten_glPopMatrix": _emscripten_glPopMatrix, "_emscripten_glPopName": _emscripten_glPopName, "_emscripten_glPrimitiveRestartIndex": _emscripten_glPrimitiveRestartIndex, "_emscripten_glPrioritizeTextures": _emscripten_glPrioritizeTextures, "_emscripten_glProgramEnvParameter4dARB": _emscripten_glProgramEnvParameter4dARB, "_emscripten_glProgramEnvParameter4dvARB": _emscripten_glProgramEnvParameter4dvARB, "_emscripten_glProgramEnvParameter4fARB": _emscripten_glProgramEnvParameter4fARB, "_emscripten_glProgramEnvParameter4fvARB": _emscripten_glProgramEnvParameter4fvARB, "_emscripten_glProgramLocalParameter4dARB": _emscripten_glProgramLocalParameter4dARB, "_emscripten_glProgramLocalParameter4dvARB": _emscripten_glProgramLocalParameter4dvARB, "_emscripten_glProgramLocalParameter4fARB": _emscripten_glProgramLocalParameter4fARB, "_emscripten_glProgramLocalParameter4fvARB": _emscripten_glProgramLocalParameter4fvARB, "_emscripten_glProgramStringARB": _emscripten_glProgramStringARB, "_emscripten_glPushAttrib": _emscripten_glPushAttrib, "_emscripten_glPushClientAttrib": _emscripten_glPushClientAttrib, "_emscripten_glPushMatrix": _emscripten_glPushMatrix, "_emscripten_glPushName": _emscripten_glPushName, "_emscripten_glRasterPos2d": _emscripten_glRasterPos2d, "_emscripten_glRasterPos2dv": _emscripten_glRasterPos2dv, "_emscripten_glRasterPos2f": _emscripten_glRasterPos2f, "_emscripten_glRasterPos2fv": _emscripten_glRasterPos2fv, "_emscripten_glRasterPos2i": _emscripten_glRasterPos2i, "_emscripten_glRasterPos2iv": _emscripten_glRasterPos2iv, "_emscripten_glRasterPos2s": _emscripten_glRasterPos2s, "_emscripten_glRasterPos2sv": _emscripten_glRasterPos2sv, "_emscripten_glRasterPos3d": _emscripten_glRasterPos3d, "_emscripten_glRasterPos3dv": _emscripten_glRasterPos3dv, "_emscripten_glRasterPos3f": _emscripten_glRasterPos3f, "_emscripten_glRasterPos3fv": _emscripten_glRasterPos3fv, "_emscripten_glRasterPos3i": _emscripten_glRasterPos3i, "_emscripten_glRasterPos3iv": _emscripten_glRasterPos3iv, "_emscripten_glRasterPos3s": _emscripten_glRasterPos3s, "_emscripten_glRasterPos3sv": _emscripten_glRasterPos3sv, "_emscripten_glRasterPos4d": _emscripten_glRasterPos4d, "_emscripten_glRasterPos4dv": _emscripten_glRasterPos4dv, "_emscripten_glRasterPos4f": _emscripten_glRasterPos4f, "_emscripten_glRasterPos4fv": _emscripten_glRasterPos4fv, "_emscripten_glRasterPos4i": _emscripten_glRasterPos4i, "_emscripten_glRasterPos4iv": _emscripten_glRasterPos4iv, "_emscripten_glRasterPos4s": _emscripten_glRasterPos4s, "_emscripten_glRasterPos4sv": _emscripten_glRasterPos4sv, "_emscripten_glReadBuffer": _emscripten_glReadBuffer, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glRectd": _emscripten_glRectd, "_emscripten_glRectdv": _emscripten_glRectdv, "_emscripten_glRectf": _emscripten_glRectf, "_emscripten_glRectfv": _emscripten_glRectfv, "_emscripten_glRecti": _emscripten_glRecti, "_emscripten_glRectiv": _emscripten_glRectiv, "_emscripten_glRects": _emscripten_glRects, "_emscripten_glRectsv": _emscripten_glRectsv, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glRenderMode": _emscripten_glRenderMode, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_glRenderbufferStorageMultisample": _emscripten_glRenderbufferStorageMultisample, "_emscripten_glResetHistogram": _emscripten_glResetHistogram, "_emscripten_glResetMinmax": _emscripten_glResetMinmax, "_emscripten_glRotated": _emscripten_glRotated, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glScaled": _emscripten_glScaled, "_emscripten_glScalef": _emscripten_glScalef, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glSecondaryColor3b": _emscripten_glSecondaryColor3b, "_emscripten_glSecondaryColor3bv": _emscripten_glSecondaryColor3bv, "_emscripten_glSecondaryColor3d": _emscripten_glSecondaryColor3d, "_emscripten_glSecondaryColor3dv": _emscripten_glSecondaryColor3dv, "_emscripten_glSecondaryColor3f": _emscripten_glSecondaryColor3f, "_emscripten_glSecondaryColor3fv": _emscripten_glSecondaryColor3fv, "_emscripten_glSecondaryColor3i": _emscripten_glSecondaryColor3i, "_emscripten_glSecondaryColor3iv": _emscripten_glSecondaryColor3iv, "_emscripten_glSecondaryColor3s": _emscripten_glSecondaryColor3s, "_emscripten_glSecondaryColor3sv": _emscripten_glSecondaryColor3sv, "_emscripten_glSecondaryColor3ub": _emscripten_glSecondaryColor3ub, "_emscripten_glSecondaryColor3ubv": _emscripten_glSecondaryColor3ubv, "_emscripten_glSecondaryColor3ui": _emscripten_glSecondaryColor3ui, "_emscripten_glSecondaryColor3uiv": _emscripten_glSecondaryColor3uiv, "_emscripten_glSecondaryColor3us": _emscripten_glSecondaryColor3us, "_emscripten_glSecondaryColor3usv": _emscripten_glSecondaryColor3usv, "_emscripten_glSecondaryColorPointer": _emscripten_glSecondaryColorPointer, "_emscripten_glSelectBuffer": _emscripten_glSelectBuffer, "_emscripten_glSeparableFilter2D": _emscripten_glSeparableFilter2D, "_emscripten_glShadeModel": _emscripten_glShadeModel, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glTexBuffer": _emscripten_glTexBuffer, "_emscripten_glTexCoord1d": _emscripten_glTexCoord1d, "_emscripten_glTexCoord1dv": _emscripten_glTexCoord1dv, "_emscripten_glTexCoord1f": _emscripten_glTexCoord1f, "_emscripten_glTexCoord1fv": _emscripten_glTexCoord1fv, "_emscripten_glTexCoord1i": _emscripten_glTexCoord1i, "_emscripten_glTexCoord1iv": _emscripten_glTexCoord1iv, "_emscripten_glTexCoord1s": _emscripten_glTexCoord1s, "_emscripten_glTexCoord1sv": _emscripten_glTexCoord1sv, "_emscripten_glTexCoord2d": _emscripten_glTexCoord2d, "_emscripten_glTexCoord2dv": _emscripten_glTexCoord2dv, "_emscripten_glTexCoord2f": _emscripten_glTexCoord2f, "_emscripten_glTexCoord2fv": _emscripten_glTexCoord2fv, "_emscripten_glTexCoord2i": _emscripten_glTexCoord2i, "_emscripten_glTexCoord2iv": _emscripten_glTexCoord2iv, "_emscripten_glTexCoord2s": _emscripten_glTexCoord2s, "_emscripten_glTexCoord2sv": _emscripten_glTexCoord2sv, "_emscripten_glTexCoord3d": _emscripten_glTexCoord3d, "_emscripten_glTexCoord3dv": _emscripten_glTexCoord3dv, "_emscripten_glTexCoord3f": _emscripten_glTexCoord3f, "_emscripten_glTexCoord3fv": _emscripten_glTexCoord3fv, "_emscripten_glTexCoord3i": _emscripten_glTexCoord3i, "_emscripten_glTexCoord3iv": _emscripten_glTexCoord3iv, "_emscripten_glTexCoord3s": _emscripten_glTexCoord3s, "_emscripten_glTexCoord3sv": _emscripten_glTexCoord3sv, "_emscripten_glTexCoord4d": _emscripten_glTexCoord4d, "_emscripten_glTexCoord4dv": _emscripten_glTexCoord4dv, "_emscripten_glTexCoord4f": _emscripten_glTexCoord4f, "_emscripten_glTexCoord4fv": _emscripten_glTexCoord4fv, "_emscripten_glTexCoord4i": _emscripten_glTexCoord4i, "_emscripten_glTexCoord4iv": _emscripten_glTexCoord4iv, "_emscripten_glTexCoord4s": _emscripten_glTexCoord4s, "_emscripten_glTexCoord4sv": _emscripten_glTexCoord4sv, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glTexEnvf": _emscripten_glTexEnvf, "_emscripten_glTexEnvfv": _emscripten_glTexEnvfv, "_emscripten_glTexEnvi": _emscripten_glTexEnvi, "_emscripten_glTexEnviv": _emscripten_glTexEnviv, "_emscripten_glTexGend": _emscripten_glTexGend, "_emscripten_glTexGendv": _emscripten_glTexGendv, "_emscripten_glTexGenf": _emscripten_glTexGenf, "_emscripten_glTexGenfv": _emscripten_glTexGenfv, "_emscripten_glTexGeni": _emscripten_glTexGeni, "_emscripten_glTexGeniv": _emscripten_glTexGeniv, "_emscripten_glTexImage1D": _emscripten_glTexImage1D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "_emscripten_glTexImage3D": _emscripten_glTexImage3D, "_emscripten_glTexParameterIiv": _emscripten_glTexParameterIiv, "_emscripten_glTexParameterIuiv": _emscripten_glTexParameterIuiv, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_emscripten_glTexStorage2D": _emscripten_glTexStorage2D, "_emscripten_glTexStorage3D": _emscripten_glTexStorage3D, "_emscripten_glTexSubImage1D": _emscripten_glTexSubImage1D, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_glTexSubImage3D": _emscripten_glTexSubImage3D, "_emscripten_glTransformFeedbackVaryings": _emscripten_glTransformFeedbackVaryings, "_emscripten_glTranslated": _emscripten_glTranslated, "_emscripten_glTranslatef": _emscripten_glTranslatef, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glUniform1ui": _emscripten_glUniform1ui, "_emscripten_glUniform1uiv": _emscripten_glUniform1uiv, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glUniform2ui": _emscripten_glUniform2ui, "_emscripten_glUniform2uiv": _emscripten_glUniform2uiv, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform3ui": _emscripten_glUniform3ui, "_emscripten_glUniform3uiv": _emscripten_glUniform3uiv, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glUniform4ui": _emscripten_glUniform4ui, "_emscripten_glUniform4uiv": _emscripten_glUniform4uiv, "_emscripten_glUniformBlockBinding": _emscripten_glUniformBlockBinding, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_emscripten_glUniformMatrix2x3fv": _emscripten_glUniformMatrix2x3fv, "_emscripten_glUniformMatrix2x4fv": _emscripten_glUniformMatrix2x4fv, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glUniformMatrix3x2fv": _emscripten_glUniformMatrix3x2fv, "_emscripten_glUniformMatrix3x4fv": _emscripten_glUniformMatrix3x4fv, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glUniformMatrix4x2fv": _emscripten_glUniformMatrix4x2fv, "_emscripten_glUniformMatrix4x3fv": _emscripten_glUniformMatrix4x3fv, "_emscripten_glUnmapBuffer": _emscripten_glUnmapBuffer, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glUseProgramObjectARB": _emscripten_glUseProgramObjectARB, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertex2d": _emscripten_glVertex2d, "_emscripten_glVertex2dv": _emscripten_glVertex2dv, "_emscripten_glVertex2f": _emscripten_glVertex2f, "_emscripten_glVertex2fv": _emscripten_glVertex2fv, "_emscripten_glVertex2i": _emscripten_glVertex2i, "_emscripten_glVertex2iv": _emscripten_glVertex2iv, "_emscripten_glVertex2s": _emscripten_glVertex2s, "_emscripten_glVertex2sv": _emscripten_glVertex2sv, "_emscripten_glVertex3d": _emscripten_glVertex3d, "_emscripten_glVertex3dv": _emscripten_glVertex3dv, "_emscripten_glVertex3f": _emscripten_glVertex3f, "_emscripten_glVertex3fv": _emscripten_glVertex3fv, "_emscripten_glVertex3i": _emscripten_glVertex3i, "_emscripten_glVertex3iv": _emscripten_glVertex3iv, "_emscripten_glVertex3s": _emscripten_glVertex3s, "_emscripten_glVertex3sv": _emscripten_glVertex3sv, "_emscripten_glVertex4d": _emscripten_glVertex4d, "_emscripten_glVertex4dv": _emscripten_glVertex4dv, "_emscripten_glVertex4f": _emscripten_glVertex4f, "_emscripten_glVertex4fv": _emscripten_glVertex4fv, "_emscripten_glVertex4i": _emscripten_glVertex4i, "_emscripten_glVertex4iv": _emscripten_glVertex4iv, "_emscripten_glVertex4s": _emscripten_glVertex4s, "_emscripten_glVertex4sv": _emscripten_glVertex4sv, "_emscripten_glVertexAttrib1d": _emscripten_glVertexAttrib1d, "_emscripten_glVertexAttrib1dv": _emscripten_glVertexAttrib1dv, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glVertexAttrib1s": _emscripten_glVertexAttrib1s, "_emscripten_glVertexAttrib1sv": _emscripten_glVertexAttrib1sv, "_emscripten_glVertexAttrib2d": _emscripten_glVertexAttrib2d, "_emscripten_glVertexAttrib2dv": _emscripten_glVertexAttrib2dv, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_emscripten_glVertexAttrib2s": _emscripten_glVertexAttrib2s, "_emscripten_glVertexAttrib2sv": _emscripten_glVertexAttrib2sv, "_emscripten_glVertexAttrib3d": _emscripten_glVertexAttrib3d, "_emscripten_glVertexAttrib3dv": _emscripten_glVertexAttrib3dv, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_emscripten_glVertexAttrib3s": _emscripten_glVertexAttrib3s, "_emscripten_glVertexAttrib3sv": _emscripten_glVertexAttrib3sv, "_emscripten_glVertexAttrib4Nbv": _emscripten_glVertexAttrib4Nbv, "_emscripten_glVertexAttrib4Niv": _emscripten_glVertexAttrib4Niv, "_emscripten_glVertexAttrib4Nsv": _emscripten_glVertexAttrib4Nsv, "_emscripten_glVertexAttrib4Nub": _emscripten_glVertexAttrib4Nub, "_emscripten_glVertexAttrib4Nubv": _emscripten_glVertexAttrib4Nubv, "_emscripten_glVertexAttrib4Nuiv": _emscripten_glVertexAttrib4Nuiv, "_emscripten_glVertexAttrib4Nusv": _emscripten_glVertexAttrib4Nusv, "_emscripten_glVertexAttrib4bv": _emscripten_glVertexAttrib4bv, "_emscripten_glVertexAttrib4d": _emscripten_glVertexAttrib4d, "_emscripten_glVertexAttrib4dv": _emscripten_glVertexAttrib4dv, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glVertexAttrib4iv": _emscripten_glVertexAttrib4iv, "_emscripten_glVertexAttrib4s": _emscripten_glVertexAttrib4s, "_emscripten_glVertexAttrib4sv": _emscripten_glVertexAttrib4sv, "_emscripten_glVertexAttrib4ubv": _emscripten_glVertexAttrib4ubv, "_emscripten_glVertexAttrib4uiv": _emscripten_glVertexAttrib4uiv, "_emscripten_glVertexAttrib4usv": _emscripten_glVertexAttrib4usv, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_glVertexAttribI1i": _emscripten_glVertexAttribI1i, "_emscripten_glVertexAttribI1iv": _emscripten_glVertexAttribI1iv, "_emscripten_glVertexAttribI1ui": _emscripten_glVertexAttribI1ui, "_emscripten_glVertexAttribI1uiv": _emscripten_glVertexAttribI1uiv, "_emscripten_glVertexAttribI2i": _emscripten_glVertexAttribI2i, "_emscripten_glVertexAttribI2iv": _emscripten_glVertexAttribI2iv, "_emscripten_glVertexAttribI2ui": _emscripten_glVertexAttribI2ui, "_emscripten_glVertexAttribI2uiv": _emscripten_glVertexAttribI2uiv, "_emscripten_glVertexAttribI3i": _emscripten_glVertexAttribI3i, "_emscripten_glVertexAttribI3iv": _emscripten_glVertexAttribI3iv, "_emscripten_glVertexAttribI3ui": _emscripten_glVertexAttribI3ui, "_emscripten_glVertexAttribI3uiv": _emscripten_glVertexAttribI3uiv, "_emscripten_glVertexAttribI4bv": _emscripten_glVertexAttribI4bv, "_emscripten_glVertexAttribI4i": _emscripten_glVertexAttribI4i, "_emscripten_glVertexAttribI4iv": _emscripten_glVertexAttribI4iv, "_emscripten_glVertexAttribI4sv": _emscripten_glVertexAttribI4sv, "_emscripten_glVertexAttribI4ubv": _emscripten_glVertexAttribI4ubv, "_emscripten_glVertexAttribI4ui": _emscripten_glVertexAttribI4ui, "_emscripten_glVertexAttribI4uiv": _emscripten_glVertexAttribI4uiv, "_emscripten_glVertexAttribI4usv": _emscripten_glVertexAttribI4usv, "_emscripten_glVertexAttribIPointer": _emscripten_glVertexAttribIPointer, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glWindowPos2d": _emscripten_glWindowPos2d, "_emscripten_glWindowPos2dv": _emscripten_glWindowPos2dv, "_emscripten_glWindowPos2f": _emscripten_glWindowPos2f, "_emscripten_glWindowPos2fv": _emscripten_glWindowPos2fv, "_emscripten_glWindowPos2i": _emscripten_glWindowPos2i, "_emscripten_glWindowPos2iv": _emscripten_glWindowPos2iv, "_emscripten_glWindowPos2s": _emscripten_glWindowPos2s, "_emscripten_glWindowPos2sv": _emscripten_glWindowPos2sv, "_emscripten_glWindowPos3d": _emscripten_glWindowPos3d, "_emscripten_glWindowPos3dv": _emscripten_glWindowPos3dv, "_emscripten_glWindowPos3f": _emscripten_glWindowPos3f, "_emscripten_glWindowPos3fv": _emscripten_glWindowPos3fv, "_emscripten_glWindowPos3i": _emscripten_glWindowPos3i, "_emscripten_glWindowPos3iv": _emscripten_glWindowPos3iv, "_emscripten_glWindowPos3s": _emscripten_glWindowPos3s, "_emscripten_glWindowPos3sv": _emscripten_glWindowPos3sv, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size, "_emscripten_set_click_callback_on_thread": _emscripten_set_click_callback_on_thread, "_emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread, "_emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread, "_emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread, "_emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread, "_emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread, "_emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread, "_emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread, "_exit": _exit, "_glActiveTexture": _glActiveTexture, "_glAttachShader": _glAttachShader, "_glBindAttribLocation": _glBindAttribLocation, "_glBindBuffer": _glBindBuffer, "_glBindTexture": _glBindTexture, "_glBlendFunc": _glBlendFunc, "_glBufferData": _glBufferData, "_glBufferSubData": _glBufferSubData, "_glClear": _glClear, "_glClearColor": _glClearColor, "_glClearDepthf": _glClearDepthf, "_glCompileShader": _glCompileShader, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_glCreateProgram": _glCreateProgram, "_glCreateShader": _glCreateShader, "_glCullFace": _glCullFace, "_glDeleteBuffers": _glDeleteBuffers, "_glDeleteProgram": _glDeleteProgram, "_glDeleteShader": _glDeleteShader, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_glDetachShader": _glDetachShader, "_glDisable": _glDisable, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glDrawArrays": _glDrawArrays, "_glDrawElements": _glDrawElements, "_glEnable": _glEnable, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_glFrontFace": _glFrontFace, "_glGenBuffers": _glGenBuffers, "_glGenTextures": _glGenTextures, "_glGetAttribLocation": _glGetAttribLocation, "_glGetFloatv": _glGetFloatv, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glGetProgramiv": _glGetProgramiv, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_glGetShaderiv": _glGetShaderiv, "_glGetString": _glGetString, "_glGetUniformLocation": _glGetUniformLocation, "_glLinkProgram": _glLinkProgram, "_glPixelStorei": _glPixelStorei, "_glShaderSource": _glShaderSource, "_glTexImage2D": _glTexImage2D, "_glTexParameterf": _glTexParameterf, "_glTexParameteri": _glTexParameteri, "_glUniform1i": _glUniform1i, "_glUniform4f": _glUniform4f, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_glUseProgram": _glUseProgram, "_glVertexAttribPointer": _glVertexAttribPointer, "_glViewport": _glViewport, "_glfwCreateWindow": _glfwCreateWindow, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "_glfwGetCursorPos": _glfwGetCursorPos, "_glfwGetKey": _glfwGetKey, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glfwGetTime": _glfwGetTime, "_glfwGetVideoModes": _glfwGetVideoModes, "_glfwInit": _glfwInit, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_glfwSetCharCallback": _glfwSetCharCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_glfwSwapBuffers": _glfwSwapBuffers, "_glfwSwapInterval": _glfwSwapInterval, "_glfwTerminate": _glfwTerminate, "_glfwWindowHint": _glfwWindowHint, "_llvm_exp2_f32": _llvm_exp2_f32, "_llvm_stackrestore": _llvm_stackrestore, "_llvm_stacksave": _llvm_stacksave, "_pthread_attr_destroy": _pthread_attr_destroy, "_pthread_attr_init": _pthread_attr_init, "_pthread_cond_destroy": _pthread_cond_destroy, "_pthread_cond_init": _pthread_cond_init, "_pthread_cond_signal": _pthread_cond_signal, "_pthread_cond_wait": _pthread_cond_wait, "_pthread_create": _pthread_create, "_pthread_join": _pthread_join, "_pthread_mutex_destroy": _pthread_mutex_destroy, "_pthread_mutex_init": _pthread_mutex_init, "_time": _time, "_usleep": _usleep, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "emscriptenWebGLGet": emscriptenWebGLGet, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX };
+// EMSCRIPTEN_START_ASM
+var asm =Module["asm"]// EMSCRIPTEN_END_ASM
+(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
+
+Module["asm"] = asm;
+var ___errno_location = Module["___errno_location"] = function() {  return Module["asm"]["___errno_location"].apply(null, arguments) };
+var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = function() {  return Module["asm"]["_emscripten_GetProcAddress"].apply(null, arguments) };
+var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = function() {  return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments) };
+var _free = Module["_free"] = function() {  return Module["asm"]["_free"].apply(null, arguments) };
+var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = function() {  return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments) };
+var _llvm_round_f32 = Module["_llvm_round_f32"] = function() {  return Module["asm"]["_llvm_round_f32"].apply(null, arguments) };
+var _main = Module["_main"] = function() {  return Module["asm"]["_main"].apply(null, arguments) };
+var _malloc = Module["_malloc"] = function() {  return Module["asm"]["_malloc"].apply(null, arguments) };
+var _memcpy = Module["_memcpy"] = function() {  return Module["asm"]["_memcpy"].apply(null, arguments) };
+var _memmove = Module["_memmove"] = function() {  return Module["asm"]["_memmove"].apply(null, arguments) };
+var _memset = Module["_memset"] = function() {  return Module["asm"]["_memset"].apply(null, arguments) };
+var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = function() {  return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments) };
+var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = function() {  return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments) };
+var _sbrk = Module["_sbrk"] = function() {  return Module["asm"]["_sbrk"].apply(null, arguments) };
+var _strstr = Module["_strstr"] = function() {  return Module["asm"]["_strstr"].apply(null, arguments) };
+var establishStackSpace = Module["establishStackSpace"] = function() {  return Module["asm"]["establishStackSpace"].apply(null, arguments) };
+var getTempRet0 = Module["getTempRet0"] = function() {  return Module["asm"]["getTempRet0"].apply(null, arguments) };
+var runPostSets = Module["runPostSets"] = function() {  return Module["asm"]["runPostSets"].apply(null, arguments) };
+var setTempRet0 = Module["setTempRet0"] = function() {  return Module["asm"]["setTempRet0"].apply(null, arguments) };
+var setThrew = Module["setThrew"] = function() {  return Module["asm"]["setThrew"].apply(null, arguments) };
+var stackAlloc = Module["stackAlloc"] = function() {  return Module["asm"]["stackAlloc"].apply(null, arguments) };
+var stackRestore = Module["stackRestore"] = function() {  return Module["asm"]["stackRestore"].apply(null, arguments) };
+var stackSave = Module["stackSave"] = function() {  return Module["asm"]["stackSave"].apply(null, arguments) };
+var dynCall_ff = Module["dynCall_ff"] = function() {  return Module["asm"]["dynCall_ff"].apply(null, arguments) };
+var dynCall_fff = Module["dynCall_fff"] = function() {  return Module["asm"]["dynCall_fff"].apply(null, arguments) };
+var dynCall_i = Module["dynCall_i"] = function() {  return Module["asm"]["dynCall_i"].apply(null, arguments) };
+var dynCall_ii = Module["dynCall_ii"] = function() {  return Module["asm"]["dynCall_ii"].apply(null, arguments) };
+var dynCall_iii = Module["dynCall_iii"] = function() {  return Module["asm"]["dynCall_iii"].apply(null, arguments) };
+var dynCall_iiii = Module["dynCall_iiii"] = function() {  return Module["asm"]["dynCall_iiii"].apply(null, arguments) };
+var dynCall_iiiii = Module["dynCall_iiiii"] = function() {  return Module["asm"]["dynCall_iiiii"].apply(null, arguments) };
+var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() {  return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) };
+var dynCall_jijii = Module["dynCall_jijii"] = function() {  return Module["asm"]["dynCall_jijii"].apply(null, arguments) };
+var dynCall_v = Module["dynCall_v"] = function() {  return Module["asm"]["dynCall_v"].apply(null, arguments) };
+var dynCall_vd = Module["dynCall_vd"] = function() {  return Module["asm"]["dynCall_vd"].apply(null, arguments) };
+var dynCall_vdd = Module["dynCall_vdd"] = function() {  return Module["asm"]["dynCall_vdd"].apply(null, arguments) };
+var dynCall_vddd = Module["dynCall_vddd"] = function() {  return Module["asm"]["dynCall_vddd"].apply(null, arguments) };
+var dynCall_vdddd = Module["dynCall_vdddd"] = function() {  return Module["asm"]["dynCall_vdddd"].apply(null, arguments) };
+var dynCall_vdddddd = Module["dynCall_vdddddd"] = function() {  return Module["asm"]["dynCall_vdddddd"].apply(null, arguments) };
+var dynCall_vf = Module["dynCall_vf"] = function() {  return Module["asm"]["dynCall_vf"].apply(null, arguments) };
+var dynCall_vff = Module["dynCall_vff"] = function() {  return Module["asm"]["dynCall_vff"].apply(null, arguments) };
+var dynCall_vfff = Module["dynCall_vfff"] = function() {  return Module["asm"]["dynCall_vfff"].apply(null, arguments) };
+var dynCall_vffff = Module["dynCall_vffff"] = function() {  return Module["asm"]["dynCall_vffff"].apply(null, arguments) };
+var dynCall_vfi = Module["dynCall_vfi"] = function() {  return Module["asm"]["dynCall_vfi"].apply(null, arguments) };
+var dynCall_vi = Module["dynCall_vi"] = function() {  return Module["asm"]["dynCall_vi"].apply(null, arguments) };
+var dynCall_vid = Module["dynCall_vid"] = function() {  return Module["asm"]["dynCall_vid"].apply(null, arguments) };
+var dynCall_vidd = Module["dynCall_vidd"] = function() {  return Module["asm"]["dynCall_vidd"].apply(null, arguments) };
+var dynCall_viddd = Module["dynCall_viddd"] = function() {  return Module["asm"]["dynCall_viddd"].apply(null, arguments) };
+var dynCall_vidddd = Module["dynCall_vidddd"] = function() {  return Module["asm"]["dynCall_vidddd"].apply(null, arguments) };
+var dynCall_viddidd = Module["dynCall_viddidd"] = function() {  return Module["asm"]["dynCall_viddidd"].apply(null, arguments) };
+var dynCall_viddiiddiii = Module["dynCall_viddiiddiii"] = function() {  return Module["asm"]["dynCall_viddiiddiii"].apply(null, arguments) };
+var dynCall_viddiii = Module["dynCall_viddiii"] = function() {  return Module["asm"]["dynCall_viddiii"].apply(null, arguments) };
+var dynCall_vif = Module["dynCall_vif"] = function() {  return Module["asm"]["dynCall_vif"].apply(null, arguments) };
+var dynCall_viff = Module["dynCall_viff"] = function() {  return Module["asm"]["dynCall_viff"].apply(null, arguments) };
+var dynCall_vifff = Module["dynCall_vifff"] = function() {  return Module["asm"]["dynCall_vifff"].apply(null, arguments) };
+var dynCall_viffff = Module["dynCall_viffff"] = function() {  return Module["asm"]["dynCall_viffff"].apply(null, arguments) };
+var dynCall_viffiff = Module["dynCall_viffiff"] = function() {  return Module["asm"]["dynCall_viffiff"].apply(null, arguments) };
+var dynCall_viffiiffiii = Module["dynCall_viffiiffiii"] = function() {  return Module["asm"]["dynCall_viffiiffiii"].apply(null, arguments) };
+var dynCall_viffiii = Module["dynCall_viffiii"] = function() {  return Module["asm"]["dynCall_viffiii"].apply(null, arguments) };
+var dynCall_vii = Module["dynCall_vii"] = function() {  return Module["asm"]["dynCall_vii"].apply(null, arguments) };
+var dynCall_viid = Module["dynCall_viid"] = function() {  return Module["asm"]["dynCall_viid"].apply(null, arguments) };
+var dynCall_viidddd = Module["dynCall_viidddd"] = function() {  return Module["asm"]["dynCall_viidddd"].apply(null, arguments) };
+var dynCall_viif = Module["dynCall_viif"] = function() {  return Module["asm"]["dynCall_viif"].apply(null, arguments) };
+var dynCall_viiffff = Module["dynCall_viiffff"] = function() {  return Module["asm"]["dynCall_viiffff"].apply(null, arguments) };
+var dynCall_viiffffi = Module["dynCall_viiffffi"] = function() {  return Module["asm"]["dynCall_viiffffi"].apply(null, arguments) };
+var dynCall_viifi = Module["dynCall_viifi"] = function() {  return Module["asm"]["dynCall_viifi"].apply(null, arguments) };
+var dynCall_viii = Module["dynCall_viii"] = function() {  return Module["asm"]["dynCall_viii"].apply(null, arguments) };
+var dynCall_viiii = Module["dynCall_viiii"] = function() {  return Module["asm"]["dynCall_viiii"].apply(null, arguments) };
+var dynCall_viiiii = Module["dynCall_viiiii"] = function() {  return Module["asm"]["dynCall_viiiii"].apply(null, arguments) };
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() {  return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) };
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() {  return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = function() {  return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = function() {  return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = function() {  return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = function() {  return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments) };
+var dynCall_viiji = Module["dynCall_viiji"] = function() {  return Module["asm"]["dynCall_viiji"].apply(null, arguments) };
+;
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module['asm'] = asm;
+
+
+
+
+
+
+
+
+Module["getMemory"] = getMemory;
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+Module["addRunDependency"] = addRunDependency;
+Module["removeRunDependency"] = removeRunDependency;
+
+
+Module["FS_createFolder"] = FS.createFolder;
+Module["FS_createPath"] = FS.createPath;
+Module["FS_createDataFile"] = FS.createDataFile;
+Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
+Module["FS_createLazyFile"] = FS.createLazyFile;
+Module["FS_createLink"] = FS.createLink;
+Module["FS_createDevice"] = FS.createDevice;
+Module["FS_unlink"] = FS.unlink;
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+/**
+ * @constructor
+ * @extends {Error}
+ * @this {ExitStatus}
+ */
+function ExitStatus(status) {
+  this.name = "ExitStatus";
+  this.message = "Program terminated with exit(" + status + ")";
+  this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var initialStackTop;
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+  if (!Module['calledRun']) run();
+  if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+Module['callMain'] = function callMain(args) {
+
+  args = args || [];
+
+  ensureInitRuntime();
+
+  var argc = args.length+1;
+  var argv = stackAlloc((argc + 1) * 4);
+  HEAP32[argv >> 2] = allocateUTF8OnStack(Module['thisProgram']);
+  for (var i = 1; i < argc; i++) {
+    HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]);
+  }
+  HEAP32[(argv >> 2) + argc] = 0;
+
+
+  try {
+
+    var ret = Module['_main'](argc, argv, 0);
+
+
+    // if we're not running an evented main loop, it's time to exit
+      exit(ret, /* implicit = */ true);
+  }
+  catch(e) {
+    if (e instanceof ExitStatus) {
+      // exit() throws this once it's done to make sure execution
+      // has been stopped completely
+      return;
+    } else if (e == 'SimulateInfiniteLoop') {
+      // running an evented main loop, don't immediately exit
+      Module['noExitRuntime'] = true;
+      return;
+    } else {
+      var toLog = e;
+      if (e && typeof e === 'object' && e.stack) {
+        toLog = [e, e.stack];
+      }
+      err('exception thrown: ' + toLog);
+      Module['quit'](1, e);
+    }
+  } finally {
+    calledMain = true;
+  }
+}
+
+
+
+
+/** @type {function(Array=)} */
+function run(args) {
+  args = args || Module['arguments'];
+
+  if (runDependencies > 0) {
+    return;
+  }
+
+
+  preRun();
+
+  if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+  if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+  function doRun() {
+    if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+    Module['calledRun'] = true;
+
+    if (ABORT) return;
+
+    ensureInitRuntime();
+
+    preMain();
+
+    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+    if (Module['_main'] && shouldRunNow) Module['callMain'](args);
+
+    postRun();
+  }
+
+  if (Module['setStatus']) {
+    Module['setStatus']('Running...');
+    setTimeout(function() {
+      setTimeout(function() {
+        Module['setStatus']('');
+      }, 1);
+      doRun();
+    }, 1);
+  } else {
+    doRun();
+  }
+}
+Module['run'] = run;
+
+
+function exit(status, implicit) {
+
+  // if this is just main exit-ing implicitly, and the status is 0, then we
+  // don't need to do anything here and can just leave. if the status is
+  // non-zero, though, then we need to report it.
+  // (we may have warned about this earlier, if a situation justifies doing so)
+  if (implicit && Module['noExitRuntime'] && status === 0) {
+    return;
+  }
+
+  if (Module['noExitRuntime']) {
+  } else {
+
+    ABORT = true;
+    EXITSTATUS = status;
+    STACKTOP = initialStackTop;
+
+    exitRuntime();
+
+    if (Module['onExit']) Module['onExit'](status);
+  }
+
+  Module['quit'](status, new ExitStatus(status));
+}
+
+var abortDecorators = [];
+
+function abort(what) {
+  if (Module['onAbort']) {
+    Module['onAbort'](what);
+  }
+
+  if (what !== undefined) {
+    out(what);
+    err(what);
+    what = JSON.stringify(what)
+  } else {
+    what = '';
+  }
+
+  ABORT = true;
+  EXITSTATUS = 1;
+
+  throw 'abort(' + what + '). Build with -s ASSERTIONS=1 for more info.';
+}
+Module['abort'] = abort;
+
+if (Module['preInit']) {
+  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+  while (Module['preInit'].length > 0) {
+    Module['preInit'].pop()();
+  }
+}
+
+// shouldRunNow refers to calling main(), not run().
+var shouldRunNow = true;
+if (Module['noInitialRun']) {
+  shouldRunNow = false;
+}
+
+  Module["noExitRuntime"] = true;
+
+run();
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+
diff --git a/games/money.wasm b/games/money.wasm
new file mode 100644
index 0000000..55edf3d
--- /dev/null
+++ b/games/money.wasm
author	Ray <[email protected]>	2018-11-17 09:59:52 +0100
committer	Ray <[email protected]>	2018-11-17 09:59:52 +0100
commit	ea1963b411f686e7703a85e8844c6d02e7c5da1b (patch)
tree	19854186c4a4fe1ba5e2929d30fd1256f882b5e7
parent	fd8498b57e1fdb87096a264aa6d4c71700340300 (diff)
download	raylib.com-ea1963b411f686e7703a85e8844c6d02e7c5da1b.tar.gz raylib.com-ea1963b411f686e7703a85e8844c6d02e7c5da1b.zip