diff options
| author | Ray <[email protected]> | 2018-11-23 12:49:30 +0100 |
|---|---|---|
| committer | Ray <[email protected]> | 2018-11-23 12:49:30 +0100 |
| commit | 5c8e72685cb7a26381deb032dd1b9486e2ce2921 (patch) | |
| tree | 788ad8e114ed9dd6001d8a463e7810f44a54b8df /examples/web/audio | |
| parent | ea1963b411f686e7703a85e8844c6d02e7c5da1b (diff) | |
| download | raylib.com-5c8e72685cb7a26381deb032dd1b9486e2ce2921.tar.gz raylib.com-5c8e72685cb7a26381deb032dd1b9486e2ce2921.zip | |
Added audio cracking example for testing
Diffstat (limited to 'examples/web/audio')
| -rw-r--r-- | examples/web/audio/audio_music_stream_test.c | 135 | ||||
| -rw-r--r-- | examples/web/audio/audio_music_stream_test.data | bin | 0 -> 1542425 bytes | |||
| -rw-r--r-- | examples/web/audio/audio_music_stream_test.html | 241 | ||||
| -rw-r--r-- | examples/web/audio/audio_music_stream_test.js | 13892 | ||||
| -rw-r--r-- | examples/web/audio/audio_music_stream_test.wasm | bin | 0 -> 294331 bytes | |||
| -rw-r--r-- | examples/web/audio/resources/game.mp3 | bin | 0 -> 1542425 bytes |
6 files changed, 14268 insertions, 0 deletions
diff --git a/examples/web/audio/audio_music_stream_test.c b/examples/web/audio/audio_music_stream_test.c new file mode 100644 index 0000000..63705ce --- /dev/null +++ b/examples/web/audio/audio_music_stream_test.c @@ -0,0 +1,135 @@ +/******************************************************************************************* +* +* raylib [audio] example - Music playing (streaming) (adapted for HTML5 platform) +* +* NOTE: This example requires OpenAL Soft library installed +* +* This example has been created using raylib 1.7 (www.raylib.com) +* raylib is licensed under an unmodified zlib/libpng license (View raylib.h for details) +* +* Copyright (c) 2015 Ramon Santamaria (@raysan5) +* +********************************************************************************************/ + +#include "raylib.h" + +#if defined(PLATFORM_WEB) + #include <emscripten/emscripten.h> +#endif + +#if defined(PLATFORM_ANDROID) + #include "android_native_app_glue.h" +#endif + +//---------------------------------------------------------------------------------- +// Global Variables Definition +//---------------------------------------------------------------------------------- +int screenWidth = 800; +int screenHeight = 450; + +int framesCounter = 0; +float timePlayed = 0.0f; +static bool pause = false; + +Music music; + +//---------------------------------------------------------------------------------- +// Module Functions Declaration +//---------------------------------------------------------------------------------- +void UpdateDrawFrame(void); // Update and Draw one frame + +//---------------------------------------------------------------------------------- +// Main Enry Point +//---------------------------------------------------------------------------------- +#if defined(PLATFORM_ANDROID) +void android_main(struct android_app *app) +#else +int main(void) +#endif +{ + // Initialization + //-------------------------------------------------------------------------------------- +#if defined(PLATFORM_ANDROID) + InitWindow(screenWidth, screenHeight, app); +#else + InitWindow(screenWidth, screenHeight, "raylib [audio] example - music playing (streaming)"); +#endif + + InitAudioDevice(); // Initialize audio device + + music = LoadMusicStream("resources/game.mp3"); + + PlayMusicStream(music); + +#if defined(PLATFORM_WEB) + emscripten_set_main_loop(UpdateDrawFrame, 0, 1); +#else + SetTargetFPS(60); // Set our game to run at 60 frames-per-second + //-------------------------------------------------------------------------------------- + + // Main game loop + while (!WindowShouldClose()) // Detect window close button or ESC key + { + UpdateDrawFrame(); + } +#endif + + // De-Initialization + //-------------------------------------------------------------------------------------- + UnloadMusicStream(music); // Unload music stream buffers from RAM + + CloseAudioDevice(); // Close audio device (music streaming is automatically stopped) + CloseWindow(); // Close window and OpenGL context + //-------------------------------------------------------------------------------------- +#if !defined(PLATFORM_ANDROID) + return 0; +#endif +} + +//---------------------------------------------------------------------------------- +// Module Functions Definition +//---------------------------------------------------------------------------------- +void UpdateDrawFrame(void) +{ + // Update + //---------------------------------------------------------------------------------- + UpdateMusicStream(music); // Update music buffer with new stream data + + // Restart music playing (stop and play) + if (IsKeyPressed(KEY_SPACE)) + { + StopMusicStream(music); + PlayMusicStream(music); + } + + // Pause/Resume music playing + if (IsKeyPressed(KEY_P)) + { + pause = !pause; + + if (pause) PauseMusicStream(music); + else ResumeMusicStream(music); + } + + // Get timePlayed scaled to bar dimensions (400 pixels) + timePlayed = GetMusicTimePlayed(music)/GetMusicTimeLength(music)*400; + //---------------------------------------------------------------------------------- + + // Draw + //---------------------------------------------------------------------------------- + BeginDrawing(); + + ClearBackground(RAYWHITE); + + DrawText("MUSIC SHOULD BE PLAYING!", 255, 150, 20, LIGHTGRAY); + + DrawRectangle(200, 200, 400, 12, LIGHTGRAY); + DrawRectangle(200, 200, (int)timePlayed, 12, MAROON); + DrawRectangleLines(200, 200, 400, 12, GRAY); + + DrawText("PRESS SPACE TO RESTART MUSIC", 215, 250, 20, LIGHTGRAY); + DrawText("PRESS P TO PAUSE/RESUME MUSIC", 208, 280, 20, LIGHTGRAY); + + EndDrawing(); + //---------------------------------------------------------------------------------- +}
\ No newline at end of file diff --git a/examples/web/audio/audio_music_stream_test.data b/examples/web/audio/audio_music_stream_test.data Binary files differnew file mode 100644 index 0000000..669da32 --- /dev/null +++ b/examples/web/audio/audio_music_stream_test.data diff --git a/examples/web/audio/audio_music_stream_test.html b/examples/web/audio/audio_music_stream_test.html new file mode 100644 index 0000000..f2d3351 --- /dev/null +++ b/examples/web/audio/audio_music_stream_test.html @@ -0,0 +1,241 @@ +<!doctype html> +<html lang="en-us"> + <head> + <meta charset="utf-8"> + <meta http-equiv="Content-Type" content="text/html; charset=utf-8"> + + <title>raylib HTML5 GAME</title> + + <meta name="title" content="raylib HTML5 GAME"> + <meta name="description" content="New HTML5 videogame, developed using raylib videogames library"> + <meta name="keywords" content="raylib, games, html5, programming, C, C++, library, learn, videogames"> + <meta name="viewport" content="width=device-width"> + + <!-- Facebook metatags for sharing --> + <meta property="og:title" content="raylib HTML5 GAME"> + <meta property="og:image:type" content="image/png"> + <meta property="og:image" content="http://www.raylib.com/common/img/raylib_logo.png"> + <meta property="og:image" content="http://www.raylib.com/common/img/raylib_logo.png"> + <meta property="og:url" content="http://www.raylib.com/games"> + <meta property="og:site_name" content="raylib.com"> + <meta property="og:description" content="New hmtl5 videogame, developed using raylib videogames library"> + + <!-- Twitter metatags for sharing --> + <meta name="twitter:card" content="summary"> + <meta name="twitter:site" content="@raysan5"> + <meta name="twitter:title" content="raylib HTML5 GAME"> + <meta name="twitter:description" content="New HTML5 videogame, developed using raylib videogames library"> + <meta name="twitter:image" content="http://www.raylib.com/common/img/raylib_logo.png"> + <meta name="twitter:url" content="http://www.raylib.com/common/img/raylib_logo.png"> + + <!--<link rel="stylesheet" href="./Koala Seasons by emegeme_files/main.css">--> + <link rel="shortcut icon" href="http://www.raylib.com/favicon.ico"> + + <style> + body { + font-family: arial; + margin: 0; + padding: none; + } + + #header_part { + width: 100%; + height: 80px; + background-color: #888888; + } + + #logo { + width:64px; + height:64px; + float:left; + position:relative; + margin:10px; + background-image:url(http://www.raylib.com/common/img/raylib_logo_64x64.png); + } + + .emscripten { padding-right: 0; margin-left: auto; margin-right: auto; display: block; } + div.emscripten { text-align: center; } + div.emscripten_border { border: 1px solid black; } + + /* the canvas *must not* have any border or padding, or mouse coords will be wrong */ + canvas.emscripten { border: 0px none; background: black; width: 100% } + + #emscripten_logo { + display: inline-block; + margin: 0; + } + + .spinner { + height: 30px; + width: 30px; + margin: 0; + margin-top: 20px; + margin-left: 20px; + display: inline-block; + vertical-align: top; + -webkit-animation: rotation .8s linear infinite; + -moz-animation: rotation .8s linear infinite; + -o-animation: rotation .8s linear infinite; + animation: rotation 0.8s linear infinite; + border-left: 5px solid black; + border-right: 5px solid black; + border-bottom: 5px solid black; + border-top: 5px solid red; + + border-radius: 100%; + background-color: rgb(245, 245, 245); + } + @-webkit-keyframes rotation { + from {-webkit-transform: rotate(0deg);} + to {-webkit-transform: rotate(360deg);} + } + @-moz-keyframes rotation { + from {-moz-transform: rotate(0deg);} + to {-moz-transform: rotate(360deg);} + } + @-o-keyframes rotation { + from {-o-transform: rotate(0deg);} + to {-o-transform: rotate(360deg);} + } + @keyframes rotation { + from {transform: rotate(0deg);} + to {transform: rotate(360deg);} + } + + #status { + display: inline-block; + vertical-align: top; + margin-top: 30px; + margin-left: 20px; + font-weight: bold; + color: rgb(40, 40, 40); + } + + #progress { + height: 20px; + width: 30px; + } + + #controls { + display: inline-block; + float: right; + vertical-align: top; + margin-top: 30px; + margin-right: 20px; + } + + #output { + width: 100%; + height: 140px; + margin: 0 auto; + margin-top: 10px; + display: block; + background-color: black; + color: rgb(37, 174, 38); + font-family: 'Lucida Console', Monaco, monospace; + outline: none; + } + </style> + </head> + <body> + <div id="header_part"> + <a id="logo" href="http://www.raylib.com"></a> + + <div class="spinner" id='spinner'></div> + <div class="emscripten" id="status">Downloading...</div> + + <span id='controls'> + <span><input type="button" value="Fullscreen" onclick="Module.requestFullscreen(false, false)"></span> + </span> + + <div class="emscripten"> + <progress value="0" max="100" id="progress" hidden=1></progress> + </div> + </div> + + <div class="emscripten_border"> + <canvas class="emscripten" id="canvas" oncontextmenu="event.preventDefault()"></canvas> + </div> + + <textarea id="output" rows="8"></textarea> + + <script type='text/javascript'> + var statusElement = document.getElementById('status'); + var progressElement = document.getElementById('progress'); + var spinnerElement = document.getElementById('spinner'); + var Module = { + preRun: [], + postRun: [], + print: (function() { + var element = document.getElementById('output'); + if (element) element.value = ''; // clear browser cache + return function(text) { + if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' '); + // These replacements are necessary if you render to raw HTML + //text = text.replace(/&/g, "&"); + //text = text.replace(/</g, "<"); + //text = text.replace(/>/g, ">"); + //text = text.replace('\n', '<br>', 'g'); + console.log(text); + if (element) { + element.value += text + "\n"; + element.scrollTop = element.scrollHeight; // focus on bottom + } + }; + })(), + printErr: function(text) { + if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' '); + if (0) { // XXX disabled for safety typeof dump == 'function') { + dump(text + '\n'); // fast, straight to the real console + } else { + console.error(text); + } + }, + canvas: (function() { + var canvas = document.getElementById('canvas'); + // As a default initial behavior, pop up an alert when webgl context is lost. To make your + // application robust, you may want to override this behavior before shipping! + // See http://www.khronos.org/registry/webgl/specs/latest/1.0/#5.15.2 + canvas.addEventListener("webglcontextlost", function(e) { alert('WebGL context lost. You will need to reload the page.'); e.preventDefault(); }, false); + return canvas; + })(), + setStatus: function(text) { + if (!Module.setStatus.last) Module.setStatus.last = { time: Date.now(), text: '' }; + if (text === Module.setStatus.text) return; + var m = text.match(/([^(]+)\((\d+(\.\d+)?)\/(\d+)\)/); + var now = Date.now(); + if (m && now - Date.now() < 30) return; // if this is a progress update, skip it if too soon + if (m) { + text = m[1]; + progressElement.value = parseInt(m[2])*100; + progressElement.max = parseInt(m[4])*100; + progressElement.hidden = false; + spinnerElement.hidden = false; + } else { + progressElement.value = null; + progressElement.max = null; + progressElement.hidden = true; + if (!text) spinnerElement.style.display = 'none'; + } + statusElement.innerHTML = text; + }, + totalDependencies: 0, + monitorRunDependencies: function(left) { + this.totalDependencies = Math.max(this.totalDependencies, left); + Module.setStatus(left ? 'Preparing... (' + (this.totalDependencies-left) + '/' + this.totalDependencies + ')' : 'All downloads complete.'); + } + }; + Module.setStatus('Downloading...'); + window.onerror = function(event) { + // TODO: do not warn on ok events like simulating an infinite loop or exitStatus + Module.setStatus('Exception thrown, see JavaScript console'); + spinnerElement.style.display = 'none'; + Module.setStatus = function(text) { + if (text) Module.printErr('[post-exception status] ' + text); + }; + }; + </script> + <script async type="text/javascript" src="audio_music_stream_test.js"></script> + </body> +</html> + diff --git a/examples/web/audio/audio_music_stream_test.js b/examples/web/audio/audio_music_stream_test.js new file mode 100644 index 0000000..ac795ca --- /dev/null +++ b/examples/web/audio/audio_music_stream_test.js @@ -0,0 +1,13892 @@ +// Copyright 2010 The Emscripten Authors. All rights reserved. +// Emscripten is available under two separate licenses, the MIT license and the +// University of Illinois/NCSA Open Source License. Both these licenses can be +// found in the LICENSE file. + +// The Module object: Our interface to the outside world. We import +// and export values on it. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to check if Module already exists (e.g. case 3 above). +// Substitution will be replaced with actual code on later stage of the build, +// this way Closure Compiler will not mangle it (e.g. case 4. above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module = typeof Module !== 'undefined' ? Module : {}; + +// --pre-jses are emitted after the Module integration code, so that they can +// refer to Module (if they choose; they can also define Module) + +if (!Module.expectedDataFileDownloads) { + Module.expectedDataFileDownloads = 0; + Module.finishedDataFileDownloads = 0; +} +Module.expectedDataFileDownloads++; +(function() { + var loadPackage = function(metadata) { + + var PACKAGE_PATH; + if (typeof window === 'object') { + PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/'); + } else if (typeof location !== 'undefined') { + // worker + PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/'); + } else { + throw 'using preloaded data can only be done on a web page or in a web worker'; + } + var PACKAGE_NAME = 'audio/audio_music_stream_test.data'; + var REMOTE_PACKAGE_BASE = 'audio_music_stream_test.data'; + if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) { + Module['locateFile'] = Module['locateFilePackage']; + err('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)'); + } + var REMOTE_PACKAGE_NAME = Module['locateFile'] ? Module['locateFile'](REMOTE_PACKAGE_BASE, '') : REMOTE_PACKAGE_BASE; + + var REMOTE_PACKAGE_SIZE = metadata.remote_package_size; + var PACKAGE_UUID = metadata.package_uuid; + + function fetchRemotePackage(packageName, packageSize, callback, errback) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', packageName, true); + xhr.responseType = 'arraybuffer'; + xhr.onprogress = function(event) { + var url = packageName; + var size = packageSize; + if (event.total) size = event.total; + if (event.loaded) { + if (!xhr.addedTotal) { + xhr.addedTotal = true; + if (!Module.dataFileDownloads) Module.dataFileDownloads = {}; + Module.dataFileDownloads[url] = { + loaded: event.loaded, + total: size + }; + } else { + Module.dataFileDownloads[url].loaded = event.loaded; + } + var total = 0; + var loaded = 0; + var num = 0; + for (var download in Module.dataFileDownloads) { + var data = Module.dataFileDownloads[download]; + total += data.total; + loaded += data.loaded; + num++; + } + total = Math.ceil(total * Module.expectedDataFileDownloads/num); + if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')'); + } else if (!Module.dataFileDownloads) { + if (Module['setStatus']) Module['setStatus']('Downloading data...'); + } + }; + xhr.onerror = function(event) { + throw new Error("NetworkError for: " + packageName); + } + xhr.onload = function(event) { + if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + var packageData = xhr.response; + callback(packageData); + } else { + throw new Error(xhr.statusText + " : " + xhr.responseURL); + } + }; + xhr.send(null); + }; + + function handleError(error) { + console.error('package error:', error); + }; + + var fetchedCallback = null; + var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null; + + if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) { + if (fetchedCallback) { + fetchedCallback(data); + fetchedCallback = null; + } else { + fetched = data; + } + }, handleError); + + function runWithFS() { + + function assert(check, msg) { + if (!check) throw msg + new Error().stack; + } +Module['FS_createPath']('/', 'resources', true, true); + + function DataRequest(start, end, audio) { + this.start = start; + this.end = end; + this.audio = audio; + } + DataRequest.prototype = { + requests: {}, + open: function(mode, name) { + this.name = name; + this.requests[name] = this; + Module['addRunDependency']('fp ' + this.name); + }, + send: function() {}, + onload: function() { + var byteArray = this.byteArray.subarray(this.start, this.end); + this.finish(byteArray); + }, + finish: function(byteArray) { + var that = this; + + Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change + Module['removeRunDependency']('fp ' + that.name); + + this.requests[this.name] = null; + } + }; + + var files = metadata.files; + for (var i = 0; i < files.length; ++i) { + new DataRequest(files[i].start, files[i].end, files[i].audio).open('GET', files[i].filename); + } + + + function processPackageData(arrayBuffer) { + Module.finishedDataFileDownloads++; + assert(arrayBuffer, 'Loading data file failed.'); + assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData'); + var byteArray = new Uint8Array(arrayBuffer); + var curr; + + // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though + // (we may be allocating before malloc is ready, during startup). + var ptr = Module['getMemory'](byteArray.length); + Module['HEAPU8'].set(byteArray, ptr); + DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length); + + var files = metadata.files; + for (var i = 0; i < files.length; ++i) { + DataRequest.prototype.requests[files[i].filename].onload(); + } + Module['removeRunDependency']('datafile_audio/audio_music_stream_test.data'); + + }; + Module['addRunDependency']('datafile_audio/audio_music_stream_test.data'); + + if (!Module.preloadResults) Module.preloadResults = {}; + + Module.preloadResults[PACKAGE_NAME] = {fromCache: false}; + if (fetched) { + processPackageData(fetched); + fetched = null; + } else { + fetchedCallback = processPackageData; + } + + } + if (Module['calledRun']) { + runWithFS(); + } else { + if (!Module['preRun']) Module['preRun'] = []; + Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it + } + + } + loadPackage({"files": [{"start": 0, "audio": 1, "end": 1542425, "filename": "/resources/game.mp3"}], "remote_package_size": 1542425, "package_uuid": "9536de61-1e5a-4f44-a002-a9f8563bc239"}); + +})(); + + + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = {}; +var key; +for (key in Module) { + if (Module.hasOwnProperty(key)) { + moduleOverrides[key] = Module[key]; + } +} + +Module['arguments'] = []; +Module['thisProgram'] = './this.program'; +Module['quit'] = function(status, toThrow) { + throw toThrow; +}; +Module['preRun'] = []; +Module['postRun'] = []; + +// Determine the runtime environment we are in. You can customize this by +// setting the ENVIRONMENT setting at compile time (see settings.js). + +var ENVIRONMENT_IS_WEB = false; +var ENVIRONMENT_IS_WORKER = false; +var ENVIRONMENT_IS_NODE = false; +var ENVIRONMENT_IS_SHELL = false; +ENVIRONMENT_IS_WEB = typeof window === 'object'; +ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; +ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; +ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + + +// Three configurations we can be running in: +// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) +// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) +// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) + +// `/` should be present at the end if `scriptDirectory` is not empty +var scriptDirectory = ''; +function locateFile(path) { + if (Module['locateFile']) { + return Module['locateFile'](path, scriptDirectory); + } else { + return scriptDirectory + path; + } +} + +if (ENVIRONMENT_IS_NODE) { + scriptDirectory = __dirname + '/'; + + // Expose functionality in the same simple way that the shells work + // Note that we pollute the global namespace here, otherwise we break in node + var nodeFS; + var nodePath; + + Module['read'] = function shell_read(filename, binary) { + var ret; + if (!nodeFS) nodeFS = require('fs'); + if (!nodePath) nodePath = require('path'); + filename = nodePath['normalize'](filename); + ret = nodeFS['readFileSync'](filename); + return binary ? ret : ret.toString(); + }; + + Module['readBinary'] = function readBinary(filename) { + var ret = Module['read'](filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; + }; + + if (process['argv'].length > 1) { + Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); + } + + Module['arguments'] = process['argv'].slice(2); + + if (typeof module !== 'undefined') { + module['exports'] = Module; + } + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + // Currently node will swallow unhandled rejections, but this behavior is + // deprecated, and in the future it will exit with error status. + process['on']('unhandledRejection', abort); + + Module['quit'] = function(status) { + process['exit'](status); + }; + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; +} else +if (ENVIRONMENT_IS_SHELL) { + + + if (typeof read != 'undefined') { + Module['read'] = function shell_read(f) { + return read(f); + }; + } + + Module['readBinary'] = function readBinary(f) { + var data; + if (typeof readbuffer === 'function') { + return new Uint8Array(readbuffer(f)); + } + data = read(f, 'binary'); + assert(typeof data === 'object'); + return data; + }; + + if (typeof scriptArgs != 'undefined') { + Module['arguments'] = scriptArgs; + } else if (typeof arguments != 'undefined') { + Module['arguments'] = arguments; + } + + if (typeof quit === 'function') { + Module['quit'] = function(status) { + quit(status); + } + } +} else +if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled + scriptDirectory = self.location.href; + } else if (document.currentScript) { // web + scriptDirectory = document.currentScript.src; + } + // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. + // otherwise, slice off the final part of the url to find the script directory. + // if scriptDirectory does not contain a slash, lastIndexOf will return -1, + // and scriptDirectory will correctly be replaced with an empty string. + if (scriptDirectory.indexOf('blob:') !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1); + } else { + scriptDirectory = ''; + } + + + Module['read'] = function shell_read(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + }; + + if (ENVIRONMENT_IS_WORKER) { + Module['readBinary'] = function readBinary(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.responseType = 'arraybuffer'; + xhr.send(null); + return new Uint8Array(xhr.response); + }; + } + + Module['readAsync'] = function readAsync(url, onload, onerror) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = function xhr_onload() { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + return; + } + onerror(); + }; + xhr.onerror = onerror; + xhr.send(null); + }; + + Module['setWindowTitle'] = function(title) { document.title = title }; +} else +{ +} + +// Set up the out() and err() hooks, which are how we can print to stdout or +// stderr, respectively. +// If the user provided Module.print or printErr, use that. Otherwise, +// console.log is checked first, as 'print' on the web will open a print dialogue +// printErr is preferable to console.warn (works better in shells) +// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior. +var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null)); +var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out)); + +// Merge back in the overrides +for (key in moduleOverrides) { + if (moduleOverrides.hasOwnProperty(key)) { + Module[key] = moduleOverrides[key]; + } +} +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = undefined; + +// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message + + + +// Copyright 2017 The Emscripten Authors. All rights reserved. +// Emscripten is available under two separate licenses, the MIT license and the +// University of Illinois/NCSA Open Source License. Both these licenses can be +// found in the LICENSE file. + +// {{PREAMBLE_ADDITIONS}} + +var STACK_ALIGN = 16; + + +function staticAlloc(size) { + var ret = STATICTOP; + STATICTOP = (STATICTOP + size + 15) & -16; + return ret; +} + +function dynamicAlloc(size) { + var ret = HEAP32[DYNAMICTOP_PTR>>2]; + var end = (ret + size + 15) & -16; + HEAP32[DYNAMICTOP_PTR>>2] = end; + if (end >= TOTAL_MEMORY) { + var success = enlargeMemory(); + if (!success) { + HEAP32[DYNAMICTOP_PTR>>2] = ret; + return 0; + } + } + return ret; +} + +function alignMemory(size, factor) { + if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default + var ret = size = Math.ceil(size / factor) * factor; + return ret; +} + +function getNativeTypeSize(type) { + switch (type) { + case 'i1': case 'i8': return 1; + case 'i16': return 2; + case 'i32': return 4; + case 'i64': return 8; + case 'float': return 4; + case 'double': return 8; + default: { + if (type[type.length-1] === '*') { + return 4; // A pointer + } else if (type[0] === 'i') { + var bits = parseInt(type.substr(1)); + assert(bits % 8 === 0); + return bits / 8; + } else { + return 0; + } + } + } +} + +function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text); + } +} + +var asm2wasmImports = { // special asm2wasm imports + "f64-rem": function(x, y) { + return x % y; + }, + "debugger": function() { + debugger; + } +}; + + + +var jsCallStartIndex = 1; +var functionPointers = new Array(0); + +// 'sig' parameter is only used on LLVM wasm backend +function addFunction(func, sig) { + var base = 0; + for (var i = base; i < base + 0; i++) { + if (!functionPointers[i]) { + functionPointers[i] = func; + return jsCallStartIndex + i; + } + } + throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; +} + +function removeFunction(index) { + functionPointers[index-jsCallStartIndex] = null; +} + +var funcWrappers = {}; + +function getFuncWrapper(func, sig) { + if (!func) return; // on null pointer, return undefined + assert(sig); + if (!funcWrappers[sig]) { + funcWrappers[sig] = {}; + } + var sigCache = funcWrappers[sig]; + if (!sigCache[func]) { + // optimize away arguments usage in common cases + if (sig.length === 1) { + sigCache[func] = function dynCall_wrapper() { + return dynCall(sig, func); + }; + } else if (sig.length === 2) { + sigCache[func] = function dynCall_wrapper(arg) { + return dynCall(sig, func, [arg]); + }; + } else { + // general case + sigCache[func] = function dynCall_wrapper() { + return dynCall(sig, func, Array.prototype.slice.call(arguments)); + }; + } + } + return sigCache[func]; +} + + +function makeBigInt(low, high, unsigned) { + return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0)); +} + +function dynCall(sig, ptr, args) { + if (args && args.length) { + return Module['dynCall_' + sig].apply(null, [ptr].concat(args)); + } else { + return Module['dynCall_' + sig].call(null, ptr); + } +} + +var tempRet0 = 0; + +var setTempRet0 = function(value) { + tempRet0 = value; +} + +var getTempRet0 = function() { + return tempRet0; +} + + +var Runtime = { + // FIXME backwards compatibility layer for ports. Support some Runtime.* + // for now, fix it there, then remove it from here. That way we + // can minimize any period of breakage. + dynCall: dynCall, // for SDL2 port +}; + +// The address globals begin at. Very low in memory, for code size and optimization opportunities. +// Above 0 is static memory, starting with globals. +// Then the stack. +// Then 'dynamic' memory for sbrk. +var GLOBAL_BASE = 1024; + + +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + + + +//======================================== +// Runtime essentials +//======================================== + +// whether we are quitting the application. no code should run after this. +// set in exit() and abort() +var ABORT = false; + +// set by exit() and abort(). Passed to 'onExit' handler. +// NOTE: This is also used as the process return code code in shell environments +// but only when noExitRuntime is false. +var EXITSTATUS = 0; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed: ' + text); + } +} + +var globalScope = this; + +// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) +function getCFunc(ident) { + var func = Module['_' + ident]; // closure exported function + assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported'); + return func; +} + +var JSfuncs = { + // Helpers for cwrap -- it can't refer to Runtime directly because it might + // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find + // out what the minified function name is. + 'stackSave': function() { + stackSave() + }, + 'stackRestore': function() { + stackRestore() + }, + // type conversion from js to c + 'arrayToC' : function(arr) { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + }, + 'stringToC' : function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + var len = (str.length << 2) + 1; + ret = stackAlloc(len); + stringToUTF8(str, ret, len); + } + return ret; + } +}; + +// For fast lookup of conversion functions +var toC = { + 'string': JSfuncs['stringToC'], 'array': JSfuncs['arrayToC'] +}; + + +// C calling interface. +function ccall(ident, returnType, argTypes, args, opts) { + function convertReturnValue(ret) { + if (returnType === 'string') return Pointer_stringify(ret); + if (returnType === 'boolean') return Boolean(ret); + return ret; + } + + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + ret = convertReturnValue(ret); + if (stack !== 0) stackRestore(stack); + return ret; +} + +function cwrap(ident, returnType, argTypes, opts) { + argTypes = argTypes || []; + // When the function takes numbers and returns a number, we can just return + // the original function + var numericArgs = argTypes.every(function(type){ return type === 'number'}); + var numericRet = returnType !== 'string'; + if (numericRet && numericArgs && !opts) { + return getCFunc(ident); + } + return function() { + return ccall(ident, returnType, argTypes, arguments, opts); + } +} + +/** @type {function(number, number, string, boolean=)} */ +function setValue(ptr, value, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': HEAP8[((ptr)>>0)]=value; break; + case 'i8': HEAP8[((ptr)>>0)]=value; break; + case 'i16': HEAP16[((ptr)>>1)]=value; break; + case 'i32': HEAP32[((ptr)>>2)]=value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)]=value; break; + case 'double': HEAPF64[((ptr)>>3)]=value; break; + default: abort('invalid type for setValue: ' + type); + } +} + +/** @type {function(number, string, boolean=)} */ +function getValue(ptr, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + default: abort('invalid type for getValue: ' + type); + } + return null; +} + +var ALLOC_NORMAL = 0; // Tries to use _malloc() +var ALLOC_STACK = 1; // Lives for the duration of the current function call +var ALLOC_STATIC = 2; // Cannot be freed +var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk +var ALLOC_NONE = 4; // Do not allocate + +// allocate(): This is for internal use. You can use it yourself as well, but the interface +// is a little tricky (see docs right below). The reason is that it is optimized +// for multiple syntaxes to save space in generated code. So you should +// normally not use allocate(), and instead allocate memory using _malloc(), +// initialize it with setValue(), and so forth. +// @slab: An array of data, or a number. If a number, then the size of the block to allocate, +// in *bytes* (note that this is sometimes confusing: the next parameter does not +// affect this!) +// @types: Either an array of types, one for each byte (or 0 if no type at that position), +// or a single type which is used for the entire block. This only matters if there +// is initial data - if @slab is a number, then this does not matter at all and is +// ignored. +// @allocator: How to allocate memory, see ALLOC_* +/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */ +function allocate(slab, types, allocator, ptr) { + var zeroinit, size; + if (typeof slab === 'number') { + zeroinit = true; + size = slab; + } else { + zeroinit = false; + size = slab.length; + } + + var singleType = typeof types === 'string' ? types : null; + + var ret; + if (allocator == ALLOC_NONE) { + ret = ptr; + } else { + ret = [typeof _malloc === 'function' ? _malloc : staticAlloc, stackAlloc, staticAlloc, dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); + } + + if (zeroinit) { + var stop; + ptr = ret; + assert((ret & 3) == 0); + stop = ret + (size & ~3); + for (; ptr < stop; ptr += 4) { + HEAP32[((ptr)>>2)]=0; + } + stop = ret + size; + while (ptr < stop) { + HEAP8[((ptr++)>>0)]=0; + } + return ret; + } + + if (singleType === 'i8') { + if (slab.subarray || slab.slice) { + HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret); + } else { + HEAPU8.set(new Uint8Array(slab), ret); + } + return ret; + } + + var i = 0, type, typeSize, previousType; + while (i < size) { + var curr = slab[i]; + + type = singleType || types[i]; + if (type === 0) { + i++; + continue; + } + + if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later + + setValue(ret+i, curr, type); + + // no need to look up size unless type changes, so cache it + if (previousType !== type) { + typeSize = getNativeTypeSize(type); + previousType = type; + } + i += typeSize; + } + + return ret; +} + +// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready +function getMemory(size) { + if (!staticSealed) return staticAlloc(size); + if (!runtimeInitialized) return dynamicAlloc(size); + return _malloc(size); +} + +/** @type {function(number, number=)} */ +function Pointer_stringify(ptr, length) { + if (length === 0 || !ptr) return ''; + // Find the length, and check for UTF while doing so + var hasUtf = 0; + var t; + var i = 0; + while (1) { + t = HEAPU8[(((ptr)+(i))>>0)]; + hasUtf |= t; + if (t == 0 && !length) break; + i++; + if (length && i == length) break; + } + if (!length) length = i; + + var ret = ''; + + if (hasUtf < 128) { + var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack + var curr; + while (length > 0) { + curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); + ret = ret ? ret + curr : curr; + ptr += MAX_CHUNK; + length -= MAX_CHUNK; + } + return ret; + } + return UTF8ToString(ptr); +} + +// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function AsciiToString(ptr) { + var str = ''; + while (1) { + var ch = HEAP8[((ptr++)>>0)]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns +// a copy of that string as a Javascript String object. + +var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined; +function UTF8ArrayToString(u8Array, idx) { + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + while (u8Array[endPtr]) ++endPtr; + + if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { + return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); + } else { + var u0, u1, u2, u3, u4, u5; + + var str = ''; + while (1) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + u0 = u8Array[idx++]; + if (!u0) return str; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + u1 = u8Array[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + u2 = u8Array[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + u3 = u8Array[idx++] & 63; + if ((u0 & 0xF8) == 0xF0) { + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; + } else { + u4 = u8Array[idx++] & 63; + if ((u0 & 0xFC) == 0xF8) { + u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; + } else { + u5 = u8Array[idx++] & 63; + u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; + } + } + } + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + } +} + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function UTF8ToString(ptr) { + return UTF8ArrayToString(HEAPU8,ptr); +} + +// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', +// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. +// outIdx: The starting offset in the array to begin the copying. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. +// This count should include the null terminator, +// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. +// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) { + var u1 = str.charCodeAt(++i); + u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); + } + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + outU8Array[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + outU8Array[outIdx++] = 0xC0 | (u >> 6); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + outU8Array[outIdx++] = 0xE0 | (u >> 12); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x1FFFFF) { + if (outIdx + 3 >= endIdx) break; + outU8Array[outIdx++] = 0xF0 | (u >> 18); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x3FFFFFF) { + if (outIdx + 4 >= endIdx) break; + outU8Array[outIdx++] = 0xF8 | (u >> 24); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 5 >= endIdx) break; + outU8Array[outIdx++] = 0xFC | (u >> 30); + outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + outU8Array[outIdx] = 0; + return outIdx - startIdx; +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) { + ++len; + } else if (u <= 0x7FF) { + len += 2; + } else if (u <= 0xFFFF) { + len += 3; + } else if (u <= 0x1FFFFF) { + len += 4; + } else if (u <= 0x3FFFFFF) { + len += 5; + } else { + len += 6; + } + } + return len; +} + +// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined; +function UTF16ToString(ptr) { + var endPtr = ptr; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + var idx = endPtr >> 1; + while (HEAP16[idx]) ++idx; + endPtr = idx << 1; + + if (endPtr - ptr > 32 && UTF16Decoder) { + return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); + } else { + var i = 0; + + var str = ''; + while (1) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0) return str; + ++i; + // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. +// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. +// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)]=codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)]=0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF16(str) { + return str.length*2; +} + +function UTF32ToString(ptr) { + var i = 0; + + var str = ''; + while (1) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) + return str; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. +// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. +// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)]=codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)]=0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; +} + +// Allocate heap space for a JS string, and write it there. +// It is the responsibility of the caller to free() that memory. +function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +// Allocate stack space for a JS string, and write it there. +function allocateUTF8OnStack(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +function demangle(func) { + return func; +} + +function demangleAll(text) { + var regex = + /__Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (y + ' [' + x + ']'); + }); +} + +function jsStackTrace() { + var err = new Error(); + if (!err.stack) { + // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, + // so try that as a special-case. + try { + throw new Error(0); + } catch(e) { + err = e; + } + if (!err.stack) { + return '(no stack trace available)'; + } + } + return err.stack.toString(); +} + +function stackTrace() { + var js = jsStackTrace(); + if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); + return demangleAll(js); +} + +// Memory management + +var PAGE_SIZE = 16384; +var WASM_PAGE_SIZE = 65536; +var ASMJS_PAGE_SIZE = 16777216; +var MIN_TOTAL_MEMORY = 16777216; + +function alignUp(x, multiple) { + if (x % multiple > 0) { + x += multiple - (x % multiple); + } + return x; +} + +var HEAP, +/** @type {ArrayBuffer} */ + buffer, +/** @type {Int8Array} */ + HEAP8, +/** @type {Uint8Array} */ + HEAPU8, +/** @type {Int16Array} */ + HEAP16, +/** @type {Uint16Array} */ + HEAPU16, +/** @type {Int32Array} */ + HEAP32, +/** @type {Uint32Array} */ + HEAPU32, +/** @type {Float32Array} */ + HEAPF32, +/** @type {Float64Array} */ + HEAPF64; + +function updateGlobalBuffer(buf) { + Module['buffer'] = buffer = buf; +} + +function updateGlobalBufferViews() { + Module['HEAP8'] = HEAP8 = new Int8Array(buffer); + Module['HEAP16'] = HEAP16 = new Int16Array(buffer); + Module['HEAP32'] = HEAP32 = new Int32Array(buffer); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer); + Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer); + Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer); +} + +var STATIC_BASE, STATICTOP, staticSealed; // static area +var STACK_BASE, STACKTOP, STACK_MAX; // stack area +var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk + + STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; + staticSealed = false; + + + + +function abortOnCannotGrowMemory() { + abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); +} + + +function enlargeMemory() { + abortOnCannotGrowMemory(); +} + + +var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; +var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864; +if (TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); + +// Initialize the runtime's memory + + + +// Use a provided buffer, if there is one, or else allocate a new one +if (Module['buffer']) { + buffer = Module['buffer']; +} else { + // Use a WebAssembly memory where available + if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') { + Module['wasmMemory'] = new WebAssembly.Memory({ 'initial': TOTAL_MEMORY / WASM_PAGE_SIZE, 'maximum': TOTAL_MEMORY / WASM_PAGE_SIZE }); + buffer = Module['wasmMemory'].buffer; + } else + { + buffer = new ArrayBuffer(TOTAL_MEMORY); + } + Module['buffer'] = buffer; +} +updateGlobalBufferViews(); + + +function getTotalMemory() { + return TOTAL_MEMORY; +} + +// Endianness check (note: assumes compiler arch was little-endian) + +function callRuntimeCallbacks(callbacks) { + while(callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == 'function') { + callback(); + continue; + } + var func = callback.func; + if (typeof func === 'number') { + if (callback.arg === undefined) { + Module['dynCall_v'](func); + } else { + Module['dynCall_vi'](func, callback.arg); + } + } else { + func(callback.arg === undefined ? null : callback.arg); + } + } +} + +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATMAIN__ = []; // functions called when main() is to be run +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the main() is called + +var runtimeInitialized = false; +var runtimeExited = false; + + +function preRun() { + // compatibility - merge in anything from Module['preRun'] at this time + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function ensureInitRuntime() { + if (runtimeInitialized) return; + runtimeInitialized = true; + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + callRuntimeCallbacks(__ATMAIN__); +} + +function exitRuntime() { + callRuntimeCallbacks(__ATEXIT__); + runtimeExited = true; +} + +function postRun() { + // compatibility - merge in anything from Module['postRun'] at this time + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} + +function addOnExit(cb) { + __ATEXIT__.unshift(cb); +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +// Deprecated: This function should not be called because it is unsafe and does not provide +// a maximum length limit of how many bytes it is allowed to write. Prefer calling the +// function stringToUTF8Array() instead, which takes in a maximum length that can be used +// to be secure from out of bounds writes. +/** @deprecated */ +function writeStringToMemory(string, buffer, dontAddNull) { + warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); + + var /** @type {number} */ lastChar, /** @type {number} */ end; + if (dontAddNull) { + // stringToUTF8Array always appends null. If we don't want to do that, remember the + // character that existed at the location where the null will be placed, and restore + // that after the write (below). + end = buffer + lengthBytesUTF8(string); + lastChar = HEAP8[end]; + } + stringToUTF8(string, buffer, Infinity); + if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. +} + +function writeArrayToMemory(array, buffer) { + HEAP8.set(array, buffer); +} + +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + HEAP8[((buffer++)>>0)]=str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)]=0; +} + +function unSign(value, bits, ignore) { + if (value >= 0) { + return value; + } + return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts + : Math.pow(2, bits) + value; +} +function reSign(value, bits, ignore) { + if (value <= 0) { + return value; + } + var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 + : Math.pow(2, bits-1); + if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that + // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors + // TODO: In i64 mode 1, resign the two parts separately and safely + value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts + } + return value; +} + + +var Math_abs = Math.abs; +var Math_cos = Math.cos; +var Math_sin = Math.sin; +var Math_tan = Math.tan; +var Math_acos = Math.acos; +var Math_asin = Math.asin; +var Math_atan = Math.atan; +var Math_atan2 = Math.atan2; +var Math_exp = Math.exp; +var Math_log = Math.log; +var Math_sqrt = Math.sqrt; +var Math_ceil = Math.ceil; +var Math_floor = Math.floor; +var Math_pow = Math.pow; +var Math_imul = Math.imul; +var Math_fround = Math.fround; +var Math_round = Math.round; +var Math_min = Math.min; +var Math_max = Math.max; +var Math_clz32 = Math.clz32; +var Math_trunc = Math.trunc; + +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// Module.preRun (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled + +function getUniqueRunDependency(id) { + return id; +} + +function addRunDependency(id) { + runDependencies++; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } +} + +function removeRunDependency(id) { + runDependencies--; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} + +Module["preloadedImages"] = {}; // maps url to image data +Module["preloadedAudios"] = {}; // maps url to audio data + + + +var memoryInitializer = null; + + + + + + +// Copyright 2017 The Emscripten Authors. All rights reserved. +// Emscripten is available under two separate licenses, the MIT license and the +// University of Illinois/NCSA Open Source License. Both these licenses can be +// found in the LICENSE file. + +// Prefix of data URIs emitted by SINGLE_FILE and related options. +var dataURIPrefix = 'data:application/octet-stream;base64,'; + +// Indicates whether filename is a base64 data URI. +function isDataURI(filename) { + return String.prototype.startsWith ? + filename.startsWith(dataURIPrefix) : + filename.indexOf(dataURIPrefix) === 0; +} + + + + +function integrateWasmJS() { + // wasm.js has several methods for creating the compiled code module here: + // * 'native-wasm' : use native WebAssembly support in the browser + // * 'interpret-s-expr': load s-expression code from a .wast and interpret + // * 'interpret-binary': load binary wasm and interpret + // * 'interpret-asm2wasm': load asm.js code, translate to wasm, and interpret + // * 'asmjs': no wasm, just load the asm.js code and use that (good for testing) + // The method is set at compile time (BINARYEN_METHOD) + // The method can be a comma-separated list, in which case, we will try the + // options one by one. Some of them can fail gracefully, and then we can try + // the next. + + // inputs + + var method = 'native-wasm'; + + var wasmTextFile = 'audio_music_stream_test.wast'; + var wasmBinaryFile = 'audio_music_stream_test.wasm'; + var asmjsCodeFile = 'audio_music_stream_test.temp.asm.js'; + + if (!isDataURI(wasmTextFile)) { + wasmTextFile = locateFile(wasmTextFile); + } + if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); + } + if (!isDataURI(asmjsCodeFile)) { + asmjsCodeFile = locateFile(asmjsCodeFile); + } + + // utilities + + var wasmPageSize = 64*1024; + + var info = { + 'global': null, + 'env': null, + 'asm2wasm': asm2wasmImports, + 'parent': Module // Module inside wasm-js.cpp refers to wasm-js.cpp; this allows access to the outside program. + }; + + var exports = null; + + + function mergeMemory(newBuffer) { + // The wasm instance creates its memory. But static init code might have written to + // buffer already, including the mem init file, and we must copy it over in a proper merge. + // TODO: avoid this copy, by avoiding such static init writes + // TODO: in shorter term, just copy up to the last static init write + var oldBuffer = Module['buffer']; + if (newBuffer.byteLength < oldBuffer.byteLength) { + err('the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here'); + } + var oldView = new Int8Array(oldBuffer); + var newView = new Int8Array(newBuffer); + + + newView.set(oldView); + updateGlobalBuffer(newBuffer); + updateGlobalBufferViews(); + } + + function getBinary() { + try { + if (Module['wasmBinary']) { + return new Uint8Array(Module['wasmBinary']); + } + if (Module['readBinary']) { + return Module['readBinary'](wasmBinaryFile); + } else { + throw "both async and sync fetching of the wasm failed"; + } + } + catch (err) { + abort(err); + } + } + + function getBinaryPromise() { + // if we don't have the binary yet, and have the Fetch api, use that + // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web + if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + if (!response['ok']) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; + } + return response['arrayBuffer'](); + }).catch(function () { + return getBinary(); + }); + } + // Otherwise, getBinary should be able to get it synchronously + return new Promise(function(resolve, reject) { + resolve(getBinary()); + }); + } + + // do-method functions + + + function doNativeWasm(global, env, providedBuffer) { + if (typeof WebAssembly !== 'object') { + err('no native wasm support detected'); + return false; + } + // prepare memory import + if (!(Module['wasmMemory'] instanceof WebAssembly.Memory)) { + err('no native wasm Memory in use'); + return false; + } + env['memory'] = Module['wasmMemory']; + // Load the wasm module and create an instance of using native support in the JS engine. + info['global'] = { + 'NaN': NaN, + 'Infinity': Infinity + }; + info['global.Math'] = Math; + info['env'] = env; + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + function receiveInstance(instance, module) { + exports = instance.exports; + if (exports.memory) mergeMemory(exports.memory); + Module['asm'] = exports; + Module["usingWasm"] = true; + removeRunDependency('wasm-instantiate'); + } + addRunDependency('wasm-instantiate'); + + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel + // to any other async startup actions they are performing. + if (Module['instantiateWasm']) { + try { + return Module['instantiateWasm'](info, receiveInstance); + } catch(e) { + err('Module.instantiateWasm callback failed with error: ' + e); + return false; + } + } + + function receiveInstantiatedSource(output) { + // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + receiveInstance(output['instance'], output['module']); + } + function instantiateArrayBuffer(receiver) { + getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info); + }).then(receiver, function(reason) { + err('failed to asynchronously prepare wasm: ' + reason); + abort(reason); + }); + } + // Prefer streaming instantiation if available. + if (!Module['wasmBinary'] && + typeof WebAssembly.instantiateStreaming === 'function' && + !isDataURI(wasmBinaryFile) && + typeof fetch === 'function') { + WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info) + .then(receiveInstantiatedSource, function(reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err('wasm streaming compile failed: ' + reason); + err('falling back to ArrayBuffer instantiation'); + instantiateArrayBuffer(receiveInstantiatedSource); + }); + } else { + instantiateArrayBuffer(receiveInstantiatedSource); + } + return {}; // no exports yet; we'll fill them in later + } + + + // We may have a preloaded value in Module.asm, save it + Module['asmPreload'] = Module['asm']; + + // Memory growth integration code + + var asmjsReallocBuffer = Module['reallocBuffer']; + + var wasmReallocBuffer = function(size) { + var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE; // In wasm, heap size must be a multiple of 64KB. In asm.js, they need to be multiples of 16MB. + size = alignUp(size, PAGE_MULTIPLE); // round up to wasm page size + var old = Module['buffer']; + var oldSize = old.byteLength; + if (Module["usingWasm"]) { + // native wasm support + try { + var result = Module['wasmMemory'].grow((size - oldSize) / wasmPageSize); // .grow() takes a delta compared to the previous size + if (result !== (-1 | 0)) { + // success in native wasm memory growth, get the buffer from the memory + return Module['buffer'] = Module['wasmMemory'].buffer; + } else { + return null; + } + } catch(e) { + return null; + } + } + }; + + Module['reallocBuffer'] = function(size) { + if (finalMethod === 'asmjs') { + return asmjsReallocBuffer(size); + } else { + return wasmReallocBuffer(size); + } + }; + + // we may try more than one; this is the final one, that worked and we are using + var finalMethod = ''; + + // Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate + // the wasm module at that time, and it receives imports and provides exports and so forth, the app + // doesn't need to care that it is wasm or polyfilled wasm or asm.js. + + Module['asm'] = function(global, env, providedBuffer) { + // import table + if (!env['table']) { + var TABLE_SIZE = Module['wasmTableSize']; + if (TABLE_SIZE === undefined) TABLE_SIZE = 1024; // works in binaryen interpreter at least + var MAX_TABLE_SIZE = Module['wasmMaxTableSize']; + if (typeof WebAssembly === 'object' && typeof WebAssembly.Table === 'function') { + if (MAX_TABLE_SIZE !== undefined) { + env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, 'maximum': MAX_TABLE_SIZE, 'element': 'anyfunc' }); + } else { + env['table'] = new WebAssembly.Table({ 'initial': TABLE_SIZE, element: 'anyfunc' }); + } + } else { + env['table'] = new Array(TABLE_SIZE); // works in binaryen interpreter at least + } + Module['wasmTable'] = env['table']; + } + + if (!env['__memory_base']) { + env['__memory_base'] = Module['STATIC_BASE']; // tell the memory segments where to place themselves + } + if (!env['__table_base']) { + env['__table_base'] = 0; // table starts at 0 by default, in dynamic linking this will change + } + + // try the methods. each should return the exports if it succeeded + + var exports; + exports = doNativeWasm(global, env, providedBuffer); + + assert(exports, 'no binaryen method succeeded.'); + + + return exports; + }; + + var methodHandler = Module['asm']; // note our method handler, as we may modify Module['asm'] later +} + +integrateWasmJS(); + +// === Body === + +var ASM_CONSTS = []; + + + + + +STATIC_BASE = GLOBAL_BASE; + +STATICTOP = STATIC_BASE + 100160; +/* global initializers */ __ATINIT__.push(); + + + + + + + +var STATIC_BUMP = 100160; +Module["STATIC_BASE"] = STATIC_BASE; +Module["STATIC_BUMP"] = STATIC_BUMP; + +/* no memory initializer */ +var tempDoublePtr = STATICTOP; STATICTOP += 16; + +function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much + HEAP8[tempDoublePtr] = HEAP8[ptr]; + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; +} + +function copyTempDouble(ptr) { + HEAP8[tempDoublePtr] = HEAP8[ptr]; + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; + HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; + HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; + HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; + HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; +} + +// {{PRE_LIBRARY}} + + + + + + + var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86}; + + var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; + + function ___setErrNo(value) { + if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; + return value; + } + + var PATH={splitPath:function (filename) { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:function (parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + },normalize:function (path) { + var isAbsolute = path.charAt(0) === '/', + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:function (path) { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:function (path) { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },extname:function (path) { + return PATH.splitPath(path)[3]; + },join:function () { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join('/')); + },join2:function (l, r) { + return PATH.normalize(l + '/' + r); + },resolve:function () { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path !== 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:function (from, to) { + from = PATH.resolve(from).substr(1); + to = PATH.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + var TTY={ttys:[],init:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function (dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function (stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + stream.tty = tty; + stream.seekable = false; + },close:function (stream) { + // flush any pending line data + stream.tty.ops.flush(stream.tty); + },flush:function (stream) { + stream.tty.ops.flush(stream.tty); + },read:function (stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function (stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + var i = 0; + try { + if (offset === 0 && length === 0) { + // musl implements an fflush using a write of a NULL buffer of size 0 + stream.tty.ops.flush(stream.tty); + } else { + while (i < length) { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + i++; + } + } + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function (tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = new Buffer(BUFSIZE); + var bytesRead = 0; + + var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion + + var fd = process.stdin.fd; + if (isPosixPlatform) { + // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) + var usingDevice = false; + try { + fd = fs.openSync('/dev/stdin', 'r'); + usingDevice = true; + } catch (e) {} + } + + try { + bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().indexOf('EOF') != -1) bytesRead = 0; + else throw e; + } + + if (usingDevice) { fs.closeSync(fd); } + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + + } else if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function (tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function (tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + var MEMFS={ops_table:null,mount:function (mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function (parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + } + return node; + },getFileDataAsRegularArray:function (node) { + if (node.contents && node.contents.subarray) { + var arr = []; + for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); + return arr; // Returns a copy of the original data. + } + return node.contents; // No-op, the file contents are already in a JS array. Return as-is. + },getFileDataAsTypedArray:function (node) { + if (!node.contents) return new Uint8Array; + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function (node, newCapacity) { + // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file + // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to + // increase the size. + if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { + node.contents = MEMFS.getFileDataAsRegularArray(node); + node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. + } + + if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + return; + } + // Not using a typed array to back the file storage. Use a standard JS array instead. + if (!node.contents && newCapacity > 0) node.contents = []; + while (node.contents.length < newCapacity) node.contents.push(0); + },resizeFileStorage:function (node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + return; + } + if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. + var oldContents = node.contents; + node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + return; + } + // Backing with a JS array. + if (!node.contents) node.contents = []; + if (node.contents.length > newSize) node.contents.length = newSize; + else while (node.contents.length < newSize) node.contents.push(0); + node.usedBytes = newSize; + },node_ops:{getattr:function (node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function (parent, name) { + throw FS.genericErrors[ERRNO_CODES.ENOENT]; + },mknod:function (parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function (old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + old_node.parent = new_dir; + },unlink:function (parent, name) { + delete parent.contents[name]; + },rmdir:function (parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + delete parent.contents[name]; + },readdir:function (node) { + var entries = ['.', '..'] + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function (parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function (node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return node.link; + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function (stream, buffer, offset, length, position, canOwn) { + + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. + else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position+length); + return length; + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + },allocate:function (stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if ( !(flags & 2) && + (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { + // We can't emulate MAP_SHARED when the file is not backed by the buffer + // we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < stream.node.usedBytes) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = _malloc(length); + if (!ptr) { + throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); + } + buffer.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (mmapFlags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + var IDBFS={dbs:{},indexedDB:function () { + if (typeof indexedDB !== 'undefined') return indexedDB; + var ret = null; + if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, 'IDBFS used, but indexedDB not supported'); + return ret; + },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { + // reuse all of the core MEMFS functionality + return MEMFS.mount.apply(null, arguments); + },syncfs:function (mount, populate, callback) { + IDBFS.getLocalSet(mount, function(err, local) { + if (err) return callback(err); + + IDBFS.getRemoteSet(mount, function(err, remote) { + if (err) return callback(err); + + var src = populate ? remote : local; + var dst = populate ? local : remote; + + IDBFS.reconcile(src, dst, callback); + }); + }); + },getDB:function (name, callback) { + // check the cache first + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db); + } + + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); + } catch (e) { + return callback(e); + } + if (!req) { + return callback("Unable to connect to IndexedDB"); + } + req.onupgradeneeded = function(e) { + var db = e.target.result; + var transaction = e.target.transaction; + + var fileStore; + + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); + } + + if (!fileStore.indexNames.contains('timestamp')) { + fileStore.createIndex('timestamp', 'timestamp', { unique: false }); + } + }; + req.onsuccess = function() { + db = req.result; + + // add to the cache + IDBFS.dbs[name] = db; + callback(null, db); + }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },getLocalSet:function (mount, callback) { + var entries = {}; + + function isRealDir(p) { + return p !== '.' && p !== '..'; + }; + function toAbsolute(root) { + return function(p) { + return PATH.join2(root, p); + } + }; + + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + + while (check.length) { + var path = check.pop(); + var stat; + + try { + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); + } + + entries[path] = { timestamp: stat.mtime }; + } + + return callback(null, { type: 'local', entries: entries }); + },getRemoteSet:function (mount, callback) { + var entries = {}; + + IDBFS.getDB(mount.mountpoint, function(err, db) { + if (err) return callback(err); + + try { + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); + transaction.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index('timestamp'); + + index.openKeyCursor().onsuccess = function(event) { + var cursor = event.target.result; + + if (!cursor) { + return callback(null, { type: 'remote', db: db, entries: entries }); + } + + entries[cursor.primaryKey] = { timestamp: cursor.key }; + + cursor.continue(); + }; + } catch (e) { + return callback(e); + } + }); + },loadLocalEntry:function (path, callback) { + var stat, node; + + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + return callback(null, { timestamp: stat.mtime, mode: stat.mode }); + } else if (FS.isFile(stat.mode)) { + // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. + // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); + } else { + return callback(new Error('node type not supported')); + } + },storeLocalEntry:function (path, entry, callback) { + try { + if (FS.isDir(entry.mode)) { + FS.mkdir(path, entry.mode); + } else if (FS.isFile(entry.mode)) { + FS.writeFile(path, entry.contents, { canOwn: true }); + } else { + return callback(new Error('node type not supported')); + } + + FS.chmod(path, entry.mode); + FS.utime(path, entry.timestamp, entry.timestamp); + } catch (e) { + return callback(e); + } + + callback(null); + },removeLocalEntry:function (path, callback) { + try { + var lookup = FS.lookupPath(path); + var stat = FS.stat(path); + + if (FS.isDir(stat.mode)) { + FS.rmdir(path); + } else if (FS.isFile(stat.mode)) { + FS.unlink(path); + } + } catch (e) { + return callback(e); + } + + callback(null); + },loadRemoteEntry:function (store, path, callback) { + var req = store.get(path); + req.onsuccess = function(event) { callback(null, event.target.result); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },storeRemoteEntry:function (store, path, entry, callback) { + var req = store.put(entry, path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },removeRemoteEntry:function (store, path, callback) { + var req = store.delete(path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },reconcile:function (src, dst, callback) { + var total = 0; + + var create = []; + Object.keys(src.entries).forEach(function (key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e.timestamp > e2.timestamp) { + create.push(key); + total++; + } + }); + + var remove = []; + Object.keys(dst.entries).forEach(function (key) { + var e = dst.entries[key]; + var e2 = src.entries[key]; + if (!e2) { + remove.push(key); + total++; + } + }); + + if (!total) { + return callback(null); + } + + var errored = false; + var completed = 0; + var db = src.type === 'remote' ? src.db : dst.db; + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return callback(err); + } + return; + } + if (++completed >= total) { + return callback(null); + } + }; + + transaction.onerror = function(e) { + done(this.error); + e.preventDefault(); + }; + + // sort paths in ascending order so directory entries are created + // before the files inside them + create.sort().forEach(function (path) { + if (dst.type === 'local') { + IDBFS.loadRemoteEntry(store, path, function (err, entry) { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done); + }); + } else { + IDBFS.loadLocalEntry(path, function (err, entry) { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done); + }); + } + }); + + // sort paths in descending order so files are deleted before their + // parent directories + remove.sort().reverse().forEach(function(path) { + if (dst.type === 'local') { + IDBFS.removeLocalEntry(path, done); + } else { + IDBFS.removeRemoteEntry(store, path, done); + } + }); + }}; + + var NODEFS={isWindows:false,staticInit:function () { + NODEFS.isWindows = !!process.platform.match(/^win/); + var flags = process["binding"]("constants"); + // Node.js 4 compatibility: it has no namespaces for constants + if (flags["fs"]) { + flags = flags["fs"]; + } + NODEFS.flagsForNodeMap = { + "1024": flags["O_APPEND"], + "64": flags["O_CREAT"], + "128": flags["O_EXCL"], + "0": flags["O_RDONLY"], + "2": flags["O_RDWR"], + "4096": flags["O_SYNC"], + "512": flags["O_TRUNC"], + "1": flags["O_WRONLY"] + }; + },bufferFrom:function (arrayBuffer) { + // Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer + // Buffer.from before 4.5 was just a method inherited from Uint8Array + // Buffer.alloc has been added with Buffer.from together, so check it instead + return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer); + },mount:function (mount) { + assert(ENVIRONMENT_IS_NODE); + return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); + },createNode:function (parent, name, mode, dev) { + if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node = FS.createNode(parent, name, mode); + node.node_ops = NODEFS.node_ops; + node.stream_ops = NODEFS.stream_ops; + return node; + },getMode:function (path) { + var stat; + try { + stat = fs.lstatSync(path); + if (NODEFS.isWindows) { + // Node.js on Windows never represents permission bit 'x', so + // propagate read bits to execute bits + stat.mode = stat.mode | ((stat.mode & 292) >> 2); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return stat.mode; + },realPath:function (node) { + var parts = []; + while (node.parent !== node) { + parts.push(node.name); + node = node.parent; + } + parts.push(node.mount.opts.root); + parts.reverse(); + return PATH.join.apply(null, parts); + },flagsForNode:function (flags) { + flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process. + var newFlags = 0; + for (var k in NODEFS.flagsForNodeMap) { + if (flags & k) { + newFlags |= NODEFS.flagsForNodeMap[k]; + flags ^= k; + } + } + + if (!flags) { + return newFlags; + } else { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + },node_ops:{getattr:function (node) { + var path = NODEFS.realPath(node); + var stat; + try { + stat = fs.lstatSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. + // See http://support.microsoft.com/kb/140365 + if (NODEFS.isWindows && !stat.blksize) { + stat.blksize = 4096; + } + if (NODEFS.isWindows && !stat.blocks) { + stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; + } + return { + dev: stat.dev, + ino: stat.ino, + mode: stat.mode, + nlink: stat.nlink, + uid: stat.uid, + gid: stat.gid, + rdev: stat.rdev, + size: stat.size, + atime: stat.atime, + mtime: stat.mtime, + ctime: stat.ctime, + blksize: stat.blksize, + blocks: stat.blocks + }; + },setattr:function (node, attr) { + var path = NODEFS.realPath(node); + try { + if (attr.mode !== undefined) { + fs.chmodSync(path, attr.mode); + // update the common node structure mode as well + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + var date = new Date(attr.timestamp); + fs.utimesSync(path, date, date); + } + if (attr.size !== undefined) { + fs.truncateSync(path, attr.size); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },lookup:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + var mode = NODEFS.getMode(path); + return NODEFS.createNode(parent, name, mode); + },mknod:function (parent, name, mode, dev) { + var node = NODEFS.createNode(parent, name, mode, dev); + // create the backing node for this in the fs root as well + var path = NODEFS.realPath(node); + try { + if (FS.isDir(node.mode)) { + fs.mkdirSync(path, node.mode); + } else { + fs.writeFileSync(path, '', { mode: node.mode }); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return node; + },rename:function (oldNode, newDir, newName) { + var oldPath = NODEFS.realPath(oldNode); + var newPath = PATH.join2(NODEFS.realPath(newDir), newName); + try { + fs.renameSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },unlink:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.unlinkSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },rmdir:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.rmdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readdir:function (node) { + var path = NODEFS.realPath(node); + try { + return fs.readdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },symlink:function (parent, newName, oldPath) { + var newPath = PATH.join2(NODEFS.realPath(parent), newName); + try { + fs.symlinkSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readlink:function (node) { + var path = NODEFS.realPath(node); + try { + path = fs.readlinkSync(path); + path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); + return path; + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + }},stream_ops:{open:function (stream) { + var path = NODEFS.realPath(stream.node); + try { + if (FS.isFile(stream.node.mode)) { + stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags)); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },close:function (stream) { + try { + if (FS.isFile(stream.node.mode) && stream.nfd) { + fs.closeSync(stream.nfd); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },read:function (stream, buffer, offset, length, position) { + // Node.js < 6 compatibility: node errors on 0 length reads + if (length === 0) return 0; + try { + return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },write:function (stream, buffer, offset, length, position) { + try { + return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + try { + var stat = fs.fstatSync(stream.nfd); + position += stat.size; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + } + } + + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + return position; + }}}; + + var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { + assert(ENVIRONMENT_IS_WORKER); + if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); + var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); + var createdParents = {}; + function ensureParent(path) { + // return the parent node, creating subdirs as necessary + var parts = path.split('/'); + var parent = root; + for (var i = 0; i < parts.length-1; i++) { + var curr = parts.slice(0, i+1).join('/'); + // Issue 4254: Using curr as a node name will prevent the node + // from being found in FS.nameTable when FS.open is called on + // a path which holds a child of this node, + // given that all FS functions assume node names + // are just their corresponding parts within their given path, + // rather than incremental aggregates which include their parent's + // directories. + if (!createdParents[curr]) { + createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); + } + parent = createdParents[curr]; + } + return parent; + } + function base(path) { + var parts = path.split('/'); + return parts[parts.length-1]; + } + // We also accept FileList here, by using Array.prototype + Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { + WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); + }); + (mount.opts["blobs"] || []).forEach(function(obj) { + WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); + }); + (mount.opts["packages"] || []).forEach(function(pack) { + pack['metadata'].files.forEach(function(file) { + var name = file.filename.substr(1); // remove initial slash + WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); + }); + }); + return root; + },createNode:function (parent, name, mode, dev, contents, mtime) { + var node = FS.createNode(parent, name, mode); + node.mode = mode; + node.node_ops = WORKERFS.node_ops; + node.stream_ops = WORKERFS.stream_ops; + node.timestamp = (mtime || new Date).getTime(); + assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); + if (mode === WORKERFS.FILE_MODE) { + node.size = contents.size; + node.contents = contents; + } else { + node.size = 4096; + node.contents = {}; + } + if (parent) { + parent.contents[name] = node; + } + return node; + },node_ops:{getattr:function (node) { + return { + dev: 1, + ino: undefined, + mode: node.mode, + nlink: 1, + uid: 0, + gid: 0, + rdev: undefined, + size: node.size, + atime: new Date(node.timestamp), + mtime: new Date(node.timestamp), + ctime: new Date(node.timestamp), + blksize: 4096, + blocks: Math.ceil(node.size / 4096), + }; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + },lookup:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + },mknod:function (parent, name, mode, dev) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rename:function (oldNode, newDir, newName) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },unlink:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rmdir:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readdir:function (node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function (parent, newName, oldPath) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readlink:function (node) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + if (position >= stream.node.size) return 0; + var chunk = stream.node.contents.slice(position, position + length); + var ab = WORKERFS.reader.readAsArrayBuffer(chunk); + buffer.set(new Uint8Array(ab), offset); + return chunk.size; + },write:function (stream, buffer, offset, length, position) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.size; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + }}}; + + var _stdin=STATICTOP; STATICTOP += 16;; + + var _stdout=STATICTOP; STATICTOP += 16;; + + var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) { + if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); + return ___setErrNo(e.errno); + },lookupPath:function (path, opts) { + path = PATH.resolve(FS.cwd(), path); + opts = opts || {}; + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + for (var key in defaults) { + if (opts[key] === undefined) { + opts[key] = defaults[key]; + } + } + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + + // split the path + var parts = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), false); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:function (node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:function (parentid, name) { + var hash = 0; + + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:function (parent, name) { + var err = FS.mayLookup(parent); + if (err) { + throw new FS.ErrnoError(err, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:function (parent, name, mode, rdev) { + if (!FS.FSNode) { + FS.FSNode = function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + + FS.FSNode.prototype = {}; + + // compatibility + var readMode = 292 | 73; + var writeMode = 146; + + // NOTE we must use Object.defineProperties instead of individual calls to + // Object.defineProperty in order to make closure compiler happy + Object.defineProperties(FS.FSNode.prototype, { + read: { + get: function() { return (this.mode & readMode) === readMode; }, + set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } + }, + write: { + get: function() { return (this.mode & writeMode) === writeMode; }, + set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } + }, + isFolder: { + get: function() { return FS.isDir(this.mode); } + }, + isDevice: { + get: function() { return FS.isChrdev(this.mode); } + } + }); + } + + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:function (node) { + FS.hashRemoveNode(node); + },isRoot:function (node) { + return node === node.parent; + },isMountpoint:function (node) { + return !!node.mounted; + },isFile:function (mode) { + return (mode & 61440) === 32768; + },isDir:function (mode) { + return (mode & 61440) === 16384; + },isLink:function (mode) { + return (mode & 61440) === 40960; + },isChrdev:function (mode) { + return (mode & 61440) === 8192; + },isBlkdev:function (mode) { + return (mode & 61440) === 24576; + },isFIFO:function (mode) { + return (mode & 61440) === 4096; + },isSocket:function (mode) { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { + var flags = FS.flagModes[str]; + if (typeof flags === 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:function (flag) { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:function (node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { + return ERRNO_CODES.EACCES; + } + return 0; + },mayLookup:function (dir) { + var err = FS.nodePermissions(dir, 'x'); + if (err) return err; + if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; + return 0; + },mayCreate:function (dir, name) { + try { + var node = FS.lookupNode(dir, name); + return ERRNO_CODES.EEXIST; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:function (dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var err = FS.nodePermissions(dir, 'wx'); + if (err) { + return err; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return ERRNO_CODES.ENOTDIR; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return ERRNO_CODES.EBUSY; + } + } else { + if (FS.isDir(node.mode)) { + return ERRNO_CODES.EISDIR; + } + } + return 0; + },mayOpen:function (node, flags) { + if (!node) { + return ERRNO_CODES.ENOENT; + } + if (FS.isLink(node.mode)) { + return ERRNO_CODES.ELOOP; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return ERRNO_CODES.EISDIR; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { + fd_start = fd_start || 0; + fd_end = fd_end || FS.MAX_OPEN_FDS; + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(ERRNO_CODES.EMFILE); + },getStream:function (fd) { + return FS.streams[fd]; + },createStream:function (stream, fd_start, fd_end) { + if (!FS.FSStream) { + FS.FSStream = function(){}; + FS.FSStream.prototype = {}; + // compatibility + Object.defineProperties(FS.FSStream.prototype, { + object: { + get: function() { return this.node; }, + set: function(val) { this.node = val; } + }, + isRead: { + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + get: function() { return (this.flags & 1024); } + } + }); + } + // clone it, so we can return an instance of FSStream + var newStream = new FS.FSStream(); + for (var p in stream) { + newStream[p] = stream[p]; + } + stream = newStream; + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:function (fd) { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:function (stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:function () { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + }},major:function (dev) { + return ((dev) >> 8); + },minor:function (dev) { + return ((dev) & 0xff); + },makedev:function (ma, mi) { + return ((ma) << 8 | (mi)); + },registerDevice:function (dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:function (dev) { + return FS.devices[dev]; + },getMounts:function (mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:function (populate, callback) { + if (typeof(populate) === 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(err) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(err); + } + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return doCallback(err); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach(function (mount) { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:function (type, opts, mountpoint) { + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:function (mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach(function (hash) { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.indexOf(current.mount) !== -1) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:function (parent, name) { + return parent.node_ops.lookup(parent, name); + },mknod:function (path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.mayCreate(parent, name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:function (path, mode) { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:function (path, mode) { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdirTree:function (path, mode) { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != ERRNO_CODES.EEXIST) throw e; + } + } + },mkdev:function (path, mode, dev) { + if (typeof(dev) === 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:function (oldpath, newpath) { + if (!PATH.resolve(oldpath)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var newname = PATH.basename(newpath); + var err = FS.mayCreate(parent, newname); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:function (old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + try { + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(ERRNO_CODES.EXDEV); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + // new path should not be an ancestor of the old path + relative = PATH.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var err = FS.mayDelete(old_dir, old_name, isdir); + if (err) { + throw new FS.ErrnoError(err); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + err = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + err = FS.nodePermissions(old_dir, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + } + try { + if (FS.trackingDelegate['willMovePath']) { + FS.trackingDelegate['willMovePath'](old_path, new_path); + } + } catch(e) { + console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + try { + if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); + } catch(e) { + console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + },rmdir:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, true); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + return node.node_ops.readdir(node); + },unlink:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, false); + if (err) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readlink:function (path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:function (path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return node.node_ops.getattr(node); + },lstat:function (path) { + return FS.stat(path, true); + },chmod:function (path, mode, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:function (path, mode) { + FS.chmod(path, mode, true); + },fchmod:function (fd, mode) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chmod(stream.node, mode); + },chown:function (path, uid, gid, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:function (path, uid, gid) { + FS.chown(path, uid, gid, true); + },fchown:function (fd, uid, gid) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chown(stream.node, uid, gid); + },truncate:function (path, len) { + if (len < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.nodePermissions(node, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:function (fd, len) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + FS.truncate(stream.node, len); + },utime:function (path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:function (path, flags, mode, fd_start, fd_end) { + if (path === "") { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path === 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(ERRNO_CODES.EEXIST); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var err = FS.mayOpen(node, flags); + if (err) { + throw new FS.ErrnoError(err); + } + } + // do truncation if necessary + if ((flags & 512)) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }, fd_start, fd_end); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + console.log("FS.trackingDelegate error on read file: " + path); + } + } + try { + if (FS.trackingDelegate['onOpenFile']) { + var trackingFlags = 0; + if ((flags & 2097155) !== 1) { + trackingFlags |= FS.tracking.openFlags.READ; + } + if ((flags & 2097155) !== 0) { + trackingFlags |= FS.tracking.openFlags.WRITE; + } + FS.trackingDelegate['onOpenFile'](path, trackingFlags); + } + } catch(e) { + console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); + } + return stream; + },close:function (stream) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + },isClosed:function (stream) { + return stream.fd === null; + },llseek:function (stream, offset, whence) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:function (stream, buffer, offset, length, position) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var seeking = typeof position !== 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:function (stream, buffer, offset, length, position, canOwn) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if (stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position !== 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + try { + if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); + } catch(e) { + console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); + } + return bytesWritten; + },allocate:function (stream, offset, length) { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + // TODO if PROT is PROT_WRITE, make sure we have write access + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EACCES); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:function (stream) { + return 0; + },ioctl:function (stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:function (path, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'r'; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:function (path, data, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'w'; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data === 'string') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error('Unsupported data type'); + } + FS.close(stream); + },cwd:function () { + return FS.currentPath; + },chdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + var err = FS.nodePermissions(lookup.node, 'x'); + if (err) { + throw new FS.ErrnoError(err); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:function () { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:function () { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: function() { return 0; }, + write: function(stream, buffer, offset, length, pos) { return length; } + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using Module['printErr'] + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device; + if (typeof crypto !== 'undefined') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else if (ENVIRONMENT_IS_NODE) { + // for nodejs + random_device = function() { return require('crypto')['randomBytes'](1)[0]; }; + } else { + // default for ES5 platforms + random_device = function() { abort("random_device"); /*Math.random() is not safe for random number generation, so this fallback random_device implementation aborts... see kripken/emscripten/pull/7096 */ }; + } + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:function () { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: function() { + var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup: function(parent, name) { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: function() { return stream.path } } + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:function () { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 'r'); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + + var stdout = FS.open('/dev/stdout', 'w'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + + var stderr = FS.open('/dev/stderr', 'w'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:function () { + if (FS.ErrnoError) return; + FS.ErrnoError = function ErrnoError(errno, node) { + this.node = node; + this.setErrno = function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + // Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8) + if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [ERRNO_CODES.ENOENT].forEach(function(code) { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = '<generic error, no stack>'; + }); + },staticInit:function () { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + 'IDBFS': IDBFS, + 'NODEFS': NODEFS, + 'WORKERFS': WORKERFS, + }; + },init:function (input, output, error) { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:function () { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + var fflush = Module['_fflush']; + if (fflush) fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:function (canRead, canWrite) { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },joinPath:function (parts, forceRelative) { + var path = PATH.join.apply(null, parts); + if (forceRelative && path[0] == '/') path = path.substr(1); + return path; + },absolutePath:function (relative, base) { + return PATH.resolve(base, relative); + },standardizePath:function (path) { + return PATH.normalize(path); + },findObject:function (path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object; + } else { + ___setErrNo(ret.error); + return null; + } + },analyzePath:function (path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createFolder:function (parent, name, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.mkdir(path, mode); + },createPath:function (parent, path, canRead, canWrite) { + parent = typeof parent === 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:function (parent, name, properties, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { + var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data === 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 'w'); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:function (parent, name, input, output) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: function(stream) { + stream.seekable = false; + }, + close: function(stream) { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: function(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: function(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },createLink:function (parent, name, target, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + return FS.symlink(target, path); + },forceLoadFile:function (obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + var success = true; + if (typeof XMLHttpRequest !== 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (Module['read']) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(Module['read'](obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + success = false; + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + if (!success) ___setErrNo(ERRNO_CODES.EIO); + return success; + },createLazyFile:function (parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + } + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + } + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (function(from, to) { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(xhr.response || []); + } else { + return intArrayFromString(xhr.responseText || '', true); + } + }); + var lazyArray = this; + lazyArray.setDataGetter(function(chunkNum) { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + } + if (typeof XMLHttpRequest !== 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(function(key) { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + return fn.apply(null, arguments); + }; + }); + // use a custom read function + stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { + Browser.init(); // XXX perhaps this method should move onto Browser? + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + var handled = false; + Module['preloadPlugins'].forEach(function(plugin) { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, function() { + if (onerror) onerror(); + removeRunDependency(dep); + }); + handled = true; + } + }); + if (!handled) finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + Browser.asyncLoad(url, function(byteArray) { + processData(byteArray); + }, onerror); + } else { + processData(url); + } + },indexedDB:function () { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:function () { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { + console.log('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var getRequest = files.get(path); + getRequest.onsuccess = function getRequest_onsuccess() { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + }}; + + + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + + if (!Browser.mainLoop.func) { + return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. + } + + if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop + }; + Browser.mainLoop.method = 'timeout'; + } else if (mode == 1 /*EM_TIMING_RAF*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'rAF'; + } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { + if (typeof setImmediate === 'undefined') { + // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) + var setImmediates = []; + var emscriptenMainLoopMessageId = 'setimmediate'; + function Browser_setImmediate_messageHandler(event) { + // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events, + // so check for both cases. + if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + } + addEventListener("message", Browser_setImmediate_messageHandler, true); + setImmediate = function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module['setImmediates'] === undefined) Module['setImmediates'] = []; + Module['setImmediates'].push(func); + postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js + } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself. + } + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + setImmediate(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'immediate'; + } + return 0; + } + + function _emscripten_get_now() { abort() }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { + Module['noExitRuntime'] = true; + + assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); + + Browser.mainLoop.func = func; + Browser.mainLoop.arg = arg; + + var browserIterationFunc; + if (typeof arg !== 'undefined') { + browserIterationFunc = function() { + Module['dynCall_vi'](func, arg); + }; + } else { + browserIterationFunc = function() { + Module['dynCall_v'](func); + }; + } + + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + // not counted, but move the progress along a tiny bit + next = next + 0.5; // do not steal all the next one's progress + Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; + } + } + console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); + Browser.mainLoop.updateStatus(); + + // catches pause/resume main loop from blocker execution + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + setTimeout(Browser.mainLoop.runner, 0); + return; + } + + // catch pauses from non-main loop sources + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Implement very basic swap interval control + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + // Not the scheduled time to render this frame - skip. + Browser.mainLoop.scheduler(); + return; + } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.tickStartTime = _emscripten_get_now(); + } + + // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize + // VBO double-buffering and reduce GPU stalls. + + + + if (Browser.mainLoop.method === 'timeout' && Module.ctx) { + err('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); + Browser.mainLoop.method = ''; // just warn once per call to set main loop + } + + Browser.mainLoop.runIter(browserIterationFunc); + + + // catch pauses from the main loop itself + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able + // to queue the newest produced audio samples. + // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() + // do not need to be hardcoded into this function, but can be more generic. + if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + + Browser.mainLoop.scheduler(); + } + + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) + + Browser.mainLoop.scheduler(); + } + + if (simulateInfiniteLoop) { + throw 'SimulateInfiniteLoop'; + } + }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. + },resume:function () { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + },updateStatus:function () { + if (Module['setStatus']) { + var message = Module['statusMessage'] || 'Please wait...'; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); + } else { + Module['setStatus'](message); + } + } else { + Module['setStatus'](''); + } + } + },runIter:function (func) { + if (ABORT) return; + if (Module['preMainLoop']) { + var preRet = Module['preMainLoop'](); + if (preRet === false) { + return; // |return false| skips a frame + } + } + try { + func(); + } catch (e) { + if (e instanceof ExitStatus) { + return; + } else { + if (e && typeof e === 'object' && e.stack) err('exception thrown: ' + [e, e.stack]); + throw e; + } + } + if (Module['postMainLoop']) Module['postMainLoop'](); + }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers + + if (Browser.initted) return; + Browser.initted = true; + + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch(e) { + Browser.hasBlobConstructor = false; + console.log("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); + Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { + console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + + // Support for plugins that can process preloaded files. You can add more of these to + // your app by creating and appending to Module.preloadPlugins. + // + // Each plugin is asked if it can handle a file based on the file's name. If it can, + // it is given the file's raw data. When it is done, it calls a callback with the file's + // (possibly modified) data. For example, a plugin might decompress a file, or it + // might create some side data structure for use later (like an Image element, etc.). + + var imagePlugin = {}; + imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + if (b.size !== byteArray.length) { // Safari bug #118630 + // Safari's Blob can only take an ArrayBuffer + b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); + } + } catch(e) { + warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + var img = new Image(); + img.onload = function img_onload() { + assert(img.complete, 'Image ' + name + ' could not be decoded'); + var canvas = document.createElement('canvas'); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext('2d'); + ctx.drawImage(img, 0, 0); + Module["preloadedImages"][name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = function img_onerror(event) { + console.log('Image ' + url + ' could not be decoded'); + if (onerror) onerror(); + }; + img.src = url; + }; + Module['preloadPlugins'].push(imagePlugin); + + var audioPlugin = {}; + audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; + }; + audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + Module["preloadedAudios"][name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + Module["preloadedAudios"][name] = new Audio(); // empty shim + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + } catch(e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! + var audio = new Audio(); + audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 + audio.onerror = function audio_onerror(event) { + if (done) return; + console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); + function encode64(data) { + var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + var PAD = '='; + var ret = ''; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = (leftchar << 8) | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = (leftchar >> (leftbits-6)) & 0x3f; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar&3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar&0xf) << 2]; + ret += PAD; + } + return ret; + } + audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); + finish(audio); // we don't wait for confirmation this worked - but it's worth trying + }; + audio.src = url; + // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror + Browser.safeSetTimeout(function() { + finish(audio); // try to use it even though it is not necessarily ready to play + }, 10000); + } else { + return fail(); + } + }; + Module['preloadPlugins'].push(audioPlugin); + + + // Canvas event setup + + function pointerLockChange() { + Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] || + document['mozPointerLockElement'] === Module['canvas'] || + document['webkitPointerLockElement'] === Module['canvas'] || + document['msPointerLockElement'] === Module['canvas']; + } + var canvas = Module['canvas']; + if (canvas) { + // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module + // Module['forcedAspectRatio'] = 4 / 3; + + canvas.requestPointerLock = canvas['requestPointerLock'] || + canvas['mozRequestPointerLock'] || + canvas['webkitRequestPointerLock'] || + canvas['msRequestPointerLock'] || + function(){}; + canvas.exitPointerLock = document['exitPointerLock'] || + document['mozExitPointerLock'] || + document['webkitExitPointerLock'] || + document['msExitPointerLock'] || + function(){}; // no-op if function does not exist + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + + document.addEventListener('pointerlockchange', pointerLockChange, false); + document.addEventListener('mozpointerlockchange', pointerLockChange, false); + document.addEventListener('webkitpointerlockchange', pointerLockChange, false); + document.addEventListener('mspointerlockchange', pointerLockChange, false); + + if (Module['elementPointerLock']) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. + + var ctx; + var contextHandle; + if (useWebGL) { + // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. + var contextAttributes = { + antialias: false, + alpha: false + }; + + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + } else { + ctx = canvas.getContext('2d'); + } + + if (!ctx) return null; + + if (setInModule) { + if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); + + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + Browser.init(); + } + return ctx; + },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + Browser.vrDevice = vrDevice; + if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; + if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; + if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; + + var canvas = Module['canvas']; + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvasContainer) { + canvas.exitFullscreen = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['msExitFullscreen'] || + document['webkitCancelFullScreen'] || + function() {}; + canvas.exitFullscreen = canvas.exitFullscreen.bind(document); + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) { + Browser.setFullscreenCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } else { + // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + + if (Browser.resizeCanvas) { + Browser.setWindowedCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } + if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen); + if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen); + } + + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener('fullscreenchange', fullscreenChange, false); + document.addEventListener('mozfullscreenchange', fullscreenChange, false); + document.addEventListener('webkitfullscreenchange', fullscreenChange, false); + document.addEventListener('MSFullscreenChange', fullscreenChange, false); + } + + // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + + // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) + canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] || + canvasContainer['mozRequestFullScreen'] || + canvasContainer['msRequestFullscreen'] || + (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) || + (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); + + if (vrDevice) { + canvasContainer.requestFullscreen({ vrDisplay: vrDevice }); + } else { + canvasContainer.requestFullscreen(); + } + },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { + err('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.'); + Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) { + return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); + } + return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); + },nextRAF:0,fakeRequestAnimationFrame:function (func) { + // try to keep 60fps between calls to here + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1000/60; + } else { + while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 + Browser.nextRAF += 1000/60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + },requestAnimationFrame:function requestAnimationFrame(func) { + if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) + Browser.fakeRequestAnimationFrame(func); + } else { + if (!window.requestAnimationFrame) { + window.requestAnimationFrame = window['requestAnimationFrame'] || + window['mozRequestAnimationFrame'] || + window['webkitRequestAnimationFrame'] || + window['msRequestAnimationFrame'] || + window['oRequestAnimationFrame'] || + Browser.fakeRequestAnimationFrame; + } + window.requestAnimationFrame(func); + } + },safeCallback:function (func) { + return function() { + if (!ABORT) return func.apply(null, arguments); + }; + },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { + Browser.allowAsyncCallbacks = false; + },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now + Browser.allowAsyncCallbacks = true; + if (Browser.queuedAsyncCallbacks.length > 0) { + var callbacks = Browser.queuedAsyncCallbacks; + Browser.queuedAsyncCallbacks = []; + callbacks.forEach(function(func) { + func(); + }); + } + },safeRequestAnimationFrame:function (func) { + return Browser.requestAnimationFrame(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }); + },safeSetTimeout:function (func, timeout) { + Module['noExitRuntime'] = true; + return setTimeout(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }, timeout); + },safeSetInterval:function (func, timeout) { + Module['noExitRuntime'] = true; + return setInterval(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } // drop it on the floor otherwise, next interval will kick in + }, timeout); + },getMimetype:function (name) { + return { + 'jpg': 'image/jpeg', + 'jpeg': 'image/jpeg', + 'png': 'image/png', + 'bmp': 'image/bmp', + 'ogg': 'audio/ogg', + 'wav': 'audio/wav', + 'mp3': 'audio/mpeg' + }[name.substr(name.lastIndexOf('.')+1)]; + },getUserMedia:function (func) { + if(!window.getUserMedia) { + window.getUserMedia = navigator['getUserMedia'] || + navigator['mozGetUserMedia']; + } + window.getUserMedia(func); + },getMovementX:function (event) { + return event['movementX'] || + event['mozMovementX'] || + event['webkitMovementX'] || + 0; + },getMovementY:function (event) { + return event['movementY'] || + event['mozMovementY'] || + event['webkitMovementY'] || + 0; + },getMouseWheelDelta:function (event) { + var delta = 0; + switch (event.type) { + case 'DOMMouseScroll': + delta = event.detail; + break; + case 'mousewheel': + delta = event.wheelDelta; + break; + case 'wheel': + delta = event['deltaY']; + break; + default: + throw 'unrecognized mouse wheel event: ' + event.type; + } + return delta; + },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup + if (Browser.pointerLock) { + // When the pointer is locked, calculate the coordinates + // based on the movement of the mouse. + // Workaround for Firefox bug 764498 + if (event.type != 'mousemove' && + ('mozMovementX' in event)) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + + // check if SDL is available + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + // just add the mouse delta to the current absolut mouse position + // FIXME: ideally this should be clamped against the canvas size and zero + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + // Otherwise, calculate the movement based on the changes + // in the coordinates. + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + + // Neither .scrollX or .pageXOffset are defined in a spec, but + // we prefer .scrollX because it is currently in a spec draft. + // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) + var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); + var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); + + if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { + var touch = event.touch; + if (touch === undefined) { + return; // the "touch" property is only defined in SDL + + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + + var coords = { x: adjustedX, y: adjustedY }; + + if (event.type === 'touchstart') { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === 'touchend' || event.type === 'touchmove') { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + + // the canvas might be CSS-scaled compared to its backbuffer; + // SDL-using content will want mouse coordinates in terms + // of backbuffer units. + x = x * (cw / rect.width); + y = y * (ch / rect.height); + + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + },asyncLoad:function (url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; + Module['readAsync'](url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, function(event) { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); + },resizeListeners:[],updateResizeListeners:function () { + var canvas = Module['canvas']; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + },setCanvasSize:function (width, height, noUpdates) { + var canvas = Module['canvas']; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags | 0x00800000; // set SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)]=flags + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },setWindowedCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)]=flags + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },updateCanvasDimensions:function (canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { + if (w/h < Module['forcedAspectRatio']) { + w = Math.round(h * Module['forcedAspectRatio']); + } else { + h = Math.round(w / Module['forcedAspectRatio']); + } + } + if (((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != 'undefined') { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != 'undefined') { + if (w != wNative || h != hNative) { + canvas.style.setProperty( "width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } + } + },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { + var handle = Browser.nextWgetRequestHandle; + Browser.nextWgetRequestHandle++; + return handle; + }}; + + function _SDL_GetTicks() { + return (Date.now() - SDL.startTime)|0; + } + + function _SDL_LockSurface(surf) { + var surfData = SDL.surfaces[surf]; + + surfData.locked++; + if (surfData.locked > 1) return 0; + + if (!surfData.buffer) { + surfData.buffer = _malloc(surfData.width * surfData.height * 4); + HEAP32[(((surf)+(20))>>2)]=surfData.buffer; + } + + // Mark in C/C++-accessible SDL structure + // SDL_Surface has the following fields: Uint32 flags, SDL_PixelFormat *format; int w, h; Uint16 pitch; void *pixels; ... + // So we have fields all of the same size, and 5 of them before us. + // TODO: Use macros like in library.js + HEAP32[(((surf)+(20))>>2)]=surfData.buffer; + + if (surf == SDL.screen && Module.screenIsReadOnly && surfData.image) return 0; + + if (SDL.defaults.discardOnLock) { + if (!surfData.image) { + surfData.image = surfData.ctx.createImageData(surfData.width, surfData.height); + } + if (!SDL.defaults.opaqueFrontBuffer) return; + } else { + surfData.image = surfData.ctx.getImageData(0, 0, surfData.width, surfData.height); + } + + // Emulate desktop behavior and kill alpha values on the locked surface. (very costly!) Set SDL.defaults.opaqueFrontBuffer = false + // if you don't want this. + if (surf == SDL.screen && SDL.defaults.opaqueFrontBuffer) { + var data = surfData.image.data; + var num = data.length; + for (var i = 0; i < num/4; i++) { + data[i*4+3] = 255; // opacity, as canvases blend alpha + } + } + + if (SDL.defaults.copyOnLock && !SDL.defaults.discardOnLock) { + // Copy pixel data to somewhere accessible to 'C/C++' + if (surfData.isFlagSet(0x00200000 /* SDL_HWPALETTE */)) { + // If this is neaded then + // we should compact the data from 32bpp to 8bpp index. + // I think best way to implement this is use + // additional colorMap hash (color->index). + // Something like this: + // + // var size = surfData.width * surfData.height; + // var data = ''; + // for (var i = 0; i<size; i++) { + // var color = SDL.translateRGBAToColor( + // surfData.image.data[i*4 ], + // surfData.image.data[i*4 +1], + // surfData.image.data[i*4 +2], + // 255); + // var index = surfData.colorMap[color]; + // HEAP8[(((surfData.buffer)+(i))>>0)]=index; + // } + throw 'CopyOnLock is not supported for SDL_LockSurface with SDL_HWPALETTE flag set' + new Error().stack; + } else { + HEAPU8.set(surfData.image.data, surfData.buffer); + } + } + + return 0; + }var SDL={defaults:{width:320,height:200,copyOnLock:true,discardOnLock:false,opaqueFrontBuffer:true},version:null,surfaces:{},canvasPool:[],events:[],fonts:[null],audios:[null],rwops:[null],music:{audio:null,volume:1},mixerFrequency:22050,mixerFormat:32784,mixerNumChannels:2,mixerChunkSize:1024,channelMinimumNumber:0,GL:false,glAttributes:{0:3,1:3,2:2,3:0,4:0,5:1,6:16,7:0,8:0,9:0,10:0,11:0,12:0,13:0,14:0,15:1,16:0,17:0,18:0},keyboardState:null,keyboardMap:{},canRequestFullscreen:false,isRequestingFullscreen:false,textInput:false,startTime:null,initFlags:0,buttonState:0,modState:0,DOMButtons:[0,0,0],DOMEventToSDLEvent:{},TOUCH_DEFAULT_ID:0,eventHandler:null,eventHandlerContext:null,eventHandlerTemp:0,keyCodes:{16:1249,17:1248,18:1250,20:1081,33:1099,34:1102,35:1101,36:1098,37:1104,38:1106,39:1103,40:1105,44:316,45:1097,46:127,91:1251,93:1125,96:1122,97:1113,98:1114,99:1115,100:1116,101:1117,102:1118,103:1119,104:1120,105:1121,106:1109,107:1111,109:1110,110:1123,111:1108,112:1082,113:1083,114:1084,115:1085,116:1086,117:1087,118:1088,119:1089,120:1090,121:1091,122:1092,123:1093,124:1128,125:1129,126:1130,127:1131,128:1132,129:1133,130:1134,131:1135,132:1136,133:1137,134:1138,135:1139,144:1107,160:94,161:33,162:34,163:35,164:36,165:37,166:38,167:95,168:40,169:41,170:42,171:43,172:124,173:45,174:123,175:125,176:126,181:127,182:129,183:128,188:44,190:46,191:47,192:96,219:91,220:92,221:93,222:39,224:1251},scanCodes:{8:42,9:43,13:40,27:41,32:44,35:204,39:53,44:54,46:55,47:56,48:39,49:30,50:31,51:32,52:33,53:34,54:35,55:36,56:37,57:38,58:203,59:51,61:46,91:47,92:49,93:48,96:52,97:4,98:5,99:6,100:7,101:8,102:9,103:10,104:11,105:12,106:13,107:14,108:15,109:16,110:17,111:18,112:19,113:20,114:21,115:22,116:23,117:24,118:25,119:26,120:27,121:28,122:29,127:76,305:224,308:226,316:70},loadRect:function (rect) { + return { + x: HEAP32[((rect + 0)>>2)], + y: HEAP32[((rect + 4)>>2)], + w: HEAP32[((rect + 8)>>2)], + h: HEAP32[((rect + 12)>>2)] + }; + },updateRect:function (rect, r) { + HEAP32[((rect)>>2)]=r.x; + HEAP32[(((rect)+(4))>>2)]=r.y; + HEAP32[(((rect)+(8))>>2)]=r.w; + HEAP32[(((rect)+(12))>>2)]=r.h; + },intersectionOfRects:function (first, second) { + var leftX = Math.max(first.x, second.x); + var leftY = Math.max(first.y, second.y); + var rightX = Math.min(first.x + first.w, second.x + second.w); + var rightY = Math.min(first.y + first.h, second.y + second.h); + + return { + x: leftX, + y: leftY, + w: Math.max(leftX, rightX) - leftX, + h: Math.max(leftY, rightY) - leftY + } + },checkPixelFormat:function (fmt) { + },loadColorToCSSRGB:function (color) { + var rgba = HEAP32[((color)>>2)]; + return 'rgb(' + (rgba&255) + ',' + ((rgba >> 8)&255) + ',' + ((rgba >> 16)&255) + ')'; + },loadColorToCSSRGBA:function (color) { + var rgba = HEAP32[((color)>>2)]; + return 'rgba(' + (rgba&255) + ',' + ((rgba >> 8)&255) + ',' + ((rgba >> 16)&255) + ',' + (((rgba >> 24)&255)/255) + ')'; + },translateColorToCSSRGBA:function (rgba) { + return 'rgba(' + (rgba&0xff) + ',' + (rgba>>8 & 0xff) + ',' + (rgba>>16 & 0xff) + ',' + (rgba>>>24)/0xff + ')'; + },translateRGBAToCSSRGBA:function (r, g, b, a) { + return 'rgba(' + (r&0xff) + ',' + (g&0xff) + ',' + (b&0xff) + ',' + (a&0xff)/255 + ')'; + },translateRGBAToColor:function (r, g, b, a) { + return r | g << 8 | b << 16 | a << 24; + },makeSurface:function (width, height, flags, usePageCanvas, source, rmask, gmask, bmask, amask) { + flags = flags || 0; + var is_SDL_HWSURFACE = flags & 0x00000001; + var is_SDL_HWPALETTE = flags & 0x00200000; + var is_SDL_OPENGL = flags & 0x04000000; + + var surf = _malloc(60); + var pixelFormat = _malloc(44); + //surface with SDL_HWPALETTE flag is 8bpp surface (1 byte) + var bpp = is_SDL_HWPALETTE ? 1 : 4; + var buffer = 0; + + // preemptively initialize this for software surfaces, + // otherwise it will be lazily initialized inside of SDL_LockSurface + if (!is_SDL_HWSURFACE && !is_SDL_OPENGL) { + buffer = _malloc(width * height * 4); + } + + HEAP32[((surf)>>2)]=flags; + HEAP32[(((surf)+(4))>>2)]=pixelFormat; + HEAP32[(((surf)+(8))>>2)]=width; + HEAP32[(((surf)+(12))>>2)]=height; + HEAP32[(((surf)+(16))>>2)]=width * bpp; // assuming RGBA or indexed for now, + // since that is what ImageData gives us in browsers + HEAP32[(((surf)+(20))>>2)]=buffer; + + HEAP32[(((surf)+(36))>>2)]=0; + HEAP32[(((surf)+(40))>>2)]=0; + HEAP32[(((surf)+(44))>>2)]=Module["canvas"].width; + HEAP32[(((surf)+(48))>>2)]=Module["canvas"].height; + + HEAP32[(((surf)+(56))>>2)]=1; + + HEAP32[((pixelFormat)>>2)]=-2042224636; + HEAP32[(((pixelFormat)+(4))>>2)]=0;// TODO + HEAP8[(((pixelFormat)+(8))>>0)]=bpp * 8; + HEAP8[(((pixelFormat)+(9))>>0)]=bpp; + + HEAP32[(((pixelFormat)+(12))>>2)]=rmask || 0x000000ff; + HEAP32[(((pixelFormat)+(16))>>2)]=gmask || 0x0000ff00; + HEAP32[(((pixelFormat)+(20))>>2)]=bmask || 0x00ff0000; + HEAP32[(((pixelFormat)+(24))>>2)]=amask || 0xff000000; + + // Decide if we want to use WebGL or not + SDL.GL = SDL.GL || is_SDL_OPENGL; + var canvas; + if (!usePageCanvas) { + if (SDL.canvasPool.length > 0) { + canvas = SDL.canvasPool.pop(); + } else { + canvas = document.createElement('canvas'); + } + canvas.width = width; + canvas.height = height; + } else { + canvas = Module['canvas']; + } + + var webGLContextAttributes = { + antialias: ((SDL.glAttributes[13 /*SDL_GL_MULTISAMPLEBUFFERS*/] != 0) && (SDL.glAttributes[14 /*SDL_GL_MULTISAMPLESAMPLES*/] > 1)), + depth: (SDL.glAttributes[6 /*SDL_GL_DEPTH_SIZE*/] > 0), + stencil: (SDL.glAttributes[7 /*SDL_GL_STENCIL_SIZE*/] > 0), + alpha: (SDL.glAttributes[3 /*SDL_GL_ALPHA_SIZE*/] > 0) + }; + + var ctx = Browser.createContext(canvas, is_SDL_OPENGL, usePageCanvas, webGLContextAttributes); + + SDL.surfaces[surf] = { + width: width, + height: height, + canvas: canvas, + ctx: ctx, + surf: surf, + buffer: buffer, + pixelFormat: pixelFormat, + alpha: 255, + flags: flags, + locked: 0, + usePageCanvas: usePageCanvas, + source: source, + + isFlagSet: function(flag) { + return flags & flag; + } + }; + + return surf; + },copyIndexedColorData:function (surfData, rX, rY, rW, rH) { + // HWPALETTE works with palette + // setted by SDL_SetColors + if (!surfData.colors) { + return; + } + + var fullWidth = Module['canvas'].width; + var fullHeight = Module['canvas'].height; + + var startX = rX || 0; + var startY = rY || 0; + var endX = (rW || (fullWidth - startX)) + startX; + var endY = (rH || (fullHeight - startY)) + startY; + + var buffer = surfData.buffer; + + if (!surfData.image.data32) { + surfData.image.data32 = new Uint32Array(surfData.image.data.buffer); + } + var data32 = surfData.image.data32; + + var colors32 = surfData.colors32; + + for (var y = startY; y < endY; ++y) { + var base = y * fullWidth; + for (var x = startX; x < endX; ++x) { + data32[base + x] = colors32[HEAPU8[((buffer + base + x)>>0)]]; + } + } + },freeSurface:function (surf) { + var refcountPointer = surf + 56; + var refcount = HEAP32[((refcountPointer)>>2)]; + if (refcount > 1) { + HEAP32[((refcountPointer)>>2)]=refcount - 1; + return; + } + + var info = SDL.surfaces[surf]; + if (!info.usePageCanvas && info.canvas) SDL.canvasPool.push(info.canvas); + if (info.buffer) _free(info.buffer); + _free(info.pixelFormat); + _free(surf); + SDL.surfaces[surf] = null; + + if (surf === SDL.screen) { + SDL.screen = null; + } + },blitSurface:function (src, srcrect, dst, dstrect, scale) { + var srcData = SDL.surfaces[src]; + var dstData = SDL.surfaces[dst]; + var sr, dr; + if (srcrect) { + sr = SDL.loadRect(srcrect); + } else { + sr = { x: 0, y: 0, w: srcData.width, h: srcData.height }; + } + if (dstrect) { + dr = SDL.loadRect(dstrect); + } else { + dr = { x: 0, y: 0, w: srcData.width, h: srcData.height }; + } + if (dstData.clipRect) { + var widthScale = (!scale || sr.w === 0) ? 1 : sr.w / dr.w; + var heightScale = (!scale || sr.h === 0) ? 1 : sr.h / dr.h; + + dr = SDL.intersectionOfRects(dstData.clipRect, dr); + + sr.w = dr.w * widthScale; + sr.h = dr.h * heightScale; + + if (dstrect) { + SDL.updateRect(dstrect, dr); + } + } + var blitw, blith; + if (scale) { + blitw = dr.w; blith = dr.h; + } else { + blitw = sr.w; blith = sr.h; + } + if (sr.w === 0 || sr.h === 0 || blitw === 0 || blith === 0) { + return 0; + } + var oldAlpha = dstData.ctx.globalAlpha; + dstData.ctx.globalAlpha = srcData.alpha/255; + dstData.ctx.drawImage(srcData.canvas, sr.x, sr.y, sr.w, sr.h, dr.x, dr.y, blitw, blith); + dstData.ctx.globalAlpha = oldAlpha; + if (dst != SDL.screen) { + // XXX As in IMG_Load, for compatibility we write out |pixels| + warnOnce('WARNING: copying canvas data to memory for compatibility'); + _SDL_LockSurface(dst); + dstData.locked--; // The surface is not actually locked in this hack + } + return 0; + },downFingers:{},savedKeydown:null,receiveEvent:function (event) { + function unpressAllPressedKeys() { + // Un-press all pressed keys: TODO + for (var code in SDL.keyboardMap) { + SDL.events.push({ + type: 'keyup', + keyCode: SDL.keyboardMap[code] + }); + } + }; + switch(event.type) { + case 'touchstart': case 'touchmove': { + event.preventDefault(); + + var touches = []; + + // Clear out any touchstart events that we've already processed + if (event.type === 'touchstart') { + for (var i = 0; i < event.touches.length; i++) { + var touch = event.touches[i]; + if (SDL.downFingers[touch.identifier] != true) { + SDL.downFingers[touch.identifier] = true; + touches.push(touch); + } + } + } else { + touches = event.touches; + } + + var firstTouch = touches[0]; + if (firstTouch) { + if (event.type == 'touchstart') { + SDL.DOMButtons[0] = 1; + } + var mouseEventType; + switch(event.type) { + case 'touchstart': mouseEventType = 'mousedown'; break; + case 'touchmove': mouseEventType = 'mousemove'; break; + } + var mouseEvent = { + type: mouseEventType, + button: 0, + pageX: firstTouch.clientX, + pageY: firstTouch.clientY + }; + SDL.events.push(mouseEvent); + } + + for (var i = 0; i < touches.length; i++) { + var touch = touches[i]; + SDL.events.push({ + type: event.type, + touch: touch + }); + }; + break; + } + case 'touchend': { + event.preventDefault(); + + // Remove the entry in the SDL.downFingers hash + // because the finger is no longer down. + for(var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + if (SDL.downFingers[touch.identifier] === true) { + delete SDL.downFingers[touch.identifier]; + } + } + + var mouseEvent = { + type: 'mouseup', + button: 0, + pageX: event.changedTouches[0].clientX, + pageY: event.changedTouches[0].clientY + }; + SDL.DOMButtons[0] = 0; + SDL.events.push(mouseEvent); + + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + SDL.events.push({ + type: 'touchend', + touch: touch + }); + }; + break; + } + case 'DOMMouseScroll': case 'mousewheel': case 'wheel': + var delta = -Browser.getMouseWheelDelta(event); // Flip the wheel direction to translate from browser wheel direction (+:down) to SDL direction (+:up) + delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. + + // Simulate old-style SDL events representing mouse wheel input as buttons + var button = delta > 0 ? 3 /*SDL_BUTTON_WHEELUP-1*/ : 4 /*SDL_BUTTON_WHEELDOWN-1*/; // Subtract one since JS->C marshalling is defined to add one back. + SDL.events.push({ type: 'mousedown', button: button, pageX: event.pageX, pageY: event.pageY }); + SDL.events.push({ type: 'mouseup', button: button, pageX: event.pageX, pageY: event.pageY }); + + // Pass a delta motion event. + SDL.events.push({ type: 'wheel', deltaX: 0, deltaY: delta }); + event.preventDefault(); // If we don't prevent this, then 'wheel' event will be sent again by the browser as 'DOMMouseScroll' and we will receive this same event the second time. + break; + case 'mousemove': + if (SDL.DOMButtons[0] === 1) { + SDL.events.push({ + type: 'touchmove', + touch: { + identifier: 0, + deviceID: -1, + pageX: event.pageX, + pageY: event.pageY + } + }); + } + if (Browser.pointerLock) { + // workaround for firefox bug 750111 + if ('mozMovementX' in event) { + event['movementX'] = event['mozMovementX']; + event['movementY'] = event['mozMovementY']; + } + // workaround for Firefox bug 782777 + if (event['movementX'] == 0 && event['movementY'] == 0) { + // ignore a mousemove event if it doesn't contain any movement info + // (without pointer lock, we infer movement from pageX/pageY, so this check is unnecessary) + event.preventDefault(); + return; + } + } + // fall through + case 'keydown': case 'keyup': case 'keypress': case 'mousedown': case 'mouseup': + // If we preventDefault on keydown events, the subsequent keypress events + // won't fire. However, it's fine (and in some cases necessary) to + // preventDefault for keys that don't generate a character. Otherwise, + // preventDefault is the right thing to do in general. + if (event.type !== 'keydown' || (!SDL.unicode && !SDL.textInput) || (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */)) { + event.preventDefault(); + } + + if (event.type == 'mousedown') { + SDL.DOMButtons[event.button] = 1; + SDL.events.push({ + type: 'touchstart', + touch: { + identifier: 0, + deviceID: -1, + pageX: event.pageX, + pageY: event.pageY + } + }); + } else if (event.type == 'mouseup') { + // ignore extra ups, can happen if we leave the canvas while pressing down, then return, + // since we add a mouseup in that case + if (!SDL.DOMButtons[event.button]) { + return; + } + + SDL.events.push({ + type: 'touchend', + touch: { + identifier: 0, + deviceID: -1, + pageX: event.pageX, + pageY: event.pageY + } + }); + SDL.DOMButtons[event.button] = 0; + } + + // We can only request fullscreen as the result of user input. + // Due to this limitation, we toggle a boolean on keydown which + // SDL_WM_ToggleFullScreen will check and subsequently set another + // flag indicating for us to request fullscreen on the following + // keyup. This isn't perfect, but it enables SDL_WM_ToggleFullScreen + // to work as the result of a keypress (which is an extremely + // common use case). + if (event.type === 'keydown' || event.type === 'mousedown') { + SDL.canRequestFullscreen = true; + } else if (event.type === 'keyup' || event.type === 'mouseup') { + if (SDL.isRequestingFullscreen) { + Module['requestFullscreen'](/*lockPointer=*/true, /*resizeCanvas=*/true); + SDL.isRequestingFullscreen = false; + } + SDL.canRequestFullscreen = false; + } + + // SDL expects a unicode character to be passed to its keydown events. + // Unfortunately, the browser APIs only provide a charCode property on + // keypress events, so we must backfill in keydown events with their + // subsequent keypress event's charCode. + if (event.type === 'keypress' && SDL.savedKeydown) { + // charCode is read-only + SDL.savedKeydown.keypressCharCode = event.charCode; + SDL.savedKeydown = null; + } else if (event.type === 'keydown') { + SDL.savedKeydown = event; + } + + // Don't push keypress events unless SDL_StartTextInput has been called. + if (event.type !== 'keypress' || SDL.textInput) { + SDL.events.push(event); + } + break; + case 'mouseout': + // Un-press all pressed mouse buttons, because we might miss the release outside of the canvas + for (var i = 0; i < 3; i++) { + if (SDL.DOMButtons[i]) { + SDL.events.push({ + type: 'mouseup', + button: i, + pageX: event.pageX, + pageY: event.pageY + }); + SDL.DOMButtons[i] = 0; + } + } + event.preventDefault(); + break; + case 'focus': + SDL.events.push(event); + event.preventDefault(); + break; + case 'blur': + SDL.events.push(event); + unpressAllPressedKeys(); + event.preventDefault(); + break; + case 'visibilitychange': + SDL.events.push({ + type: 'visibilitychange', + visible: !document.hidden + }); + unpressAllPressedKeys(); + event.preventDefault(); + break; + case 'unload': + if (Browser.mainLoop.runner) { + SDL.events.push(event); + // Force-run a main event loop, since otherwise this event will never be caught! + Browser.mainLoop.runner(); + } + return; + case 'resize': + SDL.events.push(event); + // manually triggered resize event doesn't have a preventDefault member + if (event.preventDefault) { + event.preventDefault(); + } + break; + } + if (SDL.events.length >= 10000) { + err('SDL event queue full, dropping events'); + SDL.events = SDL.events.slice(0, 10000); + } + // If we have a handler installed, this will push the events to the app + // instead of the app polling for them. + SDL.flushEventsToHandler(); + return; + },lookupKeyCodeForEvent:function (event) { + var code = event.keyCode; + if (code >= 65 && code <= 90) { + code += 32; // make lowercase for SDL + } else { + code = SDL.keyCodes[event.keyCode] || event.keyCode; + // If this is one of the modifier keys (224 | 1<<10 - 227 | 1<<10), and the event specifies that it is + // a right key, add 4 to get the right key SDL key code. + if (event.location === KeyboardEvent.DOM_KEY_LOCATION_RIGHT && code >= (224 | 1<<10) && code <= (227 | 1<<10)) { + code += 4; + } + } + return code; + },handleEvent:function (event) { + if (event.handled) return; + event.handled = true; + + switch (event.type) { + case 'touchstart': case 'touchend': case 'touchmove': { + Browser.calculateMouseEvent(event); + break; + } + case 'keydown': case 'keyup': { + var down = event.type === 'keydown'; + var code = SDL.lookupKeyCodeForEvent(event); + HEAP8[(((SDL.keyboardState)+(code))>>0)]=down; + // TODO: lmeta, rmeta, numlock, capslock, KMOD_MODE, KMOD_RESERVED + SDL.modState = (HEAP8[(((SDL.keyboardState)+(1248))>>0)] ? 0x0040 : 0) | // KMOD_LCTRL + (HEAP8[(((SDL.keyboardState)+(1249))>>0)] ? 0x0001 : 0) | // KMOD_LSHIFT + (HEAP8[(((SDL.keyboardState)+(1250))>>0)] ? 0x0100 : 0) | // KMOD_LALT + (HEAP8[(((SDL.keyboardState)+(1252))>>0)] ? 0x0080 : 0) | // KMOD_RCTRL + (HEAP8[(((SDL.keyboardState)+(1253))>>0)] ? 0x0002 : 0) | // KMOD_RSHIFT + (HEAP8[(((SDL.keyboardState)+(1254))>>0)] ? 0x0200 : 0); // KMOD_RALT + if (down) { + SDL.keyboardMap[code] = event.keyCode; // save the DOM input, which we can use to unpress it during blur + } else { + delete SDL.keyboardMap[code]; + } + + break; + } + case 'mousedown': case 'mouseup': + if (event.type == 'mousedown') { + // SDL_BUTTON(x) is defined as (1 << ((x)-1)). SDL buttons are 1-3, + // and DOM buttons are 0-2, so this means that the below formula is + // correct. + SDL.buttonState |= 1 << event.button; + } else if (event.type == 'mouseup') { + SDL.buttonState &= ~(1 << event.button); + } + // fall through + case 'mousemove': { + Browser.calculateMouseEvent(event); + break; + } + } + },flushEventsToHandler:function () { + if (!SDL.eventHandler) return; + + while (SDL.pollEvent(SDL.eventHandlerTemp)) { + Module['dynCall_iii'](SDL.eventHandler, SDL.eventHandlerContext, SDL.eventHandlerTemp); + } + },pollEvent:function (ptr) { + if (SDL.initFlags & 0x200 && SDL.joystickEventState) { + // If SDL_INIT_JOYSTICK was supplied AND the joystick system is configured + // to automatically query for events, query for joystick events. + SDL.queryJoysticks(); + } + if (ptr) { + while (SDL.events.length > 0) { + if (SDL.makeCEvent(SDL.events.shift(), ptr) !== false) return 1; + } + return 0; + } else { + // XXX: somewhat risky in that we do not check if the event is real or not (makeCEvent returns false) if no pointer supplied + return SDL.events.length > 0; + } + },makeCEvent:function (event, ptr) { + if (typeof event === 'number') { + // This is a pointer to a copy of a native C event that was SDL_PushEvent'ed + _memcpy(ptr, event, 28); + _free(event); // the copy is no longer needed + return; + } + + SDL.handleEvent(event); + + switch (event.type) { + case 'keydown': case 'keyup': { + var down = event.type === 'keydown'; + //out('Received key event: ' + event.keyCode); + var key = SDL.lookupKeyCodeForEvent(event); + var scan; + if (key >= 1024) { + scan = key - 1024; + } else { + scan = SDL.scanCodes[key] || key; + } + + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP8[(((ptr)+(8))>>0)]=down ? 1 : 0; + HEAP8[(((ptr)+(9))>>0)]=0; // TODO + HEAP32[(((ptr)+(12))>>2)]=scan; + HEAP32[(((ptr)+(16))>>2)]=key; + HEAP16[(((ptr)+(20))>>1)]=SDL.modState; + // some non-character keys (e.g. backspace and tab) won't have keypressCharCode set, fill in with the keyCode. + HEAP32[(((ptr)+(24))>>2)]=event.keypressCharCode || key; + + break; + } + case 'keypress': { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + // Not filling in windowID for now + var cStr = intArrayFromString(String.fromCharCode(event.charCode)); + for (var i = 0; i < cStr.length; ++i) { + HEAP8[(((ptr)+(8 + i))>>0)]=cStr[i]; + } + break; + } + case 'mousedown': case 'mouseup': case 'mousemove': { + if (event.type != 'mousemove') { + var down = event.type === 'mousedown'; + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=0; + HEAP32[(((ptr)+(8))>>2)]=0; + HEAP32[(((ptr)+(12))>>2)]=0; + HEAP8[(((ptr)+(16))>>0)]=event.button+1; // DOM buttons are 0-2, SDL 1-3 + HEAP8[(((ptr)+(17))>>0)]=down ? 1 : 0; + HEAP32[(((ptr)+(20))>>2)]=Browser.mouseX; + HEAP32[(((ptr)+(24))>>2)]=Browser.mouseY; + } else { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=0; + HEAP32[(((ptr)+(8))>>2)]=0; + HEAP32[(((ptr)+(12))>>2)]=0; + HEAP32[(((ptr)+(16))>>2)]=SDL.buttonState; + HEAP32[(((ptr)+(20))>>2)]=Browser.mouseX; + HEAP32[(((ptr)+(24))>>2)]=Browser.mouseY; + HEAP32[(((ptr)+(28))>>2)]=Browser.mouseMovementX; + HEAP32[(((ptr)+(32))>>2)]=Browser.mouseMovementY; + } + break; + } + case 'wheel': { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(16))>>2)]=event.deltaX; + HEAP32[(((ptr)+(20))>>2)]=event.deltaY; + break; + } + case 'touchstart': case 'touchend': case 'touchmove': { + var touch = event.touch; + if (!Browser.touches[touch.identifier]) break; + var w = Module['canvas'].width; + var h = Module['canvas'].height; + var x = Browser.touches[touch.identifier].x / w; + var y = Browser.touches[touch.identifier].y / h; + var lx = Browser.lastTouches[touch.identifier].x / w; + var ly = Browser.lastTouches[touch.identifier].y / h; + var dx = x - lx; + var dy = y - ly; + if (touch['deviceID'] === undefined) touch.deviceID = SDL.TOUCH_DEFAULT_ID; + if (dx === 0 && dy === 0 && event.type === 'touchmove') return false; // don't send these if nothing happened + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=_SDL_GetTicks(); + (tempI64 = [touch.deviceID>>>0,(tempDouble=touch.deviceID,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((ptr)+(8))>>2)]=tempI64[0],HEAP32[(((ptr)+(12))>>2)]=tempI64[1]); + (tempI64 = [touch.identifier>>>0,(tempDouble=touch.identifier,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((ptr)+(16))>>2)]=tempI64[0],HEAP32[(((ptr)+(20))>>2)]=tempI64[1]); + HEAPF32[(((ptr)+(24))>>2)]=x; + HEAPF32[(((ptr)+(28))>>2)]=y; + HEAPF32[(((ptr)+(32))>>2)]=dx; + HEAPF32[(((ptr)+(36))>>2)]=dy; + if (touch.force !== undefined) { + HEAPF32[(((ptr)+(40))>>2)]=touch.force; + } else { // No pressure data, send a digital 0/1 pressure. + HEAPF32[(((ptr)+(40))>>2)]=event.type == "touchend" ? 0 : 1; + } + break; + } + case 'unload': { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + break; + } + case 'resize': { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=event.w; + HEAP32[(((ptr)+(8))>>2)]=event.h; + break; + } + case 'joystick_button_up': case 'joystick_button_down': { + var state = event.type === 'joystick_button_up' ? 0 : 1; + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP8[(((ptr)+(4))>>0)]=event.index; + HEAP8[(((ptr)+(5))>>0)]=event.button; + HEAP8[(((ptr)+(6))>>0)]=state; + break; + } + case 'joystick_axis_motion': { + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP8[(((ptr)+(4))>>0)]=event.index; + HEAP8[(((ptr)+(5))>>0)]=event.axis; + HEAP32[(((ptr)+(8))>>2)]=SDL.joystickAxisValueConversion(event.value); + break; + } + case 'focus': { + var SDL_WINDOWEVENT_FOCUS_GAINED = 12 /* SDL_WINDOWEVENT_FOCUS_GAINED */; + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=0; + HEAP8[(((ptr)+(8))>>0)]=SDL_WINDOWEVENT_FOCUS_GAINED; + break; + } + case 'blur': { + var SDL_WINDOWEVENT_FOCUS_LOST = 13 /* SDL_WINDOWEVENT_FOCUS_LOST */; + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=0; + HEAP8[(((ptr)+(8))>>0)]=SDL_WINDOWEVENT_FOCUS_LOST; + break; + } + case 'visibilitychange': { + var SDL_WINDOWEVENT_SHOWN = 1 /* SDL_WINDOWEVENT_SHOWN */; + var SDL_WINDOWEVENT_HIDDEN = 2 /* SDL_WINDOWEVENT_HIDDEN */; + var visibilityEventID = event.visible ? SDL_WINDOWEVENT_SHOWN : SDL_WINDOWEVENT_HIDDEN; + HEAP32[((ptr)>>2)]=SDL.DOMEventToSDLEvent[event.type]; + HEAP32[(((ptr)+(4))>>2)]=0; + HEAP8[(((ptr)+(8))>>0)]=visibilityEventID; + break; + } + default: throw 'Unhandled SDL event: ' + event.type; + } + },makeFontString:function (height, fontName) { + if (fontName.charAt(0) != "'" && fontName.charAt(0) != '"') { + // https://developer.mozilla.org/ru/docs/Web/CSS/font-family + // Font family names containing whitespace should be quoted. + // BTW, quote all font names is easier than searching spaces + fontName = '"' + fontName + '"'; + } + return height + 'px ' + fontName + ', serif'; + },estimateTextWidth:function (fontData, text) { + var h = fontData.size; + var fontString = SDL.makeFontString(h, fontData.name); + var tempCtx = SDL.ttfContext; + tempCtx.save(); + tempCtx.font = fontString; + var ret = tempCtx.measureText(text).width | 0; + tempCtx.restore(); + return ret; + },allocateChannels:function (num) { // called from Mix_AllocateChannels and init + if (SDL.numChannels && SDL.numChannels >= num && num != 0) return; + SDL.numChannels = num; + SDL.channels = []; + for (var i = 0; i < num; i++) { + SDL.channels[i] = { + audio: null, + volume: 1.0 + }; + } + },setGetVolume:function (info, volume) { + if (!info) return 0; + var ret = info.volume * 128; // MIX_MAX_VOLUME + if (volume != -1) { + info.volume = Math.min(Math.max(volume, 0), 128) / 128; + if (info.audio) { + try { + info.audio.volume = info.volume; // For <audio> element + if (info.audio.webAudioGainNode) info.audio.webAudioGainNode['gain']['value'] = info.volume; // For WebAudio playback + } catch(e) { + err('setGetVolume failed to set audio volume: ' + e); + } + } + } + return ret; + },setPannerPosition:function (info, x, y, z) { + if (!info) return; + if (info.audio) { + if (info.audio.webAudioPannerNode) { + info.audio.webAudioPannerNode['setPosition'](x, y, z); + } + } + },playWebAudio:function (audio) { + if (!audio) return; + if (audio.webAudioNode) return; // This instance is already playing, don't start again. + if (!SDL.webAudioAvailable()) return; + try { + var webAudio = audio.resource.webAudio; + audio.paused = false; + if (!webAudio.decodedBuffer) { + if (webAudio.onDecodeComplete === undefined) abort("Cannot play back audio object that was not loaded"); + webAudio.onDecodeComplete.push(function() { if (!audio.paused) SDL.playWebAudio(audio); }); + return; + } + audio.webAudioNode = SDL.audioContext['createBufferSource'](); + audio.webAudioNode['buffer'] = webAudio.decodedBuffer; + audio.webAudioNode['loop'] = audio.loop; + audio.webAudioNode['onended'] = function() { audio['onended'](); } // For <media> element compatibility, route the onended signal to the instance. + + audio.webAudioPannerNode = SDL.audioContext['createPanner'](); + // avoid Chrome bug + // If posz = 0, the sound will come from only the right. + // By posz = -0.5 (slightly ahead), the sound will come from right and left correctly. + audio.webAudioPannerNode["setPosition"](0, 0, -.5); + audio.webAudioPannerNode['panningModel'] = 'equalpower'; + + // Add an intermediate gain node to control volume. + audio.webAudioGainNode = SDL.audioContext['createGain'](); + audio.webAudioGainNode['gain']['value'] = audio.volume; + + audio.webAudioNode['connect'](audio.webAudioPannerNode); + audio.webAudioPannerNode['connect'](audio.webAudioGainNode); + audio.webAudioGainNode['connect'](SDL.audioContext['destination']); + + audio.webAudioNode['start'](0, audio.currentPosition); + audio.startTime = SDL.audioContext['currentTime'] - audio.currentPosition; + } catch(e) { + err('playWebAudio failed: ' + e); + } + },pauseWebAudio:function (audio) { + if (!audio) return; + if (audio.webAudioNode) { + try { + // Remember where we left off, so that if/when we resume, we can restart the playback at a proper place. + audio.currentPosition = (SDL.audioContext['currentTime'] - audio.startTime) % audio.resource.webAudio.decodedBuffer.duration; + // Important: When we reach here, the audio playback is stopped by the user. But when calling .stop() below, the Web Audio + // graph will send the onended signal, but we don't want to process that, since pausing should not clear/destroy the audio + // channel. + audio.webAudioNode['onended'] = undefined; + audio.webAudioNode.stop(0); // 0 is a default parameter, but WebKit is confused by it #3861 + audio.webAudioNode = undefined; + } catch(e) { + err('pauseWebAudio failed: ' + e); + } + } + audio.paused = true; + },openAudioContext:function () { + // Initialize Web Audio API if we haven't done so yet. Note: Only initialize Web Audio context ever once on the web page, + // since initializing multiple times fails on Chrome saying 'audio resources have been exhausted'. + if (!SDL.audioContext) { + if (typeof(AudioContext) !== 'undefined') SDL.audioContext = new AudioContext(); + else if (typeof(webkitAudioContext) !== 'undefined') SDL.audioContext = new webkitAudioContext(); + } + },webAudioAvailable:function () { return !!SDL.audioContext; },fillWebAudioBufferFromHeap:function (heapPtr, sizeSamplesPerChannel, dstAudioBuffer) { + // The input audio data is interleaved across the channels, i.e. [L, R, L, R, L, R, ...] and is either 8-bit, 16-bit or float as + // supported by the SDL API. The output audio wave data for Web Audio API must be in planar buffers of [-1,1]-normalized Float32 data, + // so perform a buffer conversion for the data. + var numChannels = SDL.audio.channels; + for(var c = 0; c < numChannels; ++c) { + var channelData = dstAudioBuffer['getChannelData'](c); + if (channelData.length != sizeSamplesPerChannel) { + throw 'Web Audio output buffer length mismatch! Destination size: ' + channelData.length + ' samples vs expected ' + sizeSamplesPerChannel + ' samples!'; + } + if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) { + for(var j = 0; j < sizeSamplesPerChannel; ++j) { + channelData[j] = (HEAP16[(((heapPtr)+((j*numChannels + c)*2))>>1)]) / 0x8000; + } + } else if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) { + for(var j = 0; j < sizeSamplesPerChannel; ++j) { + var v = (HEAP8[(((heapPtr)+(j*numChannels + c))>>0)]); + channelData[j] = ((v >= 0) ? v-128 : v+128) /128; + } + } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) { + for(var j = 0; j < sizeSamplesPerChannel; ++j) { + channelData[j] = (HEAPF32[(((heapPtr)+((j*numChannels + c)*4))>>2)]); + } + } else { + throw 'Invalid SDL audio format ' + SDL.audio.format + '!'; + } + } + },debugSurface:function (surfData) { + console.log('dumping surface ' + [surfData.surf, surfData.source, surfData.width, surfData.height]); + var image = surfData.ctx.getImageData(0, 0, surfData.width, surfData.height); + var data = image.data; + var num = Math.min(surfData.width, surfData.height); + for (var i = 0; i < num; i++) { + console.log(' diagonal ' + i + ':' + [data[i*surfData.width*4 + i*4 + 0], data[i*surfData.width*4 + i*4 + 1], data[i*surfData.width*4 + i*4 + 2], data[i*surfData.width*4 + i*4 + 3]]); + } + },joystickEventState:1,lastJoystickState:{},joystickNamePool:{},recordJoystickState:function (joystick, state) { + // Standardize button state. + var buttons = new Array(state.buttons.length); + for (var i = 0; i < state.buttons.length; i++) { + buttons[i] = SDL.getJoystickButtonState(state.buttons[i]); + } + + SDL.lastJoystickState[joystick] = { + buttons: buttons, + axes: state.axes.slice(0), + timestamp: state.timestamp, + index: state.index, + id: state.id + }; + },getJoystickButtonState:function (button) { + if (typeof button === 'object') { + // Current gamepad API editor's draft (Firefox Nightly) + // https://dvcs.w3.org/hg/gamepad/raw-file/default/gamepad.html#idl-def-GamepadButton + return button['pressed']; + } else { + // Current gamepad API working draft (Firefox / Chrome Stable) + // http://www.w3.org/TR/2012/WD-gamepad-20120529/#gamepad-interface + return button > 0; + } + },queryJoysticks:function () { + for (var joystick in SDL.lastJoystickState) { + var state = SDL.getGamepad(joystick - 1); + var prevState = SDL.lastJoystickState[joystick]; + // If joystick was removed, state returns null. + if (typeof state === 'undefined') return; + if (state === null) return; + // Check only if the timestamp has differed. + // NOTE: Timestamp is not available in Firefox. + // NOTE: Timestamp is currently not properly set for the GearVR controller + // on Samsung Internet: it is always zero. + if (typeof state.timestamp !== 'number' || state.timestamp !== prevState.timestamp || !state.timestamp) { + var i; + for (i = 0; i < state.buttons.length; i++) { + var buttonState = SDL.getJoystickButtonState(state.buttons[i]); + // NOTE: The previous state already has a boolean representation of + // its button, so no need to standardize its button state here. + if (buttonState !== prevState.buttons[i]) { + // Insert button-press event. + SDL.events.push({ + type: buttonState ? 'joystick_button_down' : 'joystick_button_up', + joystick: joystick, + index: joystick - 1, + button: i + }); + } + } + for (i = 0; i < state.axes.length; i++) { + if (state.axes[i] !== prevState.axes[i]) { + // Insert axes-change event. + SDL.events.push({ + type: 'joystick_axis_motion', + joystick: joystick, + index: joystick - 1, + axis: i, + value: state.axes[i] + }); + } + } + + SDL.recordJoystickState(joystick, state); + } + } + },joystickAxisValueConversion:function (value) { + // Make sure value is properly clamped + value = Math.min(1, Math.max(value, -1)); + // Ensures that 0 is 0, 1 is 32767, and -1 is 32768. + return Math.ceil(((value+1) * 32767.5) - 32768); + },getGamepads:function () { + var fcn = navigator.getGamepads || navigator.webkitGamepads || navigator.mozGamepads || navigator.gamepads || navigator.webkitGetGamepads; + if (fcn !== undefined) { + // The function must be applied on the navigator object. + return fcn.apply(navigator); + } else { + return []; + } + },getGamepad:function (deviceIndex) { + var gamepads = SDL.getGamepads(); + if (gamepads.length > deviceIndex && deviceIndex >= 0) { + return gamepads[deviceIndex]; + } + return null; + }};function _SDL_PauseAudio(pauseOn) { + if (!SDL.audio) { + return; + } + if (pauseOn) { + if (SDL.audio.timer !== undefined) { + clearTimeout(SDL.audio.timer); + SDL.audio.numAudioTimersPending = 0; + SDL.audio.timer = undefined; + } + } else if (!SDL.audio.timer) { + // Start the audio playback timer callback loop. + SDL.audio.numAudioTimersPending = 1; + SDL.audio.timer = Browser.safeSetTimeout(SDL.audio.caller, 1); + } + SDL.audio.paused = pauseOn; + }function _SDL_CloseAudio() { + if (SDL.audio) { + _SDL_PauseAudio(1); + _free(SDL.audio.buffer); + SDL.audio = null; + SDL.allocateChannels(0); + } + } + + function _SDL_InitSubSystem(flags) { return 0 } + + function _SDL_OpenAudio(desired, obtained) { + try { + SDL.audio = { + freq: HEAPU32[((desired)>>2)], + format: HEAPU16[(((desired)+(4))>>1)], + channels: HEAPU8[(((desired)+(6))>>0)], + samples: HEAPU16[(((desired)+(8))>>1)], // Samples in the CB buffer per single sound channel. + callback: HEAPU32[(((desired)+(16))>>2)], + userdata: HEAPU32[(((desired)+(20))>>2)], + paused: true, + timer: null + }; + // The .silence field tells the constant sample value that corresponds to the safe un-skewed silence value for the wave data. + if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) { + SDL.audio.silence = 128; // Audio ranges in [0, 255], so silence is half-way in between. + } else if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) { + SDL.audio.silence = 0; // Signed data in range [-32768, 32767], silence is 0. + } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) { + SDL.audio.silence = 0.0; // Float data in range [-1.0, 1.0], silence is 0.0 + } else { + throw 'Invalid SDL audio format ' + SDL.audio.format + '!'; + } + // Round the desired audio frequency up to the next 'common' frequency value. + // Web Audio API spec states 'An implementation must support sample-rates in at least the range 22050 to 96000.' + if (SDL.audio.freq <= 0) { + throw 'Unsupported sound frequency ' + SDL.audio.freq + '!'; + } else if (SDL.audio.freq <= 22050) { + SDL.audio.freq = 22050; // Take it safe and clamp everything lower than 22kHz to that. + } else if (SDL.audio.freq <= 32000) { + SDL.audio.freq = 32000; + } else if (SDL.audio.freq <= 44100) { + SDL.audio.freq = 44100; + } else if (SDL.audio.freq <= 48000) { + SDL.audio.freq = 48000; + } else if (SDL.audio.freq <= 96000) { + SDL.audio.freq = 96000; + } else { + throw 'Unsupported sound frequency ' + SDL.audio.freq + '!'; + } + if (SDL.audio.channels == 0) { + SDL.audio.channels = 1; // In SDL both 0 and 1 mean mono. + } else if (SDL.audio.channels < 0 || SDL.audio.channels > 32) { + throw 'Unsupported number of audio channels for SDL audio: ' + SDL.audio.channels + '!'; + } else if (SDL.audio.channels != 1 && SDL.audio.channels != 2) { // Unsure what SDL audio spec supports. Web Audio spec supports up to 32 channels. + console.log('Warning: Using untested number of audio channels ' + SDL.audio.channels); + } + if (SDL.audio.samples < 128 || SDL.audio.samples > 524288 /* arbitrary cap */) { + throw 'Unsupported audio callback buffer size ' + SDL.audio.samples + '!'; + } else if ((SDL.audio.samples & (SDL.audio.samples-1)) != 0) { + throw 'Audio callback buffer size ' + SDL.audio.samples + ' must be a power-of-two!'; + } + + var totalSamples = SDL.audio.samples*SDL.audio.channels; + if (SDL.audio.format == 0x0008 /*AUDIO_U8*/) { + SDL.audio.bytesPerSample = 1; + } else if (SDL.audio.format == 0x8010 /*AUDIO_S16LSB*/) { + SDL.audio.bytesPerSample = 2; + } else if (SDL.audio.format == 0x8120 /*AUDIO_F32*/) { + SDL.audio.bytesPerSample = 4; + } else { + throw 'Invalid SDL audio format ' + SDL.audio.format + '!'; + } + SDL.audio.bufferSize = totalSamples*SDL.audio.bytesPerSample; + SDL.audio.bufferDurationSecs = SDL.audio.bufferSize / SDL.audio.bytesPerSample / SDL.audio.channels / SDL.audio.freq; // Duration of a single queued buffer in seconds. + SDL.audio.bufferingDelay = 50 / 1000; // Audio samples are played with a constant delay of this many seconds to account for browser and jitter. + SDL.audio.buffer = _malloc(SDL.audio.bufferSize); + + // To account for jittering in frametimes, always have multiple audio buffers queued up for the audio output device. + // This helps that we won't starve that easily if a frame takes long to complete. + SDL.audio.numSimultaneouslyQueuedBuffers = Module['SDL_numSimultaneouslyQueuedBuffers'] || 5; + + // Pulls and queues new audio data if appropriate. This function gets "over-called" in both requestAnimationFrames and + // setTimeouts to ensure that we get the finest granularity possible and as many chances from the browser to fill + // new audio data. This is because setTimeouts alone have very poor granularity for audio streaming purposes, but also + // the application might not be using emscripten_set_main_loop to drive the main loop, so we cannot rely on that alone. + SDL.audio.queueNewAudioData = function SDL_queueNewAudioData() { + if (!SDL.audio) return; + + for(var i = 0; i < SDL.audio.numSimultaneouslyQueuedBuffers; ++i) { + // Only queue new data if we don't have enough audio data already in queue. Otherwise skip this time slot + // and wait to queue more in the next time the callback is run. + var secsUntilNextPlayStart = SDL.audio.nextPlayTime - SDL.audioContext['currentTime']; + if (secsUntilNextPlayStart >= SDL.audio.bufferingDelay + SDL.audio.bufferDurationSecs*SDL.audio.numSimultaneouslyQueuedBuffers) return; + + // Ask SDL audio data from the user code. + Module['dynCall_viii'](SDL.audio.callback, SDL.audio.userdata, SDL.audio.buffer, SDL.audio.bufferSize); + // And queue it to be played after the currently playing audio stream. + SDL.audio.pushAudio(SDL.audio.buffer, SDL.audio.bufferSize); + } + } + + + // Create a callback function that will be routinely called to ask more audio data from the user application. + SDL.audio.caller = function SDL_audioCaller() { + if (!SDL.audio) return; + + --SDL.audio.numAudioTimersPending; + + SDL.audio.queueNewAudioData(); + + // Queue this callback function to be called again later to pull more audio data. + var secsUntilNextPlayStart = SDL.audio.nextPlayTime - SDL.audioContext['currentTime']; + + // Queue the next audio frame push to be performed half-way when the previously queued buffer has finished playing. + var preemptBufferFeedSecs = SDL.audio.bufferDurationSecs/2.0; + + if (SDL.audio.numAudioTimersPending < SDL.audio.numSimultaneouslyQueuedBuffers) { + ++SDL.audio.numAudioTimersPending; + SDL.audio.timer = Browser.safeSetTimeout(SDL.audio.caller, Math.max(0.0, 1000.0*(secsUntilNextPlayStart-preemptBufferFeedSecs))); + + // If we are risking starving, immediately queue an extra buffer. + if (SDL.audio.numAudioTimersPending < SDL.audio.numSimultaneouslyQueuedBuffers) { + ++SDL.audio.numAudioTimersPending; + Browser.safeSetTimeout(SDL.audio.caller, 1.0); + } + } + }; + + SDL.audio.audioOutput = new Audio(); + + // Initialize Web Audio API if we haven't done so yet. Note: Only initialize Web Audio context ever once on the web page, + // since initializing multiple times fails on Chrome saying 'audio resources have been exhausted'. + SDL.openAudioContext(); + if (!SDL.audioContext) throw 'Web Audio API is not available!'; + SDL.audio.nextPlayTime = 0; // Time in seconds when the next audio block is due to start. + + // The pushAudio function with a new audio buffer whenever there is new audio data to schedule to be played back on the device. + SDL.audio.pushAudio=function(ptr,sizeBytes) { + try { + if (SDL.audio.paused) return; + + var sizeSamples = sizeBytes / SDL.audio.bytesPerSample; // How many samples fit in the callback buffer? + var sizeSamplesPerChannel = sizeSamples / SDL.audio.channels; // How many samples per a single channel fit in the cb buffer? + if (sizeSamplesPerChannel != SDL.audio.samples) { + throw 'Received mismatching audio buffer size!'; + } + // Allocate new sound buffer to be played. + var source = SDL.audioContext['createBufferSource'](); + var soundBuffer = SDL.audioContext['createBuffer'](SDL.audio.channels,sizeSamplesPerChannel,SDL.audio.freq); + source['connect'](SDL.audioContext['destination']); + + SDL.fillWebAudioBufferFromHeap(ptr, sizeSamplesPerChannel, soundBuffer); + // Workaround https://bugzilla.mozilla.org/show_bug.cgi?id=883675 by setting the buffer only after filling. The order is important here! + source['buffer'] = soundBuffer; + + // Schedule the generated sample buffer to be played out at the correct time right after the previously scheduled + // sample buffer has finished. + var curtime = SDL.audioContext['currentTime']; + // Don't ever start buffer playbacks earlier from current time than a given constant 'SDL.audio.bufferingDelay', since a browser + // may not be able to mix that audio clip in immediately, and there may be subsequent jitter that might cause the stream to starve. + var playtime = Math.max(curtime + SDL.audio.bufferingDelay, SDL.audio.nextPlayTime); + if (typeof source['start'] !== 'undefined') { + source['start'](playtime); // New Web Audio API: sound sources are started with a .start() call. + } else if (typeof source['noteOn'] !== 'undefined') { + source['noteOn'](playtime); // Support old Web Audio API specification which had the .noteOn() API. + } + /* + // Uncomment to debug SDL buffer feed starves. + if (SDL.audio.curBufferEnd) { + var thisBufferStart = Math.round(playtime * SDL.audio.freq); + if (thisBufferStart != SDL.audio.curBufferEnd) console.log('SDL starved ' + (thisBufferStart - SDL.audio.curBufferEnd) + ' samples!'); + } + SDL.audio.curBufferEnd = Math.round(playtime * SDL.audio.freq + sizeSamplesPerChannel); + */ + + SDL.audio.nextPlayTime = playtime + SDL.audio.bufferDurationSecs; + } catch(e) { + console.log('Web Audio API error playing back audio: ' + e.toString()); + } + } + + if (obtained) { + // Report back the initialized audio parameters. + HEAP32[((obtained)>>2)]=SDL.audio.freq; + HEAP16[(((obtained)+(4))>>1)]=SDL.audio.format; + HEAP8[(((obtained)+(6))>>0)]=SDL.audio.channels; + HEAP8[(((obtained)+(7))>>0)]=SDL.audio.silence; + HEAP16[(((obtained)+(8))>>1)]=SDL.audio.samples; + HEAP32[(((obtained)+(16))>>2)]=SDL.audio.callback; + HEAP32[(((obtained)+(20))>>2)]=SDL.audio.userdata; + } + SDL.allocateChannels(32); + + } catch(e) { + console.log('Initializing SDL audio threw an exception: "' + e.toString() + '"! Continuing without audio.'); + SDL.audio = null; + SDL.allocateChannels(0); + if (obtained) { + HEAP32[((obtained)>>2)]=0; + HEAP16[(((obtained)+(4))>>1)]=0; + HEAP8[(((obtained)+(6))>>0)]=0; + HEAP8[(((obtained)+(7))>>0)]=0; + HEAP16[(((obtained)+(8))>>1)]=0; + HEAP32[(((obtained)+(16))>>2)]=0; + HEAP32[(((obtained)+(20))>>2)]=0; + } + } + if (!SDL.audio) { + return -1; + } + return 0; + } + + + function _SDL_QuitSubSystem(flags) { + out('SDL_QuitSubSystem called (and ignored)'); + } + + function ___assert_fail(condition, filename, line, func) { + abort('Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function']); + } + + function ___lock() {} + + + var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { + if (path[0] !== '/') { + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + dir = dirstream.path; + } + path = PATH.join2(dir, path); + } + return path; + },doStat:function (func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -ERRNO_CODES.ENOTDIR; + } + throw e; + } + HEAP32[((buf)>>2)]=stat.dev; + HEAP32[(((buf)+(4))>>2)]=0; + HEAP32[(((buf)+(8))>>2)]=stat.ino; + HEAP32[(((buf)+(12))>>2)]=stat.mode; + HEAP32[(((buf)+(16))>>2)]=stat.nlink; + HEAP32[(((buf)+(20))>>2)]=stat.uid; + HEAP32[(((buf)+(24))>>2)]=stat.gid; + HEAP32[(((buf)+(28))>>2)]=stat.rdev; + HEAP32[(((buf)+(32))>>2)]=0; + HEAP32[(((buf)+(36))>>2)]=stat.size; + HEAP32[(((buf)+(40))>>2)]=4096; + HEAP32[(((buf)+(44))>>2)]=stat.blocks; + HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; + HEAP32[(((buf)+(52))>>2)]=0; + HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; + HEAP32[(((buf)+(60))>>2)]=0; + HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; + HEAP32[(((buf)+(68))>>2)]=0; + HEAP32[(((buf)+(72))>>2)]=stat.ino; + return 0; + },doMsync:function (addr, stream, len, flags) { + var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); + FS.msync(stream, buffer, 0, len, flags); + },doMkdir:function (path, mode) { + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + },doMknod:function (path, mode, dev) { + // we don't want this in the JS API as it uses mknod to create all nodes. + switch (mode & 61440) { + case 32768: + case 8192: + case 24576: + case 4096: + case 49152: + break; + default: return -ERRNO_CODES.EINVAL; + } + FS.mknod(path, mode, dev); + return 0; + },doReadlink:function (path, buf, bufsize) { + if (bufsize <= 0) return -ERRNO_CODES.EINVAL; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf+len]; + stringToUTF8(ret, buf, bufsize+1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf+len] = endChar; + + return len; + },doAccess:function (path, amode) { + if (amode & ~7) { + // need a valid mode + return -ERRNO_CODES.EINVAL; + } + var node; + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -ERRNO_CODES.EACCES; + } + return 0; + },doDup:function (path, flags, suggestFD) { + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.open(path, flags, 0, suggestFD, suggestFD).fd; + },doReadv:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + } + return ret; + },doWritev:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; + },varargs:0,get:function (varargs) { + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function () { + var ret = Pointer_stringify(SYSCALLS.get()); + return ret; + },getStreamFromFD:function () { + var stream = FS.getStream(SYSCALLS.get()); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return stream; + },getSocketFromFD:function () { + var socket = SOCKFS.getSocket(SYSCALLS.get()); + if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return socket; + },getSocketAddress:function (allowNull) { + var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); + if (allowNull && addrp === 0) return null; + var info = __read_sockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + },get64:function () { + var low = SYSCALLS.get(), high = SYSCALLS.get(); + if (low >= 0) assert(high === 0); + else assert(high === -1); + return low; + },getZero:function () { + assert(SYSCALLS.get() === 0); + }};function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs; + try { + // llseek + var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get(); + // NOTE: offset_high is unused - Emscripten's off_t is 32-bit + var offset = offset_low; + FS.llseek(stream, offset, whence); + HEAP32[((result)>>2)]=stream.position; + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs; + try { + // readv + var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); + return SYSCALLS.doReadv(stream, iov, iovcnt); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs; + try { + // writev + var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get(); + return SYSCALLS.doWritev(stream, iov, iovcnt); + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs; + try { + // fcntl64 + var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get(); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -ERRNO_CODES.EINVAL; + } + var newStream; + newStream = FS.open(stream.path, stream.flags, 0, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 12: + case 12: { + var arg = SYSCALLS.get(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)]=2; + return 0; + } + case 13: + case 14: + case 13: + case 14: + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves. + ___setErrNo(ERRNO_CODES.EINVAL); + return -1; + default: { + return -ERRNO_CODES.EINVAL; + } + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs; + try { + // open + var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO + var stream = FS.open(pathname, flags, mode); + return stream.fd; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; + try { + // ioctl + var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); + switch (op) { + case 21509: + case 21505: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)]=0; + return 0; + } + case 21520: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return -ERRNO_CODES.EINVAL; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + default: abort('bad ioctl syscall ' + op); + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs; + try { + // close + var stream = SYSCALLS.getStreamFromFD(); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function ___unlock() {} + + + var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,alpha:false,depth:true,stencil:true,antialias:true,stringCache:{},setErrorCode:function (code) { + EGL.errorCode = code; + },chooseConfig:function (display, attribList, config, config_size, numConfigs) { + if (display != 62000 /* Magic ID for Emscripten 'default display' */) { + EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */); + return 0; + } + + if (attribList) { + // read attribList if it is non-null + for(;;) { + var param = HEAP32[((attribList)>>2)]; + if (param == 0x3021 /*EGL_ALPHA_SIZE*/) { + var alphaSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.alpha = (alphaSize > 0); + } else if (param == 0x3025 /*EGL_DEPTH_SIZE*/) { + var depthSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.depth = (depthSize > 0); + } else if (param == 0x3026 /*EGL_STENCIL_SIZE*/) { + var stencilSize = HEAP32[(((attribList)+(4))>>2)]; + EGL.stencil = (stencilSize > 0); + } else if (param == 0x3031 /*EGL_SAMPLES*/) { + var samples = HEAP32[(((attribList)+(4))>>2)]; + EGL.antialias = (samples > 0); + } else if (param == 0x3032 /*EGL_SAMPLE_BUFFERS*/) { + var samples = HEAP32[(((attribList)+(4))>>2)]; + EGL.antialias = (samples == 1); + } else if (param == 0x3038 /*EGL_NONE*/) { + break; + } + attribList += 8; + } + } + + if ((!config || !config_size) && !numConfigs) { + EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */); + return 0; + } + if (numConfigs) { + HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1. + } + if (config && config_size > 0) { + HEAP32[((config)>>2)]=62002; + } + + EGL.setErrorCode(0x3000 /* EGL_SUCCESS */); + return 1; + }};function _eglGetProcAddress(name_) { + return _emscripten_GetProcAddress(name_); + } + + + + + function _emscripten_get_canvas_element_size(target, width, height) { + var canvas = JSEvents.findCanvasEventTarget(target); + if (!canvas) return -4; + HEAP32[((width)>>2)]=canvas.width; + HEAP32[((height)>>2)]=canvas.height; + }function __get_canvas_element_size(target) { + var stackTop = stackSave(); + var w = stackAlloc(8); + var h = w + 4; + + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + var ret = _emscripten_get_canvas_element_size(targetInt, w, h); + var size = [HEAP32[((w)>>2)], HEAP32[((h)>>2)]]; + stackRestore(stackTop); + return size; + } + + + function _emscripten_set_canvas_element_size(target, width, height) { + var canvas = JSEvents.findCanvasEventTarget(target); + if (!canvas) return -4; + canvas.width = width; + canvas.height = height; + return 0; + }function __set_canvas_element_size(target, width, height) { + if (!target.controlTransferredOffscreen) { + target.width = width; + target.height = height; + } else { + // This function is being called from high-level JavaScript code instead of asm.js/Wasm, + // and it needs to synchronously proxy over to another thread, so marshal the string onto the heap to do the call. + var stackTop = stackSave(); + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + _emscripten_set_canvas_element_size(targetInt, width, height); + stackRestore(stackTop); + } + }var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,_onGamepadConnected:function () { ++JSEvents.numGamepadsConnected; },_onGamepadDisconnected:function () { --JSEvents.numGamepadsConnected; },staticInit:function () { + if (typeof window !== 'undefined') { + window.addEventListener("gamepadconnected", JSEvents._onGamepadConnected); + window.addEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected); + + // Chromium does not fire the gamepadconnected event on reload, so we need to get the number of gamepads here as a workaround. + // See https://bugs.chromium.org/p/chromium/issues/detail?id=502824 + var firstState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null); + if (firstState) { + JSEvents.numGamepadsConnected = firstState.length; + } + } + },removeAllEventListeners:function () { + for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + JSEvents.eventHandlers = []; + JSEvents.deferredCalls = []; + if (typeof window !== 'undefined') { + window.removeEventListener("gamepadconnected", JSEvents._onGamepadConnected); + window.removeEventListener("gamepaddisconnected", JSEvents._onGamepadDisconnected); + } + },registerRemoveEventListeners:function () { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(JSEvents.removeAllEventListeners); + JSEvents.removeEventListenersRegistered = true; + } + },findEventTarget:function (target) { + try { + // The sensible "default" target varies between events, but use window as the default + // since DOM events mostly can default to that. Specific callback registrations + // override their own defaults. + if (!target) return window; + if (typeof target === "number") target = Pointer_stringify(target); + if (target === '#window') return window; + else if (target === '#document') return document; + else if (target === '#screen') return window.screen; + else if (target === '#canvas') return Module['canvas']; + return (typeof target === 'string') ? document.getElementById(target) : target; + } catch(e) { + // In Web Workers, some objects above, such as '#document' do not exist. Gracefully + // return null for them. + return null; + } + },findCanvasEventTarget:function (target) { + if (typeof target === 'number') target = Pointer_stringify(target); + if (!target || target === '#canvas') { + if (typeof GL !== 'undefined' && GL.offscreenCanvases['canvas']) return GL.offscreenCanvases['canvas']; // TODO: Remove this line, target '#canvas' should refer only to Module['canvas'], not to GL.offscreenCanvases['canvas'] - but need stricter tests to be able to remove this line. + return Module['canvas']; + } + if (typeof GL !== 'undefined' && GL.offscreenCanvases[target]) return GL.offscreenCanvases[target]; + return JSEvents.findEventTarget(target); + },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + + for(var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + // Test if the given call was already queued, and if so, don't add it again. + for(var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + + JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); + },removeDeferredCalls:function (targetFunction) { + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + },canPerformEventHandlerRequests:function () { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + },runDeferredCalls:function () { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(this, call.argsList); + } + },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && + (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + },_removeHandler:function (i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + },registerOrRemoveHandler:function (eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + // Increment nesting count for the event handler. + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + // Process any old deferred calls the user has placed. + JSEvents.runDeferredCalls(); + // Process the actual event, calls back to user C code handler. + eventHandler.handlerFunc(event); + // Process any new deferred calls that were placed right now from this event handler. + JSEvents.runDeferredCalls(); + // Out of event handler - restore nesting count. + --JSEvents.inEventHandler; + } + + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target + && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 164 ); + + var keyEventHandlerFunc = function(event) { + var e = event || window.event; + + var keyEventData = JSEvents.keyEvent; + stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32); + stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32); + HEAP32[(((keyEventData)+(64))>>2)]=e.location; + HEAP32[(((keyEventData)+(68))>>2)]=e.ctrlKey; + HEAP32[(((keyEventData)+(72))>>2)]=e.shiftKey; + HEAP32[(((keyEventData)+(76))>>2)]=e.altKey; + HEAP32[(((keyEventData)+(80))>>2)]=e.metaKey; + HEAP32[(((keyEventData)+(84))>>2)]=e.repeat; + stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32); + stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32); + HEAP32[(((keyEventData)+(152))>>2)]=e.charCode; + HEAP32[(((keyEventData)+(156))>>2)]=e.keyCode; + HEAP32[(((keyEventData)+(160))>>2)]=e.which; + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: keyEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getBoundingClientRectOrZeros:function (target) { + return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; + },fillMouseEventData:function (eventStruct, e, target) { + HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); + HEAP32[(((eventStruct)+(8))>>2)]=e.screenX; + HEAP32[(((eventStruct)+(12))>>2)]=e.screenY; + HEAP32[(((eventStruct)+(16))>>2)]=e.clientX; + HEAP32[(((eventStruct)+(20))>>2)]=e.clientY; + HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey; + HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey; + HEAP32[(((eventStruct)+(32))>>2)]=e.altKey; + HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey; + HEAP16[(((eventStruct)+(40))>>1)]=e.button; + HEAP16[(((eventStruct)+(42))>>1)]=e.buttons; + HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX); + HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY); + + if (Module['canvas']) { + var rect = Module['canvas'].getBoundingClientRect(); + HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top; + } else { // Canvas is not initialized, return 0. + HEAP32[(((eventStruct)+(60))>>2)]=0; + HEAP32[(((eventStruct)+(64))>>2)]=0; + } + if (target) { + var rect = JSEvents.getBoundingClientRectOrZeros(target); + HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top; + } else { // No specific target passed, return 0. + HEAP32[(((eventStruct)+(52))>>2)]=0; + HEAP32[(((eventStruct)+(56))>>2)]=0; + } + // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera + // https://github.com/kripken/emscripten/pull/4997 + // https://bugs.chromium.org/p/chromium/issues/detail?id=699956 + if (e.type !== 'wheel' && e.type !== 'mousewheel') { + JSEvents.previousScreenX = e.screenX; + JSEvents.previousScreenY = e.screenY; + } + },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 72 ); + target = JSEvents.findEventTarget(target); + + var mouseEventHandlerFunc = function(event) { + var e = event || window.event; + + // TODO: Make this access thread safe, or this could update live while app is reading it. + JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: mouseEventHandlerFunc, + useCapture: useCapture + }; + // In IE, mousedown events don't either allow deferred calls to be run! + if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc( 104 ); + target = JSEvents.findEventTarget(target); + + + // The DOM Level 3 events spec event 'wheel' + var wheelHandlerFunc = function(event) { + var e = event || window.event; + var wheelEvent = JSEvents.wheelEvent; + JSEvents.fillMouseEventData(wheelEvent, e, target); + HEAPF64[(((wheelEvent)+(72))>>3)]=e["deltaX"]; + HEAPF64[(((wheelEvent)+(80))>>3)]=e["deltaY"]; + HEAPF64[(((wheelEvent)+(88))>>3)]=e["deltaZ"]; + HEAP32[(((wheelEvent)+(96))>>2)]=e["deltaMode"]; + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, wheelEvent, userData)) e.preventDefault(); + }; + // The 'mousewheel' event as implemented in Safari 6.0.5 + var mouseWheelHandlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); + HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0; + HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */; + HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */; + HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */; + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },pageScrollPos:function () { + if (window.pageXOffset > 0 || window.pageYOffset > 0) { + return [window.pageXOffset, window.pageYOffset]; + } + if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') { + return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; + } + return [document.body.scrollLeft|0, document.body.scrollTop|0]; + },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.uiEvent) JSEvents.uiEvent = _malloc( 36 ); + + if (eventTypeString == "scroll" && !target) { + target = document; // By default read scroll events on document rather than window. + } else { + target = JSEvents.findEventTarget(target); + } + + var uiEventHandlerFunc = function(event) { + var e = event || window.event; + if (e.target != target) { + // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that + // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log + // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, + // causing a new scroll, etc.. + return; + } + var scrollPos = JSEvents.pageScrollPos(); + + var uiEvent = JSEvents.uiEvent; + HEAP32[((uiEvent)>>2)]=e.detail; + HEAP32[(((uiEvent)+(4))>>2)]=document.body.clientWidth; + HEAP32[(((uiEvent)+(8))>>2)]=document.body.clientHeight; + HEAP32[(((uiEvent)+(12))>>2)]=window.innerWidth; + HEAP32[(((uiEvent)+(16))>>2)]=window.innerHeight; + HEAP32[(((uiEvent)+(20))>>2)]=window.outerWidth; + HEAP32[(((uiEvent)+(24))>>2)]=window.outerHeight; + HEAP32[(((uiEvent)+(28))>>2)]=scrollPos[0]; + HEAP32[(((uiEvent)+(32))>>2)]=scrollPos[1]; + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, uiEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: uiEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getNodeNameForTarget:function (target) { + if (!target) return ''; + if (target == window) return '#window'; + if (target == window.screen) return '#screen'; + return (target && target.nodeName) ? target.nodeName : ''; + },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc( 256 ); + + var focusEventHandlerFunc = function(event) { + var e = event || window.event; + + var nodeName = JSEvents.getNodeNameForTarget(e.target); + var id = e.target.id ? e.target.id : ''; + + var focusEvent = JSEvents.focusEvent; + stringToUTF8(nodeName, focusEvent + 0, 128); + stringToUTF8(id, focusEvent + 128, 128); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, focusEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: focusEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },tick:function () { + if (window['performance'] && window['performance']['now']) return window['performance']['now'](); + else return Date.now(); + },fillDeviceOrientationEventData:function (eventStruct, e, target) { + HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); + HEAPF64[(((eventStruct)+(8))>>3)]=e.alpha; + HEAPF64[(((eventStruct)+(16))>>3)]=e.beta; + HEAPF64[(((eventStruct)+(24))>>3)]=e.gamma; + HEAP32[(((eventStruct)+(32))>>2)]=e.absolute; + },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.deviceOrientationEvent) JSEvents.deviceOrientationEvent = _malloc( 40 ); + + var deviceOrientationEventHandlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillDeviceOrientationEventData(JSEvents.deviceOrientationEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_deviceorientation_status() + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: deviceOrientationEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fillDeviceMotionEventData:function (eventStruct, e, target) { + HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); + HEAPF64[(((eventStruct)+(8))>>3)]=e.acceleration.x; + HEAPF64[(((eventStruct)+(16))>>3)]=e.acceleration.y; + HEAPF64[(((eventStruct)+(24))>>3)]=e.acceleration.z; + HEAPF64[(((eventStruct)+(32))>>3)]=e.accelerationIncludingGravity.x; + HEAPF64[(((eventStruct)+(40))>>3)]=e.accelerationIncludingGravity.y; + HEAPF64[(((eventStruct)+(48))>>3)]=e.accelerationIncludingGravity.z; + HEAPF64[(((eventStruct)+(56))>>3)]=e.rotationRate.alpha; + HEAPF64[(((eventStruct)+(64))>>3)]=e.rotationRate.beta; + HEAPF64[(((eventStruct)+(72))>>3)]=e.rotationRate.gamma; + },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.deviceMotionEvent) JSEvents.deviceMotionEvent = _malloc( 80 ); + + var deviceMotionEventHandlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillDeviceMotionEventData(JSEvents.deviceMotionEvent, e, target); // TODO: Thread-safety with respect to emscripten_get_devicemotion_status() + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: deviceMotionEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },screenOrientation:function () { + if (!window.screen) return undefined; + return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; + },fillOrientationChangeEventData:function (eventStruct, e) { + var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; + var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; + + var orientationString = JSEvents.screenOrientation(); + var orientation = orientations.indexOf(orientationString); + if (orientation == -1) { + orientation = orientations2.indexOf(orientationString); + } + + HEAP32[((eventStruct)>>2)]=1 << orientation; + HEAP32[(((eventStruct)+(4))>>2)]=window.orientation; + },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.orientationChangeEvent) JSEvents.orientationChangeEvent = _malloc( 8 ); + + if (!target) { + target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var orientationChangeEventHandlerFunc = function(event) { + var e = event || window.event; + + var orientationChangeEvent = JSEvents.orientationChangeEvent; + + JSEvents.fillOrientationChangeEventData(orientationChangeEvent, e); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, orientationChangeEvent, userData)) e.preventDefault(); + }; + + if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { + eventTypeString = "mozorientationchange"; + } + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: orientationChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fullscreenEnabled:function () { + return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; + },fillFullscreenChangeEventData:function (eventStruct, e) { + var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + var isFullscreen = !!fullscreenElement; + HEAP32[((eventStruct)>>2)]=isFullscreen; + HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); + // If transitioning to fullscreen, report info about the element that is now fullscreen. + // If transitioning to windowed mode, report info about the element that just was fullscreen. + var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; + var nodeName = JSEvents.getNodeNameForTarget(reportedElement); + var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; + stringToUTF8(nodeName, eventStruct + 8, 128); + stringToUTF8(id, eventStruct + 136, 128); + HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; + HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; + HEAP32[(((eventStruct)+(272))>>2)]=screen.width; + HEAP32[(((eventStruct)+(276))>>2)]=screen.height; + if (isFullscreen) { + JSEvents.previousFullscreenElement = fullscreenElement; + } + },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 ); + + if (!target) target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window' + else target = JSEvents.findEventTarget(target); + + var fullscreenChangeEventhandlerFunc = function(event) { + var e = event || window.event; + + var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent; + + JSEvents.fillFullscreenChangeEventData(fullscreenChangeEvent, e); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: fullscreenChangeEventhandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },resizeCanvasForFullscreen:function (target, strategy) { + var restoreOldStyle = __registerRestoreOldStyle(target); + var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; + var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; + var rect = target.getBoundingClientRect(); + var windowedCssWidth = rect.right - rect.left; + var windowedCssHeight = rect.bottom - rect.top; + var canvasSize = __get_canvas_element_size(target); + var windowedRttWidth = canvasSize[0]; + var windowedRttHeight = canvasSize[1]; + + if (strategy.scaleMode == 3) { + __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); + cssWidth = windowedCssWidth; + cssHeight = windowedCssHeight; + } else if (strategy.scaleMode == 2) { + if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { + var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; + __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); + cssHeight = desiredCssHeight; + } else { + var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; + __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); + cssWidth = desiredCssWidth; + } + } + + // If we are adding padding, must choose a background color or otherwise Chrome will give the + // padding a default white color. Do it only if user has not customized their own background color. + if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; + // IE11 does the same, but requires the color to be set in the document body. + if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 + // Firefox always shows black letterboxes independent of style color. + + target.style.width = cssWidth + 'px'; + target.style.height = cssHeight + 'px'; + + if (strategy.filteringMode == 1) { + target.style.imageRendering = 'optimizeSpeed'; + target.style.imageRendering = '-moz-crisp-edges'; + target.style.imageRendering = '-o-crisp-edges'; + target.style.imageRendering = '-webkit-optimize-contrast'; + target.style.imageRendering = 'optimize-contrast'; + target.style.imageRendering = 'crisp-edges'; + target.style.imageRendering = 'pixelated'; + } + + var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1; + if (strategy.canvasResolutionScaleMode != 0) { + var newWidth = (cssWidth * dpiScale)|0; + var newHeight = (cssHeight * dpiScale)|0; + __set_canvas_element_size(target, newWidth, newHeight); + if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight); + } + return restoreOldStyle; + },requestFullscreen:function (target, strategy) { + // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. + if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { + JSEvents.resizeCanvasForFullscreen(target, strategy); + } + + if (target.requestFullscreen) { + target.requestFullscreen(); + } else if (target.msRequestFullscreen) { + target.msRequestFullscreen(); + } else if (target.mozRequestFullScreen) { + target.mozRequestFullScreen(); + } else if (target.mozRequestFullscreen) { + target.mozRequestFullscreen(); + } else if (target.webkitRequestFullscreen) { + target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); + } else { + if (typeof JSEvents.fullscreenEnabled() === 'undefined') { + return -1; + } else { + return -3; + } + } + + if (strategy.canvasResizedCallback) { + Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData); + } + + return 0; + },fillPointerlockChangeEventData:function (eventStruct, e) { + var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; + var isPointerlocked = !!pointerLockElement; + HEAP32[((eventStruct)>>2)]=isPointerlocked; + var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); + var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; + stringToUTF8(nodeName, eventStruct + 4, 128); + stringToUTF8(id, eventStruct + 132, 128); + },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc( 260 ); + + if (!target) target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window' + else target = JSEvents.findEventTarget(target); + + var pointerlockChangeEventHandlerFunc = function(event) { + var e = event || window.event; + + var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent; + JSEvents.fillPointerlockChangeEventData(pointerlockChangeEvent, e); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: pointerlockChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!target) target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window' + else target = JSEvents.findEventTarget(target); + + var pointerlockErrorEventHandlerFunc = function(event) { + var e = event || window.event; + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: pointerlockErrorEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },requestPointerLock:function (target) { + if (target.requestPointerLock) { + target.requestPointerLock(); + } else if (target.mozRequestPointerLock) { + target.mozRequestPointerLock(); + } else if (target.webkitRequestPointerLock) { + target.webkitRequestPointerLock(); + } else if (target.msRequestPointerLock) { + target.msRequestPointerLock(); + } else { + // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, + // or if the whole browser just doesn't support the feature. + if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { + return -3; + } else { + return -1; + } + } + return 0; + },fillVisibilityChangeEventData:function (eventStruct, e) { + var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; + var visibilityState = visibilityStates.indexOf(document.visibilityState); + + HEAP32[((eventStruct)>>2)]=document.hidden; + HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; + },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.visibilityChangeEvent) JSEvents.visibilityChangeEvent = _malloc( 8 ); + + if (!target) target = document; // Visibility change events need to be captured from 'document' by default instead of 'window' + else target = JSEvents.findEventTarget(target); + + var visibilityChangeEventHandlerFunc = function(event) { + var e = event || window.event; + + var visibilityChangeEvent = JSEvents.visibilityChangeEvent; + + JSEvents.fillVisibilityChangeEventData(visibilityChangeEvent, e); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, visibilityChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: visibilityChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1684 ); + + target = JSEvents.findEventTarget(target); + + var touchEventHandlerFunc = function(event) { + var e = event || window.event; + + var touches = {}; + for(var i = 0; i < e.touches.length; ++i) { + var touch = e.touches[i]; + touches[touch.identifier] = touch; + } + for(var i = 0; i < e.changedTouches.length; ++i) { + var touch = e.changedTouches[i]; + touches[touch.identifier] = touch; + touch.changed = true; + } + for(var i = 0; i < e.targetTouches.length; ++i) { + var touch = e.targetTouches[i]; + touches[touch.identifier].onTarget = true; + } + + var touchEvent = JSEvents.touchEvent; + var ptr = touchEvent; + HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey; + HEAP32[(((ptr)+(8))>>2)]=e.shiftKey; + HEAP32[(((ptr)+(12))>>2)]=e.altKey; + HEAP32[(((ptr)+(16))>>2)]=e.metaKey; + ptr += 20; // Advance to the start of the touch array. + var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined; + var targetRect = JSEvents.getBoundingClientRectOrZeros(target); + var numTouches = 0; + for(var i in touches) { + var t = touches[i]; + HEAP32[((ptr)>>2)]=t.identifier; + HEAP32[(((ptr)+(4))>>2)]=t.screenX; + HEAP32[(((ptr)+(8))>>2)]=t.screenY; + HEAP32[(((ptr)+(12))>>2)]=t.clientX; + HEAP32[(((ptr)+(16))>>2)]=t.clientY; + HEAP32[(((ptr)+(20))>>2)]=t.pageX; + HEAP32[(((ptr)+(24))>>2)]=t.pageY; + HEAP32[(((ptr)+(28))>>2)]=t.changed; + HEAP32[(((ptr)+(32))>>2)]=t.onTarget; + if (canvasRect) { + HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left; + HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top; + } else { + HEAP32[(((ptr)+(44))>>2)]=0; + HEAP32[(((ptr)+(48))>>2)]=0; + } + HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left; + HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top; + + ptr += 52; + + if (++numTouches >= 32) { + break; + } + } + HEAP32[((touchEvent)>>2)]=numTouches; + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend', + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: touchEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fillGamepadEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.timestamp; + for(var i = 0; i < e.axes.length; ++i) { + HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; + } else { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; + } + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; + } else { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0; + } + } + HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; + HEAP32[(((eventStruct)+(1300))>>2)]=e.index; + HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; + HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; + stringToUTF8(e.id, eventStruct + 1304, 64); + stringToUTF8(e.mapping, eventStruct + 1368, 64); + },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 ); + + var gamepadEventHandlerFunc = function(event) { + var e = event || window.event; + + var gamepadEvent = JSEvents.gamepadEvent; + JSEvents.fillGamepadEventData(gamepadEvent, e.gamepad); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: gamepadEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + var beforeUnloadEventHandlerFunc = function(event) { + var e = event || window.event; + + // Note: This is always called on the main browser thread, since it needs synchronously return a value! + var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData); + + if (confirmationMessage) { + confirmationMessage = Pointer_stringify(confirmationMessage); + } + if (confirmationMessage) { + e.preventDefault(); + e.returnValue = confirmationMessage; + return confirmationMessage; + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: beforeUnloadEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.chargingTime; + HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime; + HEAPF64[(((eventStruct)+(16))>>3)]=e.level; + HEAP32[(((eventStruct)+(24))>>2)]=e.charging; + },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.batteryEvent) JSEvents.batteryEvent = _malloc( 32 ); + + var batteryEventHandlerFunc = function(event) { + var e = event || window.event; + + var batteryEvent = JSEvents.batteryEvent; + JSEvents.fillBatteryEventData(batteryEvent, JSEvents.battery()); + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, batteryEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: batteryEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!target) target = Module['canvas']; + + var webGlEventHandlerFunc = function(event) { + var e = event || window.event; + + if (Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: webGlEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }};function _emscripten_exit_pointerlock() { + // Make sure no queued up calls will fire after this. + JSEvents.removeDeferredCalls(JSEvents.requestPointerLock); + + if (document.exitPointerLock) { + document.exitPointerLock(); + } else if (document.msExitPointerLock) { + document.msExitPointerLock(); + } else if (document.mozExitPointerLock) { + document.mozExitPointerLock(); + } else if (document.webkitExitPointerLock) { + document.webkitExitPointerLock(); + } else { + return -1; + } + return 0; + } + + + function __emscripten_sample_gamepad_data() { + // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected. + if (!JSEvents.numGamepadsConnected) return; + + // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation. + if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) { + JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null); + JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber; + } + }function _emscripten_get_gamepad_status(index, gamepadState) { + __emscripten_sample_gamepad_data(); + if (!JSEvents.lastGamepadState) return -1; + + // INVALID_PARAM is returned on a Gamepad index that never was there. + if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5; + + // NO_DATA is returned on a Gamepad index that was removed. + // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index. + // This is because gamepads must keep their original position in the array. + // For example, removing the first of two gamepads produces [null/undefined/false, gamepad]. + if (!JSEvents.lastGamepadState[index]) return -7; + + JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]); + return 0; + } + + function _emscripten_get_num_gamepads() { + // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected. + if (!JSEvents.numGamepadsConnected) return 0; + + __emscripten_sample_gamepad_data(); + if (!JSEvents.lastGamepadState) return -1; + return JSEvents.lastGamepadState.length; + } + + function _emscripten_get_pointerlock_status(pointerlockStatus) { + if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus); + if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) { + return -1; + } + return 0; + } + + function _emscripten_glAccum() { + err('missing function: emscripten_glAccum'); abort(-1); + } + + + var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:{},currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () { + GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); + for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { + GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1); + } + + // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API, + // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions. + for (var i = 0; i < 32; i++) { + GL.tempFixedLengthArray.push(new Array(i)); + } + },recordError:function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + },getNewId:function (table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) { + var source = ''; + for (var i = 0; i < count; ++i) { + var frag; + if (length) { + var len = HEAP32[(((length)+(i*4))>>2)]; + if (len < 0) { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len); + } + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } + source += frag; + } + return source; + },createContext:function (canvas, webGLContextAttributes) { + if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') { + webGLContextAttributes['majorVersion'] = 1; + webGLContextAttributes['minorVersion'] = 0; + } + + + + var ctx; + var errorInfo = '?'; + function onContextCreationError(event) { + errorInfo = event.statusMessage || errorInfo; + } + try { + canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false); + try { + if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) { + ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); + } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) { + ctx = canvas.getContext("webgl2", webGLContextAttributes); + } else { + throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!' + } + } finally { + canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false); + } + if (!ctx) throw ':('; + } catch (e) { + return 0; + } + + if (!ctx) return 0; + var context = GL.registerContext(ctx, webGLContextAttributes); + return context; + },registerContext:function (ctx, webGLContextAttributes) { + var handle = _malloc(8); // Make space on the heap to store GL context attributes that need to be accessible as shared between threads. + HEAP32[((handle)>>2)]=webGLContextAttributes["explicitSwapControl"]; // explicitSwapControl + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes['majorVersion'], + GLctx: ctx + }; + + + + // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) { + GL.initExtensions(context); + } + + + + + return handle; + },makeContextCurrent:function (contextHandle) { + // Deactivating current context? + if (!contextHandle) { + GLctx = Module.ctx = GL.currentContext = null; + return true; + } + var context = GL.contexts[contextHandle]; + if (!context) { + return false; + } + GLctx = Module.ctx = context.GLctx; // Active WebGL context object. + GL.currentContext = context; // Active Emscripten GL layer context object. + return true; + },getContext:function (contextHandle) { + return GL.contexts[contextHandle]; + },deleteContext:function (contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. + _free(GL.contexts[contextHandle]); + GL.contexts[contextHandle] = null; + },initExtensions:function (context) { + // If this function is called without a specific context object, init the extensions of the currently active context. + if (!context) context = GL.currentContext; + + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + + var GLctx = context.GLctx; + + // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. + + if (context.version < 2) { + // Extension available from Firefox 26 and Google Chrome 30 + var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays'); + if (instancedArraysExt) { + GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); }; + GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); }; + GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; + } + + // Extension available from Firefox 25 and WebKit + var vaoExt = GLctx.getExtension('OES_vertex_array_object'); + if (vaoExt) { + GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); }; + GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); }; + GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); }; + GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); }; + } + + var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers'); + if (drawBuffersExt) { + GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); }; + } + } + + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); + + // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and + // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. + // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions + // here, as long as they don't produce a performance impact for users that might not be using those extensions. + // E.g. debugging-related extensions should probably be off by default. + var automaticallyEnabledExtensions = [ // Khronos ratified WebGL extensions ordered by number (no debug extensions): + "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", + "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", + "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth", + "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear", + "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod", + // Community approved WebGL extensions ordered by number: + "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", + "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query", + "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float", + "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2"]; + + function shouldEnableAutomatically(extension) { + var ret = false; + automaticallyEnabledExtensions.forEach(function(include) { + if (extension.indexOf(include) != -1) { + ret = true; + } + }); + return ret; + } + + var exts = GLctx.getSupportedExtensions(); + if (exts && exts.length > 0) { + GLctx.getSupportedExtensions().forEach(function(ext) { + if (automaticallyEnabledExtensions.indexOf(ext) != -1) { + GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. + } + }); + } + },populateUniformTable:function (program) { + var p = GL.programs[program]; + GL.programInfos[program] = { + uniforms: {}, + maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. + maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. + maxUniformBlockNameLength: -1 // Lazily computed as well + }; + + var ptable = GL.programInfos[program]; + var utable = ptable.uniforms; + // A program's uniform table maps the string name of an uniform to an integer location of that uniform. + // The global GL.uniforms map maps integer locations to WebGLUniformLocations. + var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); + for (var i = 0; i < numUniforms; ++i) { + var u = GLctx.getActiveUniform(p, i); + + var name = u.name; + ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); + + // Strip off any trailing array specifier we might have got, e.g. "[0]". + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + name = name.slice(0, ls); + } + + // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then + // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. + // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. + var loc = GLctx.getUniformLocation(p, name); + if (loc != null) + { + var id = GL.getNewId(GL.uniforms); + utable[name] = [u.size, id]; + GL.uniforms[id] = loc; + + for (var j = 1; j < u.size; ++j) { + var n = name + '['+j+']'; + loc = GLctx.getUniformLocation(p, n); + id = GL.getNewId(GL.uniforms); + + GL.uniforms[id] = loc; + } + } + } + }};function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) } + + function _emscripten_glAlphaFunc() { + err('missing function: emscripten_glAlphaFunc'); abort(-1); + } + + function _emscripten_glAreTexturesResident() { + err('missing function: emscripten_glAreTexturesResident'); abort(-1); + } + + function _emscripten_glArrayElement() { + err('missing function: emscripten_glArrayElement'); abort(-1); + } + + function _emscripten_glAttachObjectARB() { + err('missing function: emscripten_glAttachObjectARB'); abort(-1); + } + + function _emscripten_glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _emscripten_glBegin(){ throw 'Legacy GL function (glBegin) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glBeginConditionalRender() { + err('missing function: emscripten_glBeginConditionalRender'); abort(-1); + } + + function _emscripten_glBeginQuery() { + err('missing function: emscripten_glBeginQuery'); abort(-1); + } + + function _emscripten_glBeginTransformFeedback() { + err('missing function: emscripten_glBeginTransformFeedback'); abort(-1); + } + + function _emscripten_glBindAttribLocation(program, index, name) { + name = Pointer_stringify(name); + GLctx.bindAttribLocation(GL.programs[program], index, name); + } + + function _emscripten_glBindBuffer(target, buffer) { + var bufferObj = buffer ? GL.buffers[buffer] : null; + + + GLctx.bindBuffer(target, bufferObj); + } + + function _emscripten_glBindBufferBase() { + err('missing function: emscripten_glBindBufferBase'); abort(-1); + } + + function _emscripten_glBindBufferRange() { + err('missing function: emscripten_glBindBufferRange'); abort(-1); + } + + function _emscripten_glBindFragDataLocation() { + err('missing function: emscripten_glBindFragDataLocation'); abort(-1); + } + + function _emscripten_glBindFramebuffer(target, framebuffer) { + + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null); + + } + + function _emscripten_glBindProgramARB() { + err('missing function: emscripten_glBindProgramARB'); abort(-1); + } + + function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null); + } + + function _emscripten_glBindTexture(target, texture) { + GLctx.bindTexture(target, texture ? GL.textures[texture] : null); + } + + function _emscripten_glBindVertexArray(vao) { + GLctx['bindVertexArray'](GL.vaos[vao]); + } + + function _emscripten_glBitmap() { + err('missing function: emscripten_glBitmap'); abort(-1); + } + + function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) } + + function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) } + + function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) } + + function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) } + + function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) } + + function _emscripten_glBlitFramebuffer() { + err('missing function: emscripten_glBlitFramebuffer'); abort(-1); + } + + function _emscripten_glBufferData(target, size, data, usage) { + if (!data) { + GLctx.bufferData(target, size, usage); + } else { + GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); + } + } + + function _emscripten_glBufferSubData(target, offset, size, data) { + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _emscripten_glCallList() { + err('missing function: emscripten_glCallList'); abort(-1); + } + + function _emscripten_glCallLists() { + err('missing function: emscripten_glCallLists'); abort(-1); + } + + function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) } + + function _emscripten_glClampColor() { + err('missing function: emscripten_glClampColor'); abort(-1); + } + + function _emscripten_glClear(x0) { GLctx['clear'](x0) } + + function _emscripten_glClearAccum() { + err('missing function: emscripten_glClearAccum'); abort(-1); + } + + function _emscripten_glClearBufferfi() { + err('missing function: emscripten_glClearBufferfi'); abort(-1); + } + + function _emscripten_glClearBufferfv() { + err('missing function: emscripten_glClearBufferfv'); abort(-1); + } + + function _emscripten_glClearBufferiv() { + err('missing function: emscripten_glClearBufferiv'); abort(-1); + } + + function _emscripten_glClearBufferuiv() { + err('missing function: emscripten_glClearBufferuiv'); abort(-1); + } + + function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) } + + function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) } + + function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) } + + function _emscripten_glClearIndex() { + err('missing function: emscripten_glClearIndex'); abort(-1); + } + + function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) } + + function _emscripten_glClientActiveTexture() { + err('missing function: emscripten_glClientActiveTexture'); abort(-1); + } + + function _emscripten_glClipPlane() { + err('missing function: emscripten_glClipPlane'); abort(-1); + } + + function _emscripten_glColor3b() { + err('missing function: emscripten_glColor3b'); abort(-1); + } + + function _emscripten_glColor3bv() { + err('missing function: emscripten_glColor3bv'); abort(-1); + } + + function _emscripten_glColor3d() { + err('missing function: emscripten_glColor3d'); abort(-1); + } + + function _emscripten_glColor3dv() { + err('missing function: emscripten_glColor3dv'); abort(-1); + } + + function _emscripten_glColor3f() { + err('missing function: emscripten_glColor3f'); abort(-1); + } + + function _emscripten_glColor3fv() { + err('missing function: emscripten_glColor3fv'); abort(-1); + } + + function _emscripten_glColor3i() { + err('missing function: emscripten_glColor3i'); abort(-1); + } + + function _emscripten_glColor3iv() { + err('missing function: emscripten_glColor3iv'); abort(-1); + } + + function _emscripten_glColor3s() { + err('missing function: emscripten_glColor3s'); abort(-1); + } + + function _emscripten_glColor3sv() { + err('missing function: emscripten_glColor3sv'); abort(-1); + } + + function _emscripten_glColor3ub() { + err('missing function: emscripten_glColor3ub'); abort(-1); + } + + function _emscripten_glColor3ubv() { + err('missing function: emscripten_glColor3ubv'); abort(-1); + } + + function _emscripten_glColor3ui() { + err('missing function: emscripten_glColor3ui'); abort(-1); + } + + function _emscripten_glColor3uiv() { + err('missing function: emscripten_glColor3uiv'); abort(-1); + } + + function _emscripten_glColor3us() { + err('missing function: emscripten_glColor3us'); abort(-1); + } + + function _emscripten_glColor3usv() { + err('missing function: emscripten_glColor3usv'); abort(-1); + } + + function _emscripten_glColor4b() { + err('missing function: emscripten_glColor4b'); abort(-1); + } + + function _emscripten_glColor4bv() { + err('missing function: emscripten_glColor4bv'); abort(-1); + } + + function _emscripten_glColor4d() { + err('missing function: emscripten_glColor4d'); abort(-1); + } + + function _emscripten_glColor4dv() { + err('missing function: emscripten_glColor4dv'); abort(-1); + } + + function _emscripten_glColor4f() { + err('missing function: emscripten_glColor4f'); abort(-1); + } + + function _emscripten_glColor4fv() { + err('missing function: emscripten_glColor4fv'); abort(-1); + } + + function _emscripten_glColor4i() { + err('missing function: emscripten_glColor4i'); abort(-1); + } + + function _emscripten_glColor4iv() { + err('missing function: emscripten_glColor4iv'); abort(-1); + } + + function _emscripten_glColor4s() { + err('missing function: emscripten_glColor4s'); abort(-1); + } + + function _emscripten_glColor4sv() { + err('missing function: emscripten_glColor4sv'); abort(-1); + } + + function _emscripten_glColor4ub() { + err('missing function: emscripten_glColor4ub'); abort(-1); + } + + function _emscripten_glColor4ubv() { + err('missing function: emscripten_glColor4ubv'); abort(-1); + } + + function _emscripten_glColor4ui() { + err('missing function: emscripten_glColor4ui'); abort(-1); + } + + function _emscripten_glColor4uiv() { + err('missing function: emscripten_glColor4uiv'); abort(-1); + } + + function _emscripten_glColor4us() { + err('missing function: emscripten_glColor4us'); abort(-1); + } + + function _emscripten_glColor4usv() { + err('missing function: emscripten_glColor4usv'); abort(-1); + } + + function _emscripten_glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha); + } + + function _emscripten_glColorMaski() { + err('missing function: emscripten_glColorMaski'); abort(-1); + } + + function _emscripten_glColorMaterial() { + err('missing function: emscripten_glColorMaterial'); abort(-1); + } + + function _emscripten_glColorPointer() { + err('missing function: emscripten_glColorPointer'); abort(-1); + } + + function _emscripten_glColorSubTable() { + err('missing function: emscripten_glColorSubTable'); abort(-1); + } + + function _emscripten_glColorTable() { + err('missing function: emscripten_glColorTable'); abort(-1); + } + + function _emscripten_glColorTableParameterfv() { + err('missing function: emscripten_glColorTableParameterfv'); abort(-1); + } + + function _emscripten_glColorTableParameteriv() { + err('missing function: emscripten_glColorTableParameteriv'); abort(-1); + } + + function _emscripten_glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _emscripten_glCompressedTexImage1D() { + err('missing function: emscripten_glCompressedTexImage1D'); abort(-1); + } + + function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null); + } + + function _emscripten_glCompressedTexImage3D() { + err('missing function: emscripten_glCompressedTexImage3D'); abort(-1); + } + + function _emscripten_glCompressedTexSubImage1D() { + err('missing function: emscripten_glCompressedTexSubImage1D'); abort(-1); + } + + function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null); + } + + function _emscripten_glCompressedTexSubImage3D() { + err('missing function: emscripten_glCompressedTexSubImage3D'); abort(-1); + } + + function _emscripten_glConvolutionFilter1D() { + err('missing function: emscripten_glConvolutionFilter1D'); abort(-1); + } + + function _emscripten_glConvolutionFilter2D() { + err('missing function: emscripten_glConvolutionFilter2D'); abort(-1); + } + + function _emscripten_glConvolutionParameterf() { + err('missing function: emscripten_glConvolutionParameterf'); abort(-1); + } + + function _emscripten_glConvolutionParameterfv() { + err('missing function: emscripten_glConvolutionParameterfv'); abort(-1); + } + + function _emscripten_glConvolutionParameteri() { + err('missing function: emscripten_glConvolutionParameteri'); abort(-1); + } + + function _emscripten_glConvolutionParameteriv() { + err('missing function: emscripten_glConvolutionParameteriv'); abort(-1); + } + + function _emscripten_glCopyColorSubTable() { + err('missing function: emscripten_glCopyColorSubTable'); abort(-1); + } + + function _emscripten_glCopyColorTable() { + err('missing function: emscripten_glCopyColorTable'); abort(-1); + } + + function _emscripten_glCopyConvolutionFilter1D() { + err('missing function: emscripten_glCopyConvolutionFilter1D'); abort(-1); + } + + function _emscripten_glCopyConvolutionFilter2D() { + err('missing function: emscripten_glCopyConvolutionFilter2D'); abort(-1); + } + + function _emscripten_glCopyPixels() { + err('missing function: emscripten_glCopyPixels'); abort(-1); + } + + function _emscripten_glCopyTexImage1D() { + err('missing function: emscripten_glCopyTexImage1D'); abort(-1); + } + + function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glCopyTexSubImage1D() { + err('missing function: emscripten_glCopyTexSubImage1D'); abort(-1); + } + + function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glCopyTexSubImage3D() { + err('missing function: emscripten_glCopyTexSubImage3D'); abort(-1); + } + + function _emscripten_glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _emscripten_glCreateProgramObjectARB() { + err('missing function: emscripten_glCreateProgramObjectARB'); abort(-1); + } + + function _emscripten_glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _emscripten_glCreateShaderObjectARB() { + err('missing function: emscripten_glCreateShaderObjectARB'); abort(-1); + } + + function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) } + + function _emscripten_glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; + if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; + } + } + + function _emscripten_glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[(((framebuffers)+(i*4))>>2)]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } + } + + function _emscripten_glDeleteLists() { + err('missing function: emscripten_glDeleteLists'); abort(-1); + } + + function _emscripten_glDeleteObjectARB() { + err('missing function: emscripten_glDeleteObjectARB'); abort(-1); + } + + function _emscripten_glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + function _emscripten_glDeleteProgramsARB() { + err('missing function: emscripten_glDeleteProgramsARB'); abort(-1); + } + + function _emscripten_glDeleteQueries() { + err('missing function: emscripten_glDeleteQueries'); abort(-1); + } + + function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((renderbuffers)+(i*4))>>2)]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects". + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null; + } + } + + function _emscripten_glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _emscripten_glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _emscripten_glDeleteVertexArrays(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((vaos)+(i*4))>>2)]; + GLctx['deleteVertexArray'](GL.vaos[id]); + GL.vaos[id] = null; + } + } + + function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) } + + function _emscripten_glDepthMask(flag) { + GLctx.depthMask(!!flag); + } + + function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) } + + function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) } + + function _emscripten_glDetachObjectARB() { + err('missing function: emscripten_glDetachObjectARB'); abort(-1); + } + + function _emscripten_glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _emscripten_glDisable(x0) { GLctx['disable'](x0) } + + function _emscripten_glDisableClientState() { + err('missing function: emscripten_glDisableClientState'); abort(-1); + } + + function _emscripten_glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _emscripten_glDisablei() { + err('missing function: emscripten_glDisablei'); abort(-1); + } + + function _emscripten_glDrawArrays(mode, first, count) { + + GLctx.drawArrays(mode, first, count); + + } + + function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) { + GLctx['drawArraysInstanced'](mode, first, count, primcount); + } + + function _emscripten_glDrawBuffer() { + err('missing function: emscripten_glDrawBuffer'); abort(-1); + } + + function _emscripten_glDrawBuffers(n, bufs) { + + var bufArray = GL.tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)]; + } + + GLctx['drawBuffers'](bufArray); + } + + function _emscripten_glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx['drawElementsInstanced'](mode, count, type, indices, primcount); + } + + function _emscripten_glDrawPixels() { + err('missing function: emscripten_glDrawPixels'); abort(-1); + } + + function _emscripten_glDrawRangeElements() { + err('missing function: emscripten_glDrawRangeElements'); abort(-1); + } + + function _emscripten_glEdgeFlag() { + err('missing function: emscripten_glEdgeFlag'); abort(-1); + } + + function _emscripten_glEdgeFlagPointer() { + err('missing function: emscripten_glEdgeFlagPointer'); abort(-1); + } + + function _emscripten_glEdgeFlagv() { + err('missing function: emscripten_glEdgeFlagv'); abort(-1); + } + + function _emscripten_glEnable(x0) { GLctx['enable'](x0) } + + function _emscripten_glEnableClientState() { + err('missing function: emscripten_glEnableClientState'); abort(-1); + } + + function _emscripten_glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + function _emscripten_glEnablei() { + err('missing function: emscripten_glEnablei'); abort(-1); + } + + function _emscripten_glEnd() { + err('missing function: emscripten_glEnd'); abort(-1); + } + + function _emscripten_glEndConditionalRender() { + err('missing function: emscripten_glEndConditionalRender'); abort(-1); + } + + function _emscripten_glEndList() { + err('missing function: emscripten_glEndList'); abort(-1); + } + + function _emscripten_glEndQuery() { + err('missing function: emscripten_glEndQuery'); abort(-1); + } + + function _emscripten_glEndTransformFeedback() { + err('missing function: emscripten_glEndTransformFeedback'); abort(-1); + } + + function _emscripten_glEvalCoord1d() { + err('missing function: emscripten_glEvalCoord1d'); abort(-1); + } + + function _emscripten_glEvalCoord1dv() { + err('missing function: emscripten_glEvalCoord1dv'); abort(-1); + } + + function _emscripten_glEvalCoord1f() { + err('missing function: emscripten_glEvalCoord1f'); abort(-1); + } + + function _emscripten_glEvalCoord1fv() { + err('missing function: emscripten_glEvalCoord1fv'); abort(-1); + } + + function _emscripten_glEvalCoord2d() { + err('missing function: emscripten_glEvalCoord2d'); abort(-1); + } + + function _emscripten_glEvalCoord2dv() { + err('missing function: emscripten_glEvalCoord2dv'); abort(-1); + } + + function _emscripten_glEvalCoord2f() { + err('missing function: emscripten_glEvalCoord2f'); abort(-1); + } + + function _emscripten_glEvalCoord2fv() { + err('missing function: emscripten_glEvalCoord2fv'); abort(-1); + } + + function _emscripten_glEvalMesh1() { + err('missing function: emscripten_glEvalMesh1'); abort(-1); + } + + function _emscripten_glEvalMesh2() { + err('missing function: emscripten_glEvalMesh2'); abort(-1); + } + + function _emscripten_glEvalPoint1() { + err('missing function: emscripten_glEvalPoint1'); abort(-1); + } + + function _emscripten_glEvalPoint2() { + err('missing function: emscripten_glEvalPoint2'); abort(-1); + } + + function _emscripten_glFeedbackBuffer() { + err('missing function: emscripten_glFeedbackBuffer'); abort(-1); + } + + function _emscripten_glFinish() { GLctx['finish']() } + + function _emscripten_glFlush() { GLctx['flush']() } + + function _emscripten_glFogCoordPointer() { + err('missing function: emscripten_glFogCoordPointer'); abort(-1); + } + + function _emscripten_glFogCoordd() { + err('missing function: emscripten_glFogCoordd'); abort(-1); + } + + function _emscripten_glFogCoorddv() { + err('missing function: emscripten_glFogCoorddv'); abort(-1); + } + + function _emscripten_glFogCoordf() { + err('missing function: emscripten_glFogCoordf'); abort(-1); + } + + function _emscripten_glFogCoordfv() { + err('missing function: emscripten_glFogCoordfv'); abort(-1); + } + + function _emscripten_glFogf() { + err('missing function: emscripten_glFogf'); abort(-1); + } + + function _emscripten_glFogfv() { + err('missing function: emscripten_glFogfv'); abort(-1); + } + + function _emscripten_glFogi() { + err('missing function: emscripten_glFogi'); abort(-1); + } + + function _emscripten_glFogiv() { + err('missing function: emscripten_glFogiv'); abort(-1); + } + + function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, + GL.renderbuffers[renderbuffer]); + } + + function _emscripten_glFramebufferTexture1D() { + err('missing function: emscripten_glFramebufferTexture1D'); abort(-1); + } + + function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, + GL.textures[texture], level); + } + + function _emscripten_glFramebufferTexture3D() { + err('missing function: emscripten_glFramebufferTexture3D'); abort(-1); + } + + function _emscripten_glFramebufferTextureLayer() { + err('missing function: emscripten_glFramebufferTextureLayer'); abort(-1); + } + + function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) } + + function _emscripten_glFrustum() { + err('missing function: emscripten_glFrustum'); abort(-1); + } + + function _emscripten_glGenBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var buffer = GLctx.createBuffer(); + if (!buffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.buffers); + buffer.name = id; + GL.buffers[id] = buffer; + HEAP32[(((buffers)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenFramebuffers(n, ids) { + for (var i = 0; i < n; ++i) { + var framebuffer = GLctx.createFramebuffer(); + if (!framebuffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.framebuffers); + framebuffer.name = id; + GL.framebuffers[id] = framebuffer; + HEAP32[(((ids)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenLists() { + err('missing function: emscripten_glGenLists'); abort(-1); + } + + function _emscripten_glGenProgramsARB() { + err('missing function: emscripten_glGenProgramsARB'); abort(-1); + } + + function _emscripten_glGenQueries() { + err('missing function: emscripten_glGenQueries'); abort(-1); + } + + function _emscripten_glGenRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var renderbuffer = GLctx.createRenderbuffer(); + if (!renderbuffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.renderbuffers); + renderbuffer.name = id; + GL.renderbuffers[id] = renderbuffer; + HEAP32[(((renderbuffers)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenTextures(n, textures) { + for (var i = 0; i < n; i++) { + var texture = GLctx.createTexture(); + if (!texture) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. + while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.textures); + texture.name = id; + GL.textures[id] = texture; + HEAP32[(((textures)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenVertexArrays(n, arrays) { + + for (var i = 0; i < n; i++) { + var vao = GLctx['createVertexArray'](); + if (!vao) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.vaos); + vao.name = id; + GL.vaos[id] = vao; + HEAP32[(((arrays)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) } + + function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx.getActiveAttrib(program, index); + if (!info) return; // If an error occurs, nothing will be written to length, size and type and name. + + if (bufSize > 0 && name) { + var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + + if (size) HEAP32[((size)>>2)]=info.size; + if (type) HEAP32[((type)>>2)]=info.type; + } + + function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx.getActiveUniform(program, index); + if (!info) return; // If an error occurs, nothing will be written to length, size, type and name. + + if (bufSize > 0 && name) { + var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + + if (size) HEAP32[((size)>>2)]=info.size; + if (type) HEAP32[((type)>>2)]=info.type; + } + + function _emscripten_glGetActiveUniformBlockName() { + err('missing function: emscripten_glGetActiveUniformBlockName'); abort(-1); + } + + function _emscripten_glGetActiveUniformBlockiv() { + err('missing function: emscripten_glGetActiveUniformBlockiv'); abort(-1); + } + + function _emscripten_glGetActiveUniformName() { + err('missing function: emscripten_glGetActiveUniformName'); abort(-1); + } + + function _emscripten_glGetActiveUniformsiv() { + err('missing function: emscripten_glGetActiveUniformsiv'); abort(-1); + } + + function _emscripten_glGetAttachedObjectsARB() { + err('missing function: emscripten_glGetAttachedObjectsARB'); abort(-1); + } + + function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) { + var result = GLctx.getAttachedShaders(GL.programs[program]); + var len = result.length; + if (len > maxCount) { + len = maxCount; + } + HEAP32[((count)>>2)]=len; + for (var i = 0; i < len; ++i) { + var id = GL.shaders.indexOf(result[i]); + HEAP32[(((shaders)+(i*4))>>2)]=id; + } + } + + function _emscripten_glGetAttribLocation(program, name) { + return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name)); + } + + function _emscripten_glGetBooleani_v() { + err('missing function: emscripten_glGetBooleani_v'); abort(-1); + } + + + function emscriptenWebGLGet(name_, p, type) { + // Guard against user passing a null pointer. + // Note that GLES2 spec does not say anything about how passing a null pointer should be treated. + // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but + // better to report an error instead of doing anything random. + if (!p) { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var ret = undefined; + switch(name_) { // Handle a few trivial GLES values + case 0x8DFA: // GL_SHADER_COMPILER + ret = 1; + break; + case 0x8DF8: // GL_SHADER_BINARY_FORMATS + if (type !== 'Integer' && type !== 'Integer64') { + GL.recordError(0x0500); // GL_INVALID_ENUM + } + return; // Do not write anything to the out pointer, since no binary formats are supported. + case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS + ret = 0; + break; + case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS + // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length), + // so implement it ourselves to allow C++ GLES2 code get the length. + var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/); + ret = formats ? formats.length : 0; + break; + } + + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof(result)) { + case "number": + ret = result; + break; + case "boolean": + ret = result ? 1 : 0; + break; + case "string": + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + case "object": + if (result === null) { + // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise + // can mean an invalid name_, which we need to report as an error + switch(name_) { + case 0x8894: // ARRAY_BUFFER_BINDING + case 0x8B8D: // CURRENT_PROGRAM + case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING + case 0x8CA6: // FRAMEBUFFER_BINDING + case 0x8CA7: // RENDERBUFFER_BINDING + case 0x8069: // TEXTURE_BINDING_2D + case 0x8514: { // TEXTURE_BINDING_CUBE_MAP + ret = 0; + break; + } + default: { + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + } + } + } else if (result instanceof Float32Array || + result instanceof Uint32Array || + result instanceof Int32Array || + result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break; + case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break; + case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break; + default: throw 'internal glGet error, bad type: ' + type; + } + } + return; + } else { + try { + ret = result.name | 0; + } catch(e) { + GL.recordError(0x0500); // GL_INVALID_ENUM + err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')'); + return; + } + } + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return; + } + } + + switch (type) { + case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break; + case 'Integer': HEAP32[((p)>>2)]=ret; break; + case 'Float': HEAPF32[((p)>>2)]=ret; break; + case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break; + default: throw 'internal glGet error, bad type: ' + type; + } + }function _emscripten_glGetBooleanv(name_, p) { + emscriptenWebGLGet(name_, p, 'Boolean'); + } + + function _emscripten_glGetBufferParameteriv(target, value, data) { + if (!data) { + // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense + // if data == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value); + } + + function _emscripten_glGetBufferPointerv() { + err('missing function: emscripten_glGetBufferPointerv'); abort(-1); + } + + function _emscripten_glGetBufferSubData() { + err('missing function: emscripten_glGetBufferSubData'); abort(-1); + } + + function _emscripten_glGetClipPlane() { + err('missing function: emscripten_glGetClipPlane'); abort(-1); + } + + function _emscripten_glGetColorTable() { + err('missing function: emscripten_glGetColorTable'); abort(-1); + } + + function _emscripten_glGetColorTableParameterfv() { + err('missing function: emscripten_glGetColorTableParameterfv'); abort(-1); + } + + function _emscripten_glGetColorTableParameteriv() { + err('missing function: emscripten_glGetColorTableParameteriv'); abort(-1); + } + + function _emscripten_glGetCompressedTexImage() { + err('missing function: emscripten_glGetCompressedTexImage'); abort(-1); + } + + function _emscripten_glGetConvolutionFilter() { + err('missing function: emscripten_glGetConvolutionFilter'); abort(-1); + } + + function _emscripten_glGetConvolutionParameterfv() { + err('missing function: emscripten_glGetConvolutionParameterfv'); abort(-1); + } + + function _emscripten_glGetConvolutionParameteriv() { + err('missing function: emscripten_glGetConvolutionParameteriv'); abort(-1); + } + + function _emscripten_glGetDoublev() { + err('missing function: emscripten_glGetDoublev'); abort(-1); + } + + function _emscripten_glGetError() { + // First return any GL error generated by the emscripten library_gl.js interop layer. + if (GL.lastError) { + var error = GL.lastError; + GL.lastError = 0/*GL_NO_ERROR*/; + return error; + } else { // If there were none, return the GL error from the browser GL context. + return GLctx.getError(); + } + } + + function _emscripten_glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 'Float'); + } + + function _emscripten_glGetFragDataLocation() { + err('missing function: emscripten_glGetFragDataLocation'); abort(-1); + } + + function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { + var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); + if (result instanceof WebGLRenderbuffer || + result instanceof WebGLTexture) { + result = result.name | 0; + } + HEAP32[((params)>>2)]=result; + } + + function _emscripten_glGetHandleARB() { + err('missing function: emscripten_glGetHandleARB'); abort(-1); + } + + function _emscripten_glGetHistogram() { + err('missing function: emscripten_glGetHistogram'); abort(-1); + } + + function _emscripten_glGetHistogramParameterfv() { + err('missing function: emscripten_glGetHistogramParameterfv'); abort(-1); + } + + function _emscripten_glGetHistogramParameteriv() { + err('missing function: emscripten_glGetHistogramParameteriv'); abort(-1); + } + + function _emscripten_glGetInfoLogARB() { + err('missing function: emscripten_glGetInfoLogARB'); abort(-1); + } + + function _emscripten_glGetIntegeri_v() { + err('missing function: emscripten_glGetIntegeri_v'); abort(-1); + } + + function _emscripten_glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 'Integer'); + } + + function _emscripten_glGetLightfv() { + err('missing function: emscripten_glGetLightfv'); abort(-1); + } + + function _emscripten_glGetLightiv() { + err('missing function: emscripten_glGetLightiv'); abort(-1); + } + + function _emscripten_glGetMapdv() { + err('missing function: emscripten_glGetMapdv'); abort(-1); + } + + function _emscripten_glGetMapfv() { + err('missing function: emscripten_glGetMapfv'); abort(-1); + } + + function _emscripten_glGetMapiv() { + err('missing function: emscripten_glGetMapiv'); abort(-1); + } + + function _emscripten_glGetMaterialfv() { + err('missing function: emscripten_glGetMaterialfv'); abort(-1); + } + + function _emscripten_glGetMaterialiv() { + err('missing function: emscripten_glGetMaterialiv'); abort(-1); + } + + function _emscripten_glGetMinmax() { + err('missing function: emscripten_glGetMinmax'); abort(-1); + } + + function _emscripten_glGetMinmaxParameterfv() { + err('missing function: emscripten_glGetMinmaxParameterfv'); abort(-1); + } + + function _emscripten_glGetMinmaxParameteriv() { + err('missing function: emscripten_glGetMinmaxParameteriv'); abort(-1); + } + + function _emscripten_glGetObjectParameterfvARB() { + err('missing function: emscripten_glGetObjectParameterfvARB'); abort(-1); + } + + function _emscripten_glGetObjectParameterivARB() { + err('missing function: emscripten_glGetObjectParameterivARB'); abort(-1); + } + + function _emscripten_glGetPixelMapfv() { + err('missing function: emscripten_glGetPixelMapfv'); abort(-1); + } + + function _emscripten_glGetPixelMapuiv() { + err('missing function: emscripten_glGetPixelMapuiv'); abort(-1); + } + + function _emscripten_glGetPixelMapusv() { + err('missing function: emscripten_glGetPixelMapusv'); abort(-1); + } + + function _emscripten_glGetPointerv() { + err('missing function: emscripten_glGetPointerv'); abort(-1); + } + + function _emscripten_glGetPolygonStipple() { + err('missing function: emscripten_glGetPolygonStipple'); abort(-1); + } + + function _emscripten_glGetProgramEnvParameterdvARB() { + err('missing function: emscripten_glGetProgramEnvParameterdvARB'); abort(-1); + } + + function _emscripten_glGetProgramEnvParameterfvARB() { + err('missing function: emscripten_glGetProgramEnvParameterfvARB'); abort(-1); + } + + function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + + if (maxLength > 0 && infoLog) { + var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glGetProgramLocalParameterdvARB() { + err('missing function: emscripten_glGetProgramLocalParameterdvARB'); abort(-1); + } + + function _emscripten_glGetProgramLocalParameterfvARB() { + err('missing function: emscripten_glGetProgramLocalParameterfvARB'); abort(-1); + } + + function _emscripten_glGetProgramStringARB() { + err('missing function: emscripten_glGetProgramStringARB'); abort(-1); + } + + function _emscripten_glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + + if (program >= GL.counter) { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + return; + } + + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + if (ptable.maxAttributeLength == -1) { + program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for (var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) { + if (ptable.maxUniformBlockNameLength == -1) { + program = GL.programs[program]; + var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS); + ptable.maxUniformBlockNameLength = 0; + for (var i = 0; i < numBlocks; ++i) { + var activeBlockName = GLctx.getActiveUniformBlockName(program, i); + ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength; + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _emscripten_glGetQueryObjectiv() { + err('missing function: emscripten_glGetQueryObjectiv'); abort(-1); + } + + function _emscripten_glGetQueryObjectuiv() { + err('missing function: emscripten_glGetQueryObjectuiv'); abort(-1); + } + + function _emscripten_glGetQueryiv() { + err('missing function: emscripten_glGetQueryiv'); abort(-1); + } + + function _emscripten_glGetRenderbufferParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname); + } + + function _emscripten_glGetSeparableFilter() { + err('missing function: emscripten_glGetSeparableFilter'); abort(-1); + } + + function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + if (maxLength > 0 && infoLog) { + var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { + var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); + HEAP32[((range)>>2)]=result.rangeMin; + HEAP32[(((range)+(4))>>2)]=result.rangeMax; + HEAP32[((precision)>>2)]=result.precision; + } + + function _emscripten_glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; // If an error occurs, nothing will be written to length or source. + if (bufSize > 0 && source) { + var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _emscripten_glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH + var source = GLctx.getShaderSource(GL.shaders[shader]); + var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1; + HEAP32[((p)>>2)]=sourceLength; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _emscripten_glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions(); + var gl_exts = []; + for (var i = 0; i < exts.length; ++i) { + gl_exts.push(exts[i]); + gl_exts.push("GL_" + exts[i]); + } + ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); + break; + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x9245 /* UNMASKED_VENDOR_WEBGL */: + case 0x9246 /* UNMASKED_RENDERER_WEBGL */: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + } + ret = allocate(intArrayFromString(s), 'i8', ALLOC_NORMAL); + break; + + case 0x1F02 /* GL_VERSION */: + var glVersion = GLctx.getParameter(GLctx.VERSION); + // return GLES version string corresponding to the version of the WebGL context + { + glVersion = 'OpenGL ES 2.0 (' + glVersion + ')'; + } + ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION); + // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...' + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits + glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')'; + } + ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL); + break; + default: + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _emscripten_glGetStringi() { + err('missing function: emscripten_glGetStringi'); abort(-1); + } + + function _emscripten_glGetTexEnvfv() { + err('missing function: emscripten_glGetTexEnvfv'); abort(-1); + } + + function _emscripten_glGetTexEnviv() { + err('missing function: emscripten_glGetTexEnviv'); abort(-1); + } + + function _emscripten_glGetTexGendv() { + err('missing function: emscripten_glGetTexGendv'); abort(-1); + } + + function _emscripten_glGetTexGenfv() { + err('missing function: emscripten_glGetTexGenfv'); abort(-1); + } + + function _emscripten_glGetTexGeniv() { + err('missing function: emscripten_glGetTexGeniv'); abort(-1); + } + + function _emscripten_glGetTexImage() { + err('missing function: emscripten_glGetTexImage'); abort(-1); + } + + function _emscripten_glGetTexLevelParameterfv() { + err('missing function: emscripten_glGetTexLevelParameterfv'); abort(-1); + } + + function _emscripten_glGetTexLevelParameteriv() { + err('missing function: emscripten_glGetTexLevelParameteriv'); abort(-1); + } + + function _emscripten_glGetTexParameterIiv() { + err('missing function: emscripten_glGetTexParameterIiv'); abort(-1); + } + + function _emscripten_glGetTexParameterIuiv() { + err('missing function: emscripten_glGetTexParameterIuiv'); abort(-1); + } + + function _emscripten_glGetTexParameterfv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glGetTexParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glGetTransformFeedbackVarying() { + err('missing function: emscripten_glGetTransformFeedbackVarying'); abort(-1); + } + + function _emscripten_glGetUniformBlockIndex() { + err('missing function: emscripten_glGetUniformBlockIndex'); abort(-1); + } + + function _emscripten_glGetUniformIndices() { + err('missing function: emscripten_glGetUniformIndices'); abort(-1); + } + + function _emscripten_glGetUniformLocation(program, name) { + name = Pointer_stringify(name); + + var arrayOffset = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + var arrayIndex = name.slice(ls+1, -1); + if (arrayIndex.length > 0) { + arrayOffset = parseInt(arrayIndex); + if (arrayOffset < 0) { + return -1; + } + } + name = name.slice(0, ls); + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + return -1; + } + var utable = ptable.uniforms; + var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1]+arrayOffset; + } else { + return -1; + } + } + + + function emscriptenWebGLGetUniform(program, location, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]); + if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 'Integer': HEAP32[((params)>>2)]=data; break; + case 'Float': HEAPF32[((params)>>2)]=data; break; + default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break; + case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break; + default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type; + } + } + } + }function _emscripten_glGetUniformfv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 'Float'); + } + + function _emscripten_glGetUniformiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 'Integer'); + } + + function _emscripten_glGetUniformuiv() { + err('missing function: emscripten_glGetUniformuiv'); abort(-1); + } + + function _emscripten_glGetVertexAttribIiv() { + err('missing function: emscripten_glGetVertexAttribIiv'); abort(-1); + } + + function _emscripten_glGetVertexAttribIuiv() { + err('missing function: emscripten_glGetVertexAttribIuiv'); abort(-1); + } + + function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) { + if (!pointer) { + // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense + // if pointer == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname); + } + + function _emscripten_glGetVertexAttribdv() { + err('missing function: emscripten_glGetVertexAttribdv'); abort(-1); + } + + + function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + var data = GLctx.getVertexAttrib(index, pname); + if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) { + HEAP32[((params)>>2)]=data["name"]; + } else if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 'Integer': HEAP32[((params)>>2)]=data; break; + case 'Float': HEAPF32[((params)>>2)]=data; break; + case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break; + default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break; + case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break; + case 'FloatToInteger': HEAP32[(((params)+(i*4))>>2)]=Math.fround(data[i]); break; + default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type; + } + } + } + }function _emscripten_glGetVertexAttribfv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float'); + } + + function _emscripten_glGetVertexAttribiv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger'); + } + + function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) } + + function _emscripten_glHistogram() { + err('missing function: emscripten_glHistogram'); abort(-1); + } + + function _emscripten_glIndexMask() { + err('missing function: emscripten_glIndexMask'); abort(-1); + } + + function _emscripten_glIndexPointer() { + err('missing function: emscripten_glIndexPointer'); abort(-1); + } + + function _emscripten_glIndexd() { + err('missing function: emscripten_glIndexd'); abort(-1); + } + + function _emscripten_glIndexdv() { + err('missing function: emscripten_glIndexdv'); abort(-1); + } + + function _emscripten_glIndexf() { + err('missing function: emscripten_glIndexf'); abort(-1); + } + + function _emscripten_glIndexfv() { + err('missing function: emscripten_glIndexfv'); abort(-1); + } + + function _emscripten_glIndexi() { + err('missing function: emscripten_glIndexi'); abort(-1); + } + + function _emscripten_glIndexiv() { + err('missing function: emscripten_glIndexiv'); abort(-1); + } + + function _emscripten_glIndexs() { + err('missing function: emscripten_glIndexs'); abort(-1); + } + + function _emscripten_glIndexsv() { + err('missing function: emscripten_glIndexsv'); abort(-1); + } + + function _emscripten_glIndexub() { + err('missing function: emscripten_glIndexub'); abort(-1); + } + + function _emscripten_glIndexubv() { + err('missing function: emscripten_glIndexubv'); abort(-1); + } + + function _emscripten_glInitNames() { + err('missing function: emscripten_glInitNames'); abort(-1); + } + + function _emscripten_glInterleavedArrays() { + err('missing function: emscripten_glInterleavedArrays'); abort(-1); + } + + function _emscripten_glIsBuffer(buffer) { + var b = GL.buffers[buffer]; + if (!b) return 0; + return GLctx.isBuffer(b); + } + + function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) } + + function _emscripten_glIsEnabledi() { + err('missing function: emscripten_glIsEnabledi'); abort(-1); + } + + function _emscripten_glIsFramebuffer(framebuffer) { + var fb = GL.framebuffers[framebuffer]; + if (!fb) return 0; + return GLctx.isFramebuffer(fb); + } + + function _emscripten_glIsList() { + err('missing function: emscripten_glIsList'); abort(-1); + } + + function _emscripten_glIsProgram(program) { + program = GL.programs[program]; + if (!program) return 0; + return GLctx.isProgram(program); + } + + function _emscripten_glIsQuery() { + err('missing function: emscripten_glIsQuery'); abort(-1); + } + + function _emscripten_glIsRenderbuffer(renderbuffer) { + var rb = GL.renderbuffers[renderbuffer]; + if (!rb) return 0; + return GLctx.isRenderbuffer(rb); + } + + function _emscripten_glIsShader(shader) { + var s = GL.shaders[shader]; + if (!s) return 0; + return GLctx.isShader(s); + } + + function _emscripten_glIsTexture(texture) { + var texture = GL.textures[texture]; + if (!texture) return 0; + return GLctx.isTexture(texture); + } + + function _emscripten_glIsVertexArray(array) { + + var vao = GL.vaos[array]; + if (!vao) return 0; + return GLctx['isVertexArray'](vao); + } + + function _emscripten_glLightModelf() { + err('missing function: emscripten_glLightModelf'); abort(-1); + } + + function _emscripten_glLightModelfv() { + err('missing function: emscripten_glLightModelfv'); abort(-1); + } + + function _emscripten_glLightModeli() { + err('missing function: emscripten_glLightModeli'); abort(-1); + } + + function _emscripten_glLightModeliv() { + err('missing function: emscripten_glLightModeliv'); abort(-1); + } + + function _emscripten_glLightf() { + err('missing function: emscripten_glLightf'); abort(-1); + } + + function _emscripten_glLightfv() { + err('missing function: emscripten_glLightfv'); abort(-1); + } + + function _emscripten_glLighti() { + err('missing function: emscripten_glLighti'); abort(-1); + } + + function _emscripten_glLightiv() { + err('missing function: emscripten_glLightiv'); abort(-1); + } + + function _emscripten_glLineStipple() { + err('missing function: emscripten_glLineStipple'); abort(-1); + } + + function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) } + + function _emscripten_glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.programInfos[program] = null; // uniforms no longer keep the same names after linking + GL.populateUniformTable(program); + } + + function _emscripten_glListBase() { + err('missing function: emscripten_glListBase'); abort(-1); + } + + function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glLoadMatrixd() { + err('missing function: emscripten_glLoadMatrixd'); abort(-1); + } + + function _emscripten_glLoadMatrixf() { + err('missing function: emscripten_glLoadMatrixf'); abort(-1); + } + + function _emscripten_glLoadName() { + err('missing function: emscripten_glLoadName'); abort(-1); + } + + function _emscripten_glLoadTransposeMatrixd() { + err('missing function: emscripten_glLoadTransposeMatrixd'); abort(-1); + } + + function _emscripten_glLoadTransposeMatrixf() { + err('missing function: emscripten_glLoadTransposeMatrixf'); abort(-1); + } + + function _emscripten_glLogicOp() { + err('missing function: emscripten_glLogicOp'); abort(-1); + } + + function _emscripten_glMap1d() { + err('missing function: emscripten_glMap1d'); abort(-1); + } + + function _emscripten_glMap1f() { + err('missing function: emscripten_glMap1f'); abort(-1); + } + + function _emscripten_glMap2d() { + err('missing function: emscripten_glMap2d'); abort(-1); + } + + function _emscripten_glMap2f() { + err('missing function: emscripten_glMap2f'); abort(-1); + } + + function _emscripten_glMapBuffer() { + err('missing function: emscripten_glMapBuffer'); abort(-1); + } + + function _emscripten_glMapGrid1d() { + err('missing function: emscripten_glMapGrid1d'); abort(-1); + } + + function _emscripten_glMapGrid1f() { + err('missing function: emscripten_glMapGrid1f'); abort(-1); + } + + function _emscripten_glMapGrid2d() { + err('missing function: emscripten_glMapGrid2d'); abort(-1); + } + + function _emscripten_glMapGrid2f() { + err('missing function: emscripten_glMapGrid2f'); abort(-1); + } + + function _emscripten_glMaterialf() { + err('missing function: emscripten_glMaterialf'); abort(-1); + } + + function _emscripten_glMaterialfv() { + err('missing function: emscripten_glMaterialfv'); abort(-1); + } + + function _emscripten_glMateriali() { + err('missing function: emscripten_glMateriali'); abort(-1); + } + + function _emscripten_glMaterialiv() { + err('missing function: emscripten_glMaterialiv'); abort(-1); + } + + function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glMinmax() { + err('missing function: emscripten_glMinmax'); abort(-1); + } + + function _emscripten_glMultMatrixd() { + err('missing function: emscripten_glMultMatrixd'); abort(-1); + } + + function _emscripten_glMultMatrixf() { + err('missing function: emscripten_glMultMatrixf'); abort(-1); + } + + function _emscripten_glMultTransposeMatrixd() { + err('missing function: emscripten_glMultTransposeMatrixd'); abort(-1); + } + + function _emscripten_glMultTransposeMatrixf() { + err('missing function: emscripten_glMultTransposeMatrixf'); abort(-1); + } + + function _emscripten_glMultiDrawArrays() { + err('missing function: emscripten_glMultiDrawArrays'); abort(-1); + } + + function _emscripten_glMultiDrawElements() { + err('missing function: emscripten_glMultiDrawElements'); abort(-1); + } + + function _emscripten_glMultiTexCoord1d() { + err('missing function: emscripten_glMultiTexCoord1d'); abort(-1); + } + + function _emscripten_glMultiTexCoord1dv() { + err('missing function: emscripten_glMultiTexCoord1dv'); abort(-1); + } + + function _emscripten_glMultiTexCoord1f() { + err('missing function: emscripten_glMultiTexCoord1f'); abort(-1); + } + + function _emscripten_glMultiTexCoord1fv() { + err('missing function: emscripten_glMultiTexCoord1fv'); abort(-1); + } + + function _emscripten_glMultiTexCoord1i() { + err('missing function: emscripten_glMultiTexCoord1i'); abort(-1); + } + + function _emscripten_glMultiTexCoord1iv() { + err('missing function: emscripten_glMultiTexCoord1iv'); abort(-1); + } + + function _emscripten_glMultiTexCoord1s() { + err('missing function: emscripten_glMultiTexCoord1s'); abort(-1); + } + + function _emscripten_glMultiTexCoord1sv() { + err('missing function: emscripten_glMultiTexCoord1sv'); abort(-1); + } + + function _emscripten_glMultiTexCoord2d() { + err('missing function: emscripten_glMultiTexCoord2d'); abort(-1); + } + + function _emscripten_glMultiTexCoord2dv() { + err('missing function: emscripten_glMultiTexCoord2dv'); abort(-1); + } + + function _emscripten_glMultiTexCoord2f() { + err('missing function: emscripten_glMultiTexCoord2f'); abort(-1); + } + + function _emscripten_glMultiTexCoord2fv() { + err('missing function: emscripten_glMultiTexCoord2fv'); abort(-1); + } + + function _emscripten_glMultiTexCoord2i() { + err('missing function: emscripten_glMultiTexCoord2i'); abort(-1); + } + + function _emscripten_glMultiTexCoord2iv() { + err('missing function: emscripten_glMultiTexCoord2iv'); abort(-1); + } + + function _emscripten_glMultiTexCoord2s() { + err('missing function: emscripten_glMultiTexCoord2s'); abort(-1); + } + + function _emscripten_glMultiTexCoord2sv() { + err('missing function: emscripten_glMultiTexCoord2sv'); abort(-1); + } + + function _emscripten_glMultiTexCoord3d() { + err('missing function: emscripten_glMultiTexCoord3d'); abort(-1); + } + + function _emscripten_glMultiTexCoord3dv() { + err('missing function: emscripten_glMultiTexCoord3dv'); abort(-1); + } + + function _emscripten_glMultiTexCoord3f() { + err('missing function: emscripten_glMultiTexCoord3f'); abort(-1); + } + + function _emscripten_glMultiTexCoord3fv() { + err('missing function: emscripten_glMultiTexCoord3fv'); abort(-1); + } + + function _emscripten_glMultiTexCoord3i() { + err('missing function: emscripten_glMultiTexCoord3i'); abort(-1); + } + + function _emscripten_glMultiTexCoord3iv() { + err('missing function: emscripten_glMultiTexCoord3iv'); abort(-1); + } + + function _emscripten_glMultiTexCoord3s() { + err('missing function: emscripten_glMultiTexCoord3s'); abort(-1); + } + + function _emscripten_glMultiTexCoord3sv() { + err('missing function: emscripten_glMultiTexCoord3sv'); abort(-1); + } + + function _emscripten_glMultiTexCoord4d() { + err('missing function: emscripten_glMultiTexCoord4d'); abort(-1); + } + + function _emscripten_glMultiTexCoord4dv() { + err('missing function: emscripten_glMultiTexCoord4dv'); abort(-1); + } + + function _emscripten_glMultiTexCoord4f() { + err('missing function: emscripten_glMultiTexCoord4f'); abort(-1); + } + + function _emscripten_glMultiTexCoord4fv() { + err('missing function: emscripten_glMultiTexCoord4fv'); abort(-1); + } + + function _emscripten_glMultiTexCoord4i() { + err('missing function: emscripten_glMultiTexCoord4i'); abort(-1); + } + + function _emscripten_glMultiTexCoord4iv() { + err('missing function: emscripten_glMultiTexCoord4iv'); abort(-1); + } + + function _emscripten_glMultiTexCoord4s() { + err('missing function: emscripten_glMultiTexCoord4s'); abort(-1); + } + + function _emscripten_glMultiTexCoord4sv() { + err('missing function: emscripten_glMultiTexCoord4sv'); abort(-1); + } + + function _emscripten_glNewList() { + err('missing function: emscripten_glNewList'); abort(-1); + } + + function _emscripten_glNormal3b() { + err('missing function: emscripten_glNormal3b'); abort(-1); + } + + function _emscripten_glNormal3bv() { + err('missing function: emscripten_glNormal3bv'); abort(-1); + } + + function _emscripten_glNormal3d() { + err('missing function: emscripten_glNormal3d'); abort(-1); + } + + function _emscripten_glNormal3dv() { + err('missing function: emscripten_glNormal3dv'); abort(-1); + } + + function _emscripten_glNormal3f() { + err('missing function: emscripten_glNormal3f'); abort(-1); + } + + function _emscripten_glNormal3fv() { + err('missing function: emscripten_glNormal3fv'); abort(-1); + } + + function _emscripten_glNormal3i() { + err('missing function: emscripten_glNormal3i'); abort(-1); + } + + function _emscripten_glNormal3iv() { + err('missing function: emscripten_glNormal3iv'); abort(-1); + } + + function _emscripten_glNormal3s() { + err('missing function: emscripten_glNormal3s'); abort(-1); + } + + function _emscripten_glNormal3sv() { + err('missing function: emscripten_glNormal3sv'); abort(-1); + } + + function _emscripten_glNormalPointer() { + err('missing function: emscripten_glNormalPointer'); abort(-1); + } + + function _emscripten_glOrtho() { + err('missing function: emscripten_glOrtho'); abort(-1); + } + + function _emscripten_glPassThrough() { + err('missing function: emscripten_glPassThrough'); abort(-1); + } + + function _emscripten_glPixelMapfv() { + err('missing function: emscripten_glPixelMapfv'); abort(-1); + } + + function _emscripten_glPixelMapuiv() { + err('missing function: emscripten_glPixelMapuiv'); abort(-1); + } + + function _emscripten_glPixelMapusv() { + err('missing function: emscripten_glPixelMapusv'); abort(-1); + } + + function _emscripten_glPixelStoref() { + err('missing function: emscripten_glPixelStoref'); abort(-1); + } + + function _emscripten_glPixelStorei(pname, param) { + if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { + GL.packAlignment = param; + } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function _emscripten_glPixelTransferf() { + err('missing function: emscripten_glPixelTransferf'); abort(-1); + } + + function _emscripten_glPixelTransferi() { + err('missing function: emscripten_glPixelTransferi'); abort(-1); + } + + function _emscripten_glPixelZoom() { + err('missing function: emscripten_glPixelZoom'); abort(-1); + } + + function _emscripten_glPointParameterf() { + err('missing function: emscripten_glPointParameterf'); abort(-1); + } + + function _emscripten_glPointParameterfv() { + err('missing function: emscripten_glPointParameterfv'); abort(-1); + } + + function _emscripten_glPointParameteri() { + err('missing function: emscripten_glPointParameteri'); abort(-1); + } + + function _emscripten_glPointParameteriv() { + err('missing function: emscripten_glPointParameteriv'); abort(-1); + } + + function _emscripten_glPointSize() { + err('missing function: emscripten_glPointSize'); abort(-1); + } + + function _emscripten_glPolygonMode() { + err('missing function: emscripten_glPolygonMode'); abort(-1); + } + + function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) } + + function _emscripten_glPolygonStipple() { + err('missing function: emscripten_glPolygonStipple'); abort(-1); + } + + function _emscripten_glPopAttrib() { + err('missing function: emscripten_glPopAttrib'); abort(-1); + } + + function _emscripten_glPopClientAttrib() { + err('missing function: emscripten_glPopClientAttrib'); abort(-1); + } + + function _emscripten_glPopMatrix() { + err('missing function: emscripten_glPopMatrix'); abort(-1); + } + + function _emscripten_glPopName() { + err('missing function: emscripten_glPopName'); abort(-1); + } + + function _emscripten_glPrimitiveRestartIndex() { + err('missing function: emscripten_glPrimitiveRestartIndex'); abort(-1); + } + + function _emscripten_glPrioritizeTextures() { + err('missing function: emscripten_glPrioritizeTextures'); abort(-1); + } + + function _emscripten_glProgramEnvParameter4dARB() { + err('missing function: emscripten_glProgramEnvParameter4dARB'); abort(-1); + } + + function _emscripten_glProgramEnvParameter4dvARB() { + err('missing function: emscripten_glProgramEnvParameter4dvARB'); abort(-1); + } + + function _emscripten_glProgramEnvParameter4fARB() { + err('missing function: emscripten_glProgramEnvParameter4fARB'); abort(-1); + } + + function _emscripten_glProgramEnvParameter4fvARB() { + err('missing function: emscripten_glProgramEnvParameter4fvARB'); abort(-1); + } + + function _emscripten_glProgramLocalParameter4dARB() { + err('missing function: emscripten_glProgramLocalParameter4dARB'); abort(-1); + } + + function _emscripten_glProgramLocalParameter4dvARB() { + err('missing function: emscripten_glProgramLocalParameter4dvARB'); abort(-1); + } + + function _emscripten_glProgramLocalParameter4fARB() { + err('missing function: emscripten_glProgramLocalParameter4fARB'); abort(-1); + } + + function _emscripten_glProgramLocalParameter4fvARB() { + err('missing function: emscripten_glProgramLocalParameter4fvARB'); abort(-1); + } + + function _emscripten_glProgramStringARB() { + err('missing function: emscripten_glProgramStringARB'); abort(-1); + } + + function _emscripten_glPushAttrib() { + err('missing function: emscripten_glPushAttrib'); abort(-1); + } + + function _emscripten_glPushClientAttrib() { + err('missing function: emscripten_glPushClientAttrib'); abort(-1); + } + + function _emscripten_glPushMatrix() { + err('missing function: emscripten_glPushMatrix'); abort(-1); + } + + function _emscripten_glPushName() { + err('missing function: emscripten_glPushName'); abort(-1); + } + + function _emscripten_glRasterPos2d() { + err('missing function: emscripten_glRasterPos2d'); abort(-1); + } + + function _emscripten_glRasterPos2dv() { + err('missing function: emscripten_glRasterPos2dv'); abort(-1); + } + + function _emscripten_glRasterPos2f() { + err('missing function: emscripten_glRasterPos2f'); abort(-1); + } + + function _emscripten_glRasterPos2fv() { + err('missing function: emscripten_glRasterPos2fv'); abort(-1); + } + + function _emscripten_glRasterPos2i() { + err('missing function: emscripten_glRasterPos2i'); abort(-1); + } + + function _emscripten_glRasterPos2iv() { + err('missing function: emscripten_glRasterPos2iv'); abort(-1); + } + + function _emscripten_glRasterPos2s() { + err('missing function: emscripten_glRasterPos2s'); abort(-1); + } + + function _emscripten_glRasterPos2sv() { + err('missing function: emscripten_glRasterPos2sv'); abort(-1); + } + + function _emscripten_glRasterPos3d() { + err('missing function: emscripten_glRasterPos3d'); abort(-1); + } + + function _emscripten_glRasterPos3dv() { + err('missing function: emscripten_glRasterPos3dv'); abort(-1); + } + + function _emscripten_glRasterPos3f() { + err('missing function: emscripten_glRasterPos3f'); abort(-1); + } + + function _emscripten_glRasterPos3fv() { + err('missing function: emscripten_glRasterPos3fv'); abort(-1); + } + + function _emscripten_glRasterPos3i() { + err('missing function: emscripten_glRasterPos3i'); abort(-1); + } + + function _emscripten_glRasterPos3iv() { + err('missing function: emscripten_glRasterPos3iv'); abort(-1); + } + + function _emscripten_glRasterPos3s() { + err('missing function: emscripten_glRasterPos3s'); abort(-1); + } + + function _emscripten_glRasterPos3sv() { + err('missing function: emscripten_glRasterPos3sv'); abort(-1); + } + + function _emscripten_glRasterPos4d() { + err('missing function: emscripten_glRasterPos4d'); abort(-1); + } + + function _emscripten_glRasterPos4dv() { + err('missing function: emscripten_glRasterPos4dv'); abort(-1); + } + + function _emscripten_glRasterPos4f() { + err('missing function: emscripten_glRasterPos4f'); abort(-1); + } + + function _emscripten_glRasterPos4fv() { + err('missing function: emscripten_glRasterPos4fv'); abort(-1); + } + + function _emscripten_glRasterPos4i() { + err('missing function: emscripten_glRasterPos4i'); abort(-1); + } + + function _emscripten_glRasterPos4iv() { + err('missing function: emscripten_glRasterPos4iv'); abort(-1); + } + + function _emscripten_glRasterPos4s() { + err('missing function: emscripten_glRasterPos4s'); abort(-1); + } + + function _emscripten_glRasterPos4sv() { + err('missing function: emscripten_glRasterPos4sv'); abort(-1); + } + + function _emscripten_glReadBuffer() { + err('missing function: emscripten_glReadBuffer'); abort(-1); + } + + + + function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return Math.floor((x + y - 1) / y) * y + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return (height <= 0) ? 0 : + ((height - 1) * alignedRowSize + plainRowSize); + }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var sizePerPixel; + var numChannels; + switch(format) { + case 0x1906 /* GL_ALPHA */: + case 0x1909 /* GL_LUMINANCE */: + case 0x1902 /* GL_DEPTH_COMPONENT */: + numChannels = 1; + break; + case 0x190A /* GL_LUMINANCE_ALPHA */: + numChannels = 2; + break; + case 0x1907 /* GL_RGB */: + case 0x8C40 /* GL_SRGB_EXT */: + numChannels = 3; + break; + case 0x1908 /* GL_RGBA */: + case 0x8C42 /* GL_SRGB_ALPHA_EXT */: + numChannels = 4; + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return null; + } + switch (type) { + case 0x1401 /* GL_UNSIGNED_BYTE */: + sizePerPixel = numChannels*1; + break; + case 0x1403 /* GL_UNSIGNED_SHORT */: + case 0x8D61 /* GL_HALF_FLOAT_OES */: + sizePerPixel = numChannels*2; + break; + case 0x1405 /* GL_UNSIGNED_INT */: + case 0x1406 /* GL_FLOAT */: + sizePerPixel = numChannels*4; + break; + case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */: + sizePerPixel = 4; + break; + case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */: + case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */: + case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */: + sizePerPixel = 2; + break; + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return null; + } + var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment); + switch(type) { + case 0x1401 /* GL_UNSIGNED_BYTE */: + return HEAPU8.subarray((pixels),(pixels+bytes)); + case 0x1406 /* GL_FLOAT */: + return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2); + case 0x1405 /* GL_UNSIGNED_INT */: + case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */: + return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2); + case 0x1403 /* GL_UNSIGNED_SHORT */: + case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */: + case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */: + case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */: + case 0x8D61 /* GL_HALF_FLOAT_OES */: + return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1); + default: + GL.recordError(0x0500); // GL_INVALID_ENUM + return null; + } + }function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return; + } + GLctx.readPixels(x, y, width, height, format, type, pixelData); + } + + function _emscripten_glRectd() { + err('missing function: emscripten_glRectd'); abort(-1); + } + + function _emscripten_glRectdv() { + err('missing function: emscripten_glRectdv'); abort(-1); + } + + function _emscripten_glRectf() { + err('missing function: emscripten_glRectf'); abort(-1); + } + + function _emscripten_glRectfv() { + err('missing function: emscripten_glRectfv'); abort(-1); + } + + function _emscripten_glRecti() { + err('missing function: emscripten_glRecti'); abort(-1); + } + + function _emscripten_glRectiv() { + err('missing function: emscripten_glRectiv'); abort(-1); + } + + function _emscripten_glRects() { + err('missing function: emscripten_glRects'); abort(-1); + } + + function _emscripten_glRectsv() { + err('missing function: emscripten_glRectsv'); abort(-1); + } + + function _emscripten_glReleaseShaderCompiler() { + // NOP (as allowed by GLES 2.0 spec) + } + + function _emscripten_glRenderMode() { + err('missing function: emscripten_glRenderMode'); abort(-1); + } + + function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) } + + function _emscripten_glRenderbufferStorageMultisample() { + err('missing function: emscripten_glRenderbufferStorageMultisample'); abort(-1); + } + + function _emscripten_glResetHistogram() { + err('missing function: emscripten_glResetHistogram'); abort(-1); + } + + function _emscripten_glResetMinmax() { + err('missing function: emscripten_glResetMinmax'); abort(-1); + } + + function _emscripten_glRotated() { + err('missing function: emscripten_glRotated'); abort(-1); + } + + function _emscripten_glRotatef() { + err('missing function: emscripten_glRotatef'); abort(-1); + } + + function _emscripten_glSampleCoverage(value, invert) { + GLctx.sampleCoverage(value, !!invert); + } + + function _emscripten_glScaled() { + err('missing function: emscripten_glScaled'); abort(-1); + } + + function _emscripten_glScalef() { + err('missing function: emscripten_glScalef'); abort(-1); + } + + function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) } + + function _emscripten_glSecondaryColor3b() { + err('missing function: emscripten_glSecondaryColor3b'); abort(-1); + } + + function _emscripten_glSecondaryColor3bv() { + err('missing function: emscripten_glSecondaryColor3bv'); abort(-1); + } + + function _emscripten_glSecondaryColor3d() { + err('missing function: emscripten_glSecondaryColor3d'); abort(-1); + } + + function _emscripten_glSecondaryColor3dv() { + err('missing function: emscripten_glSecondaryColor3dv'); abort(-1); + } + + function _emscripten_glSecondaryColor3f() { + err('missing function: emscripten_glSecondaryColor3f'); abort(-1); + } + + function _emscripten_glSecondaryColor3fv() { + err('missing function: emscripten_glSecondaryColor3fv'); abort(-1); + } + + function _emscripten_glSecondaryColor3i() { + err('missing function: emscripten_glSecondaryColor3i'); abort(-1); + } + + function _emscripten_glSecondaryColor3iv() { + err('missing function: emscripten_glSecondaryColor3iv'); abort(-1); + } + + function _emscripten_glSecondaryColor3s() { + err('missing function: emscripten_glSecondaryColor3s'); abort(-1); + } + + function _emscripten_glSecondaryColor3sv() { + err('missing function: emscripten_glSecondaryColor3sv'); abort(-1); + } + + function _emscripten_glSecondaryColor3ub() { + err('missing function: emscripten_glSecondaryColor3ub'); abort(-1); + } + + function _emscripten_glSecondaryColor3ubv() { + err('missing function: emscripten_glSecondaryColor3ubv'); abort(-1); + } + + function _emscripten_glSecondaryColor3ui() { + err('missing function: emscripten_glSecondaryColor3ui'); abort(-1); + } + + function _emscripten_glSecondaryColor3uiv() { + err('missing function: emscripten_glSecondaryColor3uiv'); abort(-1); + } + + function _emscripten_glSecondaryColor3us() { + err('missing function: emscripten_glSecondaryColor3us'); abort(-1); + } + + function _emscripten_glSecondaryColor3usv() { + err('missing function: emscripten_glSecondaryColor3usv'); abort(-1); + } + + function _emscripten_glSecondaryColorPointer() { + err('missing function: emscripten_glSecondaryColorPointer'); abort(-1); + } + + function _emscripten_glSelectBuffer() { + err('missing function: emscripten_glSelectBuffer'); abort(-1); + } + + function _emscripten_glSeparableFilter2D() { + err('missing function: emscripten_glSeparableFilter2D'); abort(-1); + } + + function _emscripten_glShadeModel() { + err('missing function: emscripten_glShadeModel'); abort(-1); + } + + function _emscripten_glShaderBinary() { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + } + + function _emscripten_glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + + + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) } + + function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) } + + function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) } + + function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) } + + function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) } + + function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) } + + function _emscripten_glTexBuffer() { + err('missing function: emscripten_glTexBuffer'); abort(-1); + } + + function _emscripten_glTexCoord1d() { + err('missing function: emscripten_glTexCoord1d'); abort(-1); + } + + function _emscripten_glTexCoord1dv() { + err('missing function: emscripten_glTexCoord1dv'); abort(-1); + } + + function _emscripten_glTexCoord1f() { + err('missing function: emscripten_glTexCoord1f'); abort(-1); + } + + function _emscripten_glTexCoord1fv() { + err('missing function: emscripten_glTexCoord1fv'); abort(-1); + } + + function _emscripten_glTexCoord1i() { + err('missing function: emscripten_glTexCoord1i'); abort(-1); + } + + function _emscripten_glTexCoord1iv() { + err('missing function: emscripten_glTexCoord1iv'); abort(-1); + } + + function _emscripten_glTexCoord1s() { + err('missing function: emscripten_glTexCoord1s'); abort(-1); + } + + function _emscripten_glTexCoord1sv() { + err('missing function: emscripten_glTexCoord1sv'); abort(-1); + } + + function _emscripten_glTexCoord2d() { + err('missing function: emscripten_glTexCoord2d'); abort(-1); + } + + function _emscripten_glTexCoord2dv() { + err('missing function: emscripten_glTexCoord2dv'); abort(-1); + } + + function _emscripten_glTexCoord2f() { + err('missing function: emscripten_glTexCoord2f'); abort(-1); + } + + function _emscripten_glTexCoord2fv() { + err('missing function: emscripten_glTexCoord2fv'); abort(-1); + } + + function _emscripten_glTexCoord2i() { + err('missing function: emscripten_glTexCoord2i'); abort(-1); + } + + function _emscripten_glTexCoord2iv() { + err('missing function: emscripten_glTexCoord2iv'); abort(-1); + } + + function _emscripten_glTexCoord2s() { + err('missing function: emscripten_glTexCoord2s'); abort(-1); + } + + function _emscripten_glTexCoord2sv() { + err('missing function: emscripten_glTexCoord2sv'); abort(-1); + } + + function _emscripten_glTexCoord3d() { + err('missing function: emscripten_glTexCoord3d'); abort(-1); + } + + function _emscripten_glTexCoord3dv() { + err('missing function: emscripten_glTexCoord3dv'); abort(-1); + } + + function _emscripten_glTexCoord3f() { + err('missing function: emscripten_glTexCoord3f'); abort(-1); + } + + function _emscripten_glTexCoord3fv() { + err('missing function: emscripten_glTexCoord3fv'); abort(-1); + } + + function _emscripten_glTexCoord3i() { + err('missing function: emscripten_glTexCoord3i'); abort(-1); + } + + function _emscripten_glTexCoord3iv() { + err('missing function: emscripten_glTexCoord3iv'); abort(-1); + } + + function _emscripten_glTexCoord3s() { + err('missing function: emscripten_glTexCoord3s'); abort(-1); + } + + function _emscripten_glTexCoord3sv() { + err('missing function: emscripten_glTexCoord3sv'); abort(-1); + } + + function _emscripten_glTexCoord4d() { + err('missing function: emscripten_glTexCoord4d'); abort(-1); + } + + function _emscripten_glTexCoord4dv() { + err('missing function: emscripten_glTexCoord4dv'); abort(-1); + } + + function _emscripten_glTexCoord4f() { + err('missing function: emscripten_glTexCoord4f'); abort(-1); + } + + function _emscripten_glTexCoord4fv() { + err('missing function: emscripten_glTexCoord4fv'); abort(-1); + } + + function _emscripten_glTexCoord4i() { + err('missing function: emscripten_glTexCoord4i'); abort(-1); + } + + function _emscripten_glTexCoord4iv() { + err('missing function: emscripten_glTexCoord4iv'); abort(-1); + } + + function _emscripten_glTexCoord4s() { + err('missing function: emscripten_glTexCoord4s'); abort(-1); + } + + function _emscripten_glTexCoord4sv() { + err('missing function: emscripten_glTexCoord4sv'); abort(-1); + } + + function _emscripten_glTexCoordPointer() { + err('missing function: emscripten_glTexCoordPointer'); abort(-1); + } + + function _emscripten_glTexEnvf() { + err('missing function: emscripten_glTexEnvf'); abort(-1); + } + + function _emscripten_glTexEnvfv() { + err('missing function: emscripten_glTexEnvfv'); abort(-1); + } + + function _emscripten_glTexEnvi() { + err('missing function: emscripten_glTexEnvi'); abort(-1); + } + + function _emscripten_glTexEnviv() { + err('missing function: emscripten_glTexEnviv'); abort(-1); + } + + function _emscripten_glTexGend() { + err('missing function: emscripten_glTexGend'); abort(-1); + } + + function _emscripten_glTexGendv() { + err('missing function: emscripten_glTexGendv'); abort(-1); + } + + function _emscripten_glTexGenf() { + err('missing function: emscripten_glTexGenf'); abort(-1); + } + + function _emscripten_glTexGenfv() { + err('missing function: emscripten_glTexGenfv'); abort(-1); + } + + function _emscripten_glTexGeni() { + err('missing function: emscripten_glTexGeni'); abort(-1); + } + + function _emscripten_glTexGeniv() { + err('missing function: emscripten_glTexGeniv'); abort(-1); + } + + function _emscripten_glTexImage1D() { + err('missing function: emscripten_glTexImage1D'); abort(-1); + } + + function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); + } + + function _emscripten_glTexImage3D() { + err('missing function: emscripten_glTexImage3D'); abort(-1); + } + + function _emscripten_glTexParameterIiv() { + err('missing function: emscripten_glTexParameterIiv'); abort(-1); + } + + function _emscripten_glTexParameterIuiv() { + err('missing function: emscripten_glTexParameterIuiv'); abort(-1); + } + + function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) } + + function _emscripten_glTexParameterfv(target, pname, params) { + var param = HEAPF32[((params)>>2)]; + GLctx.texParameterf(target, pname, param); + } + + function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _emscripten_glTexParameteriv(target, pname, params) { + var param = HEAP32[((params)>>2)]; + GLctx.texParameteri(target, pname, param); + } + + function _emscripten_glTexStorage2D() { + err('missing function: emscripten_glTexStorage2D'); abort(-1); + } + + function _emscripten_glTexStorage3D() { + err('missing function: emscripten_glTexStorage3D'); abort(-1); + } + + function _emscripten_glTexSubImage1D() { + err('missing function: emscripten_glTexSubImage1D'); abort(-1); + } + + function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); + } + + function _emscripten_glTexSubImage3D() { + err('missing function: emscripten_glTexSubImage3D'); abort(-1); + } + + function _emscripten_glTransformFeedbackVaryings() { + err('missing function: emscripten_glTransformFeedbackVaryings'); abort(-1); + } + + function _emscripten_glTranslated() { + err('missing function: emscripten_glTranslated'); abort(-1); + } + + function _emscripten_glTranslatef() { + err('missing function: emscripten_glTranslatef'); abort(-1); + } + + function _emscripten_glUniform1f(location, v0) { + GLctx.uniform1f(GL.uniforms[location], v0); + } + + function _emscripten_glUniform1fv(location, count, value) { + + + var view; + if (count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[count-1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*4)>>2); + } + GLctx.uniform1fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform1i(location, v0) { + GLctx.uniform1i(GL.uniforms[location], v0); + } + + function _emscripten_glUniform1iv(location, count, value) { + + + GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2)); + } + + function _emscripten_glUniform1ui() { + err('missing function: emscripten_glUniform1ui'); abort(-1); + } + + function _emscripten_glUniform1uiv() { + err('missing function: emscripten_glUniform1uiv'); abort(-1); + } + + function _emscripten_glUniform2f(location, v0, v1) { + GLctx.uniform2f(GL.uniforms[location], v0, v1); + } + + function _emscripten_glUniform2fv(location, count, value) { + + + var view; + if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[2*count-1]; + for (var i = 0; i < 2*count; i += 2) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*8)>>2); + } + GLctx.uniform2fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform2i(location, v0, v1) { + GLctx.uniform2i(GL.uniforms[location], v0, v1); + } + + function _emscripten_glUniform2iv(location, count, value) { + + + GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2)); + } + + function _emscripten_glUniform2ui() { + err('missing function: emscripten_glUniform2ui'); abort(-1); + } + + function _emscripten_glUniform2uiv() { + err('missing function: emscripten_glUniform2uiv'); abort(-1); + } + + function _emscripten_glUniform3f(location, v0, v1, v2) { + GLctx.uniform3f(GL.uniforms[location], v0, v1, v2); + } + + function _emscripten_glUniform3fv(location, count, value) { + + + var view; + if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[3*count-1]; + for (var i = 0; i < 3*count; i += 3) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*12)>>2); + } + GLctx.uniform3fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform3i(location, v0, v1, v2) { + GLctx.uniform3i(GL.uniforms[location], v0, v1, v2); + } + + function _emscripten_glUniform3iv(location, count, value) { + + + GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2)); + } + + function _emscripten_glUniform3ui() { + err('missing function: emscripten_glUniform3ui'); abort(-1); + } + + function _emscripten_glUniform3uiv() { + err('missing function: emscripten_glUniform3uiv'); abort(-1); + } + + function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glUniform4fv(location, count, value) { + + + var view; + if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[4*count-1]; + for (var i = 0; i < 4*count; i += 4) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniform4fv(GL.uniforms[location], view); + } + + function _emscripten_glUniform4i(location, v0, v1, v2, v3) { + GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glUniform4iv(location, count, value) { + + + GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2)); + } + + function _emscripten_glUniform4ui() { + err('missing function: emscripten_glUniform4ui'); abort(-1); + } + + function _emscripten_glUniform4uiv() { + err('missing function: emscripten_glUniform4uiv'); abort(-1); + } + + function _emscripten_glUniformBlockBinding() { + err('missing function: emscripten_glUniformBlockBinding'); abort(-1); + } + + function _emscripten_glUniformMatrix2fv(location, count, transpose, value) { + + + var view; + if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[4*count-1]; + for (var i = 0; i < 4*count; i += 4) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*16)>>2); + } + GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUniformMatrix2x3fv() { + err('missing function: emscripten_glUniformMatrix2x3fv'); abort(-1); + } + + function _emscripten_glUniformMatrix2x4fv() { + err('missing function: emscripten_glUniformMatrix2x4fv'); abort(-1); + } + + function _emscripten_glUniformMatrix3fv(location, count, transpose, value) { + + + var view; + if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[9*count-1]; + for (var i = 0; i < 9*count; i += 9) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)]; + view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)]; + view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)]; + view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)]; + view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*36)>>2); + } + GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUniformMatrix3x2fv() { + err('missing function: emscripten_glUniformMatrix3x2fv'); abort(-1); + } + + function _emscripten_glUniformMatrix3x4fv() { + err('missing function: emscripten_glUniformMatrix3x4fv'); abort(-1); + } + + function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { + + + var view; + if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[16*count-1]; + for (var i = 0; i < 16*count; i += 16) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)]; + view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)]; + view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)]; + view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)]; + view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)]; + view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)]; + view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)]; + view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)]; + view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)]; + view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)]; + view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)]; + view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view); + } + + function _emscripten_glUniformMatrix4x2fv() { + err('missing function: emscripten_glUniformMatrix4x2fv'); abort(-1); + } + + function _emscripten_glUniformMatrix4x3fv() { + err('missing function: emscripten_glUniformMatrix4x3fv'); abort(-1); + } + + function _emscripten_glUnmapBuffer() { + err('missing function: emscripten_glUnmapBuffer'); abort(-1); + } + + function _emscripten_glUseProgram(program) { + GLctx.useProgram(program ? GL.programs[program] : null); + } + + function _emscripten_glUseProgramObjectARB() { + err('missing function: emscripten_glUseProgramObjectARB'); abort(-1); + } + + function _emscripten_glValidateProgram(program) { + GLctx.validateProgram(GL.programs[program]); + } + + function _emscripten_glVertex2d() { + err('missing function: emscripten_glVertex2d'); abort(-1); + } + + function _emscripten_glVertex2dv() { + err('missing function: emscripten_glVertex2dv'); abort(-1); + } + + function _emscripten_glVertex2f() { + err('missing function: emscripten_glVertex2f'); abort(-1); + } + + function _emscripten_glVertex2fv() { + err('missing function: emscripten_glVertex2fv'); abort(-1); + } + + function _emscripten_glVertex2i() { + err('missing function: emscripten_glVertex2i'); abort(-1); + } + + function _emscripten_glVertex2iv() { + err('missing function: emscripten_glVertex2iv'); abort(-1); + } + + function _emscripten_glVertex2s() { + err('missing function: emscripten_glVertex2s'); abort(-1); + } + + function _emscripten_glVertex2sv() { + err('missing function: emscripten_glVertex2sv'); abort(-1); + } + + function _emscripten_glVertex3d() { + err('missing function: emscripten_glVertex3d'); abort(-1); + } + + function _emscripten_glVertex3dv() { + err('missing function: emscripten_glVertex3dv'); abort(-1); + } + + function _emscripten_glVertex3f() { + err('missing function: emscripten_glVertex3f'); abort(-1); + } + + function _emscripten_glVertex3fv() { + err('missing function: emscripten_glVertex3fv'); abort(-1); + } + + function _emscripten_glVertex3i() { + err('missing function: emscripten_glVertex3i'); abort(-1); + } + + function _emscripten_glVertex3iv() { + err('missing function: emscripten_glVertex3iv'); abort(-1); + } + + function _emscripten_glVertex3s() { + err('missing function: emscripten_glVertex3s'); abort(-1); + } + + function _emscripten_glVertex3sv() { + err('missing function: emscripten_glVertex3sv'); abort(-1); + } + + function _emscripten_glVertex4d() { + err('missing function: emscripten_glVertex4d'); abort(-1); + } + + function _emscripten_glVertex4dv() { + err('missing function: emscripten_glVertex4dv'); abort(-1); + } + + function _emscripten_glVertex4f() { + err('missing function: emscripten_glVertex4f'); abort(-1); + } + + function _emscripten_glVertex4fv() { + err('missing function: emscripten_glVertex4fv'); abort(-1); + } + + function _emscripten_glVertex4i() { + err('missing function: emscripten_glVertex4i'); abort(-1); + } + + function _emscripten_glVertex4iv() { + err('missing function: emscripten_glVertex4iv'); abort(-1); + } + + function _emscripten_glVertex4s() { + err('missing function: emscripten_glVertex4s'); abort(-1); + } + + function _emscripten_glVertex4sv() { + err('missing function: emscripten_glVertex4sv'); abort(-1); + } + + function _emscripten_glVertexAttrib1d() { + err('missing function: emscripten_glVertexAttrib1d'); abort(-1); + } + + function _emscripten_glVertexAttrib1dv() { + err('missing function: emscripten_glVertexAttrib1dv'); abort(-1); + } + + function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) } + + function _emscripten_glVertexAttrib1fv(index, v) { + + GLctx.vertexAttrib1f(index, HEAPF32[v>>2]); + } + + function _emscripten_glVertexAttrib1s() { + err('missing function: emscripten_glVertexAttrib1s'); abort(-1); + } + + function _emscripten_glVertexAttrib1sv() { + err('missing function: emscripten_glVertexAttrib1sv'); abort(-1); + } + + function _emscripten_glVertexAttrib2d() { + err('missing function: emscripten_glVertexAttrib2d'); abort(-1); + } + + function _emscripten_glVertexAttrib2dv() { + err('missing function: emscripten_glVertexAttrib2dv'); abort(-1); + } + + function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) } + + function _emscripten_glVertexAttrib2fv(index, v) { + + GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]); + } + + function _emscripten_glVertexAttrib2s() { + err('missing function: emscripten_glVertexAttrib2s'); abort(-1); + } + + function _emscripten_glVertexAttrib2sv() { + err('missing function: emscripten_glVertexAttrib2sv'); abort(-1); + } + + function _emscripten_glVertexAttrib3d() { + err('missing function: emscripten_glVertexAttrib3d'); abort(-1); + } + + function _emscripten_glVertexAttrib3dv() { + err('missing function: emscripten_glVertexAttrib3dv'); abort(-1); + } + + function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) } + + function _emscripten_glVertexAttrib3fv(index, v) { + + GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]); + } + + function _emscripten_glVertexAttrib3s() { + err('missing function: emscripten_glVertexAttrib3s'); abort(-1); + } + + function _emscripten_glVertexAttrib3sv() { + err('missing function: emscripten_glVertexAttrib3sv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nbv() { + err('missing function: emscripten_glVertexAttrib4Nbv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Niv() { + err('missing function: emscripten_glVertexAttrib4Niv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nsv() { + err('missing function: emscripten_glVertexAttrib4Nsv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nub() { + err('missing function: emscripten_glVertexAttrib4Nub'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nubv() { + err('missing function: emscripten_glVertexAttrib4Nubv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nuiv() { + err('missing function: emscripten_glVertexAttrib4Nuiv'); abort(-1); + } + + function _emscripten_glVertexAttrib4Nusv() { + err('missing function: emscripten_glVertexAttrib4Nusv'); abort(-1); + } + + function _emscripten_glVertexAttrib4bv() { + err('missing function: emscripten_glVertexAttrib4bv'); abort(-1); + } + + function _emscripten_glVertexAttrib4d() { + err('missing function: emscripten_glVertexAttrib4d'); abort(-1); + } + + function _emscripten_glVertexAttrib4dv() { + err('missing function: emscripten_glVertexAttrib4dv'); abort(-1); + } + + function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) } + + function _emscripten_glVertexAttrib4fv(index, v) { + + GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]); + } + + function _emscripten_glVertexAttrib4iv() { + err('missing function: emscripten_glVertexAttrib4iv'); abort(-1); + } + + function _emscripten_glVertexAttrib4s() { + err('missing function: emscripten_glVertexAttrib4s'); abort(-1); + } + + function _emscripten_glVertexAttrib4sv() { + err('missing function: emscripten_glVertexAttrib4sv'); abort(-1); + } + + function _emscripten_glVertexAttrib4ubv() { + err('missing function: emscripten_glVertexAttrib4ubv'); abort(-1); + } + + function _emscripten_glVertexAttrib4uiv() { + err('missing function: emscripten_glVertexAttrib4uiv'); abort(-1); + } + + function _emscripten_glVertexAttrib4usv() { + err('missing function: emscripten_glVertexAttrib4usv'); abort(-1); + } + + function _emscripten_glVertexAttribDivisor(index, divisor) { + GLctx['vertexAttribDivisor'](index, divisor); + } + + function _emscripten_glVertexAttribI1i() { + err('missing function: emscripten_glVertexAttribI1i'); abort(-1); + } + + function _emscripten_glVertexAttribI1iv() { + err('missing function: emscripten_glVertexAttribI1iv'); abort(-1); + } + + function _emscripten_glVertexAttribI1ui() { + err('missing function: emscripten_glVertexAttribI1ui'); abort(-1); + } + + function _emscripten_glVertexAttribI1uiv() { + err('missing function: emscripten_glVertexAttribI1uiv'); abort(-1); + } + + function _emscripten_glVertexAttribI2i() { + err('missing function: emscripten_glVertexAttribI2i'); abort(-1); + } + + function _emscripten_glVertexAttribI2iv() { + err('missing function: emscripten_glVertexAttribI2iv'); abort(-1); + } + + function _emscripten_glVertexAttribI2ui() { + err('missing function: emscripten_glVertexAttribI2ui'); abort(-1); + } + + function _emscripten_glVertexAttribI2uiv() { + err('missing function: emscripten_glVertexAttribI2uiv'); abort(-1); + } + + function _emscripten_glVertexAttribI3i() { + err('missing function: emscripten_glVertexAttribI3i'); abort(-1); + } + + function _emscripten_glVertexAttribI3iv() { + err('missing function: emscripten_glVertexAttribI3iv'); abort(-1); + } + + function _emscripten_glVertexAttribI3ui() { + err('missing function: emscripten_glVertexAttribI3ui'); abort(-1); + } + + function _emscripten_glVertexAttribI3uiv() { + err('missing function: emscripten_glVertexAttribI3uiv'); abort(-1); + } + + function _emscripten_glVertexAttribI4bv() { + err('missing function: emscripten_glVertexAttribI4bv'); abort(-1); + } + + function _emscripten_glVertexAttribI4i() { + err('missing function: emscripten_glVertexAttribI4i'); abort(-1); + } + + function _emscripten_glVertexAttribI4iv() { + err('missing function: emscripten_glVertexAttribI4iv'); abort(-1); + } + + function _emscripten_glVertexAttribI4sv() { + err('missing function: emscripten_glVertexAttribI4sv'); abort(-1); + } + + function _emscripten_glVertexAttribI4ubv() { + err('missing function: emscripten_glVertexAttribI4ubv'); abort(-1); + } + + function _emscripten_glVertexAttribI4ui() { + err('missing function: emscripten_glVertexAttribI4ui'); abort(-1); + } + + function _emscripten_glVertexAttribI4uiv() { + err('missing function: emscripten_glVertexAttribI4uiv'); abort(-1); + } + + function _emscripten_glVertexAttribI4usv() { + err('missing function: emscripten_glVertexAttribI4usv'); abort(-1); + } + + function _emscripten_glVertexAttribIPointer() { + err('missing function: emscripten_glVertexAttribIPointer'); abort(-1); + } + + function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); + } + + function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; } + + function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + function _emscripten_glWindowPos2d() { + err('missing function: emscripten_glWindowPos2d'); abort(-1); + } + + function _emscripten_glWindowPos2dv() { + err('missing function: emscripten_glWindowPos2dv'); abort(-1); + } + + function _emscripten_glWindowPos2f() { + err('missing function: emscripten_glWindowPos2f'); abort(-1); + } + + function _emscripten_glWindowPos2fv() { + err('missing function: emscripten_glWindowPos2fv'); abort(-1); + } + + function _emscripten_glWindowPos2i() { + err('missing function: emscripten_glWindowPos2i'); abort(-1); + } + + function _emscripten_glWindowPos2iv() { + err('missing function: emscripten_glWindowPos2iv'); abort(-1); + } + + function _emscripten_glWindowPos2s() { + err('missing function: emscripten_glWindowPos2s'); abort(-1); + } + + function _emscripten_glWindowPos2sv() { + err('missing function: emscripten_glWindowPos2sv'); abort(-1); + } + + function _emscripten_glWindowPos3d() { + err('missing function: emscripten_glWindowPos3d'); abort(-1); + } + + function _emscripten_glWindowPos3dv() { + err('missing function: emscripten_glWindowPos3dv'); abort(-1); + } + + function _emscripten_glWindowPos3f() { + err('missing function: emscripten_glWindowPos3f'); abort(-1); + } + + function _emscripten_glWindowPos3fv() { + err('missing function: emscripten_glWindowPos3fv'); abort(-1); + } + + function _emscripten_glWindowPos3i() { + err('missing function: emscripten_glWindowPos3i'); abort(-1); + } + + function _emscripten_glWindowPos3iv() { + err('missing function: emscripten_glWindowPos3iv'); abort(-1); + } + + function _emscripten_glWindowPos3s() { + err('missing function: emscripten_glWindowPos3s'); abort(-1); + } + + function _emscripten_glWindowPos3sv() { + err('missing function: emscripten_glWindowPos3sv'); abort(-1); + } + + function _emscripten_request_pointerlock(target, deferUntilInEventHandler) { + if (!target) target = '#canvas'; + target = JSEvents.findEventTarget(target); + if (!target) return -4; + if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) { + return -1; + } + + var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); + + // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. + if (!canPerformRequests) { + if (deferUntilInEventHandler) { + JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]); + return 1; + } else { + return -2; + } + } + + return JSEvents.requestPointerLock(target); + } + + function _emscripten_set_click_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click", targetThread); + return 0; + } + + function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1; + if (!target) target = document; + else { + target = JSEvents.findEventTarget(target); + if (!target) return -4; + } + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread); + JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread); + return 0; + } + + function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; + JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread); + return 0; + } + + function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1; + JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread); + return 0; + } + + function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread); + return 0; + } + + + function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread); + return 0; + } + + function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread); + return 0; + } + + function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread); + return 0; + } + + function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread); + return 0; + } + + + function __exit(status) { + // void _exit(int status); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html + exit(status); + }function _exit(status) { + __exit(status); + } + + function _glActiveTexture(x0) { GLctx['activeTexture'](x0) } + + function _glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glBindAttribLocation(program, index, name) { + name = Pointer_stringify(name); + GLctx.bindAttribLocation(GL.programs[program], index, name); + } + + function _glBindBuffer(target, buffer) { + var bufferObj = buffer ? GL.buffers[buffer] : null; + + + GLctx.bindBuffer(target, bufferObj); + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, texture ? GL.textures[texture] : null); + } + + function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) } + + function _glBufferData(target, size, data, usage) { + if (!data) { + GLctx.bufferData(target, size, usage); + } else { + GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage); + } + } + + function _glBufferSubData(target, offset, size, data) { + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _glClear(x0) { GLctx['clear'](x0) } + + function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) } + + function _glClearDepthf(x0) { GLctx['clearDepth'](x0) } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null); + } + + function _glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + GL.programs[id] = program; + return id; + } + + function _glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; + } + + function _glCullFace(x0) { GLctx['cullFace'](x0) } + + function _glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0; + if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0; + } + } + + function _glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + GL.programInfos[id] = null; + } + + function _glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _glDepthFunc(x0) { GLctx['depthFunc'](x0) } + + function _glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _glDisable(x0) { GLctx['disable'](x0) } + + function _glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); + } + + function _glDrawArrays(mode, first, count) { + + GLctx.drawArrays(mode, first, count); + + } + + function _glDrawElements(mode, count, type, indices) { + + GLctx.drawElements(mode, count, type, indices); + + } + + function _glEnable(x0) { GLctx['enable'](x0) } + + function _glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); + } + + function _glFrontFace(x0) { GLctx['frontFace'](x0) } + + function _glGenBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var buffer = GLctx.createBuffer(); + if (!buffer) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.buffers); + buffer.name = id; + GL.buffers[id] = buffer; + HEAP32[(((buffers)+(i*4))>>2)]=id; + } + } + + function _glGenTextures(n, textures) { + for (var i = 0; i < n; i++) { + var texture = GLctx.createTexture(); + if (!texture) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0. + while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0; + return; + } + var id = GL.getNewId(GL.textures); + texture.name = id; + GL.textures[id] = texture; + HEAP32[(((textures)+(i*4))>>2)]=id; + } + } + + function _glGetAttribLocation(program, name) { + return GLctx.getAttribLocation(GL.programs[program], Pointer_stringify(name)); + } + + function _glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 'Float'); + } + + function _glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + + if (maxLength > 0 && infoLog) { + var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + + if (program >= GL.counter) { + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + GL.recordError(0x0502 /* GL_INVALID_OPERATION */); + return; + } + + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + HEAP32[((p)>>2)]=ptable.maxUniformLength; + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + if (ptable.maxAttributeLength == -1) { + program = GL.programs[program]; + var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES); + ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned. + for (var i = 0; i < numAttribs; ++i) { + var activeAttrib = GLctx.getActiveAttrib(program, i); + ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxAttributeLength; + } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) { + if (ptable.maxUniformBlockNameLength == -1) { + program = GL.programs[program]; + var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS); + ptable.maxUniformBlockNameLength = 0; + for (var i = 0; i < numBlocks; ++i) { + var activeBlockName = GLctx.getActiveUniformBlockName(program, i); + ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1); + } + } + HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength; + } else { + HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname); + } + } + + function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + if (maxLength > 0 && infoLog) { + var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength); + if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)]=0; + } + } + + function _glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)]=log.length + 1; + } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH + var source = GLctx.getShaderSource(GL.shaders[shader]); + var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1; + HEAP32[((p)>>2)]=sourceLength; + } else { + HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions(); + var gl_exts = []; + for (var i = 0; i < exts.length; ++i) { + gl_exts.push(exts[i]); + gl_exts.push("GL_" + exts[i]); + } + ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); + break; + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x9245 /* UNMASKED_VENDOR_WEBGL */: + case 0x9246 /* UNMASKED_RENDERER_WEBGL */: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + } + ret = allocate(intArrayFromString(s), 'i8', ALLOC_NORMAL); + break; + + case 0x1F02 /* GL_VERSION */: + var glVersion = GLctx.getParameter(GLctx.VERSION); + // return GLES version string corresponding to the version of the WebGL context + { + glVersion = 'OpenGL ES 2.0 (' + glVersion + ')'; + } + ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION); + // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...' + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits + glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')'; + } + ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL); + break; + default: + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _glGetUniformLocation(program, name) { + name = Pointer_stringify(name); + + var arrayOffset = 0; + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + var arrayIndex = name.slice(ls+1, -1); + if (arrayIndex.length > 0) { + arrayOffset = parseInt(arrayIndex); + if (arrayOffset < 0) { + return -1; + } + } + name = name.slice(0, ls); + } + + var ptable = GL.programInfos[program]; + if (!ptable) { + return -1; + } + var utable = ptable.uniforms; + var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ] + if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1. + return uniformInfo[1]+arrayOffset; + } else { + return -1; + } + } + + function _glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.programInfos[program] = null; // uniforms no longer keep the same names after linking + GL.populateUniformTable(program); + } + + function _glPixelStorei(pname, param) { + if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) { + GL.packAlignment = param; + } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function _glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + + + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData); + } + + function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _glUniform1i(location, v0) { + GLctx.uniform1i(GL.uniforms[location], v0); + } + + function _glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3); + } + + function _glUniformMatrix4fv(location, count, transpose, value) { + + + var view; + if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) { + // avoid allocation when uploading few enough uniforms + view = GL.miniTempBufferViews[16*count-1]; + for (var i = 0; i < 16*count; i += 16) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)]; + view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)]; + view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)]; + view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)]; + view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)]; + view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)]; + view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)]; + view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)]; + view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)]; + view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)]; + view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)]; + view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)]; + } + } else { + view = HEAPF32.subarray((value)>>2,(value+count*64)>>2); + } + GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view); + } + + function _glUseProgram(program) { + GLctx.useProgram(program ? GL.programs[program] : null); + } + + function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); + } + + function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + + var GLFW={Window:function (id, width, height, title, monitor, share) { + this.id = id; + this.x = 0; + this.y = 0; + this.fullscreen = false; // Used to determine if app in fullscreen mode + this.storedX = 0; // Used to store X before fullscreen + this.storedY = 0; // Used to store Y before fullscreen + this.width = width; + this.height = height; + this.storedWidth = width; // Used to store width before fullscreen + this.storedHeight = height; // Used to store height before fullscreen + this.title = title; + this.monitor = monitor; + this.share = share; + this.attributes = GLFW.hints; + this.inputModes = { + 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL) + 0x00033002:0, // GLFW_STICKY_KEYS + 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS + }; + this.buttons = 0; + this.keys = new Array(); + this.domKeys = new Array(); + this.shouldClose = 0; + this.title = null; + this.windowPosFunc = null; // GLFWwindowposfun + this.windowSizeFunc = null; // GLFWwindowsizefun + this.windowCloseFunc = null; // GLFWwindowclosefun + this.windowRefreshFunc = null; // GLFWwindowrefreshfun + this.windowFocusFunc = null; // GLFWwindowfocusfun + this.windowIconifyFunc = null; // GLFWwindowiconifyfun + this.framebufferSizeFunc = null; // GLFWframebuffersizefun + this.mouseButtonFunc = null; // GLFWmousebuttonfun + this.cursorPosFunc = null; // GLFWcursorposfun + this.cursorEnterFunc = null; // GLFWcursorenterfun + this.scrollFunc = null; // GLFWscrollfun + this.dropFunc = null; // GLFWdropfun + this.keyFunc = null; // GLFWkeyfun + this.charFunc = null; // GLFWcharfun + this.userptr = null; + },WindowFromId:function (id) { + if (id <= 0 || !GLFW.windows) return null; + return GLFW.windows[id - 1]; + },joystickFunc:null,errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) { + switch (keycode) { + // these keycodes are only defined for GLFW3, assume they are the same for GLFW2 + case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE + case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE + case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA + case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS + case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS + case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD + case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH + case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0 + case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1 + case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2 + case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3 + case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4 + case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5 + case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6 + case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7 + case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8 + case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9 + case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON + case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL + case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL + case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A + case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B + case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C + case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D + case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E + case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F + case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G + case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H + case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I + case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J + case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K + case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L + case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M + case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N + case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O + case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P + case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q + case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R + case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S + case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T + case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U + case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V + case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W + case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X + case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y + case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z + case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET + case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH + case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET + case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT + + + case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE + case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER + case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB + case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE + case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT + case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE + case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT + case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT + case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN + case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP + case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP + case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN + case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME + case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END + case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK + case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK + case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK + case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN + case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE + case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1 + case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2 + case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3 + case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4 + case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5 + case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6 + case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7 + case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8 + case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9 + case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10 + case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11 + case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12 + case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13 + case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14 + case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15 + case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16 + case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17 + case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18 + case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19 + case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20 + case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21 + case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22 + case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23 + case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24 + case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25 + case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0 + case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1 + case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2 + case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3 + case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4 + case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5 + case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6 + case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7 + case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8 + case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9 + case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL + case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE + case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY + case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT + case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD + // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT) + // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT) + case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT + case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL + case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT + case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER + // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT) + // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT) + // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT) + // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT) + case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU + // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these? + default:return -1; // GLFW_KEY_UNKNOWN + }; + },getModBits:function (win) { + var mod = 0; + if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT + if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL + if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT + if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER + return mod; + },onKeyPress:function (event) { + if (!GLFW.active || !GLFW.active.charFunc) return; + if (event.ctrlKey || event.metaKey) return; + + // correct unicode charCode is only available with onKeyPress event + var charCode = event.charCode; + if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return; + + + Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode); + },onKeyChanged:function (keyCode, status) { + if (!GLFW.active) return; + + var key = GLFW.DOMToGLFWKeyCode(keyCode); + if (key == -1) return; + + var repeat = status && GLFW.active.keys[key]; + GLFW.active.keys[key] = status; + GLFW.active.domKeys[keyCode] = status; + if (!GLFW.active.keyFunc) return; + + + if (repeat) status = 2; // GLFW_REPEAT + Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, keyCode, status, GLFW.getModBits(GLFW.active)); + },onGamepadConnected:function (event) { + GLFW.refreshJoysticks(); + },onGamepadDisconnected:function (event) { + GLFW.refreshJoysticks(); + },onKeydown:function (event) { + GLFW.onKeyChanged(event.keyCode, 1); // GLFW_PRESS or GLFW_REPEAT + + // This logic comes directly from the sdl implementation. We cannot + // call preventDefault on all keydown events otherwise onKeyPress will + // not get called + if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) { + event.preventDefault(); + } + },onKeyup:function (event) { + GLFW.onKeyChanged(event.keyCode, 0); // GLFW_RELEASE + },onBlur:function (event) { + if (!GLFW.active) return; + + for (var i = 0; i < GLFW.active.domKeys.length; ++i) { + if (GLFW.active.domKeys[i]) { + GLFW.onKeyChanged(i, 0); // GLFW_RELEASE + } + } + },onMousemove:function (event) { + if (!GLFW.active) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return; + + + Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY); + },DOMToGLFWMouseButton:function (event) { + // DOM and glfw have different button codes. + // See http://www.w3schools.com/jsref/event_button.asp. + var eventButton = event['button']; + if (eventButton > 0) { + if (eventButton == 1) { + eventButton = 2; + } else { + eventButton = 1; + } + } + return eventButton; + },onMouseenter:function (event) { + if (!GLFW.active) return; + + if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return; + + Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1); + },onMouseleave:function (event) { + if (!GLFW.active) return; + + if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return; + + Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0); + },onMouseButtonChanged:function (event, status) { + if (!GLFW.active) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"]) return; + + var eventButton = GLFW.DOMToGLFWMouseButton(event); + + if (status == 1) { // GLFW_PRESS + GLFW.active.buttons |= (1 << eventButton); + try { + event.target.setCapture(); + } catch (e) {} + } else { // GLFW_RELEASE + GLFW.active.buttons &= ~(1 << eventButton); + } + + if (!GLFW.active.mouseButtonFunc) return; + + + Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)); + },onMouseButtonDown:function (event) { + if (!GLFW.active) return; + GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS + },onMouseButtonUp:function (event) { + if (!GLFW.active) return; + GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE + },onMouseWheel:function (event) { + // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up) + var delta = -Browser.getMouseWheelDelta(event); + delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. + GLFW.wheelPos += delta; + + if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return; + + + var sx = 0; + var sy = 0; + if (event.type == 'mousewheel') { + sx = event.wheelDeltaX; + sy = event.wheelDeltaY; + } else { + sx = event.deltaX; + sy = event.deltaY; + } + + Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy); + + event.preventDefault(); + },onCanvasResize:function (width, height) { + if (!GLFW.active) return; + + var resizeNeeded = true; + + // If the client is requesting fullscreen mode + if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) { + GLFW.active.storedX = GLFW.active.x; + GLFW.active.storedY = GLFW.active.y; + GLFW.active.storedWidth = GLFW.active.width; + GLFW.active.storedHeight = GLFW.active.height; + GLFW.active.x = GLFW.active.y = 0; + GLFW.active.width = screen.width; + GLFW.active.height = screen.height; + GLFW.active.fullscreen = true; + + // If the client is reverting from fullscreen mode + } else if (GLFW.active.fullscreen == true) { + GLFW.active.x = GLFW.active.storedX; + GLFW.active.y = GLFW.active.storedY; + GLFW.active.width = GLFW.active.storedWidth; + GLFW.active.height = GLFW.active.storedHeight; + GLFW.active.fullscreen = false; + + // If the width/height values do not match current active window sizes + } else if (GLFW.active.width != width || GLFW.active.height != height) { + GLFW.active.width = width; + GLFW.active.height = height; + } else { + resizeNeeded = false; + } + + // If any of the above conditions were true, we need to resize the canvas + if (resizeNeeded) { + // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions + Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); + // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of + // the canvas should drive window and framebuffer size respectfully. + GLFW.onWindowSizeChanged(); + GLFW.onFramebufferSizeChanged(); + } + },onWindowSizeChanged:function () { + if (!GLFW.active) return; + + if (!GLFW.active.windowSizeFunc) return; + + + Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height); + },onFramebufferSizeChanged:function () { + if (!GLFW.active) return; + + if (!GLFW.active.framebufferSizeFunc) return; + + Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height); + },requestFullscreen:function () { + var RFS = Module["canvas"]['requestFullscreen'] || + Module["canvas"]['mozRequestFullScreen'] || + Module["canvas"]['webkitRequestFullScreen'] || + (function() {}); + RFS.apply(Module["canvas"], []); + },requestFullScreen:function () { + err('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.'); + GLFW.requestFullScreen = function() { + return GLFW.requestFullscreen(); + } + return GLFW.requestFullscreen(); + },exitFullscreen:function () { + var CFS = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['webkitCancelFullScreen'] || + (function() {}); + CFS.apply(document, []); + },cancelFullScreen:function () { + err('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.'); + GLFW.cancelFullScreen = function() { + return GLFW.exitFullscreen(); + } + return GLFW.exitFullscreen(); + },getTime:function () { + return _emscripten_get_now() / 1000; + },setWindowTitle:function (winid, title) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + win.title = Pointer_stringify(title); + if (GLFW.active.id == win.id) { + document.title = win.title; + } + },setJoystickCallback:function (cbfun) { + GLFW.joystickFunc = cbfun; + GLFW.refreshJoysticks(); + },joys:{},lastGamepadState:null,lastGamepadStateFrame:null,refreshJoysticks:function () { + // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation. + if (Browser.mainLoop.currentFrameNumber !== GLFW.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) { + GLFW.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null); + GLFW.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber; + + for (var joy = 0; joy < GLFW.lastGamepadState.length; ++joy) { + var gamepad = GLFW.lastGamepadState[joy]; + + if (gamepad) { + if (!GLFW.joys[joy]) { + console.log('glfw joystick connected:',joy); + GLFW.joys[joy] = { + id: allocate(intArrayFromString(gamepad.id), 'i8', ALLOC_NORMAL), + buttonsCount: gamepad.buttons.length, + axesCount: gamepad.axes.length, + buttons: allocate(new Array(gamepad.buttons.length), 'i8', ALLOC_NORMAL), + axes: allocate(new Array(gamepad.axes.length*4), 'float', ALLOC_NORMAL) + }; + + if (GLFW.joystickFunc) { + Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040001); // GLFW_CONNECTED + } + } + + var data = GLFW.joys[joy]; + + for (var i = 0; i < gamepad.buttons.length; ++i) { + setValue(data.buttons + i, gamepad.buttons[i].pressed, 'i8'); + } + + for (var i = 0; i < gamepad.axes.length; ++i) { + setValue(data.axes + i*4, gamepad.axes[i], 'float'); + } + } else { + if (GLFW.joys[joy]) { + console.log('glfw joystick disconnected',joy); + + if (GLFW.joystickFunc) { + Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040002); // GLFW_DISCONNECTED + } + + _free(GLFW.joys[joy].id); + _free(GLFW.joys[joy].buttons); + _free(GLFW.joys[joy].axes); + + delete GLFW.joys[joy]; + } + } + } + } + },setKeyCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.keyFunc = cbfun; + },setCharCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.charFunc = cbfun; + },setMouseButtonCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.mouseButtonFunc = cbfun; + },setCursorPosCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.cursorPosFunc = cbfun; + },setScrollCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.scrollFunc = cbfun; + },setDropCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.dropFunc = cbfun; + },onDrop:function (event) { + if (!GLFW.active || !GLFW.active.dropFunc) return; + if (!event.dataTransfer || !event.dataTransfer.files || event.dataTransfer.files.length == 0) return; + + event.preventDefault(); + + var filenames = allocate(new Array(event.dataTransfer.files.length*4), 'i8*', ALLOC_NORMAL); + var filenamesArray = []; + var count = event.dataTransfer.files.length; + + // Read and save the files to emscripten's FS + var written = 0; + var drop_dir = '.glfw_dropped_files'; + FS.createPath('/', drop_dir); + + function save(file) { + var path = '/' + drop_dir + '/' + file.name.replace(/\//g, '_'); + var reader = new FileReader(); + reader.onloadend = function(e) { + if (reader.readyState != 2) { // not DONE + ++written; + console.log('failed to read dropped file: '+file.name+': '+reader.error); + return; + } + + var data = e.target.result; + FS.writeFile(path, new Uint8Array(data)); + if (++written === count) { + Module['dynCall_viii'](GLFW.active.dropFunc, GLFW.active.id, count, filenames); + + for (var i = 0; i < filenamesArray.length; ++i) { + _free(filenamesArray[i]); + } + _free(filenames); + } + }; + reader.readAsArrayBuffer(file); + + var filename = allocate(intArrayFromString(path), 'i8', ALLOC_NORMAL); + filenamesArray.push(filename); + setValue(filenames + i*4, filename, 'i8*'); + } + + for (var i = 0; i < count; ++i) { + save(event.dataTransfer.files[i]); + } + + return false; + },onDragover:function (event) { + if (!GLFW.active || !GLFW.active.dropFunc) return; + + event.preventDefault(); + return false; + },setWindowSizeCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowSizeFunc = cbfun; + + },setWindowCloseCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowCloseFunc = cbfun; + },setWindowRefreshCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowRefreshFunc = cbfun; + },onClickRequestPointerLock:function (e) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + e.preventDefault(); + } + },setInputMode:function (winid, mode, value) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + switch(mode) { + case 0x00033001: { // GLFW_CURSOR + switch(value) { + case 0x00034001: { // GLFW_CURSOR_NORMAL + win.inputModes[mode] = value; + Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true); + Module['canvas'].exitPointerLock(); + break; + } + case 0x00034002: { // GLFW_CURSOR_HIDDEN + console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented."); + break; + } + case 0x00034003: { // GLFW_CURSOR_DISABLED + win.inputModes[mode] = value; + Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true); + Module['canvas'].requestPointerLock(); + break; + } + default: { + console.log("glfwSetInputMode called with unknown value parameter value: " + value + "."); + break; + } + } + break; + } + case 0x00033002: { // GLFW_STICKY_KEYS + console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented."); + break; + } + case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS + console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented."); + break; + } + default: { + console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + "."); + break; + } + } + },getKey:function (winid, key) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return win.keys[key]; + },getMouseButton:function (winid, button) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return (win.buttons & (1 << button)) > 0; + },getCursorPos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'double'); + setValue(y, Browser.mouseY, 'double'); + },getMousePos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'i32'); + setValue(y, Browser.mouseY, 'i32'); + },setCursorPos:function (winid, x, y) { + },getWindowPos:function (winid, x, y) { + var wx = 0; + var wy = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + wx = win.x; + wy = win.y; + } + + setValue(x, wx, 'i32'); + setValue(y, wy, 'i32'); + },setWindowPos:function (winid, x, y) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.x = x; + win.y = y; + },getWindowSize:function (winid, width, height) { + var ww = 0; + var wh = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + ww = win.width; + wh = win.height; + } + + setValue(width, ww, 'i32'); + setValue(height, wh, 'i32'); + },setWindowSize:function (winid, width, height) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (GLFW.active.id == win.id) { + if (width == screen.width && height == screen.height) { + GLFW.requestFullscreen(); + } else { + GLFW.exitFullscreen(); + Browser.setCanvasSize(width, height); + win.width = width; + win.height = height; + } + } + + if (!win.windowSizeFunc) return; + + + Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height); + },createWindow:function (width, height, title, monitor, share) { + var i, id; + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++); + if (i > 0) throw "glfwCreateWindow only supports one window at time currently"; + + // id for window + id = i + 1; + + // not valid + if (width <= 0 || height <= 0) return 0; + + if (monitor) { + GLFW.requestFullscreen(); + } else { + Browser.setCanvasSize(width, height); + } + + // Create context when there are no existing alive windows + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++); + if (i == GLFW.windows.length) { + var contextAttributes = { + antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES + depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS + stencil: (GLFW.hints[0x00021006] > 0), // GLFW_STENCIL_BITS + alpha: (GLFW.hints[0x00021004] > 0) // GLFW_ALPHA_BITS + } + Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes); + } + + // If context creation failed, do not return a valid window + if (!Module.ctx) return 0; + + // Get non alive id + var win = new GLFW.Window(id, width, height, title, monitor, share); + + // Set window to array + if (id - 1 == GLFW.windows.length) { + GLFW.windows.push(win); + } else { + GLFW.windows[id - 1] = win; + } + + GLFW.active = win; + return win.id; + },destroyWindow:function (winid) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (win.windowCloseFunc) + Module['dynCall_vi'](win.windowCloseFunc, win.id); + + GLFW.windows[win.id - 1] = null; + if (GLFW.active.id == win.id) + GLFW.active = null; + + // Destroy context when no alive windows + for (var i = 0; i < GLFW.windows.length; i++) + if (GLFW.windows[i] !== null) return; + + Module.ctx = Browser.destroyContext(Module['canvas'], true, true); + },swapBuffers:function (winid) { + },GLFW2ParamToGLFW3Param:function (param) { + var table = { + 0x00030001:0, // GLFW_MOUSE_CURSOR + 0x00030002:0, // GLFW_STICKY_KEYS + 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS + 0x00030004:0, // GLFW_SYSTEM_KEYS + 0x00030005:0, // GLFW_KEY_REPEAT + 0x00030006:0, // GLFW_AUTO_POLL_EVENTS + 0x00020001:0, // GLFW_OPENED + 0x00020002:0, // GLFW_ACTIVE + 0x00020003:0, // GLFW_ICONIFIED + 0x00020004:0, // GLFW_ACCELERATED + 0x00020005:0x00021001, // GLFW_RED_BITS + 0x00020006:0x00021002, // GLFW_GREEN_BITS + 0x00020007:0x00021003, // GLFW_BLUE_BITS + 0x00020008:0x00021004, // GLFW_ALPHA_BITS + 0x00020009:0x00021005, // GLFW_DEPTH_BITS + 0x0002000A:0x00021006, // GLFW_STENCIL_BITS + 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE + 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS + 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS + 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS + 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS + 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS + 0x00020011:0x0002100C, // GLFW_STEREO + 0x00020012:0, // GLFW_WINDOW_NO_RESIZE + 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES + 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR + 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR + 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT + 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT + 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE + }; + return table[param]; + }};function _glfwCreateWindow(width, height, title, monitor, share) { + return GLFW.createWindow(width, height, title, monitor, share); + } + + function _glfwDefaultWindowHints() { + GLFW.hints = GLFW.defaultHints; + } + + function _glfwDestroyWindow(winid) { + return GLFW.destroyWindow(winid); + } + + function _glfwGetCursorPos(winid, x, y) { + GLFW.getCursorPos(winid, x, y); + } + + function _glfwGetPrimaryMonitor() { + return 1; + } + + function _glfwGetTime() { + return GLFW.getTime() - GLFW.initialTime; + } + + function _glfwGetVideoModes(monitor, count) { + setValue(count, 0, 'i32'); + return 0; + } + + function _glfwInit() { + if (GLFW.windows) return 1; // GL_TRUE + + GLFW.initialTime = GLFW.getTime(); + GLFW.hints = GLFW.defaultHints; + GLFW.windows = new Array() + GLFW.active = null; + + window.addEventListener("gamepadconnected", GLFW.onGamepadConnected, true); + window.addEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true); + window.addEventListener("keydown", GLFW.onKeydown, true); + window.addEventListener("keypress", GLFW.onKeyPress, true); + window.addEventListener("keyup", GLFW.onKeyup, true); + window.addEventListener("blur", GLFW.onBlur, true); + Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true); + Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true); + Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true); + Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true); + Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true); + Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true); + Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true); + Module["canvas"].addEventListener('drop', GLFW.onDrop, true); + Module["canvas"].addEventListener('dragover', GLFW.onDragover, true); + + Browser.resizeListeners.push(function(width, height) { + GLFW.onCanvasResize(width, height); + }); + return 1; // GL_TRUE + } + + function _glfwMakeContextCurrent(winid) {} + + function _glfwSetCharCallback(winid, cbfun) { + GLFW.setCharCallback(winid, cbfun); + } + + function _glfwSetCursorEnterCallback(winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.cursorEnterFunc = cbfun; + } + + function _glfwSetCursorPosCallback(winid, cbfun) { + GLFW.setCursorPosCallback(winid, cbfun); + } + + function _glfwSetErrorCallback(cbfun) { + GLFW.errorFunc = cbfun; + } + + function _glfwSetKeyCallback(winid, cbfun) { + GLFW.setKeyCallback(winid, cbfun); + } + + function _glfwSetMouseButtonCallback(winid, cbfun) { + GLFW.setMouseButtonCallback(winid, cbfun); + } + + function _glfwSetScrollCallback(winid, cbfun) { + GLFW.setScrollCallback(winid, cbfun); + } + + function _glfwSetWindowIconifyCallback(winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowIconifyFunc = cbfun; + } + + function _glfwSetWindowShouldClose(winid, value) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.shouldClose = value; + } + + function _glfwSetWindowSizeCallback(winid, cbfun) { + GLFW.setWindowSizeCallback(winid, cbfun); + } + + function _glfwSwapBuffers(winid) { + GLFW.swapBuffers(winid); + } + + function _glfwSwapInterval(interval) { + interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same. + if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval); + } + + function _glfwTerminate() { + window.removeEventListener("gamepadconnected", GLFW.onGamepadConnected, true); + window.removeEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true); + window.removeEventListener("keydown", GLFW.onKeydown, true); + window.removeEventListener("keypress", GLFW.onKeyPress, true); + window.removeEventListener("keyup", GLFW.onKeyup, true); + window.removeEventListener("blur", GLFW.onBlur, true); + Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true); + Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true); + Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true); + Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true); + Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true); + Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true); + Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true); + Module["canvas"].removeEventListener('drop', GLFW.onDrop, true); + Module["canvas"].removeEventListener('dragover', GLFW.onDragover, true); + + + Module["canvas"].width = Module["canvas"].height = 1; + GLFW.windows = null; + GLFW.active = null; + } + + function _glfwWindowHint(target, hint) { + GLFW.hints[target] = hint; + } + + + + function _llvm_exp2_f32(x) { + return Math.pow(2, x); + } + + + + function _llvm_stackrestore(p) { + var self = _llvm_stacksave; + var ret = self.LLVM_SAVEDSTACKS[p]; + self.LLVM_SAVEDSTACKS.splice(p, 1); + stackRestore(ret); + } + + function _llvm_stacksave() { + var self = _llvm_stacksave; + if (!self.LLVM_SAVEDSTACKS) { + self.LLVM_SAVEDSTACKS = []; + } + self.LLVM_SAVEDSTACKS.push(stackSave()); + return self.LLVM_SAVEDSTACKS.length-1; + } + + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.set(HEAPU8.subarray(src, src+num), dest); + return dest; + } + + + + + + function _pthread_attr_destroy(attr) { + /* int pthread_attr_destroy(pthread_attr_t *attr); */ + //FIXME: should destroy the pthread_attr_t struct + return 0; + } + + function _pthread_attr_init(attr) { + /* int pthread_attr_init(pthread_attr_t *attr); */ + //FIXME: should allocate a pthread_attr_t + return 0; + } + + function _pthread_cond_destroy() { return 0; } + + function _pthread_cond_init() { return 0; } + + function _pthread_cond_signal() { return 0; } + + function _pthread_cond_wait() { return 0; } + + function _pthread_create() { + return 11; + } + + function _pthread_join() {} + + function _pthread_mutex_destroy() {} + + function _pthread_mutex_init() {} + + + + + + + + function _time(ptr) { + var ret = (Date.now()/1000)|0; + if (ptr) { + HEAP32[((ptr)>>2)]=ret; + } + return ret; + } + + function _usleep(useconds) { + // int usleep(useconds_t useconds); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html + // We're single-threaded, so use a busy loop. Super-ugly. + var msec = useconds / 1000; + if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']) { + var start = self['performance']['now'](); + while (self['performance']['now']() - start < msec) { + // Do nothing. + } + } else { + var start = Date.now(); + while (Date.now() - start < msec) { + // Do nothing. + } + } + return 0; + } + +FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;; +__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });; +if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); }; +Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) }; + Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) }; + Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; + Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; + Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; + Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; + Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } + Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }; +if (ENVIRONMENT_IS_NODE) { + _emscripten_get_now = function _emscripten_get_now_actual() { + var t = process['hrtime'](); + return t[0] * 1e3 + t[1] / 1e6; + }; + } else if (typeof dateNow !== 'undefined') { + _emscripten_get_now = dateNow; + } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') { + _emscripten_get_now = function() { return self['performance']['now'](); }; + } else if (typeof performance === 'object' && typeof performance['now'] === 'function') { + _emscripten_get_now = function() { return performance['now'](); }; + } else { + _emscripten_get_now = Date.now; + }; +JSEvents.staticInit();; +var GLctx; GL.init(); +DYNAMICTOP_PTR = staticAlloc(4); + +STACK_BASE = STACKTOP = alignMemory(STATICTOP); + +STACK_MAX = STACK_BASE + TOTAL_STACK; + +DYNAMIC_BASE = alignMemory(STACK_MAX); + +HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE; + +staticSealed = true; // seal the static portion of memory + +var ASSERTIONS = false; + +// Copyright 2017 The Emscripten Authors. All rights reserved. +// Emscripten is available under two separate licenses, the MIT license and the +// University of Illinois/NCSA Open Source License. Both these licenses can be +// found in the LICENSE file. + +/** @type {function(string, boolean=, number=)} */ +function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 0xFF) { + if (ASSERTIONS) { + assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); + } + chr &= 0xFF; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(''); +} + + + +Module['wasmTableSize'] = 1414; + +Module['wasmMaxTableSize'] = 1414; + +Module.asmGlobalArg = {}; + +Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "setTempRet0": setTempRet0, "getTempRet0": getTempRet0, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "_SDL_CloseAudio": _SDL_CloseAudio, "_SDL_GetTicks": _SDL_GetTicks, "_SDL_InitSubSystem": _SDL_InitSubSystem, "_SDL_LockSurface": _SDL_LockSurface, "_SDL_OpenAudio": _SDL_OpenAudio, "_SDL_PauseAudio": _SDL_PauseAudio, "_SDL_QuitSubSystem": _SDL_QuitSubSystem, "___assert_fail": ___assert_fail, "___lock": ___lock, "___setErrNo": ___setErrNo, "___syscall140": ___syscall140, "___syscall145": ___syscall145, "___syscall146": ___syscall146, "___syscall221": ___syscall221, "___syscall5": ___syscall5, "___syscall54": ___syscall54, "___syscall6": ___syscall6, "___unlock": ___unlock, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "__exit": __exit, "__get_canvas_element_size": __get_canvas_element_size, "__set_canvas_element_size": __set_canvas_element_size, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_emscripten_get_canvas_element_size": _emscripten_get_canvas_element_size, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_get_now": _emscripten_get_now, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_emscripten_glAccum": _emscripten_glAccum, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glAlphaFunc": _emscripten_glAlphaFunc, "_emscripten_glAreTexturesResident": _emscripten_glAreTexturesResident, "_emscripten_glArrayElement": _emscripten_glArrayElement, "_emscripten_glAttachObjectARB": _emscripten_glAttachObjectARB, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_emscripten_glBegin": _emscripten_glBegin, "_emscripten_glBeginConditionalRender": _emscripten_glBeginConditionalRender, "_emscripten_glBeginQuery": _emscripten_glBeginQuery, "_emscripten_glBeginTransformFeedback": _emscripten_glBeginTransformFeedback, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glBindBufferBase": _emscripten_glBindBufferBase, "_emscripten_glBindBufferRange": _emscripten_glBindBufferRange, "_emscripten_glBindFragDataLocation": _emscripten_glBindFragDataLocation, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glBitmap": _emscripten_glBitmap, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glBlitFramebuffer": _emscripten_glBlitFramebuffer, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glCallList": _emscripten_glCallList, "_emscripten_glCallLists": _emscripten_glCallLists, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glClampColor": _emscripten_glClampColor, "_emscripten_glClear": _emscripten_glClear, "_emscripten_glClearAccum": _emscripten_glClearAccum, "_emscripten_glClearBufferfi": _emscripten_glClearBufferfi, "_emscripten_glClearBufferfv": _emscripten_glClearBufferfv, "_emscripten_glClearBufferiv": _emscripten_glClearBufferiv, "_emscripten_glClearBufferuiv": _emscripten_glClearBufferuiv, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glClearDepth": _emscripten_glClearDepth, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glClearIndex": _emscripten_glClearIndex, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glClipPlane": _emscripten_glClipPlane, "_emscripten_glColor3b": _emscripten_glColor3b, "_emscripten_glColor3bv": _emscripten_glColor3bv, "_emscripten_glColor3d": _emscripten_glColor3d, "_emscripten_glColor3dv": _emscripten_glColor3dv, "_emscripten_glColor3f": _emscripten_glColor3f, "_emscripten_glColor3fv": _emscripten_glColor3fv, "_emscripten_glColor3i": _emscripten_glColor3i, "_emscripten_glColor3iv": _emscripten_glColor3iv, "_emscripten_glColor3s": _emscripten_glColor3s, "_emscripten_glColor3sv": _emscripten_glColor3sv, "_emscripten_glColor3ub": _emscripten_glColor3ub, "_emscripten_glColor3ubv": _emscripten_glColor3ubv, "_emscripten_glColor3ui": _emscripten_glColor3ui, "_emscripten_glColor3uiv": _emscripten_glColor3uiv, "_emscripten_glColor3us": _emscripten_glColor3us, "_emscripten_glColor3usv": _emscripten_glColor3usv, "_emscripten_glColor4b": _emscripten_glColor4b, "_emscripten_glColor4bv": _emscripten_glColor4bv, "_emscripten_glColor4d": _emscripten_glColor4d, "_emscripten_glColor4dv": _emscripten_glColor4dv, "_emscripten_glColor4f": _emscripten_glColor4f, "_emscripten_glColor4fv": _emscripten_glColor4fv, "_emscripten_glColor4i": _emscripten_glColor4i, "_emscripten_glColor4iv": _emscripten_glColor4iv, "_emscripten_glColor4s": _emscripten_glColor4s, "_emscripten_glColor4sv": _emscripten_glColor4sv, "_emscripten_glColor4ub": _emscripten_glColor4ub, "_emscripten_glColor4ubv": _emscripten_glColor4ubv, "_emscripten_glColor4ui": _emscripten_glColor4ui, "_emscripten_glColor4uiv": _emscripten_glColor4uiv, "_emscripten_glColor4us": _emscripten_glColor4us, "_emscripten_glColor4usv": _emscripten_glColor4usv, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glColorMaski": _emscripten_glColorMaski, "_emscripten_glColorMaterial": _emscripten_glColorMaterial, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_glColorSubTable": _emscripten_glColorSubTable, "_emscripten_glColorTable": _emscripten_glColorTable, "_emscripten_glColorTableParameterfv": _emscripten_glColorTableParameterfv, "_emscripten_glColorTableParameteriv": _emscripten_glColorTableParameteriv, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_emscripten_glCompressedTexImage1D": _emscripten_glCompressedTexImage1D, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glCompressedTexImage3D": _emscripten_glCompressedTexImage3D, "_emscripten_glCompressedTexSubImage1D": _emscripten_glCompressedTexSubImage1D, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "_emscripten_glCompressedTexSubImage3D": _emscripten_glCompressedTexSubImage3D, "_emscripten_glConvolutionFilter1D": _emscripten_glConvolutionFilter1D, "_emscripten_glConvolutionFilter2D": _emscripten_glConvolutionFilter2D, "_emscripten_glConvolutionParameterf": _emscripten_glConvolutionParameterf, "_emscripten_glConvolutionParameterfv": _emscripten_glConvolutionParameterfv, "_emscripten_glConvolutionParameteri": _emscripten_glConvolutionParameteri, "_emscripten_glConvolutionParameteriv": _emscripten_glConvolutionParameteriv, "_emscripten_glCopyColorSubTable": _emscripten_glCopyColorSubTable, "_emscripten_glCopyColorTable": _emscripten_glCopyColorTable, "_emscripten_glCopyConvolutionFilter1D": _emscripten_glCopyConvolutionFilter1D, "_emscripten_glCopyConvolutionFilter2D": _emscripten_glCopyConvolutionFilter2D, "_emscripten_glCopyPixels": _emscripten_glCopyPixels, "_emscripten_glCopyTexImage1D": _emscripten_glCopyTexImage1D, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glCopyTexSubImage1D": _emscripten_glCopyTexSubImage1D, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glCopyTexSubImage3D": _emscripten_glCopyTexSubImage3D, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCreateProgramObjectARB": _emscripten_glCreateProgramObjectARB, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glCreateShaderObjectARB": _emscripten_glCreateShaderObjectARB, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_emscripten_glDeleteLists": _emscripten_glDeleteLists, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteProgramsARB": _emscripten_glDeleteProgramsARB, "_emscripten_glDeleteQueries": _emscripten_glDeleteQueries, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "_emscripten_glDetachObjectARB": _emscripten_glDetachObjectARB, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDisableClientState": _emscripten_glDisableClientState, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_emscripten_glDisablei": _emscripten_glDisablei, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_glDrawBuffer": _emscripten_glDrawBuffer, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glDrawPixels": _emscripten_glDrawPixels, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_emscripten_glEdgeFlag": _emscripten_glEdgeFlag, "_emscripten_glEdgeFlagPointer": _emscripten_glEdgeFlagPointer, "_emscripten_glEdgeFlagv": _emscripten_glEdgeFlagv, "_emscripten_glEnable": _emscripten_glEnable, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glEnablei": _emscripten_glEnablei, "_emscripten_glEnd": _emscripten_glEnd, "_emscripten_glEndConditionalRender": _emscripten_glEndConditionalRender, "_emscripten_glEndList": _emscripten_glEndList, "_emscripten_glEndQuery": _emscripten_glEndQuery, "_emscripten_glEndTransformFeedback": _emscripten_glEndTransformFeedback, "_emscripten_glEvalCoord1d": _emscripten_glEvalCoord1d, "_emscripten_glEvalCoord1dv": _emscripten_glEvalCoord1dv, "_emscripten_glEvalCoord1f": _emscripten_glEvalCoord1f, "_emscripten_glEvalCoord1fv": _emscripten_glEvalCoord1fv, "_emscripten_glEvalCoord2d": _emscripten_glEvalCoord2d, "_emscripten_glEvalCoord2dv": _emscripten_glEvalCoord2dv, "_emscripten_glEvalCoord2f": _emscripten_glEvalCoord2f, "_emscripten_glEvalCoord2fv": _emscripten_glEvalCoord2fv, "_emscripten_glEvalMesh1": _emscripten_glEvalMesh1, "_emscripten_glEvalMesh2": _emscripten_glEvalMesh2, "_emscripten_glEvalPoint1": _emscripten_glEvalPoint1, "_emscripten_glEvalPoint2": _emscripten_glEvalPoint2, "_emscripten_glFeedbackBuffer": _emscripten_glFeedbackBuffer, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glFogCoordPointer": _emscripten_glFogCoordPointer, "_emscripten_glFogCoordd": _emscripten_glFogCoordd, "_emscripten_glFogCoorddv": _emscripten_glFogCoorddv, "_emscripten_glFogCoordf": _emscripten_glFogCoordf, "_emscripten_glFogCoordfv": _emscripten_glFogCoordfv, "_emscripten_glFogf": _emscripten_glFogf, "_emscripten_glFogfv": _emscripten_glFogfv, "_emscripten_glFogi": _emscripten_glFogi, "_emscripten_glFogiv": _emscripten_glFogiv, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "_emscripten_glFramebufferTexture1D": _emscripten_glFramebufferTexture1D, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glFramebufferTexture3D": _emscripten_glFramebufferTexture3D, "_emscripten_glFramebufferTextureLayer": _emscripten_glFramebufferTextureLayer, "_emscripten_glFrontFace": _emscripten_glFrontFace, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_emscripten_glGenLists": _emscripten_glGenLists, "_emscripten_glGenProgramsARB": _emscripten_glGenProgramsARB, "_emscripten_glGenQueries": _emscripten_glGenQueries, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_emscripten_glGetActiveUniformBlockName": _emscripten_glGetActiveUniformBlockName, "_emscripten_glGetActiveUniformBlockiv": _emscripten_glGetActiveUniformBlockiv, "_emscripten_glGetActiveUniformName": _emscripten_glGetActiveUniformName, "_emscripten_glGetActiveUniformsiv": _emscripten_glGetActiveUniformsiv, "_emscripten_glGetAttachedObjectsARB": _emscripten_glGetAttachedObjectsARB, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_glGetBooleani_v": _emscripten_glGetBooleani_v, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glGetBufferPointerv": _emscripten_glGetBufferPointerv, "_emscripten_glGetBufferSubData": _emscripten_glGetBufferSubData, "_emscripten_glGetClipPlane": _emscripten_glGetClipPlane, "_emscripten_glGetColorTable": _emscripten_glGetColorTable, "_emscripten_glGetColorTableParameterfv": _emscripten_glGetColorTableParameterfv, "_emscripten_glGetColorTableParameteriv": _emscripten_glGetColorTableParameteriv, "_emscripten_glGetCompressedTexImage": _emscripten_glGetCompressedTexImage, "_emscripten_glGetConvolutionFilter": _emscripten_glGetConvolutionFilter, "_emscripten_glGetConvolutionParameterfv": _emscripten_glGetConvolutionParameterfv, "_emscripten_glGetConvolutionParameteriv": _emscripten_glGetConvolutionParameteriv, "_emscripten_glGetDoublev": _emscripten_glGetDoublev, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glGetFragDataLocation": _emscripten_glGetFragDataLocation, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glGetHandleARB": _emscripten_glGetHandleARB, "_emscripten_glGetHistogram": _emscripten_glGetHistogram, "_emscripten_glGetHistogramParameterfv": _emscripten_glGetHistogramParameterfv, "_emscripten_glGetHistogramParameteriv": _emscripten_glGetHistogramParameteriv, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glGetIntegeri_v": _emscripten_glGetIntegeri_v, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glGetLightfv": _emscripten_glGetLightfv, "_emscripten_glGetLightiv": _emscripten_glGetLightiv, "_emscripten_glGetMapdv": _emscripten_glGetMapdv, "_emscripten_glGetMapfv": _emscripten_glGetMapfv, "_emscripten_glGetMapiv": _emscripten_glGetMapiv, "_emscripten_glGetMaterialfv": _emscripten_glGetMaterialfv, "_emscripten_glGetMaterialiv": _emscripten_glGetMaterialiv, "_emscripten_glGetMinmax": _emscripten_glGetMinmax, "_emscripten_glGetMinmaxParameterfv": _emscripten_glGetMinmaxParameterfv, "_emscripten_glGetMinmaxParameteriv": _emscripten_glGetMinmaxParameteriv, "_emscripten_glGetObjectParameterfvARB": _emscripten_glGetObjectParameterfvARB, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_glGetPixelMapfv": _emscripten_glGetPixelMapfv, "_emscripten_glGetPixelMapuiv": _emscripten_glGetPixelMapuiv, "_emscripten_glGetPixelMapusv": _emscripten_glGetPixelMapusv, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_glGetPolygonStipple": _emscripten_glGetPolygonStipple, "_emscripten_glGetProgramEnvParameterdvARB": _emscripten_glGetProgramEnvParameterdvARB, "_emscripten_glGetProgramEnvParameterfvARB": _emscripten_glGetProgramEnvParameterfvARB, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_emscripten_glGetProgramLocalParameterdvARB": _emscripten_glGetProgramLocalParameterdvARB, "_emscripten_glGetProgramLocalParameterfvARB": _emscripten_glGetProgramLocalParameterfvARB, "_emscripten_glGetProgramStringARB": _emscripten_glGetProgramStringARB, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glGetQueryObjectiv": _emscripten_glGetQueryObjectiv, "_emscripten_glGetQueryObjectuiv": _emscripten_glGetQueryObjectuiv, "_emscripten_glGetQueryiv": _emscripten_glGetQueryiv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glGetSeparableFilter": _emscripten_glGetSeparableFilter, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glGetStringi": _emscripten_glGetStringi, "_emscripten_glGetTexEnvfv": _emscripten_glGetTexEnvfv, "_emscripten_glGetTexEnviv": _emscripten_glGetTexEnviv, "_emscripten_glGetTexGendv": _emscripten_glGetTexGendv, "_emscripten_glGetTexGenfv": _emscripten_glGetTexGenfv, "_emscripten_glGetTexGeniv": _emscripten_glGetTexGeniv, "_emscripten_glGetTexImage": _emscripten_glGetTexImage, "_emscripten_glGetTexLevelParameterfv": _emscripten_glGetTexLevelParameterfv, "_emscripten_glGetTexLevelParameteriv": _emscripten_glGetTexLevelParameteriv, "_emscripten_glGetTexParameterIiv": _emscripten_glGetTexParameterIiv, "_emscripten_glGetTexParameterIuiv": _emscripten_glGetTexParameterIuiv, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "_emscripten_glGetTransformFeedbackVarying": _emscripten_glGetTransformFeedbackVarying, "_emscripten_glGetUniformBlockIndex": _emscripten_glGetUniformBlockIndex, "_emscripten_glGetUniformIndices": _emscripten_glGetUniformIndices, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_emscripten_glGetUniformuiv": _emscripten_glGetUniformuiv, "_emscripten_glGetVertexAttribIiv": _emscripten_glGetVertexAttribIiv, "_emscripten_glGetVertexAttribIuiv": _emscripten_glGetVertexAttribIuiv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_emscripten_glGetVertexAttribdv": _emscripten_glGetVertexAttribdv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glHistogram": _emscripten_glHistogram, "_emscripten_glIndexMask": _emscripten_glIndexMask, "_emscripten_glIndexPointer": _emscripten_glIndexPointer, "_emscripten_glIndexd": _emscripten_glIndexd, "_emscripten_glIndexdv": _emscripten_glIndexdv, "_emscripten_glIndexf": _emscripten_glIndexf, "_emscripten_glIndexfv": _emscripten_glIndexfv, "_emscripten_glIndexi": _emscripten_glIndexi, "_emscripten_glIndexiv": _emscripten_glIndexiv, "_emscripten_glIndexs": _emscripten_glIndexs, "_emscripten_glIndexsv": _emscripten_glIndexsv, "_emscripten_glIndexub": _emscripten_glIndexub, "_emscripten_glIndexubv": _emscripten_glIndexubv, "_emscripten_glInitNames": _emscripten_glInitNames, "_emscripten_glInterleavedArrays": _emscripten_glInterleavedArrays, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glIsEnabledi": _emscripten_glIsEnabledi, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsList": _emscripten_glIsList, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glIsQuery": _emscripten_glIsQuery, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glIsVertexArray": _emscripten_glIsVertexArray, "_emscripten_glLightModelf": _emscripten_glLightModelf, "_emscripten_glLightModelfv": _emscripten_glLightModelfv, "_emscripten_glLightModeli": _emscripten_glLightModeli, "_emscripten_glLightModeliv": _emscripten_glLightModeliv, "_emscripten_glLightf": _emscripten_glLightf, "_emscripten_glLightfv": _emscripten_glLightfv, "_emscripten_glLighti": _emscripten_glLighti, "_emscripten_glLightiv": _emscripten_glLightiv, "_emscripten_glLineStipple": _emscripten_glLineStipple, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glListBase": _emscripten_glListBase, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_emscripten_glLoadMatrixd": _emscripten_glLoadMatrixd, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glLoadName": _emscripten_glLoadName, "_emscripten_glLoadTransposeMatrixd": _emscripten_glLoadTransposeMatrixd, "_emscripten_glLoadTransposeMatrixf": _emscripten_glLoadTransposeMatrixf, "_emscripten_glLogicOp": _emscripten_glLogicOp, "_emscripten_glMap1d": _emscripten_glMap1d, "_emscripten_glMap1f": _emscripten_glMap1f, "_emscripten_glMap2d": _emscripten_glMap2d, "_emscripten_glMap2f": _emscripten_glMap2f, "_emscripten_glMapBuffer": _emscripten_glMapBuffer, "_emscripten_glMapGrid1d": _emscripten_glMapGrid1d, "_emscripten_glMapGrid1f": _emscripten_glMapGrid1f, "_emscripten_glMapGrid2d": _emscripten_glMapGrid2d, "_emscripten_glMapGrid2f": _emscripten_glMapGrid2f, "_emscripten_glMaterialf": _emscripten_glMaterialf, "_emscripten_glMaterialfv": _emscripten_glMaterialfv, "_emscripten_glMateriali": _emscripten_glMateriali, "_emscripten_glMaterialiv": _emscripten_glMaterialiv, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_emscripten_glMinmax": _emscripten_glMinmax, "_emscripten_glMultMatrixd": _emscripten_glMultMatrixd, "_emscripten_glMultMatrixf": _emscripten_glMultMatrixf, "_emscripten_glMultTransposeMatrixd": _emscripten_glMultTransposeMatrixd, "_emscripten_glMultTransposeMatrixf": _emscripten_glMultTransposeMatrixf, "_emscripten_glMultiDrawArrays": _emscripten_glMultiDrawArrays, "_emscripten_glMultiDrawElements": _emscripten_glMultiDrawElements, "_emscripten_glMultiTexCoord1d": _emscripten_glMultiTexCoord1d, "_emscripten_glMultiTexCoord1dv": _emscripten_glMultiTexCoord1dv, "_emscripten_glMultiTexCoord1f": _emscripten_glMultiTexCoord1f, "_emscripten_glMultiTexCoord1fv": _emscripten_glMultiTexCoord1fv, "_emscripten_glMultiTexCoord1i": _emscripten_glMultiTexCoord1i, "_emscripten_glMultiTexCoord1iv": _emscripten_glMultiTexCoord1iv, "_emscripten_glMultiTexCoord1s": _emscripten_glMultiTexCoord1s, "_emscripten_glMultiTexCoord1sv": _emscripten_glMultiTexCoord1sv, "_emscripten_glMultiTexCoord2d": _emscripten_glMultiTexCoord2d, "_emscripten_glMultiTexCoord2dv": _emscripten_glMultiTexCoord2dv, "_emscripten_glMultiTexCoord2f": _emscripten_glMultiTexCoord2f, "_emscripten_glMultiTexCoord2fv": _emscripten_glMultiTexCoord2fv, "_emscripten_glMultiTexCoord2i": _emscripten_glMultiTexCoord2i, "_emscripten_glMultiTexCoord2iv": _emscripten_glMultiTexCoord2iv, "_emscripten_glMultiTexCoord2s": _emscripten_glMultiTexCoord2s, "_emscripten_glMultiTexCoord2sv": _emscripten_glMultiTexCoord2sv, "_emscripten_glMultiTexCoord3d": _emscripten_glMultiTexCoord3d, "_emscripten_glMultiTexCoord3dv": _emscripten_glMultiTexCoord3dv, "_emscripten_glMultiTexCoord3f": _emscripten_glMultiTexCoord3f, "_emscripten_glMultiTexCoord3fv": _emscripten_glMultiTexCoord3fv, "_emscripten_glMultiTexCoord3i": _emscripten_glMultiTexCoord3i, "_emscripten_glMultiTexCoord3iv": _emscripten_glMultiTexCoord3iv, "_emscripten_glMultiTexCoord3s": _emscripten_glMultiTexCoord3s, "_emscripten_glMultiTexCoord3sv": _emscripten_glMultiTexCoord3sv, "_emscripten_glMultiTexCoord4d": _emscripten_glMultiTexCoord4d, "_emscripten_glMultiTexCoord4dv": _emscripten_glMultiTexCoord4dv, "_emscripten_glMultiTexCoord4f": _emscripten_glMultiTexCoord4f, "_emscripten_glMultiTexCoord4fv": _emscripten_glMultiTexCoord4fv, "_emscripten_glMultiTexCoord4i": _emscripten_glMultiTexCoord4i, "_emscripten_glMultiTexCoord4iv": _emscripten_glMultiTexCoord4iv, "_emscripten_glMultiTexCoord4s": _emscripten_glMultiTexCoord4s, "_emscripten_glMultiTexCoord4sv": _emscripten_glMultiTexCoord4sv, "_emscripten_glNewList": _emscripten_glNewList, "_emscripten_glNormal3b": _emscripten_glNormal3b, "_emscripten_glNormal3bv": _emscripten_glNormal3bv, "_emscripten_glNormal3d": _emscripten_glNormal3d, "_emscripten_glNormal3dv": _emscripten_glNormal3dv, "_emscripten_glNormal3f": _emscripten_glNormal3f, "_emscripten_glNormal3fv": _emscripten_glNormal3fv, "_emscripten_glNormal3i": _emscripten_glNormal3i, "_emscripten_glNormal3iv": _emscripten_glNormal3iv, "_emscripten_glNormal3s": _emscripten_glNormal3s, "_emscripten_glNormal3sv": _emscripten_glNormal3sv, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_emscripten_glOrtho": _emscripten_glOrtho, "_emscripten_glPassThrough": _emscripten_glPassThrough, "_emscripten_glPixelMapfv": _emscripten_glPixelMapfv, "_emscripten_glPixelMapuiv": _emscripten_glPixelMapuiv, "_emscripten_glPixelMapusv": _emscripten_glPixelMapusv, "_emscripten_glPixelStoref": _emscripten_glPixelStoref, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_emscripten_glPixelTransferf": _emscripten_glPixelTransferf, "_emscripten_glPixelTransferi": _emscripten_glPixelTransferi, "_emscripten_glPixelZoom": _emscripten_glPixelZoom, "_emscripten_glPointParameterf": _emscripten_glPointParameterf, "_emscripten_glPointParameterfv": _emscripten_glPointParameterfv, "_emscripten_glPointParameteri": _emscripten_glPointParameteri, "_emscripten_glPointParameteriv": _emscripten_glPointParameteriv, "_emscripten_glPointSize": _emscripten_glPointSize, "_emscripten_glPolygonMode": _emscripten_glPolygonMode, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glPolygonStipple": _emscripten_glPolygonStipple, "_emscripten_glPopAttrib": _emscripten_glPopAttrib, "_emscripten_glPopClientAttrib": _emscripten_glPopClientAttrib, "_emscripten_glPopMatrix": _emscripten_glPopMatrix, "_emscripten_glPopName": _emscripten_glPopName, "_emscripten_glPrimitiveRestartIndex": _emscripten_glPrimitiveRestartIndex, "_emscripten_glPrioritizeTextures": _emscripten_glPrioritizeTextures, "_emscripten_glProgramEnvParameter4dARB": _emscripten_glProgramEnvParameter4dARB, "_emscripten_glProgramEnvParameter4dvARB": _emscripten_glProgramEnvParameter4dvARB, "_emscripten_glProgramEnvParameter4fARB": _emscripten_glProgramEnvParameter4fARB, "_emscripten_glProgramEnvParameter4fvARB": _emscripten_glProgramEnvParameter4fvARB, "_emscripten_glProgramLocalParameter4dARB": _emscripten_glProgramLocalParameter4dARB, "_emscripten_glProgramLocalParameter4dvARB": _emscripten_glProgramLocalParameter4dvARB, "_emscripten_glProgramLocalParameter4fARB": _emscripten_glProgramLocalParameter4fARB, "_emscripten_glProgramLocalParameter4fvARB": _emscripten_glProgramLocalParameter4fvARB, "_emscripten_glProgramStringARB": _emscripten_glProgramStringARB, "_emscripten_glPushAttrib": _emscripten_glPushAttrib, "_emscripten_glPushClientAttrib": _emscripten_glPushClientAttrib, "_emscripten_glPushMatrix": _emscripten_glPushMatrix, "_emscripten_glPushName": _emscripten_glPushName, "_emscripten_glRasterPos2d": _emscripten_glRasterPos2d, "_emscripten_glRasterPos2dv": _emscripten_glRasterPos2dv, "_emscripten_glRasterPos2f": _emscripten_glRasterPos2f, "_emscripten_glRasterPos2fv": _emscripten_glRasterPos2fv, "_emscripten_glRasterPos2i": _emscripten_glRasterPos2i, "_emscripten_glRasterPos2iv": _emscripten_glRasterPos2iv, "_emscripten_glRasterPos2s": _emscripten_glRasterPos2s, "_emscripten_glRasterPos2sv": _emscripten_glRasterPos2sv, "_emscripten_glRasterPos3d": _emscripten_glRasterPos3d, "_emscripten_glRasterPos3dv": _emscripten_glRasterPos3dv, "_emscripten_glRasterPos3f": _emscripten_glRasterPos3f, "_emscripten_glRasterPos3fv": _emscripten_glRasterPos3fv, "_emscripten_glRasterPos3i": _emscripten_glRasterPos3i, "_emscripten_glRasterPos3iv": _emscripten_glRasterPos3iv, "_emscripten_glRasterPos3s": _emscripten_glRasterPos3s, "_emscripten_glRasterPos3sv": _emscripten_glRasterPos3sv, "_emscripten_glRasterPos4d": _emscripten_glRasterPos4d, "_emscripten_glRasterPos4dv": _emscripten_glRasterPos4dv, "_emscripten_glRasterPos4f": _emscripten_glRasterPos4f, "_emscripten_glRasterPos4fv": _emscripten_glRasterPos4fv, "_emscripten_glRasterPos4i": _emscripten_glRasterPos4i, "_emscripten_glRasterPos4iv": _emscripten_glRasterPos4iv, "_emscripten_glRasterPos4s": _emscripten_glRasterPos4s, "_emscripten_glRasterPos4sv": _emscripten_glRasterPos4sv, "_emscripten_glReadBuffer": _emscripten_glReadBuffer, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glRectd": _emscripten_glRectd, "_emscripten_glRectdv": _emscripten_glRectdv, "_emscripten_glRectf": _emscripten_glRectf, "_emscripten_glRectfv": _emscripten_glRectfv, "_emscripten_glRecti": _emscripten_glRecti, "_emscripten_glRectiv": _emscripten_glRectiv, "_emscripten_glRects": _emscripten_glRects, "_emscripten_glRectsv": _emscripten_glRectsv, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glRenderMode": _emscripten_glRenderMode, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_glRenderbufferStorageMultisample": _emscripten_glRenderbufferStorageMultisample, "_emscripten_glResetHistogram": _emscripten_glResetHistogram, "_emscripten_glResetMinmax": _emscripten_glResetMinmax, "_emscripten_glRotated": _emscripten_glRotated, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glScaled": _emscripten_glScaled, "_emscripten_glScalef": _emscripten_glScalef, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glSecondaryColor3b": _emscripten_glSecondaryColor3b, "_emscripten_glSecondaryColor3bv": _emscripten_glSecondaryColor3bv, "_emscripten_glSecondaryColor3d": _emscripten_glSecondaryColor3d, "_emscripten_glSecondaryColor3dv": _emscripten_glSecondaryColor3dv, "_emscripten_glSecondaryColor3f": _emscripten_glSecondaryColor3f, "_emscripten_glSecondaryColor3fv": _emscripten_glSecondaryColor3fv, "_emscripten_glSecondaryColor3i": _emscripten_glSecondaryColor3i, "_emscripten_glSecondaryColor3iv": _emscripten_glSecondaryColor3iv, "_emscripten_glSecondaryColor3s": _emscripten_glSecondaryColor3s, "_emscripten_glSecondaryColor3sv": _emscripten_glSecondaryColor3sv, "_emscripten_glSecondaryColor3ub": _emscripten_glSecondaryColor3ub, "_emscripten_glSecondaryColor3ubv": _emscripten_glSecondaryColor3ubv, "_emscripten_glSecondaryColor3ui": _emscripten_glSecondaryColor3ui, "_emscripten_glSecondaryColor3uiv": _emscripten_glSecondaryColor3uiv, "_emscripten_glSecondaryColor3us": _emscripten_glSecondaryColor3us, "_emscripten_glSecondaryColor3usv": _emscripten_glSecondaryColor3usv, "_emscripten_glSecondaryColorPointer": _emscripten_glSecondaryColorPointer, "_emscripten_glSelectBuffer": _emscripten_glSelectBuffer, "_emscripten_glSeparableFilter2D": _emscripten_glSeparableFilter2D, "_emscripten_glShadeModel": _emscripten_glShadeModel, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glTexBuffer": _emscripten_glTexBuffer, "_emscripten_glTexCoord1d": _emscripten_glTexCoord1d, "_emscripten_glTexCoord1dv": _emscripten_glTexCoord1dv, "_emscripten_glTexCoord1f": _emscripten_glTexCoord1f, "_emscripten_glTexCoord1fv": _emscripten_glTexCoord1fv, "_emscripten_glTexCoord1i": _emscripten_glTexCoord1i, "_emscripten_glTexCoord1iv": _emscripten_glTexCoord1iv, "_emscripten_glTexCoord1s": _emscripten_glTexCoord1s, "_emscripten_glTexCoord1sv": _emscripten_glTexCoord1sv, "_emscripten_glTexCoord2d": _emscripten_glTexCoord2d, "_emscripten_glTexCoord2dv": _emscripten_glTexCoord2dv, "_emscripten_glTexCoord2f": _emscripten_glTexCoord2f, "_emscripten_glTexCoord2fv": _emscripten_glTexCoord2fv, "_emscripten_glTexCoord2i": _emscripten_glTexCoord2i, "_emscripten_glTexCoord2iv": _emscripten_glTexCoord2iv, "_emscripten_glTexCoord2s": _emscripten_glTexCoord2s, "_emscripten_glTexCoord2sv": _emscripten_glTexCoord2sv, "_emscripten_glTexCoord3d": _emscripten_glTexCoord3d, "_emscripten_glTexCoord3dv": _emscripten_glTexCoord3dv, "_emscripten_glTexCoord3f": _emscripten_glTexCoord3f, "_emscripten_glTexCoord3fv": _emscripten_glTexCoord3fv, "_emscripten_glTexCoord3i": _emscripten_glTexCoord3i, "_emscripten_glTexCoord3iv": _emscripten_glTexCoord3iv, "_emscripten_glTexCoord3s": _emscripten_glTexCoord3s, "_emscripten_glTexCoord3sv": _emscripten_glTexCoord3sv, "_emscripten_glTexCoord4d": _emscripten_glTexCoord4d, "_emscripten_glTexCoord4dv": _emscripten_glTexCoord4dv, "_emscripten_glTexCoord4f": _emscripten_glTexCoord4f, "_emscripten_glTexCoord4fv": _emscripten_glTexCoord4fv, "_emscripten_glTexCoord4i": _emscripten_glTexCoord4i, "_emscripten_glTexCoord4iv": _emscripten_glTexCoord4iv, "_emscripten_glTexCoord4s": _emscripten_glTexCoord4s, "_emscripten_glTexCoord4sv": _emscripten_glTexCoord4sv, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glTexEnvf": _emscripten_glTexEnvf, "_emscripten_glTexEnvfv": _emscripten_glTexEnvfv, "_emscripten_glTexEnvi": _emscripten_glTexEnvi, "_emscripten_glTexEnviv": _emscripten_glTexEnviv, "_emscripten_glTexGend": _emscripten_glTexGend, "_emscripten_glTexGendv": _emscripten_glTexGendv, "_emscripten_glTexGenf": _emscripten_glTexGenf, "_emscripten_glTexGenfv": _emscripten_glTexGenfv, "_emscripten_glTexGeni": _emscripten_glTexGeni, "_emscripten_glTexGeniv": _emscripten_glTexGeniv, "_emscripten_glTexImage1D": _emscripten_glTexImage1D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "_emscripten_glTexImage3D": _emscripten_glTexImage3D, "_emscripten_glTexParameterIiv": _emscripten_glTexParameterIiv, "_emscripten_glTexParameterIuiv": _emscripten_glTexParameterIuiv, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_emscripten_glTexStorage2D": _emscripten_glTexStorage2D, "_emscripten_glTexStorage3D": _emscripten_glTexStorage3D, "_emscripten_glTexSubImage1D": _emscripten_glTexSubImage1D, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_glTexSubImage3D": _emscripten_glTexSubImage3D, "_emscripten_glTransformFeedbackVaryings": _emscripten_glTransformFeedbackVaryings, "_emscripten_glTranslated": _emscripten_glTranslated, "_emscripten_glTranslatef": _emscripten_glTranslatef, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glUniform1ui": _emscripten_glUniform1ui, "_emscripten_glUniform1uiv": _emscripten_glUniform1uiv, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glUniform2ui": _emscripten_glUniform2ui, "_emscripten_glUniform2uiv": _emscripten_glUniform2uiv, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform3ui": _emscripten_glUniform3ui, "_emscripten_glUniform3uiv": _emscripten_glUniform3uiv, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glUniform4ui": _emscripten_glUniform4ui, "_emscripten_glUniform4uiv": _emscripten_glUniform4uiv, "_emscripten_glUniformBlockBinding": _emscripten_glUniformBlockBinding, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_emscripten_glUniformMatrix2x3fv": _emscripten_glUniformMatrix2x3fv, "_emscripten_glUniformMatrix2x4fv": _emscripten_glUniformMatrix2x4fv, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glUniformMatrix3x2fv": _emscripten_glUniformMatrix3x2fv, "_emscripten_glUniformMatrix3x4fv": _emscripten_glUniformMatrix3x4fv, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glUniformMatrix4x2fv": _emscripten_glUniformMatrix4x2fv, "_emscripten_glUniformMatrix4x3fv": _emscripten_glUniformMatrix4x3fv, "_emscripten_glUnmapBuffer": _emscripten_glUnmapBuffer, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glUseProgramObjectARB": _emscripten_glUseProgramObjectARB, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertex2d": _emscripten_glVertex2d, "_emscripten_glVertex2dv": _emscripten_glVertex2dv, "_emscripten_glVertex2f": _emscripten_glVertex2f, "_emscripten_glVertex2fv": _emscripten_glVertex2fv, "_emscripten_glVertex2i": _emscripten_glVertex2i, "_emscripten_glVertex2iv": _emscripten_glVertex2iv, "_emscripten_glVertex2s": _emscripten_glVertex2s, "_emscripten_glVertex2sv": _emscripten_glVertex2sv, "_emscripten_glVertex3d": _emscripten_glVertex3d, "_emscripten_glVertex3dv": _emscripten_glVertex3dv, "_emscripten_glVertex3f": _emscripten_glVertex3f, "_emscripten_glVertex3fv": _emscripten_glVertex3fv, "_emscripten_glVertex3i": _emscripten_glVertex3i, "_emscripten_glVertex3iv": _emscripten_glVertex3iv, "_emscripten_glVertex3s": _emscripten_glVertex3s, "_emscripten_glVertex3sv": _emscripten_glVertex3sv, "_emscripten_glVertex4d": _emscripten_glVertex4d, "_emscripten_glVertex4dv": _emscripten_glVertex4dv, "_emscripten_glVertex4f": _emscripten_glVertex4f, "_emscripten_glVertex4fv": _emscripten_glVertex4fv, "_emscripten_glVertex4i": _emscripten_glVertex4i, "_emscripten_glVertex4iv": _emscripten_glVertex4iv, "_emscripten_glVertex4s": _emscripten_glVertex4s, "_emscripten_glVertex4sv": _emscripten_glVertex4sv, "_emscripten_glVertexAttrib1d": _emscripten_glVertexAttrib1d, "_emscripten_glVertexAttrib1dv": _emscripten_glVertexAttrib1dv, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glVertexAttrib1s": _emscripten_glVertexAttrib1s, "_emscripten_glVertexAttrib1sv": _emscripten_glVertexAttrib1sv, "_emscripten_glVertexAttrib2d": _emscripten_glVertexAttrib2d, "_emscripten_glVertexAttrib2dv": _emscripten_glVertexAttrib2dv, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_emscripten_glVertexAttrib2s": _emscripten_glVertexAttrib2s, "_emscripten_glVertexAttrib2sv": _emscripten_glVertexAttrib2sv, "_emscripten_glVertexAttrib3d": _emscripten_glVertexAttrib3d, "_emscripten_glVertexAttrib3dv": _emscripten_glVertexAttrib3dv, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_emscripten_glVertexAttrib3s": _emscripten_glVertexAttrib3s, "_emscripten_glVertexAttrib3sv": _emscripten_glVertexAttrib3sv, "_emscripten_glVertexAttrib4Nbv": _emscripten_glVertexAttrib4Nbv, "_emscripten_glVertexAttrib4Niv": _emscripten_glVertexAttrib4Niv, "_emscripten_glVertexAttrib4Nsv": _emscripten_glVertexAttrib4Nsv, "_emscripten_glVertexAttrib4Nub": _emscripten_glVertexAttrib4Nub, "_emscripten_glVertexAttrib4Nubv": _emscripten_glVertexAttrib4Nubv, "_emscripten_glVertexAttrib4Nuiv": _emscripten_glVertexAttrib4Nuiv, "_emscripten_glVertexAttrib4Nusv": _emscripten_glVertexAttrib4Nusv, "_emscripten_glVertexAttrib4bv": _emscripten_glVertexAttrib4bv, "_emscripten_glVertexAttrib4d": _emscripten_glVertexAttrib4d, "_emscripten_glVertexAttrib4dv": _emscripten_glVertexAttrib4dv, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glVertexAttrib4iv": _emscripten_glVertexAttrib4iv, "_emscripten_glVertexAttrib4s": _emscripten_glVertexAttrib4s, "_emscripten_glVertexAttrib4sv": _emscripten_glVertexAttrib4sv, "_emscripten_glVertexAttrib4ubv": _emscripten_glVertexAttrib4ubv, "_emscripten_glVertexAttrib4uiv": _emscripten_glVertexAttrib4uiv, "_emscripten_glVertexAttrib4usv": _emscripten_glVertexAttrib4usv, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_glVertexAttribI1i": _emscripten_glVertexAttribI1i, "_emscripten_glVertexAttribI1iv": _emscripten_glVertexAttribI1iv, "_emscripten_glVertexAttribI1ui": _emscripten_glVertexAttribI1ui, "_emscripten_glVertexAttribI1uiv": _emscripten_glVertexAttribI1uiv, "_emscripten_glVertexAttribI2i": _emscripten_glVertexAttribI2i, "_emscripten_glVertexAttribI2iv": _emscripten_glVertexAttribI2iv, "_emscripten_glVertexAttribI2ui": _emscripten_glVertexAttribI2ui, "_emscripten_glVertexAttribI2uiv": _emscripten_glVertexAttribI2uiv, "_emscripten_glVertexAttribI3i": _emscripten_glVertexAttribI3i, "_emscripten_glVertexAttribI3iv": _emscripten_glVertexAttribI3iv, "_emscripten_glVertexAttribI3ui": _emscripten_glVertexAttribI3ui, "_emscripten_glVertexAttribI3uiv": _emscripten_glVertexAttribI3uiv, "_emscripten_glVertexAttribI4bv": _emscripten_glVertexAttribI4bv, "_emscripten_glVertexAttribI4i": _emscripten_glVertexAttribI4i, "_emscripten_glVertexAttribI4iv": _emscripten_glVertexAttribI4iv, "_emscripten_glVertexAttribI4sv": _emscripten_glVertexAttribI4sv, "_emscripten_glVertexAttribI4ubv": _emscripten_glVertexAttribI4ubv, "_emscripten_glVertexAttribI4ui": _emscripten_glVertexAttribI4ui, "_emscripten_glVertexAttribI4uiv": _emscripten_glVertexAttribI4uiv, "_emscripten_glVertexAttribI4usv": _emscripten_glVertexAttribI4usv, "_emscripten_glVertexAttribIPointer": _emscripten_glVertexAttribIPointer, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glWindowPos2d": _emscripten_glWindowPos2d, "_emscripten_glWindowPos2dv": _emscripten_glWindowPos2dv, "_emscripten_glWindowPos2f": _emscripten_glWindowPos2f, "_emscripten_glWindowPos2fv": _emscripten_glWindowPos2fv, "_emscripten_glWindowPos2i": _emscripten_glWindowPos2i, "_emscripten_glWindowPos2iv": _emscripten_glWindowPos2iv, "_emscripten_glWindowPos2s": _emscripten_glWindowPos2s, "_emscripten_glWindowPos2sv": _emscripten_glWindowPos2sv, "_emscripten_glWindowPos3d": _emscripten_glWindowPos3d, "_emscripten_glWindowPos3dv": _emscripten_glWindowPos3dv, "_emscripten_glWindowPos3f": _emscripten_glWindowPos3f, "_emscripten_glWindowPos3fv": _emscripten_glWindowPos3fv, "_emscripten_glWindowPos3i": _emscripten_glWindowPos3i, "_emscripten_glWindowPos3iv": _emscripten_glWindowPos3iv, "_emscripten_glWindowPos3s": _emscripten_glWindowPos3s, "_emscripten_glWindowPos3sv": _emscripten_glWindowPos3sv, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size, "_emscripten_set_click_callback_on_thread": _emscripten_set_click_callback_on_thread, "_emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread, "_emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread, "_emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread, "_emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread, "_emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread, "_emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread, "_emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread, "_exit": _exit, "_glActiveTexture": _glActiveTexture, "_glAttachShader": _glAttachShader, "_glBindAttribLocation": _glBindAttribLocation, "_glBindBuffer": _glBindBuffer, "_glBindTexture": _glBindTexture, "_glBlendFunc": _glBlendFunc, "_glBufferData": _glBufferData, "_glBufferSubData": _glBufferSubData, "_glClear": _glClear, "_glClearColor": _glClearColor, "_glClearDepthf": _glClearDepthf, "_glCompileShader": _glCompileShader, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_glCreateProgram": _glCreateProgram, "_glCreateShader": _glCreateShader, "_glCullFace": _glCullFace, "_glDeleteBuffers": _glDeleteBuffers, "_glDeleteProgram": _glDeleteProgram, "_glDeleteShader": _glDeleteShader, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_glDetachShader": _glDetachShader, "_glDisable": _glDisable, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glDrawArrays": _glDrawArrays, "_glDrawElements": _glDrawElements, "_glEnable": _glEnable, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_glFrontFace": _glFrontFace, "_glGenBuffers": _glGenBuffers, "_glGenTextures": _glGenTextures, "_glGetAttribLocation": _glGetAttribLocation, "_glGetFloatv": _glGetFloatv, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glGetProgramiv": _glGetProgramiv, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_glGetShaderiv": _glGetShaderiv, "_glGetString": _glGetString, "_glGetUniformLocation": _glGetUniformLocation, "_glLinkProgram": _glLinkProgram, "_glPixelStorei": _glPixelStorei, "_glShaderSource": _glShaderSource, "_glTexImage2D": _glTexImage2D, "_glTexParameteri": _glTexParameteri, "_glUniform1i": _glUniform1i, "_glUniform4f": _glUniform4f, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_glUseProgram": _glUseProgram, "_glVertexAttribPointer": _glVertexAttribPointer, "_glViewport": _glViewport, "_glfwCreateWindow": _glfwCreateWindow, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "_glfwGetCursorPos": _glfwGetCursorPos, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glfwGetTime": _glfwGetTime, "_glfwGetVideoModes": _glfwGetVideoModes, "_glfwInit": _glfwInit, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_glfwSetCharCallback": _glfwSetCharCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_glfwSwapBuffers": _glfwSwapBuffers, "_glfwSwapInterval": _glfwSwapInterval, "_glfwTerminate": _glfwTerminate, "_glfwWindowHint": _glfwWindowHint, "_llvm_exp2_f32": _llvm_exp2_f32, "_llvm_stackrestore": _llvm_stackrestore, "_llvm_stacksave": _llvm_stacksave, "_pthread_attr_destroy": _pthread_attr_destroy, "_pthread_attr_init": _pthread_attr_init, "_pthread_cond_destroy": _pthread_cond_destroy, "_pthread_cond_init": _pthread_cond_init, "_pthread_cond_signal": _pthread_cond_signal, "_pthread_cond_wait": _pthread_cond_wait, "_pthread_create": _pthread_create, "_pthread_join": _pthread_join, "_pthread_mutex_destroy": _pthread_mutex_destroy, "_pthread_mutex_init": _pthread_mutex_init, "_time": _time, "_usleep": _usleep, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "emscriptenWebGLGet": emscriptenWebGLGet, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX }; +// EMSCRIPTEN_START_ASM +var asm =Module["asm"]// EMSCRIPTEN_END_ASM +(Module.asmGlobalArg, Module.asmLibraryArg, buffer); + +Module["asm"] = asm; +var ___errno_location = Module["___errno_location"] = function() { return Module["asm"]["___errno_location"].apply(null, arguments) }; +var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = function() { return Module["asm"]["_emscripten_GetProcAddress"].apply(null, arguments) }; +var _free = Module["_free"] = function() { return Module["asm"]["_free"].apply(null, arguments) }; +var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = function() { return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments) }; +var _llvm_round_f32 = Module["_llvm_round_f32"] = function() { return Module["asm"]["_llvm_round_f32"].apply(null, arguments) }; +var _main = Module["_main"] = function() { return Module["asm"]["_main"].apply(null, arguments) }; +var _malloc = Module["_malloc"] = function() { return Module["asm"]["_malloc"].apply(null, arguments) }; +var _memcpy = Module["_memcpy"] = function() { return Module["asm"]["_memcpy"].apply(null, arguments) }; +var _memmove = Module["_memmove"] = function() { return Module["asm"]["_memmove"].apply(null, arguments) }; +var _memset = Module["_memset"] = function() { return Module["asm"]["_memset"].apply(null, arguments) }; +var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = function() { return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments) }; +var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = function() { return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments) }; +var _sbrk = Module["_sbrk"] = function() { return Module["asm"]["_sbrk"].apply(null, arguments) }; +var _strstr = Module["_strstr"] = function() { return Module["asm"]["_strstr"].apply(null, arguments) }; +var establishStackSpace = Module["establishStackSpace"] = function() { return Module["asm"]["establishStackSpace"].apply(null, arguments) }; +var runPostSets = Module["runPostSets"] = function() { return Module["asm"]["runPostSets"].apply(null, arguments) }; +var setThrew = Module["setThrew"] = function() { return Module["asm"]["setThrew"].apply(null, arguments) }; +var stackAlloc = Module["stackAlloc"] = function() { return Module["asm"]["stackAlloc"].apply(null, arguments) }; +var stackRestore = Module["stackRestore"] = function() { return Module["asm"]["stackRestore"].apply(null, arguments) }; +var stackSave = Module["stackSave"] = function() { return Module["asm"]["stackSave"].apply(null, arguments) }; +var dynCall_ff = Module["dynCall_ff"] = function() { return Module["asm"]["dynCall_ff"].apply(null, arguments) }; +var dynCall_fff = Module["dynCall_fff"] = function() { return Module["asm"]["dynCall_fff"].apply(null, arguments) }; +var dynCall_i = Module["dynCall_i"] = function() { return Module["asm"]["dynCall_i"].apply(null, arguments) }; +var dynCall_ii = Module["dynCall_ii"] = function() { return Module["asm"]["dynCall_ii"].apply(null, arguments) }; +var dynCall_iii = Module["dynCall_iii"] = function() { return Module["asm"]["dynCall_iii"].apply(null, arguments) }; +var dynCall_iiii = Module["dynCall_iiii"] = function() { return Module["asm"]["dynCall_iiii"].apply(null, arguments) }; +var dynCall_iiiii = Module["dynCall_iiiii"] = function() { return Module["asm"]["dynCall_iiiii"].apply(null, arguments) }; +var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() { return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) }; +var dynCall_jijii = Module["dynCall_jijii"] = function() { return Module["asm"]["dynCall_jijii"].apply(null, arguments) }; +var dynCall_v = Module["dynCall_v"] = function() { return Module["asm"]["dynCall_v"].apply(null, arguments) }; +var dynCall_vd = Module["dynCall_vd"] = function() { return Module["asm"]["dynCall_vd"].apply(null, arguments) }; +var dynCall_vdd = Module["dynCall_vdd"] = function() { return Module["asm"]["dynCall_vdd"].apply(null, arguments) }; +var dynCall_vddd = Module["dynCall_vddd"] = function() { return Module["asm"]["dynCall_vddd"].apply(null, arguments) }; +var dynCall_vdddd = Module["dynCall_vdddd"] = function() { return Module["asm"]["dynCall_vdddd"].apply(null, arguments) }; +var dynCall_vdddddd = Module["dynCall_vdddddd"] = function() { return Module["asm"]["dynCall_vdddddd"].apply(null, arguments) }; +var dynCall_vf = Module["dynCall_vf"] = function() { return Module["asm"]["dynCall_vf"].apply(null, arguments) }; +var dynCall_vff = Module["dynCall_vff"] = function() { return Module["asm"]["dynCall_vff"].apply(null, arguments) }; +var dynCall_vfff = Module["dynCall_vfff"] = function() { return Module["asm"]["dynCall_vfff"].apply(null, arguments) }; +var dynCall_vffff = Module["dynCall_vffff"] = function() { return Module["asm"]["dynCall_vffff"].apply(null, arguments) }; +var dynCall_vfi = Module["dynCall_vfi"] = function() { return Module["asm"]["dynCall_vfi"].apply(null, arguments) }; +var dynCall_vi = Module["dynCall_vi"] = function() { return Module["asm"]["dynCall_vi"].apply(null, arguments) }; +var dynCall_vid = Module["dynCall_vid"] = function() { return Module["asm"]["dynCall_vid"].apply(null, arguments) }; +var dynCall_vidd = Module["dynCall_vidd"] = function() { return Module["asm"]["dynCall_vidd"].apply(null, arguments) }; +var dynCall_viddd = Module["dynCall_viddd"] = function() { return Module["asm"]["dynCall_viddd"].apply(null, arguments) }; +var dynCall_vidddd = Module["dynCall_vidddd"] = function() { return Module["asm"]["dynCall_vidddd"].apply(null, arguments) }; +var dynCall_viddidd = Module["dynCall_viddidd"] = function() { return Module["asm"]["dynCall_viddidd"].apply(null, arguments) }; +var dynCall_viddiiddiii = Module["dynCall_viddiiddiii"] = function() { return Module["asm"]["dynCall_viddiiddiii"].apply(null, arguments) }; +var dynCall_viddiii = Module["dynCall_viddiii"] = function() { return Module["asm"]["dynCall_viddiii"].apply(null, arguments) }; +var dynCall_vif = Module["dynCall_vif"] = function() { return Module["asm"]["dynCall_vif"].apply(null, arguments) }; +var dynCall_viff = Module["dynCall_viff"] = function() { return Module["asm"]["dynCall_viff"].apply(null, arguments) }; +var dynCall_vifff = Module["dynCall_vifff"] = function() { return Module["asm"]["dynCall_vifff"].apply(null, arguments) }; +var dynCall_viffff = Module["dynCall_viffff"] = function() { return Module["asm"]["dynCall_viffff"].apply(null, arguments) }; +var dynCall_viffiff = Module["dynCall_viffiff"] = function() { return Module["asm"]["dynCall_viffiff"].apply(null, arguments) }; +var dynCall_viffiiffiii = Module["dynCall_viffiiffiii"] = function() { return Module["asm"]["dynCall_viffiiffiii"].apply(null, arguments) }; +var dynCall_viffiii = Module["dynCall_viffiii"] = function() { return Module["asm"]["dynCall_viffiii"].apply(null, arguments) }; +var dynCall_vii = Module["dynCall_vii"] = function() { return Module["asm"]["dynCall_vii"].apply(null, arguments) }; +var dynCall_viid = Module["dynCall_viid"] = function() { return Module["asm"]["dynCall_viid"].apply(null, arguments) }; +var dynCall_viidddd = Module["dynCall_viidddd"] = function() { return Module["asm"]["dynCall_viidddd"].apply(null, arguments) }; +var dynCall_viif = Module["dynCall_viif"] = function() { return Module["asm"]["dynCall_viif"].apply(null, arguments) }; +var dynCall_viiffff = Module["dynCall_viiffff"] = function() { return Module["asm"]["dynCall_viiffff"].apply(null, arguments) }; +var dynCall_viiffffi = Module["dynCall_viiffffi"] = function() { return Module["asm"]["dynCall_viiffffi"].apply(null, arguments) }; +var dynCall_viifi = Module["dynCall_viifi"] = function() { return Module["asm"]["dynCall_viifi"].apply(null, arguments) }; +var dynCall_viii = Module["dynCall_viii"] = function() { return Module["asm"]["dynCall_viii"].apply(null, arguments) }; +var dynCall_viiii = Module["dynCall_viiii"] = function() { return Module["asm"]["dynCall_viiii"].apply(null, arguments) }; +var dynCall_viiiii = Module["dynCall_viiiii"] = function() { return Module["asm"]["dynCall_viiiii"].apply(null, arguments) }; +var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() { return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) }; +var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) }; +var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments) }; +var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments) }; +var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments) }; +var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = function() { return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments) }; +var dynCall_viiji = Module["dynCall_viiji"] = function() { return Module["asm"]["dynCall_viiji"].apply(null, arguments) }; +; + + + +// === Auto-generated postamble setup entry stuff === + +Module['asm'] = asm; + + + + + + + + +Module["getMemory"] = getMemory; + + + + + + + + + + + + + + + + + + + + + + + + +Module["addRunDependency"] = addRunDependency; +Module["removeRunDependency"] = removeRunDependency; + + +Module["FS_createFolder"] = FS.createFolder; +Module["FS_createPath"] = FS.createPath; +Module["FS_createDataFile"] = FS.createDataFile; +Module["FS_createPreloadedFile"] = FS.createPreloadedFile; +Module["FS_createLazyFile"] = FS.createLazyFile; +Module["FS_createLink"] = FS.createLink; +Module["FS_createDevice"] = FS.createDevice; +Module["FS_unlink"] = FS.unlink; + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +/** + * @constructor + * @extends {Error} + * @this {ExitStatus} + */ +function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status; +}; +ExitStatus.prototype = new Error(); +ExitStatus.prototype.constructor = ExitStatus; + +var initialStackTop; +var calledMain = false; + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!Module['calledRun']) run(); + if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +} + +Module['callMain'] = function callMain(args) { + + args = args || []; + + ensureInitRuntime(); + + var argc = args.length+1; + var argv = stackAlloc((argc + 1) * 4); + HEAP32[argv >> 2] = allocateUTF8OnStack(Module['thisProgram']); + for (var i = 1; i < argc; i++) { + HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); + } + HEAP32[(argv >> 2) + argc] = 0; + + + try { + + var ret = Module['_main'](argc, argv, 0); + + + // if we're not running an evented main loop, it's time to exit + exit(ret, /* implicit = */ true); + } + catch(e) { + if (e instanceof ExitStatus) { + // exit() throws this once it's done to make sure execution + // has been stopped completely + return; + } else if (e == 'SimulateInfiniteLoop') { + // running an evented main loop, don't immediately exit + Module['noExitRuntime'] = true; + return; + } else { + var toLog = e; + if (e && typeof e === 'object' && e.stack) { + toLog = [e, e.stack]; + } + err('exception thrown: ' + toLog); + Module['quit'](1, e); + } + } finally { + calledMain = true; + } +} + + + + +/** @type {function(Array=)} */ +function run(args) { + args = args || Module['arguments']; + + if (runDependencies > 0) { + return; + } + + + preRun(); + + if (runDependencies > 0) return; // a preRun added a dependency, run will be called later + if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame + + function doRun() { + if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening + Module['calledRun'] = true; + + if (ABORT) return; + + ensureInitRuntime(); + + preMain(); + + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + if (Module['_main'] && shouldRunNow) Module['callMain'](args); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else { + doRun(); + } +} +Module['run'] = run; + + +function exit(status, implicit) { + + // if this is just main exit-ing implicitly, and the status is 0, then we + // don't need to do anything here and can just leave. if the status is + // non-zero, though, then we need to report it. + // (we may have warned about this earlier, if a situation justifies doing so) + if (implicit && Module['noExitRuntime'] && status === 0) { + return; + } + + if (Module['noExitRuntime']) { + } else { + + ABORT = true; + EXITSTATUS = status; + STACKTOP = initialStackTop; + + exitRuntime(); + + if (Module['onExit']) Module['onExit'](status); + } + + Module['quit'](status, new ExitStatus(status)); +} + +var abortDecorators = []; + +function abort(what) { + if (Module['onAbort']) { + Module['onAbort'](what); + } + + if (what !== undefined) { + out(what); + err(what); + what = JSON.stringify(what) + } else { + what = ''; + } + + ABORT = true; + EXITSTATUS = 1; + + throw 'abort(' + what + '). Build with -s ASSERTIONS=1 for more info.'; +} +Module['abort'] = abort; + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +// shouldRunNow refers to calling main(), not run(). +var shouldRunNow = true; +if (Module['noInitialRun']) { + shouldRunNow = false; +} + + Module["noExitRuntime"] = true; + +run(); + + + + + +// {{MODULE_ADDITIONS}} + + + diff --git a/examples/web/audio/audio_music_stream_test.wasm b/examples/web/audio/audio_music_stream_test.wasm Binary files differnew file mode 100644 index 0000000..c22ef2c --- /dev/null +++ b/examples/web/audio/audio_music_stream_test.wasm diff --git a/examples/web/audio/resources/game.mp3 b/examples/web/audio/resources/game.mp3 Binary files differnew file mode 100644 index 0000000..669da32 --- /dev/null +++ b/examples/web/audio/resources/game.mp3 |
