summaryrefslogtreecommitdiffhomepage
path: root/examples/web/shaders/shaders_postprocessing.js
diff options
context:
space:
mode:
authorraysan5 <[email protected]>2017-07-24 19:45:46 +0200
committerraysan5 <[email protected]>2017-07-24 19:45:46 +0200
commit46ad8ae6eefc76a2e1f0ce88cdef2b919bb2d936 (patch)
treefae44589bea3de03639b0ce88d0adc29044ed062 /examples/web/shaders/shaders_postprocessing.js
downloadraylib.com-46ad8ae6eefc76a2e1f0ce88cdef2b919bb2d936.tar.gz
raylib.com-46ad8ae6eefc76a2e1f0ce88cdef2b919bb2d936.zip
Added webpage
Moved from @raysan5/raylib/docs
Diffstat (limited to 'examples/web/shaders/shaders_postprocessing.js')
-rw-r--r--examples/web/shaders/shaders_postprocessing.js47997
1 files changed, 47997 insertions, 0 deletions
diff --git a/examples/web/shaders/shaders_postprocessing.js b/examples/web/shaders/shaders_postprocessing.js
new file mode 100644
index 0000000..d3f6aa8
--- /dev/null
+++ b/examples/web/shaders/shaders_postprocessing.js
@@ -0,0 +1,47997 @@
+
+var Module;
+
+if (typeof Module === 'undefined') Module = {};
+
+if (!Module.expectedDataFileDownloads) {
+ Module.expectedDataFileDownloads = 0;
+ Module.finishedDataFileDownloads = 0;
+}
+Module.expectedDataFileDownloads++;
+(function() {
+ var loadPackage = function(metadata) {
+
+ var PACKAGE_PATH;
+ if (typeof window === 'object') {
+ PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
+ } else if (typeof location !== 'undefined') {
+ // worker
+ PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
+ } else {
+ throw 'using preloaded data can only be done on a web page or in a web worker';
+ }
+ var PACKAGE_NAME = 'shaders/shaders_postprocessing.data';
+ var REMOTE_PACKAGE_BASE = 'shaders_postprocessing.data';
+ if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
+ Module['locateFile'] = Module['locateFilePackage'];
+ Module.printErr('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
+ }
+ var REMOTE_PACKAGE_NAME = typeof Module['locateFile'] === 'function' ?
+ Module['locateFile'](REMOTE_PACKAGE_BASE) :
+ ((Module['filePackagePrefixURL'] || '') + REMOTE_PACKAGE_BASE);
+
+ var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
+ var PACKAGE_UUID = metadata.package_uuid;
+
+ function fetchRemotePackage(packageName, packageSize, callback, errback) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', packageName, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onprogress = function(event) {
+ var url = packageName;
+ var size = packageSize;
+ if (event.total) size = event.total;
+ if (event.loaded) {
+ if (!xhr.addedTotal) {
+ xhr.addedTotal = true;
+ if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
+ Module.dataFileDownloads[url] = {
+ loaded: event.loaded,
+ total: size
+ };
+ } else {
+ Module.dataFileDownloads[url].loaded = event.loaded;
+ }
+ var total = 0;
+ var loaded = 0;
+ var num = 0;
+ for (var download in Module.dataFileDownloads) {
+ var data = Module.dataFileDownloads[download];
+ total += data.total;
+ loaded += data.loaded;
+ num++;
+ }
+ total = Math.ceil(total * Module.expectedDataFileDownloads/num);
+ if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
+ } else if (!Module.dataFileDownloads) {
+ if (Module['setStatus']) Module['setStatus']('Downloading data...');
+ }
+ };
+ xhr.onerror = function(event) {
+ throw new Error("NetworkError for: " + packageName);
+ }
+ xhr.onload = function(event) {
+ if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ var packageData = xhr.response;
+ callback(packageData);
+ } else {
+ throw new Error(xhr.statusText + " : " + xhr.responseURL);
+ }
+ };
+ xhr.send(null);
+ };
+
+ function handleError(error) {
+ console.error('package error:', error);
+ };
+
+ var fetchedCallback = null;
+ var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;
+
+ if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
+ if (fetchedCallback) {
+ fetchedCallback(data);
+ fetchedCallback = null;
+ } else {
+ fetched = data;
+ }
+ }, handleError);
+
+ function runWithFS() {
+
+ function assert(check, msg) {
+ if (!check) throw msg + new Error().stack;
+ }
+Module['FS_createPath']('/', 'resources', true, true);
+Module['FS_createPath']('/resources', 'model', true, true);
+Module['FS_createPath']('/resources', 'shaders', true, true);
+Module['FS_createPath']('/resources/shaders', 'glsl100', true, true);
+
+ function DataRequest(start, end, crunched, audio) {
+ this.start = start;
+ this.end = end;
+ this.crunched = crunched;
+ this.audio = audio;
+ }
+ DataRequest.prototype = {
+ requests: {},
+ open: function(mode, name) {
+ this.name = name;
+ this.requests[name] = this;
+ Module['addRunDependency']('fp ' + this.name);
+ },
+ send: function() {},
+ onload: function() {
+ var byteArray = this.byteArray.subarray(this.start, this.end);
+
+ this.finish(byteArray);
+
+ },
+ finish: function(byteArray) {
+ var that = this;
+
+ Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
+ Module['removeRunDependency']('fp ' + that.name);
+
+ this.requests[this.name] = null;
+ }
+ };
+
+ var files = metadata.files;
+ for (i = 0; i < files.length; ++i) {
+ new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio).open('GET', files[i].filename);
+ }
+
+
+ function processPackageData(arrayBuffer) {
+ Module.finishedDataFileDownloads++;
+ assert(arrayBuffer, 'Loading data file failed.');
+ assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
+ var byteArray = new Uint8Array(arrayBuffer);
+ var curr;
+
+ // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
+ // (we may be allocating before malloc is ready, during startup).
+ if (Module['SPLIT_MEMORY']) Module.printErr('warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting');
+ var ptr = Module['getMemory'](byteArray.length);
+ Module['HEAPU8'].set(byteArray, ptr);
+ DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
+
+ var files = metadata.files;
+ for (i = 0; i < files.length; ++i) {
+ DataRequest.prototype.requests[files[i].filename].onload();
+ }
+ Module['removeRunDependency']('datafile_shaders/shaders_postprocessing.data');
+
+ };
+ Module['addRunDependency']('datafile_shaders/shaders_postprocessing.data');
+
+ if (!Module.preloadResults) Module.preloadResults = {};
+
+ Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
+ if (fetched) {
+ processPackageData(fetched);
+ fetched = null;
+ } else {
+ fetchedCallback = processPackageData;
+ }
+
+ }
+ if (Module['calledRun']) {
+ runWithFS();
+ } else {
+ if (!Module['preRun']) Module['preRun'] = [];
+ Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
+ }
+
+ }
+ loadPackage({"files": [{"audio": 0, "start": 0, "crunched": 0, "end": 2748249, "filename": "/resources/model/dwarf.obj"}, {"audio": 0, "start": 2748249, "crunched": 0, "end": 4022872, "filename": "/resources/model/dwarf_diffuse.png"}, {"audio": 0, "start": 4022872, "crunched": 0, "end": 4023423, "filename": "/resources/shaders/glsl100/base.fs"}, {"audio": 0, "start": 4023423, "crunched": 0, "end": 4024028, "filename": "/resources/shaders/glsl100/base.vs"}, {"audio": 0, "start": 4024028, "crunched": 0, "end": 4025108, "filename": "/resources/shaders/glsl100/bloom.fs"}, {"audio": 0, "start": 4025108, "crunched": 0, "end": 4026178, "filename": "/resources/shaders/glsl100/blur.fs"}, {"audio": 0, "start": 4026178, "crunched": 0, "end": 4027346, "filename": "/resources/shaders/glsl100/cross_hatching.fs"}, {"audio": 0, "start": 4027346, "crunched": 0, "end": 4028771, "filename": "/resources/shaders/glsl100/cross_stitching.fs"}, {"audio": 0, "start": 4028771, "crunched": 0, "end": 4030960, "filename": "/resources/shaders/glsl100/distortion.fs"}, {"audio": 0, "start": 4030960, "crunched": 0, "end": 4032107, "filename": "/resources/shaders/glsl100/dream_vision.fs"}, {"audio": 0, "start": 4032107, "crunched": 0, "end": 4033036, "filename": "/resources/shaders/glsl100/fisheye.fs"}, {"audio": 0, "start": 4033036, "crunched": 0, "end": 4033701, "filename": "/resources/shaders/glsl100/grayscale.fs"}, {"audio": 0, "start": 4033701, "crunched": 0, "end": 4034456, "filename": "/resources/shaders/glsl100/pixelizer.fs"}, {"audio": 0, "start": 4034456, "crunched": 0, "end": 4035085, "filename": "/resources/shaders/glsl100/posterization.fs"}, {"audio": 0, "start": 4035085, "crunched": 0, "end": 4035827, "filename": "/resources/shaders/glsl100/predator.fs"}, {"audio": 0, "start": 4035827, "crunched": 0, "end": 4036947, "filename": "/resources/shaders/glsl100/scanlines.fs"}, {"audio": 0, "start": 4036947, "crunched": 0, "end": 4038590, "filename": "/resources/shaders/glsl100/sobel.fs"}, {"audio": 0, "start": 4038590, "crunched": 0, "end": 4039631, "filename": "/resources/shaders/glsl100/swirl.fs"}], "remote_package_size": 4039631, "package_uuid": "09621c9e-8caf-4662-85f4-3a180518546b"});
+
+})();
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it, and do the work to get that through
+// closure compiler if necessary. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to do an eval in order to handle the closure compiler
+// case, where this code here is minified but Module was defined
+// elsewhere (e.g. case 4 above). We also need to check if Module
+// already exists (e.g. case 3 above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module;
+if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+for (var key in Module) {
+ if (Module.hasOwnProperty(key)) {
+ moduleOverrides[key] = Module[key];
+ }
+}
+
+// The environment setup code below is customized to use Module.
+// *** Environment setup code ***
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = false;
+var ENVIRONMENT_IS_SHELL = false;
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+
+if (Module['ENVIRONMENT']) {
+ if (Module['ENVIRONMENT'] === 'WEB') {
+ ENVIRONMENT_IS_WEB = true;
+ } else if (Module['ENVIRONMENT'] === 'WORKER') {
+ ENVIRONMENT_IS_WORKER = true;
+ } else if (Module['ENVIRONMENT'] === 'NODE') {
+ ENVIRONMENT_IS_NODE = true;
+ } else if (Module['ENVIRONMENT'] === 'SHELL') {
+ ENVIRONMENT_IS_SHELL = true;
+ } else {
+ throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
+ }
+} else {
+ ENVIRONMENT_IS_WEB = typeof window === 'object';
+ ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+ ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+ ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+}
+
+
+if (ENVIRONMENT_IS_NODE) {
+ // Expose functionality in the same simple way that the shells work
+ // Note that we pollute the global namespace here, otherwise we break in node
+ if (!Module['print']) Module['print'] = console.log;
+ if (!Module['printErr']) Module['printErr'] = console.warn;
+
+ var nodeFS;
+ var nodePath;
+
+ Module['read'] = function read(filename, binary) {
+ if (!nodeFS) nodeFS = require('fs');
+ if (!nodePath) nodePath = require('path');
+ filename = nodePath['normalize'](filename);
+ var ret = nodeFS['readFileSync'](filename);
+ return binary ? ret : ret.toString();
+ };
+
+ Module['readBinary'] = function readBinary(filename) {
+ var ret = Module['read'](filename, true);
+ if (!ret.buffer) {
+ ret = new Uint8Array(ret);
+ }
+ assert(ret.buffer);
+ return ret;
+ };
+
+ Module['load'] = function load(f) {
+ globalEval(read(f));
+ };
+
+ if (!Module['thisProgram']) {
+ if (process['argv'].length > 1) {
+ Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+ } else {
+ Module['thisProgram'] = 'unknown-program';
+ }
+ }
+
+ Module['arguments'] = process['argv'].slice(2);
+
+ if (typeof module !== 'undefined') {
+ module['exports'] = Module;
+ }
+
+ process['on']('uncaughtException', function(ex) {
+ // suppress ExitStatus exceptions from showing an error
+ if (!(ex instanceof ExitStatus)) {
+ throw ex;
+ }
+ });
+
+ Module['inspect'] = function () { return '[Emscripten Module object]'; };
+}
+else if (ENVIRONMENT_IS_SHELL) {
+ if (!Module['print']) Module['print'] = print;
+ if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
+
+ if (typeof read != 'undefined') {
+ Module['read'] = read;
+ } else {
+ Module['read'] = function read() { throw 'no read() available' };
+ }
+
+ Module['readBinary'] = function readBinary(f) {
+ if (typeof readbuffer === 'function') {
+ return new Uint8Array(readbuffer(f));
+ }
+ var data = read(f, 'binary');
+ assert(typeof data === 'object');
+ return data;
+ };
+
+ if (typeof scriptArgs != 'undefined') {
+ Module['arguments'] = scriptArgs;
+ } else if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+ if (typeof quit === 'function') {
+ Module['quit'] = function(status, toThrow) {
+ quit(status);
+ }
+ }
+
+}
+else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+ Module['read'] = function read(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.send(null);
+ return xhr.responseText;
+ };
+
+ if (ENVIRONMENT_IS_WORKER) {
+ Module['readBinary'] = function read(url) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ xhr.responseType = 'arraybuffer';
+ xhr.send(null);
+ return xhr.response;
+ };
+ }
+
+ Module['readAsync'] = function readAsync(url, onload, onerror) {
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, true);
+ xhr.responseType = 'arraybuffer';
+ xhr.onload = function xhr_onload() {
+ if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+ onload(xhr.response);
+ } else {
+ onerror();
+ }
+ };
+ xhr.onerror = onerror;
+ xhr.send(null);
+ };
+
+ if (typeof arguments != 'undefined') {
+ Module['arguments'] = arguments;
+ }
+
+ if (typeof console !== 'undefined') {
+ if (!Module['print']) Module['print'] = function print(x) {
+ console.log(x);
+ };
+ if (!Module['printErr']) Module['printErr'] = function printErr(x) {
+ console.warn(x);
+ };
+ } else {
+ // Probably a worker, and without console.log. We can do very little here...
+ var TRY_USE_DUMP = false;
+ if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
+ dump(x);
+ }) : (function(x) {
+ // self.postMessage(x); // enable this if you want stdout to be sent as messages
+ }));
+ }
+
+ if (ENVIRONMENT_IS_WORKER) {
+ Module['load'] = importScripts;
+ }
+
+ if (typeof Module['setWindowTitle'] === 'undefined') {
+ Module['setWindowTitle'] = function(title) { document.title = title };
+ }
+}
+else {
+ // Unreachable because SHELL is dependant on the others
+ throw 'Unknown runtime environment. Where are we?';
+}
+
+function globalEval(x) {
+ eval.call(null, x);
+}
+if (!Module['load'] && Module['read']) {
+ Module['load'] = function load(f) {
+ globalEval(Module['read'](f));
+ };
+}
+if (!Module['print']) {
+ Module['print'] = function(){};
+}
+if (!Module['printErr']) {
+ Module['printErr'] = Module['print'];
+}
+if (!Module['arguments']) {
+ Module['arguments'] = [];
+}
+if (!Module['thisProgram']) {
+ Module['thisProgram'] = './this.program';
+}
+if (!Module['quit']) {
+ Module['quit'] = function(status, toThrow) {
+ throw toThrow;
+ }
+}
+
+// *** Environment setup code ***
+
+// Closure helpers
+Module.print = Module['print'];
+Module.printErr = Module['printErr'];
+
+// Callbacks
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// Merge back in the overrides
+for (var key in moduleOverrides) {
+ if (moduleOverrides.hasOwnProperty(key)) {
+ Module[key] = moduleOverrides[key];
+ }
+}
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = undefined;
+
+
+
+// {{PREAMBLE_ADDITIONS}}
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+// site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+// site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+//========================================
+// Runtime code shared with compiler
+//========================================
+
+var Runtime = {
+ setTempRet0: function (value) {
+ tempRet0 = value;
+ return value;
+ },
+ getTempRet0: function () {
+ return tempRet0;
+ },
+ stackSave: function () {
+ return STACKTOP;
+ },
+ stackRestore: function (stackTop) {
+ STACKTOP = stackTop;
+ },
+ getNativeTypeSize: function (type) {
+ switch (type) {
+ case 'i1': case 'i8': return 1;
+ case 'i16': return 2;
+ case 'i32': return 4;
+ case 'i64': return 8;
+ case 'float': return 4;
+ case 'double': return 8;
+ default: {
+ if (type[type.length-1] === '*') {
+ return Runtime.QUANTUM_SIZE; // A pointer
+ } else if (type[0] === 'i') {
+ var bits = parseInt(type.substr(1));
+ assert(bits % 8 === 0);
+ return bits/8;
+ } else {
+ return 0;
+ }
+ }
+ }
+ },
+ getNativeFieldSize: function (type) {
+ return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
+ },
+ STACK_ALIGN: 16,
+ prepVararg: function (ptr, type) {
+ if (type === 'double' || type === 'i64') {
+ // move so the load is aligned
+ if (ptr & 7) {
+ assert((ptr & 7) === 4);
+ ptr += 4;
+ }
+ } else {
+ assert((ptr & 3) === 0);
+ }
+ return ptr;
+ },
+ getAlignSize: function (type, size, vararg) {
+ // we align i64s and doubles on 64-bit boundaries, unlike x86
+ if (!vararg && (type == 'i64' || type == 'double')) return 8;
+ if (!type) return Math.min(size, 8); // align structures internally to 64 bits
+ return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
+ },
+ dynCall: function (sig, ptr, args) {
+ if (args && args.length) {
+ assert(args.length == sig.length-1);
+ assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+ return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
+ } else {
+ assert(sig.length == 1);
+ assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+ return Module['dynCall_' + sig].call(null, ptr);
+ }
+ },
+ functionPointers: [],
+ addFunction: function (func) {
+ for (var i = 0; i < Runtime.functionPointers.length; i++) {
+ if (!Runtime.functionPointers[i]) {
+ Runtime.functionPointers[i] = func;
+ return 2*(1 + i);
+ }
+ }
+ throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+ },
+ removeFunction: function (index) {
+ Runtime.functionPointers[(index-2)/2] = null;
+ },
+ warnOnce: function (text) {
+ if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
+ if (!Runtime.warnOnce.shown[text]) {
+ Runtime.warnOnce.shown[text] = 1;
+ Module.printErr(text);
+ }
+ },
+ funcWrappers: {},
+ getFuncWrapper: function (func, sig) {
+ assert(sig);
+ if (!Runtime.funcWrappers[sig]) {
+ Runtime.funcWrappers[sig] = {};
+ }
+ var sigCache = Runtime.funcWrappers[sig];
+ if (!sigCache[func]) {
+ // optimize away arguments usage in common cases
+ if (sig.length === 1) {
+ sigCache[func] = function dynCall_wrapper() {
+ return Runtime.dynCall(sig, func);
+ };
+ } else if (sig.length === 2) {
+ sigCache[func] = function dynCall_wrapper(arg) {
+ return Runtime.dynCall(sig, func, [arg]);
+ };
+ } else {
+ // general case
+ sigCache[func] = function dynCall_wrapper() {
+ return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
+ };
+ }
+ }
+ return sigCache[func];
+ },
+ getCompilerSetting: function (name) {
+ throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
+ },
+ stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; },
+ staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
+ dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
+ alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
+ makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
+ GLOBAL_BASE: 8,
+ QUANTUM_SIZE: 4,
+ __dummy__: 0
+}
+
+
+
+Module["Runtime"] = Runtime;
+
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
+var EXITSTATUS = 0;
+
+function assert(condition, text) {
+ if (!condition) {
+ abort('Assertion failed: ' + text);
+ }
+}
+
+var globalScope = this;
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+ var func = Module['_' + ident]; // closure exported function
+ if (!func) {
+ try { func = eval('_' + ident); } catch(e) {}
+ }
+ assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
+ return func;
+}
+
+var cwrap, ccall;
+(function(){
+ var JSfuncs = {
+ // Helpers for cwrap -- it can't refer to Runtime directly because it might
+ // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
+ // out what the minified function name is.
+ 'stackSave': function() {
+ Runtime.stackSave()
+ },
+ 'stackRestore': function() {
+ Runtime.stackRestore()
+ },
+ // type conversion from js to c
+ 'arrayToC' : function(arr) {
+ var ret = Runtime.stackAlloc(arr.length);
+ writeArrayToMemory(arr, ret);
+ return ret;
+ },
+ 'stringToC' : function(str) {
+ var ret = 0;
+ if (str !== null && str !== undefined && str !== 0) { // null string
+ // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+ var len = (str.length << 2) + 1;
+ ret = Runtime.stackAlloc(len);
+ stringToUTF8(str, ret, len);
+ }
+ return ret;
+ }
+ };
+ // For fast lookup of conversion functions
+ var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
+
+ // C calling interface.
+ ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
+ var func = getCFunc(ident);
+ var cArgs = [];
+ var stack = 0;
+ assert(returnType !== 'array', 'Return type should not be "array".');
+ if (args) {
+ for (var i = 0; i < args.length; i++) {
+ var converter = toC[argTypes[i]];
+ if (converter) {
+ if (stack === 0) stack = Runtime.stackSave();
+ cArgs[i] = converter(args[i]);
+ } else {
+ cArgs[i] = args[i];
+ }
+ }
+ }
+ var ret = func.apply(null, cArgs);
+ if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') {
+ assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall');
+ }
+ if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values');
+ if (returnType === 'string') ret = Pointer_stringify(ret);
+ if (stack !== 0) {
+ if (opts && opts.async) {
+ EmterpreterAsync.asyncFinalizers.push(function() {
+ Runtime.stackRestore(stack);
+ });
+ return;
+ }
+ Runtime.stackRestore(stack);
+ }
+ return ret;
+ }
+
+ var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
+ function parseJSFunc(jsfunc) {
+ // Match the body and the return value of a javascript function source
+ var parsed = jsfunc.toString().match(sourceRegex).slice(1);
+ return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
+ }
+
+ // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
+ var JSsource = null;
+ function ensureJSsource() {
+ if (!JSsource) {
+ JSsource = {};
+ for (var fun in JSfuncs) {
+ if (JSfuncs.hasOwnProperty(fun)) {
+ // Elements of toCsource are arrays of three items:
+ // the code, and the return value
+ JSsource[fun] = parseJSFunc(JSfuncs[fun]);
+ }
+ }
+ }
+ }
+
+ cwrap = function cwrap(ident, returnType, argTypes) {
+ argTypes = argTypes || [];
+ var cfunc = getCFunc(ident);
+ // When the function takes numbers and returns a number, we can just return
+ // the original function
+ var numericArgs = argTypes.every(function(type){ return type === 'number'});
+ var numericRet = (returnType !== 'string');
+ if ( numericRet && numericArgs) {
+ return cfunc;
+ }
+ // Creation of the arguments list (["$1","$2",...,"$nargs"])
+ var argNames = argTypes.map(function(x,i){return '$'+i});
+ var funcstr = "(function(" + argNames.join(',') + ") {";
+ var nargs = argTypes.length;
+ if (!numericArgs) {
+ // Generate the code needed to convert the arguments from javascript
+ // values to pointers
+ ensureJSsource();
+ funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
+ for (var i = 0; i < nargs; i++) {
+ var arg = argNames[i], type = argTypes[i];
+ if (type === 'number') continue;
+ var convertCode = JSsource[type + 'ToC']; // [code, return]
+ funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
+ funcstr += convertCode.body + ';';
+ funcstr += arg + '=(' + convertCode.returnValue + ');';
+ }
+ }
+
+ // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
+ var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
+ // Call the function
+ funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
+ if (!numericRet) { // Return type can only by 'string' or 'number'
+ // Convert the result to a string
+ var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
+ funcstr += 'ret = ' + strgfy + '(ret);';
+ }
+ funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }";
+ if (!numericArgs) {
+ // If we had a stack, restore it
+ ensureJSsource();
+ funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
+ }
+ funcstr += 'return ret})';
+ return eval(funcstr);
+ };
+})();
+Module["ccall"] = ccall;
+Module["cwrap"] = cwrap;
+
+function setValue(ptr, value, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': HEAP8[((ptr)>>0)]=value; break;
+ case 'i8': HEAP8[((ptr)>>0)]=value; break;
+ case 'i16': HEAP16[((ptr)>>1)]=value; break;
+ case 'i32': HEAP32[((ptr)>>2)]=value; break;
+ case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+ case 'float': HEAPF32[((ptr)>>2)]=value; break;
+ case 'double': HEAPF64[((ptr)>>3)]=value; break;
+ default: abort('invalid type for setValue: ' + type);
+ }
+}
+Module["setValue"] = setValue;
+
+
+function getValue(ptr, type, noSafe) {
+ type = type || 'i8';
+ if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+ switch(type) {
+ case 'i1': return HEAP8[((ptr)>>0)];
+ case 'i8': return HEAP8[((ptr)>>0)];
+ case 'i16': return HEAP16[((ptr)>>1)];
+ case 'i32': return HEAP32[((ptr)>>2)];
+ case 'i64': return HEAP32[((ptr)>>2)];
+ case 'float': return HEAPF32[((ptr)>>2)];
+ case 'double': return HEAPF64[((ptr)>>3)];
+ default: abort('invalid type for setValue: ' + type);
+ }
+ return null;
+}
+Module["getValue"] = getValue;
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_STATIC = 2; // Cannot be freed
+var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
+var ALLOC_NONE = 4; // Do not allocate
+Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
+Module["ALLOC_STACK"] = ALLOC_STACK;
+Module["ALLOC_STATIC"] = ALLOC_STATIC;
+Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
+Module["ALLOC_NONE"] = ALLOC_NONE;
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+// is a little tricky (see docs right below). The reason is that it is optimized
+// for multiple syntaxes to save space in generated code. So you should
+// normally not use allocate(), and instead allocate memory using _malloc(),
+// initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+// in *bytes* (note that this is sometimes confusing: the next parameter does not
+// affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+// or a single type which is used for the entire block. This only matters if there
+// is initial data - if @slab is a number, then this does not matter at all and is
+// ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+function allocate(slab, types, allocator, ptr) {
+ var zeroinit, size;
+ if (typeof slab === 'number') {
+ zeroinit = true;
+ size = slab;
+ } else {
+ zeroinit = false;
+ size = slab.length;
+ }
+
+ var singleType = typeof types === 'string' ? types : null;
+
+ var ret;
+ if (allocator == ALLOC_NONE) {
+ ret = ptr;
+ } else {
+ ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
+ }
+
+ if (zeroinit) {
+ var ptr = ret, stop;
+ assert((ret & 3) == 0);
+ stop = ret + (size & ~3);
+ for (; ptr < stop; ptr += 4) {
+ HEAP32[((ptr)>>2)]=0;
+ }
+ stop = ret + size;
+ while (ptr < stop) {
+ HEAP8[((ptr++)>>0)]=0;
+ }
+ return ret;
+ }
+
+ if (singleType === 'i8') {
+ if (slab.subarray || slab.slice) {
+ HEAPU8.set(slab, ret);
+ } else {
+ HEAPU8.set(new Uint8Array(slab), ret);
+ }
+ return ret;
+ }
+
+ var i = 0, type, typeSize, previousType;
+ while (i < size) {
+ var curr = slab[i];
+
+ if (typeof curr === 'function') {
+ curr = Runtime.getFunctionIndex(curr);
+ }
+
+ type = singleType || types[i];
+ if (type === 0) {
+ i++;
+ continue;
+ }
+ assert(type, 'Must know what type to store in allocate!');
+
+ if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+ setValue(ret+i, curr, type);
+
+ // no need to look up size unless type changes, so cache it
+ if (previousType !== type) {
+ typeSize = Runtime.getNativeTypeSize(type);
+ previousType = type;
+ }
+ i += typeSize;
+ }
+
+ return ret;
+}
+Module["allocate"] = allocate;
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+ if (!staticSealed) return Runtime.staticAlloc(size);
+ if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
+ return _malloc(size);
+}
+Module["getMemory"] = getMemory;
+
+function Pointer_stringify(ptr, /* optional */ length) {
+ if (length === 0 || !ptr) return '';
+ // TODO: use TextDecoder
+ // Find the length, and check for UTF while doing so
+ var hasUtf = 0;
+ var t;
+ var i = 0;
+ while (1) {
+ assert(ptr + i < TOTAL_MEMORY);
+ t = HEAPU8[(((ptr)+(i))>>0)];
+ hasUtf |= t;
+ if (t == 0 && !length) break;
+ i++;
+ if (length && i == length) break;
+ }
+ if (!length) length = i;
+
+ var ret = '';
+
+ if (hasUtf < 128) {
+ var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
+ var curr;
+ while (length > 0) {
+ curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
+ ret = ret ? ret + curr : curr;
+ ptr += MAX_CHUNK;
+ length -= MAX_CHUNK;
+ }
+ return ret;
+ }
+ return Module['UTF8ToString'](ptr);
+}
+Module["Pointer_stringify"] = Pointer_stringify;
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+ var str = '';
+ while (1) {
+ var ch = HEAP8[((ptr++)>>0)];
+ if (!ch) return str;
+ str += String.fromCharCode(ch);
+ }
+}
+Module["AsciiToString"] = AsciiToString;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+ return writeAsciiToMemory(str, outPtr, false);
+}
+Module["stringToAscii"] = stringToAscii;
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
+function UTF8ArrayToString(u8Array, idx) {
+ var endPtr = idx;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ while (u8Array[endPtr]) ++endPtr;
+
+ if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
+ return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
+ } else {
+ var u0, u1, u2, u3, u4, u5;
+
+ var str = '';
+ while (1) {
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ u0 = u8Array[idx++];
+ if (!u0) return str;
+ if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+ u1 = u8Array[idx++] & 63;
+ if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+ u2 = u8Array[idx++] & 63;
+ if ((u0 & 0xF0) == 0xE0) {
+ u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+ } else {
+ u3 = u8Array[idx++] & 63;
+ if ((u0 & 0xF8) == 0xF0) {
+ u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
+ } else {
+ u4 = u8Array[idx++] & 63;
+ if ((u0 & 0xFC) == 0xF8) {
+ u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
+ } else {
+ u5 = u8Array[idx++] & 63;
+ u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
+ }
+ }
+ }
+ if (u0 < 0x10000) {
+ str += String.fromCharCode(u0);
+ } else {
+ var ch = u0 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ }
+ }
+ }
+}
+Module["UTF8ArrayToString"] = UTF8ArrayToString;
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function UTF8ToString(ptr) {
+ return UTF8ArrayToString(HEAPU8,ptr);
+}
+Module["UTF8ToString"] = UTF8ToString;
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+// outIdx: The starting offset in the array to begin the copying.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+ if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+ return 0;
+
+ var startIdx = outIdx;
+ var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ if (outIdx >= endIdx) break;
+ outU8Array[outIdx++] = u;
+ } else if (u <= 0x7FF) {
+ if (outIdx + 1 >= endIdx) break;
+ outU8Array[outIdx++] = 0xC0 | (u >> 6);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0xFFFF) {
+ if (outIdx + 2 >= endIdx) break;
+ outU8Array[outIdx++] = 0xE0 | (u >> 12);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x1FFFFF) {
+ if (outIdx + 3 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF0 | (u >> 18);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else if (u <= 0x3FFFFFF) {
+ if (outIdx + 4 >= endIdx) break;
+ outU8Array[outIdx++] = 0xF8 | (u >> 24);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ } else {
+ if (outIdx + 5 >= endIdx) break;
+ outU8Array[outIdx++] = 0xFC | (u >> 30);
+ outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+ outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+ outU8Array[outIdx++] = 0x80 | (u & 63);
+ }
+ }
+ // Null-terminate the pointer to the buffer.
+ outU8Array[outIdx] = 0;
+ return outIdx - startIdx;
+}
+Module["stringToUTF8Array"] = stringToUTF8Array;
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+Module["stringToUTF8"] = stringToUTF8;
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF8(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var u = str.charCodeAt(i); // possibly a lead surrogate
+ if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+ if (u <= 0x7F) {
+ ++len;
+ } else if (u <= 0x7FF) {
+ len += 2;
+ } else if (u <= 0xFFFF) {
+ len += 3;
+ } else if (u <= 0x1FFFFF) {
+ len += 4;
+ } else if (u <= 0x3FFFFFF) {
+ len += 5;
+ } else {
+ len += 6;
+ }
+ }
+ return len;
+}
+Module["lengthBytesUTF8"] = lengthBytesUTF8;
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
+function UTF16ToString(ptr) {
+ assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
+ var endPtr = ptr;
+ // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+ // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+ var idx = endPtr >> 1;
+ while (HEAP16[idx]) ++idx;
+ endPtr = idx << 1;
+
+ if (endPtr - ptr > 32 && UTF16Decoder) {
+ return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
+ } else {
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+ if (codeUnit == 0) return str;
+ ++i;
+ // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+ str += String.fromCharCode(codeUnit);
+ }
+ }
+}
+
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+ assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 2) return 0;
+ maxBytesToWrite -= 2; // Null terminator.
+ var startPtr = outPtr;
+ var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+ for (var i = 0; i < numCharsToWrite; ++i) {
+ // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ HEAP16[((outPtr)>>1)]=codeUnit;
+ outPtr += 2;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP16[((outPtr)>>1)]=0;
+ return outPtr - startPtr;
+}
+
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+ return str.length*2;
+}
+
+
+function UTF32ToString(ptr) {
+ assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
+ var i = 0;
+
+ var str = '';
+ while (1) {
+ var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+ if (utf32 == 0)
+ return str;
+ ++i;
+ // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ if (utf32 >= 0x10000) {
+ var ch = utf32 - 0x10000;
+ str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+ } else {
+ str += String.fromCharCode(utf32);
+ }
+ }
+}
+
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+// str: the Javascript string to copy.
+// outPtr: Byte address in Emscripten HEAP where to write the string to.
+// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+ assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
+ assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+ // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+ if (maxBytesToWrite === undefined) {
+ maxBytesToWrite = 0x7FFFFFFF;
+ }
+ if (maxBytesToWrite < 4) return 0;
+ var startPtr = outPtr;
+ var endPtr = startPtr + maxBytesToWrite - 4;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+ var trailSurrogate = str.charCodeAt(++i);
+ codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+ }
+ HEAP32[((outPtr)>>2)]=codeUnit;
+ outPtr += 4;
+ if (outPtr + 4 > endPtr) break;
+ }
+ // Null-terminate the pointer to the HEAP.
+ HEAP32[((outPtr)>>2)]=0;
+ return outPtr - startPtr;
+}
+
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+ var len = 0;
+ for (var i = 0; i < str.length; ++i) {
+ // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+ // See http://unicode.org/faq/utf_bom.html#utf16-3
+ var codeUnit = str.charCodeAt(i);
+ if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+ len += 4;
+ }
+
+ return len;
+}
+
+
+function demangle(func) {
+ var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
+ if (__cxa_demangle_func) {
+ try {
+ var s =
+ func.substr(1);
+ var len = lengthBytesUTF8(s)+1;
+ var buf = _malloc(len);
+ stringToUTF8(s, buf, len);
+ var status = _malloc(4);
+ var ret = __cxa_demangle_func(buf, 0, 0, status);
+ if (getValue(status, 'i32') === 0 && ret) {
+ return Pointer_stringify(ret);
+ }
+ // otherwise, libcxxabi failed
+ } catch(e) {
+ // ignore problems here
+ } finally {
+ if (buf) _free(buf);
+ if (status) _free(status);
+ if (ret) _free(ret);
+ }
+ // failure when using libcxxabi, don't demangle
+ return func;
+ }
+ Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
+ return func;
+}
+
+function demangleAll(text) {
+ var regex =
+ /__Z[\w\d_]+/g;
+ return text.replace(regex,
+ function(x) {
+ var y = demangle(x);
+ return x === y ? x : (x + ' [' + y + ']');
+ });
+}
+
+function jsStackTrace() {
+ var err = new Error();
+ if (!err.stack) {
+ // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+ // so try that as a special-case.
+ try {
+ throw new Error(0);
+ } catch(e) {
+ err = e;
+ }
+ if (!err.stack) {
+ return '(no stack trace available)';
+ }
+ }
+ return err.stack.toString();
+}
+
+function stackTrace() {
+ var js = jsStackTrace();
+ if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+ return demangleAll(js);
+}
+Module["stackTrace"] = stackTrace;
+
+// Memory management
+
+var PAGE_SIZE = 16384;
+var WASM_PAGE_SIZE = 65536;
+var ASMJS_PAGE_SIZE = 16777216;
+var MIN_TOTAL_MEMORY = 16777216;
+
+function alignUp(x, multiple) {
+ if (x % multiple > 0) {
+ x += multiple - (x % multiple);
+ }
+ return x;
+}
+
+var HEAP;
+var buffer;
+var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
+
+function updateGlobalBuffer(buf) {
+ Module['buffer'] = buffer = buf;
+}
+
+function updateGlobalBufferViews() {
+ Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
+ Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
+ Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
+ Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
+ Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
+ Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
+ Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
+ Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
+}
+
+var STATIC_BASE, STATICTOP, staticSealed; // static area
+var STACK_BASE, STACKTOP, STACK_MAX; // stack area
+var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
+
+ STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
+ staticSealed = false;
+
+
+// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+function writeStackCookie() {
+ assert((STACK_MAX & 3) == 0);
+ HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
+ HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
+}
+
+function checkStackCookie() {
+ if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
+ abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
+ }
+ // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
+ if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
+}
+
+function abortStackOverflow(allocSize) {
+ abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - asm.stackSave() + allocSize) + ' bytes available!');
+}
+
+function abortOnCannotGrowMemory() {
+ abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
+}
+
+
+function enlargeMemory() {
+ abortOnCannotGrowMemory();
+}
+
+
+var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
+var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864;
+if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
+
+// Initialize the runtime's memory
+// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
+assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
+ 'JS engine does not provide full typed array support');
+
+
+
+// Use a provided buffer, if there is one, or else allocate a new one
+if (Module['buffer']) {
+ buffer = Module['buffer'];
+ assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength);
+} else {
+ // Use a WebAssembly memory where available
+ {
+ buffer = new ArrayBuffer(TOTAL_MEMORY);
+ }
+ assert(buffer.byteLength === TOTAL_MEMORY);
+}
+updateGlobalBufferViews();
+
+
+function getTotalMemory() {
+ return TOTAL_MEMORY;
+}
+
+// Endianness check (note: assumes compiler arch was little-endian)
+ HEAP32[0] = 0x63736d65; /* 'emsc' */
+HEAP16[1] = 0x6373;
+if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
+
+Module['HEAP'] = HEAP;
+Module['buffer'] = buffer;
+Module['HEAP8'] = HEAP8;
+Module['HEAP16'] = HEAP16;
+Module['HEAP32'] = HEAP32;
+Module['HEAPU8'] = HEAPU8;
+Module['HEAPU16'] = HEAPU16;
+Module['HEAPU32'] = HEAPU32;
+Module['HEAPF32'] = HEAPF32;
+Module['HEAPF64'] = HEAPF64;
+
+function callRuntimeCallbacks(callbacks) {
+ while(callbacks.length > 0) {
+ var callback = callbacks.shift();
+ if (typeof callback == 'function') {
+ callback();
+ continue;
+ }
+ var func = callback.func;
+ if (typeof func === 'number') {
+ if (callback.arg === undefined) {
+ Module['dynCall_v'](func);
+ } else {
+ Module['dynCall_vi'](func, callback.arg);
+ }
+ } else {
+ func(callback.arg === undefined ? null : callback.arg);
+ }
+ }
+}
+
+var __ATPRERUN__ = []; // functions called before the runtime is initialized
+var __ATINIT__ = []; // functions called during startup
+var __ATMAIN__ = []; // functions called when main() is to be run
+var __ATEXIT__ = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the runtime has exited
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+
+function preRun() {
+ // compatibility - merge in anything from Module['preRun'] at this time
+ if (Module['preRun']) {
+ if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+ while (Module['preRun'].length) {
+ addOnPreRun(Module['preRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+ checkStackCookie();
+ if (runtimeInitialized) return;
+ runtimeInitialized = true;
+ callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+ checkStackCookie();
+ callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+ checkStackCookie();
+ callRuntimeCallbacks(__ATEXIT__);
+ runtimeExited = true;
+}
+
+function postRun() {
+ checkStackCookie();
+ // compatibility - merge in anything from Module['postRun'] at this time
+ if (Module['postRun']) {
+ if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+ while (Module['postRun'].length) {
+ addOnPostRun(Module['postRun'].shift());
+ }
+ }
+ callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+ __ATPRERUN__.unshift(cb);
+}
+Module["addOnPreRun"] = addOnPreRun;
+
+function addOnInit(cb) {
+ __ATINIT__.unshift(cb);
+}
+Module["addOnInit"] = addOnInit;
+
+function addOnPreMain(cb) {
+ __ATMAIN__.unshift(cb);
+}
+Module["addOnPreMain"] = addOnPreMain;
+
+function addOnExit(cb) {
+ __ATEXIT__.unshift(cb);
+}
+Module["addOnExit"] = addOnExit;
+
+function addOnPostRun(cb) {
+ __ATPOSTRUN__.unshift(cb);
+}
+Module["addOnPostRun"] = addOnPostRun;
+
+// Tools
+
+
+function intArrayFromString(stringy, dontAddNull, length /* optional */) {
+ var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+ var u8array = new Array(len);
+ var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+ if (dontAddNull) u8array.length = numBytesWritten;
+ return u8array;
+}
+Module["intArrayFromString"] = intArrayFromString;
+
+function intArrayToString(array) {
+ var ret = [];
+ for (var i = 0; i < array.length; i++) {
+ var chr = array[i];
+ if (chr > 0xFF) {
+ assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
+ chr &= 0xFF;
+ }
+ ret.push(String.fromCharCode(chr));
+ }
+ return ret.join('');
+}
+Module["intArrayToString"] = intArrayToString;
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+function writeStringToMemory(string, buffer, dontAddNull) {
+ Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+ var lastChar, end;
+ if (dontAddNull) {
+ // stringToUTF8Array always appends null. If we don't want to do that, remember the
+ // character that existed at the location where the null will be placed, and restore
+ // that after the write (below).
+ end = buffer + lengthBytesUTF8(string);
+ lastChar = HEAP8[end];
+ }
+ stringToUTF8(string, buffer, Infinity);
+ if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+Module["writeStringToMemory"] = writeStringToMemory;
+
+function writeArrayToMemory(array, buffer) {
+ assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
+ HEAP8.set(array, buffer);
+}
+Module["writeArrayToMemory"] = writeArrayToMemory;
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+ for (var i = 0; i < str.length; ++i) {
+ assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
+ HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+ }
+ // Null-terminate the pointer to the HEAP.
+ if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+Module["writeAsciiToMemory"] = writeAsciiToMemory;
+
+function unSign(value, bits, ignore) {
+ if (value >= 0) {
+ return value;
+ }
+ return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+ : Math.pow(2, bits) + value;
+}
+function reSign(value, bits, ignore) {
+ if (value <= 0) {
+ return value;
+ }
+ var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+ : Math.pow(2, bits-1);
+ if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+ // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+ // TODO: In i64 mode 1, resign the two parts separately and safely
+ value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+ }
+ return value;
+}
+
+
+// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
+if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
+ var ah = a >>> 16;
+ var al = a & 0xffff;
+ var bh = b >>> 16;
+ var bl = b & 0xffff;
+ return (al*bl + ((ah*bl + al*bh) << 16))|0;
+};
+Math.imul = Math['imul'];
+
+
+if (!Math['clz32']) Math['clz32'] = function(x) {
+ x = x >>> 0;
+ for (var i = 0; i < 32; i++) {
+ if (x & (1 << (31 - i))) return i;
+ }
+ return 32;
+};
+Math.clz32 = Math['clz32']
+
+if (!Math['trunc']) Math['trunc'] = function(x) {
+ return x < 0 ? Math.ceil(x) : Math.floor(x);
+};
+Math.trunc = Math['trunc'];
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_round = Math.round;
+var Math_min = Math.min;
+var Math_clz32 = Math.clz32;
+var Math_trunc = Math.trunc;
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+ var orig = id;
+ while (1) {
+ if (!runDependencyTracking[id]) return id;
+ id = orig + Math.random();
+ }
+ return id;
+}
+
+function addRunDependency(id) {
+ runDependencies++;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (id) {
+ assert(!runDependencyTracking[id]);
+ runDependencyTracking[id] = 1;
+ if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
+ // Check for missing dependencies every few seconds
+ runDependencyWatcher = setInterval(function() {
+ if (ABORT) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ return;
+ }
+ var shown = false;
+ for (var dep in runDependencyTracking) {
+ if (!shown) {
+ shown = true;
+ Module.printErr('still waiting on run dependencies:');
+ }
+ Module.printErr('dependency: ' + dep);
+ }
+ if (shown) {
+ Module.printErr('(end of list)');
+ }
+ }, 10000);
+ }
+ } else {
+ Module.printErr('warning: run dependency added without ID');
+ }
+}
+Module["addRunDependency"] = addRunDependency;
+
+function removeRunDependency(id) {
+ runDependencies--;
+ if (Module['monitorRunDependencies']) {
+ Module['monitorRunDependencies'](runDependencies);
+ }
+ if (id) {
+ assert(runDependencyTracking[id]);
+ delete runDependencyTracking[id];
+ } else {
+ Module.printErr('warning: run dependency removed without ID');
+ }
+ if (runDependencies == 0) {
+ if (runDependencyWatcher !== null) {
+ clearInterval(runDependencyWatcher);
+ runDependencyWatcher = null;
+ }
+ if (dependenciesFulfilled) {
+ var callback = dependenciesFulfilled;
+ dependenciesFulfilled = null;
+ callback(); // can add another dependenciesFulfilled
+ }
+ }
+}
+Module["removeRunDependency"] = removeRunDependency;
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+
+var memoryInitializer = null;
+
+
+
+
+
+
+// === Body ===
+
+var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } }];
+
+function _emscripten_asm_const_iii(code, a0, a1) {
+ return ASM_CONSTS[code](a0, a1);
+}
+
+
+
+STATIC_BASE = 8;
+
+STATICTOP = STATIC_BASE + 25904;
+ /* global initializers */ __ATINIT__.push();
+
+
+/* memory initializer */ allocate([32,3,0,0,194,1,0,0,0,0,64,64,0,0,64,64,0,0,64,64,0,0,0,0,0,0,192,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,52,66,56,20,0,0,66,20,0,0,80,20,0,0,93,20,0,0,103,20,0,0,118,20,0,0,134,20,0,0,148,20,0,0,158,20,0,0,166,20,0,0,172,20,0,0,178,20,0,0,1,1,0,0,1,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,205,204,12,64,0,0,128,63,0,0,128,63,46,186,232,62,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,0,0,128,191,20,0,0,0,255,255,255,255,205,204,236,63,2,0,0,0,86,1,0,0,85,1,0,0,87,0,0,0,83,0,0,0,68,0,0,0,65,0,0,0,69,0,0,0,81,0,0,0,255,255,255,255,0,1,0,0,255,255,255,255,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,188,89,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,124,16,0,0,5,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,3,0,0,0,39,97,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,124,16,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,95,112,137,0,255,9,47,15,114,97,121,108,105,98,32,91,115,104,97,100,101,114,115,93,32,101,120,97,109,112,108,101,32,45,32,112,111,115,116,112,114,111,99,101,115,115,105,110,103,32,115,104,97,100,101,114,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,46,111,98,106,0,114,101,115,111,117,114,99,101,115,47,109,111,100,101,108,47,100,119,97,114,102,95,100,105,102,102,117,115,101,46,112,110,103,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,49,48,48,47,98,97,115,101,46,118,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,103,114,97,121,115,99,97,108,101,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,112,111,115,116,101,114,105,122,97,116,105,111,110,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,100,114,101,97,109,95,118,105,115,105,111,110,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,112,105,120,101,108,105,122,101,114,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,99,114,111,115,115,95,104,97,116,99,104,105,110,103,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,99,114,111,115,115,95,115,116,105,116,99,104,105,110,103,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,112,114,101,100,97,116,111,114,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,115,99,97,110,108,105,110,101,115,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,102,105,115,104,101,121,101,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,115,111,98,101,108,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,98,108,111,111,109,46,102,115,0,114,101,115,111,117,114,99,101,115,47,115,104,97,100,101,114,115,47,103,108,115,108,37,105,47,98,108,117,114,46,102,115,0,40,99,41,32,68,119,97,114,102,32,51,68,32,109,111,100,101,108,32,98,121,32,68,97,118,105,100,32,77,111,114,101,110,111,0,67,85,82,82,69,78,84,32,80,79,83,84,80,82,79,32,83,72,65,68,69,82,58,0,60,32,62,0,71,82,65,89,83,67,65,76,69,0,80,79,83,84,69,82,73,90,65,84,73,79,78,0,68,82,69,65,77,95,86,73,83,73,79,78,0,80,73,88,69,76,73,90,69,82,0,67,82,79,83,83,95,72,65,84,67,72,73,78,71,0,67,82,79,83,83,95,83,84,73,84,67,72,73,78,71,0,80,82,69,68,65,84,79,82,95,86,73,69,87,0,83,67,65,78,76,73,78,69,83,0,70,73,83,72,69,89,69,0,83,79,66,69,76,0,66,76,79,79,77,0,66,76,85,82,0,5,5,4,0,2,3,7,0,3,3,11,0,91,37,115,93,32,114,82,69,83,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,84,104,105,115,32,105,115,32,110,111,116,32,97,32,118,97,108,105,100,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,115,111,117,114,99,101,32,100,97,116,97,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,113,117,101,115,116,101,100,32,114,101,115,111,117,114,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,79,117,116,32,111,102,32,109,101,109,111,114,121,32,119,104,105,108,101,32,100,101,99,111,109,112,114,101,115,115,105,110,103,32,100,97,116,97,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,105,111,110,32,102,97,105,108,101,100,0,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,32,100,111,32,110,111,116,32,109,97,116,99,104,44,32,100,97,116,97,32,109,97,121,32,98,101,32,99,111,114,114,117,112,116,101,100,0,32,45,45,32,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,32,45,45,32,82,101,116,117,114,110,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,102,114,111,109,32,37,117,32,98,121,116,101,115,32,116,111,32,37,117,32,98,121,116,101,115,0,73,78,70,79,58,32,0,87,65,82,78,73,78,71,58,32,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,80,97,114,97,109,101,116,101,114,115,58,32,37,105,120,37,105,44,32,37,105,32,109,105,112,115,44,32,102,111,114,109,97,116,32,37,105,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,46,114,114,101,115,0,91,37,115,93,32,82,101,115,111,117,114,99,101,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,99,111,110,116,97,105,110,32,105,109,97,103,101,32,100,97,116,97,0,46,112,110,103,0,114,98,0,46,104,100,114,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,40,111,110,108,121,32,51,32,99,104,97,110,110,101,108,32,51,50,32,98,105,116,32,102,108,111,97,116,115,41,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,111,117,116,111,102,109,101,109,0,114,105,46,98,105,116,115,95,112,101,114,95,99,104,97,110,110,101,108,32,61,61,32,49,54,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,108,111,97,100,95,97,110,100,95,112,111,115,116,112,114,111,99,101,115,115,95,56,98,105,116,0,98,97,100,32,114,101,113,95,99,111,109,112,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,49,54,0,48,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,116,111,111,32,108,97,114,103,101,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49,54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,110,32,61,61,32,51,0,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,8,8,8,8,8,8,8,8,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,112,110,103,32,115,105,103,0,35,63,82,65,68,73,65,78,67,69,0,35,63,82,71,66,69,0,110,111,116,32,72,68,82,0,70,79,82,77,65,84,61,51,50,45,98,105,116,95,114,108,101,95,114,103,98,101,0,117,110,115,117,112,112,111,114,116,101,100,32,102,111,114,109,97,116,0,45,89,32,0,117,110,115,117,112,112,111,114,116,101,100,32,100,97,116,97,32,108,97,121,111,117,116,0,43,88,32,0,105,110,118,97,108,105,100,32,100,101,99,111,100,101,100,32,115,99,97,110,108,105,110,101,32,108,101,110,103,116,104,0,99,111,114,114,117,112,116,0,35,63,82,65,68,73,65,78,67,69,10,0,35,63,82,71,66,69,10,0,73,109,97,103,101,32,102,111,114,109,97,116,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,37,50,105,32,70,80,83,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,70,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,46,46,46,0,70,114,97,109,101,98,117,102,102,101,114,32,105,115,32,117,110,115,117,112,112,111,114,116,101,100,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,97,116,116,97,99,104,109,101,110,116,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,100,105,109,101,110,115,105,111,110,115,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,109,105,115,115,105,110,103,32,97,116,116,97,99,104,109,101,110,116,0,91,70,66,79,32,73,68,32,37,105,93,32,70,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,46,111,98,106,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,86,65,79,32,73,68,32,37,105,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,115,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,37,42,91,94,10,93,115,10,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,47,37,105,32,37,105,47,47,37,105,32,37,105,47,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,118,101,114,116,101,120,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,40,109,101,115,104,32,97,110,100,32,109,97,116,101,114,105,97,108,41,32,102,114,111,109,32,82,65,77,32,97,110,100,32,86,82,65,77,0,109,111,100,101,108,77,97,116,114,105,120,0,118,105,101,119,68,105,114,0,103,108,111,115,115,105,110,101,115,115,0,117,115,101,78,111,114,109,97,108,0,117,115,101,83,112,101,99,117,108,97,114,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,55,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,69,115,99,97,112,101,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,79,69,83,95,116,101,120,116,117,114,101,95,102,108,111,97,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
+/* memory initializer */ allocate([105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,102,105,108,116,101,114,95,97,110,105,115,111,116,114,111,112,105,99,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,109,105,114,114,111,114,95,99,108,97,109,112,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,110,105,115,111,116,114,111,112,105,99,32,116,101,120,116,117,114,101,115,32,102,105,108,116,101,114,105,110,103,32,115,117,112,112,111,114,116,101,100,32,40,109,97,120,58,32,37,46,48,102,88,41,0,91,69,88,84,69,78,83,73,79,78,93,32,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,116,101,120,116,117,114,101,32,109,111,100,101,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,114,116,0,91,37,115,93,32,84,101,120,116,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,67,117,115,116,111,109,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,83,72,68,82,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,32,100,97,116,97,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,110,97,110,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240);
+
+
+
+
+
+/* no memory initializer */
+var tempDoublePtr = STATICTOP; STATICTOP += 16;
+
+assert(tempDoublePtr % 8 == 0);
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+}
+
+function copyTempDouble(ptr) {
+
+ HEAP8[tempDoublePtr] = HEAP8[ptr];
+
+ HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+
+ HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+
+ HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+
+ HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+
+ HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+
+ HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+
+ HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+
+}
+
+// {{PRE_LIBRARY}}
+
+
+
+ var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
+ GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
+ for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
+ GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
+ }
+
+ // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
+ // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
+ for (var i = 0; i < 32; i++) {
+ GL.tempFixedLengthArray.push(new Array(i));
+ }
+ },recordError:function recordError(errorCode) {
+ if (!GL.lastError) {
+ GL.lastError = errorCode;
+ }
+ },getNewId:function (table) {
+ var ret = GL.counter++;
+ for (var i = table.length; i < ret; i++) {
+ table[i] = null;
+ }
+ return ret;
+ },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
+ var source = '';
+ for (var i = 0; i < count; ++i) {
+ var frag;
+ if (length) {
+ var len = HEAP32[(((length)+(i*4))>>2)];
+ if (len < 0) {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+ } else {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
+ }
+ } else {
+ frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
+ }
+ source += frag;
+ }
+ return source;
+ },createContext:function (canvas, webGLContextAttributes) {
+ if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
+ webGLContextAttributes['majorVersion'] = 1;
+ webGLContextAttributes['minorVersion'] = 0;
+ }
+ var ctx;
+ var errorInfo = '?';
+ function onContextCreationError(event) {
+ errorInfo = event.statusMessage || errorInfo;
+ }
+ try {
+ canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
+ try {
+ if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
+ ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
+ } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
+ ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
+ } else {
+ throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
+ }
+ } finally {
+ canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
+ }
+ if (!ctx) throw ':(';
+ } catch (e) {
+ Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
+ return 0;
+ }
+ // possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
+
+ if (!ctx) return 0;
+ return GL.registerContext(ctx, webGLContextAttributes);
+ },registerContext:function (ctx, webGLContextAttributes) {
+ var handle = GL.getNewId(GL.contexts);
+ var context = {
+ handle: handle,
+ attributes: webGLContextAttributes,
+ version: webGLContextAttributes['majorVersion'],
+ GLctx: ctx
+ };
+
+
+ // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
+ if (ctx.canvas) ctx.canvas.GLctxObject = context;
+ GL.contexts[handle] = context;
+ if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
+ GL.initExtensions(context);
+ }
+ return handle;
+ },makeContextCurrent:function (contextHandle) {
+ var context = GL.contexts[contextHandle];
+ if (!context) return false;
+ GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
+ GL.currentContext = context; // Active Emscripten GL layer context object.
+ return true;
+ },getContext:function (contextHandle) {
+ return GL.contexts[contextHandle];
+ },deleteContext:function (contextHandle) {
+ if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+ if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
+ if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
+ GL.contexts[contextHandle] = null;
+ },initExtensions:function (context) {
+ // If this function is called without a specific context object, init the extensions of the currently active context.
+ if (!context) context = GL.currentContext;
+
+ if (context.initExtensionsDone) return;
+ context.initExtensionsDone = true;
+
+ var GLctx = context.GLctx;
+
+ context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
+
+ // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
+
+ if (context.version < 2) {
+ // Extension available from Firefox 26 and Google Chrome 30
+ var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
+ if (instancedArraysExt) {
+ GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
+ GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
+ GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
+ }
+
+ // Extension available from Firefox 25 and WebKit
+ var vaoExt = GLctx.getExtension('OES_vertex_array_object');
+ if (vaoExt) {
+ GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
+ GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
+ GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
+ GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
+ }
+
+ var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
+ if (drawBuffersExt) {
+ GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
+ }
+ }
+
+ GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+
+ // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
+ // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
+ // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
+ // here, as long as they don't produce a performance impact for users that might not be using those extensions.
+ // E.g. debugging-related extensions should probably be off by default.
+ var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
+ "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
+ "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
+ "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
+ "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
+ "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
+ "EXT_shader_texture_lod", "EXT_color_buffer_float"];
+
+ function shouldEnableAutomatically(extension) {
+ var ret = false;
+ automaticallyEnabledExtensions.forEach(function(include) {
+ if (ext.indexOf(include) != -1) {
+ ret = true;
+ }
+ });
+ return ret;
+ }
+
+ var exts = GLctx.getSupportedExtensions();
+ if (exts && exts.length > 0) {
+ GLctx.getSupportedExtensions().forEach(function(ext) {
+ if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
+ GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
+ }
+ });
+ }
+ },populateUniformTable:function (program) {
+ var p = GL.programs[program];
+ GL.programInfos[program] = {
+ uniforms: {},
+ maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
+ maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
+ maxUniformBlockNameLength: -1 // Lazily computed as well
+ };
+
+ var ptable = GL.programInfos[program];
+ var utable = ptable.uniforms;
+ // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
+ // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
+ var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
+ for (var i = 0; i < numUniforms; ++i) {
+ var u = GLctx.getActiveUniform(p, i);
+
+ var name = u.name;
+ ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
+
+ // Strip off any trailing array specifier we might have got, e.g. "[0]".
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ name = name.slice(0, ls);
+ }
+
+ // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
+ // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
+ // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
+ var loc = GLctx.getUniformLocation(p, name);
+ if (loc != null)
+ {
+ var id = GL.getNewId(GL.uniforms);
+ utable[name] = [u.size, id];
+ GL.uniforms[id] = loc;
+
+ for (var j = 1; j < u.size; ++j) {
+ var n = name + '['+j+']';
+ loc = GLctx.getUniformLocation(p, n);
+ id = GL.getNewId(GL.uniforms);
+
+ GL.uniforms[id] = loc;
+ }
+ }
+ }
+ }};function _emscripten_glIsRenderbuffer(renderbuffer) {
+ var rb = GL.renderbuffers[renderbuffer];
+ if (!rb) return 0;
+ return GLctx.isRenderbuffer(rb);
+ }
+
+ function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
+
+
+
+ function _emscripten_get_now() { abort() }
+
+
+
+ function _emscripten_set_main_loop_timing(mode, value) {
+ Browser.mainLoop.timingMode = mode;
+ Browser.mainLoop.timingValue = value;
+
+ if (!Browser.mainLoop.func) {
+ console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
+ return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
+ }
+
+ if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
+ var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
+ setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
+ };
+ Browser.mainLoop.method = 'timeout';
+ } else if (mode == 1 /*EM_TIMING_RAF*/) {
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
+ Browser.requestAnimationFrame(Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = 'rAF';
+ } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
+ if (!window['setImmediate']) {
+ // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
+ var setImmediates = [];
+ var emscriptenMainLoopMessageId = 'setimmediate';
+ function Browser_setImmediate_messageHandler(event) {
+ if (event.source === window && event.data === emscriptenMainLoopMessageId) {
+ event.stopPropagation();
+ setImmediates.shift()();
+ }
+ }
+ window.addEventListener("message", Browser_setImmediate_messageHandler, true);
+ window['setImmediate'] = function Browser_emulated_setImmediate(func) {
+ setImmediates.push(func);
+ if (ENVIRONMENT_IS_WORKER) {
+ if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
+ Module['setImmediates'].push(func);
+ window.postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
+ } else window.postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
+ }
+ }
+ Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
+ window['setImmediate'](Browser.mainLoop.runner);
+ };
+ Browser.mainLoop.method = 'immediate';
+ }
+ return 0;
+ }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
+ Module['noExitRuntime'] = true;
+
+ assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
+
+ Browser.mainLoop.func = func;
+ Browser.mainLoop.arg = arg;
+
+ var browserIterationFunc;
+ if (typeof arg !== 'undefined') {
+ browserIterationFunc = function() {
+ Module['dynCall_vi'](func, arg);
+ };
+ } else {
+ browserIterationFunc = function() {
+ Module['dynCall_v'](func);
+ };
+ }
+
+ var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
+
+ Browser.mainLoop.runner = function Browser_mainLoop_runner() {
+ if (ABORT) return;
+ if (Browser.mainLoop.queue.length > 0) {
+ var start = Date.now();
+ var blocker = Browser.mainLoop.queue.shift();
+ blocker.func(blocker.arg);
+ if (Browser.mainLoop.remainingBlockers) {
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
+ if (blocker.counted) {
+ Browser.mainLoop.remainingBlockers = next;
+ } else {
+ // not counted, but move the progress along a tiny bit
+ next = next + 0.5; // do not steal all the next one's progress
+ Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
+ }
+ }
+ console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
+ Browser.mainLoop.updateStatus();
+
+ // catches pause/resume main loop from blocker execution
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+
+ setTimeout(Browser.mainLoop.runner, 0);
+ return;
+ }
+
+ // catch pauses from non-main loop sources
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+
+ // Implement very basic swap interval control
+ Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
+ if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
+ // Not the scheduled time to render this frame - skip.
+ Browser.mainLoop.scheduler();
+ return;
+ } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
+ Browser.mainLoop.tickStartTime = _emscripten_get_now();
+ }
+
+ // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
+ // VBO double-buffering and reduce GPU stalls.
+
+
+ if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
+ Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
+ Browser.mainLoop.method = ''; // just warn once per call to set main loop
+ }
+
+ Browser.mainLoop.runIter(browserIterationFunc);
+
+ checkStackCookie();
+
+ // catch pauses from the main loop itself
+ if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+
+ // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
+ // to queue the newest produced audio samples.
+ // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
+ // do not need to be hardcoded into this function, but can be more generic.
+ if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
+
+ Browser.mainLoop.scheduler();
+ }
+
+ if (!noSetTiming) {
+ if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
+ else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
+
+ Browser.mainLoop.scheduler();
+ }
+
+ if (simulateInfiniteLoop) {
+ throw 'SimulateInfiniteLoop';
+ }
+ }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
+ Browser.mainLoop.scheduler = null;
+ Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
+ },resume:function () {
+ Browser.mainLoop.currentlyRunningMainloop++;
+ var timingMode = Browser.mainLoop.timingMode;
+ var timingValue = Browser.mainLoop.timingValue;
+ var func = Browser.mainLoop.func;
+ Browser.mainLoop.func = null;
+ _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
+ _emscripten_set_main_loop_timing(timingMode, timingValue);
+ Browser.mainLoop.scheduler();
+ },updateStatus:function () {
+ if (Module['setStatus']) {
+ var message = Module['statusMessage'] || 'Please wait...';
+ var remaining = Browser.mainLoop.remainingBlockers;
+ var expected = Browser.mainLoop.expectedBlockers;
+ if (remaining) {
+ if (remaining < expected) {
+ Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
+ } else {
+ Module['setStatus'](message);
+ }
+ } else {
+ Module['setStatus']('');
+ }
+ }
+ },runIter:function (func) {
+ if (ABORT) return;
+ if (Module['preMainLoop']) {
+ var preRet = Module['preMainLoop']();
+ if (preRet === false) {
+ return; // |return false| skips a frame
+ }
+ }
+ try {
+ func();
+ } catch (e) {
+ if (e instanceof ExitStatus) {
+ return;
+ } else {
+ if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
+ throw e;
+ }
+ }
+ if (Module['postMainLoop']) Module['postMainLoop']();
+ }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
+ if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
+
+ if (Browser.initted) return;
+ Browser.initted = true;
+
+ try {
+ new Blob();
+ Browser.hasBlobConstructor = true;
+ } catch(e) {
+ Browser.hasBlobConstructor = false;
+ console.log("warning: no blob constructor, cannot create blobs with mimetypes");
+ }
+ Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
+ Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
+ if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
+ console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
+ Module.noImageDecoding = true;
+ }
+
+ // Support for plugins that can process preloaded files. You can add more of these to
+ // your app by creating and appending to Module.preloadPlugins.
+ //
+ // Each plugin is asked if it can handle a file based on the file's name. If it can,
+ // it is given the file's raw data. When it is done, it calls a callback with the file's
+ // (possibly modified) data. For example, a plugin might decompress a file, or it
+ // might create some side data structure for use later (like an Image element, etc.).
+
+ var imagePlugin = {};
+ imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
+ return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
+ };
+ imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+ var b = null;
+ if (Browser.hasBlobConstructor) {
+ try {
+ b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+ if (b.size !== byteArray.length) { // Safari bug #118630
+ // Safari's Blob can only take an ArrayBuffer
+ b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
+ }
+ } catch(e) {
+ Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
+ }
+ }
+ if (!b) {
+ var bb = new Browser.BlobBuilder();
+ bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
+ b = bb.getBlob();
+ }
+ var url = Browser.URLObject.createObjectURL(b);
+ assert(typeof url == 'string', 'createObjectURL must return a url as a string');
+ var img = new Image();
+ img.onload = function img_onload() {
+ assert(img.complete, 'Image ' + name + ' could not be decoded');
+ var canvas = document.createElement('canvas');
+ canvas.width = img.width;
+ canvas.height = img.height;
+ var ctx = canvas.getContext('2d');
+ ctx.drawImage(img, 0, 0);
+ Module["preloadedImages"][name] = canvas;
+ Browser.URLObject.revokeObjectURL(url);
+ if (onload) onload(byteArray);
+ };
+ img.onerror = function img_onerror(event) {
+ console.log('Image ' + url + ' could not be decoded');
+ if (onerror) onerror();
+ };
+ img.src = url;
+ };
+ Module['preloadPlugins'].push(imagePlugin);
+
+ var audioPlugin = {};
+ audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
+ return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
+ };
+ audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+ var done = false;
+ function finish(audio) {
+ if (done) return;
+ done = true;
+ Module["preloadedAudios"][name] = audio;
+ if (onload) onload(byteArray);
+ }
+ function fail() {
+ if (done) return;
+ done = true;
+ Module["preloadedAudios"][name] = new Audio(); // empty shim
+ if (onerror) onerror();
+ }
+ if (Browser.hasBlobConstructor) {
+ try {
+ var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+ } catch(e) {
+ return fail();
+ }
+ var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
+ assert(typeof url == 'string', 'createObjectURL must return a url as a string');
+ var audio = new Audio();
+ audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
+ audio.onerror = function audio_onerror(event) {
+ if (done) return;
+ console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
+ function encode64(data) {
+ var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+ var PAD = '=';
+ var ret = '';
+ var leftchar = 0;
+ var leftbits = 0;
+ for (var i = 0; i < data.length; i++) {
+ leftchar = (leftchar << 8) | data[i];
+ leftbits += 8;
+ while (leftbits >= 6) {
+ var curr = (leftchar >> (leftbits-6)) & 0x3f;
+ leftbits -= 6;
+ ret += BASE[curr];
+ }
+ }
+ if (leftbits == 2) {
+ ret += BASE[(leftchar&3) << 4];
+ ret += PAD + PAD;
+ } else if (leftbits == 4) {
+ ret += BASE[(leftchar&0xf) << 2];
+ ret += PAD;
+ }
+ return ret;
+ }
+ audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
+ finish(audio); // we don't wait for confirmation this worked - but it's worth trying
+ };
+ audio.src = url;
+ // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
+ Browser.safeSetTimeout(function() {
+ finish(audio); // try to use it even though it is not necessarily ready to play
+ }, 10000);
+ } else {
+ return fail();
+ }
+ };
+ Module['preloadPlugins'].push(audioPlugin);
+
+ // Canvas event setup
+
+ function pointerLockChange() {
+ Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
+ document['mozPointerLockElement'] === Module['canvas'] ||
+ document['webkitPointerLockElement'] === Module['canvas'] ||
+ document['msPointerLockElement'] === Module['canvas'];
+ }
+ var canvas = Module['canvas'];
+ if (canvas) {
+ // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
+ // Module['forcedAspectRatio'] = 4 / 3;
+
+ canvas.requestPointerLock = canvas['requestPointerLock'] ||
+ canvas['mozRequestPointerLock'] ||
+ canvas['webkitRequestPointerLock'] ||
+ canvas['msRequestPointerLock'] ||
+ function(){};
+ canvas.exitPointerLock = document['exitPointerLock'] ||
+ document['mozExitPointerLock'] ||
+ document['webkitExitPointerLock'] ||
+ document['msExitPointerLock'] ||
+ function(){}; // no-op if function does not exist
+ canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+
+ document.addEventListener('pointerlockchange', pointerLockChange, false);
+ document.addEventListener('mozpointerlockchange', pointerLockChange, false);
+ document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
+ document.addEventListener('mspointerlockchange', pointerLockChange, false);
+
+ if (Module['elementPointerLock']) {
+ canvas.addEventListener("click", function(ev) {
+ if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+ Module['canvas'].requestPointerLock();
+ ev.preventDefault();
+ }
+ }, false);
+ }
+ }
+ },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
+ if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
+
+ var ctx;
+ var contextHandle;
+ if (useWebGL) {
+ // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
+ var contextAttributes = {
+ antialias: false,
+ alpha: false
+ };
+
+ if (webGLContextAttributes) {
+ for (var attribute in webGLContextAttributes) {
+ contextAttributes[attribute] = webGLContextAttributes[attribute];
+ }
+ }
+
+ contextHandle = GL.createContext(canvas, contextAttributes);
+ if (contextHandle) {
+ ctx = GL.getContext(contextHandle).GLctx;
+ }
+ } else {
+ ctx = canvas.getContext('2d');
+ }
+
+ if (!ctx) return null;
+
+ if (setInModule) {
+ if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
+
+ Module.ctx = ctx;
+ if (useWebGL) GL.makeContextCurrent(contextHandle);
+ Module.useWebGL = useWebGL;
+ Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
+ Browser.init();
+ }
+ return ctx;
+ },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
+ Browser.lockPointer = lockPointer;
+ Browser.resizeCanvas = resizeCanvas;
+ Browser.vrDevice = vrDevice;
+ if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
+ if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
+ if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
+
+ var canvas = Module['canvas'];
+ function fullscreenChange() {
+ Browser.isFullscreen = false;
+ var canvasContainer = canvas.parentNode;
+ if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+ document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+ document['webkitCurrentFullScreenElement']) === canvasContainer) {
+ canvas.exitFullscreen = document['exitFullscreen'] ||
+ document['cancelFullScreen'] ||
+ document['mozCancelFullScreen'] ||
+ document['msExitFullscreen'] ||
+ document['webkitCancelFullScreen'] ||
+ function() {};
+ canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
+ if (Browser.lockPointer) canvas.requestPointerLock();
+ Browser.isFullscreen = true;
+ if (Browser.resizeCanvas) Browser.setFullscreenCanvasSize();
+ } else {
+
+ // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+ canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+ canvasContainer.parentNode.removeChild(canvasContainer);
+
+ if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
+ }
+ if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
+ if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
+ Browser.updateCanvasDimensions(canvas);
+ }
+
+ if (!Browser.fullscreenHandlersInstalled) {
+ Browser.fullscreenHandlersInstalled = true;
+ document.addEventListener('fullscreenchange', fullscreenChange, false);
+ document.addEventListener('mozfullscreenchange', fullscreenChange, false);
+ document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
+ document.addEventListener('MSFullscreenChange', fullscreenChange, false);
+ }
+
+ // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+ var canvasContainer = document.createElement("div");
+ canvas.parentNode.insertBefore(canvasContainer, canvas);
+ canvasContainer.appendChild(canvas);
+
+ // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+ canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
+ canvasContainer['mozRequestFullScreen'] ||
+ canvasContainer['msRequestFullscreen'] ||
+ (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
+ (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
+
+ if (vrDevice) {
+ canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
+ } else {
+ canvasContainer.requestFullscreen();
+ }
+ },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
+ Module.printErr('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
+ Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
+ return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+ }
+ return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+ },nextRAF:0,fakeRequestAnimationFrame:function (func) {
+ // try to keep 60fps between calls to here
+ var now = Date.now();
+ if (Browser.nextRAF === 0) {
+ Browser.nextRAF = now + 1000/60;
+ } else {
+ while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
+ Browser.nextRAF += 1000/60;
+ }
+ }
+ var delay = Math.max(Browser.nextRAF - now, 0);
+ setTimeout(func, delay);
+ },requestAnimationFrame:function requestAnimationFrame(func) {
+ if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
+ Browser.fakeRequestAnimationFrame(func);
+ } else {
+ if (!window.requestAnimationFrame) {
+ window.requestAnimationFrame = window['requestAnimationFrame'] ||
+ window['mozRequestAnimationFrame'] ||
+ window['webkitRequestAnimationFrame'] ||
+ window['msRequestAnimationFrame'] ||
+ window['oRequestAnimationFrame'] ||
+ Browser.fakeRequestAnimationFrame;
+ }
+ window.requestAnimationFrame(func);
+ }
+ },safeCallback:function (func) {
+ return function() {
+ if (!ABORT) return func.apply(null, arguments);
+ };
+ },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
+ Browser.allowAsyncCallbacks = false;
+ },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
+ Browser.allowAsyncCallbacks = true;
+ if (Browser.queuedAsyncCallbacks.length > 0) {
+ var callbacks = Browser.queuedAsyncCallbacks;
+ Browser.queuedAsyncCallbacks = [];
+ callbacks.forEach(function(func) {
+ func();
+ });
+ }
+ },safeRequestAnimationFrame:function (func) {
+ return Browser.requestAnimationFrame(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } else {
+ Browser.queuedAsyncCallbacks.push(func);
+ }
+ });
+ },safeSetTimeout:function (func, timeout) {
+ Module['noExitRuntime'] = true;
+ return setTimeout(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } else {
+ Browser.queuedAsyncCallbacks.push(func);
+ }
+ }, timeout);
+ },safeSetInterval:function (func, timeout) {
+ Module['noExitRuntime'] = true;
+ return setInterval(function() {
+ if (ABORT) return;
+ if (Browser.allowAsyncCallbacks) {
+ func();
+ } // drop it on the floor otherwise, next interval will kick in
+ }, timeout);
+ },getMimetype:function (name) {
+ return {
+ 'jpg': 'image/jpeg',
+ 'jpeg': 'image/jpeg',
+ 'png': 'image/png',
+ 'bmp': 'image/bmp',
+ 'ogg': 'audio/ogg',
+ 'wav': 'audio/wav',
+ 'mp3': 'audio/mpeg'
+ }[name.substr(name.lastIndexOf('.')+1)];
+ },getUserMedia:function (func) {
+ if(!window.getUserMedia) {
+ window.getUserMedia = navigator['getUserMedia'] ||
+ navigator['mozGetUserMedia'];
+ }
+ window.getUserMedia(func);
+ },getMovementX:function (event) {
+ return event['movementX'] ||
+ event['mozMovementX'] ||
+ event['webkitMovementX'] ||
+ 0;
+ },getMovementY:function (event) {
+ return event['movementY'] ||
+ event['mozMovementY'] ||
+ event['webkitMovementY'] ||
+ 0;
+ },getMouseWheelDelta:function (event) {
+ var delta = 0;
+ switch (event.type) {
+ case 'DOMMouseScroll':
+ delta = event.detail;
+ break;
+ case 'mousewheel':
+ delta = event.wheelDelta;
+ break;
+ case 'wheel':
+ delta = event['deltaY'];
+ break;
+ default:
+ throw 'unrecognized mouse wheel event: ' + event.type;
+ }
+ return delta;
+ },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
+ if (Browser.pointerLock) {
+ // When the pointer is locked, calculate the coordinates
+ // based on the movement of the mouse.
+ // Workaround for Firefox bug 764498
+ if (event.type != 'mousemove' &&
+ ('mozMovementX' in event)) {
+ Browser.mouseMovementX = Browser.mouseMovementY = 0;
+ } else {
+ Browser.mouseMovementX = Browser.getMovementX(event);
+ Browser.mouseMovementY = Browser.getMovementY(event);
+ }
+
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
+ Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
+ } else {
+ // just add the mouse delta to the current absolut mouse position
+ // FIXME: ideally this should be clamped against the canvas size and zero
+ Browser.mouseX += Browser.mouseMovementX;
+ Browser.mouseY += Browser.mouseMovementY;
+ }
+ } else {
+ // Otherwise, calculate the movement based on the changes
+ // in the coordinates.
+ var rect = Module["canvas"].getBoundingClientRect();
+ var cw = Module["canvas"].width;
+ var ch = Module["canvas"].height;
+
+ // Neither .scrollX or .pageXOffset are defined in a spec, but
+ // we prefer .scrollX because it is currently in a spec draft.
+ // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+ var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
+ var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
+ // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
+ // and we have no viable fallback.
+ assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
+
+ if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
+ var touch = event.touch;
+ if (touch === undefined) {
+ return; // the "touch" property is only defined in SDL
+
+ }
+ var adjustedX = touch.pageX - (scrollX + rect.left);
+ var adjustedY = touch.pageY - (scrollY + rect.top);
+
+ adjustedX = adjustedX * (cw / rect.width);
+ adjustedY = adjustedY * (ch / rect.height);
+
+ var coords = { x: adjustedX, y: adjustedY };
+
+ if (event.type === 'touchstart') {
+ Browser.lastTouches[touch.identifier] = coords;
+ Browser.touches[touch.identifier] = coords;
+ } else if (event.type === 'touchend' || event.type === 'touchmove') {
+ var last = Browser.touches[touch.identifier];
+ if (!last) last = coords;
+ Browser.lastTouches[touch.identifier] = last;
+ Browser.touches[touch.identifier] = coords;
+ }
+ return;
+ }
+
+ var x = event.pageX - (scrollX + rect.left);
+ var y = event.pageY - (scrollY + rect.top);
+
+ // the canvas might be CSS-scaled compared to its backbuffer;
+ // SDL-using content will want mouse coordinates in terms
+ // of backbuffer units.
+ x = x * (cw / rect.width);
+ y = y * (ch / rect.height);
+
+ Browser.mouseMovementX = x - Browser.mouseX;
+ Browser.mouseMovementY = y - Browser.mouseY;
+ Browser.mouseX = x;
+ Browser.mouseY = y;
+ }
+ },asyncLoad:function (url, onload, onerror, noRunDep) {
+ var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
+ Module['readAsync'](url, function(arrayBuffer) {
+ assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
+ onload(new Uint8Array(arrayBuffer));
+ if (dep) removeRunDependency(dep);
+ }, function(event) {
+ if (onerror) {
+ onerror();
+ } else {
+ throw 'Loading data file "' + url + '" failed.';
+ }
+ });
+ if (dep) addRunDependency(dep);
+ },resizeListeners:[],updateResizeListeners:function () {
+ var canvas = Module['canvas'];
+ Browser.resizeListeners.forEach(function(listener) {
+ listener(canvas.width, canvas.height);
+ });
+ },setCanvasSize:function (width, height, noUpdates) {
+ var canvas = Module['canvas'];
+ Browser.updateCanvasDimensions(canvas, width, height);
+ if (!noUpdates) Browser.updateResizeListeners();
+ },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
+ flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
+ HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
+ }
+ Browser.updateResizeListeners();
+ },setWindowedCanvasSize:function () {
+ // check if SDL is available
+ if (typeof SDL != "undefined") {
+ var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
+ flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
+ HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
+ }
+ Browser.updateResizeListeners();
+ },updateCanvasDimensions:function (canvas, wNative, hNative) {
+ if (wNative && hNative) {
+ canvas.widthNative = wNative;
+ canvas.heightNative = hNative;
+ } else {
+ wNative = canvas.widthNative;
+ hNative = canvas.heightNative;
+ }
+ var w = wNative;
+ var h = hNative;
+ if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
+ if (w/h < Module['forcedAspectRatio']) {
+ w = Math.round(h * Module['forcedAspectRatio']);
+ } else {
+ h = Math.round(w / Module['forcedAspectRatio']);
+ }
+ }
+ if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+ document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+ document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
+ var factor = Math.min(screen.width / w, screen.height / h);
+ w = Math.round(w * factor);
+ h = Math.round(h * factor);
+ }
+ if (Browser.resizeCanvas) {
+ if (canvas.width != w) canvas.width = w;
+ if (canvas.height != h) canvas.height = h;
+ if (typeof canvas.style != 'undefined') {
+ canvas.style.removeProperty( "width");
+ canvas.style.removeProperty("height");
+ }
+ } else {
+ if (canvas.width != wNative) canvas.width = wNative;
+ if (canvas.height != hNative) canvas.height = hNative;
+ if (typeof canvas.style != 'undefined') {
+ if (w != wNative || h != hNative) {
+ canvas.style.setProperty( "width", w + "px", "important");
+ canvas.style.setProperty("height", h + "px", "important");
+ } else {
+ canvas.style.removeProperty( "width");
+ canvas.style.removeProperty("height");
+ }
+ }
+ }
+ },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
+ var handle = Browser.nextWgetRequestHandle;
+ Browser.nextWgetRequestHandle++;
+ return handle;
+ }};var GLFW={Window:function (id, width, height, title, monitor, share) {
+ this.id = id;
+ this.x = 0;
+ this.y = 0;
+ this.fullscreen = false; // Used to determine if app in fullscreen mode
+ this.storedX = 0; // Used to store X before fullscreen
+ this.storedY = 0; // Used to store Y before fullscreen
+ this.width = width;
+ this.height = height;
+ this.storedWidth = width; // Used to store width before fullscreen
+ this.storedHeight = height; // Used to store height before fullscreen
+ this.title = title;
+ this.monitor = monitor;
+ this.share = share;
+ this.attributes = GLFW.hints;
+ this.inputModes = {
+ 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
+ 0x00033002:0, // GLFW_STICKY_KEYS
+ 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
+ };
+ this.buttons = 0;
+ this.keys = new Array();
+ this.shouldClose = 0;
+ this.title = null;
+ this.windowPosFunc = null; // GLFWwindowposfun
+ this.windowSizeFunc = null; // GLFWwindowsizefun
+ this.windowCloseFunc = null; // GLFWwindowclosefun
+ this.windowRefreshFunc = null; // GLFWwindowrefreshfun
+ this.windowFocusFunc = null; // GLFWwindowfocusfun
+ this.windowIconifyFunc = null; // GLFWwindowiconifyfun
+ this.framebufferSizeFunc = null; // GLFWframebuffersizefun
+ this.mouseButtonFunc = null; // GLFWmousebuttonfun
+ this.cursorPosFunc = null; // GLFWcursorposfun
+ this.cursorEnterFunc = null; // GLFWcursorenterfun
+ this.scrollFunc = null; // GLFWscrollfun
+ this.keyFunc = null; // GLFWkeyfun
+ this.charFunc = null; // GLFWcharfun
+ this.userptr = null;
+ },WindowFromId:function (id) {
+ if (id <= 0 || !GLFW.windows) return null;
+ return GLFW.windows[id - 1];
+ },errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
+ switch (keycode) {
+ // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
+ case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
+ case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
+ case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
+ case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
+ case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
+ case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
+ case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
+ case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
+ case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
+ case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
+ case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
+ case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
+ case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
+ case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
+ case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
+ case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
+ case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
+ case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
+ case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+ case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+ case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
+ case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
+ case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
+ case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
+ case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
+ case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
+ case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
+ case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
+ case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
+ case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
+ case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
+ case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
+ case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
+ case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
+ case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
+ case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
+ case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
+ case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
+ case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
+ case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
+ case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
+ case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
+ case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
+ case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
+ case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
+ case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
+ case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
+ case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
+ case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
+ case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
+
+
+ case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
+ case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
+ case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
+ case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
+ case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
+ case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
+ case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
+ case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
+ case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
+ case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
+ case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
+ case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
+ case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
+ case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
+ case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
+ case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
+ case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
+ case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
+ case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
+ case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
+ case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
+ case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
+ case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
+ case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
+ case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
+ case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
+ case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
+ case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
+ case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
+ case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
+ case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
+ case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
+ case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
+ case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
+ case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
+ case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
+ case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
+ case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
+ case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
+ case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
+ case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
+ case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
+ case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
+ case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
+ case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
+ case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
+ case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
+ case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
+ case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
+ case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
+ case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
+ case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
+ case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
+ case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
+ case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
+ case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
+ case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
+ case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
+ case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
+ // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
+ // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
+ case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
+ case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
+ case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
+ case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
+ // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
+ // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
+ // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
+ case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
+ // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
+ default:return -1; // GLFW_KEY_UNKNOWN
+ };
+ },getModBits:function (win) {
+ var mod = 0;
+ if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
+ if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
+ if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
+ if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
+ return mod;
+ },onKeyPress:function (event) {
+ if (!GLFW.active || !GLFW.active.charFunc) return;
+
+ // correct unicode charCode is only available with onKeyPress event
+ var charCode = event.charCode;
+ if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
+
+
+ Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode);
+ },onKeyChanged:function (event, status) {
+ if (!GLFW.active) return;
+
+ var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
+ if (key == -1) return;
+
+ var repeat = status && GLFW.active.keys[key];
+ GLFW.active.keys[key] = status;
+ if (!GLFW.active.keyFunc) return;
+
+
+ if (repeat) status = 2; // GLFW_REPEAT
+ Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active));
+ },onKeydown:function (event) {
+ GLFW.onKeyChanged(event, 1); // GLFW_PRESS or GLFW_REPEAT
+
+ // This logic comes directly from the sdl implementation. We cannot
+ // call preventDefault on all keydown events otherwise onKeyPress will
+ // not get called
+ if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
+ event.preventDefault();
+ }
+ },onKeyup:function (event) {
+ GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
+ },onMousemove:function (event) {
+ if (!GLFW.active) return;
+
+ Browser.calculateMouseEvent(event);
+
+ if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
+
+
+ Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
+ },DOMToGLFWMouseButton:function (event) {
+ // DOM and glfw have different button codes.
+ // See http://www.w3schools.com/jsref/event_button.asp.
+ var eventButton = event['button'];
+ if (eventButton > 0) {
+ if (eventButton == 1) {
+ eventButton = 2;
+ } else {
+ eventButton = 1;
+ }
+ }
+ return eventButton;
+ },onMouseenter:function (event) {
+ if (!GLFW.active) return;
+
+ if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+
+ Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
+ },onMouseleave:function (event) {
+ if (!GLFW.active) return;
+
+ if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+
+ Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
+ },onMouseButtonChanged:function (event, status) {
+ if (!GLFW.active) return;
+
+ Browser.calculateMouseEvent(event);
+
+ if (event.target != Module["canvas"]) return;
+
+ eventButton = GLFW.DOMToGLFWMouseButton(event);
+
+ if (status == 1) { // GLFW_PRESS
+ GLFW.active.buttons |= (1 << eventButton);
+ try {
+ event.target.setCapture();
+ } catch (e) {}
+ } else { // GLFW_RELEASE
+ GLFW.active.buttons &= ~(1 << eventButton);
+ }
+
+ if (!GLFW.active.mouseButtonFunc) return;
+
+
+ Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
+ },onMouseButtonDown:function (event) {
+ if (!GLFW.active) return;
+ GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
+ },onMouseButtonUp:function (event) {
+ if (!GLFW.active) return;
+ GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
+ },onMouseWheel:function (event) {
+ // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
+ var delta = -Browser.getMouseWheelDelta(event);
+ delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
+ GLFW.wheelPos += delta;
+
+ if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
+
+
+ var sx = 0;
+ var sy = 0;
+ if (event.type == 'mousewheel') {
+ sx = event.wheelDeltaX;
+ sy = event.wheelDeltaY;
+ } else {
+ sx = event.deltaX;
+ sy = event.deltaY;
+ }
+
+ Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
+
+ event.preventDefault();
+ },onCanvasResize:function (width, height) {
+ if (!GLFW.active) return;
+
+ var resizeNeeded = true;
+
+ // If the client is requestiong fullscreen mode
+ if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
+ GLFW.active.storedX = GLFW.active.x;
+ GLFW.active.storedY = GLFW.active.y;
+ GLFW.active.storedWidth = GLFW.active.width;
+ GLFW.active.storedHeight = GLFW.active.height;
+ GLFW.active.x = GLFW.active.y = 0;
+ GLFW.active.width = screen.width;
+ GLFW.active.height = screen.height;
+ GLFW.active.fullscreen = true;
+
+ // If the client is reverting from fullscreen mode
+ } else if (GLFW.active.fullscreen == true) {
+ GLFW.active.x = GLFW.active.storedX;
+ GLFW.active.y = GLFW.active.storedY;
+ GLFW.active.width = GLFW.active.storedWidth;
+ GLFW.active.height = GLFW.active.storedHeight;
+ GLFW.active.fullscreen = false;
+
+ // If the width/height values do not match current active window sizes
+ } else if (GLFW.active.width != width || GLFW.active.height != height) {
+ GLFW.active.width = width;
+ GLFW.active.height = height;
+ } else {
+ resizeNeeded = false;
+ }
+
+ // If any of the above conditions were true, we need to resize the canvas
+ if (resizeNeeded) {
+ // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
+ Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
+ // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
+ // the canvas should drive window and framebuffer size respectfully.
+ GLFW.onWindowSizeChanged();
+ GLFW.onFramebufferSizeChanged();
+ }
+ },onWindowSizeChanged:function () {
+ if (!GLFW.active) return;
+
+ if (!GLFW.active.windowSizeFunc) return;
+
+
+ Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+ },onFramebufferSizeChanged:function () {
+ if (!GLFW.active) return;
+
+ if (!GLFW.active.framebufferSizeFunc) return;
+
+ Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+ },requestFullscreen:function () {
+ var RFS = Module["canvas"]['requestFullscreen'] ||
+ Module["canvas"]['mozRequestFullScreen'] ||
+ Module["canvas"]['webkitRequestFullScreen'] ||
+ (function() {});
+ RFS.apply(Module["canvas"], []);
+ },requestFullScreen:function () {
+ Module.printErr('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
+ GLFW.requestFullScreen = function() {
+ return GLFW.requestFullscreen();
+ }
+ return GLFW.requestFullscreen();
+ },exitFullscreen:function () {
+ var CFS = document['exitFullscreen'] ||
+ document['cancelFullScreen'] ||
+ document['mozCancelFullScreen'] ||
+ document['webkitCancelFullScreen'] ||
+ (function() {});
+ CFS.apply(document, []);
+ },cancelFullScreen:function () {
+ Module.printErr('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
+ GLFW.cancelFullScreen = function() {
+ return GLFW.exitFullscreen();
+ }
+ return GLFW.exitFullscreen();
+ },getTime:function () {
+ return _emscripten_get_now() / 1000;
+ },setWindowTitle:function (winid, title) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ win.title = Pointer_stringify(title);
+ if (GLFW.active.id == win.id) {
+ document.title = win.title;
+ }
+ },setKeyCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.keyFunc = cbfun;
+ },setCharCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.charFunc = cbfun;
+ },setMouseButtonCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.mouseButtonFunc = cbfun;
+ },setCursorPosCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.cursorPosFunc = cbfun;
+ },setScrollCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.scrollFunc = cbfun;
+ },setWindowSizeCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowSizeFunc = cbfun;
+
+ },setWindowCloseCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowCloseFunc = cbfun;
+ },setWindowRefreshCallback:function (winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowRefreshFunc = cbfun;
+ },onClickRequestPointerLock:function (e) {
+ if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+ Module['canvas'].requestPointerLock();
+ e.preventDefault();
+ }
+ },setInputMode:function (winid, mode, value) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ switch(mode) {
+ case 0x00033001: { // GLFW_CURSOR
+ switch(value) {
+ case 0x00034001: { // GLFW_CURSOR_NORMAL
+ win.inputModes[mode] = value;
+ Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
+ Module['canvas'].exitPointerLock();
+ break;
+ }
+ case 0x00034002: { // GLFW_CURSOR_HIDDEN
+ console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
+ break;
+ }
+ case 0x00034003: { // GLFW_CURSOR_DISABLED
+ win.inputModes[mode] = value;
+ Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
+ Module['canvas'].requestPointerLock();
+ break;
+ }
+ default: {
+ console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
+ break;
+ }
+ }
+ break;
+ }
+ case 0x00033002: { // GLFW_STICKY_KEYS
+ console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
+ break;
+ }
+ case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
+ console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
+ break;
+ }
+ default: {
+ console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
+ break;
+ }
+ }
+ },getKey:function (winid, key) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return win.keys[key];
+ },getMouseButton:function (winid, button) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return 0;
+ return (win.buttons & (1 << button)) > 0;
+ },getCursorPos:function (winid, x, y) {
+ setValue(x, Browser.mouseX, 'double');
+ setValue(y, Browser.mouseY, 'double');
+ },getMousePos:function (winid, x, y) {
+ setValue(x, Browser.mouseX, 'i32');
+ setValue(y, Browser.mouseY, 'i32');
+ },setCursorPos:function (winid, x, y) {
+ },getWindowPos:function (winid, x, y) {
+ var wx = 0;
+ var wy = 0;
+
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ wx = win.x;
+ wy = win.y;
+ }
+
+ setValue(x, wx, 'i32');
+ setValue(y, wy, 'i32');
+ },setWindowPos:function (winid, x, y) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.x = x;
+ win.y = y;
+ },getWindowSize:function (winid, width, height) {
+ var ww = 0;
+ var wh = 0;
+
+ var win = GLFW.WindowFromId(winid);
+ if (win) {
+ ww = win.width;
+ wh = win.height;
+ }
+
+ setValue(width, ww, 'i32');
+ setValue(height, wh, 'i32');
+ },setWindowSize:function (winid, width, height) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ if (GLFW.active.id == win.id) {
+ if (width == screen.width && height == screen.height) {
+ GLFW.requestFullscreen();
+ } else {
+ GLFW.exitFullscreen();
+ Browser.setCanvasSize(width, height);
+ win.width = width;
+ win.height = height;
+ }
+ }
+
+ if (!win.windowSizeFunc) return;
+
+
+ Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height);
+ },createWindow:function (width, height, title, monitor, share) {
+ var i, id;
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
+ if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
+
+ // id for window
+ id = i + 1;
+
+ // not valid
+ if (width <= 0 || height <= 0) return 0;
+
+ if (monitor) {
+ GLFW.requestFullscreen();
+ } else {
+ Browser.setCanvasSize(width, height);
+ }
+
+ // Create context when there are no existing alive windows
+ for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
+ if (i == GLFW.windows.length) {
+ var contextAttributes = {
+ antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
+ depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS
+ stencil: (GLFW.hints[0x00021006] > 0), // GLFW_STENCIL_BITS
+ alpha: (GLFW.hints[0x00021004] > 0) // GLFW_ALPHA_BITS
+ }
+ Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
+ }
+
+ // If context creation failed, do not return a valid window
+ if (!Module.ctx) return 0;
+
+ // Get non alive id
+ var win = new GLFW.Window(id, width, height, title, monitor, share);
+
+ // Set window to array
+ if (id - 1 == GLFW.windows.length) {
+ GLFW.windows.push(win);
+ } else {
+ GLFW.windows[id - 1] = win;
+ }
+
+ GLFW.active = win;
+ return win.id;
+ },destroyWindow:function (winid) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+
+ if (win.windowCloseFunc)
+ Module['dynCall_vi'](win.windowCloseFunc, win.id);
+
+ GLFW.windows[win.id - 1] = null;
+ if (GLFW.active.id == win.id)
+ GLFW.active = null;
+
+ // Destroy context when no alive windows
+ for (var i = 0; i < GLFW.windows.length; i++)
+ if (GLFW.windows[i] !== null) return;
+
+ Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
+ },swapBuffers:function (winid) {
+ },GLFW2ParamToGLFW3Param:function (param) {
+ table = {
+ 0x00030001:0, // GLFW_MOUSE_CURSOR
+ 0x00030002:0, // GLFW_STICKY_KEYS
+ 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
+ 0x00030004:0, // GLFW_SYSTEM_KEYS
+ 0x00030005:0, // GLFW_KEY_REPEAT
+ 0x00030006:0, // GLFW_AUTO_POLL_EVENTS
+ 0x00020001:0, // GLFW_OPENED
+ 0x00020002:0, // GLFW_ACTIVE
+ 0x00020003:0, // GLFW_ICONIFIED
+ 0x00020004:0, // GLFW_ACCELERATED
+ 0x00020005:0x00021001, // GLFW_RED_BITS
+ 0x00020006:0x00021002, // GLFW_GREEN_BITS
+ 0x00020007:0x00021003, // GLFW_BLUE_BITS
+ 0x00020008:0x00021004, // GLFW_ALPHA_BITS
+ 0x00020009:0x00021005, // GLFW_DEPTH_BITS
+ 0x0002000A:0x00021006, // GLFW_STENCIL_BITS
+ 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
+ 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
+ 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
+ 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
+ 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
+ 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
+ 0x00020011:0x0002100C, // GLFW_STEREO
+ 0x00020012:0, // GLFW_WINDOW_NO_RESIZE
+ 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
+ 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
+ 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
+ 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
+ 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
+ 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
+ };
+ return table[param];
+ }};function _glfwGetVideoModes(monitor, count) {
+ setValue(count, 0, 'i32');
+ return 0;
+ }
+
+ function _glLinkProgram(program) {
+ GLctx.linkProgram(GL.programs[program]);
+ GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+ GL.populateUniformTable(program);
+ }
+
+ function _glBindTexture(target, texture) {
+ GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+ }
+
+ function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
+
+ function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+ GL.renderbuffers[renderbuffer]);
+ }
+
+ function _glGetString(name_) {
+ if (GL.stringCache[name_]) return GL.stringCache[name_];
+ var ret;
+ switch(name_) {
+ case 0x1F00 /* GL_VENDOR */:
+ case 0x1F01 /* GL_RENDERER */:
+ case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+ case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+ ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F02 /* GL_VERSION */:
+ var glVersion = GLctx.getParameter(GLctx.VERSION);
+ // return GLES version string corresponding to the version of the WebGL context
+ {
+ glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+ }
+ ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F03 /* GL_EXTENSIONS */:
+ var exts = GLctx.getSupportedExtensions();
+ var gl_exts = [];
+ for (var i = 0; i < exts.length; ++i) {
+ gl_exts.push(exts[i]);
+ gl_exts.push("GL_" + exts[i]);
+ }
+ ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+ var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+ // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+ var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+ var ver_num = glslVersion.match(ver_re);
+ if (ver_num !== null) {
+ if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+ glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+ }
+ ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
+ break;
+ default:
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return 0;
+ }
+ GL.stringCache[name_] = ret;
+ return ret;
+ }
+
+ function _emscripten_glUniform3iv(location, count, value) {
+
+
+ GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
+ }
+
+ function _emscripten_glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+
+
+ GLctx.shaderSource(GL.shaders[shader], source);
+ }
+
+ function _emscripten_glReleaseShaderCompiler() {
+ // NOP (as allowed by GLES 2.0 spec)
+ }
+
+ function _glfwSetScrollCallback(winid, cbfun) {
+ GLFW.setScrollCallback(winid, cbfun);
+ }
+
+ function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
+
+ function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+ function _glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+ }
+
+
+
+
+ var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
+
+ var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+
+ function ___setErrNo(value) {
+ if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+ else Module.printErr('failed to set errno from JS');
+ return value;
+ }
+
+ var PATH={splitPath:function (filename) {
+ var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+ return splitPathRe.exec(filename).slice(1);
+ },normalizeArray:function (parts, allowAboveRoot) {
+ // if the path tries to go above the root, `up` ends up > 0
+ var up = 0;
+ for (var i = parts.length - 1; i >= 0; i--) {
+ var last = parts[i];
+ if (last === '.') {
+ parts.splice(i, 1);
+ } else if (last === '..') {
+ parts.splice(i, 1);
+ up++;
+ } else if (up) {
+ parts.splice(i, 1);
+ up--;
+ }
+ }
+ // if the path is allowed to go above the root, restore leading ..s
+ if (allowAboveRoot) {
+ for (; up--; up) {
+ parts.unshift('..');
+ }
+ }
+ return parts;
+ },normalize:function (path) {
+ var isAbsolute = path.charAt(0) === '/',
+ trailingSlash = path.substr(-1) === '/';
+ // Normalize the path
+ path = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), !isAbsolute).join('/');
+ if (!path && !isAbsolute) {
+ path = '.';
+ }
+ if (path && trailingSlash) {
+ path += '/';
+ }
+ return (isAbsolute ? '/' : '') + path;
+ },dirname:function (path) {
+ var result = PATH.splitPath(path),
+ root = result[0],
+ dir = result[1];
+ if (!root && !dir) {
+ // No dirname whatsoever
+ return '.';
+ }
+ if (dir) {
+ // It has a dirname, strip trailing slash
+ dir = dir.substr(0, dir.length - 1);
+ }
+ return root + dir;
+ },basename:function (path) {
+ // EMSCRIPTEN return '/'' for '/', not an empty string
+ if (path === '/') return '/';
+ var lastSlash = path.lastIndexOf('/');
+ if (lastSlash === -1) return path;
+ return path.substr(lastSlash+1);
+ },extname:function (path) {
+ return PATH.splitPath(path)[3];
+ },join:function () {
+ var paths = Array.prototype.slice.call(arguments, 0);
+ return PATH.normalize(paths.join('/'));
+ },join2:function (l, r) {
+ return PATH.normalize(l + '/' + r);
+ },resolve:function () {
+ var resolvedPath = '',
+ resolvedAbsolute = false;
+ for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+ var path = (i >= 0) ? arguments[i] : FS.cwd();
+ // Skip empty and invalid entries
+ if (typeof path !== 'string') {
+ throw new TypeError('Arguments to path.resolve must be strings');
+ } else if (!path) {
+ return ''; // an invalid portion invalidates the whole thing
+ }
+ resolvedPath = path + '/' + resolvedPath;
+ resolvedAbsolute = path.charAt(0) === '/';
+ }
+ // At this point the path should be resolved to a full absolute path, but
+ // handle relative paths to be safe (might happen when process.cwd() fails)
+ resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+ return !!p;
+ }), !resolvedAbsolute).join('/');
+ return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+ },relative:function (from, to) {
+ from = PATH.resolve(from).substr(1);
+ to = PATH.resolve(to).substr(1);
+ function trim(arr) {
+ var start = 0;
+ for (; start < arr.length; start++) {
+ if (arr[start] !== '') break;
+ }
+ var end = arr.length - 1;
+ for (; end >= 0; end--) {
+ if (arr[end] !== '') break;
+ }
+ if (start > end) return [];
+ return arr.slice(start, end - start + 1);
+ }
+ var fromParts = trim(from.split('/'));
+ var toParts = trim(to.split('/'));
+ var length = Math.min(fromParts.length, toParts.length);
+ var samePartsLength = length;
+ for (var i = 0; i < length; i++) {
+ if (fromParts[i] !== toParts[i]) {
+ samePartsLength = i;
+ break;
+ }
+ }
+ var outputParts = [];
+ for (var i = samePartsLength; i < fromParts.length; i++) {
+ outputParts.push('..');
+ }
+ outputParts = outputParts.concat(toParts.slice(samePartsLength));
+ return outputParts.join('/');
+ }};
+
+ var TTY={ttys:[],init:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // currently, FS.init does not distinguish if process.stdin is a file or TTY
+ // // device, it always assumes it's a TTY device. because of this, we're forcing
+ // // process.stdin to UTF8 encoding to at least make stdin reading compatible
+ // // with text files until FS.init can be refactored.
+ // process['stdin']['setEncoding']('utf8');
+ // }
+ },shutdown:function () {
+ // https://github.com/kripken/emscripten/pull/1555
+ // if (ENVIRONMENT_IS_NODE) {
+ // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+ // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+ // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+ // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+ // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+ // process['stdin']['pause']();
+ // }
+ },register:function (dev, ops) {
+ TTY.ttys[dev] = { input: [], output: [], ops: ops };
+ FS.registerDevice(dev, TTY.stream_ops);
+ },stream_ops:{open:function (stream) {
+ var tty = TTY.ttys[stream.node.rdev];
+ if (!tty) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ stream.tty = tty;
+ stream.seekable = false;
+ },close:function (stream) {
+ // flush any pending line data
+ stream.tty.ops.flush(stream.tty);
+ },flush:function (stream) {
+ stream.tty.ops.flush(stream.tty);
+ },read:function (stream, buffer, offset, length, pos /* ignored */) {
+ if (!stream.tty || !stream.tty.ops.get_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = stream.tty.ops.get_char(stream.tty);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, pos) {
+ if (!stream.tty || !stream.tty.ops.put_char) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
+ }
+ for (var i = 0; i < length; i++) {
+ try {
+ stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }},default_tty_ops:{get_char:function (tty) {
+ if (!tty.input.length) {
+ var result = null;
+ if (ENVIRONMENT_IS_NODE) {
+ // we will read data by chunks of BUFSIZE
+ var BUFSIZE = 256;
+ var buf = new Buffer(BUFSIZE);
+ var bytesRead = 0;
+
+ var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
+
+ var fd = process.stdin.fd;
+ if (isPosixPlatform) {
+ // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+ var usingDevice = false;
+ try {
+ fd = fs.openSync('/dev/stdin', 'r');
+ usingDevice = true;
+ } catch (e) {}
+ }
+
+ try {
+ bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+ } catch(e) {
+ // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+ // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+ if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
+ else throw e;
+ }
+
+ if (usingDevice) { fs.closeSync(fd); }
+ if (bytesRead > 0) {
+ result = buf.slice(0, bytesRead).toString('utf-8');
+ } else {
+ result = null;
+ }
+
+ } else if (typeof window != 'undefined' &&
+ typeof window.prompt == 'function') {
+ // Browser.
+ result = window.prompt('Input: '); // returns null on cancel
+ if (result !== null) {
+ result += '\n';
+ }
+ } else if (typeof readline == 'function') {
+ // Command line.
+ result = readline();
+ if (result !== null) {
+ result += '\n';
+ }
+ }
+ if (!result) {
+ return null;
+ }
+ tty.input = intArrayFromString(result, true);
+ }
+ return tty.input.shift();
+ },put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ Module['print'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ Module['print'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }},default_tty1_ops:{put_char:function (tty, val) {
+ if (val === null || val === 10) {
+ Module['printErr'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ } else {
+ if (val != 0) tty.output.push(val);
+ }
+ },flush:function (tty) {
+ if (tty.output && tty.output.length > 0) {
+ Module['printErr'](UTF8ArrayToString(tty.output, 0));
+ tty.output = [];
+ }
+ }}};
+
+ var MEMFS={ops_table:null,mount:function (mount) {
+ return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+ // no supported
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (!MEMFS.ops_table) {
+ MEMFS.ops_table = {
+ dir: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ lookup: MEMFS.node_ops.lookup,
+ mknod: MEMFS.node_ops.mknod,
+ rename: MEMFS.node_ops.rename,
+ unlink: MEMFS.node_ops.unlink,
+ rmdir: MEMFS.node_ops.rmdir,
+ readdir: MEMFS.node_ops.readdir,
+ symlink: MEMFS.node_ops.symlink
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek
+ }
+ },
+ file: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: {
+ llseek: MEMFS.stream_ops.llseek,
+ read: MEMFS.stream_ops.read,
+ write: MEMFS.stream_ops.write,
+ allocate: MEMFS.stream_ops.allocate,
+ mmap: MEMFS.stream_ops.mmap,
+ msync: MEMFS.stream_ops.msync
+ }
+ },
+ link: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr,
+ readlink: MEMFS.node_ops.readlink
+ },
+ stream: {}
+ },
+ chrdev: {
+ node: {
+ getattr: MEMFS.node_ops.getattr,
+ setattr: MEMFS.node_ops.setattr
+ },
+ stream: FS.chrdev_stream_ops
+ }
+ };
+ }
+ var node = FS.createNode(parent, name, mode, dev);
+ if (FS.isDir(node.mode)) {
+ node.node_ops = MEMFS.ops_table.dir.node;
+ node.stream_ops = MEMFS.ops_table.dir.stream;
+ node.contents = {};
+ } else if (FS.isFile(node.mode)) {
+ node.node_ops = MEMFS.ops_table.file.node;
+ node.stream_ops = MEMFS.ops_table.file.stream;
+ node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+ // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+ // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+ // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+ node.contents = null;
+ } else if (FS.isLink(node.mode)) {
+ node.node_ops = MEMFS.ops_table.link.node;
+ node.stream_ops = MEMFS.ops_table.link.stream;
+ } else if (FS.isChrdev(node.mode)) {
+ node.node_ops = MEMFS.ops_table.chrdev.node;
+ node.stream_ops = MEMFS.ops_table.chrdev.stream;
+ }
+ node.timestamp = Date.now();
+ // add the new node to the parent
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },getFileDataAsRegularArray:function (node) {
+ if (node.contents && node.contents.subarray) {
+ var arr = [];
+ for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+ return arr; // Returns a copy of the original data.
+ }
+ return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+ },getFileDataAsTypedArray:function (node) {
+ if (!node.contents) return new Uint8Array;
+ if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+ return new Uint8Array(node.contents);
+ },expandFileStorage:function (node, newCapacity) {
+ // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
+ // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
+ // increase the size.
+ if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
+ node.contents = MEMFS.getFileDataAsRegularArray(node);
+ node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
+ }
+
+ if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
+ var prevCapacity = node.contents ? node.contents.length : 0;
+ if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+ // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+ // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+ // avoid overshooting the allocation cap by a very large margin.
+ var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+ newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+ if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+ if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+ return;
+ }
+ // Not using a typed array to back the file storage. Use a standard JS array instead.
+ if (!node.contents && newCapacity > 0) node.contents = [];
+ while (node.contents.length < newCapacity) node.contents.push(0);
+ },resizeFileStorage:function (node, newSize) {
+ if (node.usedBytes == newSize) return;
+ if (newSize == 0) {
+ node.contents = null; // Fully decommit when requesting a resize to zero.
+ node.usedBytes = 0;
+ return;
+ }
+ if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+ var oldContents = node.contents;
+ node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+ if (oldContents) {
+ node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+ }
+ node.usedBytes = newSize;
+ return;
+ }
+ // Backing with a JS array.
+ if (!node.contents) node.contents = [];
+ if (node.contents.length > newSize) node.contents.length = newSize;
+ else while (node.contents.length < newSize) node.contents.push(0);
+ node.usedBytes = newSize;
+ },node_ops:{getattr:function (node) {
+ var attr = {};
+ // device numbers reuse inode numbers.
+ attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+ attr.ino = node.id;
+ attr.mode = node.mode;
+ attr.nlink = 1;
+ attr.uid = 0;
+ attr.gid = 0;
+ attr.rdev = node.rdev;
+ if (FS.isDir(node.mode)) {
+ attr.size = 4096;
+ } else if (FS.isFile(node.mode)) {
+ attr.size = node.usedBytes;
+ } else if (FS.isLink(node.mode)) {
+ attr.size = node.link.length;
+ } else {
+ attr.size = 0;
+ }
+ attr.atime = new Date(node.timestamp);
+ attr.mtime = new Date(node.timestamp);
+ attr.ctime = new Date(node.timestamp);
+ // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+ // but this is not required by the standard.
+ attr.blksize = 4096;
+ attr.blocks = Math.ceil(attr.size / attr.blksize);
+ return attr;
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ if (attr.size !== undefined) {
+ MEMFS.resizeFileStorage(node, attr.size);
+ }
+ },lookup:function (parent, name) {
+ throw FS.genericErrors[ERRNO_CODES.ENOENT];
+ },mknod:function (parent, name, mode, dev) {
+ return MEMFS.createNode(parent, name, mode, dev);
+ },rename:function (old_node, new_dir, new_name) {
+ // if we're overwriting a directory at new_name, make sure it's empty.
+ if (FS.isDir(old_node.mode)) {
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ }
+ if (new_node) {
+ for (var i in new_node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ }
+ }
+ // do the internal rewiring
+ delete old_node.parent.contents[old_node.name];
+ old_node.name = new_name;
+ new_dir.contents[new_name] = old_node;
+ old_node.parent = new_dir;
+ },unlink:function (parent, name) {
+ delete parent.contents[name];
+ },rmdir:function (parent, name) {
+ var node = FS.lookupNode(parent, name);
+ for (var i in node.contents) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ delete parent.contents[name];
+ },readdir:function (node) {
+ var entries = ['.', '..']
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newname, oldpath) {
+ var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+ node.link = oldpath;
+ return node;
+ },readlink:function (node) {
+ if (!FS.isLink(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return node.link;
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ var contents = stream.node.contents;
+ if (position >= stream.node.usedBytes) return 0;
+ var size = Math.min(stream.node.usedBytes - position, length);
+ assert(size >= 0);
+ if (size > 8 && contents.subarray) { // non-trivial, and typed array
+ buffer.set(contents.subarray(position, position + size), offset);
+ } else {
+ for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+ }
+ return size;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (!length) return 0;
+ var node = stream.node;
+ node.timestamp = Date.now();
+
+ if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+ if (canOwn) {
+ assert(position === 0, 'canOwn must imply no weird position inside the file');
+ node.contents = buffer.subarray(offset, offset + length);
+ node.usedBytes = length;
+ return length;
+ } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+ node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+ node.usedBytes = length;
+ return length;
+ } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+ node.contents.set(buffer.subarray(offset, offset + length), position);
+ return length;
+ }
+ }
+
+ // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+ MEMFS.expandFileStorage(node, position+length);
+ if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+ else {
+ for (var i = 0; i < length; i++) {
+ node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+ }
+ }
+ node.usedBytes = Math.max(node.usedBytes, position+length);
+ return length;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.usedBytes;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ },allocate:function (stream, offset, length) {
+ MEMFS.expandFileStorage(stream.node, offset + length);
+ stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ var ptr;
+ var allocated;
+ var contents = stream.node.contents;
+ // Only make a new copy when MAP_PRIVATE is specified.
+ if ( !(flags & 2) &&
+ (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+ // We can't emulate MAP_SHARED when the file is not backed by the buffer
+ // we're mapping to (e.g. the HEAP buffer).
+ allocated = false;
+ ptr = contents.byteOffset;
+ } else {
+ // Try to avoid unnecessary slices.
+ if (position > 0 || position + length < stream.node.usedBytes) {
+ if (contents.subarray) {
+ contents = contents.subarray(position, position + length);
+ } else {
+ contents = Array.prototype.slice.call(contents, position, position + length);
+ }
+ }
+ allocated = true;
+ ptr = _malloc(length);
+ if (!ptr) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
+ }
+ buffer.set(contents, ptr);
+ }
+ return { ptr: ptr, allocated: allocated };
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!FS.isFile(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (mmapFlags & 2) {
+ // MAP_PRIVATE calls need not to be synced back to underlying fs
+ return 0;
+ }
+
+ var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+ // should we check if bytesWritten and length are the same?
+ return 0;
+ }}};
+
+ var IDBFS={dbs:{},indexedDB:function () {
+ if (typeof indexedDB !== 'undefined') return indexedDB;
+ var ret = null;
+ if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ assert(ret, 'IDBFS used, but indexedDB not supported');
+ return ret;
+ },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+ // reuse all of the core MEMFS functionality
+ return MEMFS.mount.apply(null, arguments);
+ },syncfs:function (mount, populate, callback) {
+ IDBFS.getLocalSet(mount, function(err, local) {
+ if (err) return callback(err);
+
+ IDBFS.getRemoteSet(mount, function(err, remote) {
+ if (err) return callback(err);
+
+ var src = populate ? remote : local;
+ var dst = populate ? local : remote;
+
+ IDBFS.reconcile(src, dst, callback);
+ });
+ });
+ },getDB:function (name, callback) {
+ // check the cache first
+ var db = IDBFS.dbs[name];
+ if (db) {
+ return callback(null, db);
+ }
+
+ var req;
+ try {
+ req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+ } catch (e) {
+ return callback(e);
+ }
+ if (!req) {
+ return callback("Unable to connect to IndexedDB");
+ }
+ req.onupgradeneeded = function(e) {
+ var db = e.target.result;
+ var transaction = e.target.transaction;
+
+ var fileStore;
+
+ if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+ fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ } else {
+ fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+ }
+
+ if (!fileStore.indexNames.contains('timestamp')) {
+ fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+ }
+ };
+ req.onsuccess = function() {
+ db = req.result;
+
+ // add to the cache
+ IDBFS.dbs[name] = db;
+ callback(null, db);
+ };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },getLocalSet:function (mount, callback) {
+ var entries = {};
+
+ function isRealDir(p) {
+ return p !== '.' && p !== '..';
+ };
+ function toAbsolute(root) {
+ return function(p) {
+ return PATH.join2(root, p);
+ }
+ };
+
+ var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+
+ while (check.length) {
+ var path = check.pop();
+ var stat;
+
+ try {
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+ }
+
+ entries[path] = { timestamp: stat.mtime };
+ }
+
+ return callback(null, { type: 'local', entries: entries });
+ },getRemoteSet:function (mount, callback) {
+ var entries = {};
+
+ IDBFS.getDB(mount.mountpoint, function(err, db) {
+ if (err) return callback(err);
+
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+ transaction.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+ var index = store.index('timestamp');
+
+ index.openKeyCursor().onsuccess = function(event) {
+ var cursor = event.target.result;
+
+ if (!cursor) {
+ return callback(null, { type: 'remote', db: db, entries: entries });
+ }
+
+ entries[cursor.primaryKey] = { timestamp: cursor.key };
+
+ cursor.continue();
+ };
+ });
+ },loadLocalEntry:function (path, callback) {
+ var stat, node;
+
+ try {
+ var lookup = FS.lookupPath(path);
+ node = lookup.node;
+ stat = FS.stat(path);
+ } catch (e) {
+ return callback(e);
+ }
+
+ if (FS.isDir(stat.mode)) {
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+ } else if (FS.isFile(stat.mode)) {
+ // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+ // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+ node.contents = MEMFS.getFileDataAsTypedArray(node);
+ return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+ },storeLocalEntry:function (path, entry, callback) {
+ try {
+ if (FS.isDir(entry.mode)) {
+ FS.mkdir(path, entry.mode);
+ } else if (FS.isFile(entry.mode)) {
+ FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
+ } else {
+ return callback(new Error('node type not supported'));
+ }
+
+ FS.chmod(path, entry.mode);
+ FS.utime(path, entry.timestamp, entry.timestamp);
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },removeLocalEntry:function (path, callback) {
+ try {
+ var lookup = FS.lookupPath(path);
+ var stat = FS.stat(path);
+
+ if (FS.isDir(stat.mode)) {
+ FS.rmdir(path);
+ } else if (FS.isFile(stat.mode)) {
+ FS.unlink(path);
+ }
+ } catch (e) {
+ return callback(e);
+ }
+
+ callback(null);
+ },loadRemoteEntry:function (store, path, callback) {
+ var req = store.get(path);
+ req.onsuccess = function(event) { callback(null, event.target.result); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },storeRemoteEntry:function (store, path, entry, callback) {
+ var req = store.put(entry, path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },removeRemoteEntry:function (store, path, callback) {
+ var req = store.delete(path);
+ req.onsuccess = function() { callback(null); };
+ req.onerror = function(e) {
+ callback(this.error);
+ e.preventDefault();
+ };
+ },reconcile:function (src, dst, callback) {
+ var total = 0;
+
+ var create = [];
+ Object.keys(src.entries).forEach(function (key) {
+ var e = src.entries[key];
+ var e2 = dst.entries[key];
+ if (!e2 || e.timestamp > e2.timestamp) {
+ create.push(key);
+ total++;
+ }
+ });
+
+ var remove = [];
+ Object.keys(dst.entries).forEach(function (key) {
+ var e = dst.entries[key];
+ var e2 = src.entries[key];
+ if (!e2) {
+ remove.push(key);
+ total++;
+ }
+ });
+
+ if (!total) {
+ return callback(null);
+ }
+
+ var errored = false;
+ var completed = 0;
+ var db = src.type === 'remote' ? src.db : dst.db;
+ var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+ var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return callback(err);
+ }
+ return;
+ }
+ if (++completed >= total) {
+ return callback(null);
+ }
+ };
+
+ transaction.onerror = function(e) {
+ done(this.error);
+ e.preventDefault();
+ };
+
+ // sort paths in ascending order so directory entries are created
+ // before the files inside them
+ create.sort().forEach(function (path) {
+ if (dst.type === 'local') {
+ IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeLocalEntry(path, entry, done);
+ });
+ } else {
+ IDBFS.loadLocalEntry(path, function (err, entry) {
+ if (err) return done(err);
+ IDBFS.storeRemoteEntry(store, path, entry, done);
+ });
+ }
+ });
+
+ // sort paths in descending order so files are deleted before their
+ // parent directories
+ remove.sort().reverse().forEach(function(path) {
+ if (dst.type === 'local') {
+ IDBFS.removeLocalEntry(path, done);
+ } else {
+ IDBFS.removeRemoteEntry(store, path, done);
+ }
+ });
+ }};
+
+ var NODEFS={isWindows:false,staticInit:function () {
+ NODEFS.isWindows = !!process.platform.match(/^win/);
+ },mount:function (mount) {
+ assert(ENVIRONMENT_IS_NODE);
+ return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+ },createNode:function (parent, name, mode, dev) {
+ if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node = FS.createNode(parent, name, mode);
+ node.node_ops = NODEFS.node_ops;
+ node.stream_ops = NODEFS.stream_ops;
+ return node;
+ },getMode:function (path) {
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ if (NODEFS.isWindows) {
+ // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
+ // propagate write bits to execute bits.
+ stat.mode = stat.mode | ((stat.mode & 146) >> 1);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return stat.mode;
+ },realPath:function (node) {
+ var parts = [];
+ while (node.parent !== node) {
+ parts.push(node.name);
+ node = node.parent;
+ }
+ parts.push(node.mount.opts.root);
+ parts.reverse();
+ return PATH.join.apply(null, parts);
+ },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
+ flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+ flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
+ if (flags in NODEFS.flagsToPermissionStringMap) {
+ return NODEFS.flagsToPermissionStringMap[flags];
+ } else {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ },node_ops:{getattr:function (node) {
+ var path = NODEFS.realPath(node);
+ var stat;
+ try {
+ stat = fs.lstatSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+ // See http://support.microsoft.com/kb/140365
+ if (NODEFS.isWindows && !stat.blksize) {
+ stat.blksize = 4096;
+ }
+ if (NODEFS.isWindows && !stat.blocks) {
+ stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+ }
+ return {
+ dev: stat.dev,
+ ino: stat.ino,
+ mode: stat.mode,
+ nlink: stat.nlink,
+ uid: stat.uid,
+ gid: stat.gid,
+ rdev: stat.rdev,
+ size: stat.size,
+ atime: stat.atime,
+ mtime: stat.mtime,
+ ctime: stat.ctime,
+ blksize: stat.blksize,
+ blocks: stat.blocks
+ };
+ },setattr:function (node, attr) {
+ var path = NODEFS.realPath(node);
+ try {
+ if (attr.mode !== undefined) {
+ fs.chmodSync(path, attr.mode);
+ // update the common node structure mode as well
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ var date = new Date(attr.timestamp);
+ fs.utimesSync(path, date, date);
+ }
+ if (attr.size !== undefined) {
+ fs.truncateSync(path, attr.size);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },lookup:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ var mode = NODEFS.getMode(path);
+ return NODEFS.createNode(parent, name, mode);
+ },mknod:function (parent, name, mode, dev) {
+ var node = NODEFS.createNode(parent, name, mode, dev);
+ // create the backing node for this in the fs root as well
+ var path = NODEFS.realPath(node);
+ try {
+ if (FS.isDir(node.mode)) {
+ fs.mkdirSync(path, node.mode);
+ } else {
+ fs.writeFileSync(path, '', { mode: node.mode });
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return node;
+ },rename:function (oldNode, newDir, newName) {
+ var oldPath = NODEFS.realPath(oldNode);
+ var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+ try {
+ fs.renameSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },unlink:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.unlinkSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },rmdir:function (parent, name) {
+ var path = PATH.join2(NODEFS.realPath(parent), name);
+ try {
+ fs.rmdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readdir:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ return fs.readdirSync(path);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },symlink:function (parent, newName, oldPath) {
+ var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+ try {
+ fs.symlinkSync(oldPath, newPath);
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },readlink:function (node) {
+ var path = NODEFS.realPath(node);
+ try {
+ path = fs.readlinkSync(path);
+ path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+ return path;
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }},stream_ops:{open:function (stream) {
+ var path = NODEFS.realPath(stream.node);
+ try {
+ if (FS.isFile(stream.node.mode)) {
+ stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },close:function (stream) {
+ try {
+ if (FS.isFile(stream.node.mode) && stream.nfd) {
+ fs.closeSync(stream.nfd);
+ }
+ } catch (e) {
+ if (!e.code) throw e;
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ },read:function (stream, buffer, offset, length, position) {
+ if (length === 0) return 0; // node errors on 0 length reads
+ // FIXME this is terrible.
+ var nbuffer = new Buffer(length);
+ var res;
+ try {
+ res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ if (res > 0) {
+ for (var i = 0; i < res; i++) {
+ buffer[offset + i] = nbuffer[i];
+ }
+ }
+ return res;
+ },write:function (stream, buffer, offset, length, position) {
+ // FIXME this is terrible.
+ var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
+ var res;
+ try {
+ res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ return res;
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ try {
+ var stat = fs.fstatSync(stream.nfd);
+ position += stat.size;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES[e.code]);
+ }
+ }
+ }
+
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ return position;
+ }}};
+
+ var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+ assert(ENVIRONMENT_IS_WORKER);
+ if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+ var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+ var createdParents = {};
+ function ensureParent(path) {
+ // return the parent node, creating subdirs as necessary
+ var parts = path.split('/');
+ var parent = root;
+ for (var i = 0; i < parts.length-1; i++) {
+ var curr = parts.slice(0, i+1).join('/');
+ // Issue 4254: Using curr as a node name will prevent the node
+ // from being found in FS.nameTable when FS.open is called on
+ // a path which holds a child of this node,
+ // given that all FS functions assume node names
+ // are just their corresponding parts within their given path,
+ // rather than incremental aggregates which include their parent's
+ // directories.
+ if (!createdParents[curr]) {
+ createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
+ }
+ parent = createdParents[curr];
+ }
+ return parent;
+ }
+ function base(path) {
+ var parts = path.split('/');
+ return parts[parts.length-1];
+ }
+ // We also accept FileList here, by using Array.prototype
+ Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+ WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+ });
+ (mount.opts["blobs"] || []).forEach(function(obj) {
+ WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+ });
+ (mount.opts["packages"] || []).forEach(function(pack) {
+ pack['metadata'].files.forEach(function(file) {
+ var name = file.filename.substr(1); // remove initial slash
+ WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+ });
+ });
+ return root;
+ },createNode:function (parent, name, mode, dev, contents, mtime) {
+ var node = FS.createNode(parent, name, mode);
+ node.mode = mode;
+ node.node_ops = WORKERFS.node_ops;
+ node.stream_ops = WORKERFS.stream_ops;
+ node.timestamp = (mtime || new Date).getTime();
+ assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+ if (mode === WORKERFS.FILE_MODE) {
+ node.size = contents.size;
+ node.contents = contents;
+ } else {
+ node.size = 4096;
+ node.contents = {};
+ }
+ if (parent) {
+ parent.contents[name] = node;
+ }
+ return node;
+ },node_ops:{getattr:function (node) {
+ return {
+ dev: 1,
+ ino: undefined,
+ mode: node.mode,
+ nlink: 1,
+ uid: 0,
+ gid: 0,
+ rdev: undefined,
+ size: node.size,
+ atime: new Date(node.timestamp),
+ mtime: new Date(node.timestamp),
+ ctime: new Date(node.timestamp),
+ blksize: 4096,
+ blocks: Math.ceil(node.size / 4096),
+ };
+ },setattr:function (node, attr) {
+ if (attr.mode !== undefined) {
+ node.mode = attr.mode;
+ }
+ if (attr.timestamp !== undefined) {
+ node.timestamp = attr.timestamp;
+ }
+ },lookup:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ },mknod:function (parent, name, mode, dev) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rename:function (oldNode, newDir, newName) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },unlink:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },rmdir:function (parent, name) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readdir:function (node) {
+ var entries = ['.', '..'];
+ for (var key in node.contents) {
+ if (!node.contents.hasOwnProperty(key)) {
+ continue;
+ }
+ entries.push(key);
+ }
+ return entries;
+ },symlink:function (parent, newName, oldPath) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ },readlink:function (node) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+ if (position >= stream.node.size) return 0;
+ var chunk = stream.node.contents.slice(position, position + length);
+ var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+ buffer.set(new Uint8Array(ab), offset);
+ return chunk.size;
+ },write:function (stream, buffer, offset, length, position) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ },llseek:function (stream, offset, whence) {
+ var position = offset;
+ if (whence === 1) { // SEEK_CUR.
+ position += stream.position;
+ } else if (whence === 2) { // SEEK_END.
+ if (FS.isFile(stream.node.mode)) {
+ position += stream.node.size;
+ }
+ }
+ if (position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return position;
+ }}};
+
+ var _stdin=STATICTOP; STATICTOP += 16;;
+
+ var _stdout=STATICTOP; STATICTOP += 16;;
+
+ var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
+ if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+ return ___setErrNo(e.errno);
+ },lookupPath:function (path, opts) {
+ path = PATH.resolve(FS.cwd(), path);
+ opts = opts || {};
+
+ if (!path) return { path: '', node: null };
+
+ var defaults = {
+ follow_mount: true,
+ recurse_count: 0
+ };
+ for (var key in defaults) {
+ if (opts[key] === undefined) {
+ opts[key] = defaults[key];
+ }
+ }
+
+ if (opts.recurse_count > 8) { // max recursive lookup of 8
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+
+ // split the path
+ var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+ return !!p;
+ }), false);
+
+ // start at the root
+ var current = FS.root;
+ var current_path = '/';
+
+ for (var i = 0; i < parts.length; i++) {
+ var islast = (i === parts.length-1);
+ if (islast && opts.parent) {
+ // stop resolving
+ break;
+ }
+
+ current = FS.lookupNode(current, parts[i]);
+ current_path = PATH.join2(current_path, parts[i]);
+
+ // jump to the mount's root node if this is a mountpoint
+ if (FS.isMountpoint(current)) {
+ if (!islast || (islast && opts.follow_mount)) {
+ current = current.mounted.root;
+ }
+ }
+
+ // by default, lookupPath will not follow a symlink if it is the final path component.
+ // setting opts.follow = true will override this behavior.
+ if (!islast || opts.follow) {
+ var count = 0;
+ while (FS.isLink(current.mode)) {
+ var link = FS.readlink(current_path);
+ current_path = PATH.resolve(PATH.dirname(current_path), link);
+
+ var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+ current = lookup.node;
+
+ if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+ throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
+ }
+ }
+ }
+ }
+
+ return { path: current_path, node: current };
+ },getPath:function (node) {
+ var path;
+ while (true) {
+ if (FS.isRoot(node)) {
+ var mount = node.mount.mountpoint;
+ if (!path) return mount;
+ return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+ }
+ path = path ? node.name + '/' + path : node.name;
+ node = node.parent;
+ }
+ },hashName:function (parentid, name) {
+ var hash = 0;
+
+
+ for (var i = 0; i < name.length; i++) {
+ hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+ }
+ return ((parentid + hash) >>> 0) % FS.nameTable.length;
+ },hashAddNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ node.name_next = FS.nameTable[hash];
+ FS.nameTable[hash] = node;
+ },hashRemoveNode:function (node) {
+ var hash = FS.hashName(node.parent.id, node.name);
+ if (FS.nameTable[hash] === node) {
+ FS.nameTable[hash] = node.name_next;
+ } else {
+ var current = FS.nameTable[hash];
+ while (current) {
+ if (current.name_next === node) {
+ current.name_next = node.name_next;
+ break;
+ }
+ current = current.name_next;
+ }
+ }
+ },lookupNode:function (parent, name) {
+ var err = FS.mayLookup(parent);
+ if (err) {
+ throw new FS.ErrnoError(err, parent);
+ }
+ var hash = FS.hashName(parent.id, name);
+ for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+ var nodeName = node.name;
+ if (node.parent.id === parent.id && nodeName === name) {
+ return node;
+ }
+ }
+ // if we failed to find it in the cache, call into the VFS
+ return FS.lookup(parent, name);
+ },createNode:function (parent, name, mode, rdev) {
+ if (!FS.FSNode) {
+ FS.FSNode = function(parent, name, mode, rdev) {
+ if (!parent) {
+ parent = this; // root node sets parent to itself
+ }
+ this.parent = parent;
+ this.mount = parent.mount;
+ this.mounted = null;
+ this.id = FS.nextInode++;
+ this.name = name;
+ this.mode = mode;
+ this.node_ops = {};
+ this.stream_ops = {};
+ this.rdev = rdev;
+ };
+
+ FS.FSNode.prototype = {};
+
+ // compatibility
+ var readMode = 292 | 73;
+ var writeMode = 146;
+
+ // NOTE we must use Object.defineProperties instead of individual calls to
+ // Object.defineProperty in order to make closure compiler happy
+ Object.defineProperties(FS.FSNode.prototype, {
+ read: {
+ get: function() { return (this.mode & readMode) === readMode; },
+ set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+ },
+ write: {
+ get: function() { return (this.mode & writeMode) === writeMode; },
+ set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+ },
+ isFolder: {
+ get: function() { return FS.isDir(this.mode); }
+ },
+ isDevice: {
+ get: function() { return FS.isChrdev(this.mode); }
+ }
+ });
+ }
+
+ var node = new FS.FSNode(parent, name, mode, rdev);
+
+ FS.hashAddNode(node);
+
+ return node;
+ },destroyNode:function (node) {
+ FS.hashRemoveNode(node);
+ },isRoot:function (node) {
+ return node === node.parent;
+ },isMountpoint:function (node) {
+ return !!node.mounted;
+ },isFile:function (mode) {
+ return (mode & 61440) === 32768;
+ },isDir:function (mode) {
+ return (mode & 61440) === 16384;
+ },isLink:function (mode) {
+ return (mode & 61440) === 40960;
+ },isChrdev:function (mode) {
+ return (mode & 61440) === 8192;
+ },isBlkdev:function (mode) {
+ return (mode & 61440) === 24576;
+ },isFIFO:function (mode) {
+ return (mode & 61440) === 4096;
+ },isSocket:function (mode) {
+ return (mode & 49152) === 49152;
+ },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+ var flags = FS.flagModes[str];
+ if (typeof flags === 'undefined') {
+ throw new Error('Unknown file open mode: ' + str);
+ }
+ return flags;
+ },flagsToPermissionString:function (flag) {
+ var perms = ['r', 'w', 'rw'][flag & 3];
+ if ((flag & 512)) {
+ perms += 'w';
+ }
+ return perms;
+ },nodePermissions:function (node, perms) {
+ if (FS.ignorePermissions) {
+ return 0;
+ }
+ // return 0 if any user, group or owner bits are set.
+ if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+ return ERRNO_CODES.EACCES;
+ } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+ return ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },mayLookup:function (dir) {
+ var err = FS.nodePermissions(dir, 'x');
+ if (err) return err;
+ if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
+ return 0;
+ },mayCreate:function (dir, name) {
+ try {
+ var node = FS.lookupNode(dir, name);
+ return ERRNO_CODES.EEXIST;
+ } catch (e) {
+ }
+ return FS.nodePermissions(dir, 'wx');
+ },mayDelete:function (dir, name, isdir) {
+ var node;
+ try {
+ node = FS.lookupNode(dir, name);
+ } catch (e) {
+ return e.errno;
+ }
+ var err = FS.nodePermissions(dir, 'wx');
+ if (err) {
+ return err;
+ }
+ if (isdir) {
+ if (!FS.isDir(node.mode)) {
+ return ERRNO_CODES.ENOTDIR;
+ }
+ if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+ return ERRNO_CODES.EBUSY;
+ }
+ } else {
+ if (FS.isDir(node.mode)) {
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return 0;
+ },mayOpen:function (node, flags) {
+ if (!node) {
+ return ERRNO_CODES.ENOENT;
+ }
+ if (FS.isLink(node.mode)) {
+ return ERRNO_CODES.ELOOP;
+ } else if (FS.isDir(node.mode)) {
+ if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+ (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+ return ERRNO_CODES.EISDIR;
+ }
+ }
+ return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+ },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+ fd_start = fd_start || 0;
+ fd_end = fd_end || FS.MAX_OPEN_FDS;
+ for (var fd = fd_start; fd <= fd_end; fd++) {
+ if (!FS.streams[fd]) {
+ return fd;
+ }
+ }
+ throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
+ },getStream:function (fd) {
+ return FS.streams[fd];
+ },createStream:function (stream, fd_start, fd_end) {
+ if (!FS.FSStream) {
+ FS.FSStream = function(){};
+ FS.FSStream.prototype = {};
+ // compatibility
+ Object.defineProperties(FS.FSStream.prototype, {
+ object: {
+ get: function() { return this.node; },
+ set: function(val) { this.node = val; }
+ },
+ isRead: {
+ get: function() { return (this.flags & 2097155) !== 1; }
+ },
+ isWrite: {
+ get: function() { return (this.flags & 2097155) !== 0; }
+ },
+ isAppend: {
+ get: function() { return (this.flags & 1024); }
+ }
+ });
+ }
+ // clone it, so we can return an instance of FSStream
+ var newStream = new FS.FSStream();
+ for (var p in stream) {
+ newStream[p] = stream[p];
+ }
+ stream = newStream;
+ var fd = FS.nextfd(fd_start, fd_end);
+ stream.fd = fd;
+ FS.streams[fd] = stream;
+ return stream;
+ },closeStream:function (fd) {
+ FS.streams[fd] = null;
+ },chrdev_stream_ops:{open:function (stream) {
+ var device = FS.getDevice(stream.node.rdev);
+ // override node's stream ops with the device's
+ stream.stream_ops = device.stream_ops;
+ // forward the open call
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ },llseek:function () {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }},major:function (dev) {
+ return ((dev) >> 8);
+ },minor:function (dev) {
+ return ((dev) & 0xff);
+ },makedev:function (ma, mi) {
+ return ((ma) << 8 | (mi));
+ },registerDevice:function (dev, ops) {
+ FS.devices[dev] = { stream_ops: ops };
+ },getDevice:function (dev) {
+ return FS.devices[dev];
+ },getMounts:function (mount) {
+ var mounts = [];
+ var check = [mount];
+
+ while (check.length) {
+ var m = check.pop();
+
+ mounts.push(m);
+
+ check.push.apply(check, m.mounts);
+ }
+
+ return mounts;
+ },syncfs:function (populate, callback) {
+ if (typeof(populate) === 'function') {
+ callback = populate;
+ populate = false;
+ }
+
+ FS.syncFSRequests++;
+
+ if (FS.syncFSRequests > 1) {
+ console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+ }
+
+ var mounts = FS.getMounts(FS.root.mount);
+ var completed = 0;
+
+ function doCallback(err) {
+ assert(FS.syncFSRequests > 0);
+ FS.syncFSRequests--;
+ return callback(err);
+ }
+
+ function done(err) {
+ if (err) {
+ if (!done.errored) {
+ done.errored = true;
+ return doCallback(err);
+ }
+ return;
+ }
+ if (++completed >= mounts.length) {
+ doCallback(null);
+ }
+ };
+
+ // sync all mounts
+ mounts.forEach(function (mount) {
+ if (!mount.type.syncfs) {
+ return done(null);
+ }
+ mount.type.syncfs(mount, populate, done);
+ });
+ },mount:function (type, opts, mountpoint) {
+ var root = mountpoint === '/';
+ var pseudo = !mountpoint;
+ var node;
+
+ if (root && FS.root) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ } else if (!root && !pseudo) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ mountpoint = lookup.path; // use the absolute path
+ node = lookup.node;
+
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+
+ if (!FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ }
+
+ var mount = {
+ type: type,
+ opts: opts,
+ mountpoint: mountpoint,
+ mounts: []
+ };
+
+ // create a root node for the fs
+ var mountRoot = type.mount(mount);
+ mountRoot.mount = mount;
+ mount.root = mountRoot;
+
+ if (root) {
+ FS.root = mountRoot;
+ } else if (node) {
+ // set as a mountpoint
+ node.mounted = mount;
+
+ // add the new mount to the current mount's children
+ if (node.mount) {
+ node.mount.mounts.push(mount);
+ }
+ }
+
+ return mountRoot;
+ },unmount:function (mountpoint) {
+ var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+
+ if (!FS.isMountpoint(lookup.node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+
+ // destroy the nodes for this mount, and all its child mounts
+ var node = lookup.node;
+ var mount = node.mounted;
+ var mounts = FS.getMounts(mount);
+
+ Object.keys(FS.nameTable).forEach(function (hash) {
+ var current = FS.nameTable[hash];
+
+ while (current) {
+ var next = current.name_next;
+
+ if (mounts.indexOf(current.mount) !== -1) {
+ FS.destroyNode(current);
+ }
+
+ current = next;
+ }
+ });
+
+ // no longer a mountpoint
+ node.mounted = null;
+
+ // remove this mount from the child mounts
+ var idx = node.mount.mounts.indexOf(mount);
+ assert(idx !== -1);
+ node.mount.mounts.splice(idx, 1);
+ },lookup:function (parent, name) {
+ return parent.node_ops.lookup(parent, name);
+ },mknod:function (path, mode, dev) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ if (!name || name === '.' || name === '..') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.mayCreate(parent, name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.mknod) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.mknod(parent, name, mode, dev);
+ },create:function (path, mode) {
+ mode = mode !== undefined ? mode : 438 /* 0666 */;
+ mode &= 4095;
+ mode |= 32768;
+ return FS.mknod(path, mode, 0);
+ },mkdir:function (path, mode) {
+ mode = mode !== undefined ? mode : 511 /* 0777 */;
+ mode &= 511 | 512;
+ mode |= 16384;
+ return FS.mknod(path, mode, 0);
+ },mkdirTree:function (path, mode) {
+ var dirs = path.split('/');
+ var d = '';
+ for (var i = 0; i < dirs.length; ++i) {
+ if (!dirs[i]) continue;
+ d += '/' + dirs[i];
+ try {
+ FS.mkdir(d, mode);
+ } catch(e) {
+ if (e.errno != ERRNO_CODES.EEXIST) throw e;
+ }
+ }
+ },mkdev:function (path, mode, dev) {
+ if (typeof(dev) === 'undefined') {
+ dev = mode;
+ mode = 438 /* 0666 */;
+ }
+ mode |= 8192;
+ return FS.mknod(path, mode, dev);
+ },symlink:function (oldpath, newpath) {
+ if (!PATH.resolve(oldpath)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var lookup = FS.lookupPath(newpath, { parent: true });
+ var parent = lookup.node;
+ if (!parent) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ var newname = PATH.basename(newpath);
+ var err = FS.mayCreate(parent, newname);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.symlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return parent.node_ops.symlink(parent, newname, oldpath);
+ },rename:function (old_path, new_path) {
+ var old_dirname = PATH.dirname(old_path);
+ var new_dirname = PATH.dirname(new_path);
+ var old_name = PATH.basename(old_path);
+ var new_name = PATH.basename(new_path);
+ // parents must exist
+ var lookup, old_dir, new_dir;
+ try {
+ lookup = FS.lookupPath(old_path, { parent: true });
+ old_dir = lookup.node;
+ lookup = FS.lookupPath(new_path, { parent: true });
+ new_dir = lookup.node;
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ // need to be part of the same mount
+ if (old_dir.mount !== new_dir.mount) {
+ throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
+ }
+ // source must exist
+ var old_node = FS.lookupNode(old_dir, old_name);
+ // old path should not be an ancestor of the new path
+ var relative = PATH.relative(old_path, new_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ // new path should not be an ancestor of the old path
+ relative = PATH.relative(new_path, old_dirname);
+ if (relative.charAt(0) !== '.') {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
+ }
+ // see if the new path already exists
+ var new_node;
+ try {
+ new_node = FS.lookupNode(new_dir, new_name);
+ } catch (e) {
+ // not fatal
+ }
+ // early out if nothing needs to change
+ if (old_node === new_node) {
+ return;
+ }
+ // we'll need to delete the old entry
+ var isdir = FS.isDir(old_node.mode);
+ var err = FS.mayDelete(old_dir, old_name, isdir);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ // need delete permissions if we'll be overwriting.
+ // need create permissions if new doesn't already exist.
+ err = new_node ?
+ FS.mayDelete(new_dir, new_name, isdir) :
+ FS.mayCreate(new_dir, new_name);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!old_dir.node_ops.rename) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ // if we are going to change the parent, check write permissions
+ if (new_dir !== old_dir) {
+ err = FS.nodePermissions(old_dir, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['willMovePath']) {
+ FS.trackingDelegate['willMovePath'](old_path, new_path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ // remove the node from the lookup hash
+ FS.hashRemoveNode(old_node);
+ // do the underlying fs rename
+ try {
+ old_dir.node_ops.rename(old_node, new_dir, new_name);
+ } catch (e) {
+ throw e;
+ } finally {
+ // add the node back to the hash (in case node_ops.rename
+ // changed its name)
+ FS.hashAddNode(old_node);
+ }
+ try {
+ if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+ }
+ },rmdir:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, true);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.rmdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.rmdir(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ if (!node.node_ops.readdir) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ return node.node_ops.readdir(node);
+ },unlink:function (path) {
+ var lookup = FS.lookupPath(path, { parent: true });
+ var parent = lookup.node;
+ var name = PATH.basename(path);
+ var node = FS.lookupNode(parent, name);
+ var err = FS.mayDelete(parent, name, false);
+ if (err) {
+ // According to POSIX, we should map EISDIR to EPERM, but
+ // we instead do what Linux does (and we must, as we use
+ // the musl linux libc).
+ throw new FS.ErrnoError(err);
+ }
+ if (!parent.node_ops.unlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isMountpoint(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
+ }
+ try {
+ if (FS.trackingDelegate['willDeletePath']) {
+ FS.trackingDelegate['willDeletePath'](path);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ parent.node_ops.unlink(parent, name);
+ FS.destroyNode(node);
+ try {
+ if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+ }
+ },readlink:function (path) {
+ var lookup = FS.lookupPath(path);
+ var link = lookup.node;
+ if (!link) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!link.node_ops.readlink) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+ },stat:function (path, dontFollow) {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ var node = lookup.node;
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!node.node_ops.getattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ return node.node_ops.getattr(node);
+ },lstat:function (path) {
+ return FS.stat(path, true);
+ },chmod:function (path, mode, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ mode: (mode & 4095) | (node.mode & ~4095),
+ timestamp: Date.now()
+ });
+ },lchmod:function (path, mode) {
+ FS.chmod(path, mode, true);
+ },fchmod:function (fd, mode) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chmod(stream.node, mode);
+ },chown:function (path, uid, gid, dontFollow) {
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: !dontFollow });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ node.node_ops.setattr(node, {
+ timestamp: Date.now()
+ // we ignore the uid / gid for now
+ });
+ },lchown:function (path, uid, gid) {
+ FS.chown(path, uid, gid, true);
+ },fchown:function (fd, uid, gid) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ FS.chown(stream.node, uid, gid);
+ },truncate:function (path, len) {
+ if (len < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var node;
+ if (typeof path === 'string') {
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ } else {
+ node = path;
+ }
+ if (!node.node_ops.setattr) {
+ throw new FS.ErrnoError(ERRNO_CODES.EPERM);
+ }
+ if (FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!FS.isFile(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var err = FS.nodePermissions(node, 'w');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ node.node_ops.setattr(node, {
+ size: len,
+ timestamp: Date.now()
+ });
+ },ftruncate:function (fd, len) {
+ var stream = FS.getStream(fd);
+ if (!stream) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ FS.truncate(stream.node, len);
+ },utime:function (path, atime, mtime) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ var node = lookup.node;
+ node.node_ops.setattr(node, {
+ timestamp: Math.max(atime, mtime)
+ });
+ },open:function (path, flags, mode, fd_start, fd_end) {
+ if (path === "") {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+ mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+ if ((flags & 64)) {
+ mode = (mode & 4095) | 32768;
+ } else {
+ mode = 0;
+ }
+ var node;
+ if (typeof path === 'object') {
+ node = path;
+ } else {
+ path = PATH.normalize(path);
+ try {
+ var lookup = FS.lookupPath(path, {
+ follow: !(flags & 131072)
+ });
+ node = lookup.node;
+ } catch (e) {
+ // ignore
+ }
+ }
+ // perhaps we need to create the node
+ var created = false;
+ if ((flags & 64)) {
+ if (node) {
+ // if O_CREAT and O_EXCL are set, error out if the node already exists
+ if ((flags & 128)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
+ }
+ } else {
+ // node doesn't exist, try to create it
+ node = FS.mknod(path, mode, 0);
+ created = true;
+ }
+ }
+ if (!node) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ // can't truncate a device
+ if (FS.isChrdev(node.mode)) {
+ flags &= ~512;
+ }
+ // if asked only for a directory, then this must be one
+ if ((flags & 65536) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ // check permissions, if this is not a file we just created now (it is ok to
+ // create and write to a file with read-only permissions; it is read-only
+ // for later use)
+ if (!created) {
+ var err = FS.mayOpen(node, flags);
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ }
+ // do truncation if necessary
+ if ((flags & 512)) {
+ FS.truncate(node, 0);
+ }
+ // we've already handled these, don't pass down to the underlying vfs
+ flags &= ~(128 | 512);
+
+ // register the stream with the filesystem
+ var stream = FS.createStream({
+ node: node,
+ path: FS.getPath(node), // we want the absolute path to the node
+ flags: flags,
+ seekable: true,
+ position: 0,
+ stream_ops: node.stream_ops,
+ // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+ ungotten: [],
+ error: false
+ }, fd_start, fd_end);
+ // call the new stream's open function
+ if (stream.stream_ops.open) {
+ stream.stream_ops.open(stream);
+ }
+ if (Module['logReadFiles'] && !(flags & 1)) {
+ if (!FS.readFiles) FS.readFiles = {};
+ if (!(path in FS.readFiles)) {
+ FS.readFiles[path] = 1;
+ Module['printErr']('read file: ' + path);
+ }
+ }
+ try {
+ if (FS.trackingDelegate['onOpenFile']) {
+ var trackingFlags = 0;
+ if ((flags & 2097155) !== 1) {
+ trackingFlags |= FS.tracking.openFlags.READ;
+ }
+ if ((flags & 2097155) !== 0) {
+ trackingFlags |= FS.tracking.openFlags.WRITE;
+ }
+ FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+ }
+ } catch(e) {
+ console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+ }
+ return stream;
+ },close:function (stream) {
+ if (stream.getdents) stream.getdents = null; // free readdir state
+ try {
+ if (stream.stream_ops.close) {
+ stream.stream_ops.close(stream);
+ }
+ } catch (e) {
+ throw e;
+ } finally {
+ FS.closeStream(stream.fd);
+ }
+ },llseek:function (stream, offset, whence) {
+ if (!stream.seekable || !stream.stream_ops.llseek) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ stream.position = stream.stream_ops.llseek(stream, offset, whence);
+ stream.ungotten = [];
+ return stream.position;
+ },read:function (stream, buffer, offset, length, position) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.read) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ var seeking = true;
+ if (typeof position === 'undefined') {
+ position = stream.position;
+ seeking = false;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+ if (!seeking) stream.position += bytesRead;
+ return bytesRead;
+ },write:function (stream, buffer, offset, length, position, canOwn) {
+ if (length < 0 || position < 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (FS.isDir(stream.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
+ }
+ if (!stream.stream_ops.write) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if (stream.flags & 1024) {
+ // seek to the end before writing in append mode
+ FS.llseek(stream, 0, 2);
+ }
+ var seeking = true;
+ if (typeof position === 'undefined') {
+ position = stream.position;
+ seeking = false;
+ } else if (!stream.seekable) {
+ throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
+ }
+ var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+ if (!seeking) stream.position += bytesWritten;
+ try {
+ if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+ } catch(e) {
+ console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
+ }
+ return bytesWritten;
+ },allocate:function (stream, offset, length) {
+ if (offset < 0 || length <= 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
+ }
+ if ((stream.flags & 2097155) === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ }
+ if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ if (!stream.stream_ops.allocate) {
+ throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
+ }
+ stream.stream_ops.allocate(stream, offset, length);
+ },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+ // TODO if PROT is PROT_WRITE, make sure we have write access
+ if ((stream.flags & 2097155) === 1) {
+ throw new FS.ErrnoError(ERRNO_CODES.EACCES);
+ }
+ if (!stream.stream_ops.mmap) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
+ }
+ return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+ },msync:function (stream, buffer, offset, length, mmapFlags) {
+ if (!stream || !stream.stream_ops.msync) {
+ return 0;
+ }
+ return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+ },munmap:function (stream) {
+ return 0;
+ },ioctl:function (stream, cmd, arg) {
+ if (!stream.stream_ops.ioctl) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
+ }
+ return stream.stream_ops.ioctl(stream, cmd, arg);
+ },readFile:function (path, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'r';
+ opts.encoding = opts.encoding || 'binary';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var ret;
+ var stream = FS.open(path, opts.flags);
+ var stat = FS.stat(path);
+ var length = stat.size;
+ var buf = new Uint8Array(length);
+ FS.read(stream, buf, 0, length, 0);
+ if (opts.encoding === 'utf8') {
+ ret = UTF8ArrayToString(buf, 0);
+ } else if (opts.encoding === 'binary') {
+ ret = buf;
+ }
+ FS.close(stream);
+ return ret;
+ },writeFile:function (path, data, opts) {
+ opts = opts || {};
+ opts.flags = opts.flags || 'w';
+ opts.encoding = opts.encoding || 'utf8';
+ if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+ throw new Error('Invalid encoding type "' + opts.encoding + '"');
+ }
+ var stream = FS.open(path, opts.flags, opts.mode);
+ if (opts.encoding === 'utf8') {
+ var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+ var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+ FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
+ } else if (opts.encoding === 'binary') {
+ FS.write(stream, data, 0, data.length, 0, opts.canOwn);
+ }
+ FS.close(stream);
+ },cwd:function () {
+ return FS.currentPath;
+ },chdir:function (path) {
+ var lookup = FS.lookupPath(path, { follow: true });
+ if (lookup.node === null) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
+ }
+ if (!FS.isDir(lookup.node.mode)) {
+ throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
+ }
+ var err = FS.nodePermissions(lookup.node, 'x');
+ if (err) {
+ throw new FS.ErrnoError(err);
+ }
+ FS.currentPath = lookup.path;
+ },createDefaultDirectories:function () {
+ FS.mkdir('/tmp');
+ FS.mkdir('/home');
+ FS.mkdir('/home/web_user');
+ },createDefaultDevices:function () {
+ // create /dev
+ FS.mkdir('/dev');
+ // setup /dev/null
+ FS.registerDevice(FS.makedev(1, 3), {
+ read: function() { return 0; },
+ write: function(stream, buffer, offset, length, pos) { return length; }
+ });
+ FS.mkdev('/dev/null', FS.makedev(1, 3));
+ // setup /dev/tty and /dev/tty1
+ // stderr needs to print output using Module['printErr']
+ // so we register a second tty just for it.
+ TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+ TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+ FS.mkdev('/dev/tty', FS.makedev(5, 0));
+ FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+ // setup /dev/[u]random
+ var random_device;
+ if (typeof crypto !== 'undefined') {
+ // for modern web browsers
+ var randomBuffer = new Uint8Array(1);
+ random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+ } else if (ENVIRONMENT_IS_NODE) {
+ // for nodejs
+ random_device = function() { return require('crypto').randomBytes(1)[0]; };
+ } else {
+ // default for ES5 platforms
+ random_device = function() { return (Math.random()*256)|0; };
+ }
+ FS.createDevice('/dev', 'random', random_device);
+ FS.createDevice('/dev', 'urandom', random_device);
+ // we're not going to emulate the actual shm device,
+ // just create the tmp dirs that reside in it commonly
+ FS.mkdir('/dev/shm');
+ FS.mkdir('/dev/shm/tmp');
+ },createSpecialDirectories:function () {
+ // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+ FS.mkdir('/proc');
+ FS.mkdir('/proc/self');
+ FS.mkdir('/proc/self/fd');
+ FS.mount({
+ mount: function() {
+ var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
+ node.node_ops = {
+ lookup: function(parent, name) {
+ var fd = +name;
+ var stream = FS.getStream(fd);
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ var ret = {
+ parent: null,
+ mount: { mountpoint: 'fake' },
+ node_ops: { readlink: function() { return stream.path } }
+ };
+ ret.parent = ret; // make it look like a simple root node
+ return ret;
+ }
+ };
+ return node;
+ }
+ }, {}, '/proc/self/fd');
+ },createStandardStreams:function () {
+ // TODO deprecate the old functionality of a single
+ // input / output callback and that utilizes FS.createDevice
+ // and instead require a unique set of stream ops
+
+ // by default, we symlink the standard streams to the
+ // default tty devices. however, if the standard streams
+ // have been overwritten we create a unique device for
+ // them instead.
+ if (Module['stdin']) {
+ FS.createDevice('/dev', 'stdin', Module['stdin']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdin');
+ }
+ if (Module['stdout']) {
+ FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+ } else {
+ FS.symlink('/dev/tty', '/dev/stdout');
+ }
+ if (Module['stderr']) {
+ FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+ } else {
+ FS.symlink('/dev/tty1', '/dev/stderr');
+ }
+
+ // open default streams for the stdin, stdout and stderr devices
+ var stdin = FS.open('/dev/stdin', 'r');
+ assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+
+ var stdout = FS.open('/dev/stdout', 'w');
+ assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+
+ var stderr = FS.open('/dev/stderr', 'w');
+ assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+ },ensureErrnoError:function () {
+ if (FS.ErrnoError) return;
+ FS.ErrnoError = function ErrnoError(errno, node) {
+ //Module.printErr(stackTrace()); // useful for debugging
+ this.node = node;
+ this.setErrno = function(errno) {
+ this.errno = errno;
+ for (var key in ERRNO_CODES) {
+ if (ERRNO_CODES[key] === errno) {
+ this.code = key;
+ break;
+ }
+ }
+ };
+ this.setErrno(errno);
+ this.message = ERRNO_MESSAGES[errno];
+ if (this.stack) this.stack = demangleAll(this.stack);
+ };
+ FS.ErrnoError.prototype = new Error();
+ FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+ // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+ [ERRNO_CODES.ENOENT].forEach(function(code) {
+ FS.genericErrors[code] = new FS.ErrnoError(code);
+ FS.genericErrors[code].stack = '<generic error, no stack>';
+ });
+ },staticInit:function () {
+ FS.ensureErrnoError();
+
+ FS.nameTable = new Array(4096);
+
+ FS.mount(MEMFS, {}, '/');
+
+ FS.createDefaultDirectories();
+ FS.createDefaultDevices();
+ FS.createSpecialDirectories();
+
+ FS.filesystems = {
+ 'MEMFS': MEMFS,
+ 'IDBFS': IDBFS,
+ 'NODEFS': NODEFS,
+ 'WORKERFS': WORKERFS,
+ };
+ },init:function (input, output, error) {
+ assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+ FS.init.initialized = true;
+
+ FS.ensureErrnoError();
+
+ // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+ Module['stdin'] = input || Module['stdin'];
+ Module['stdout'] = output || Module['stdout'];
+ Module['stderr'] = error || Module['stderr'];
+
+ FS.createStandardStreams();
+ },quit:function () {
+ FS.init.initialized = false;
+ // force-flush all streams, so we get musl std streams printed out
+ var fflush = Module['_fflush'];
+ if (fflush) fflush(0);
+ // close all of our streams
+ for (var i = 0; i < FS.streams.length; i++) {
+ var stream = FS.streams[i];
+ if (!stream) {
+ continue;
+ }
+ FS.close(stream);
+ }
+ },getMode:function (canRead, canWrite) {
+ var mode = 0;
+ if (canRead) mode |= 292 | 73;
+ if (canWrite) mode |= 146;
+ return mode;
+ },joinPath:function (parts, forceRelative) {
+ var path = PATH.join.apply(null, parts);
+ if (forceRelative && path[0] == '/') path = path.substr(1);
+ return path;
+ },absolutePath:function (relative, base) {
+ return PATH.resolve(base, relative);
+ },standardizePath:function (path) {
+ return PATH.normalize(path);
+ },findObject:function (path, dontResolveLastLink) {
+ var ret = FS.analyzePath(path, dontResolveLastLink);
+ if (ret.exists) {
+ return ret.object;
+ } else {
+ ___setErrNo(ret.error);
+ return null;
+ }
+ },analyzePath:function (path, dontResolveLastLink) {
+ // operate from within the context of the symlink's target
+ try {
+ var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ path = lookup.path;
+ } catch (e) {
+ }
+ var ret = {
+ isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+ parentExists: false, parentPath: null, parentObject: null
+ };
+ try {
+ var lookup = FS.lookupPath(path, { parent: true });
+ ret.parentExists = true;
+ ret.parentPath = lookup.path;
+ ret.parentObject = lookup.node;
+ ret.name = PATH.basename(path);
+ lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+ ret.exists = true;
+ ret.path = lookup.path;
+ ret.object = lookup.node;
+ ret.name = lookup.node.name;
+ ret.isRoot = lookup.path === '/';
+ } catch (e) {
+ ret.error = e.errno;
+ };
+ return ret;
+ },createFolder:function (parent, name, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.mkdir(path, mode);
+ },createPath:function (parent, path, canRead, canWrite) {
+ parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+ var parts = path.split('/').reverse();
+ while (parts.length) {
+ var part = parts.pop();
+ if (!part) continue;
+ var current = PATH.join2(parent, part);
+ try {
+ FS.mkdir(current);
+ } catch (e) {
+ // ignore EEXIST
+ }
+ parent = current;
+ }
+ return current;
+ },createFile:function (parent, name, properties, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(canRead, canWrite);
+ return FS.create(path, mode);
+ },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+ var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+ var mode = FS.getMode(canRead, canWrite);
+ var node = FS.create(path, mode);
+ if (data) {
+ if (typeof data === 'string') {
+ var arr = new Array(data.length);
+ for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+ data = arr;
+ }
+ // make sure we can write to the file
+ FS.chmod(node, mode | 146);
+ var stream = FS.open(node, 'w');
+ FS.write(stream, data, 0, data.length, 0, canOwn);
+ FS.close(stream);
+ FS.chmod(node, mode);
+ }
+ return node;
+ },createDevice:function (parent, name, input, output) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ var mode = FS.getMode(!!input, !!output);
+ if (!FS.createDevice.major) FS.createDevice.major = 64;
+ var dev = FS.makedev(FS.createDevice.major++, 0);
+ // Create a fake device that a set of stream ops to emulate
+ // the old behavior.
+ FS.registerDevice(dev, {
+ open: function(stream) {
+ stream.seekable = false;
+ },
+ close: function(stream) {
+ // flush any pending line data
+ if (output && output.buffer && output.buffer.length) {
+ output(10);
+ }
+ },
+ read: function(stream, buffer, offset, length, pos /* ignored */) {
+ var bytesRead = 0;
+ for (var i = 0; i < length; i++) {
+ var result;
+ try {
+ result = input();
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ if (result === undefined && bytesRead === 0) {
+ throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
+ }
+ if (result === null || result === undefined) break;
+ bytesRead++;
+ buffer[offset+i] = result;
+ }
+ if (bytesRead) {
+ stream.node.timestamp = Date.now();
+ }
+ return bytesRead;
+ },
+ write: function(stream, buffer, offset, length, pos) {
+ for (var i = 0; i < length; i++) {
+ try {
+ output(buffer[offset+i]);
+ } catch (e) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ }
+ if (length) {
+ stream.node.timestamp = Date.now();
+ }
+ return i;
+ }
+ });
+ return FS.mkdev(path, mode, dev);
+ },createLink:function (parent, name, target, canRead, canWrite) {
+ var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+ return FS.symlink(target, path);
+ },forceLoadFile:function (obj) {
+ if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+ var success = true;
+ if (typeof XMLHttpRequest !== 'undefined') {
+ throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+ } else if (Module['read']) {
+ // Command-line.
+ try {
+ // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+ // read() will try to parse UTF8.
+ obj.contents = intArrayFromString(Module['read'](obj.url), true);
+ obj.usedBytes = obj.contents.length;
+ } catch (e) {
+ success = false;
+ }
+ } else {
+ throw new Error('Cannot load without read() or XMLHttpRequest.');
+ }
+ if (!success) ___setErrNo(ERRNO_CODES.EIO);
+ return success;
+ },createLazyFile:function (parent, name, url, canRead, canWrite) {
+ // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+ function LazyUint8Array() {
+ this.lengthKnown = false;
+ this.chunks = []; // Loaded chunks. Index is the chunk number
+ }
+ LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+ if (idx > this.length-1 || idx < 0) {
+ return undefined;
+ }
+ var chunkOffset = idx % this.chunkSize;
+ var chunkNum = (idx / this.chunkSize)|0;
+ return this.getter(chunkNum)[chunkOffset];
+ }
+ LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+ this.getter = getter;
+ }
+ LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+ // Find length
+ var xhr = new XMLHttpRequest();
+ xhr.open('HEAD', url, false);
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ var datalength = Number(xhr.getResponseHeader("Content-length"));
+ var header;
+ var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+ var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+
+ var chunkSize = 1024*1024; // Chunk size in bytes
+
+ if (!hasByteServing) chunkSize = datalength;
+
+ // Function to get a range from the remote URL.
+ var doXHR = (function(from, to) {
+ if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+ if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+
+ // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+ var xhr = new XMLHttpRequest();
+ xhr.open('GET', url, false);
+ if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+
+ // Some hints to the browser that we want binary data.
+ if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+ if (xhr.overrideMimeType) {
+ xhr.overrideMimeType('text/plain; charset=x-user-defined');
+ }
+
+ xhr.send(null);
+ if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+ if (xhr.response !== undefined) {
+ return new Uint8Array(xhr.response || []);
+ } else {
+ return intArrayFromString(xhr.responseText || '', true);
+ }
+ });
+ var lazyArray = this;
+ lazyArray.setDataGetter(function(chunkNum) {
+ var start = chunkNum * chunkSize;
+ var end = (chunkNum+1) * chunkSize - 1; // including this byte
+ end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+ lazyArray.chunks[chunkNum] = doXHR(start, end);
+ }
+ if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+ return lazyArray.chunks[chunkNum];
+ });
+
+ if (usesGzip || !datalength) {
+ // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+ chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+ datalength = this.getter(0).length;
+ chunkSize = datalength;
+ console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
+ }
+
+ this._length = datalength;
+ this._chunkSize = chunkSize;
+ this.lengthKnown = true;
+ }
+ if (typeof XMLHttpRequest !== 'undefined') {
+ if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+ var lazyArray = new LazyUint8Array();
+ Object.defineProperties(lazyArray, {
+ length: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._length;
+ }
+ },
+ chunkSize: {
+ get: function() {
+ if(!this.lengthKnown) {
+ this.cacheLength();
+ }
+ return this._chunkSize;
+ }
+ }
+ });
+
+ var properties = { isDevice: false, contents: lazyArray };
+ } else {
+ var properties = { isDevice: false, url: url };
+ }
+
+ var node = FS.createFile(parent, name, properties, canRead, canWrite);
+ // This is a total hack, but I want to get this lazy file code out of the
+ // core of MEMFS. If we want to keep this lazy file concept I feel it should
+ // be its own thin LAZYFS proxying calls to MEMFS.
+ if (properties.contents) {
+ node.contents = properties.contents;
+ } else if (properties.url) {
+ node.contents = null;
+ node.url = properties.url;
+ }
+ // Add a function that defers querying the file size until it is asked the first time.
+ Object.defineProperties(node, {
+ usedBytes: {
+ get: function() { return this.contents.length; }
+ }
+ });
+ // override each stream op with one that tries to force load the lazy file first
+ var stream_ops = {};
+ var keys = Object.keys(node.stream_ops);
+ keys.forEach(function(key) {
+ var fn = node.stream_ops[key];
+ stream_ops[key] = function forceLoadLazyFile() {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ return fn.apply(null, arguments);
+ };
+ });
+ // use a custom read function
+ stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+ if (!FS.forceLoadFile(node)) {
+ throw new FS.ErrnoError(ERRNO_CODES.EIO);
+ }
+ var contents = stream.node.contents;
+ if (position >= contents.length)
+ return 0;
+ var size = Math.min(contents.length - position, length);
+ assert(size >= 0);
+ if (contents.slice) { // normal array
+ for (var i = 0; i < size; i++) {
+ buffer[offset + i] = contents[position + i];
+ }
+ } else {
+ for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+ buffer[offset + i] = contents.get(position + i);
+ }
+ }
+ return size;
+ };
+ node.stream_ops = stream_ops;
+ return node;
+ },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+ Browser.init(); // XXX perhaps this method should move onto Browser?
+ // TODO we should allow people to just pass in a complete filename instead
+ // of parent and name being that we just join them anyways
+ var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+ var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+ function processData(byteArray) {
+ function finish(byteArray) {
+ if (preFinish) preFinish();
+ if (!dontCreateFile) {
+ FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+ }
+ if (onload) onload();
+ removeRunDependency(dep);
+ }
+ var handled = false;
+ Module['preloadPlugins'].forEach(function(plugin) {
+ if (handled) return;
+ if (plugin['canHandle'](fullname)) {
+ plugin['handle'](byteArray, fullname, finish, function() {
+ if (onerror) onerror();
+ removeRunDependency(dep);
+ });
+ handled = true;
+ }
+ });
+ if (!handled) finish(byteArray);
+ }
+ addRunDependency(dep);
+ if (typeof url == 'string') {
+ Browser.asyncLoad(url, function(byteArray) {
+ processData(byteArray);
+ }, onerror);
+ } else {
+ processData(url);
+ }
+ },indexedDB:function () {
+ return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+ },DB_NAME:function () {
+ return 'EM_FS_' + window.location.pathname;
+ },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+ console.log('creating db');
+ var db = openRequest.result;
+ db.createObjectStore(FS.DB_STORE_NAME);
+ };
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+ putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+ putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ },loadFilesFromDB:function (paths, onload, onerror) {
+ onload = onload || function(){};
+ onerror = onerror || function(){};
+ var indexedDB = FS.indexedDB();
+ try {
+ var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+ } catch (e) {
+ return onerror(e);
+ }
+ openRequest.onupgradeneeded = onerror; // no database to load from
+ openRequest.onsuccess = function openRequest_onsuccess() {
+ var db = openRequest.result;
+ try {
+ var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+ } catch(e) {
+ onerror(e);
+ return;
+ }
+ var files = transaction.objectStore(FS.DB_STORE_NAME);
+ var ok = 0, fail = 0, total = paths.length;
+ function finish() {
+ if (fail == 0) onload(); else onerror();
+ }
+ paths.forEach(function(path) {
+ var getRequest = files.get(path);
+ getRequest.onsuccess = function getRequest_onsuccess() {
+ if (FS.analyzePath(path).exists) {
+ FS.unlink(path);
+ }
+ FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+ ok++;
+ if (ok + fail == total) finish();
+ };
+ getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+ });
+ transaction.onerror = onerror;
+ };
+ openRequest.onerror = onerror;
+ }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+ if (path[0] !== '/') {
+ // relative path
+ var dir;
+ if (dirfd === -100) {
+ dir = FS.cwd();
+ } else {
+ var dirstream = FS.getStream(dirfd);
+ if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ dir = dirstream.path;
+ }
+ path = PATH.join2(dir, path);
+ }
+ return path;
+ },doStat:function (func, path, buf) {
+ try {
+ var stat = func(path);
+ } catch (e) {
+ if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+ // an error occurred while trying to look up the path; we should just report ENOTDIR
+ return -ERRNO_CODES.ENOTDIR;
+ }
+ throw e;
+ }
+ HEAP32[((buf)>>2)]=stat.dev;
+ HEAP32[(((buf)+(4))>>2)]=0;
+ HEAP32[(((buf)+(8))>>2)]=stat.ino;
+ HEAP32[(((buf)+(12))>>2)]=stat.mode;
+ HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+ HEAP32[(((buf)+(20))>>2)]=stat.uid;
+ HEAP32[(((buf)+(24))>>2)]=stat.gid;
+ HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+ HEAP32[(((buf)+(32))>>2)]=0;
+ HEAP32[(((buf)+(36))>>2)]=stat.size;
+ HEAP32[(((buf)+(40))>>2)]=4096;
+ HEAP32[(((buf)+(44))>>2)]=stat.blocks;
+ HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(52))>>2)]=0;
+ HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(60))>>2)]=0;
+ HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
+ HEAP32[(((buf)+(68))>>2)]=0;
+ HEAP32[(((buf)+(72))>>2)]=stat.ino;
+ return 0;
+ },doMsync:function (addr, stream, len, flags) {
+ var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+ FS.msync(stream, buffer, 0, len, flags);
+ },doMkdir:function (path, mode) {
+ // remove a trailing slash, if one - /a/b/ has basename of '', but
+ // we want to create b in the context of this function
+ path = PATH.normalize(path);
+ if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+ FS.mkdir(path, mode, 0);
+ return 0;
+ },doMknod:function (path, mode, dev) {
+ // we don't want this in the JS API as it uses mknod to create all nodes.
+ switch (mode & 61440) {
+ case 32768:
+ case 8192:
+ case 24576:
+ case 4096:
+ case 49152:
+ break;
+ default: return -ERRNO_CODES.EINVAL;
+ }
+ FS.mknod(path, mode, dev);
+ return 0;
+ },doReadlink:function (path, buf, bufsize) {
+ if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+ var ret = FS.readlink(path);
+
+ var len = Math.min(bufsize, lengthBytesUTF8(ret));
+ var endChar = HEAP8[buf+len];
+ stringToUTF8(ret, buf, bufsize+1);
+ // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+ // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+ HEAP8[buf+len] = endChar;
+
+ return len;
+ },doAccess:function (path, amode) {
+ if (amode & ~7) {
+ // need a valid mode
+ return -ERRNO_CODES.EINVAL;
+ }
+ var node;
+ var lookup = FS.lookupPath(path, { follow: true });
+ node = lookup.node;
+ var perms = '';
+ if (amode & 4) perms += 'r';
+ if (amode & 2) perms += 'w';
+ if (amode & 1) perms += 'x';
+ if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+ return -ERRNO_CODES.EACCES;
+ }
+ return 0;
+ },doDup:function (path, flags, suggestFD) {
+ var suggest = FS.getStream(suggestFD);
+ if (suggest) FS.close(suggest);
+ return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+ },doReadv:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.read(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ if (curr < len) break; // nothing more to read
+ }
+ return ret;
+ },doWritev:function (stream, iov, iovcnt, offset) {
+ var ret = 0;
+ for (var i = 0; i < iovcnt; i++) {
+ var ptr = HEAP32[(((iov)+(i*8))>>2)];
+ var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+ var curr = FS.write(stream, HEAP8,ptr, len, offset);
+ if (curr < 0) return -1;
+ ret += curr;
+ }
+ return ret;
+ },varargs:0,get:function (varargs) {
+ SYSCALLS.varargs += 4;
+ var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+ return ret;
+ },getStr:function () {
+ var ret = Pointer_stringify(SYSCALLS.get());
+ return ret;
+ },getStreamFromFD:function () {
+ var stream = FS.getStream(SYSCALLS.get());
+ if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return stream;
+ },getSocketFromFD:function () {
+ var socket = SOCKFS.getSocket(SYSCALLS.get());
+ if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+ return socket;
+ },getSocketAddress:function (allowNull) {
+ var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+ if (allowNull && addrp === 0) return null;
+ var info = __read_sockaddr(addrp, addrlen);
+ if (info.errno) throw new FS.ErrnoError(info.errno);
+ info.addr = DNS.lookup_addr(info.addr) || info.addr;
+ return info;
+ },get64:function () {
+ var low = SYSCALLS.get(), high = SYSCALLS.get();
+ if (low >= 0) assert(high === 0);
+ else assert(high === -1);
+ return low;
+ },getZero:function () {
+ assert(SYSCALLS.get() === 0);
+ }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // ioctl
+ var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+ switch (op) {
+ case 21505: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ case 21506: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0; // no-op, not actually adjusting terminal settings
+ }
+ case 21519: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ var argp = SYSCALLS.get();
+ HEAP32[((argp)>>2)]=0;
+ return 0;
+ }
+ case 21520: {
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return -ERRNO_CODES.EINVAL; // not supported
+ }
+ case 21531: {
+ var argp = SYSCALLS.get();
+ return FS.ioctl(stream, op, argp);
+ }
+ case 21523: {
+ // TODO: in theory we should write to the winsize struct that gets
+ // passed in, but for now musl doesn't read anything on it
+ if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+ return 0;
+ }
+ default: abort('bad ioctl syscall ' + op);
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _emscripten_glSampleCoverage(value, invert) {
+ GLctx.sampleCoverage(value, !!invert);
+ }
+
+ function _glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((textures)+(i*4))>>2)];
+ var texture = GL.textures[id];
+ if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+ }
+
+ function _emscripten_glFrustum() {
+ Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
+ }
+
+ function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
+
+ function _glfwSetWindowSizeCallback(winid, cbfun) {
+ GLFW.setWindowSizeCallback(winid, cbfun);
+ }
+
+ function _emscripten_glGetTexParameterfv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+ }
+
+ function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
+ GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
+ }
+
+ function _emscripten_glBindRenderbuffer(target, renderbuffer) {
+ GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
+ }
+
+ function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+
+
+ var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:function () {
+ if (typeof window !== 'undefined') {
+ window.addEventListener("gamepadconnected", function() { ++JSEvents.numGamepadsConnected; });
+ window.addEventListener("gamepaddisconnected", function() { --JSEvents.numGamepadsConnected; });
+ }
+ },registerRemoveEventListeners:function () {
+ if (!JSEvents.removeEventListenersRegistered) {
+ __ATEXIT__.push(function() {
+ for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
+ JSEvents._removeHandler(i);
+ }
+ });
+ JSEvents.removeEventListenersRegistered = true;
+ }
+ },findEventTarget:function (target) {
+ if (target) {
+ if (typeof target == "number") {
+ target = Pointer_stringify(target);
+ }
+ if (target == '#window') return window;
+ else if (target == '#document') return document;
+ else if (target == '#screen') return window.screen;
+ else if (target == '#canvas') return Module['canvas'];
+
+ if (typeof target == 'string') return document.getElementById(target);
+ else return target;
+ } else {
+ // The sensible target varies between events, but use window as the default
+ // since DOM events mostly can default to that. Specific callback registrations
+ // override their own defaults.
+ return window;
+ }
+ },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
+ function arraysHaveEqualContent(arrA, arrB) {
+ if (arrA.length != arrB.length) return false;
+
+ for(var i in arrA) {
+ if (arrA[i] != arrB[i]) return false;
+ }
+ return true;
+ }
+ // Test if the given call was already queued, and if so, don't add it again.
+ for(var i in JSEvents.deferredCalls) {
+ var call = JSEvents.deferredCalls[i];
+ if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+ return;
+ }
+ }
+ JSEvents.deferredCalls.push({
+ targetFunction: targetFunction,
+ precedence: precedence,
+ argsList: argsList
+ });
+
+ JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
+ },removeDeferredCalls:function (targetFunction) {
+ for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ }
+ }
+ },canPerformEventHandlerRequests:function () {
+ return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+ },runDeferredCalls:function () {
+ if (!JSEvents.canPerformEventHandlerRequests()) {
+ return;
+ }
+ for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+ var call = JSEvents.deferredCalls[i];
+ JSEvents.deferredCalls.splice(i, 1);
+ --i;
+ call.targetFunction.apply(this, call.argsList);
+ }
+ },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
+ for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == target &&
+ (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ },_removeHandler:function (i) {
+ var h = JSEvents.eventHandlers[i];
+ h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+ JSEvents.eventHandlers.splice(i, 1);
+ },registerOrRemoveHandler:function (eventHandler) {
+ var jsEventHandler = function jsEventHandler(event) {
+ // Increment nesting count for the event handler.
+ ++JSEvents.inEventHandler;
+ JSEvents.currentEventHandler = eventHandler;
+ // Process any old deferred calls the user has placed.
+ JSEvents.runDeferredCalls();
+ // Process the actual event, calls back to user C code handler.
+ eventHandler.handlerFunc(event);
+ // Process any new deferred calls that were placed right now from this event handler.
+ JSEvents.runDeferredCalls();
+ // Out of event handler - restore nesting count.
+ --JSEvents.inEventHandler;
+ }
+
+ if (eventHandler.callbackfunc) {
+ eventHandler.eventListenerFunc = jsEventHandler;
+ eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
+ JSEvents.eventHandlers.push(eventHandler);
+ JSEvents.registerRemoveEventListeners();
+ } else {
+ for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+ if (JSEvents.eventHandlers[i].target == eventHandler.target
+ && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+ JSEvents._removeHandler(i--);
+ }
+ }
+ }
+ },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.keyEvent) {
+ JSEvents.keyEvent = _malloc( 164 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ stringToUTF8(e.key ? e.key : "", JSEvents.keyEvent + 0, 32);
+ stringToUTF8(e.code ? e.code : "", JSEvents.keyEvent + 32, 32);
+ HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
+ HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
+ HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
+ HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
+ HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
+ HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
+ stringToUTF8(e.locale ? e.locale : "", JSEvents.keyEvent + 88, 32);
+ stringToUTF8(e.char ? e.char : "", JSEvents.keyEvent + 120, 32);
+ HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
+ HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
+ HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.keyEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },getBoundingClientRectOrZeros:function (target) {
+ return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
+ },fillMouseEventData:function (eventStruct, e, target) {
+ HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+ HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
+ HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
+ HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
+ HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
+ HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
+ HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
+ HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
+ HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
+ HEAP16[(((eventStruct)+(40))>>1)]=e.button;
+ HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
+ HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
+ HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
+
+ if (Module['canvas']) {
+ var rect = Module['canvas'].getBoundingClientRect();
+ HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
+ HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
+ } else { // Canvas is not initialized, return 0.
+ HEAP32[(((eventStruct)+(60))>>2)]=0;
+ HEAP32[(((eventStruct)+(64))>>2)]=0;
+ }
+ if (target) {
+ var rect = JSEvents.getBoundingClientRectOrZeros(target);
+ HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
+ HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
+ } else { // No specific target passed, return 0.
+ HEAP32[(((eventStruct)+(52))>>2)]=0;
+ HEAP32[(((eventStruct)+(56))>>2)]=0;
+ }
+ // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
+ // https://github.com/kripken/emscripten/pull/4997
+ // https://bugs.chromium.org/p/chromium/issues/detail?id=699956
+ if (e.type !== 'wheel' && e.type !== 'mousewheel') {
+ JSEvents.previousScreenX = e.screenX;
+ JSEvents.previousScreenY = e.screenY;
+ }
+ },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.mouseEvent) {
+ JSEvents.mouseEvent = _malloc( 72 );
+ }
+ target = JSEvents.findEventTarget(target);
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ // In IE, mousedown events don't either allow deferred calls to be run!
+ if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.wheelEvent) {
+ JSEvents.wheelEvent = _malloc( 104 );
+ }
+ target = JSEvents.findEventTarget(target);
+ // The DOM Level 3 events spec event 'wheel'
+ var wheelHandlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
+ HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
+ HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
+ HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
+ HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+ // The 'mousewheel' event as implemented in Safari 6.0.5
+ var mouseWheelHandlerFunc = function(event) {
+ var e = event || window.event;
+ JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
+ HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0;
+ HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */;
+ HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
+ HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: true,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },pageScrollPos:function () {
+ if (window.pageXOffset > 0 || window.pageYOffset > 0) {
+ return [window.pageXOffset, window.pageYOffset];
+ }
+ if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
+ return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
+ }
+ return [document.body.scrollLeft|0, document.body.scrollTop|0];
+ },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.uiEvent) {
+ JSEvents.uiEvent = _malloc( 36 );
+ }
+
+ if (eventTypeString == "scroll" && !target) {
+ target = document; // By default read scroll events on document rather than window.
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+ if (e.target != target) {
+ // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
+ // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
+ // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
+ // causing a new scroll, etc..
+ return;
+ }
+ var scrollPos = JSEvents.pageScrollPos();
+ HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
+ HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
+ HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
+ HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
+ HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
+ HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
+ HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
+ HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
+ HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.uiEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },getNodeNameForTarget:function (target) {
+ if (!target) return '';
+ if (target == window) return '#window';
+ if (target == window.screen) return '#screen';
+ return (target && target.nodeName) ? target.nodeName : '';
+ },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.focusEvent) {
+ JSEvents.focusEvent = _malloc( 256 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var nodeName = JSEvents.getNodeNameForTarget(e.target);
+ var id = e.target.id ? e.target.id : '';
+ stringToUTF8(nodeName, JSEvents.focusEvent + 0, 128);
+ stringToUTF8(id, JSEvents.focusEvent + 128, 128);
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.focusEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },tick:function () {
+ if (window['performance'] && window['performance']['now']) return window['performance']['now']();
+ else return Date.now();
+ },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.deviceOrientationEvent) {
+ JSEvents.deviceOrientationEvent = _malloc( 40 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
+ HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
+ HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.deviceMotionEvent) {
+ JSEvents.deviceMotionEvent = _malloc( 80 );
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
+ HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },screenOrientation:function () {
+ if (!window.screen) return undefined;
+ return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
+ },fillOrientationChangeEventData:function (eventStruct, e) {
+ var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
+ var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
+
+ var orientationString = JSEvents.screenOrientation();
+ var orientation = orientations.indexOf(orientationString);
+ if (orientation == -1) {
+ orientation = orientations2.indexOf(orientationString);
+ }
+
+ HEAP32[((eventStruct)>>2)]=1 << orientation;
+ HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
+ },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.orientationChangeEvent) {
+ JSEvents.orientationChangeEvent = _malloc( 8 );
+ }
+
+ if (!target) {
+ target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.orientationChangeEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
+ eventTypeString = "mozorientationchange";
+ }
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },fullscreenEnabled:function () {
+ return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
+ },fillFullscreenChangeEventData:function (eventStruct, e) {
+ var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
+ var isFullscreen = !!fullscreenElement;
+ HEAP32[((eventStruct)>>2)]=isFullscreen;
+ HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
+ // If transitioning to fullscreen, report info about the element that is now fullscreen.
+ // If transitioning to windowed mode, report info about the element that just was fullscreen.
+ var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
+ var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
+ var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
+ stringToUTF8(nodeName, eventStruct + 8, 128);
+ stringToUTF8(id, eventStruct + 136, 128);
+ HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
+ HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
+ HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
+ HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
+ if (isFullscreen) {
+ JSEvents.previousFullscreenElement = fullscreenElement;
+ }
+ },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.fullscreenChangeEvent) {
+ JSEvents.fullscreenChangeEvent = _malloc( 280 );
+ }
+
+ if (!target) {
+ target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.fullscreenChangeEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },resizeCanvasForFullscreen:function (target, strategy) {
+ var restoreOldStyle = __registerRestoreOldStyle(target);
+ var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
+ var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
+ var rect = target.getBoundingClientRect();
+ var windowedCssWidth = rect.right - rect.left;
+ var windowedCssHeight = rect.bottom - rect.top;
+ var windowedRttWidth = target.width;
+ var windowedRttHeight = target.height;
+
+ if (strategy.scaleMode == 3) {
+ __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
+ cssWidth = windowedCssWidth;
+ cssHeight = windowedCssHeight;
+ } else if (strategy.scaleMode == 2) {
+ if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
+ var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
+ __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
+ cssHeight = desiredCssHeight;
+ } else {
+ var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
+ __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
+ cssWidth = desiredCssWidth;
+ }
+ }
+
+ // If we are adding padding, must choose a background color or otherwise Chrome will give the
+ // padding a default white color. Do it only if user has not customized their own background color.
+ if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
+ // IE11 does the same, but requires the color to be set in the document body.
+ if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
+ // Firefox always shows black letterboxes independent of style color.
+
+ target.style.width = cssWidth + 'px';
+ target.style.height = cssHeight + 'px';
+
+ if (strategy.filteringMode == 1) {
+ target.style.imageRendering = 'optimizeSpeed';
+ target.style.imageRendering = '-moz-crisp-edges';
+ target.style.imageRendering = '-o-crisp-edges';
+ target.style.imageRendering = '-webkit-optimize-contrast';
+ target.style.imageRendering = 'optimize-contrast';
+ target.style.imageRendering = 'crisp-edges';
+ target.style.imageRendering = 'pixelated';
+ }
+
+ var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
+ if (strategy.canvasResolutionScaleMode != 0) {
+ target.width = cssWidth * dpiScale;
+ target.height = cssHeight * dpiScale;
+ if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
+ }
+ return restoreOldStyle;
+ },requestFullscreen:function (target, strategy) {
+ // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
+ if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
+ JSEvents.resizeCanvasForFullscreen(target, strategy);
+ }
+
+ if (target.requestFullscreen) {
+ target.requestFullscreen();
+ } else if (target.msRequestFullscreen) {
+ target.msRequestFullscreen();
+ } else if (target.mozRequestFullScreen) {
+ target.mozRequestFullScreen();
+ } else if (target.mozRequestFullscreen) {
+ target.mozRequestFullscreen();
+ } else if (target.webkitRequestFullscreen) {
+ target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
+ } else {
+ if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
+ return -1;
+ } else {
+ return -3;
+ }
+ }
+
+ if (strategy.canvasResizedCallback) {
+ Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
+ }
+
+ return 0;
+ },fillPointerlockChangeEventData:function (eventStruct, e) {
+ var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
+ var isPointerlocked = !!pointerLockElement;
+ HEAP32[((eventStruct)>>2)]=isPointerlocked;
+ var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
+ var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
+ stringToUTF8(nodeName, eventStruct + 4, 128);
+ stringToUTF8(id, eventStruct + 132, 128);
+ },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.pointerlockChangeEvent) {
+ JSEvents.pointerlockChangeEvent = _malloc( 260 );
+ }
+
+ if (!target) {
+ target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.pointerlockChangeEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!target) {
+ target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },requestPointerLock:function (target) {
+ if (target.requestPointerLock) {
+ target.requestPointerLock();
+ } else if (target.mozRequestPointerLock) {
+ target.mozRequestPointerLock();
+ } else if (target.webkitRequestPointerLock) {
+ target.webkitRequestPointerLock();
+ } else if (target.msRequestPointerLock) {
+ target.msRequestPointerLock();
+ } else {
+ // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
+ // or if the whole browser just doesn't support the feature.
+ if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
+ return -3;
+ } else {
+ return -1;
+ }
+ }
+ return 0;
+ },fillVisibilityChangeEventData:function (eventStruct, e) {
+ var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
+ var visibilityState = visibilityStates.indexOf(document.visibilityState);
+
+ HEAP32[((eventStruct)>>2)]=document.hidden;
+ HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
+ },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.visibilityChangeEvent) {
+ JSEvents.visibilityChangeEvent = _malloc( 8 );
+ }
+
+ if (!target) {
+ target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
+ } else {
+ target = JSEvents.findEventTarget(target);
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.visibilityChangeEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.touchEvent) {
+ JSEvents.touchEvent = _malloc( 1684 );
+ }
+
+ target = JSEvents.findEventTarget(target);
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var touches = {};
+ for(var i = 0; i < e.touches.length; ++i) {
+ var touch = e.touches[i];
+ touches[touch.identifier] = touch;
+ }
+ for(var i = 0; i < e.changedTouches.length; ++i) {
+ var touch = e.changedTouches[i];
+ touches[touch.identifier] = touch;
+ touch.changed = true;
+ }
+ for(var i = 0; i < e.targetTouches.length; ++i) {
+ var touch = e.targetTouches[i];
+ touches[touch.identifier].onTarget = true;
+ }
+
+ var ptr = JSEvents.touchEvent;
+ HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
+ HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
+ HEAP32[(((ptr)+(12))>>2)]=e.altKey;
+ HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
+ ptr += 20; // Advance to the start of the touch array.
+ var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
+ var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
+ var numTouches = 0;
+ for(var i in touches) {
+ var t = touches[i];
+ HEAP32[((ptr)>>2)]=t.identifier;
+ HEAP32[(((ptr)+(4))>>2)]=t.screenX;
+ HEAP32[(((ptr)+(8))>>2)]=t.screenY;
+ HEAP32[(((ptr)+(12))>>2)]=t.clientX;
+ HEAP32[(((ptr)+(16))>>2)]=t.clientY;
+ HEAP32[(((ptr)+(20))>>2)]=t.pageX;
+ HEAP32[(((ptr)+(24))>>2)]=t.pageY;
+ HEAP32[(((ptr)+(28))>>2)]=t.changed;
+ HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
+ if (canvasRect) {
+ HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
+ HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
+ } else {
+ HEAP32[(((ptr)+(44))>>2)]=0;
+ HEAP32[(((ptr)+(48))>>2)]=0;
+ }
+ HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
+ HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
+
+ ptr += 52;
+
+ if (++numTouches >= 32) {
+ break;
+ }
+ }
+ HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.touchEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: target,
+ allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
+ // Once the above bug is resolved, enable the following condition if possible:
+ // allowsDeferredCalls: eventTypeString == 'touchstart',
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },fillGamepadEventData:function (eventStruct, e) {
+ HEAPF64[((eventStruct)>>3)]=e.timestamp;
+ for(var i = 0; i < e.axes.length; ++i) {
+ HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
+ }
+ for(var i = 0; i < e.buttons.length; ++i) {
+ if (typeof(e.buttons[i]) === 'object') {
+ HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
+ } else {
+ HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
+ }
+ }
+ for(var i = 0; i < e.buttons.length; ++i) {
+ if (typeof(e.buttons[i]) === 'object') {
+ HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
+ } else {
+ HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
+ }
+ }
+ HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
+ HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
+ HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
+ HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
+ stringToUTF8(e.id, eventStruct + 1304, 64);
+ stringToUTF8(e.mapping, eventStruct + 1368, 64);
+ },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.gamepadEvent) {
+ JSEvents.gamepadEvent = _malloc( 1432 );
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.gamepadEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: true,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
+
+ if (confirmationMessage) {
+ confirmationMessage = Pointer_stringify(confirmationMessage);
+ }
+ if (confirmationMessage) {
+ e.preventDefault();
+ e.returnValue = confirmationMessage;
+ return confirmationMessage;
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
+ HEAPF64[((eventStruct)>>3)]=e.chargingTime;
+ HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
+ HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
+ HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
+ },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!JSEvents.batteryEvent) {
+ JSEvents.batteryEvent = _malloc( 32 );
+ }
+
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.batteryEvent, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
+ if (!target) {
+ target = Module['canvas'];
+ }
+ var handlerFunc = function(event) {
+ var e = event || window.event;
+
+ var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
+ if (shouldCancel) {
+ e.preventDefault();
+ }
+ };
+
+ var eventHandler = {
+ target: JSEvents.findEventTarget(target),
+ allowsDeferredCalls: false,
+ eventTypeString: eventTypeString,
+ callbackfunc: callbackfunc,
+ handlerFunc: handlerFunc,
+ useCapture: useCapture
+ };
+ JSEvents.registerOrRemoveHandler(eventHandler);
+ }};function __emscripten_sample_gamepad_data() {
+ // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
+ if (!JSEvents.numGamepadsConnected) return;
+
+ // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
+ if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
+ JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
+ JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
+ }
+ }function _emscripten_get_gamepad_status(index, gamepadState) {
+ __emscripten_sample_gamepad_data();
+ if (!JSEvents.lastGamepadState) return -1;
+
+ // INVALID_PARAM is returned on a Gamepad index that never was there.
+ if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
+
+ // NO_DATA is returned on a Gamepad index that was removed.
+ // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
+ // This is because gamepads must keep their original position in the array.
+ // For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
+ if (!JSEvents.lastGamepadState[index]) return -7;
+
+ JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
+ return 0;
+ }
+
+ var _llvm_pow_f64=Math_pow;
+
+ function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _emscripten_glTexParameterfv(target, pname, params) {
+ var param = HEAPF32[((params)>>2)];
+ GLctx.texParameterf(target, pname, param);
+ }
+
+ function _emscripten_glLinkProgram(program) {
+ GLctx.linkProgram(GL.programs[program]);
+ GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
+ GL.populateUniformTable(program);
+ }
+
+ function _glUniform1f(location, v0) {
+ GLctx.uniform1f(GL.uniforms[location], v0);
+ }
+
+ function _emscripten_glUniform3f(location, v0, v1, v2) {
+ GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
+ }
+
+ function _emscripten_glGetObjectParameterivARB() {
+ Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
+ }
+
+ function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+ function _emscripten_glUniform3i(location, v0, v1, v2) {
+ GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
+ }
+
+ function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
+
+ function _glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+ }
+
+ function _glUniform1i(location, v0) {
+ GLctx.uniform1i(GL.uniforms[location], v0);
+ }
+
+ function _emscripten_glBindAttribLocation(program, index, name) {
+ name = Pointer_stringify(name);
+ GLctx.bindAttribLocation(GL.programs[program], index, name);
+ }
+
+ function _glGenRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var renderbuffer = GLctx.createRenderbuffer();
+ if (!renderbuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.renderbuffers);
+ renderbuffer.name = id;
+ GL.renderbuffers[id] = renderbuffer;
+ HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+ }
+
+ function _glDisable(x0) { GLctx['disable'](x0) }
+
+ function _glfwGetMouseButton(winid, button) {
+ return GLFW.getMouseButton(winid, button);
+ }
+
+ function _emscripten_glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+ }
+
+
+ Module["_memset"] = _memset;
+
+ function _glfwMakeContextCurrent(winid) {}
+
+ function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
+ return 0;
+ }
+
+ function _glBindFramebuffer(target, framebuffer) {
+ GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
+ }
+
+ function ___lock() {}
+
+ function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
+
+ function _glCullFace(x0) { GLctx['cullFace'](x0) }
+
+ function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
+ if (!pointer) {
+ // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
+ // if pointer == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
+ }
+
+ function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
+
+ function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
+
+ function _emscripten_glNormalPointer() {
+ Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
+ }
+
+
+ var _emscripten_GetProcAddress=undefined;
+ Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
+
+ var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
+ EGL.errorCode = code;
+ },chooseConfig:function (display, attribList, config, config_size, numConfigs) {
+ if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
+ EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
+ return 0;
+ }
+ // TODO: read attribList.
+ if ((!config || !config_size) && !numConfigs) {
+ EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
+ return 0;
+ }
+ if (numConfigs) {
+ HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
+ }
+ if (config && config_size > 0) {
+ HEAP32[((config)>>2)]=62002;
+ }
+
+ EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
+ return 1;
+ }};function _eglGetProcAddress(name_) {
+ return _emscripten_GetProcAddress(name_);
+ }
+
+ function _glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+ GL.programInfos[id] = null;
+ }
+
+ function _glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
+
+ function _emscripten_get_pointerlock_status(pointerlockStatus) {
+ if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus);
+ if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
+ return -1;
+ }
+ return 0;
+ }
+
+ function _glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _glfwGetPrimaryMonitor() {
+ return 1;
+ }
+
+
+ function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var data = GLctx.getVertexAttrib(index, pname);
+ if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
+ HEAP32[((params)>>2)]=data["name"];
+ } else if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 'Integer': HEAP32[((params)>>2)]=data; break;
+ case 'Float': HEAPF32[((params)>>2)]=data; break;
+ case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
+ default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
+ case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
+ case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
+ default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+ }
+ }
+ }
+ }function _emscripten_glGetVertexAttribfv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
+ }
+
+ function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
+ return 0;
+ }
+
+ function _glUniform3f(location, v0, v1, v2) {
+ GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
+ }
+
+ function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _emscripten_glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((buffers)+(i*4))>>2)];
+ var buffer = GL.buffers[id];
+
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+
+ if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+ if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+ }
+ }
+
+ function _emscripten_glTexParameteriv(target, pname, params) {
+ var param = HEAP32[((params)>>2)];
+ GLctx.texParameteri(target, pname, param);
+ }
+
+ function _glDrawElements(mode, count, type, indices) {
+
+ GLctx.drawElements(mode, count, type, indices);
+
+ }
+
+ function _glfwTerminate() {
+ window.removeEventListener("keydown", GLFW.onKeydown, true);
+ window.removeEventListener("keypress", GLFW.onKeyPress, true);
+ window.removeEventListener("keyup", GLFW.onKeyup, true);
+ Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
+ Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
+ Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
+ Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
+ Module["canvas"].width = Module["canvas"].height = 1;
+ GLFW.windows = null;
+ GLFW.active = null;
+ }
+
+ function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
+
+
+ var view;
+ if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[4*count-1];
+ for (var i = 0; i < 4*count; i += 4) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+ }
+ GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
+ }
+
+ function _emscripten_glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+ }
+
+ function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // open
+ var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+ var stream = FS.open(pathname, flags, mode);
+ return stream.fd;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // close
+ var stream = SYSCALLS.getStreamFromFD();
+ FS.close(stream);
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _llvm_stacksave() {
+ var self = _llvm_stacksave;
+ if (!self.LLVM_SAVEDSTACKS) {
+ self.LLVM_SAVEDSTACKS = [];
+ }
+ self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
+ return self.LLVM_SAVEDSTACKS.length-1;
+ }
+
+ function _emscripten_glGetVertexAttribiv(index, pname, params) {
+ // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+ // otherwise the results are undefined. (GLES3 spec 6.1.12)
+ emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
+ }
+
+ function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
+
+
+ var view;
+ if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[16*count-1];
+ for (var i = 0; i < 16*count; i += 16) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+ view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+ view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+ view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+ view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+ view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+ view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+ view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+ view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+ view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+ view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+ view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+ }
+ GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+ }
+
+ function _glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
+
+ function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
+ GLctx['drawArraysInstanced'](mode, first, count, primcount);
+ }
+
+ function _emscripten_glEnableClientState() {
+ Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
+ }
+
+ function _emscripten_glGetPointerv() {
+ Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
+ }
+
+ function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // llseek
+ var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+ var offset = offset_low;
+ assert(offset_high === 0);
+ FS.llseek(stream, offset, whence);
+ HEAP32[((result)>>2)]=stream.position;
+ if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+ return 0;
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // writev
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doWritev(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // readv
+ var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+ return SYSCALLS.doReadv(stream, iov, iovcnt);
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+
+ function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
+
+ function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
+
+
+ Module["_i64Subtract"] = _i64Subtract;
+
+
+ Module["_i64Add"] = _i64Add;
+
+ function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
+ return 0;
+ }
+
+ function _glUseProgram(program) {
+ GLctx.useProgram(program ? GL.programs[program] : null);
+ }
+
+ function _emscripten_glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+ }
+
+ function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
+
+ function _emscripten_glFinish() { GLctx['finish']() }
+
+ function _glDeleteFramebuffers(n, framebuffers) {
+ for (var i = 0; i < n; ++i) {
+ var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+ }
+
+ function _glDrawArrays(mode, first, count) {
+
+ GLctx.drawArrays(mode, first, count);
+
+ }
+
+ function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+ function _emscripten_get_num_gamepads() {
+ // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
+ if (!JSEvents.numGamepadsConnected) return 0;
+
+ __emscripten_sample_gamepad_data();
+ if (!JSEvents.lastGamepadState) return -1;
+ return JSEvents.lastGamepadState.length;
+ }
+
+ function ___assert_fail(condition, filename, line, func) {
+ ABORT = true;
+ throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
+ }
+
+ function _emscripten_glUniform4iv(location, count, value) {
+
+
+ GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
+ }
+
+ function _glClear(x0) { GLctx['clear'](x0) }
+
+ function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _emscripten_glUniform3fv(location, count, value) {
+
+
+ var view;
+ if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[3*count-1];
+ for (var i = 0; i < 3*count; i += 3) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
+ }
+ GLctx.uniform3fv(GL.uniforms[location], view);
+ }
+
+ function _emscripten_glIsTexture(texture) {
+ var texture = GL.textures[texture];
+ if (!texture) return 0;
+ return GLctx.isTexture(texture);
+ }
+
+ function _glEnableVertexAttribArray(index) {
+ GLctx.enableVertexAttribArray(index);
+ }
+
+ function _emscripten_glAttachShader(program, shader) {
+ GLctx.attachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _glUniform4f(location, v0, v1, v2, v3) {
+ GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+ }
+
+ function _glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+ GLctx.framebufferTexture2D(target, attachment, textarget,
+ GL.textures[texture], level);
+ }
+
+ function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
+ if (!target) target = '#canvas';
+ target = JSEvents.findEventTarget(target);
+ if (!target) return -4;
+ if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
+ return -1;
+ }
+
+ var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
+
+ // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
+ if (!canPerformRequests) {
+ if (deferUntilInEventHandler) {
+ JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]);
+ return 1;
+ } else {
+ return -2;
+ }
+ }
+
+ return JSEvents.requestPointerLock(target);
+ }
+
+
+
+ var cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC);
+ Module["_llvm_cttz_i32"] = _llvm_cttz_i32;
+ Module["___udivmoddi4"] = ___udivmoddi4;
+ Module["___udivdi3"] = ___udivdi3;
+
+ function _glfwCreateWindow(width, height, title, monitor, share) {
+ return GLFW.createWindow(width, height, title, monitor, share);
+ }
+
+ function _emscripten_glColorPointer() {
+ Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
+ }
+
+ function _glfwDefaultWindowHints() {
+ GLFW.hints = GLFW.defaultHints;
+ }
+
+ function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
+
+ function _emscripten_glDetachShader(program, shader) {
+ GLctx.detachShader(GL.programs[program],
+ GL.shaders[shader]);
+ }
+
+ function _emscripten_glDeleteVertexArrays(n, vaos) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((vaos)+(i*4))>>2)];
+ GLctx['deleteVertexArray'](GL.vaos[id]);
+ GL.vaos[id] = null;
+ }
+ }
+
+ function _glGenFramebuffers(n, ids) {
+ for (var i = 0; i < n; ++i) {
+ var framebuffer = GLctx.createFramebuffer();
+ if (!framebuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.framebuffers);
+ framebuffer.name = id;
+ GL.framebuffers[id] = framebuffer;
+ HEAP32[(((ids)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _glfwInit() {
+ if (GLFW.windows) return 1; // GL_TRUE
+
+ GLFW.initialTime = GLFW.getTime();
+ GLFW.hints = GLFW.defaultHints;
+ GLFW.windows = new Array()
+ GLFW.active = null;
+
+ window.addEventListener("keydown", GLFW.onKeydown, true);
+ window.addEventListener("keypress", GLFW.onKeyPress, true);
+ window.addEventListener("keyup", GLFW.onKeyup, true);
+ Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
+ Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
+ Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
+ Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
+ Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
+ Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
+ Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
+
+ Browser.resizeListeners.push(function(width, height) {
+ GLFW.onCanvasResize(width, height);
+ });
+ return 1; // GL_TRUE
+ }
+
+ function _emscripten_glGetTexParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+ }
+
+ function _glfwSwapBuffers(winid) {
+ GLFW.swapBuffers(winid);
+ }
+
+ function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
+
+ function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
+
+ function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
+ GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+ }
+
+ function _glDisableVertexAttribArray(index) {
+ GLctx.disableVertexAttribArray(index);
+ }
+
+ function _emscripten_glUseProgram(program) {
+ GLctx.useProgram(program ? GL.programs[program] : null);
+ }
+
+ function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
+
+ function _emscripten_glUniform2fv(location, count, value) {
+
+
+ var view;
+ if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[2*count-1];
+ for (var i = 0; i < 2*count; i += 2) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
+ }
+ GLctx.uniform2fv(GL.uniforms[location], view);
+ }
+
+ function _glfwSwapInterval(interval) {
+ interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
+ if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
+ else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
+ }
+
+ function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ if (maxLength > 0 && infoLog) {
+ var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
+
+ function _abort() {
+ Module['abort']();
+ }
+
+ function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+ GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+ GL.renderbuffers[renderbuffer]);
+ }
+
+ function _emscripten_glDeleteFramebuffers(n, framebuffers) {
+ for (var i = 0; i < n; ++i) {
+ var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+ var framebuffer = GL.framebuffers[id];
+ if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+ GLctx.deleteFramebuffer(framebuffer);
+ framebuffer.name = 0;
+ GL.framebuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glIsBuffer(buffer) {
+ var b = GL.buffers[buffer];
+ if (!b) return 0;
+ return GLctx.isBuffer(b);
+ }
+
+ function _emscripten_glUniform2iv(location, count, value) {
+
+
+ GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
+ }
+
+ function _emscripten_glVertexAttrib1fv(index, v) {
+
+ GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
+ }
+
+ function _glEnable(x0) { GLctx['enable'](x0) }
+
+
+
+ function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
+ function roundedToNextMultipleOf(x, y) {
+ return Math.floor((x + y - 1) / y) * y
+ }
+ var plainRowSize = width * sizePerPixel;
+ var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+ return (height <= 0) ? 0 :
+ ((height - 1) * alignedRowSize + plainRowSize);
+ }function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+ var sizePerPixel;
+ var numChannels;
+ switch(format) {
+ case 0x1906 /* GL_ALPHA */:
+ case 0x1909 /* GL_LUMINANCE */:
+ case 0x1902 /* GL_DEPTH_COMPONENT */:
+ numChannels = 1;
+ break;
+ case 0x190A /* GL_LUMINANCE_ALPHA */:
+ numChannels = 2;
+ break;
+ case 0x1907 /* GL_RGB */:
+ case 0x8C40 /* GL_SRGB_EXT */:
+ numChannels = 3;
+ break;
+ case 0x1908 /* GL_RGBA */:
+ case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
+ numChannels = 4;
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return null;
+ }
+ switch (type) {
+ case 0x1401 /* GL_UNSIGNED_BYTE */:
+ sizePerPixel = numChannels*1;
+ break;
+ case 0x1403 /* GL_UNSIGNED_SHORT */:
+ case 0x8D61 /* GL_HALF_FLOAT_OES */:
+ sizePerPixel = numChannels*2;
+ break;
+ case 0x1405 /* GL_UNSIGNED_INT */:
+ case 0x1406 /* GL_FLOAT */:
+ sizePerPixel = numChannels*4;
+ break;
+ case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
+ sizePerPixel = 4;
+ break;
+ case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+ case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+ case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+ sizePerPixel = 2;
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return null;
+ }
+ var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
+ switch(type) {
+ case 0x1401 /* GL_UNSIGNED_BYTE */:
+ return HEAPU8.subarray((pixels),(pixels+bytes));
+ case 0x1406 /* GL_FLOAT */:
+ return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
+ case 0x1405 /* GL_UNSIGNED_INT */:
+ case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
+ return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
+ case 0x1403 /* GL_UNSIGNED_SHORT */:
+ case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+ case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+ case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+ case 0x8D61 /* GL_HALF_FLOAT_OES */:
+ return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return null;
+ }
+ }function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
+ var pixelData = null;
+ if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
+ GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+ }
+
+ function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
+
+ var _emscripten_asm_const_int=true;
+
+ function _emscripten_glUniform2f(location, v0, v1) {
+ GLctx.uniform2f(GL.uniforms[location], v0, v1);
+ }
+
+ function _glGetAttribLocation(program, name) {
+ program = GL.programs[program];
+ name = Pointer_stringify(name);
+ return GLctx.getAttribLocation(program, name);
+ }
+
+ function _glfwWindowHint(target, hint) {
+ GLFW.hints[target] = hint;
+ }
+
+ function _emscripten_glUniform2i(location, v0, v1) {
+ GLctx.uniform2i(GL.uniforms[location], v0, v1);
+ }
+
+ function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+ function _glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ program.name = id;
+ GL.programs[id] = program;
+ return id;
+ }
+
+ function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
+ var renderbuffer = GL.renderbuffers[id];
+ if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+ GLctx.deleteRenderbuffer(renderbuffer);
+ renderbuffer.name = 0;
+ GL.renderbuffers[id] = null;
+ }
+ }
+
+ function _emscripten_glGetBufferParameteriv(target, value, data) {
+ if (!data) {
+ // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+ // if data == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
+ }
+
+
+ function emscriptenWebGLGetUniform(program, location, params, type) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
+ if (typeof data == 'number' || typeof data == 'boolean') {
+ switch (type) {
+ case 'Integer': HEAP32[((params)>>2)]=data; break;
+ case 'Float': HEAPF32[((params)>>2)]=data; break;
+ default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+ }
+ } else {
+ for (var i = 0; i < data.length; i++) {
+ switch (type) {
+ case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
+ case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
+ default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+ }
+ }
+ }
+ }function _emscripten_glGetUniformiv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 'Integer');
+ }
+
+ function _emscripten_glDepthMask(flag) {
+ GLctx.depthMask(!!flag);
+ }
+
+
+ function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+ function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
+ if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
+ if (!target) target = document;
+ else {
+ target = JSEvents.findEventTarget(target);
+ if (!target) return -4;
+ }
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
+ JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
+ return 0;
+ }
+
+
+
+ Module["___muldsi3"] = ___muldsi3;
+ Module["___muldi3"] = ___muldi3;
+
+ function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
+ var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+ HEAP32[((range)>>2)]=result.rangeMin;
+ HEAP32[(((range)+(4))>>2)]=result.rangeMax;
+ HEAP32[((precision)>>2)]=result.precision;
+ }
+
+ function _emscripten_glUniform1fv(location, count, value) {
+
+
+ var view;
+ if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[count-1];
+ for (var i = 0; i < count; ++i) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
+ }
+ GLctx.uniform1fv(GL.uniforms[location], view);
+ }
+
+ function _glfwSetMouseButtonCallback(winid, cbfun) {
+ GLFW.setMouseButtonCallback(winid, cbfun);
+ }
+
+ function _emscripten_set_gamepaddisconnected_callback(userData, useCapture, callbackfunc) {
+ if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+ JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected");
+ return 0;
+ }
+
+ function _emscripten_glBindProgramARB() {
+ Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
+ }
+
+ function _emscripten_glBindTexture(target, texture) {
+ GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
+ }
+
+ function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
+
+ function _emscripten_glDeleteProgram(id) {
+ if (!id) return;
+ var program = GL.programs[id];
+ if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteProgram(program);
+ program.name = 0;
+ GL.programs[id] = null;
+ GL.programInfos[id] = null;
+ }
+
+ function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
+
+ function _emscripten_glVertexAttrib3fv(index, v) {
+
+ GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
+ }
+
+ function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+ function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
+ program = GL.programs[program];
+ var info = GLctx.getActiveAttrib(program, index);
+ if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
+
+ if (bufSize > 0 && name) {
+ var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+
+ if (size) HEAP32[((size)>>2)]=info.size;
+ if (type) HEAP32[((type)>>2)]=info.type;
+ }
+
+ function _emscripten_glIsFramebuffer(framebuffer) {
+ var fb = GL.framebuffers[framebuffer];
+ if (!fb) return 0;
+ return GLctx.isFramebuffer(fb);
+ }
+
+ function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
+
+ function _glfwGetCursorPos(winid, x, y) {
+ GLFW.getCursorPos(winid, x, y);
+ }
+
+ function _emscripten_glGetString(name_) {
+ if (GL.stringCache[name_]) return GL.stringCache[name_];
+ var ret;
+ switch(name_) {
+ case 0x1F00 /* GL_VENDOR */:
+ case 0x1F01 /* GL_RENDERER */:
+ case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+ case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+ ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F02 /* GL_VERSION */:
+ var glVersion = GLctx.getParameter(GLctx.VERSION);
+ // return GLES version string corresponding to the version of the WebGL context
+ {
+ glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+ }
+ ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x1F03 /* GL_EXTENSIONS */:
+ var exts = GLctx.getSupportedExtensions();
+ var gl_exts = [];
+ for (var i = 0; i < exts.length; ++i) {
+ gl_exts.push(exts[i]);
+ gl_exts.push("GL_" + exts[i]);
+ }
+ ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
+ break;
+ case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+ var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+ // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+ var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+ var ver_num = glslVersion.match(ver_re);
+ if (ver_num !== null) {
+ if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+ glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+ }
+ ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
+ break;
+ default:
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return 0;
+ }
+ GL.stringCache[name_] = ret;
+ return ret;
+ }
+
+ function _emscripten_glGetAttribLocation(program, name) {
+ program = GL.programs[program];
+ name = Pointer_stringify(name);
+ return GLctx.getAttribLocation(program, name);
+ }
+
+ function _emscripten_glRotatef() {
+ Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
+ }
+
+
+ function emscriptenWebGLGet(name_, p, type) {
+ // Guard against user passing a null pointer.
+ // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
+ // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
+ // better to report an error instead of doing anything random.
+ if (!p) {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ var ret = undefined;
+ switch(name_) { // Handle a few trivial GLES values
+ case 0x8DFA: // GL_SHADER_COMPILER
+ ret = 1;
+ break;
+ case 0x8DF8: // GL_SHADER_BINARY_FORMATS
+ if (type !== 'Integer' && type !== 'Integer64') {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ }
+ return; // Do not write anything to the out pointer, since no binary formats are supported.
+ case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
+ ret = 0;
+ break;
+ case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+ // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
+ // so implement it ourselves to allow C++ GLES2 code get the length.
+ var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
+ ret = formats.length;
+ break;
+ }
+
+ if (ret === undefined) {
+ var result = GLctx.getParameter(name_);
+ switch (typeof(result)) {
+ case "number":
+ ret = result;
+ break;
+ case "boolean":
+ ret = result ? 1 : 0;
+ break;
+ case "string":
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ case "object":
+ if (result === null) {
+ // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
+ // can mean an invalid name_, which we need to report as an error
+ switch(name_) {
+ case 0x8894: // ARRAY_BUFFER_BINDING
+ case 0x8B8D: // CURRENT_PROGRAM
+ case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
+ case 0x8CA6: // FRAMEBUFFER_BINDING
+ case 0x8CA7: // RENDERBUFFER_BINDING
+ case 0x8069: // TEXTURE_BINDING_2D
+ case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
+ ret = 0;
+ break;
+ }
+ default: {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ }
+ } else if (result instanceof Float32Array ||
+ result instanceof Uint32Array ||
+ result instanceof Int32Array ||
+ result instanceof Array) {
+ for (var i = 0; i < result.length; ++i) {
+ switch (type) {
+ case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break;
+ case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
+ case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break;
+ default: throw 'internal glGet error, bad type: ' + type;
+ }
+ }
+ return;
+ } else if (result instanceof WebGLBuffer ||
+ result instanceof WebGLProgram ||
+ result instanceof WebGLFramebuffer ||
+ result instanceof WebGLRenderbuffer ||
+ result instanceof WebGLTexture) {
+ ret = result.name | 0;
+ } else {
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ break;
+ default:
+ GL.recordError(0x0500); // GL_INVALID_ENUM
+ return;
+ }
+ }
+
+ switch (type) {
+ case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break;
+ case 'Integer': HEAP32[((p)>>2)]=ret; break;
+ case 'Float': HEAPF32[((p)>>2)]=ret; break;
+ case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
+ default: throw 'internal glGet error, bad type: ' + type;
+ }
+ }function _emscripten_glGetIntegerv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Integer');
+ }
+
+ function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
+ var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+ HEAP32[((params)>>2)]=result;
+ }
+
+ function _llvm_stackrestore(p) {
+ var self = _llvm_stacksave;
+ var ret = self.LLVM_SAVEDSTACKS[p];
+ self.LLVM_SAVEDSTACKS.splice(p, 1);
+ Runtime.stackRestore(ret);
+ }
+
+ function _glfwSetWindowShouldClose(winid, value) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.shouldClose = value;
+ }
+
+ function _emscripten_glClientActiveTexture() {
+ Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
+ }
+
+ function _glGenBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx.createBuffer();
+ if (!buffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.buffers);
+ buffer.name = id;
+ GL.buffers[id] = buffer;
+ HEAP32[(((buffers)+(i*4))>>2)]=id;
+ }
+ }
+
+
+ function _emscripten_memcpy_big(dest, src, num) {
+ HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+ return dest;
+ }
+ Module["_memcpy"] = _memcpy;
+
+ function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ if (maxLength > 0 && infoLog) {
+ var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _glfwGetTime() {
+ return GLFW.getTime() - GLFW.initialTime;
+ }
+
+ function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
+ if (!params) {
+ // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+ // if params == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
+ }
+
+ function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
+
+ function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
+ var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+ if (!pixelData) {
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ return;
+ }
+ GLctx.readPixels(x, y, width, height, format, type, pixelData);
+ }
+
+ function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
+ GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+ }
+
+ function _emscripten_glGetError() {
+ // First return any GL error generated by the emscripten library_gl.js interop layer.
+ if (GL.lastError) {
+ var error = GL.lastError;
+ GL.lastError = 0/*GL_NO_ERROR*/;
+ return error;
+ } else { // If there were none, return the GL error from the browser GL context.
+ return GLctx.getError();
+ }
+ }
+
+ function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+ GLctx.framebufferTexture2D(target, attachment, textarget,
+ GL.textures[texture], level);
+ }
+
+ function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
+
+ function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+
+ Module["_memmove"] = _memmove;
+
+ function _glGenTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var texture = GLctx.createTexture();
+ if (!texture) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+ while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.textures);
+ texture.name = id;
+ GL.textures[id] = texture;
+ HEAP32[(((textures)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
+
+ function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+
+ Module["___uremdi3"] = ___uremdi3;
+
+ function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+ function _emscripten_glClear(x0) { GLctx['clear'](x0) }
+
+ function _emscripten_glBindBuffer(target, buffer) {
+ var bufferObj = buffer ? GL.buffers[buffer] : null;
+
+
+ GLctx.bindBuffer(target, bufferObj);
+ }
+
+ function _emscripten_glGetUniformfv(program, location, params) {
+ emscriptenWebGLGetUniform(program, location, params, 'Float');
+ }
+
+ function _glGetProgramiv(program, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ if (program >= GL.counter) {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ return;
+ }
+
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+ HEAP32[((p)>>2)]=ptable.maxUniformLength;
+ } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+ if (ptable.maxAttributeLength == -1) {
+ var program = GL.programs[program];
+ var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+ ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+ for (var i = 0; i < numAttribs; ++i) {
+ var activeAttrib = GLctx.getActiveAttrib(program, i);
+ ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+ } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+ if (ptable.maxUniformBlockNameLength == -1) {
+ var program = GL.programs[program];
+ var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
+ ptable.maxUniformBlockNameLength = 0;
+ for (var i = 0; i < numBlocks; ++i) {
+ var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+ ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+ }
+ }
+
+ function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+ }
+
+ function _emscripten_exit_pointerlock() {
+ // Make sure no queued up calls will fire after this.
+ JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
+
+ if (document.exitPointerLock) {
+ document.exitPointerLock();
+ } else if (document.msExitPointerLock) {
+ document.msExitPointerLock();
+ } else if (document.mozExitPointerLock) {
+ document.mozExitPointerLock();
+ } else if (document.webkitExitPointerLock) {
+ document.webkitExitPointerLock();
+ } else {
+ return -1;
+ }
+ return 0;
+ }
+
+ function _emscripten_glDrawRangeElements() {
+ Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
+ }
+
+ function _glGetUniformLocation(program, name) {
+ name = Pointer_stringify(name);
+
+ var arrayOffset = 0;
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ var arrayIndex = name.slice(ls+1, -1);
+ if (arrayIndex.length > 0) {
+ arrayOffset = parseInt(arrayIndex);
+ if (arrayOffset < 0) {
+ return -1;
+ }
+ }
+ name = name.slice(0, ls);
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ return -1;
+ }
+ var utable = ptable.uniforms;
+ var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+ if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+ return uniformInfo[1]+arrayOffset;
+ } else {
+ return -1;
+ }
+ }
+
+ function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
+ var result = GLctx.getAttachedShaders(GL.programs[program]);
+ var len = result.length;
+ if (len > maxCount) {
+ len = maxCount;
+ }
+ HEAP32[((count)>>2)]=len;
+ for (var i = 0; i < len; ++i) {
+ var id = GL.shaders.indexOf(result[i]);
+ assert(id !== -1, 'shader not bound to local id');
+ HEAP32[(((shaders)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glGenRenderbuffers(n, renderbuffers) {
+ for (var i = 0; i < n; i++) {
+ var renderbuffer = GLctx.createRenderbuffer();
+ if (!renderbuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.renderbuffers);
+ renderbuffer.name = id;
+ GL.renderbuffers[id] = renderbuffer;
+ HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+ function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+ function _emscripten_glUniform1iv(location, count, value) {
+
+
+ GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
+ }
+
+ function _emscripten_glTexCoordPointer() {
+ Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
+ }
+
+ function _emscripten_glGetInfoLogARB() {
+ Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
+ }
+
+
+ function __exit(status) {
+ // void _exit(int status);
+ // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+ Module['exit'](status);
+ }function _exit(status) {
+ __exit(status);
+ }
+
+ function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
+
+ function _glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
+
+ function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+ function _glfwSetCursorPosCallback(winid, cbfun) {
+ GLFW.setCursorPosCallback(winid, cbfun);
+ }
+
+ function _glBindAttribLocation(program, index, name) {
+ name = Pointer_stringify(name);
+ GLctx.bindAttribLocation(GL.programs[program], index, name);
+ }
+
+ function _emscripten_glShaderBinary() {
+ GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+ }
+
+ function _emscripten_glIsProgram(program) {
+ var program = GL.programs[program];
+ if (!program) return 0;
+ return GLctx.isProgram(program);
+ }
+
+ function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
+
+ function _emscripten_glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+ }
+
+ function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
+
+
+ var view;
+ if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[9*count-1];
+ for (var i = 0; i < 9*count; i += 9) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+ view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+ view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+ view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+ view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
+ }
+ GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
+ }
+
+ function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
+
+ function _emscripten_glUniform4fv(location, count, value) {
+
+
+ var view;
+ if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[4*count-1];
+ for (var i = 0; i < 4*count; i += 4) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+ }
+ GLctx.uniform4fv(GL.uniforms[location], view);
+ }
+
+ function _glBufferSubData(target, offset, size, data) {
+ GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+ }
+
+ function _emscripten_glGenFramebuffers(n, ids) {
+ for (var i = 0; i < n; ++i) {
+ var framebuffer = GLctx.createFramebuffer();
+ if (!framebuffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.framebuffers);
+ framebuffer.name = id;
+ GL.framebuffers[id] = framebuffer;
+ HEAP32[(((ids)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _glGetShaderiv(shader, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+ }
+ }
+
+ function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
+
+ function _glfwSetWindowIconifyCallback(winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.windowIconifyFunc = cbfun;
+ }
+
+ function _emscripten_glUniform1i(location, v0) {
+ GLctx.uniform1i(GL.uniforms[location], v0);
+ }
+
+ function _emscripten_glGenTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var texture = GLctx.createTexture();
+ if (!texture) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
+ while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.textures);
+ texture.name = id;
+ GL.textures[id] = texture;
+ HEAP32[(((textures)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glVertexAttrib2fv(index, v) {
+
+ GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
+ }
+
+ function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
+ program = GL.programs[program];
+ var info = GLctx.getActiveUniform(program, index);
+ if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
+
+ if (bufSize > 0 && name) {
+ var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+
+ if (size) HEAP32[((size)>>2)]=info.size;
+ if (type) HEAP32[((type)>>2)]=info.type;
+ }
+
+
+ Module["_roundf"] = _roundf;
+
+ function _emscripten_glDeleteObjectARB() {
+ Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
+ }
+
+ function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
+ return 0;
+ }
+
+ function _emscripten_glUniform1f(location, v0) {
+ GLctx.uniform1f(GL.uniforms[location], v0);
+ }
+
+ function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+ GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+ }
+
+ function _glShaderSource(shader, count, string, length) {
+ var source = GL.getSource(shader, count, string, length);
+
+
+ GLctx.shaderSource(GL.shaders[shader], source);
+ }
+
+ function _emscripten_glDrawArrays(mode, first, count) {
+
+ GLctx.drawArrays(mode, first, count);
+
+ }
+
+ function _emscripten_glGenBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var buffer = GLctx.createBuffer();
+ if (!buffer) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.buffers);
+ buffer.name = id;
+ GL.buffers[id] = buffer;
+ HEAP32[(((buffers)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }
+
+ function _emscripten_set_keypress_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress");
+ return 0;
+ }
+
+ function _glfwSetCharCallback(winid, cbfun) {
+ GLFW.setCharCallback(winid, cbfun);
+ }
+
+ function _emscripten_glGetUniformLocation(program, name) {
+ name = Pointer_stringify(name);
+
+ var arrayOffset = 0;
+ // If user passed an array accessor "[index]", parse the array index off the accessor.
+ if (name.indexOf(']', name.length-1) !== -1) {
+ var ls = name.lastIndexOf('[');
+ var arrayIndex = name.slice(ls+1, -1);
+ if (arrayIndex.length > 0) {
+ arrayOffset = parseInt(arrayIndex);
+ if (arrayOffset < 0) {
+ return -1;
+ }
+ }
+ name = name.slice(0, ls);
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ return -1;
+ }
+ var utable = ptable.uniforms;
+ var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+ if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+ return uniformInfo[1]+arrayOffset;
+ } else {
+ return -1;
+ }
+ }
+
+ function _glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+ function _glBindBuffer(target, buffer) {
+ var bufferObj = buffer ? GL.buffers[buffer] : null;
+
+
+ GLctx.bindBuffer(target, bufferObj);
+ }
+
+ function _emscripten_glVertexAttrib4fv(index, v) {
+
+ GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
+ }
+
+ function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
+
+ function _glfwSetCursorEnterCallback(winid, cbfun) {
+ var win = GLFW.WindowFromId(winid);
+ if (!win) return;
+ win.cursorEnterFunc = cbfun;
+ }
+
+
+ Module["_bitshift64Lshr"] = _bitshift64Lshr;
+
+ function _glBufferData(target, size, data, usage) {
+ if (!data) {
+ GLctx.bufferData(target, size, usage);
+ } else {
+ GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+ }
+ }
+
+ function _emscripten_glIsShader(shader) {
+ var s = GL.shaders[shader];
+ if (!s) return 0;
+ return GLctx.isShader(s);
+ }
+
+ function _emscripten_glDrawBuffers(n, bufs) {
+
+ var bufArray = GL.tempFixedLengthArray[n];
+ for (var i = 0; i < n; i++) {
+ bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
+ }
+
+ GLctx['drawBuffers'](bufArray);
+ }
+
+ function _glGetFloatv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Float');
+ }
+
+ function _emscripten_glBindFramebuffer(target, framebuffer) {
+ GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
+ }
+
+ function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
+
+ function _emscripten_glBufferSubData(target, offset, size, data) {
+ GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+ }
+
+ function _emscripten_glBufferData(target, size, data, usage) {
+ if (!data) {
+ GLctx.bufferData(target, size, usage);
+ } else {
+ GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
+ }
+ }
+
+
+ Module["_sbrk"] = _sbrk;
+
+
+ Module["_bitshift64Shl"] = _bitshift64Shl;
+
+ function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
+ var result = GLctx.getShaderSource(GL.shaders[shader]);
+ if (!result) return; // If an error occurs, nothing will be written to length or source.
+ if (bufSize > 0 && source) {
+ var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+
+ Module["_llvm_bswap_i32"] = _llvm_bswap_i32;
+
+ function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+ function _glBindRenderbuffer(target, renderbuffer) {
+ GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
+ }
+
+ function _glfwSetKeyCallback(winid, cbfun) {
+ GLFW.setKeyCallback(winid, cbfun);
+ }
+
+ function _emscripten_set_gamepadconnected_callback(userData, useCapture, callbackfunc) {
+ if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+ JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected");
+ return 0;
+ }
+
+ function _emscripten_glGetFloatv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Float');
+ }
+
+ function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+
+ var pixelData = null;
+ if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+ }
+
+ function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+
+ if (maxLength > 0 && infoLog) {
+ var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glVertexAttribDivisor(index, divisor) {
+ GLctx['vertexAttribDivisor'](index, divisor);
+ }
+
+ function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
+ GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
+ }
+
+ function _emscripten_glDrawElements(mode, count, type, indices) {
+
+ GLctx.drawElements(mode, count, type, indices);
+
+ }
+
+ function _glDeleteBuffers(n, buffers) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((buffers)+(i*4))>>2)];
+ var buffer = GL.buffers[id];
+
+ // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+ // correspond to existing buffer objects."
+ if (!buffer) continue;
+
+ GLctx.deleteBuffer(buffer);
+ buffer.name = 0;
+ GL.buffers[id] = null;
+
+ if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+ if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+ }
+ }
+
+ function _emscripten_glCreateProgram() {
+ var id = GL.getNewId(GL.programs);
+ var program = GLctx.createProgram();
+ program.name = id;
+ GL.programs[id] = program;
+ return id;
+ }
+
+ function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+ GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+ }
+
+ function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+ function _emscripten_glBindVertexArray(vao) {
+ GLctx['bindVertexArray'](GL.vaos[vao]);
+ }
+
+ function _emscripten_glLoadMatrixf() {
+ Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
+ }
+
+ function _glDeleteShader(id) {
+ if (!id) return;
+ var shader = GL.shaders[id];
+ if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+ GLctx.deleteShader(shader);
+ GL.shaders[id] = null;
+ }
+
+ function _emscripten_glGetProgramiv(program, pname, p) {
+ if (!p) {
+ // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+ // if p == null, issue a GL error to notify user about it.
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ if (program >= GL.counter) {
+ GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+ return;
+ }
+
+ var ptable = GL.programInfos[program];
+ if (!ptable) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ return;
+ }
+
+ if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+ HEAP32[((p)>>2)]=log.length + 1;
+ } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+ HEAP32[((p)>>2)]=ptable.maxUniformLength;
+ } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+ if (ptable.maxAttributeLength == -1) {
+ var program = GL.programs[program];
+ var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
+ ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+ for (var i = 0; i < numAttribs; ++i) {
+ var activeAttrib = GLctx.getActiveAttrib(program, i);
+ ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+ } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+ if (ptable.maxUniformBlockNameLength == -1) {
+ var program = GL.programs[program];
+ var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
+ ptable.maxUniformBlockNameLength = 0;
+ for (var i = 0; i < numBlocks; ++i) {
+ var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+ ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+ }
+ }
+ HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+ } else {
+ HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+ }
+ }
+
+ function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
+ var log = GLctx.getProgramInfoLog(GL.programs[program]);
+ if (log === null) log = '(unknown error)';
+
+ if (maxLength > 0 && infoLog) {
+ var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+ if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+ } else {
+ if (length) HEAP32[((length)>>2)]=0;
+ }
+ }
+
+ function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+
+ var pixelData = null;
+ if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
+ GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
+ }
+
+ function _glPixelStorei(pname, param) {
+ if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+ GL.packAlignment = param;
+ } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+ }
+
+ function ___unlock() {}
+
+ function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+ function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+ function _glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
+
+ function _glfwDestroyWindow(winid) {
+ return GLFW.destroyWindow(winid);
+ }
+
+ function _emscripten_glFlush() { GLctx['flush']() }
+
+ function _glfwSetErrorCallback(cbfun) {
+ GLFW.errorFunc = cbfun;
+ }
+
+ function _emscripten_glCreateShader(shaderType) {
+ var id = GL.getNewId(GL.shaders);
+ GL.shaders[id] = GLctx.createShader(shaderType);
+ return id;
+ }
+
+ function _glUniformMatrix4fv(location, count, transpose, value) {
+
+
+ var view;
+ if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+ // avoid allocation when uploading few enough uniforms
+ view = GL.miniTempBufferViews[16*count-1];
+ for (var i = 0; i < 16*count; i += 16) {
+ view[i] = HEAPF32[(((value)+(4*i))>>2)];
+ view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+ view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+ view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+ view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+ view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+ view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+ view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+ view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+ view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+ view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+ view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+ view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+ view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+ view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+ view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+ }
+ } else {
+ view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+ }
+ GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+ }
+
+ function _emscripten_glValidateProgram(program) {
+ GLctx.validateProgram(GL.programs[program]);
+ }
+
+ function _emscripten_set_click_callback(target, userData, useCapture, callbackfunc) {
+ JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click");
+ return 0;
+ }
+
+ function _glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+ function _emscripten_glColorMask(red, green, blue, alpha) {
+ GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+ }
+
+ function _emscripten_glPixelStorei(pname, param) {
+ if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
+ GL.packAlignment = param;
+ } else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+ GL.unpackAlignment = param;
+ }
+ GLctx.pixelStorei(pname, param);
+ }
+
+ function _emscripten_glDeleteTextures(n, textures) {
+ for (var i = 0; i < n; i++) {
+ var id = HEAP32[(((textures)+(i*4))>>2)];
+ var texture = GL.textures[id];
+ if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+ GLctx.deleteTexture(texture);
+ texture.name = 0;
+ GL.textures[id] = null;
+ }
+ }
+
+ function _glfwGetKey(winid, key) {
+ return GLFW.getKey(winid, key);
+ }
+
+ function _emscripten_glCompileShader(shader) {
+ GLctx.compileShader(GL.shaders[shader]);
+ }
+
+ function _emscripten_glGenVertexArrays(n, arrays) {
+
+ for (var i = 0; i < n; i++) {
+ var vao = GLctx['createVertexArray']();
+ if (!vao) {
+ GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+ while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
+ return;
+ }
+ var id = GL.getNewId(GL.vaos);
+ vao.name = id;
+ GL.vaos[id] = vao;
+ HEAP32[(((arrays)+(i*4))>>2)]=id;
+ }
+ }
+
+ function _time(ptr) {
+ var ret = (Date.now()/1000)|0;
+ if (ptr) {
+ HEAP32[((ptr)>>2)]=ret;
+ }
+ return ret;
+ }
+
+ function _emscripten_glGetBooleanv(name_, p) {
+ emscriptenWebGLGet(name_, p, 'Boolean');
+ }
+
+ function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
+ try {
+ // fcntl64
+ var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+ switch (cmd) {
+ case 0: {
+ var arg = SYSCALLS.get();
+ if (arg < 0) {
+ return -ERRNO_CODES.EINVAL;
+ }
+ var newStream;
+ newStream = FS.open(stream.path, stream.flags, 0, arg);
+ return newStream.fd;
+ }
+ case 1:
+ case 2:
+ return 0; // FD_CLOEXEC makes no sense for a single process.
+ case 3:
+ return stream.flags;
+ case 4: {
+ var arg = SYSCALLS.get();
+ stream.flags |= arg;
+ return 0;
+ }
+ case 12:
+ case 12: {
+ var arg = SYSCALLS.get();
+ var offset = 0;
+ // We're always unlocked.
+ HEAP16[(((arg)+(offset))>>1)]=2;
+ return 0;
+ }
+ case 13:
+ case 14:
+ case 13:
+ case 14:
+ return 0; // Pretend that the locking is successful.
+ case 16:
+ case 8:
+ return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+ case 9:
+ // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+ ___setErrNo(ERRNO_CODES.EINVAL);
+ return -1;
+ default: {
+ return -ERRNO_CODES.EINVAL;
+ }
+ }
+ } catch (e) {
+ if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+ return -e.errno;
+ }
+ }
+var GLctx; GL.init();
+if (ENVIRONMENT_IS_NODE) {
+ _emscripten_get_now = function _emscripten_get_now_actual() {
+ var t = process['hrtime']();
+ return t[0] * 1e3 + t[1] / 1e6;
+ };
+ } else if (typeof dateNow !== 'undefined') {
+ _emscripten_get_now = dateNow;
+ } else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
+ _emscripten_get_now = function() { return self['performance']['now'](); };
+ } else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
+ _emscripten_get_now = function() { return performance['now'](); };
+ } else {
+ _emscripten_get_now = Date.now;
+ };
+Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Module.printErr("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
+ Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
+ Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
+ Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
+ Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
+ Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
+ Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
+ Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
+FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
+__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
+JSEvents.staticInit();;
+DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);
+
+STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
+
+STACK_MAX = STACK_BASE + TOTAL_STACK;
+
+DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);
+
+HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
+
+staticSealed = true; // seal the static portion of memory
+
+assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
+
+
+
+function nullFunc_viiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vd(x) { Module["printErr"]("Invalid function pointer called with signature 'vd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vid(x) { Module["printErr"]("Invalid function pointer called with signature 'vid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vi(x) { Module["printErr"]("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vii(x) { Module["printErr"]("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viddd(x) { Module["printErr"]("Invalid function pointer called with signature 'viddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vidd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viii(x) { Module["printErr"]("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vidddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vdi(x) { Module["printErr"]("Invalid function pointer called with signature 'vdi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iii(x) { Module["printErr"]("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_i(x) { Module["printErr"]("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vdddddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vdddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vdd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_v(x) { Module["printErr"]("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viid(x) { Module["printErr"]("Invalid function pointer called with signature 'viid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function invoke_viiiii(index,a1,a2,a3,a4,a5) {
+ try {
+ Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vd(index,a1) {
+ try {
+ Module["dynCall_vd"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vid(index,a1,a2) {
+ try {
+ Module["dynCall_vid"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vi(index,a1) {
+ try {
+ Module["dynCall_vi"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vii(index,a1,a2) {
+ try {
+ Module["dynCall_vii"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_ii(index,a1) {
+ try {
+ return Module["dynCall_ii"](index,a1);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viddd(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_viddd"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vidd(index,a1,a2,a3) {
+ try {
+ Module["dynCall_vidd"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iiii(index,a1,a2,a3) {
+ try {
+ return Module["dynCall_iiii"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ try {
+ Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ try {
+ Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viii(index,a1,a2,a3) {
+ try {
+ Module["dynCall_viii"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vidddd(index,a1,a2,a3,a4,a5) {
+ try {
+ Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdi(index,a1,a2) {
+ try {
+ Module["dynCall_vdi"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ try {
+ Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ try {
+ Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_iii(index,a1,a2) {
+ try {
+ return Module["dynCall_iii"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_i(index) {
+ try {
+ return Module["dynCall_i"](index);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
+ try {
+ Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdddd(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_vdddd"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_vdd(index,a1,a2) {
+ try {
+ Module["dynCall_vdd"](index,a1,a2);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_v(index) {
+ try {
+ Module["dynCall_v"](index);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viid(index,a1,a2,a3) {
+ try {
+ Module["dynCall_viid"](index,a1,a2,a3);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+function invoke_viiii(index,a1,a2,a3,a4) {
+ try {
+ Module["dynCall_viiii"](index,a1,a2,a3,a4);
+ } catch(e) {
+ if (typeof e !== 'number' && e !== 'longjmp') throw e;
+ Module["setThrew"](1, 0);
+ }
+}
+
+Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };
+
+Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_vd": nullFunc_vd, "nullFunc_vid": nullFunc_vid, "nullFunc_vi": nullFunc_vi, "nullFunc_vii": nullFunc_vii, "nullFunc_ii": nullFunc_ii, "nullFunc_viddd": nullFunc_viddd, "nullFunc_vidd": nullFunc_vidd, "nullFunc_iiii": nullFunc_iiii, "nullFunc_viiiiiiii": nullFunc_viiiiiiii, "nullFunc_viiiiii": nullFunc_viiiiii, "nullFunc_viii": nullFunc_viii, "nullFunc_vidddd": nullFunc_vidddd, "nullFunc_vdi": nullFunc_vdi, "nullFunc_viiiiiii": nullFunc_viiiiiii, "nullFunc_viiiiiiiii": nullFunc_viiiiiiiii, "nullFunc_iii": nullFunc_iii, "nullFunc_i": nullFunc_i, "nullFunc_vdddddd": nullFunc_vdddddd, "nullFunc_vdddd": nullFunc_vdddd, "nullFunc_vdd": nullFunc_vdd, "nullFunc_v": nullFunc_v, "nullFunc_viid": nullFunc_viid, "nullFunc_viiii": nullFunc_viiii, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_glVertexAttrib4f": _glVertexAttrib4f, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_glDisable": _glDisable, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glCreateShader": _glCreateShader, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_glVertexAttrib3f": _glVertexAttrib3f, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "___syscall145": ___syscall145, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "___syscall146": ___syscall146, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_glRenderbufferStorage": _glRenderbufferStorage, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glBindRenderbuffer": _glBindRenderbuffer, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_glUniform3f": _glUniform3f, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_glGenTextures": _glGenTextures, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_glFramebufferRenderbuffer": _glFramebufferRenderbuffer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "___syscall6": ___syscall6, "___syscall5": ___syscall5, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_glBindFramebuffer": _glBindFramebuffer, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_glGenFramebuffers": _glGenFramebuffers, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "_glCullFace": _glCullFace, "_llvm_pow_f64": _llvm_pow_f64, "_emscripten_set_keypress_callback": _emscripten_set_keypress_callback, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "_glDeleteFramebuffers": _glDeleteFramebuffers, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "_emscripten_set_click_callback": _emscripten_set_click_callback, "_glCheckFramebufferStatus": _glCheckFramebufferStatus, "_emscripten_glFinish": _emscripten_glFinish, "_glFramebufferTexture2D": _glFramebufferTexture2D, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "___syscall221": ___syscall221, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glDisable": _emscripten_glDisable, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_glGetFloatv": _glGetFloatv, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_glfwGetMouseButton": _glfwGetMouseButton, "_emscripten_glHint": _emscripten_glHint, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_glActiveTexture": _glActiveTexture, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_emscripten_set_gamepaddisconnected_callback": _emscripten_set_gamepaddisconnected_callback, "_emscripten_asm_const_iii": _emscripten_asm_const_iii, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_glUniform1f": _glUniform1f, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_set_gamepadconnected_callback": _emscripten_set_gamepadconnected_callback, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_glfwGetKey": _glfwGetKey, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_glClear": _glClear, "_emscripten_glFrustum": _emscripten_glFrustum, "_glVertexAttrib2f": _glVertexAttrib2f, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "__exit": __exit, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glStencilOp": _emscripten_glStencilOp, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "___syscall54": ___syscall54, "___unlock": ___unlock, "_glLinkProgram": _glLinkProgram, "_glfwSwapBuffers": _glfwSwapBuffers, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_glGenRenderbuffers": _glGenRenderbuffers, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glClearColor": _emscripten_glClearColor, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
+// EMSCRIPTEN_START_ASM
+var asm = (function(global, env, buffer) {
+ 'use asm';
+
+
+ var HEAP8 = new global.Int8Array(buffer);
+ var HEAP16 = new global.Int16Array(buffer);
+ var HEAP32 = new global.Int32Array(buffer);
+ var HEAPU8 = new global.Uint8Array(buffer);
+ var HEAPU16 = new global.Uint16Array(buffer);
+ var HEAPU32 = new global.Uint32Array(buffer);
+ var HEAPF32 = new global.Float32Array(buffer);
+ var HEAPF64 = new global.Float64Array(buffer);
+
+
+ var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
+ var tempDoublePtr=env.tempDoublePtr|0;
+ var ABORT=env.ABORT|0;
+ var STACKTOP=env.STACKTOP|0;
+ var STACK_MAX=env.STACK_MAX|0;
+ var cttz_i8=env.cttz_i8|0;
+
+ var __THREW__ = 0;
+ var threwValue = 0;
+ var setjmpId = 0;
+ var undef = 0;
+ var nan = global.NaN, inf = global.Infinity;
+ var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
+ var tempRet0 = 0;
+
+ var Math_floor=global.Math.floor;
+ var Math_abs=global.Math.abs;
+ var Math_sqrt=global.Math.sqrt;
+ var Math_pow=global.Math.pow;
+ var Math_cos=global.Math.cos;
+ var Math_sin=global.Math.sin;
+ var Math_tan=global.Math.tan;
+ var Math_acos=global.Math.acos;
+ var Math_asin=global.Math.asin;
+ var Math_atan=global.Math.atan;
+ var Math_atan2=global.Math.atan2;
+ var Math_exp=global.Math.exp;
+ var Math_log=global.Math.log;
+ var Math_ceil=global.Math.ceil;
+ var Math_imul=global.Math.imul;
+ var Math_min=global.Math.min;
+ var Math_max=global.Math.max;
+ var Math_clz32=global.Math.clz32;
+ var abort=env.abort;
+ var assert=env.assert;
+ var enlargeMemory=env.enlargeMemory;
+ var getTotalMemory=env.getTotalMemory;
+ var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
+ var abortStackOverflow=env.abortStackOverflow;
+ var nullFunc_viiiii=env.nullFunc_viiiii;
+ var nullFunc_vd=env.nullFunc_vd;
+ var nullFunc_vid=env.nullFunc_vid;
+ var nullFunc_vi=env.nullFunc_vi;
+ var nullFunc_vii=env.nullFunc_vii;
+ var nullFunc_ii=env.nullFunc_ii;
+ var nullFunc_viddd=env.nullFunc_viddd;
+ var nullFunc_vidd=env.nullFunc_vidd;
+ var nullFunc_iiii=env.nullFunc_iiii;
+ var nullFunc_viiiiiiii=env.nullFunc_viiiiiiii;
+ var nullFunc_viiiiii=env.nullFunc_viiiiii;
+ var nullFunc_viii=env.nullFunc_viii;
+ var nullFunc_vidddd=env.nullFunc_vidddd;
+ var nullFunc_vdi=env.nullFunc_vdi;
+ var nullFunc_viiiiiii=env.nullFunc_viiiiiii;
+ var nullFunc_viiiiiiiii=env.nullFunc_viiiiiiiii;
+ var nullFunc_iii=env.nullFunc_iii;
+ var nullFunc_i=env.nullFunc_i;
+ var nullFunc_vdddddd=env.nullFunc_vdddddd;
+ var nullFunc_vdddd=env.nullFunc_vdddd;
+ var nullFunc_vdd=env.nullFunc_vdd;
+ var nullFunc_v=env.nullFunc_v;
+ var nullFunc_viid=env.nullFunc_viid;
+ var nullFunc_viiii=env.nullFunc_viiii;
+ var invoke_viiiii=env.invoke_viiiii;
+ var invoke_vd=env.invoke_vd;
+ var invoke_vid=env.invoke_vid;
+ var invoke_vi=env.invoke_vi;
+ var invoke_vii=env.invoke_vii;
+ var invoke_ii=env.invoke_ii;
+ var invoke_viddd=env.invoke_viddd;
+ var invoke_vidd=env.invoke_vidd;
+ var invoke_iiii=env.invoke_iiii;
+ var invoke_viiiiiiii=env.invoke_viiiiiiii;
+ var invoke_viiiiii=env.invoke_viiiiii;
+ var invoke_viii=env.invoke_viii;
+ var invoke_vidddd=env.invoke_vidddd;
+ var invoke_vdi=env.invoke_vdi;
+ var invoke_viiiiiii=env.invoke_viiiiiii;
+ var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
+ var invoke_iii=env.invoke_iii;
+ var invoke_i=env.invoke_i;
+ var invoke_vdddddd=env.invoke_vdddddd;
+ var invoke_vdddd=env.invoke_vdddd;
+ var invoke_vdd=env.invoke_vdd;
+ var invoke_v=env.invoke_v;
+ var invoke_viid=env.invoke_viid;
+ var invoke_viiii=env.invoke_viiii;
+ var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
+ var _glUseProgram=env._glUseProgram;
+ var _emscripten_glShaderSource=env._emscripten_glShaderSource;
+ var _glfwCreateWindow=env._glfwCreateWindow;
+ var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
+ var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
+ var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
+ var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
+ var _emscripten_glCullFace=env._emscripten_glCullFace;
+ var _emscripten_glIsProgram=env._emscripten_glIsProgram;
+ var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
+ var _emscripten_glViewport=env._emscripten_glViewport;
+ var _emscripten_glFrontFace=env._emscripten_glFrontFace;
+ var ___assert_fail=env.___assert_fail;
+ var _glDeleteProgram=env._glDeleteProgram;
+ var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
+ var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
+ var _emscripten_glUseProgram=env._emscripten_glUseProgram;
+ var _glVertexAttrib4f=env._glVertexAttrib4f;
+ var _glBindBuffer=env._glBindBuffer;
+ var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
+ var _glGetShaderInfoLog=env._glGetShaderInfoLog;
+ var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
+ var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
+ var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
+ var _glDisable=env._glDisable;
+ var _glBlendFunc=env._glBlendFunc;
+ var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
+ var _glGetAttribLocation=env._glGetAttribLocation;
+ var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
+ var _glCreateShader=env._glCreateShader;
+ var _emscripten_glReadPixels=env._emscripten_glReadPixels;
+ var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
+ var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
+ var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
+ var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
+ var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
+ var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
+ var _glUniform4f=env._glUniform4f;
+ var _llvm_stacksave=env._llvm_stacksave;
+ var _emscripten_glUniform1i=env._emscripten_glUniform1i;
+ var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
+ var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
+ var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
+ var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
+ var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
+ var _glfwInit=env._glfwInit;
+ var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
+ var _glGenBuffers=env._glGenBuffers;
+ var _glShaderSource=env._glShaderSource;
+ var _emscripten_glGetString=env._emscripten_glGetString;
+ var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
+ var _glVertexAttrib3f=env._glVertexAttrib3f;
+ var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
+ var _emscripten_glScissor=env._emscripten_glScissor;
+ var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
+ var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
+ var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
+ var ___syscall145=env.___syscall145;
+ var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
+ var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
+ var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
+ var ___syscall140=env.___syscall140;
+ var _glfwSetErrorCallback=env._glfwSetErrorCallback;
+ var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
+ var _glfwDestroyWindow=env._glfwDestroyWindow;
+ var ___syscall146=env.___syscall146;
+ var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
+ var _emscripten_glAttachShader=env._emscripten_glAttachShader;
+ var _glVertexAttribPointer=env._glVertexAttribPointer;
+ var _emscripten_glUniform2i=env._emscripten_glUniform2i;
+ var _emscripten_glUniform2f=env._emscripten_glUniform2f;
+ var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
+ var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
+ var _glRenderbufferStorage=env._glRenderbufferStorage;
+ var _glGetProgramInfoLog=env._glGetProgramInfoLog;
+ var _glfwSetScrollCallback=env._glfwSetScrollCallback;
+ var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
+ var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
+ var _emscripten_glGenTextures=env._emscripten_glGenTextures;
+ var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
+ var _llvm_stackrestore=env._llvm_stackrestore;
+ var _glBindRenderbuffer=env._glBindRenderbuffer;
+ var _emscripten_glClear=env._emscripten_glClear;
+ var _glDrawElements=env._glDrawElements;
+ var _glBufferSubData=env._glBufferSubData;
+ var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
+ var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
+ var _glViewport=env._glViewport;
+ var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
+ var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
+ var ___setErrNo=env.___setErrNo;
+ var _eglGetProcAddress=env._eglGetProcAddress;
+ var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
+ var _glDeleteTextures=env._glDeleteTextures;
+ var _glDepthFunc=env._glDepthFunc;
+ var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
+ var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
+ var _glUniform3f=env._glUniform3f;
+ var _emscripten_glFlush=env._emscripten_glFlush;
+ var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
+ var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
+ var _emscripten_glGetError=env._emscripten_glGetError;
+ var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
+ var _emscripten_glUniform3f=env._emscripten_glUniform3f;
+ var _emscripten_glUniform3i=env._emscripten_glUniform3i;
+ var _emscripten_glRotatef=env._emscripten_glRotatef;
+ var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
+ var _glEnable=env._glEnable;
+ var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
+ var _glGenTextures=env._glGenTextures;
+ var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
+ var _glGetString=env._glGetString;
+ var _emscripten_glClearStencil=env._emscripten_glClearStencil;
+ var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
+ var emscriptenWebGLGet=env.emscriptenWebGLGet;
+ var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
+ var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
+ var _emscripten_get_now=env._emscripten_get_now;
+ var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
+ var _glAttachShader=env._glAttachShader;
+ var _glFramebufferRenderbuffer=env._glFramebufferRenderbuffer;
+ var _emscripten_glEnable=env._emscripten_glEnable;
+ var _glCreateProgram=env._glCreateProgram;
+ var _glUniformMatrix4fv=env._glUniformMatrix4fv;
+ var _emscripten_glClearDepth=env._emscripten_glClearDepth;
+ var ___lock=env.___lock;
+ var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
+ var ___syscall6=env.___syscall6;
+ var ___syscall5=env.___syscall5;
+ var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
+ var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
+ var _time=env._time;
+ var _glBindFramebuffer=env._glBindFramebuffer;
+ var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
+ var _glGenFramebuffers=env._glGenFramebuffers;
+ var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
+ var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
+ var _exit=env._exit;
+ var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
+ var _emscripten_glUniform4i=env._emscripten_glUniform4i;
+ var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
+ var _glCullFace=env._glCullFace;
+ var _llvm_pow_f64=env._llvm_pow_f64;
+ var _emscripten_set_keypress_callback=env._emscripten_set_keypress_callback;
+ var __emscripten_sample_gamepad_data=env.__emscripten_sample_gamepad_data;
+ var _glDeleteFramebuffers=env._glDeleteFramebuffers;
+ var _emscripten_get_gamepad_status=env._emscripten_get_gamepad_status;
+ var _emscripten_glUniform4f=env._emscripten_glUniform4f;
+ var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
+ var _glfwGetVideoModes=env._glfwGetVideoModes;
+ var _emscripten_set_click_callback=env._emscripten_set_click_callback;
+ var _glCheckFramebufferStatus=env._glCheckFramebufferStatus;
+ var _emscripten_glFinish=env._emscripten_glFinish;
+ var _glFramebufferTexture2D=env._glFramebufferTexture2D;
+ var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
+ var _emscripten_glDrawElements=env._emscripten_glDrawElements;
+ var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
+ var _emscripten_get_num_gamepads=env._emscripten_get_num_gamepads;
+ var ___syscall221=env.___syscall221;
+ var _emscripten_glStencilMask=env._emscripten_glStencilMask;
+ var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
+ var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
+ var _glClearDepthf=env._glClearDepthf;
+ var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
+ var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
+ var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
+ var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
+ var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
+ var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
+ var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
+ var _glBindTexture=env._glBindTexture;
+ var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
+ var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
+ var _emscripten_glDisable=env._emscripten_glDisable;
+ var _glfwSetCharCallback=env._glfwSetCharCallback;
+ var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
+ var _glGetFloatv=env._glGetFloatv;
+ var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
+ var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
+ var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
+ var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
+ var _glDrawArrays=env._glDrawArrays;
+ var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
+ var _emscripten_memcpy_big=env._emscripten_memcpy_big;
+ var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
+ var _glCompileShader=env._glCompileShader;
+ var _emscripten_get_pointerlock_status=env._emscripten_get_pointerlock_status;
+ var _glfwGetMouseButton=env._glfwGetMouseButton;
+ var _emscripten_glHint=env._emscripten_glHint;
+ var _emscripten_glDepthRange=env._emscripten_glDepthRange;
+ var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
+ var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
+ var _glActiveTexture=env._glActiveTexture;
+ var _emscripten_request_pointerlock=env._emscripten_request_pointerlock;
+ var _emscripten_set_gamepaddisconnected_callback=env._emscripten_set_gamepaddisconnected_callback;
+ var _emscripten_asm_const_iii=env._emscripten_asm_const_iii;
+ var _emscripten_glDepthMask=env._emscripten_glDepthMask;
+ var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
+ var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
+ var _glfwTerminate=env._glfwTerminate;
+ var _glFrontFace=env._glFrontFace;
+ var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
+ var _emscripten_exit_pointerlock=env._emscripten_exit_pointerlock;
+ var _glfwSwapInterval=env._glfwSwapInterval;
+ var _glUniform1i=env._glUniform1i;
+ var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
+ var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
+ var _abort=env._abort;
+ var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
+ var _glDeleteBuffers=env._glDeleteBuffers;
+ var _glBufferData=env._glBufferData;
+ var _glTexImage2D=env._glTexImage2D;
+ var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
+ var _glfwSetKeyCallback=env._glfwSetKeyCallback;
+ var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
+ var _glUniform1f=env._glUniform1f;
+ var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
+ var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
+ var _glDeleteShader=env._glDeleteShader;
+ var _emscripten_glUniform1f=env._emscripten_glUniform1f;
+ var _glGetProgramiv=env._glGetProgramiv;
+ var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
+ var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
+ var _glfwGetTime=env._glfwGetTime;
+ var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
+ var _emscripten_set_gamepadconnected_callback=env._emscripten_set_gamepadconnected_callback;
+ var _emscripten_glBlendColor=env._emscripten_glBlendColor;
+ var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
+ var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
+ var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
+ var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
+ var _emscripten_glCreateShader=env._emscripten_glCreateShader;
+ var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
+ var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
+ var _glfwGetKey=env._glfwGetKey;
+ var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
+ var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
+ var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
+ var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
+ var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
+ var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
+ var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
+ var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
+ var _glGetShaderiv=env._glGetShaderiv;
+ var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
+ var _glGetUniformLocation=env._glGetUniformLocation;
+ var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
+ var _emscripten_glCompileShader=env._emscripten_glCompileShader;
+ var _glClear=env._glClear;
+ var _emscripten_glFrustum=env._emscripten_glFrustum;
+ var _glVertexAttrib2f=env._glVertexAttrib2f;
+ var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
+ var __exit=env.__exit;
+ var _emscripten_glLineWidth=env._emscripten_glLineWidth;
+ var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
+ var _emscripten_glStencilOp=env._emscripten_glStencilOp;
+ var _glBindAttribLocation=env._glBindAttribLocation;
+ var _glPixelStorei=env._glPixelStorei;
+ var _emscripten_glColorMask=env._emscripten_glColorMask;
+ var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
+ var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
+ var _emscripten_glIsTexture=env._emscripten_glIsTexture;
+ var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
+ var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
+ var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
+ var _emscripten_glBindTexture=env._emscripten_glBindTexture;
+ var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
+ var _glfwGetCursorPos=env._glfwGetCursorPos;
+ var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
+ var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
+ var ___syscall54=env.___syscall54;
+ var ___unlock=env.___unlock;
+ var _glLinkProgram=env._glLinkProgram;
+ var _glfwSwapBuffers=env._glfwSwapBuffers;
+ var _emscripten_glColorPointer=env._emscripten_glColorPointer;
+ var _emscripten_set_main_loop=env._emscripten_set_main_loop;
+ var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
+ var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
+ var _glfwWindowHint=env._glfwWindowHint;
+ var _emscripten_glIsShader=env._emscripten_glIsShader;
+ var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
+ var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
+ var _glCompressedTexImage2D=env._glCompressedTexImage2D;
+ var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
+ var _glGenRenderbuffers=env._glGenRenderbuffers;
+ var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
+ var _emscripten_glClearColor=env._emscripten_glClearColor;
+ var _emscripten_glBufferData=env._emscripten_glBufferData;
+ var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
+ var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
+ var _glTexParameteri=env._glTexParameteri;
+ var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
+ var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
+ var _emscripten_glDetachShader=env._emscripten_glDetachShader;
+ var _glClearColor=env._glClearColor;
+ var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
+ var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
+ var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
+ var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
+ var tempFloat = 0.0;
+
+// EMSCRIPTEN_START_FUNCS
+
+function stackAlloc(size) {
+ size = size|0;
+ var ret = 0;
+ ret = STACKTOP;
+ STACKTOP = (STACKTOP + size)|0;
+ STACKTOP = (STACKTOP + 15)&-16;
+ if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(size|0);
+
+ return ret|0;
+}
+function stackSave() {
+ return STACKTOP|0;
+}
+function stackRestore(top) {
+ top = top|0;
+ STACKTOP = top;
+}
+function establishStackSpace(stackBase, stackMax) {
+ stackBase = stackBase|0;
+ stackMax = stackMax|0;
+ STACKTOP = stackBase;
+ STACK_MAX = stackMax;
+}
+
+function setThrew(threw, value) {
+ threw = threw|0;
+ value = value|0;
+ if ((__THREW__|0) == 0) {
+ __THREW__ = threw;
+ threwValue = value;
+ }
+}
+
+function setTempRet0(value) {
+ value = value|0;
+ tempRet0 = value;
+}
+function getTempRet0() {
+ return tempRet0|0;
+}
+
+function _main() {
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $dwarf$byval_copy = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer25 = 0;
+ var $vararg_buffer28 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1360|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1360|0);
+ $dwarf$byval_copy = sp + 88|0;
+ $vararg_buffer28 = sp + 80|0;
+ $vararg_buffer25 = sp + 72|0;
+ $vararg_buffer22 = sp + 64|0;
+ $vararg_buffer19 = sp + 56|0;
+ $vararg_buffer16 = sp + 48|0;
+ $vararg_buffer13 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $0 = sp + 1096|0;
+ $1 = sp + 1072|0;
+ $2 = sp + 1016|0;
+ $3 = sp + 960|0;
+ $4 = sp + 904|0;
+ $5 = sp + 848|0;
+ $6 = sp + 792|0;
+ $7 = sp + 736|0;
+ $8 = sp + 680|0;
+ $9 = sp + 624|0;
+ $10 = sp + 568|0;
+ $11 = sp + 512|0;
+ $12 = sp + 456|0;
+ $13 = sp + 400|0;
+ $14 = sp + 352|0;
+ _SetConfigFlags(32);
+ $15 = HEAP32[2]|0;
+ $16 = HEAP32[3]|0;
+ _InitWindow($15,$16,4512);
+ _LoadModel($0,4561);
+ _memcpy((19608|0),($0|0),264)|0;
+ _LoadTexture($1,4587);
+ ;HEAP32[19872>>2]=HEAP32[$1>>2]|0;HEAP32[19872+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[19872+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[19872+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[19872+16>>2]=HEAP32[$1+16>>2]|0;
+ ;HEAP32[(19796)>>2]=HEAP32[$1>>2]|0;HEAP32[(19796)+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[(19796)+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[(19796)+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[(19796)+16>>2]=HEAP32[$1+16>>2]|0;
+ HEAP32[$vararg_buffer>>2] = 100;
+ $17 = (_FormatText(4655,$vararg_buffer)|0);
+ _LoadShader($2,4621,$17);
+ dest=19892; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer1>>2] = 100;
+ $18 = (_FormatText(4693,$vararg_buffer1)|0);
+ _LoadShader($3,4621,$18);
+ dest=(19948); src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer4>>2] = 100;
+ $19 = (_FormatText(4735,$vararg_buffer4)|0);
+ _LoadShader($4,4621,$19);
+ dest=(20004); src=$4; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer7>>2] = 100;
+ $20 = (_FormatText(4776,$vararg_buffer7)|0);
+ _LoadShader($5,4621,$20);
+ dest=(20060); src=$5; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer10>>2] = 100;
+ $21 = (_FormatText(4814,$vararg_buffer10)|0);
+ _LoadShader($6,4621,$21);
+ dest=(20116); src=$6; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer13>>2] = 100;
+ $22 = (_FormatText(4857,$vararg_buffer13)|0);
+ _LoadShader($7,4621,$22);
+ dest=(20172); src=$7; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer16>>2] = 100;
+ $23 = (_FormatText(4901,$vararg_buffer16)|0);
+ _LoadShader($8,4621,$23);
+ dest=(20228); src=$8; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer19>>2] = 100;
+ $24 = (_FormatText(4938,$vararg_buffer19)|0);
+ _LoadShader($9,4621,$24);
+ dest=(20284); src=$9; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer22>>2] = 100;
+ $25 = (_FormatText(4976,$vararg_buffer22)|0);
+ _LoadShader($10,4621,$25);
+ dest=(20340); src=$10; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer25>>2] = 100;
+ $26 = (_FormatText(5012,$vararg_buffer25)|0);
+ _LoadShader($11,4621,$26);
+ dest=(20396); src=$11; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$vararg_buffer28>>2] = 100;
+ $27 = (_FormatText(5046,$vararg_buffer28)|0);
+ _LoadShader($12,4621,$27);
+ dest=(20452); src=$12; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[$dwarf$byval_copy>>2] = 100;
+ $28 = (_FormatText(5080,$dwarf$byval_copy)|0);
+ _LoadShader($13,4621,$28);
+ dest=(20508); src=$13; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $29 = HEAP32[2]|0;
+ $30 = HEAP32[3]|0;
+ _LoadRenderTexture($14,$29,$30);
+ dest=20564; src=$14; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$dwarf$byval_copy; src=16; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetCameraMode($dwarf$byval_copy,2);
+ _emscripten_set_main_loop((1|0),0,1);
+ dest=$dwarf$byval_copy; src=19892; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(19948); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20004); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20060); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20116); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20172); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20228); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20284); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20340); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20396); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20452); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ dest=$dwarf$byval_copy; src=(20508); stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _UnloadShader($dwarf$byval_copy);
+ ;HEAP32[$dwarf$byval_copy>>2]=HEAP32[19872>>2]|0;HEAP32[$dwarf$byval_copy+4>>2]=HEAP32[19872+4>>2]|0;HEAP32[$dwarf$byval_copy+8>>2]=HEAP32[19872+8>>2]|0;HEAP32[$dwarf$byval_copy+12>>2]=HEAP32[19872+12>>2]|0;HEAP32[$dwarf$byval_copy+16>>2]=HEAP32[19872+16>>2]|0;
+ _UnloadTexture($dwarf$byval_copy);
+ _memcpy(($dwarf$byval_copy|0),(19608|0),264)|0;
+ _UnloadModel($dwarf$byval_copy);
+ _CloseWindow();
+ STACKTOP = sp;return 0;
+}
+function _UpdateDrawFrame() {
+ var $$byval_copy10 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$pr = 0, $$sink = 0, $$sink2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
+ var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 432|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(432|0);
+ $$byval_copy10 = sp + 336|0;
+ $$byval_copy4 = sp + 292|0;
+ $$byval_copy3 = sp + 24|0;
+ $$byval_copy2 = sp;
+ $0 = sp + 416|0;
+ $1 = sp + 328|0;
+ $2 = sp + 312|0;
+ $3 = sp + 304|0;
+ $4 = sp + 288|0;
+ $5 = sp + 412|0;
+ $6 = sp + 408|0;
+ $7 = sp + 404|0;
+ $8 = sp + 400|0;
+ $9 = sp + 396|0;
+ $10 = sp + 392|0;
+ _UpdateCamera(16);
+ $11 = (_IsKeyPressed(262)|0);
+ $12 = ($11|0)==(0);
+ if ($12) {
+ $13 = (_IsKeyPressed(263)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $$pr = HEAP32[4898]|0;
+ $18 = $$pr;
+ } else {
+ $$sink2 = -1;
+ label = 3;
+ }
+ } else {
+ $$sink2 = 1;
+ label = 3;
+ }
+ if ((label|0) == 3) {
+ $15 = HEAP32[4898]|0;
+ $16 = (($15) + ($$sink2))|0;
+ HEAP32[4898] = $16;
+ $18 = $16;
+ }
+ $17 = ($18|0)>(11);
+ if ($17) {
+ $$sink = 0;
+ label = 7;
+ } else {
+ $19 = ($18|0)<(0);
+ if ($19) {
+ $$sink = 11;
+ label = 7;
+ }
+ }
+ if ((label|0) == 7) {
+ HEAP32[4898] = $$sink;
+ }
+ _BeginDrawing();
+ HEAP8[$0>>0] = -11;
+ $20 = ((($0)) + 1|0);
+ HEAP8[$20>>0] = -11;
+ $21 = ((($0)) + 2|0);
+ HEAP8[$21>>0] = -11;
+ $22 = ((($0)) + 3|0);
+ HEAP8[$22>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$0>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$0+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$0+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$0+3>>0]|0;
+ _ClearBackground($$byval_copy10);
+ dest=$$byval_copy10; src=20564; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _BeginTextureMode($$byval_copy10);
+ dest=$$byval_copy10; src=16; stop=dest+40|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _Begin3dMode($$byval_copy10);
+ HEAP32[$1>>2] = -1;
+ _memcpy(($$byval_copy3|0),(19608|0),264)|0;
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[19596>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[19596+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[19596+8>>2]|0;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$1>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$1+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$1+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$1+3>>0]|0;
+ _DrawModel($$byval_copy3,$$byval_copy4,2.0,$$byval_copy10);
+ _DrawGrid(10,1.0);
+ _End3dMode();
+ _EndTextureMode();
+ $23 = HEAP32[4898]|0;
+ $24 = (19892 + (($23*56)|0)|0);
+ dest=$$byval_copy10; src=$24; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _BeginShaderMode($$byval_copy10);
+ HEAP32[$2>>2] = 0;
+ $25 = ((($2)) + 4|0);
+ HEAP32[$25>>2] = 0;
+ $26 = ((($2)) + 8|0);
+ $27 = HEAP32[(20572)>>2]|0;
+ HEAP32[$26>>2] = $27;
+ $28 = ((($2)) + 12|0);
+ $29 = HEAP32[(20576)>>2]|0;
+ $30 = (0 - ($29))|0;
+ HEAP32[$28>>2] = $30;
+ HEAPF32[$3>>2] = 0.0;
+ $31 = ((($3)) + 4|0);
+ HEAPF32[$31>>2] = 0.0;
+ HEAP32[$4>>2] = -1;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[(20568)>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[(20568)+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[(20568)+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[(20568)+12>>2]|0;HEAP32[$$byval_copy2+16>>2]=HEAP32[(20568)+16>>2]|0;
+ ;HEAP32[$$byval_copy3>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$2+12>>2]|0;
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$3+4>>2]|0;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$4+3>>0]|0;
+ _DrawTextureRec($$byval_copy2,$$byval_copy3,$$byval_copy4,$$byval_copy10);
+ _EndShaderMode();
+ HEAP8[$6>>0] = -56;
+ $32 = ((($6)) + 1|0);
+ HEAP8[$32>>0] = -56;
+ $33 = ((($6)) + 2|0);
+ HEAP8[$33>>0] = -56;
+ $34 = ((($6)) + 3|0);
+ HEAP8[$34>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$6>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$6+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$6+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$6+3>>0]|0;
+ _Fade($5,$$byval_copy10,0.69999998807907104);
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$5+3>>0]|0;
+ _DrawRectangle(0,9,580,30,$$byval_copy10);
+ $35 = HEAP32[2]|0;
+ $36 = (($35) + -200)|0;
+ $37 = HEAP32[3]|0;
+ $38 = (($37) + -20)|0;
+ HEAP8[$7>>0] = 80;
+ $39 = ((($7)) + 1|0);
+ HEAP8[$39>>0] = 80;
+ $40 = ((($7)) + 2|0);
+ HEAP8[$40>>0] = 80;
+ $41 = ((($7)) + 3|0);
+ HEAP8[$41>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$7>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$7+3>>0]|0;
+ _DrawText(5113,$36,$38,10,$$byval_copy10);
+ HEAP8[$8>>0] = 0;
+ $42 = ((($8)) + 1|0);
+ HEAP8[$42>>0] = 0;
+ $43 = ((($8)) + 2|0);
+ HEAP8[$43>>0] = 0;
+ $44 = ((($8)) + 3|0);
+ HEAP8[$44>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$8>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$8+3>>0]|0;
+ _DrawText(5148,10,15,20,$$byval_copy10);
+ $45 = HEAP32[4898]|0;
+ $46 = (56 + ($45<<2)|0);
+ $47 = HEAP32[$46>>2]|0;
+ HEAP8[$9>>0] = -26;
+ $48 = ((($9)) + 1|0);
+ HEAP8[$48>>0] = 41;
+ $49 = ((($9)) + 2|0);
+ HEAP8[$49>>0] = 55;
+ $50 = ((($9)) + 3|0);
+ HEAP8[$50>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$9>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$9+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$9+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$9+3>>0]|0;
+ _DrawText($47,330,15,20,$$byval_copy10);
+ HEAP8[$10>>0] = 0;
+ $51 = ((($10)) + 1|0);
+ HEAP8[$51>>0] = 82;
+ $52 = ((($10)) + 2|0);
+ HEAP8[$52>>0] = -84;
+ $53 = ((($10)) + 3|0);
+ HEAP8[$53>>0] = -1;
+ ;HEAP8[$$byval_copy10>>0]=HEAP8[$10>>0]|0;HEAP8[$$byval_copy10+1>>0]=HEAP8[$10+1>>0]|0;HEAP8[$$byval_copy10+2>>0]=HEAP8[$10+2>>0]|0;HEAP8[$$byval_copy10+3>>0]=HEAP8[$10+3>>0]|0;
+ _DrawText(5172,540,10,30,$$byval_copy10);
+ _DrawFPS(700,15);
+ _EndDrawing();
+ STACKTOP = sp;return;
+}
+function _tinfl_decompress($0,$1,$2,$3,$4,$5,$6) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ $6 = $6|0;
+ var $$ = 0, $$$301127 = 0, $$010861840 = 0, $$010871839 = 0, $$010881838 = 0, $$010911856 = 0, $$010941846 = 0, $$010951864 = 0, $$01097 = 0, $$01194 = 0, $$011971855 = 0, $$01202 = 0, $$01202$shrunk = 0, $$01203 = 0, $$01300 = 0, $$01300$shrunk = 0, $$01309 = 0, $$01410 = 0, $$01410$shrunk = 0, $$01411 = 0;
+ var $$01411$shrunk = 0, $$01412 = 0, $$01413 = 0, $$01413$shrunk = 0, $$01416 = 0, $$01507 = 0, $$01607 = 0, $$01834 = 0, $$0937$lcssa = 0, $$09371833 = 0, $$0938$lcssa = 0, $$09381832 = 0, $$0941$lcssa = 0, $$09411816 = 0, $$09431831 = 0, $$09441830 = 0, $$0947 = 0, $$0947$shrunk = 0, $$0948 = 0, $$0949 = 0;
+ var $$0950 = 0, $$0950$shrunk = 0, $$0951 = 0, $$0952 = 0, $$0952$shrunk = 0, $$0953 = 0, $$0956 = 0, $$0959 = 0, $$0959$shrunk = 0, $$0960 = 0, $$0963 = 0, $$0967 = 0, $$0971 = 0, $$0971$shrunk = 0, $$0972 = 0, $$0975 = 0, $$0978 = 0, $$0979 = 0, $$0979$shrunk = 0, $$0980 = 0;
+ var $$0980$shrunk = 0, $$0981 = 0, $$0984 = 0, $$0987 = 0, $$0991 = 0, $$1$lcssa = 0, $$100 = 0, $$1001409 = 0, $$101426 = 0, $$101617 = 0, $$110891852 = 0, $$11098 = 0, $$11098$ph = 0, $$111427 = 0, $$111518 = 0, $$111618 = 0, $$11198 = 0, $$11204 = 0, $$11204$ph = 0, $$11310 = 0;
+ var $$11310$ph = 0, $$11417 = 0, $$11508 = 0, $$11608 = 0, $$11818 = 0, $$121428 = 0, $$121428$ph = 0, $$121519 = 0, $$121619 = 0, $$121619$ph = 0, $$13 = 0, $$131004 = 0, $$131110 = 0, $$131216 = 0, $$131322 = 0, $$131429 = 0, $$131520 = 0, $$131620 = 0, $$14 = 0, $$141005 = 0;
+ var $$141111 = 0, $$141217 = 0, $$141323 = 0, $$141430 = 0, $$141521 = 0, $$141621 = 0, $$15 = 0, $$151006 = 0, $$151112 = 0, $$151218 = 0, $$151324 = 0, $$151431 = 0, $$151522 = 0, $$151622 = 0, $$16 = 0, $$161007 = 0, $$161113 = 0, $$161113$ph = 0, $$161219 = 0, $$161325 = 0;
+ var $$161432 = 0, $$161523 = 0, $$161623 = 0, $$17 = 0, $$17$ph = 0, $$171008 = 0, $$171008$ph = 0, $$171114 = 0, $$171220 = 0, $$171220$ph = 0, $$171326 = 0, $$171326$ph = 0, $$171433 = 0, $$171524 = 0, $$171624 = 0, $$1753 = 0, $$1754 = 0, $$18 = 0, $$181009 = 0, $$181115 = 0;
+ var $$181221 = 0, $$181327 = 0, $$181434 = 0, $$181525 = 0, $$181625 = 0, $$19 = 0, $$191010 = 0, $$191116 = 0, $$191222 = 0, $$191328 = 0, $$191435 = 0, $$191526 = 0, $$191626 = 0, $$1939$lcssa = 0, $$19391817 = 0, $$19421823 = 0, $$1945$lcssa = 0, $$19451815 = 0, $$1954 = 0, $$1957 = 0;
+ var $$1961 = 0, $$1961$ = 0, $$1964 = 0, $$1968 = 0, $$1973 = 0, $$1976 = 0, $$1982 = 0, $$1985 = 0, $$1988 = 0, $$1988$ph = 0, $$1992 = 0, $$1992$ph = 0, $$2$lcssa = 0, $$20 = 0, $$201011 = 0, $$201117 = 0, $$201223 = 0, $$201329 = 0, $$201436 = 0, $$201527 = 0;
+ var $$201627 = 0, $$21 = 0, $$21099 = 0, $$211012 = 0, $$211118 = 0, $$211224 = 0, $$211330 = 0, $$211437 = 0, $$211437$ph = 0, $$211528 = 0, $$211628 = 0, $$211628$ph = 0, $$21196 = 0, $$21199$lcssa = 0, $$211991845 = 0, $$21205 = 0, $$21311 = 0, $$21418 = 0, $$21509 = 0, $$21609 = 0;
+ var $$21825 = 0, $$22 = 0, $$221013 = 0, $$221119 = 0, $$221225 = 0, $$221331 = 0, $$221438 = 0, $$221529 = 0, $$221629 = 0, $$23 = 0, $$231014 = 0, $$231120 = 0, $$231226 = 0, $$231332 = 0, $$231439 = 0, $$231530 = 0, $$231630 = 0, $$24 = 0, $$241015 = 0, $$241121 = 0;
+ var $$241227 = 0, $$241333 = 0, $$241440 = 0, $$241531 = 0, $$241631 = 0, $$25 = 0, $$251016 = 0, $$251122 = 0, $$251122$ph = 0, $$251228 = 0, $$251334 = 0, $$251441 = 0, $$251532 = 0, $$251632 = 0, $$26 = 0, $$26$ph = 0, $$261017 = 0, $$261017$ph = 0, $$261123 = 0, $$261229 = 0;
+ var $$261229$ph = 0, $$261335 = 0, $$261335$ph = 0, $$261442 = 0, $$261533 = 0, $$261633 = 0, $$27 = 0, $$271018 = 0, $$271124 = 0, $$271230 = 0, $$271336 = 0, $$271443 = 0, $$271534 = 0, $$271634 = 0, $$28 = 0, $$281019 = 0, $$281125 = 0, $$281231 = 0, $$281337 = 0, $$281444 = 0;
+ var $$281535 = 0, $$281635 = 0, $$29 = 0, $$291020 = 0, $$291126 = 0, $$291232 = 0, $$291338 = 0, $$291445 = 0, $$291536 = 0, $$291636 = 0, $$2940$lcssa = 0, $$29401824 = 0, $$2946$lcssa = 0, $$29461822 = 0, $$2955 = 0, $$2958 = 0, $$2965 = 0, $$2969 = 0, $$2974 = 0, $$2977 = 0;
+ var $$2983 = 0, $$2986 = 0, $$2989 = 0, $$2993 = 0, $$30 = 0, $$301021 = 0, $$301127 = 0, $$301233 = 0, $$301339 = 0, $$301446 = 0, $$301537 = 0, $$301637 = 0, $$31 = 0, $$31100$v = 0, $$311022 = 0, $$311128 = 0, $$311234 = 0, $$311340 = 0, $$311447 = 0, $$311538 = 0;
+ var $$311638 = 0, $$31200 = 0, $$31206 = 0, $$31206$ph = 0, $$31312 = 0, $$31312$ph = 0, $$31419 = 0, $$31419$ph = 0, $$31610 = 0, $$31610$ph = 0, $$32 = 0, $$321023 = 0, $$321129 = 0, $$321235 = 0, $$321341 = 0, $$321448 = 0, $$321448$ph = 0, $$321539 = 0, $$321639 = 0, $$321639$ph = 0;
+ var $$33 = 0, $$331024 = 0, $$331130 = 0, $$331236 = 0, $$331342 = 0, $$331449 = 0, $$331540 = 0, $$331640 = 0, $$34 = 0, $$341025 = 0, $$341131 = 0, $$341237 = 0, $$341343 = 0, $$341450 = 0, $$341541 = 0, $$341641 = 0, $$35 = 0, $$351026 = 0, $$351132 = 0, $$351238 = 0;
+ var $$351344 = 0, $$351451 = 0, $$351542 = 0, $$351642 = 0, $$36 = 0, $$361027 = 0, $$361027$ph = 0, $$361133 = 0, $$361133$ph = 0, $$361239 = 0, $$361345 = 0, $$361452 = 0, $$361543 = 0, $$361643 = 0, $$37 = 0, $$37$ph = 0, $$371028 = 0, $$371134 = 0, $$371240 = 0, $$371240$ph = 0;
+ var $$371346 = 0, $$371346$ph = 0, $$371453 = 0, $$371453$ph = 0, $$371544 = 0, $$371644 = 0, $$371644$ph = 0, $$38 = 0, $$381029 = 0, $$381135 = 0, $$381241 = 0, $$381347 = 0, $$381454 = 0, $$381545 = 0, $$381645 = 0, $$39 = 0, $$391030 = 0, $$391136 = 0, $$391242 = 0, $$391348 = 0;
+ var $$391455 = 0, $$391546 = 0, $$391646 = 0, $$3966 = 0, $$3970 = 0, $$3990 = 0, $$3990$ph = 0, $$3994 = 0, $$3994$ph = 0, $$40 = 0, $$401031 = 0, $$401137 = 0, $$401243 = 0, $$401349 = 0, $$401456 = 0, $$401547 = 0, $$401647 = 0, $$41 = 0, $$411032 = 0, $$411032$ph = 0;
+ var $$411138 = 0, $$411138$ph = 0, $$411244 = 0, $$411350 = 0, $$411457 = 0, $$411548 = 0, $$411648 = 0, $$41201 = 0, $$41420 = 0, $$41511 = 0, $$41611 = 0, $$42 = 0, $$42$ph = 0, $$421033 = 0, $$421139 = 0, $$421245 = 0, $$421245$ph = 0, $$421351 = 0, $$421351$ph = 0, $$421458 = 0;
+ var $$421549 = 0, $$421649 = 0, $$43 = 0, $$431034 = 0, $$431140 = 0, $$431246 = 0, $$431352 = 0, $$431459 = 0, $$431550 = 0, $$431650 = 0, $$44 = 0, $$441035 = 0, $$441141 = 0, $$441247 = 0, $$441353 = 0, $$441460 = 0, $$441460$ph = 0, $$441551 = 0, $$441651 = 0, $$441651$ph = 0;
+ var $$45 = 0, $$451036 = 0, $$451142 = 0, $$451248 = 0, $$451354 = 0, $$451461 = 0, $$451552 = 0, $$451652 = 0, $$46 = 0, $$461037 = 0, $$461143 = 0, $$461249 = 0, $$461355 = 0, $$461462 = 0, $$461553 = 0, $$461653 = 0, $$47 = 0, $$471038 = 0, $$471144 = 0, $$471250 = 0;
+ var $$471356 = 0, $$471463 = 0, $$471554 = 0, $$471654 = 0, $$48 = 0, $$481039 = 0, $$481039$ph = 0, $$481145 = 0, $$481145$ph = 0, $$481251 = 0, $$481357 = 0, $$481464 = 0, $$481555 = 0, $$481655 = 0, $$49 = 0, $$49$ph = 0, $$491040 = 0, $$491146 = 0, $$491252 = 0, $$491252$ph = 0;
+ var $$491358 = 0, $$491358$ph = 0, $$491465 = 0, $$491465$ph = 0, $$491556 = 0, $$491656 = 0, $$491656$ph = 0, $$5 = 0, $$50 = 0, $$501041 = 0, $$501147 = 0, $$501253 = 0, $$501359 = 0, $$501466 = 0, $$501557 = 0, $$501657 = 0, $$51 = 0, $$51102 = 0, $$511042 = 0, $$511148 = 0;
+ var $$511254 = 0, $$511360 = 0, $$511467 = 0, $$511558 = 0, $$511658 = 0, $$51208 = 0, $$51314 = 0, $$51512 = 0, $$52 = 0, $$521043 = 0, $$521043$ph = 0, $$521149 = 0, $$521255 = 0, $$521361 = 0, $$521468 = 0, $$521559 = 0, $$521659 = 0, $$53 = 0, $$531044 = 0, $$531150 = 0;
+ var $$531150$ph = 0, $$531256 = 0, $$531362 = 0, $$531469 = 0, $$531560 = 0, $$531660 = 0, $$54 = 0, $$54$ph = 0, $$541045 = 0, $$541151 = 0, $$541257 = 0, $$541257$ph = 0, $$541363 = 0, $$541363$ph = 0, $$541470$ph = 0, $$541561 = 0, $$541661$lcssa = 0, $$541661$ph = 0, $$5416611868 = 0, $$55 = 0;
+ var $$551046 = 0, $$551152 = 0, $$551258 = 0, $$551364 = 0, $$551471 = 0, $$551562 = 0, $$551662 = 0, $$56 = 0, $$561047 = 0, $$561153 = 0, $$561259 = 0, $$561365 = 0, $$561472 = 0, $$561563 = 0, $$561663 = 0, $$57 = 0, $$571048$ph = 0, $$571154 = 0, $$571260 = 0, $$571366 = 0;
+ var $$571473 = 0, $$571473$ph = 0, $$571564 = 0, $$571664 = 0, $$571664$ph = 0, $$58 = 0, $$581049 = 0, $$581155$lcssa = 0, $$581155$ph = 0, $$5811551871 = 0, $$581261 = 0, $$581367 = 0, $$581474 = 0, $$581565$lcssa = 0, $$581565$ph = 0, $$5815651869 = 0, $$581665 = 0, $$59$lcssa = 0, $$59$ph = 0, $$591050 = 0;
+ var $$591156 = 0, $$591262$ph = 0, $$591368$lcssa = 0, $$591368$ph = 0, $$5913681870 = 0, $$591475 = 0, $$591566 = 0, $$591666 = 0, $$591872 = 0, $$5996 = 0, $$6 = 0, $$60 = 0, $$601051 = 0, $$601051$ph = 0, $$601157 = 0, $$601263 = 0, $$601369 = 0, $$601476 = 0, $$601567 = 0, $$61 = 0;
+ var $$61103 = 0, $$611052 = 0, $$611158 = 0, $$611158$ph = 0, $$611264 = 0, $$611370 = 0, $$611477 = 0, $$611568 = 0, $$611668 = 0, $$61209 = 0, $$61315 = 0, $$61513 = 0, $$62 = 0, $$62$ph = 0, $$621053 = 0, $$621159 = 0, $$621265 = 0, $$621265$ph = 0, $$621371 = 0, $$621371$ph = 0;
+ var $$621478 = 0, $$621569 = 0, $$621669 = 0, $$63 = 0, $$631054 = 0, $$631266 = 0, $$631372 = 0, $$631479 = 0, $$631479$ph = 0, $$631570 = 0, $$631670 = 0, $$64 = 0, $$641055 = 0, $$641161 = 0, $$641267 = 0, $$641373 = 0, $$641480 = 0, $$641571 = 0, $$641671 = 0, $$641671$ph = 0;
+ var $$65 = 0, $$651056 = 0, $$651162 = 0, $$651268 = 0, $$651374 = 0, $$651481 = 0, $$651572 = 0, $$651672 = 0, $$66 = 0, $$661057 = 0, $$661057$ph = 0, $$661163 = 0, $$661269 = 0, $$661375 = 0, $$661482 = 0, $$661673 = 0, $$671058 = 0, $$671164 = 0, $$671164$ph = 0, $$671270 = 0;
+ var $$671483 = 0, $$671574 = 0, $$671674 = 0, $$68 = 0, $$681059 = 0, $$681165 = 0, $$681271 = 0, $$681271$ph = 0, $$681377 = 0, $$681484 = 0, $$681484$ph = 0, $$681575 = 0, $$681675 = 0, $$69 = 0, $$691060 = 0, $$691166 = 0, $$691272 = 0, $$691378 = 0, $$691485 = 0, $$691576 = 0;
+ var $$691676 = 0, $$691676$ph = 0, $$6997 = 0, $$7 = 0, $$70 = 0, $$701061 = 0, $$701167 = 0, $$701273 = 0, $$701379 = 0, $$701486 = 0, $$701577 = 0, $$701677 = 0, $$71 = 0, $$71$ph = 0, $$71104 = 0, $$711062 = 0, $$711062$ph = 0, $$711168 = 0, $$711274 = 0, $$711380 = 0;
+ var $$711380$ph = 0, $$711487 = 0, $$711578 = 0, $$711678 = 0, $$71210 = 0, $$71316 = 0, $$71514 = 0, $$72 = 0, $$721063 = 0, $$721169 = 0, $$721169$ph = 0, $$721275 = 0, $$721381 = 0, $$721488 = 0, $$721488$ph = 0, $$721579 = 0, $$721679 = 0, $$73 = 0, $$731064 = 0, $$731170 = 0;
+ var $$731276 = 0, $$731276$ph = 0, $$731382 = 0, $$731489 = 0, $$731580 = 0, $$731680 = 0, $$731680$ph = 0, $$74 = 0, $$741065 = 0, $$741065$ph = 0, $$741171 = 0, $$741277 = 0, $$741383 = 0, $$741490 = 0, $$741581 = 0, $$741681 = 0, $$75 = 0, $$751066 = 0, $$751172 = 0, $$751278 = 0;
+ var $$751384 = 0, $$751491 = 0, $$751582 = 0, $$751682 = 0, $$76 = 0, $$76$ph = 0, $$761067 = 0, $$761173 = 0, $$761173$ph = 0, $$761279 = 0, $$761279$ph = 0, $$761385 = 0, $$761385$ph = 0, $$761492 = 0, $$761583 = 0, $$761683 = 0, $$77 = 0, $$771068 = 0, $$771174 = 0, $$771280 = 0;
+ var $$771386 = 0, $$771584 = 0, $$771684 = 0, $$78 = 0, $$781069 = 0, $$781175 = 0, $$781281 = 0, $$781387 = 0, $$781585 = 0, $$781685 = 0, $$79 = 0, $$791070 = 0, $$791176 = 0, $$791282 = 0, $$791388 = 0, $$791586 = 0, $$791686 = 0, $$7998 = 0, $$8 = 0, $$8$ph = 0;
+ var $$80 = 0, $$80$ph = 0, $$801071 = 0, $$801177 = 0, $$801283 = 0, $$801389 = 0, $$801389$ph = 0, $$801496 = 0, $$801587 = 0, $$801687 = 0, $$81 = 0, $$81105 = 0, $$81105$ph = 0, $$811178 = 0, $$811284 = 0, $$811390 = 0, $$811497 = 0, $$811588 = 0, $$81211 = 0, $$81211$ph = 0;
+ var $$81317 = 0, $$81317$ph = 0, $$81424 = 0, $$81515 = 0, $$81615 = 0, $$82 = 0, $$821179 = 0, $$821285 = 0, $$821391 = 0, $$821498 = 0, $$821589 = 0, $$83 = 0, $$831180 = 0, $$831392 = 0, $$831499 = 0, $$831590 = 0, $$84 = 0, $$841075 = 0, $$841393 = 0, $$841500 = 0;
+ var $$841500$ph = 0, $$841591 = 0, $$841691 = 0, $$85 = 0, $$851076 = 0, $$851394 = 0, $$851501 = 0, $$851592 = 0, $$851692 = 0, $$86 = 0, $$861077 = 0, $$861289 = 0, $$861395 = 0, $$861502 = 0, $$861693 = 0, $$871078 = 0, $$871184 = 0, $$871290 = 0, $$871503 = 0, $$871694 = 0;
+ var $$881079 = 0, $$881079$ph = 0, $$881185 = 0, $$881291 = 0, $$881504 = 0, $$881595 = 0, $$881695 = 0, $$881695$ph = 0, $$891080 = 0, $$891186 = 0, $$891292 = 0, $$891505 = 0, $$891596 = 0, $$891696 = 0, $$8999 = 0, $$8999$ph = 0, $$9 = 0, $$90 = 0, $$901081 = 0, $$901187 = 0;
+ var $$901187$ph = 0, $$901293 = 0, $$901293$ph = 0, $$901399 = 0, $$901506 = 0, $$901597 = 0, $$901697 = 0, $$91 = 0, $$91000 = 0, $$91106 = 0, $$911082 = 0, $$911188 = 0, $$911294 = 0, $$911400 = 0, $$911598 = 0, $$911698 = 0, $$91212 = 0, $$91318 = 0, $$91425 = 0, $$91616 = 0;
+ var $$92 = 0, $$921083 = 0, $$921189 = 0, $$921295 = 0, $$921401 = 0, $$921599 = 0, $$921699 = 0, $$93 = 0, $$931084 = 0, $$931190 = 0, $$931296 = 0, $$931402 = 0, $$931600 = 0, $$931700 = 0, $$94 = 0, $$94$ph = 0, $$941085 = 0, $$941191 = 0, $$941297 = 0, $$941403 = 0;
+ var $$941403$ph = 0, $$941601 = 0, $$941701 = 0, $$95 = 0, $$951192 = 0, $$951298 = 0, $$951404 = 0, $$951602 = 0, $$96 = 0, $$961193 = 0, $$961299 = 0, $$961405 = 0, $$961603 = 0, $$97 = 0, $$971406 = 0, $$971604 = 0, $$98 = 0, $$981407 = 0, $$981605 = 0, $$99 = 0;
+ var $$991408 = 0, $$991606 = 0, $$lcssa1778 = 0, $$lcssa1779 = 0, $$lcssa1799 = 0, $$lcssa1802 = 0, $$not = 0, $$not1747 = 0, $$sink12 = 0, $$sink13 = 0, $$sink16 = 0, $$sink17 = 0, $$sink1705 = 0, $$sink1710 = 0, $$sink1713 = 0, $$sink1716 = 0, $$sink1719 = 0, $$sink1722 = 0, $$sink1729 = 0, $$sink1732 = 0;
+ var $$sink1736 = 0, $$sink1739 = 0, $$sink1743 = 0, $$sink1746 = 0, $$sink1750 = 0, $$sink3 = 0, $$sink3$shrunk = 0, $$sink30 = 0, $$sink9 = 0, $$sink9$shrunk = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0;
+ var $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0;
+ var $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0;
+ var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
+ var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0;
+ var $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0;
+ var $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0;
+ var $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0;
+ var $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0;
+ var $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0;
+ var $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0;
+ var $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0;
+ var $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0;
+ var $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0;
+ var $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0;
+ var $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0;
+ var $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0;
+ var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
+ var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
+ var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
+ var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
+ var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
+ var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0;
+ var $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0;
+ var $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0;
+ var $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0;
+ var $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0;
+ var $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0;
+ var $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0;
+ var $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0;
+ var $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0;
+ var $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0;
+ var $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0;
+ var $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0;
+ var $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0;
+ var $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0;
+ var $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0;
+ var $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0;
+ var $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0;
+ var $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0;
+ var $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0;
+ var $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0;
+ var $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0;
+ var $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0;
+ var $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0;
+ var $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0;
+ var $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0;
+ var $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0;
+ var $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $exitcond = 0, $not$ = 0, $not$1755 = 0, $or$cond = 0, $or$cond1702 = 0, $or$cond1752 = 0, $or$cond24 = 0, $or$cond29 = 0, $scevgep = 0;
+ var $scevgep1947 = 0, $scevgep1948 = 0, $scevgep1955 = 0, $scevgep1957 = 0, $scevgep1959 = 0, $scevgep19611962 = 0, $trunc = 0, $trunc$clear = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
+ $7 = sp + 64|0;
+ $8 = sp;
+ $9 = HEAP32[$2>>2]|0;
+ $10 = (($1) + ($9)|0);
+ $11 = HEAP32[$5>>2]|0;
+ $12 = (($4) + ($11)|0);
+ $13 = $6 & 4;
+ $14 = ($13|0)!=(0);
+ $15 = $4;
+ $16 = $3;
+ $17 = $16 ^ -1;
+ $18 = (($15) + ($17))|0;
+ $19 = (($18) + ($11))|0;
+ $$1753 = $14 ? -1 : $19;
+ $20 = (($$1753) + 1)|0;
+ $21 = $20 & $$1753;
+ $22 = ($21|0)!=(0);
+ $23 = ($4>>>0)<($3>>>0);
+ $or$cond1702 = $23 | $22;
+ if ($or$cond1702) {
+ HEAP32[$5>>2] = 0;
+ HEAP32[$2>>2] = 0;
+ $$0951 = -3;
+ STACKTOP = sp;return ($$0951|0);
+ }
+ $24 = ((($0)) + 4|0);
+ $25 = HEAP32[$24>>2]|0;
+ $26 = ((($0)) + 56|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = ((($0)) + 32|0);
+ $29 = HEAP32[$28>>2]|0;
+ $30 = ((($0)) + 36|0);
+ $31 = HEAP32[$30>>2]|0;
+ $32 = ((($0)) + 40|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = ((($0)) + 60|0);
+ $35 = HEAP32[$34>>2]|0;
+ $36 = HEAP32[$0>>2]|0;
+ L5: do {
+ switch ($36|0) {
+ case 0: {
+ $37 = ((($0)) + 12|0);
+ HEAP32[$37>>2] = 0;
+ $38 = ((($0)) + 8|0);
+ HEAP32[$38>>2] = 0;
+ $39 = ((($0)) + 28|0);
+ HEAP32[$39>>2] = 1;
+ $40 = ((($0)) + 16|0);
+ HEAP32[$40>>2] = 1;
+ $41 = $6 & 1;
+ $42 = ($41|0)==(0);
+ if ($42) {
+ $$01416 = $35;$$01607 = $4;$$41511 = $1;$$5 = 0;$$51102 = 0;$$51208 = 0;$$51314 = 0;$$5996 = 0;
+ label = 14;
+ } else {
+ $43 = ($9|0)<(1);
+ if ($43) {
+ $$01097 = 0;$$01203 = 0;$$01309 = 0;$$0987 = 0;$$0991 = 0;
+ label = 6;
+ } else {
+ $$11098$ph = 0;$$11204$ph = 0;$$11310$ph = 0;$$1988$ph = 0;$$1992$ph = 0;
+ label = 8;
+ }
+ }
+ break;
+ }
+ case 1: {
+ $46 = ($9|0)>(0);
+ if ($46) {
+ $$11098$ph = $31;$$11204$ph = $33;$$11310$ph = $27;$$1988$ph = $25;$$1992$ph = $29;
+ label = 8;
+ } else {
+ $$01097 = $31;$$01203 = $33;$$01309 = $27;$$0987 = $25;$$0991 = $29;
+ label = 6;
+ }
+ break;
+ }
+ case 2: {
+ $53 = ($9|0)>(0);
+ if ($53) {
+ $$31206$ph = $33;$$31312$ph = $27;$$3990$ph = $25;$$3994$ph = $29;$$sink1705 = $1;
+ label = 12;
+ } else {
+ $$11508 = $1;$$21099 = $31;$$21205 = $33;$$21311 = $27;$$2989 = $25;$$2993 = $29;
+ label = 10;
+ }
+ break;
+ }
+ case 36: {
+ $$0960 = -1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 36;
+ label = 243;
+ break;
+ }
+ case 3: {
+ $75 = ($9|0)>(0);
+ if ($75) {
+ $$31419$ph = $35;$$31610$ph = $4;$$8$ph = $25;$$81105$ph = $31;$$81211$ph = $33;$$81317$ph = $27;$$8999$ph = $29;$$sink1710 = $1;
+ label = 18;
+ } else {
+ $$21418 = $35;$$21609 = $4;$$61513 = $1;$$7 = $25;$$71104 = $31;$$71210 = $33;$$71316 = $27;$$7998 = $29;
+ label = 16;
+ }
+ break;
+ }
+ case 5: {
+ $90 = ($9|0)>(0);
+ if ($90) {
+ $91 = ((($1)) + 1|0);
+ $92 = HEAP8[$1>>0]|0;
+ $93 = $92&255;
+ $$01412 = $93;$$111518 = $91;
+ } else {
+ $88 = $6 & 2;
+ $89 = ($88|0)==(0);
+ if ($89) {
+ $$01412 = 0;$$111518 = $1;
+ } else {
+ $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 5;
+ label = 243;
+ break L5;
+ }
+ }
+ $94 = $$01412 << $25;
+ $95 = $94 | $27;
+ $96 = (($25) + 8)|0;
+ $$121519 = $$111518;$$13 = $96;$$131004 = $29;$$131216 = $33;$$131322 = $95;$$81424 = $35;$$81615 = $4;
+ label = 25;
+ break;
+ }
+ case 6: {
+ $106 = ($9|0)>(0);
+ if ($106) {
+ $$121428$ph = $35;$$121619$ph = $4;$$161113$ph = $31;$$17$ph = $25;$$171008$ph = $29;$$171220$ph = $33;$$171326$ph = $27;$$sink1713 = $1;
+ label = 32;
+ } else {
+ $$111427 = $35;$$111618 = $4;$$151112 = $31;$$151522 = $1;$$16 = $25;$$161007 = $29;$$161219 = $33;$$161325 = $27;
+ label = 30;
+ }
+ break;
+ }
+ case 7: {
+ $120 = ($9|0)>(0);
+ if ($120) {
+ $121 = ((($1)) + 1|0);
+ $122 = HEAP8[$1>>0]|0;
+ $$151431 = $35;$$151622 = $4;$$191116 = $31;$$191526 = $121;$$20 = $25;$$201011 = $29;$$201223 = $33;$$201329 = $27;$$sink12 = $122;
+ label = 39;
+ } else {
+ $$141430 = $35;$$141621 = $4;$$181115 = $31;$$181525 = $1;$$19 = $25;$$191010 = $29;$$191222 = $33;$$191328 = $27;
+ label = 36;
+ }
+ break;
+ }
+ case 39: {
+ $$171433 = $35;$$171624 = $4;$$211118 = $31;$$211528 = $1;$$22 = $25;$$221013 = $29;$$221225 = $33;$$221331 = $27;
+ label = 43;
+ break;
+ }
+ case 51: {
+ $152 = ($9|0)>(0);
+ if ($152) {
+ $$211437$ph = $35;$$211628$ph = $4;$$251122$ph = $31;$$26$ph = $25;$$261017$ph = $29;$$261229$ph = $33;$$261335$ph = $27;$$sink1716 = $1;
+ label = 49;
+ } else {
+ $$201436 = $35;$$201627 = $4;$$241121 = $31;$$241531 = $1;$$25 = $25;$$251016 = $29;$$251228 = $33;$$251334 = $27;
+ label = 47;
+ }
+ break;
+ }
+ case 52: {
+ $$231439 = $35;$$231630 = $4;$$271018 = $29;$$271124 = $31;$$271534 = $1;$$28 = $25;$$281231 = $33;$$281337 = $27;
+ label = 52;
+ break;
+ }
+ case 9: {
+ $$251441 = $35;$$251632 = $4;$$291020 = $29;$$291126 = $31;$$291536 = $1;$$30 = $25;$$301233 = $33;$$301339 = $27;
+ label = 55;
+ break;
+ }
+ case 38: {
+ $$261442 = $35;$$261633 = $4;$$301021 = $29;$$301127 = $31;$$301537 = $1;$$31 = $25;$$311234 = $33;$$311340 = $27;
+ label = 56;
+ break;
+ }
+ case 40: {
+ $$271443 = $35;$$271634 = $4;$$311022 = $29;$$311128 = $31;$$311538 = $1;$$32 = $25;$$321235 = $33;$$321341 = $27;
+ label = 58;
+ break;
+ }
+ case 10: {
+ $$281444 = $35;$$281635 = $4;$$321023 = $29;$$321129 = $31;$$321539 = $1;$$33 = $25;$$331236 = $33;$$331342 = $27;
+ label = 60;
+ break;
+ }
+ case 11: {
+ $193 = ($9|0)>(0);
+ if ($193) {
+ $$321448$ph = $35;$$321639$ph = $4;$$361027$ph = $29;$$361133$ph = $31;$$37$ph = $25;$$371240$ph = $33;$$371346$ph = $27;$$sink1719 = $1;
+ label = 66;
+ } else {
+ $$311447 = $35;$$311638 = $4;$$351026 = $29;$$351132 = $31;$$351542 = $1;$$36 = $25;$$361239 = $33;$$361345 = $27;
+ label = 64;
+ }
+ break;
+ }
+ case 14: {
+ $224 = ($9|0)>(0);
+ if ($224) {
+ $$371453$ph = $35;$$371644$ph = $4;$$411032$ph = $29;$$411138$ph = $31;$$42$ph = $25;$$421245$ph = $33;$$421351$ph = $27;$$sink1722 = $1;
+ label = 75;
+ } else {
+ $$361452 = $35;$$361643 = $4;$$401031 = $29;$$401137 = $31;$$401547 = $1;$$41 = $25;$$411244 = $33;$$411350 = $27;
+ label = 73;
+ }
+ break;
+ }
+ case 35: {
+ $$401456 = $35;$$401647 = $4;$$441035 = $29;$$441141 = $31;$$441551 = $1;$$45 = $25;$$451248 = $33;$$451354 = $27;
+ label = 86;
+ break;
+ }
+ case 16: {
+ $452 = ($9|0)>(0);
+ if ($452) {
+ $$441460$ph = $35;$$441651$ph = $4;$$481039$ph = $29;$$481145$ph = $31;$$49$ph = $25;$$491252$ph = $33;$$491358$ph = $27;$$sink1729 = $1;
+ label = 116;
+ } else {
+ $$431459 = $35;$$431650 = $4;$$471038 = $29;$$471144 = $31;$$471554 = $1;$$48 = $25;$$481251 = $33;$$481357 = $27;
+ label = 114;
+ }
+ break;
+ }
+ case 17: {
+ $$461462 = $35;$$461653 = $4;$$491040 = $29;$$501147 = $31;$$501557 = $1;$$51 = $25;$$511254 = $33;$$511360 = $27;
+ label = 125;
+ break;
+ }
+ case 18: {
+ $503 = ($9|0)>(0);
+ if ($503) {
+ $$491465$ph = $35;$$491656$ph = $4;$$521043$ph = $29;$$531150$ph = $31;$$54$ph = $25;$$541257$ph = $33;$$541363$ph = $27;$$sink1732 = $1;
+ label = 130;
+ } else {
+ $$481464 = $35;$$481655 = $4;$$511042 = $29;$$521149 = $31;$$521559 = $1;$$53 = $25;$$531256 = $33;$$531362 = $27;
+ label = 128;
+ }
+ break;
+ }
+ case 21: {
+ $$511467 = $35;$$511658 = $4;$$541045 = $29;$$551152 = $31;$$551562 = $1;$$56 = $25;$$561259 = $33;$$561365 = $27;
+ label = 136;
+ break;
+ }
+ case 23: {
+ $572 = ($9|0)>(0);
+ if ($572) {
+ $$571473$ph = $35;$$571664$ph = $4;$$601051$ph = $29;$$611158$ph = $31;$$62$ph = $25;$$621265$ph = $33;$$621371$ph = $27;$$sink1736 = $1;
+ label = 153;
+ } else {
+ $$561472 = $35;$$561663 = $4;$$591050 = $29;$$601157 = $31;$$601567 = $1;$$61 = $25;$$611264 = $33;$$611370 = $27;
+ label = 151;
+ }
+ break;
+ }
+ case 24: {
+ $$591475 = $35;$$591666 = $4;$$621053 = $29;$$621159 = $31;$$631570 = $1;$$64 = $25;$$641267 = $33;$$641373 = $27;
+ label = 160;
+ break;
+ }
+ case 25: {
+ $696 = ($9|0)>(0);
+ if ($696) {
+ $$631479$ph = $35;$$641671$ph = $4;$$661057$ph = $29;$$671164$ph = $31;$$681271$ph = $33;$$71$ph = $25;$$711380$ph = $27;$$sink1739 = $1;
+ label = 182;
+ } else {
+ $$621478 = $35;$$631670 = $4;$$651056 = $29;$$661163 = $31;$$671270 = $33;$$691576 = $1;$$70 = $25;$$701379 = $27;
+ label = 180;
+ }
+ break;
+ }
+ case 26: {
+ $737 = ($9|0)>(0);
+ if ($737) {
+ $$681484$ph = $35;$$691676$ph = $4;$$711062$ph = $29;$$721169$ph = $31;$$731276$ph = $33;$$76$ph = $25;$$761385$ph = $27;$$sink1743 = $1;
+ label = 195;
+ } else {
+ $$671483 = $35;$$681675 = $4;$$701061 = $29;$$711168 = $31;$$721275 = $33;$$741581 = $1;$$75 = $25;$$751384 = $27;
+ label = 193;
+ }
+ break;
+ }
+ case 27: {
+ $784 = ($9|0)>(0);
+ if ($784) {
+ $$721488$ph = $35;$$731680$ph = $4;$$741065$ph = $29;$$761173$ph = $31;$$761279$ph = $33;$$80$ph = $25;$$801389$ph = $27;$$sink1746 = $1;
+ label = 206;
+ } else {
+ $$711487 = $35;$$721679 = $4;$$731064 = $29;$$751172 = $31;$$751278 = $33;$$781585 = $1;$$79 = $25;$$791388 = $27;
+ label = 204;
+ }
+ break;
+ }
+ case 37: {
+ $$731489 = $35;$$761683 = $4;$$771068 = $29;$$791176 = $31;$$791282 = $33;$$821589 = $1;$$83 = $25;$$831392 = $27;
+ label = 210;
+ break;
+ }
+ case 53: {
+ $$751491 = $35;$$781685 = $4;$$791070 = $29;$$811178 = $31;$$811284 = $33;$$841591 = $1;$$85 = $25;$$851394 = $27;
+ label = 213;
+ break;
+ }
+ case 32: {
+ $842 = ($9|0)>(0);
+ if ($842) {
+ $843 = ((($1)) + 1|0);
+ $844 = HEAP8[$1>>0]|0;
+ $845 = $844&255;
+ $$0949 = $845;$$881595 = $843;
+ } else {
+ $840 = $6 & 2;
+ $841 = ($840|0)==(0);
+ if ($841) {
+ $$0949 = 0;$$881595 = $1;
+ } else {
+ $$0960 = 1;$$891505 = $35;$$931084 = $29;$$931700 = $4;$$951192 = $31;$$951298 = $33;$$981605 = $1;$$99 = $25;$$991408 = $27;$$sink30 = 32;
+ label = 243;
+ break L5;
+ }
+ }
+ $846 = $$0949 << $25;
+ $847 = $846 | $27;
+ $848 = (($25) + 8)|0;
+ $$801496 = $35;$$841075 = $29;$$841691 = $4;$$861289 = $33;$$891596 = $$881595;$$90 = $848;$$901399 = $847;
+ label = 226;
+ break;
+ }
+ case 41: {
+ $858 = ($9|0)>(0);
+ if ($858) {
+ $$841500$ph = $35;$$881079$ph = $29;$$881695$ph = $4;$$901187$ph = $31;$$901293$ph = $33;$$94$ph = $25;$$941403$ph = $27;$$sink1750 = $1;
+ label = 233;
+ } else {
+ $$831499 = $35;$$871078 = $29;$$871694 = $4;$$891186 = $31;$$891292 = $33;$$921599 = $1;$$93 = $25;$$931402 = $27;
+ label = 231;
+ }
+ break;
+ }
+ case 42: {
+ $871 = ($9|0)>(0);
+ if ($871) {
+ $872 = ((($1)) + 1|0);
+ $873 = HEAP8[$1>>0]|0;
+ $874 = $873&255;
+ $$0948 = $874;$$871503 = $35;$$911082 = $29;$$911698 = $4;$$931190 = $31;$$931296 = $33;$$961603 = $872;$$97 = $25;$$971406 = $27;
+ label = 241;
+ } else {
+ $$861502 = $35;$$901081 = $29;$$901697 = $4;$$921189 = $31;$$921295 = $33;$$951602 = $1;$$96 = $25;$$961405 = $27;
+ label = 237;
+ }
+ break;
+ }
+ case 34: {
+ $$881504 = $35;$$921083 = $29;$$921699 = $4;$$941191 = $31;$$941297 = $33;$$971604 = $1;$$98 = $25;$$981407 = $27;
+ label = 242;
+ break;
+ }
+ default: {
+ $$100 = $25;$$1001409 = $27;$$1961 = -1;$$901506 = $35;$$941085 = $29;$$941701 = $4;$$961193 = $31;$$961299 = $33;$$991606 = $1;
+ label = 244;
+ }
+ }
+ } while(0);
+ if ((label|0) == 6) {
+ $44 = $6 & 2;
+ $45 = ($44|0)==(0);
+ if ($45) {
+ $$01507 = $1;$$11098 = $$01097;$$11204 = $$01203;$$11310 = $$01309;$$1988 = $$0987;$$1992 = $$0991;$$sink3$shrunk = 0;
+ label = 9;
+ } else {
+ $$0960 = 1;$$891505 = $35;$$931084 = $$0991;$$931700 = $4;$$951192 = $$01097;$$951298 = $$01203;$$981605 = $1;$$99 = $$0987;$$991408 = $$01309;$$sink30 = 1;
+ label = 243;
+ }
+ }
+ else if ((label|0) == 8) {
+ $47 = ((($1)) + 1|0);
+ $48 = HEAP8[$1>>0]|0;
+ $$01507 = $47;$$11098 = $$11098$ph;$$11204 = $$11204$ph;$$11310 = $$11310$ph;$$1988 = $$1988$ph;$$1992 = $$1992$ph;$$sink3$shrunk = $48;
+ label = 9;
+ }
+ if ((label|0) == 9) {
+ $$sink3 = $$sink3$shrunk&255;
+ $49 = ((($0)) + 8|0);
+ HEAP32[$49>>2] = $$sink3;
+ $50 = ($$01507>>>0)<($10>>>0);
+ if ($50) {
+ $$31206$ph = $$11204;$$31312$ph = $$11310;$$3990$ph = $$1988;$$3994$ph = $$1992;$$sink1705 = $$01507;
+ label = 12;
+ } else {
+ $$11508 = $$01507;$$21099 = $$11098;$$21205 = $$11204;$$21311 = $$11310;$$2989 = $$1988;$$2993 = $$1992;
+ label = 10;
+ }
+ }
+ if ((label|0) == 10) {
+ $51 = $6 & 2;
+ $52 = ($51|0)==(0);
+ if ($52) {
+ $$21509 = $$11508;$$31206 = $$21205;$$31312 = $$21311;$$3990 = $$2989;$$3994 = $$2993;$$sink9$shrunk = 0;
+ label = 13;
+ } else {
+ $$0960 = 1;$$891505 = $35;$$931084 = $$2993;$$931700 = $4;$$951192 = $$21099;$$951298 = $$21205;$$981605 = $$11508;$$99 = $$2989;$$991408 = $$21311;$$sink30 = 2;
+ label = 243;
+ }
+ }
+ else if ((label|0) == 12) {
+ $54 = ((($$sink1705)) + 1|0);
+ $55 = HEAP8[$$sink1705>>0]|0;
+ $$21509 = $54;$$31206 = $$31206$ph;$$31312 = $$31312$ph;$$3990 = $$3990$ph;$$3994 = $$3994$ph;$$sink9$shrunk = $55;
+ label = 13;
+ }
+ if ((label|0) == 13) {
+ $$sink9 = $$sink9$shrunk&255;
+ $56 = ((($0)) + 12|0);
+ HEAP32[$56>>2] = $$sink9;
+ $57 = ((($0)) + 8|0);
+ $58 = HEAP32[$57>>2]|0;
+ $59 = $58 << 8;
+ $60 = $59 | $$sink9;
+ $61 = (($60>>>0) % 31)&-1;
+ $62 = $$sink9 & 32;
+ $63 = $61 | $62;
+ $64 = $58 & 15;
+ $65 = ($64|0)!=(8);
+ $not$ = ($63|0)!=(0);
+ $$1754 = $65 | $not$;
+ $66 = $58 >>> 4;
+ $67 = 256 << $66;
+ $68 = ($67>>>0)>(32768);
+ $69 = ($20>>>0)<($67>>>0);
+ $$ = $68 | $69;
+ $not$1755 = $14 ^ 1;
+ $70 = $$ & $not$1755;
+ $$31100$v = $70 | $$1754;
+ if ($$31100$v) {
+ $$0960 = -1;$$891505 = $35;$$931084 = $$3994;$$931700 = $4;$$951192 = 1;$$951298 = $$31206;$$981605 = $$21509;$$99 = $$3990;$$991408 = $$31312;$$sink30 = 36;
+ label = 243;
+ } else {
+ $$01416 = $35;$$01607 = $4;$$41511 = $$21509;$$5 = $$3990;$$51102 = 0;$$51208 = $$31206;$$51314 = $$31312;$$5996 = $$3994;
+ label = 14;
+ }
+ }
+ L46: while(1) {
+ switch (label|0) {
+ case 14: {
+ label = 0;
+ $71 = ($$5>>>0)<(3);
+ if ($71) {
+ $$11417 = $$01416;$$11608 = $$01607;$$51512 = $$41511;$$6 = $$5;$$61103 = $$51102;$$61209 = $$51208;$$61315 = $$51314;$$6997 = $$5996;
+ label = 15;
+ } else {
+ $$41420 = $$01416;$$41611 = $$01607;$$81515 = $$41511;$$9 = $$5;$$91000 = $$5996;$$91106 = $$51102;$$91212 = $$51208;$$91318 = $$51314;
+ label = 20;
+ }
+ break;
+ }
+ case 16: {
+ label = 0;
+ $73 = $6 & 2;
+ $74 = ($73|0)==(0);
+ if ($74) {
+ $$01413$shrunk = 0;$$31419 = $$21418;$$31610 = $$21609;$$71514 = $$61513;$$8 = $$7;$$81105 = $$71104;$$81211 = $$71210;$$81317 = $$71316;$$8999 = $$7998;
+ label = 19;
+ } else {
+ $$0960 = 1;$$891505 = $$21418;$$931084 = $$7998;$$931700 = $$21609;$$951192 = $$71104;$$951298 = $$71210;$$981605 = $$61513;$$99 = $$7;$$991408 = $$71316;$$sink30 = 3;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 18: {
+ label = 0;
+ $76 = ((($$sink1710)) + 1|0);
+ $77 = HEAP8[$$sink1710>>0]|0;
+ $$01413$shrunk = $77;$$31419 = $$31419$ph;$$31610 = $$31610$ph;$$71514 = $76;$$8 = $$8$ph;$$81105 = $$81105$ph;$$81211 = $$81211$ph;$$81317 = $$81317$ph;$$8999 = $$8999$ph;
+ label = 19;
+ break;
+ }
+ case 25: {
+ label = 0;
+ $97 = $$13 & 7;
+ $98 = $$131322 >>> $97;
+ $99 = (($$13) - ($97))|0;
+ $$131110 = 0;$$131520 = $$121519;$$14 = $99;$$141005 = $$131004;$$141217 = $$131216;$$141323 = $98;$$91425 = $$81424;$$91616 = $$81615;
+ label = 26;
+ break;
+ }
+ case 30: {
+ label = 0;
+ $104 = $6 & 2;
+ $105 = ($104|0)==(0);
+ if ($105) {
+ $$01411$shrunk = 0;$$121428 = $$111427;$$121619 = $$111618;$$161113 = $$151112;$$161523 = $$151522;$$17 = $$16;$$171008 = $$161007;$$171220 = $$161219;$$171326 = $$161325;
+ label = 33;
+ } else {
+ $$0960 = 1;$$891505 = $$111427;$$931084 = $$161007;$$931700 = $$111618;$$951192 = $$151112;$$951298 = $$161219;$$981605 = $$151522;$$99 = $$16;$$991408 = $$161325;$$sink30 = 6;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 32: {
+ label = 0;
+ $107 = ((($$sink1713)) + 1|0);
+ $108 = HEAP8[$$sink1713>>0]|0;
+ $$01411$shrunk = $108;$$121428 = $$121428$ph;$$121619 = $$121619$ph;$$161113 = $$161113$ph;$$161523 = $107;$$17 = $$17$ph;$$171008 = $$171008$ph;$$171220 = $$171220$ph;$$171326 = $$171326$ph;
+ label = 33;
+ break;
+ }
+ case 36: {
+ label = 0;
+ $118 = $6 & 2;
+ $119 = ($118|0)==(0);
+ if ($119) {
+ $$151431 = $$141430;$$151622 = $$141621;$$191116 = $$181115;$$191526 = $$181525;$$20 = $$19;$$201011 = $$191010;$$201223 = $$191222;$$201329 = $$191328;$$sink12 = 0;
+ label = 39;
+ continue L46;
+ } else {
+ $$0960 = 1;$$891505 = $$141430;$$931084 = $$191010;$$931700 = $$141621;$$951192 = $$181115;$$951298 = $$191222;$$981605 = $$181525;$$99 = $$19;$$991408 = $$191328;$$sink30 = 7;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 39: {
+ label = 0;
+ $$sink13 = (((($0)) + 10528|0) + ($$191116)|0);
+ HEAP8[$$sink13>>0] = $$sink12;
+ $$161432 = $$151431;$$161623 = $$151622;$$201117 = $$191116;$$201527 = $$191526;$$21 = $$20;$$211012 = $$201011;$$211224 = $$201223;$$211330 = $$201329;
+ label = 41;
+ break;
+ }
+ case 43: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$171433;$$931084 = $$221013;$$931700 = $$171624;$$951192 = $$211118;$$951298 = $$221225;$$981605 = $$211528;$$99 = $$22;$$991408 = $$221331;$$sink30 = 39;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 47: {
+ label = 0;
+ $150 = $6 & 2;
+ $151 = ($150|0)==(0);
+ if ($151) {
+ $$01410$shrunk = 0;$$211437 = $$201436;$$211628 = $$201627;$$251122 = $$241121;$$251532 = $$241531;$$26 = $$25;$$261017 = $$251016;$$261229 = $$251228;$$261335 = $$251334;
+ label = 50;
+ } else {
+ $$0960 = 1;$$891505 = $$201436;$$931084 = $$251016;$$931700 = $$201627;$$951192 = $$241121;$$951298 = $$251228;$$981605 = $$241531;$$99 = $$25;$$991408 = $$251334;$$sink30 = 51;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 49: {
+ label = 0;
+ $153 = ((($$sink1716)) + 1|0);
+ $154 = HEAP8[$$sink1716>>0]|0;
+ $$01410$shrunk = $154;$$211437 = $$211437$ph;$$211628 = $$211628$ph;$$251122 = $$251122$ph;$$251532 = $153;$$26 = $$26$ph;$$261017 = $$261017$ph;$$261229 = $$261229$ph;$$261335 = $$261335$ph;
+ label = 50;
+ break;
+ }
+ case 52: {
+ label = 0;
+ $162 = ($$231630>>>0)<($12>>>0);
+ if (!($162)) {
+ $$0960 = 2;$$891505 = $$231439;$$931084 = $$271018;$$931700 = $$231630;$$951192 = $$271124;$$951298 = $$281231;$$981605 = $$271534;$$99 = $$28;$$991408 = $$281337;$$sink30 = 52;
+ label = 243;
+ continue L46;
+ }
+ $163 = $$271018&255;
+ $164 = ((($$231630)) + 1|0);
+ HEAP8[$$231630>>0] = $163;
+ $165 = (($$271124) + -1)|0;
+ $$181434 = $$231439;$$181625 = $164;$$221119 = $165;$$221529 = $$271534;$$23 = $$28;$$231014 = $$271018;$$231226 = $$281231;$$231332 = $$281337;
+ label = 44;
+ break;
+ }
+ case 55: {
+ label = 0;
+ $167 = ($$251632>>>0)<($12>>>0);
+ if ($167) {
+ $$261442 = $$251441;$$261633 = $$251632;$$301021 = $$291020;$$301127 = $$291126;$$301537 = $$291536;$$31 = $$30;$$311234 = $$301233;$$311340 = $$301339;
+ label = 56;
+ continue L46;
+ } else {
+ $$0960 = 2;$$891505 = $$251441;$$931084 = $$291020;$$931700 = $$251632;$$951192 = $$291126;$$951298 = $$301233;$$981605 = $$291536;$$99 = $$30;$$991408 = $$301339;$$sink30 = 9;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 56: {
+ label = 0;
+ $168 = ($$301537>>>0)<($10>>>0);
+ if ($168) {
+ $171 = $12;
+ $172 = $$261633;
+ $173 = (($171) - ($172))|0;
+ $174 = $10;
+ $175 = $$301537;
+ $176 = (($174) - ($175))|0;
+ $177 = ($173>>>0)<($176>>>0);
+ $$sink17 = $177 ? $12 : $10;
+ $$sink16 = $177 ? $$261633 : $$301537;
+ $178 = $$sink17;
+ $179 = $$sink16;
+ $180 = (($178) - ($179))|0;
+ $181 = ($180>>>0)<($$301127>>>0);
+ $$$301127 = $181 ? $180 : $$301127;
+ _memcpy(($$261633|0),($$301537|0),($$$301127|0))|0;
+ $182 = (($$301537) + ($$$301127)|0);
+ $183 = (($$261633) + ($$$301127)|0);
+ $184 = (($$301127) - ($$$301127))|0;
+ $$241440 = $$261442;$$241631 = $183;$$281019 = $$301021;$$281125 = $184;$$281535 = $182;$$29 = $$31;$$291232 = $$311234;$$291338 = $$311340;
+ label = 54;
+ break;
+ } else {
+ $169 = $6 & 2;
+ $170 = ($169|0)==(0);
+ if ($170) {
+ $$271443 = $$261442;$$271634 = $$261633;$$311022 = $$301021;$$311128 = $$301127;$$311538 = $$301537;$$32 = $$31;$$321235 = $$311234;$$321341 = $$311340;
+ label = 58;
+ continue L46;
+ } else {
+ $$0960 = 1;$$891505 = $$261442;$$931084 = $$301021;$$931700 = $$261633;$$951192 = $$301127;$$951298 = $$311234;$$981605 = $$301537;$$99 = $$31;$$991408 = $$311340;$$sink30 = 38;
+ label = 243;
+ continue L46;
+ }
+ }
+ break;
+ }
+ case 58: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$271443;$$931084 = $$311022;$$931700 = $$271634;$$951192 = $$311128;$$951298 = $$321235;$$981605 = $$311538;$$99 = $$32;$$991408 = $$321341;$$sink30 = 40;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 60: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$281444;$$931084 = $$321023;$$931700 = $$281635;$$951192 = $$321129;$$951298 = $$331236;$$981605 = $$321539;$$99 = $$33;$$991408 = $$331342;$$sink30 = 10;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 64: {
+ label = 0;
+ $191 = $6 & 2;
+ $192 = ($191|0)==(0);
+ if ($192) {
+ $$01300$shrunk = 0;$$321448 = $$311447;$$321639 = $$311638;$$361027 = $$351026;$$361133 = $$351132;$$361543 = $$351542;$$37 = $$36;$$371240 = $$361239;$$371346 = $$361345;
+ label = 67;
+ } else {
+ $$0960 = 1;$$891505 = $$311447;$$931084 = $$351026;$$931700 = $$311638;$$951192 = $$351132;$$951298 = $$361239;$$981605 = $$351542;$$99 = $$36;$$991408 = $$361345;$$sink30 = 11;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 66: {
+ label = 0;
+ $194 = ((($$sink1719)) + 1|0);
+ $195 = HEAP8[$$sink1719>>0]|0;
+ $$01300$shrunk = $195;$$321448 = $$321448$ph;$$321639 = $$321639$ph;$$361027 = $$361027$ph;$$361133 = $$361133$ph;$$361543 = $194;$$37 = $$37$ph;$$371240 = $$371240$ph;$$371346 = $$371346$ph;
+ label = 67;
+ break;
+ }
+ case 73: {
+ label = 0;
+ $222 = $6 & 2;
+ $223 = ($222|0)==(0);
+ if ($223) {
+ $$01202$shrunk = 0;$$371453 = $$361452;$$371644 = $$361643;$$411032 = $$401031;$$411138 = $$401137;$$411548 = $$401547;$$42 = $$41;$$421245 = $$411244;$$421351 = $$411350;
+ label = 76;
+ } else {
+ $$0960 = 1;$$891505 = $$361452;$$931084 = $$401031;$$931700 = $$361643;$$951192 = $$401137;$$951298 = $$411244;$$981605 = $$401547;$$99 = $$41;$$991408 = $$411350;$$sink30 = 14;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 75: {
+ label = 0;
+ $225 = ((($$sink1722)) + 1|0);
+ $226 = HEAP8[$$sink1722>>0]|0;
+ $$01202$shrunk = $226;$$371453 = $$371453$ph;$$371644 = $$371644$ph;$$411032 = $$411032$ph;$$411138 = $$411138$ph;$$411548 = $225;$$42 = $$42$ph;$$421245 = $$421245$ph;$$421351 = $$421351$ph;
+ label = 76;
+ break;
+ }
+ case 86: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$401456;$$931084 = $$441035;$$931700 = $$401647;$$951192 = $$441141;$$951298 = $$451248;$$981605 = $$441551;$$99 = $$45;$$991408 = $$451354;$$sink30 = 35;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 114: {
+ label = 0;
+ $450 = $6 & 2;
+ $451 = ($450|0)==(0);
+ if ($451) {
+ $$0980$shrunk = 0;$$441460 = $$431459;$$441651 = $$431650;$$481039 = $$471038;$$481145 = $$471144;$$481555 = $$471554;$$49 = $$48;$$491252 = $$481251;$$491358 = $$481357;
+ label = 117;
+ } else {
+ $$0960 = 1;$$891505 = $$431459;$$931084 = $$471038;$$931700 = $$431650;$$951192 = $$471144;$$951298 = $$481251;$$981605 = $$471554;$$99 = $$48;$$991408 = $$481357;$$sink30 = 16;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 116: {
+ label = 0;
+ $453 = ((($$sink1729)) + 1|0);
+ $454 = HEAP8[$$sink1729>>0]|0;
+ $$0980$shrunk = $454;$$441460 = $$441460$ph;$$441651 = $$441651$ph;$$481039 = $$481039$ph;$$481145 = $$481145$ph;$$481555 = $453;$$49 = $$49$ph;$$491252 = $$491252$ph;$$491358 = $$491358$ph;
+ label = 117;
+ break;
+ }
+ case 125: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$461462;$$931084 = $$491040;$$931700 = $$461653;$$951192 = $$501147;$$951298 = $$511254;$$981605 = $$501557;$$99 = $$51;$$991408 = $$511360;$$sink30 = 17;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 128: {
+ label = 0;
+ $501 = $6 & 2;
+ $502 = ($501|0)==(0);
+ if ($502) {
+ $$0979$shrunk = 0;$$491465 = $$481464;$$491656 = $$481655;$$521043 = $$511042;$$531150 = $$521149;$$531560 = $$521559;$$54 = $$53;$$541257 = $$531256;$$541363 = $$531362;
+ label = 131;
+ } else {
+ $$0960 = 1;$$891505 = $$481464;$$931084 = $$511042;$$931700 = $$481655;$$951192 = $$521149;$$951298 = $$531256;$$981605 = $$521559;$$99 = $$53;$$991408 = $$531362;$$sink30 = 18;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 130: {
+ label = 0;
+ $504 = ((($$sink1732)) + 1|0);
+ $505 = HEAP8[$$sink1732>>0]|0;
+ $$0979$shrunk = $505;$$491465 = $$491465$ph;$$491656 = $$491656$ph;$$521043 = $$521043$ph;$$531150 = $$531150$ph;$$531560 = $504;$$54 = $$54$ph;$$541257 = $$541257$ph;$$541363 = $$541363$ph;
+ label = 131;
+ break;
+ }
+ case 136: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$511467;$$931084 = $$541045;$$931700 = $$511658;$$951192 = $$551152;$$951298 = $$561259;$$981605 = $$551562;$$99 = $$56;$$991408 = $$561365;$$sink30 = 21;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 151: {
+ label = 0;
+ $570 = $6 & 2;
+ $571 = ($570|0)==(0);
+ if ($571) {
+ $$0971$shrunk = 0;$$571473 = $$561472;$$571664 = $$561663;$$601051 = $$591050;$$611158 = $$601157;$$611568 = $$601567;$$62 = $$61;$$621265 = $$611264;$$621371 = $$611370;
+ label = 154;
+ } else {
+ $$0960 = 1;$$891505 = $$561472;$$931084 = $$591050;$$931700 = $$561663;$$951192 = $$601157;$$951298 = $$611264;$$981605 = $$601567;$$99 = $$61;$$991408 = $$611370;$$sink30 = 23;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 153: {
+ label = 0;
+ $573 = ((($$sink1736)) + 1|0);
+ $574 = HEAP8[$$sink1736>>0]|0;
+ $$0971$shrunk = $574;$$571473 = $$571473$ph;$$571664 = $$571664$ph;$$601051 = $$601051$ph;$$611158 = $$611158$ph;$$611568 = $573;$$62 = $$62$ph;$$621265 = $$621265$ph;$$621371 = $$621371$ph;
+ label = 154;
+ break;
+ }
+ case 160: {
+ label = 0;
+ $610 = ($$591666>>>0)<($12>>>0);
+ if (!($610)) {
+ $$0960 = 2;$$891505 = $$591475;$$931084 = $$621053;$$931700 = $$591666;$$951192 = $$621159;$$951298 = $$641267;$$981605 = $$631570;$$99 = $$64;$$991408 = $$641373;$$sink30 = 24;
+ label = 243;
+ continue L46;
+ }
+ $611 = $$621159&255;
+ $612 = ((($$591666)) + 1|0);
+ HEAP8[$$591666>>0] = $611;
+ $$541470$ph = $$591475;$$541661$ph = $612;$$571048$ph = $$621053;$$581155$ph = $$621159;$$581565$ph = $$631570;$$59$ph = $$64;$$591262$ph = $$641267;$$591368$ph = $$641373;
+ label = 140;
+ break;
+ }
+ case 180: {
+ label = 0;
+ $694 = $6 & 2;
+ $695 = ($694|0)==(0);
+ if ($695) {
+ $$0959$shrunk = 0;$$631479 = $$621478;$$641671 = $$631670;$$661057 = $$651056;$$671164 = $$661163;$$681271 = $$671270;$$701577 = $$691576;$$71 = $$70;$$711380 = $$701379;
+ label = 183;
+ } else {
+ $$0960 = 1;$$891505 = $$621478;$$931084 = $$651056;$$931700 = $$631670;$$951192 = $$661163;$$951298 = $$671270;$$981605 = $$691576;$$99 = $$70;$$991408 = $$701379;$$sink30 = 25;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 182: {
+ label = 0;
+ $697 = ((($$sink1739)) + 1|0);
+ $698 = HEAP8[$$sink1739>>0]|0;
+ $$0959$shrunk = $698;$$631479 = $$631479$ph;$$641671 = $$641671$ph;$$661057 = $$661057$ph;$$671164 = $$671164$ph;$$681271 = $$681271$ph;$$701577 = $697;$$71 = $$71$ph;$$711380 = $$711380$ph;
+ label = 183;
+ break;
+ }
+ case 193: {
+ label = 0;
+ $735 = $6 & 2;
+ $736 = ($735|0)==(0);
+ if ($736) {
+ $$0952$shrunk = 0;$$681484 = $$671483;$$691676 = $$681675;$$711062 = $$701061;$$721169 = $$711168;$$731276 = $$721275;$$751582 = $$741581;$$76 = $$75;$$761385 = $$751384;
+ label = 196;
+ } else {
+ $$0960 = 1;$$891505 = $$671483;$$931084 = $$701061;$$931700 = $$681675;$$951192 = $$711168;$$951298 = $$721275;$$981605 = $$741581;$$99 = $$75;$$991408 = $$751384;$$sink30 = 26;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 195: {
+ label = 0;
+ $738 = ((($$sink1743)) + 1|0);
+ $739 = HEAP8[$$sink1743>>0]|0;
+ $$0952$shrunk = $739;$$681484 = $$681484$ph;$$691676 = $$691676$ph;$$711062 = $$711062$ph;$$721169 = $$721169$ph;$$731276 = $$731276$ph;$$751582 = $738;$$76 = $$76$ph;$$761385 = $$761385$ph;
+ label = 196;
+ break;
+ }
+ case 204: {
+ label = 0;
+ $782 = $6 & 2;
+ $783 = ($782|0)==(0);
+ if ($783) {
+ $$0950$shrunk = 0;$$721488 = $$711487;$$731680 = $$721679;$$741065 = $$731064;$$761173 = $$751172;$$761279 = $$751278;$$791586 = $$781585;$$80 = $$79;$$801389 = $$791388;
+ label = 207;
+ } else {
+ $$0960 = 1;$$891505 = $$711487;$$931084 = $$731064;$$931700 = $$721679;$$951192 = $$751172;$$951298 = $$751278;$$981605 = $$781585;$$99 = $$79;$$991408 = $$791388;$$sink30 = 27;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 206: {
+ label = 0;
+ $785 = ((($$sink1746)) + 1|0);
+ $786 = HEAP8[$$sink1746>>0]|0;
+ $$0950$shrunk = $786;$$721488 = $$721488$ph;$$731680 = $$731680$ph;$$741065 = $$741065$ph;$$761173 = $$761173$ph;$$761279 = $$761279$ph;$$791586 = $785;$$80 = $$80$ph;$$801389 = $$801389$ph;
+ label = 207;
+ break;
+ }
+ case 210: {
+ label = 0;
+ $$0960 = -1;$$891505 = $$731489;$$931084 = $$771068;$$931700 = $$761683;$$951192 = $$791176;$$951298 = $$791282;$$981605 = $$821589;$$99 = $$83;$$991408 = $$831392;$$sink30 = 37;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 213: {
+ label = 0;
+ $809 = ($$781685>>>0)<($12>>>0);
+ if (!($809)) {
+ $$0960 = 2;$$891505 = $$751491;$$931084 = $$791070;$$931700 = $$781685;$$951192 = $$811178;$$951298 = $$811284;$$981605 = $$841591;$$99 = $$85;$$991408 = $$851394;$$sink30 = 53;
+ label = 243;
+ continue L46;
+ }
+ $810 = (($$751491) + 1)|0;
+ $811 = (($$751491) - ($$791070))|0;
+ $812 = $811 & $$1753;
+ $813 = (($3) + ($812)|0);
+ $814 = HEAP8[$813>>0]|0;
+ $815 = ((($$781685)) + 1|0);
+ HEAP8[$$781685>>0] = $814;
+ $$741490 = $810;$$771684 = $815;$$781069 = $$791070;$$801177 = $$811178;$$801283 = $$811284;$$831590 = $$841591;$$84 = $$85;$$841393 = $$851394;
+ label = 212;
+ break;
+ }
+ case 226: {
+ label = 0;
+ $849 = $$90 & 7;
+ $850 = $$901399 >>> $849;
+ $851 = (($$90) - ($849))|0;
+ $$811497 = $$801496;$$851076 = $$841075;$$851692 = $$841691;$$871184 = 0;$$871290 = $$861289;$$901597 = $$891596;$$91 = $851;$$911400 = $850;
+ label = 227;
+ break;
+ }
+ case 231: {
+ label = 0;
+ $856 = $6 & 2;
+ $857 = ($856|0)==(0);
+ if ($857) {
+ $$0947$shrunk = 0;$$841500 = $$831499;$$881079 = $$871078;$$881695 = $$871694;$$901187 = $$891186;$$901293 = $$891292;$$931600 = $$921599;$$94 = $$93;$$941403 = $$931402;
+ label = 234;
+ } else {
+ $$0960 = 1;$$891505 = $$831499;$$931084 = $$871078;$$931700 = $$871694;$$951192 = $$891186;$$951298 = $$891292;$$981605 = $$921599;$$99 = $$93;$$991408 = $$931402;$$sink30 = 41;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 233: {
+ label = 0;
+ $859 = ((($$sink1750)) + 1|0);
+ $860 = HEAP8[$$sink1750>>0]|0;
+ $$0947$shrunk = $860;$$841500 = $$841500$ph;$$881079 = $$881079$ph;$$881695 = $$881695$ph;$$901187 = $$901187$ph;$$901293 = $$901293$ph;$$931600 = $859;$$94 = $$94$ph;$$941403 = $$941403$ph;
+ label = 234;
+ break;
+ }
+ case 237: {
+ label = 0;
+ $869 = $6 & 2;
+ $870 = ($869|0)==(0);
+ if ($870) {
+ $$0948 = 0;$$871503 = $$861502;$$911082 = $$901081;$$911698 = $$901697;$$931190 = $$921189;$$931296 = $$921295;$$961603 = $$951602;$$97 = $$96;$$971406 = $$961405;
+ label = 241;
+ continue L46;
+ } else {
+ $$0960 = 1;$$891505 = $$861502;$$931084 = $$901081;$$931700 = $$901697;$$951192 = $$921189;$$951298 = $$921295;$$981605 = $$951602;$$99 = $$96;$$991408 = $$961405;$$sink30 = 42;
+ label = 243;
+ continue L46;
+ }
+ break;
+ }
+ case 241: {
+ label = 0;
+ $878 = ((($0)) + 16|0);
+ $879 = HEAP32[$878>>2]|0;
+ $880 = $879 << 8;
+ $881 = $880 | $$0948;
+ HEAP32[$878>>2] = $881;
+ $882 = (($$931190) + 1)|0;
+ $$811497 = $$871503;$$851076 = $$911082;$$851692 = $$911698;$$871184 = $882;$$871290 = $$931296;$$901597 = $$961603;$$91 = $$97;$$911400 = $$971406;
+ label = 227;
+ break;
+ }
+ case 242: {
+ label = 0;
+ $$0960 = 0;$$891505 = $$881504;$$931084 = $$921083;$$931700 = $$921699;$$951192 = $$941191;$$951298 = $$941297;$$981605 = $$971604;$$99 = $$98;$$991408 = $$981407;$$sink30 = 34;
+ label = 243;
+ continue L46;
+ break;
+ }
+ case 243: {
+ label = 0;
+ HEAP32[$0>>2] = $$sink30;
+ $$100 = $$99;$$1001409 = $$991408;$$1961 = $$0960;$$901506 = $$891505;$$941085 = $$931084;$$941701 = $$931700;$$961193 = $$951192;$$961299 = $$951298;$$991606 = $$981605;
+ label = 244;
+ continue L46;
+ break;
+ }
+ case 244: {
+ label = 0;
+ HEAP32[$24>>2] = $$100;
+ HEAP32[$26>>2] = $$1001409;
+ HEAP32[$28>>2] = $$941085;
+ HEAP32[$30>>2] = $$961193;
+ HEAP32[$32>>2] = $$961299;
+ HEAP32[$34>>2] = $$901506;
+ $883 = $$991606;
+ $884 = $1;
+ $885 = (($883) - ($884))|0;
+ HEAP32[$2>>2] = $885;
+ $886 = $$941701;
+ $887 = $4;
+ $888 = (($886) - ($887))|0;
+ HEAP32[$5>>2] = $888;
+ $889 = $6 & 9;
+ $890 = ($889|0)!=(0);
+ $891 = ($$1961|0)>(-1);
+ $or$cond29 = $890 & $891;
+ if ($or$cond29) {
+ break L46;
+ } else {
+ $$0951 = $$1961;
+ label = 258;
+ break L46;
+ }
+ break;
+ }
+ }
+ switch (label|0) {
+ case 19: {
+ label = 0;
+ $$01413 = $$01413$shrunk&255;
+ $78 = $$01413 << $$8;
+ $79 = $78 | $$81317;
+ $80 = (($$8) + 8)|0;
+ $81 = ($80>>>0)<(3);
+ if ($81) {
+ $$11417 = $$31419;$$11608 = $$31610;$$51512 = $$71514;$$6 = $80;$$61103 = $$81105;$$61209 = $$81211;$$61315 = $79;$$6997 = $$8999;
+ label = 15;
+ } else {
+ $$41420 = $$31419;$$41611 = $$31610;$$81515 = $$71514;$$9 = $80;$$91000 = $$8999;$$91106 = $$81105;$$91212 = $$81211;$$91318 = $79;
+ label = 20;
+ }
+ break;
+ }
+ case 33: {
+ label = 0;
+ $$01411 = $$01411$shrunk&255;
+ $109 = $$01411 << $$17;
+ $110 = $109 | $$171326;
+ $111 = (($$17) + 8)|0;
+ $112 = ($$17>>>0)>(4294967287);
+ if ($112) {
+ $$101426 = $$121428;$$101617 = $$121619;$$141111 = $$161113;$$141521 = $$161523;$$15 = $111;$$151006 = $$171008;$$151218 = $$171220;$$151324 = $110;
+ label = 29;
+ } else {
+ $$131429 = $$121428;$$131620 = $$121619;$$171114 = $$161113;$$171524 = $$161523;$$18 = $111;$$181009 = $$171008;$$181221 = $$171220;$$181327 = $110;
+ label = 34;
+ }
+ break;
+ }
+ case 50: {
+ label = 0;
+ $$01410 = $$01410$shrunk&255;
+ $155 = $$01410 << $$26;
+ $156 = $155 | $$261335;
+ $157 = (($$26) + 8)|0;
+ $158 = ($$26>>>0)>(4294967287);
+ if ($158) {
+ $$191435 = $$211437;$$191626 = $$211628;$$231120 = $$251122;$$231530 = $$251532;$$24 = $157;$$241015 = $$261017;$$241227 = $$261229;$$241333 = $156;
+ label = 46;
+ } else {
+ $$221438 = $$211437;$$221629 = $$211628;$$261123 = $$251122;$$261533 = $$251532;$$27 = $157;$$271230 = $$261229;$$271336 = $156;
+ label = 51;
+ }
+ break;
+ }
+ case 67: {
+ label = 0;
+ $$01300 = $$01300$shrunk&255;
+ $196 = $$01300 << $$37;
+ $197 = $196 | $$371346;
+ $198 = (($$37) + 8)|0;
+ $199 = (5303 + ($$361133)|0);
+ $200 = HEAP8[$199>>0]|0;
+ $201 = $200 << 24 >> 24;
+ $202 = ($198>>>0)<($201>>>0);
+ if ($202) {
+ $$301446 = $$321448;$$301637 = $$321639;$$341025 = $$361027;$$341131 = $$361133;$$341541 = $$361543;$$35 = $198;$$351238 = $$371240;$$351344 = $197;
+ label = 63;
+ } else {
+ $$331449 = $$321448;$$331640 = $$321639;$$371028 = $$361027;$$371134 = $$361133;$$371544 = $$361543;$$38 = $198;$$381241 = $$371240;$$381347 = $197;
+ label = 68;
+ }
+ break;
+ }
+ case 76: {
+ label = 0;
+ $$01202 = $$01202$shrunk&255;
+ $227 = $$01202 << $$42;
+ $228 = $227 | $$421351;
+ $229 = (($$42) + 8)|0;
+ $230 = ($229>>>0)<(3);
+ if ($230) {
+ $$351451 = $$371453;$$351642 = $$371644;$$391030 = $$411032;$$391136 = $$411138;$$391546 = $$411548;$$40 = $229;$$401243 = $$421245;$$401349 = $228;
+ label = 72;
+ } else {
+ $$381454 = $$371453;$$381645 = $$371644;$$421033 = $$411032;$$421139 = $$411138;$$421549 = $$411548;$$43 = $229;$$431246 = $$421245;$$431352 = $228;
+ label = 77;
+ }
+ break;
+ }
+ case 117: {
+ label = 0;
+ $$0980 = $$0980$shrunk&255;
+ $455 = $$0980 << $$49;
+ $456 = $455 | $$491358;
+ $457 = (($$49) + 8)|0;
+ $458 = ($457>>>0)<(15);
+ if ($458) {
+ $$421458 = $$441460;$$421649 = $$441651;$$461037 = $$481039;$$461143 = $$481145;$$461553 = $$481555;$$47 = $457;$$471250 = $$491252;$$471356 = $456;
+ label = 108;
+ } else {
+ $$451461 = $$441460;$$451652 = $$441651;$$491146 = $$481145;$$491556 = $$481555;$$50 = $457;$$501253 = $$491252;$$501359 = $456;
+ label = 119;
+ }
+ break;
+ }
+ case 131: {
+ label = 0;
+ $$0979 = $$0979$shrunk&255;
+ $506 = $$0979 << $$54;
+ $507 = $506 | $$541363;
+ $508 = (($$54) + 8)|0;
+ $509 = ($508>>>0)<($$541257>>>0);
+ if ($509) {
+ $$471463 = $$491465;$$471654 = $$491656;$$501041 = $$521043;$$511148 = $$531150;$$511558 = $$531560;$$52 = $508;$$521255 = $$541257;$$521361 = $507;
+ label = 127;
+ } else {
+ $$501466 = $$491465;$$501657 = $$491656;$$531044 = $$521043;$$541151 = $$531150;$$541561 = $$531560;$$55 = $508;$$551258 = $$541257;$$551364 = $507;
+ label = 132;
+ }
+ break;
+ }
+ case 154: {
+ label = 0;
+ $$0971 = $$0971$shrunk&255;
+ $575 = $$0971 << $$62;
+ $576 = $575 | $$621371;
+ $577 = (($$62) + 8)|0;
+ $578 = ($577>>>0)<(15);
+ if ($578) {
+ $$551471 = $$571473;$$551662 = $$571664;$$581049 = $$601051;$$591156 = $$611158;$$591566 = $$611568;$$60 = $577;$$601263 = $$621265;$$601369 = $576;
+ label = 145;
+ } else {
+ $$581474 = $$571473;$$581665 = $$571664;$$611052 = $$601051;$$621569 = $$611568;$$63 = $577;$$631266 = $$621265;$$631372 = $576;
+ label = 156;
+ }
+ break;
+ }
+ case 183: {
+ label = 0;
+ $$0959 = $$0959$shrunk&255;
+ $699 = $$0959 << $$71;
+ $700 = $699 | $$711380;
+ $701 = (($$71) + 8)|0;
+ $702 = ($701>>>0)<($$681271>>>0);
+ if ($702) {
+ $$611477 = $$631479;$$621669 = $$641671;$$641055 = $$661057;$$651162 = $$671164;$$661269 = $$681271;$$681575 = $$701577;$$69 = $701;$$691378 = $700;
+ label = 179;
+ } else {
+ $$641480 = $$631479;$$651672 = $$641671;$$671058 = $$661057;$$681165 = $$671164;$$691272 = $$681271;$$711578 = $$701577;$$72 = $701;$$721381 = $700;
+ label = 184;
+ }
+ break;
+ }
+ case 196: {
+ label = 0;
+ $$0952 = $$0952$shrunk&255;
+ $740 = $$0952 << $$76;
+ $741 = $740 | $$761385;
+ $742 = (($$76) + 8)|0;
+ $743 = ($742>>>0)<(15);
+ if ($743) {
+ $$661482 = $$681484;$$671674 = $$691676;$$691060 = $$711062;$$701167 = $$721169;$$711274 = $$731276;$$731580 = $$751582;$$74 = $742;$$741383 = $741;
+ label = 187;
+ } else {
+ $$691485 = $$681484;$$701677 = $$691676;$$731170 = $$721169;$$761583 = $$751582;$$77 = $742;$$771386 = $741;
+ label = 198;
+ }
+ break;
+ }
+ case 207: {
+ label = 0;
+ $$0950 = $$0950$shrunk&255;
+ $787 = $$0950 << $$80;
+ $788 = $787 | $$801389;
+ $789 = (($$80) + 8)|0;
+ $790 = ($789>>>0)<($$761279>>>0);
+ if ($790) {
+ $$701486 = $$721488;$$711678 = $$731680;$$721063 = $$741065;$$741171 = $$761173;$$741277 = $$761279;$$771584 = $$791586;$$78 = $789;$$781387 = $788;
+ label = 203;
+ } else {
+ $$741681 = $$731680;$$751066 = $$741065;$$771174 = $$761173;$$771280 = $$761279;$$801587 = $$791586;$$81 = $789;$$811390 = $788;
+ label = 208;
+ }
+ break;
+ }
+ case 227: {
+ label = 0;
+ $852 = ($$871184>>>0)<(4);
+ if (!($852)) {
+ $$881504 = $$811497;$$921083 = $$851076;$$921699 = $$851692;$$941191 = $$871184;$$941297 = $$871290;$$971604 = $$901597;$$98 = $$91;$$981407 = $$911400;
+ label = 242;
+ continue L46;
+ }
+ $853 = ($$91|0)==(0);
+ if (!($853)) {
+ $854 = ($$91>>>0)<(8);
+ if ($854) {
+ $$821498 = $$811497;$$861077 = $$851076;$$861693 = $$851692;$$881185 = $$871184;$$881291 = $$871290;$$911598 = $$901597;$$92 = $$91;$$921401 = $$911400;
+ label = 230;
+ break;
+ } else {
+ $$851501 = $$811497;$$891080 = $$851076;$$891696 = $$851692;$$911188 = $$871184;$$911294 = $$871290;$$941601 = $$901597;$$95 = $$91;$$951404 = $$911400;
+ label = 235;
+ break;
+ }
+ }
+ $868 = ($$901597>>>0)<($10>>>0);
+ if (!($868)) {
+ $$861502 = $$811497;$$901081 = $$851076;$$901697 = $$851692;$$921189 = $$871184;$$921295 = $$871290;$$951602 = $$901597;$$96 = 0;$$961405 = $$911400;
+ label = 237;
+ continue L46;
+ }
+ $875 = ((($$901597)) + 1|0);
+ $876 = HEAP8[$$901597>>0]|0;
+ $877 = $876&255;
+ $$0948 = $877;$$871503 = $$811497;$$911082 = $$851076;$$911698 = $$851692;$$931190 = $$871184;$$931296 = $$871290;$$961603 = $875;$$97 = 0;$$971406 = $$911400;
+ label = 241;
+ continue L46;
+ break;
+ }
+ case 234: {
+ label = 0;
+ $$0947 = $$0947$shrunk&255;
+ $861 = $$0947 << $$94;
+ $862 = $861 | $$941403;
+ $863 = (($$94) + 8)|0;
+ $864 = ($$94>>>0)>(4294967287);
+ if ($864) {
+ $$821498 = $$841500;$$861077 = $$881079;$$861693 = $$881695;$$881185 = $$901187;$$881291 = $$901293;$$911598 = $$931600;$$92 = $863;$$921401 = $862;
+ label = 230;
+ } else {
+ $$851501 = $$841500;$$891080 = $$881079;$$891696 = $$881695;$$911188 = $$901187;$$911294 = $$901293;$$941601 = $$931600;$$95 = $863;$$951404 = $862;
+ label = 235;
+ }
+ break;
+ }
+ }
+ L119: do {
+ if ((label|0) == 15) {
+ label = 0;
+ $72 = ($$51512>>>0)<($10>>>0);
+ if ($72) {
+ $$31419$ph = $$11417;$$31610$ph = $$11608;$$8$ph = $$6;$$81105$ph = $$61103;$$81211$ph = $$61209;$$81317$ph = $$61315;$$8999$ph = $$6997;$$sink1710 = $$51512;
+ label = 18;
+ continue L46;
+ } else {
+ $$21418 = $$11417;$$21609 = $$11608;$$61513 = $$51512;$$7 = $$6;$$71104 = $$61103;$$71210 = $$61209;$$71316 = $$61315;$$7998 = $$6997;
+ label = 16;
+ continue L46;
+ }
+ }
+ else if ((label|0) == 20) {
+ label = 0;
+ $82 = $$91318 & 7;
+ $83 = ((($0)) + 20|0);
+ HEAP32[$83>>2] = $82;
+ $84 = $$91318 >>> 3;
+ $85 = (($$9) + -3)|0;
+ $86 = $82 >>> 1;
+ $87 = ((($0)) + 24|0);
+ HEAP32[$87>>2] = $86;
+ $trunc = $86&255;
+ $trunc$clear = $trunc & 3;
+ switch ($trunc$clear<<24>>24) {
+ case 0: {
+ $$121519 = $$81515;$$13 = $85;$$131004 = $$91000;$$131216 = $$91212;$$131322 = $84;$$81424 = $$41420;$$81615 = $$41611;
+ label = 25;
+ continue L46;
+ break;
+ }
+ case 3: {
+ $$281444 = $$41420;$$281635 = $$41611;$$321023 = $$91000;$$321129 = $$91106;$$321539 = $$81515;$$33 = $85;$$331236 = $$91212;$$331342 = $84;
+ label = 60;
+ continue L46;
+ break;
+ }
+ case 1: {
+ break;
+ }
+ default: {
+ $$291445 = $$41420;$$291636 = $$41611;$$331024 = $$91000;$$331130 = 0;$$331540 = $$81515;$$34 = $85;$$341237 = $$91212;$$341343 = $84;
+ label = 61;
+ break L119;
+ }
+ }
+ $240 = ((($0)) + 44|0);
+ HEAP32[$240>>2] = 288;
+ $241 = ((($0)) + 48|0);
+ HEAP32[$241>>2] = 32;
+ $242 = ((($0)) + 3552|0);
+ ;HEAP32[$242>>2]=84215045|0;HEAP32[$242+4>>2]=84215045|0;HEAP32[$242+8>>2]=84215045|0;HEAP32[$242+12>>2]=84215045|0;HEAP32[$242+16>>2]=84215045|0;HEAP32[$242+20>>2]=84215045|0;HEAP32[$242+24>>2]=84215045|0;HEAP32[$242+28>>2]=84215045|0;
+ $scevgep19611962 = ((($0)) + 64|0);
+ _memset(($scevgep19611962|0),8,144)|0;
+ $scevgep1959 = ((($0)) + 208|0);
+ dest=$scevgep1959; stop=dest+112|0; do { HEAP8[dest>>0]=9|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ $scevgep1957 = ((($0)) + 320|0);
+ dest=$scevgep1957; stop=dest+24|0; do { HEAP8[dest>>0]=7|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ $scevgep1955 = ((($0)) + 344|0);
+ $243 = $scevgep1955;
+ $244 = $243;
+ HEAP8[$244>>0]=134744072&255;HEAP8[$244+1>>0]=(134744072>>8)&255;HEAP8[$244+2>>0]=(134744072>>16)&255;HEAP8[$244+3>>0]=134744072>>24;
+ $245 = (($243) + 4)|0;
+ $246 = $245;
+ HEAP8[$246>>0]=134744072&255;HEAP8[$246+1>>0]=(134744072>>8)&255;HEAP8[$246+2>>0]=(134744072>>16)&255;HEAP8[$246+3>>0]=134744072>>24;
+ $$391455 = $$41420;$$391646 = $$41611;$$431034 = $$91000;$$431140 = $$91106;$$431550 = $$81515;$$44 = $85;$$441247 = $$91212;$$441353 = $84;
+ label = 80;
+ }
+ else if ((label|0) == 230) {
+ label = 0;
+ $855 = ($$911598>>>0)<($10>>>0);
+ if ($855) {
+ $$841500$ph = $$821498;$$881079$ph = $$861077;$$881695$ph = $$861693;$$901187$ph = $$881185;$$901293$ph = $$881291;$$94$ph = $$92;$$941403$ph = $$921401;$$sink1750 = $$911598;
+ label = 233;
+ continue L46;
+ } else {
+ $$831499 = $$821498;$$871078 = $$861077;$$871694 = $$861693;$$891186 = $$881185;$$891292 = $$881291;$$921599 = $$911598;$$93 = $$92;$$931402 = $$921401;
+ label = 231;
+ continue L46;
+ }
+ }
+ else if ((label|0) == 235) {
+ label = 0;
+ $865 = $$951404 & 255;
+ $866 = $$951404 >>> 8;
+ $867 = (($$95) + -8)|0;
+ $$0948 = $865;$$871503 = $$851501;$$911082 = $$891080;$$911698 = $$891696;$$931190 = $$911188;$$931296 = $$911294;$$961603 = $$941601;$$97 = $867;$$971406 = $866;
+ label = 241;
+ continue L46;
+ }
+ } while(0);
+ L125: while(1) {
+ L126: switch (label|0) {
+ case 26: {
+ label = 0;
+ $100 = ($$131110>>>0)<(4);
+ if (!($100)) {
+ $127 = ((($0)) + 10528|0);
+ $128 = HEAP8[$127>>0]|0;
+ $129 = $128&255;
+ $130 = ((($0)) + 10529|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = $131&255;
+ $133 = $132 << 8;
+ $134 = $133 | $129;
+ $135 = ((($0)) + 10530|0);
+ $136 = HEAP8[$135>>0]|0;
+ $137 = $136&255;
+ $138 = ((($0)) + 10531|0);
+ $139 = HEAP8[$138>>0]|0;
+ $140 = $139&255;
+ $141 = $140 << 8;
+ $142 = $141 | $137;
+ $143 = $142 ^ 65535;
+ $144 = ($134|0)==($143|0);
+ if ($144) {
+ $$181434 = $$91425;$$181625 = $$91616;$$221119 = $134;$$221529 = $$131520;$$23 = $$14;$$231014 = $$141005;$$231226 = $$141217;$$231332 = $$141323;
+ label = 44;
+ continue L125;
+ } else {
+ $$171433 = $$91425;$$171624 = $$91616;$$211118 = $134;$$211528 = $$131520;$$22 = $$14;$$221013 = $$141005;$$221225 = $$141217;$$221331 = $$141323;
+ label = 43;
+ continue L46;
+ }
+ }
+ $101 = ($$14|0)==(0);
+ if (!($101)) {
+ $102 = ($$14>>>0)<(8);
+ if ($102) {
+ $$101426 = $$91425;$$101617 = $$91616;$$141111 = $$131110;$$141521 = $$131520;$$15 = $$14;$$151006 = $$141005;$$151218 = $$141217;$$151324 = $$141323;
+ label = 29;
+ continue L125;
+ } else {
+ $$131429 = $$91425;$$131620 = $$91616;$$171114 = $$131110;$$171524 = $$131520;$$18 = $$14;$$181009 = $$141005;$$181221 = $$141217;$$181327 = $$141323;
+ label = 34;
+ continue L125;
+ }
+ }
+ $117 = ($$131520>>>0)<($10>>>0);
+ if (!($117)) {
+ $$141430 = $$91425;$$141621 = $$91616;$$181115 = $$131110;$$181525 = $$131520;$$19 = 0;$$191010 = $$141005;$$191222 = $$141217;$$191328 = $$141323;
+ label = 36;
+ continue L46;
+ }
+ $123 = ((($$131520)) + 1|0);
+ $124 = HEAP8[$$131520>>0]|0;
+ $125 = (((($0)) + 10528|0) + ($$131110)|0);
+ HEAP8[$125>>0] = $124;
+ $$161432 = $$91425;$$161623 = $$91616;$$201117 = $$131110;$$201527 = $123;$$21 = 0;$$211012 = $$141005;$$211224 = $$141217;$$211330 = $$141323;
+ label = 41;
+ continue L125;
+ break;
+ }
+ case 29: {
+ label = 0;
+ $103 = ($$141521>>>0)<($10>>>0);
+ if ($103) {
+ $$121428$ph = $$101426;$$121619$ph = $$101617;$$161113$ph = $$141111;$$17$ph = $$15;$$171008$ph = $$151006;$$171220$ph = $$151218;$$171326$ph = $$151324;$$sink1713 = $$141521;
+ label = 32;
+ continue L46;
+ } else {
+ $$111427 = $$101426;$$111618 = $$101617;$$151112 = $$141111;$$151522 = $$141521;$$16 = $$15;$$161007 = $$151006;$$161219 = $$151218;$$161325 = $$151324;
+ label = 30;
+ continue L46;
+ }
+ break;
+ }
+ case 34: {
+ label = 0;
+ $113 = $$181327&255;
+ $114 = (((($0)) + 10528|0) + ($$171114)|0);
+ HEAP8[$114>>0] = $113;
+ $115 = $$181327 >>> 8;
+ $116 = (($$18) + -8)|0;
+ $$161432 = $$131429;$$161623 = $$131620;$$201117 = $$171114;$$201527 = $$171524;$$21 = $116;$$211012 = $$181009;$$211224 = $$181221;$$211330 = $115;
+ label = 41;
+ continue L125;
+ break;
+ }
+ case 41: {
+ label = 0;
+ $126 = (($$201117) + 1)|0;
+ $$131110 = $126;$$131520 = $$201527;$$14 = $$21;$$141005 = $$211012;$$141217 = $$211224;$$141323 = $$211330;$$91425 = $$161432;$$91616 = $$161623;
+ label = 26;
+ continue L125;
+ break;
+ }
+ case 44: {
+ label = 0;
+ $145 = ($$221119|0)!=(0);
+ $146 = ($$23|0)!=(0);
+ $147 = $145 & $146;
+ if (!($147)) {
+ $$241440 = $$181434;$$241631 = $$181625;$$281019 = $$231014;$$281125 = $$221119;$$281535 = $$221529;$$29 = $$23;$$291232 = $$231226;$$291338 = $$231332;
+ label = 54;
+ continue L125;
+ }
+ $148 = ($$23>>>0)<(8);
+ if ($148) {
+ $$191435 = $$181434;$$191626 = $$181625;$$231120 = $$221119;$$231530 = $$221529;$$24 = $$23;$$241015 = $$231014;$$241227 = $$231226;$$241333 = $$231332;
+ label = 46;
+ continue L125;
+ } else {
+ $$221438 = $$181434;$$221629 = $$181625;$$261123 = $$221119;$$261533 = $$221529;$$27 = $$23;$$271230 = $$231226;$$271336 = $$231332;
+ label = 51;
+ continue L125;
+ }
+ break;
+ }
+ case 46: {
+ label = 0;
+ $149 = ($$231530>>>0)<($10>>>0);
+ if ($149) {
+ $$211437$ph = $$191435;$$211628$ph = $$191626;$$251122$ph = $$231120;$$26$ph = $$24;$$261017$ph = $$241015;$$261229$ph = $$241227;$$261335$ph = $$241333;$$sink1716 = $$231530;
+ label = 49;
+ continue L46;
+ } else {
+ $$201436 = $$191435;$$201627 = $$191626;$$241121 = $$231120;$$241531 = $$231530;$$25 = $$24;$$251016 = $$241015;$$251228 = $$241227;$$251334 = $$241333;
+ label = 47;
+ continue L46;
+ }
+ break;
+ }
+ case 51: {
+ label = 0;
+ $159 = $$271336 & 255;
+ $160 = $$271336 >>> 8;
+ $161 = (($$27) + -8)|0;
+ $$231439 = $$221438;$$231630 = $$221629;$$271018 = $159;$$271124 = $$261123;$$271534 = $$261533;$$28 = $161;$$281231 = $$271230;$$281337 = $160;
+ label = 52;
+ continue L46;
+ break;
+ }
+ case 54: {
+ label = 0;
+ $166 = ($$281125|0)==(0);
+ if ($166) {
+ $$761492 = $$241440;$$801071 = $$281019;$$801687 = $$241631;$$821285 = $$291232;$$831180 = 0;$$851592 = $$281535;$$86 = $$29;$$861395 = $$291338;
+ label = 220;
+ break L125;
+ } else {
+ $$251441 = $$241440;$$251632 = $$241631;$$291020 = $$281019;$$291126 = $$281125;$$291536 = $$281535;$$30 = $$29;$$301233 = $$291232;$$301339 = $$291338;
+ label = 55;
+ continue L46;
+ }
+ break;
+ }
+ case 61: {
+ label = 0;
+ $185 = ($$331130>>>0)<(3);
+ if ($185) {
+ $186 = (5303 + ($$331130)|0);
+ $187 = HEAP8[$186>>0]|0;
+ $188 = $187 << 24 >> 24;
+ $189 = ($$34>>>0)<($188>>>0);
+ if ($189) {
+ $$301446 = $$291445;$$301637 = $$291636;$$341025 = $$331024;$$341131 = $$331130;$$341541 = $$331540;$$35 = $$34;$$351238 = $$341237;$$351344 = $$341343;
+ label = 63;
+ continue L125;
+ } else {
+ $$331449 = $$291445;$$331640 = $$291636;$$371028 = $$331024;$$371134 = $$331130;$$371544 = $$331540;$$38 = $$34;$$381241 = $$341237;$$381347 = $$341343;
+ label = 68;
+ continue L125;
+ }
+ } else {
+ $216 = ((($0)) + 7040|0);
+ _memset(($216|0),0,288)|0;
+ $$341450 = $$291445;$$341641 = $$291636;$$381029 = $$331024;$$381135 = 0;$$381545 = $$331540;$$39 = $$34;$$391242 = $$341237;$$391348 = $$341343;
+ label = 70;
+ break;
+ }
+ break;
+ }
+ case 63: {
+ label = 0;
+ $190 = ($$341541>>>0)<($10>>>0);
+ if ($190) {
+ $$321448$ph = $$301446;$$321639$ph = $$301637;$$361027$ph = $$341025;$$361133$ph = $$341131;$$37$ph = $$35;$$371240$ph = $$351238;$$371346$ph = $$351344;$$sink1719 = $$341541;
+ label = 66;
+ continue L46;
+ } else {
+ $$311447 = $$301446;$$311638 = $$301637;$$351026 = $$341025;$$351132 = $$341131;$$351542 = $$341541;$$36 = $$35;$$361239 = $$351238;$$361345 = $$351344;
+ label = 64;
+ continue L46;
+ }
+ break;
+ }
+ case 68: {
+ label = 0;
+ $203 = (5303 + ($$371134)|0);
+ $204 = HEAP8[$203>>0]|0;
+ $205 = $204 << 24 >> 24;
+ $206 = 1 << $205;
+ $207 = (($206) + -1)|0;
+ $208 = $207 & $$381347;
+ $209 = (((($0)) + 44|0) + ($$371134<<2)|0);
+ $210 = $$381347 >>> $205;
+ $211 = (($$38) - ($205))|0;
+ $212 = (104 + ($$371134<<2)|0);
+ $213 = HEAP32[$212>>2]|0;
+ $214 = (($208) + ($213))|0;
+ HEAP32[$209>>2] = $214;
+ $215 = (($$371134) + 1)|0;
+ $$291445 = $$331449;$$291636 = $$331640;$$331024 = $$371028;$$331130 = $215;$$331540 = $$371544;$$34 = $211;$$341237 = $$381241;$$341343 = $210;
+ label = 61;
+ continue L125;
+ break;
+ }
+ case 72: {
+ label = 0;
+ $221 = ($$391546>>>0)<($10>>>0);
+ if ($221) {
+ $$371453$ph = $$351451;$$371644$ph = $$351642;$$411032$ph = $$391030;$$411138$ph = $$391136;$$42$ph = $$40;$$421245$ph = $$401243;$$421351$ph = $$401349;$$sink1722 = $$391546;
+ label = 75;
+ continue L46;
+ } else {
+ $$361452 = $$351451;$$361643 = $$351642;$$401031 = $$391030;$$401137 = $$391136;$$401547 = $$391546;$$41 = $$40;$$411244 = $$401243;$$411350 = $$401349;
+ label = 73;
+ continue L46;
+ }
+ break;
+ }
+ case 77: {
+ label = 0;
+ $231 = $$431352 & 7;
+ $232 = $$431352 >>> 3;
+ $233 = (($$43) + -3)|0;
+ $234 = $231&255;
+ $235 = (7816 + ($$421139)|0);
+ $236 = HEAP8[$235>>0]|0;
+ $237 = $236&255;
+ $238 = (((($0)) + 7040|0) + ($237)|0);
+ HEAP8[$238>>0] = $234;
+ $239 = (($$421139) + 1)|0;
+ $$341450 = $$381454;$$341641 = $$381645;$$381029 = $$421033;$$381135 = $239;$$381545 = $$421549;$$39 = $233;$$391242 = $$431246;$$391348 = $232;
+ label = 70;
+ break;
+ }
+ case 80: {
+ label = 0;
+ $247 = ((($0)) + 24|0);
+ $248 = HEAP32[$247>>2]|0;
+ $249 = ($248|0)>(-1);
+ if ($249) {
+ dest=$8; stop=dest+64|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $250 = (((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0);
+ _memset(($250|0),0,3200)|0;
+ $251 = HEAP32[$247>>2]|0;
+ $252 = (((($0)) + 44|0) + ($251<<2)|0);
+ $253 = HEAP32[$252>>2]|0;
+ $254 = ($253|0)==(0);
+ if (!($254)) {
+ $255 = HEAP32[$247>>2]|0;
+ $256 = (((($0)) + 44|0) + ($255<<2)|0);
+ $257 = HEAP32[$256>>2]|0;
+ $$010951864 = 0;
+ while(1) {
+ $258 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010951864)|0);
+ $259 = HEAP8[$258>>0]|0;
+ $260 = $259&255;
+ $261 = (($8) + ($260<<2)|0);
+ $262 = HEAP32[$261>>2]|0;
+ $263 = (($262) + 1)|0;
+ HEAP32[$261>>2] = $263;
+ $264 = (($$010951864) + 1)|0;
+ $265 = ($264>>>0)<($257>>>0);
+ if ($265) {
+ $$010951864 = $264;
+ } else {
+ break;
+ }
+ }
+ }
+ $266 = ((($7)) + 4|0);
+ HEAP32[$266>>2] = 0;
+ HEAP32[$7>>2] = 0;
+ $267 = ((($8)) + 4|0);
+ $268 = HEAP32[$267>>2]|0;
+ $269 = $268 << 1;
+ $270 = ((($7)) + 8|0);
+ HEAP32[$270>>2] = $269;
+ $271 = ((($8)) + 8|0);
+ $272 = HEAP32[$271>>2]|0;
+ $273 = (($272) + ($268))|0;
+ $274 = (($272) + ($269))|0;
+ $275 = $274 << 1;
+ $276 = ((($7)) + 12|0);
+ HEAP32[$276>>2] = $275;
+ $277 = ((($8)) + 12|0);
+ $278 = HEAP32[$277>>2]|0;
+ $279 = (($278) + ($273))|0;
+ $280 = (($278) + ($275))|0;
+ $281 = $280 << 1;
+ $282 = ((($7)) + 16|0);
+ HEAP32[$282>>2] = $281;
+ $283 = ((($8)) + 16|0);
+ $284 = HEAP32[$283>>2]|0;
+ $285 = (($284) + ($279))|0;
+ $286 = (($284) + ($281))|0;
+ $287 = $286 << 1;
+ $288 = ((($7)) + 20|0);
+ HEAP32[$288>>2] = $287;
+ $289 = ((($8)) + 20|0);
+ $290 = HEAP32[$289>>2]|0;
+ $291 = (($290) + ($285))|0;
+ $292 = (($290) + ($287))|0;
+ $293 = $292 << 1;
+ $294 = ((($7)) + 24|0);
+ HEAP32[$294>>2] = $293;
+ $295 = ((($8)) + 24|0);
+ $296 = HEAP32[$295>>2]|0;
+ $297 = (($296) + ($291))|0;
+ $298 = (($296) + ($293))|0;
+ $299 = $298 << 1;
+ $300 = ((($7)) + 28|0);
+ HEAP32[$300>>2] = $299;
+ $301 = ((($8)) + 28|0);
+ $302 = HEAP32[$301>>2]|0;
+ $303 = (($302) + ($297))|0;
+ $304 = (($302) + ($299))|0;
+ $305 = $304 << 1;
+ $306 = ((($7)) + 32|0);
+ HEAP32[$306>>2] = $305;
+ $307 = ((($8)) + 32|0);
+ $308 = HEAP32[$307>>2]|0;
+ $309 = (($308) + ($303))|0;
+ $310 = (($308) + ($305))|0;
+ $311 = $310 << 1;
+ $312 = ((($7)) + 36|0);
+ HEAP32[$312>>2] = $311;
+ $313 = ((($8)) + 36|0);
+ $314 = HEAP32[$313>>2]|0;
+ $315 = (($314) + ($309))|0;
+ $316 = (($314) + ($311))|0;
+ $317 = $316 << 1;
+ $318 = ((($7)) + 40|0);
+ HEAP32[$318>>2] = $317;
+ $319 = ((($8)) + 40|0);
+ $320 = HEAP32[$319>>2]|0;
+ $321 = (($320) + ($315))|0;
+ $322 = (($320) + ($317))|0;
+ $323 = $322 << 1;
+ $324 = ((($7)) + 44|0);
+ HEAP32[$324>>2] = $323;
+ $325 = ((($8)) + 44|0);
+ $326 = HEAP32[$325>>2]|0;
+ $327 = (($326) + ($321))|0;
+ $328 = (($326) + ($323))|0;
+ $329 = $328 << 1;
+ $330 = ((($7)) + 48|0);
+ HEAP32[$330>>2] = $329;
+ $331 = ((($8)) + 48|0);
+ $332 = HEAP32[$331>>2]|0;
+ $333 = (($332) + ($327))|0;
+ $334 = (($332) + ($329))|0;
+ $335 = $334 << 1;
+ $336 = ((($7)) + 52|0);
+ HEAP32[$336>>2] = $335;
+ $337 = ((($8)) + 52|0);
+ $338 = HEAP32[$337>>2]|0;
+ $339 = (($338) + ($333))|0;
+ $340 = (($338) + ($335))|0;
+ $341 = $340 << 1;
+ $342 = ((($7)) + 56|0);
+ HEAP32[$342>>2] = $341;
+ $343 = ((($8)) + 56|0);
+ $344 = HEAP32[$343>>2]|0;
+ $345 = (($344) + ($339))|0;
+ $346 = (($344) + ($341))|0;
+ $347 = $346 << 1;
+ $348 = ((($7)) + 60|0);
+ HEAP32[$348>>2] = $347;
+ $349 = ((($8)) + 60|0);
+ $350 = HEAP32[$349>>2]|0;
+ $351 = (($350) + ($345))|0;
+ $352 = (($350) + ($347))|0;
+ $353 = $352 << 1;
+ $354 = ((($7)) + 64|0);
+ HEAP32[$354>>2] = $353;
+ $355 = ($353|0)!=(65536);
+ $356 = ($351>>>0)>(1);
+ $or$cond = $355 & $356;
+ if ($or$cond) {
+ $$401456 = $$391455;$$401647 = $$391646;$$441035 = $$431034;$$441141 = $$431140;$$441551 = $$431550;$$45 = $$44;$$451248 = $$441247;$$451354 = $$441353;
+ label = 86;
+ continue L46;
+ }
+ $357 = HEAP32[$247>>2]|0;
+ $358 = (((($0)) + 44|0) + ($357<<2)|0);
+ $359 = HEAP32[$358>>2]|0;
+ $360 = ($359|0)==(0);
+ if ($360) {
+ $$lcssa1779 = $357;
+ } else {
+ $$010911856 = 0;$$011971855 = -1;
+ while(1) {
+ $361 = ((((($0)) + 64|0) + (($248*3488)|0)|0) + ($$010911856)|0);
+ $362 = HEAP8[$361>>0]|0;
+ $363 = $362&255;
+ $364 = ($362<<24>>24)==(0);
+ L142: do {
+ if ($364) {
+ $$41201 = $$011971855;
+ } else {
+ $365 = (($7) + ($363<<2)|0);
+ $366 = HEAP32[$365>>2]|0;
+ $367 = (($366) + 1)|0;
+ HEAP32[$365>>2] = $367;
+ $$010861840 = $366;$$010871839 = $363;$$010881838 = 0;
+ while(1) {
+ $368 = $$010881838 << 1;
+ $369 = $$010861840 & 1;
+ $370 = $369 | $368;
+ $371 = (($$010871839) + -1)|0;
+ $372 = $$010861840 >>> 1;
+ $373 = ($371|0)==(0);
+ if ($373) {
+ break;
+ } else {
+ $$010861840 = $372;$$010871839 = $371;$$010881838 = $370;
+ }
+ }
+ $374 = ($362&255)<(11);
+ if ($374) {
+ $375 = $363 << 9;
+ $376 = $375 | $$010911856;
+ $377 = $376&65535;
+ $378 = ($370>>>0)<(1024);
+ if (!($378)) {
+ $$41201 = $$011971855;
+ break;
+ }
+ $379 = 1 << $363;
+ $$110891852 = $370;
+ while(1) {
+ $380 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($$110891852<<1)|0);
+ HEAP16[$380>>1] = $377;
+ $381 = (($$110891852) + ($379))|0;
+ $382 = ($381>>>0)<(1024);
+ if ($382) {
+ $$110891852 = $381;
+ } else {
+ $$41201 = $$011971855;
+ break L142;
+ }
+ }
+ }
+ $383 = $370 & 1023;
+ $384 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 288|0) + ($383<<1)|0);
+ $385 = HEAP16[$384>>1]|0;
+ $386 = $385 << 16 >> 16;
+ $387 = ($385<<16>>16)==(0);
+ if ($387) {
+ $388 = (($$011971855) + -2)|0;
+ $389 = $$011971855&65535;
+ HEAP16[$384>>1] = $389;
+ $$01194 = $$011971855;$$11198 = $388;
+ } else {
+ $$01194 = $386;$$11198 = $$011971855;
+ }
+ $390 = $$010881838 >>> 9;
+ $391 = ($362&255)>(11);
+ $392 = $390 & 1;
+ $393 = (($392) - ($$01194))|0;
+ $394 = (($393) + -1)|0;
+ if ($391) {
+ $395 = $390 & 4194303;
+ $$010941846 = $363;$$211991845 = $$11198;$397 = $394;$406 = $395;
+ while(1) {
+ $396 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($397<<1)|0);
+ $398 = HEAP16[$396>>1]|0;
+ $399 = ($398<<16>>16)==(0);
+ if ($399) {
+ $400 = $$211991845&65535;
+ HEAP16[$396>>1] = $400;
+ $401 = (($$211991845) + -2)|0;
+ $$21196 = $$211991845;$$31200 = $401;
+ } else {
+ $402 = $398 << 16 >> 16;
+ $$21196 = $402;$$31200 = $$211991845;
+ }
+ $403 = (($$010941846) + -1)|0;
+ $404 = ($403>>>0)>(11);
+ $405 = $406 >>> 1;
+ $407 = $405 & 1;
+ $408 = (($407) - ($$21196))|0;
+ $409 = (($408) + -1)|0;
+ if ($404) {
+ $$010941846 = $403;$$211991845 = $$31200;$397 = $409;$406 = $405;
+ } else {
+ $$21199$lcssa = $$31200;$$lcssa1778 = $409;
+ break;
+ }
+ }
+ } else {
+ $$21199$lcssa = $$11198;$$lcssa1778 = $394;
+ }
+ $410 = $$010911856&65535;
+ $411 = ((((((($0)) + 64|0) + (($248*3488)|0)|0)) + 2336|0) + ($$lcssa1778<<1)|0);
+ HEAP16[$411>>1] = $410;
+ $$41201 = $$21199$lcssa;
+ }
+ } while(0);
+ $412 = (($$010911856) + 1)|0;
+ $413 = HEAP32[$247>>2]|0;
+ $414 = (((($0)) + 44|0) + ($413<<2)|0);
+ $415 = HEAP32[$414>>2]|0;
+ $416 = ($412>>>0)<($415>>>0);
+ if ($416) {
+ $$010911856 = $412;$$011971855 = $$41201;
+ } else {
+ $$lcssa1779 = $413;
+ break;
+ }
+ }
+ }
+ $417 = ($$lcssa1779|0)==(2);
+ if ($417) {
+ $$411457 = $$391455;$$411648 = $$391646;$$451036 = $$431034;$$451142 = 0;$$451552 = $$431550;$$46 = $$44;$$461249 = $$441247;$$461355 = $$441353;
+ label = 105;
+ } else {
+ $$521468 = $$391455;$$521659 = $$391646;$$551046 = $$431034;$$561153 = $$431140;$$561563 = $$431550;$$57 = $$44;$$571260 = $$441247;$$571366 = $$441353;
+ label = 138;
+ }
+ } else {
+ $$531469 = $$391455;$$531660 = $$391646;$$561047 = $$431034;$$571154 = $$431140;$$571564 = $$431550;$$58 = $$44;$$581261 = $$441247;$$581367 = $$441353;
+ label = 139;
+ }
+ break;
+ }
+ case 108: {
+ label = 0;
+ $429 = $$471356 & 1023;
+ $430 = (((($0)) + 7328|0) + ($429<<1)|0);
+ $431 = HEAP16[$430>>1]|0;
+ $432 = $431 << 16 >> 16;
+ $433 = ($431<<16>>16)>(-1);
+ if ($433) {
+ $434 = $432 >> 9;
+ $435 = (($434) + -1)|0;
+ $436 = ($435>>>0)<($$47>>>0);
+ if ($436) {
+ $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
+ label = 119;
+ continue L125;
+ } else {
+ label = 113;
+ break L125;
+ }
+ }
+ $437 = ($$47>>>0)>(10);
+ if ($437) {
+ $$0981 = 10;$$0984 = $432;
+ } else {
+ label = 113;
+ break L125;
+ }
+ while(1) {
+ $438 = $$0984 ^ -1;
+ $439 = $$471356 >>> $$0981;
+ $440 = $439 & 1;
+ $441 = (($440) + ($438))|0;
+ $442 = (((($0)) + 9376|0) + ($441<<1)|0);
+ $443 = HEAP16[$442>>1]|0;
+ $444 = ($443<<16>>16)<(0);
+ if (!($444)) {
+ $$451461 = $$421458;$$451652 = $$421649;$$491146 = $$461143;$$491556 = $$461553;$$50 = $$47;$$501253 = $$471250;$$501359 = $$471356;
+ label = 119;
+ continue L125;
+ }
+ $445 = (($$0981) + 1)|0;
+ $446 = $443 << 16 >> 16;
+ $447 = (($$0981) + 2)|0;
+ $448 = ($$47>>>0)<($447>>>0);
+ if ($448) {
+ label = 113;
+ break L125;
+ } else {
+ $$0981 = $445;$$0984 = $446;
+ }
+ }
+ break;
+ }
+ case 119: {
+ label = 0;
+ $471 = $$501359 & 1023;
+ $472 = (((($0)) + 7328|0) + ($471<<1)|0);
+ $473 = HEAP16[$472>>1]|0;
+ $474 = $473 << 16 >> 16;
+ $475 = ($473<<16>>16)>(-1);
+ if ($475) {
+ $476 = $474 >> 9;
+ $477 = $474 & 511;
+ $$2983 = $476;$$2986 = $477;
+ } else {
+ $$1982 = 10;$$1985 = $474;
+ while(1) {
+ $478 = $$1985 ^ -1;
+ $479 = (($$1982) + 1)|0;
+ $480 = $$501359 >>> $$1982;
+ $481 = $480 & 1;
+ $482 = (($481) + ($478))|0;
+ $483 = (((($0)) + 9376|0) + ($482<<1)|0);
+ $484 = HEAP16[$483>>1]|0;
+ $485 = $484 << 16 >> 16;
+ $486 = ($484<<16>>16)<(0);
+ if ($486) {
+ $$1982 = $479;$$1985 = $485;
+ } else {
+ $$2983 = $479;$$2986 = $485;
+ break;
+ }
+ }
+ }
+ $487 = $$501359 >>> $$2983;
+ $488 = (($$50) - ($$2983))|0;
+ $489 = ($$2986>>>0)<(16);
+ if ($489) {
+ $490 = $$2986&255;
+ $491 = (($$491146) + 1)|0;
+ $492 = (((($0)) + 10532|0) + ($$491146)|0);
+ HEAP8[$492>>0] = $490;
+ $$411457 = $$451461;$$411648 = $$451652;$$451036 = $$2986;$$451142 = $491;$$451552 = $$491556;$$46 = $488;$$461249 = $$501253;$$461355 = $487;
+ label = 105;
+ break;
+ }
+ $493 = ($$2986|0)!=(16);
+ $494 = ($$491146|0)!=(0);
+ $or$cond24 = $494 | $493;
+ if (!($or$cond24)) {
+ $$461462 = $$451461;$$461653 = $$451652;$$491040 = $$2986;$$501147 = $$491146;$$501557 = $$491556;$$51 = $488;$$511254 = $$501253;$$511360 = $487;
+ label = 125;
+ continue L46;
+ }
+ $495 = (($$2986) + -16)|0;
+ $496 = (5307 + ($495)|0);
+ $497 = HEAP8[$496>>0]|0;
+ $498 = $497 << 24 >> 24;
+ $499 = ($488>>>0)<($498>>>0);
+ if ($499) {
+ $$471463 = $$451461;$$471654 = $$451652;$$501041 = $$2986;$$511148 = $$491146;$$511558 = $$491556;$$52 = $488;$$521255 = $498;$$521361 = $487;
+ label = 127;
+ continue L125;
+ } else {
+ $$501466 = $$451461;$$501657 = $$451652;$$531044 = $$2986;$$541151 = $$491146;$$541561 = $$491556;$$55 = $488;$$551258 = $498;$$551364 = $487;
+ label = 132;
+ continue L125;
+ }
+ break;
+ }
+ case 127: {
+ label = 0;
+ $500 = ($$511558>>>0)<($10>>>0);
+ if ($500) {
+ $$491465$ph = $$471463;$$491656$ph = $$471654;$$521043$ph = $$501041;$$531150$ph = $$511148;$$54$ph = $$52;$$541257$ph = $$521255;$$541363$ph = $$521361;$$sink1732 = $$511558;
+ label = 130;
+ continue L46;
+ } else {
+ $$481464 = $$471463;$$481655 = $$471654;$$511042 = $$501041;$$521149 = $$511148;$$521559 = $$511558;$$53 = $$52;$$531256 = $$521255;$$531362 = $$521361;
+ label = 128;
+ continue L46;
+ }
+ break;
+ }
+ case 132: {
+ label = 0;
+ $510 = 1 << $$551258;
+ $511 = (($510) + -1)|0;
+ $512 = $511 & $$551364;
+ $513 = $$551364 >>> $$551258;
+ $514 = (($$55) - ($$551258))|0;
+ $515 = (($$531044) + -16)|0;
+ $516 = (5311 + ($515)|0);
+ $517 = HEAP8[$516>>0]|0;
+ $518 = $517 << 24 >> 24;
+ $519 = (($518) + ($512))|0;
+ $520 = (((($0)) + 10532|0) + ($$541151)|0);
+ $521 = ($$531044|0)==(16);
+ if ($521) {
+ $522 = (($$541151) + -1)|0;
+ $523 = (((($0)) + 10532|0) + ($522)|0);
+ $524 = HEAP8[$523>>0]|0;
+ $525 = $524&255;
+ $527 = $525;
+ } else {
+ $527 = 0;
+ }
+ $526 = $527&255;
+ _memset(($520|0),($526|0),($519|0))|0;
+ $528 = (($519) + ($$541151))|0;
+ $$411457 = $$501466;$$411648 = $$501657;$$451036 = $$531044;$$451142 = $528;$$451552 = $$541561;$$46 = $514;$$461249 = $$551258;$$461355 = $513;
+ label = 105;
+ break;
+ }
+ case 140: {
+ label = 0;
+ $539 = $10;
+ $540 = $$581565$ph;
+ $541 = (($539) - ($540))|0;
+ $542 = ($541|0)<(4);
+ $543 = ($$59$ph>>>0)<(15);
+ L241: do {
+ if ($542) {
+ $$541661$lcssa = $$541661$ph;$$581155$lcssa = $$581155$ph;$$581565$lcssa = $$581565$ph;$$59$lcssa = $$59$ph;$$591368$lcssa = $$591368$ph;$$lcssa1799 = $543;$$lcssa1802 = $541;
+ } else {
+ $544 = $12;
+ $$5416611868 = $$541661$ph;$$5811551871 = $$581155$ph;$$5815651869 = $$581565$ph;$$5913681870 = $$591368$ph;$$591872 = $$59$ph;$965 = $543;$966 = $541;
+ while(1) {
+ $545 = $$5416611868;
+ $546 = (($544) - ($545))|0;
+ $547 = ($546|0)<(2);
+ if ($547) {
+ $$541661$lcssa = $$5416611868;$$581155$lcssa = $$5811551871;$$581565$lcssa = $$5815651869;$$59$lcssa = $$591872;$$591368$lcssa = $$5913681870;$$lcssa1799 = $965;$$lcssa1802 = $966;
+ break L241;
+ }
+ if ($965) {
+ $613 = HEAP8[$$5815651869>>0]|0;
+ $614 = $613&255;
+ $615 = ((($$5815651869)) + 1|0);
+ $616 = HEAP8[$615>>0]|0;
+ $617 = $616&255;
+ $618 = $617 << 8;
+ $619 = $618 | $614;
+ $620 = $619 << $$591872;
+ $621 = $620 | $$5913681870;
+ $622 = ((($$5815651869)) + 2|0);
+ $623 = (($$591872) + 16)|0;
+ $$641571 = $622;$$65 = $623;$$651374 = $621;
+ } else {
+ $$641571 = $$5815651869;$$65 = $$591872;$$651374 = $$5913681870;
+ }
+ $624 = $$651374 & 1023;
+ $625 = (((($0)) + 352|0) + ($624<<1)|0);
+ $626 = HEAP16[$625>>1]|0;
+ $627 = $626 << 16 >> 16;
+ $628 = ($626<<16>>16)>(-1);
+ if ($628) {
+ $629 = $627 >> 9;
+ $$1964 = $629;$$1968 = $627;
+ } else {
+ $$0963 = 10;$$0967 = $627;
+ while(1) {
+ $630 = $$0967 ^ -1;
+ $631 = (($$0963) + 1)|0;
+ $632 = $$651374 >>> $$0963;
+ $633 = $632 & 1;
+ $634 = (($633) + ($630))|0;
+ $635 = (((($0)) + 2400|0) + ($634<<1)|0);
+ $636 = HEAP16[$635>>1]|0;
+ $637 = $636 << 16 >> 16;
+ $638 = ($636<<16>>16)<(0);
+ if ($638) {
+ $$0963 = $631;$$0967 = $637;
+ } else {
+ $$1964 = $631;$$1968 = $637;
+ break;
+ }
+ }
+ }
+ $639 = $$651374 >>> $$1964;
+ $640 = (($$65) - ($$1964))|0;
+ $641 = $$1968 & 256;
+ $642 = ($641|0)==(0);
+ if (!($642)) {
+ $$601476 = $$541470$ph;$$611668 = $$5416611868;$$631054 = $$571048$ph;$$641161 = $$1968;$$651268 = $$591262$ph;$$671574 = $$641571;$$68 = $640;$$681377 = $639;
+ label = 176;
+ break L126;
+ }
+ $643 = ($640>>>0)<(15);
+ if ($643) {
+ $644 = HEAP8[$$641571>>0]|0;
+ $645 = $644&255;
+ $646 = ((($$641571)) + 1|0);
+ $647 = HEAP8[$646>>0]|0;
+ $648 = $647&255;
+ $649 = $648 << 8;
+ $650 = $649 | $645;
+ $651 = $650 << $640;
+ $652 = $651 | $639;
+ $653 = ((($$641571)) + 2|0);
+ $654 = (($640) + 16)|0;
+ $$651572 = $653;$$66 = $654;$$661375 = $652;
+ } else {
+ $$651572 = $$641571;$$66 = $640;$$661375 = $639;
+ }
+ $655 = $$661375 & 1023;
+ $656 = (((($0)) + 352|0) + ($655<<1)|0);
+ $657 = HEAP16[$656>>1]|0;
+ $658 = $657 << 16 >> 16;
+ $659 = ($657<<16>>16)>(-1);
+ if ($659) {
+ $660 = $658 >> 9;
+ $$3966 = $660;$$3970 = $658;
+ } else {
+ $$2965 = 10;$$2969 = $658;
+ while(1) {
+ $661 = $$2969 ^ -1;
+ $662 = (($$2965) + 1)|0;
+ $663 = $$661375 >>> $$2965;
+ $664 = $663 & 1;
+ $665 = (($664) + ($661))|0;
+ $666 = (((($0)) + 2400|0) + ($665<<1)|0);
+ $667 = HEAP16[$666>>1]|0;
+ $668 = $667 << 16 >> 16;
+ $669 = ($667<<16>>16)<(0);
+ if ($669) {
+ $$2965 = $662;$$2969 = $668;
+ } else {
+ $$3966 = $662;$$3970 = $668;
+ break;
+ }
+ }
+ }
+ $670 = $$661375 >>> $$3966;
+ $671 = (($$66) - ($$3966))|0;
+ $672 = $$1968&255;
+ HEAP8[$$5416611868>>0] = $672;
+ $673 = $$3970 & 256;
+ $674 = ($673|0)==(0);
+ if (!($674)) {
+ break;
+ }
+ $676 = $$3970&255;
+ $677 = ((($$5416611868)) + 1|0);
+ HEAP8[$677>>0] = $676;
+ $678 = ((($$5416611868)) + 2|0);
+ $679 = $$651572;
+ $680 = (($539) - ($679))|0;
+ $681 = ($680|0)<(4);
+ $682 = ($671>>>0)<(15);
+ if ($681) {
+ $$541661$lcssa = $678;$$581155$lcssa = $$1968;$$581565$lcssa = $$651572;$$59$lcssa = $671;$$591368$lcssa = $670;$$lcssa1799 = $682;$$lcssa1802 = $680;
+ break L241;
+ } else {
+ $$5416611868 = $678;$$5811551871 = $$1968;$$5815651869 = $$651572;$$5913681870 = $670;$$591872 = $671;$965 = $682;$966 = $680;
+ }
+ }
+ $675 = ((($$5416611868)) + 1|0);
+ $$601476 = $$541470$ph;$$611668 = $675;$$631054 = $$571048$ph;$$641161 = $$3970;$$651268 = $$591262$ph;$$671574 = $$651572;$$68 = $671;$$681377 = $670;
+ label = 176;
+ break L126;
+ }
+ } while(0);
+ if (!($$lcssa1799)) {
+ $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $$581565$lcssa;$$63 = $$59$lcssa;$$631266 = $$591262$ph;$$631372 = $$591368$lcssa;
+ label = 156;
+ continue L125;
+ }
+ $548 = ($$lcssa1802|0)<(2);
+ if ($548) {
+ $$551471 = $$541470$ph;$$551662 = $$541661$lcssa;$$581049 = $$571048$ph;$$591156 = $$581155$lcssa;$$591566 = $$581565$lcssa;$$60 = $$59$lcssa;$$601263 = $$591262$ph;$$601369 = $$591368$lcssa;
+ label = 145;
+ continue L125;
+ }
+ $579 = HEAP8[$$581565$lcssa>>0]|0;
+ $580 = $579&255;
+ $581 = $580 << $$59$lcssa;
+ $582 = ((($$581565$lcssa)) + 1|0);
+ $583 = HEAP8[$582>>0]|0;
+ $584 = $583&255;
+ $585 = (($$59$lcssa) + 8)|0;
+ $586 = $584 << $585;
+ $587 = $581 | $$591368$lcssa;
+ $588 = $587 | $586;
+ $589 = ((($$581565$lcssa)) + 2|0);
+ $590 = (($$59$lcssa) + 16)|0;
+ $$581474 = $$541470$ph;$$581665 = $$541661$lcssa;$$611052 = $$571048$ph;$$621569 = $589;$$63 = $590;$$631266 = $$591262$ph;$$631372 = $588;
+ label = 156;
+ continue L125;
+ break;
+ }
+ case 145: {
+ label = 0;
+ $549 = $$601369 & 1023;
+ $550 = (((($0)) + 352|0) + ($549<<1)|0);
+ $551 = HEAP16[$550>>1]|0;
+ $552 = $551 << 16 >> 16;
+ $553 = ($551<<16>>16)>(-1);
+ if ($553) {
+ $554 = $552 >> 9;
+ $555 = (($554) + -1)|0;
+ $556 = ($555>>>0)<($$60>>>0);
+ if ($556) {
+ $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
+ label = 156;
+ continue L125;
+ } else {
+ label = 150;
+ break L125;
+ }
+ }
+ $557 = ($$60>>>0)>(10);
+ if ($557) {
+ $$0972 = 10;$$0975 = $552;
+ } else {
+ label = 150;
+ break L125;
+ }
+ while(1) {
+ $558 = $$0975 ^ -1;
+ $559 = $$601369 >>> $$0972;
+ $560 = $559 & 1;
+ $561 = (($560) + ($558))|0;
+ $562 = (((($0)) + 2400|0) + ($561<<1)|0);
+ $563 = HEAP16[$562>>1]|0;
+ $564 = ($563<<16>>16)<(0);
+ if (!($564)) {
+ $$581474 = $$551471;$$581665 = $$551662;$$611052 = $$581049;$$621569 = $$591566;$$63 = $$60;$$631266 = $$601263;$$631372 = $$601369;
+ label = 156;
+ continue L125;
+ }
+ $565 = (($$0972) + 1)|0;
+ $566 = $563 << 16 >> 16;
+ $567 = (($$0972) + 2)|0;
+ $568 = ($$60>>>0)<($567>>>0);
+ if ($568) {
+ label = 150;
+ break L125;
+ } else {
+ $$0972 = $565;$$0975 = $566;
+ }
+ }
+ break;
+ }
+ case 156: {
+ label = 0;
+ $591 = $$631372 & 1023;
+ $592 = (((($0)) + 352|0) + ($591<<1)|0);
+ $593 = HEAP16[$592>>1]|0;
+ $594 = $593 << 16 >> 16;
+ $595 = ($593<<16>>16)>(-1);
+ if ($595) {
+ $596 = $594 >> 9;
+ $597 = $594 & 511;
+ $$2974 = $596;$$2977 = $597;
+ } else {
+ $$1973 = 10;$$1976 = $594;
+ while(1) {
+ $598 = $$1976 ^ -1;
+ $599 = (($$1973) + 1)|0;
+ $600 = $$631372 >>> $$1973;
+ $601 = $600 & 1;
+ $602 = (($601) + ($598))|0;
+ $603 = (((($0)) + 2400|0) + ($602<<1)|0);
+ $604 = HEAP16[$603>>1]|0;
+ $605 = $604 << 16 >> 16;
+ $606 = ($604<<16>>16)<(0);
+ if ($606) {
+ $$1973 = $599;$$1976 = $605;
+ } else {
+ $$2974 = $599;$$2977 = $605;
+ break;
+ }
+ }
+ }
+ $607 = $$631372 >>> $$2974;
+ $608 = (($$63) - ($$2974))|0;
+ $609 = ($$2977>>>0)>(255);
+ if ($609) {
+ $$601476 = $$581474;$$611668 = $$581665;$$631054 = $$611052;$$641161 = $$2977;$$651268 = $$631266;$$671574 = $$621569;$$68 = $608;$$681377 = $607;
+ label = 176;
+ } else {
+ $$591475 = $$581474;$$591666 = $$581665;$$621053 = $$611052;$$621159 = $$2977;$$631570 = $$621569;$$64 = $608;$$641267 = $$631266;$$641373 = $607;
+ label = 160;
+ continue L46;
+ }
+ break;
+ }
+ case 179: {
+ label = 0;
+ $693 = ($$681575>>>0)<($10>>>0);
+ if ($693) {
+ $$631479$ph = $$611477;$$641671$ph = $$621669;$$661057$ph = $$641055;$$671164$ph = $$651162;$$681271$ph = $$661269;$$71$ph = $$69;$$711380$ph = $$691378;$$sink1739 = $$681575;
+ label = 182;
+ continue L46;
+ } else {
+ $$621478 = $$611477;$$631670 = $$621669;$$651056 = $$641055;$$661163 = $$651162;$$671270 = $$661269;$$691576 = $$681575;$$70 = $$69;$$701379 = $$691378;
+ label = 180;
+ continue L46;
+ }
+ break;
+ }
+ case 184: {
+ label = 0;
+ $703 = 1 << $$691272;
+ $704 = (($703) + -1)|0;
+ $705 = $704 & $$721381;
+ $706 = $$721381 >>> $$691272;
+ $707 = (($$72) - ($$691272))|0;
+ $708 = (($705) + ($$681165))|0;
+ $$651481 = $$641480;$$661673 = $$651672;$$681059 = $$671058;$$691166 = $708;$$701273 = $$691272;$$721579 = $$711578;$$73 = $707;$$731382 = $706;
+ label = 185;
+ break;
+ }
+ case 187: {
+ label = 0;
+ $714 = $$741383 & 1023;
+ $715 = (((($0)) + 3840|0) + ($714<<1)|0);
+ $716 = HEAP16[$715>>1]|0;
+ $717 = $716 << 16 >> 16;
+ $718 = ($716<<16>>16)>(-1);
+ if ($718) {
+ $719 = $717 >> 9;
+ $720 = (($719) + -1)|0;
+ $721 = ($720>>>0)<($$74>>>0);
+ if ($721) {
+ $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
+ label = 198;
+ continue L125;
+ } else {
+ label = 192;
+ break L125;
+ }
+ }
+ $722 = ($$74>>>0)>(10);
+ if ($722) {
+ $$0953 = 10;$$0956 = $717;
+ } else {
+ label = 192;
+ break L125;
+ }
+ while(1) {
+ $723 = $$0956 ^ -1;
+ $724 = $$741383 >>> $$0953;
+ $725 = $724 & 1;
+ $726 = (($725) + ($723))|0;
+ $727 = (((($0)) + 5888|0) + ($726<<1)|0);
+ $728 = HEAP16[$727>>1]|0;
+ $729 = ($728<<16>>16)<(0);
+ if (!($729)) {
+ $$691485 = $$661482;$$701677 = $$671674;$$731170 = $$701167;$$761583 = $$731580;$$77 = $$74;$$771386 = $$741383;
+ label = 198;
+ continue L125;
+ }
+ $730 = (($$0953) + 1)|0;
+ $731 = $728 << 16 >> 16;
+ $732 = (($$0953) + 2)|0;
+ $733 = ($$74>>>0)<($732>>>0);
+ if ($733) {
+ label = 192;
+ break L125;
+ } else {
+ $$0953 = $730;$$0956 = $731;
+ }
+ }
+ break;
+ }
+ case 198: {
+ label = 0;
+ $756 = $$771386 & 1023;
+ $757 = (((($0)) + 3840|0) + ($756<<1)|0);
+ $758 = HEAP16[$757>>1]|0;
+ $759 = $758 << 16 >> 16;
+ $760 = ($758<<16>>16)>(-1);
+ if ($760) {
+ $761 = $759 >> 9;
+ $762 = $759 & 511;
+ $$2955 = $761;$$2958 = $762;
+ } else {
+ $$1954 = 10;$$1957 = $759;
+ while(1) {
+ $763 = $$1957 ^ -1;
+ $764 = (($$1954) + 1)|0;
+ $765 = $$771386 >>> $$1954;
+ $766 = $765 & 1;
+ $767 = (($766) + ($763))|0;
+ $768 = (((($0)) + 5888|0) + ($767<<1)|0);
+ $769 = HEAP16[$768>>1]|0;
+ $770 = $769 << 16 >> 16;
+ $771 = ($769<<16>>16)<(0);
+ if ($771) {
+ $$1954 = $764;$$1957 = $770;
+ } else {
+ $$2955 = $764;$$2958 = $770;
+ break;
+ }
+ }
+ }
+ $772 = $$771386 >>> $$2955;
+ $773 = (($$77) - ($$2955))|0;
+ $774 = (3564 + ($$2958<<2)|0);
+ $775 = HEAP32[$774>>2]|0;
+ $776 = (3436 + ($$2958<<2)|0);
+ $777 = HEAP32[$776>>2]|0;
+ $778 = (($$2958) + -4)|0;
+ $779 = ($778>>>0)<(26);
+ if ($779) {
+ $780 = ($773>>>0)<($775>>>0);
+ if ($780) {
+ $$701486 = $$691485;$$711678 = $$701677;$$721063 = $777;$$741171 = $$731170;$$741277 = $775;$$771584 = $$761583;$$78 = $773;$$781387 = $772;
+ label = 203;
+ continue L125;
+ } else {
+ $$741681 = $$701677;$$751066 = $777;$$771174 = $$731170;$$771280 = $775;$$801587 = $$761583;$$81 = $773;$$811390 = $772;
+ label = 208;
+ continue L125;
+ }
+ } else {
+ $$751682 = $$701677;$$761067 = $777;$$781175 = $$731170;$$781281 = $775;$$811588 = $$761583;$$82 = $773;$$821391 = $772;
+ label = 209;
+ }
+ break;
+ }
+ case 203: {
+ label = 0;
+ $781 = ($$771584>>>0)<($10>>>0);
+ if ($781) {
+ $$721488$ph = $$701486;$$731680$ph = $$711678;$$741065$ph = $$721063;$$761173$ph = $$741171;$$761279$ph = $$741277;$$80$ph = $$78;$$801389$ph = $$781387;$$sink1746 = $$771584;
+ label = 206;
+ continue L46;
+ } else {
+ $$711487 = $$701486;$$721679 = $$711678;$$731064 = $$721063;$$751172 = $$741171;$$751278 = $$741277;$$781585 = $$771584;$$79 = $$78;$$791388 = $$781387;
+ label = 204;
+ continue L46;
+ }
+ break;
+ }
+ case 208: {
+ label = 0;
+ $791 = 1 << $$771280;
+ $792 = (($791) + -1)|0;
+ $793 = $792 & $$811390;
+ $794 = $$811390 >>> $$771280;
+ $795 = (($$81) - ($$771280))|0;
+ $796 = (($793) + ($$751066))|0;
+ $$751682 = $$741681;$$761067 = $796;$$781175 = $$771174;$$781281 = $$771280;$$811588 = $$801587;$$82 = $795;$$821391 = $794;
+ label = 209;
+ break;
+ }
+ case 212: {
+ label = 0;
+ $807 = (($$801177) + -1)|0;
+ $808 = ($$801177|0)==(0);
+ if ($808) {
+ $$531469 = $$741490;$$531660 = $$771684;$$561047 = $$781069;$$571154 = $807;$$571564 = $$831590;$$58 = $$84;$$581261 = $$801283;$$581367 = $$841393;
+ label = 139;
+ } else {
+ $$751491 = $$741490;$$781685 = $$771684;$$791070 = $$781069;$$811178 = $807;$$811284 = $$801283;$$841591 = $$831590;$$85 = $$84;$$851394 = $$841393;
+ label = 213;
+ continue L46;
+ }
+ break;
+ }
+ }
+ do {
+ if ((label|0) == 70) {
+ label = 0;
+ $217 = ((($0)) + 52|0);
+ $218 = HEAP32[$217>>2]|0;
+ $219 = ($$381135>>>0)<($218>>>0);
+ if ($219) {
+ $220 = ($$39>>>0)<(3);
+ if ($220) {
+ $$351451 = $$341450;$$351642 = $$341641;$$391030 = $$381029;$$391136 = $$381135;$$391546 = $$381545;$$40 = $$39;$$401243 = $$391242;$$401349 = $$391348;
+ label = 72;
+ continue L125;
+ } else {
+ $$381454 = $$341450;$$381645 = $$341641;$$421033 = $$381029;$$421139 = $$381135;$$421549 = $$381545;$$43 = $$39;$$431246 = $$391242;$$431352 = $$391348;
+ label = 77;
+ continue L125;
+ }
+ } else {
+ HEAP32[$217>>2] = 19;
+ $$391455 = $$341450;$$391646 = $$341641;$$431034 = $$381029;$$431140 = $$381135;$$431550 = $$381545;$$44 = $$39;$$441247 = $$391242;$$441353 = $$391348;
+ label = 80;
+ continue L125;
+ }
+ }
+ else if ((label|0) == 105) {
+ label = 0;
+ $418 = ((($0)) + 44|0);
+ $419 = HEAP32[$418>>2]|0;
+ $420 = ((($0)) + 48|0);
+ $421 = HEAP32[$420>>2]|0;
+ $422 = (($421) + ($419))|0;
+ $423 = ($$451142>>>0)<($422>>>0);
+ if (!($423)) {
+ $529 = ($422|0)==($$451142|0);
+ if (!($529)) {
+ $$511467 = $$411457;$$511658 = $$411648;$$541045 = $$451036;$$551152 = $$451142;$$551562 = $$451552;$$56 = $$46;$$561259 = $$461249;$$561365 = $$461355;
+ label = 136;
+ continue L46;
+ }
+ $530 = ((($0)) + 64|0);
+ $531 = ((($0)) + 10532|0);
+ _memcpy(($530|0),($531|0),($419|0))|0;
+ $532 = ((($0)) + 3552|0);
+ $533 = HEAP32[$418>>2]|0;
+ $534 = (((($0)) + 10532|0) + ($533)|0);
+ $535 = HEAP32[$420>>2]|0;
+ _memcpy(($532|0),($534|0),($535|0))|0;
+ $$521468 = $$411457;$$521659 = $$411648;$$551046 = $$451036;$$561153 = $$451142;$$561563 = $$451552;$$57 = $$46;$$571260 = $$461249;$$571366 = $$461355;
+ label = 138;
+ break;
+ }
+ $424 = ($$46>>>0)<(15);
+ if (!($424)) {
+ $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $$451552;$$50 = $$46;$$501253 = $$461249;$$501359 = $$461355;
+ label = 119;
+ continue L125;
+ }
+ $425 = $10;
+ $426 = $$451552;
+ $427 = (($425) - ($426))|0;
+ $428 = ($427|0)<(2);
+ if ($428) {
+ $$421458 = $$411457;$$421649 = $$411648;$$461037 = $$451036;$$461143 = $$451142;$$461553 = $$451552;$$47 = $$46;$$471250 = $$461249;$$471356 = $$461355;
+ label = 108;
+ continue L125;
+ }
+ $459 = HEAP8[$$451552>>0]|0;
+ $460 = $459&255;
+ $461 = $460 << $$46;
+ $462 = ((($$451552)) + 1|0);
+ $463 = HEAP8[$462>>0]|0;
+ $464 = $463&255;
+ $465 = (($$46) + 8)|0;
+ $466 = $464 << $465;
+ $467 = $461 | $$461355;
+ $468 = $467 | $466;
+ $469 = ((($$451552)) + 2|0);
+ $470 = (($$46) + 16)|0;
+ $$451461 = $$411457;$$451652 = $$411648;$$491146 = $$451142;$$491556 = $469;$$50 = $470;$$501253 = $$461249;$$501359 = $468;
+ label = 119;
+ continue L125;
+ }
+ else if ((label|0) == 176) {
+ label = 0;
+ $683 = $$641161 & 511;
+ $684 = ($683|0)==(256);
+ if ($684) {
+ $$761492 = $$601476;$$801071 = $$631054;$$801687 = $$611668;$$821285 = $$651268;$$831180 = 256;$$851592 = $$671574;$$86 = $$68;$$861395 = $$681377;
+ label = 220;
+ break L125;
+ }
+ $685 = (($683) + -257)|0;
+ $686 = (3312 + ($685<<2)|0);
+ $687 = HEAP32[$686>>2]|0;
+ $688 = (3188 + ($685<<2)|0);
+ $689 = HEAP32[$688>>2]|0;
+ $690 = (($683) + -265)|0;
+ $691 = ($690>>>0)<(20);
+ if ($691) {
+ $692 = ($$68>>>0)<($687>>>0);
+ if ($692) {
+ $$611477 = $$601476;$$621669 = $$611668;$$641055 = $$631054;$$651162 = $689;$$661269 = $687;$$681575 = $$671574;$$69 = $$68;$$691378 = $$681377;
+ label = 179;
+ continue L125;
+ } else {
+ $$641480 = $$601476;$$651672 = $$611668;$$671058 = $$631054;$$681165 = $689;$$691272 = $687;$$711578 = $$671574;$$72 = $$68;$$721381 = $$681377;
+ label = 184;
+ continue L125;
+ }
+ } else {
+ $$651481 = $$601476;$$661673 = $$611668;$$681059 = $$631054;$$691166 = $689;$$701273 = $687;$$721579 = $$671574;$$73 = $$68;$$731382 = $$681377;
+ label = 185;
+ }
+ }
+ else if ((label|0) == 209) {
+ label = 0;
+ $797 = $$751682;
+ $798 = $3;
+ $799 = (($797) - ($798))|0;
+ $$not = ($799>>>0)>=($$761067>>>0);
+ $$not1747 = $14 ^ 1;
+ $brmerge = $$not | $$not1747;
+ if (!($brmerge)) {
+ $$731489 = $799;$$761683 = $$751682;$$771068 = $$761067;$$791176 = $$781175;$$791282 = $$781281;$$821589 = $$811588;$$83 = $$82;$$831392 = $$821391;
+ label = 210;
+ continue L46;
+ }
+ $800 = (($799) - ($$761067))|0;
+ $801 = $800 & $$1753;
+ $802 = (($3) + ($801)|0);
+ $803 = ($$751682>>>0)>($802>>>0);
+ $804 = $803 ? $$751682 : $802;
+ $805 = (($804) + ($$781175)|0);
+ $806 = ($805>>>0)>($12>>>0);
+ if ($806) {
+ $$741490 = $799;$$771684 = $$751682;$$781069 = $$761067;$$801177 = $$781175;$$801283 = $$781281;$$831590 = $$811588;$$84 = $$82;$$841393 = $$821391;
+ label = 212;
+ continue L125;
+ } else {
+ $$0978 = $802;$$791686 = $$751682;$$821179 = $$781175;
+ }
+ while(1) {
+ $816 = HEAP8[$$0978>>0]|0;
+ HEAP8[$$791686>>0] = $816;
+ $817 = ((($$0978)) + 1|0);
+ $818 = HEAP8[$817>>0]|0;
+ $819 = ((($$791686)) + 1|0);
+ HEAP8[$819>>0] = $818;
+ $820 = ((($$0978)) + 2|0);
+ $821 = HEAP8[$820>>0]|0;
+ $822 = ((($$791686)) + 2|0);
+ HEAP8[$822>>0] = $821;
+ $823 = ((($$791686)) + 3|0);
+ $824 = ((($$0978)) + 3|0);
+ $825 = (($$821179) + -3)|0;
+ $826 = ($825|0)>(2);
+ if ($826) {
+ $$0978 = $824;$$791686 = $823;$$821179 = $825;
+ } else {
+ break;
+ }
+ }
+ $827 = ($825|0)>(0);
+ if ($827) {
+ $828 = HEAP8[$824>>0]|0;
+ HEAP8[$823>>0] = $828;
+ $829 = ($825|0)==(1);
+ if (!($829)) {
+ $830 = ((($$0978)) + 4|0);
+ $831 = HEAP8[$830>>0]|0;
+ $832 = ((($$791686)) + 4|0);
+ HEAP8[$832>>0] = $831;
+ }
+ $833 = (($823) + ($825)|0);
+ $$531469 = $799;$$531660 = $833;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
+ label = 139;
+ } else {
+ $$531469 = $799;$$531660 = $823;$$561047 = $$761067;$$571154 = $825;$$571564 = $$811588;$$58 = $$82;$$581261 = $$781281;$$581367 = $$821391;
+ label = 139;
+ }
+ }
+ } while(0);
+ if ((label|0) == 138) {
+ label = 0;
+ $536 = ((($0)) + 24|0);
+ $537 = HEAP32[$536>>2]|0;
+ $538 = (($537) + -1)|0;
+ HEAP32[$536>>2] = $538;
+ $$391455 = $$521468;$$391646 = $$521659;$$431034 = $$551046;$$431140 = $$561153;$$431550 = $$561563;$$44 = $$57;$$441247 = $$571260;$$441353 = $$571366;
+ label = 80;
+ continue;
+ }
+ else if ((label|0) == 139) {
+ label = 0;
+ $$541470$ph = $$531469;$$541661$ph = $$531660;$$571048$ph = $$561047;$$581155$ph = $$571154;$$581565$ph = $$571564;$$59$ph = $$58;$$591262$ph = $$581261;$$591368$ph = $$581367;
+ label = 140;
+ continue;
+ }
+ else if ((label|0) == 185) {
+ label = 0;
+ $709 = ($$73>>>0)<(15);
+ if (!($709)) {
+ $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $$721579;$$77 = $$73;$$771386 = $$731382;
+ label = 198;
+ continue;
+ }
+ $710 = $10;
+ $711 = $$721579;
+ $712 = (($710) - ($711))|0;
+ $713 = ($712|0)<(2);
+ if ($713) {
+ $$661482 = $$651481;$$671674 = $$661673;$$691060 = $$681059;$$701167 = $$691166;$$711274 = $$701273;$$731580 = $$721579;$$74 = $$73;$$741383 = $$731382;
+ label = 187;
+ continue;
+ }
+ $744 = HEAP8[$$721579>>0]|0;
+ $745 = $744&255;
+ $746 = $745 << $$73;
+ $747 = ((($$721579)) + 1|0);
+ $748 = HEAP8[$747>>0]|0;
+ $749 = $748&255;
+ $750 = (($$73) + 8)|0;
+ $751 = $749 << $750;
+ $752 = $746 | $$731382;
+ $753 = $752 | $751;
+ $754 = ((($$721579)) + 2|0);
+ $755 = (($$73) + 16)|0;
+ $$691485 = $$651481;$$701677 = $$661673;$$731170 = $$691166;$$761583 = $754;$$77 = $755;$$771386 = $753;
+ label = 198;
+ continue;
+ }
+ }
+ if ((label|0) == 113) {
+ label = 0;
+ $449 = ($$461553>>>0)<($10>>>0);
+ if ($449) {
+ $$441460$ph = $$421458;$$441651$ph = $$421649;$$481039$ph = $$461037;$$481145$ph = $$461143;$$49$ph = $$47;$$491252$ph = $$471250;$$491358$ph = $$471356;$$sink1729 = $$461553;
+ label = 116;
+ continue;
+ } else {
+ $$431459 = $$421458;$$431650 = $$421649;$$471038 = $$461037;$$471144 = $$461143;$$471554 = $$461553;$$48 = $$47;$$481251 = $$471250;$$481357 = $$471356;
+ label = 114;
+ continue;
+ }
+ }
+ else if ((label|0) == 150) {
+ label = 0;
+ $569 = ($$591566>>>0)<($10>>>0);
+ if ($569) {
+ $$571473$ph = $$551471;$$571664$ph = $$551662;$$601051$ph = $$581049;$$611158$ph = $$591156;$$62$ph = $$60;$$621265$ph = $$601263;$$621371$ph = $$601369;$$sink1736 = $$591566;
+ label = 153;
+ continue;
+ } else {
+ $$561472 = $$551471;$$561663 = $$551662;$$591050 = $$581049;$$601157 = $$591156;$$601567 = $$591566;$$61 = $$60;$$611264 = $$601263;$$611370 = $$601369;
+ label = 151;
+ continue;
+ }
+ }
+ else if ((label|0) == 192) {
+ label = 0;
+ $734 = ($$731580>>>0)<($10>>>0);
+ if ($734) {
+ $$681484$ph = $$661482;$$691676$ph = $$671674;$$711062$ph = $$691060;$$721169$ph = $$701167;$$731276$ph = $$711274;$$76$ph = $$74;$$761385$ph = $$741383;$$sink1743 = $$731580;
+ label = 195;
+ continue;
+ } else {
+ $$671483 = $$661482;$$681675 = $$671674;$$701061 = $$691060;$$711168 = $$701167;$$721275 = $$711274;$$741581 = $$731580;$$75 = $$74;$$751384 = $$741383;
+ label = 193;
+ continue;
+ }
+ }
+ else if ((label|0) == 220) {
+ label = 0;
+ $834 = ((($0)) + 20|0);
+ $835 = HEAP32[$834>>2]|0;
+ $836 = $835 & 1;
+ $837 = ($836|0)==(0);
+ if ($837) {
+ $$01416 = $$761492;$$01607 = $$801687;$$41511 = $$851592;$$5 = $$86;$$51102 = $$831180;$$51208 = $$821285;$$51314 = $$861395;$$5996 = $$801071;
+ label = 14;
+ continue;
+ }
+ $838 = $6 & 1;
+ $839 = ($838|0)==(0);
+ if ($839) {
+ $$881504 = $$761492;$$921083 = $$801071;$$921699 = $$801687;$$941191 = $$831180;$$941297 = $$821285;$$971604 = $$851592;$$98 = $$86;$$981407 = $$861395;
+ label = 242;
+ continue;
+ } else {
+ $$801496 = $$761492;$$841075 = $$801071;$$841691 = $$801687;$$861289 = $$821285;$$891596 = $$851592;$$90 = $$86;$$901399 = $$861395;
+ label = 226;
+ continue;
+ }
+ }
+ }
+ if ((label|0) == 258) {
+ STACKTOP = sp;return ($$0951|0);
+ }
+ $892 = ((($0)) + 28|0);
+ $893 = HEAP32[$892>>2]|0;
+ $894 = $893 & 65535;
+ $895 = $893 >>> 16;
+ $896 = ($888|0)==(0);
+ if ($896) {
+ $$0937$lcssa = $895;$$0938$lcssa = $894;
+ } else {
+ $897 = (($888>>>0) % 5552)&-1;
+ $$01834 = $897;$$09371833 = $895;$$09381832 = $894;$$09431831 = $888;$$09441830 = $4;
+ while(1) {
+ $898 = ($$01834>>>0)>(7);
+ if ($898) {
+ $899 = (($$01834) + -8)|0;
+ $900 = $899 & -8;
+ $scevgep = ((($$09441830)) + 8|0);
+ $$09411816 = 0;$$11818 = $$09371833;$$19391817 = $$09381832;$$19451815 = $$09441830;
+ while(1) {
+ $904 = HEAP8[$$19451815>>0]|0;
+ $905 = $904&255;
+ $906 = (($905) + ($$19391817))|0;
+ $907 = (($906) + ($$11818))|0;
+ $908 = ((($$19451815)) + 1|0);
+ $909 = HEAP8[$908>>0]|0;
+ $910 = $909&255;
+ $911 = (($906) + ($910))|0;
+ $912 = (($907) + ($911))|0;
+ $913 = ((($$19451815)) + 2|0);
+ $914 = HEAP8[$913>>0]|0;
+ $915 = $914&255;
+ $916 = (($911) + ($915))|0;
+ $917 = (($912) + ($916))|0;
+ $918 = ((($$19451815)) + 3|0);
+ $919 = HEAP8[$918>>0]|0;
+ $920 = $919&255;
+ $921 = (($916) + ($920))|0;
+ $922 = (($917) + ($921))|0;
+ $923 = ((($$19451815)) + 4|0);
+ $924 = HEAP8[$923>>0]|0;
+ $925 = $924&255;
+ $926 = (($921) + ($925))|0;
+ $927 = (($922) + ($926))|0;
+ $928 = ((($$19451815)) + 5|0);
+ $929 = HEAP8[$928>>0]|0;
+ $930 = $929&255;
+ $931 = (($926) + ($930))|0;
+ $932 = (($927) + ($931))|0;
+ $933 = ((($$19451815)) + 6|0);
+ $934 = HEAP8[$933>>0]|0;
+ $935 = $934&255;
+ $936 = (($931) + ($935))|0;
+ $937 = (($932) + ($936))|0;
+ $938 = ((($$19451815)) + 7|0);
+ $939 = HEAP8[$938>>0]|0;
+ $940 = $939&255;
+ $941 = (($936) + ($940))|0;
+ $942 = (($937) + ($941))|0;
+ $943 = (($$09411816) + 8)|0;
+ $944 = ((($$19451815)) + 8|0);
+ $945 = $943 | 7;
+ $946 = ($945>>>0)<($$01834>>>0);
+ if ($946) {
+ $$09411816 = $943;$$11818 = $942;$$19391817 = $941;$$19451815 = $944;
+ } else {
+ break;
+ }
+ }
+ $901 = (($900) + 8)|0;
+ $scevgep1947 = (($scevgep) + ($900)|0);
+ $$0941$lcssa = $901;$$1$lcssa = $942;$$1939$lcssa = $941;$$1945$lcssa = $scevgep1947;
+ } else {
+ $$0941$lcssa = 0;$$1$lcssa = $$09371833;$$1939$lcssa = $$09381832;$$1945$lcssa = $$09441830;
+ }
+ $902 = ($$01834>>>0)>($$0941$lcssa>>>0);
+ if ($902) {
+ $903 = (($$01834) - ($$0941$lcssa))|0;
+ $$19421823 = $$0941$lcssa;$$21825 = $$1$lcssa;$$29401824 = $$1939$lcssa;$$29461822 = $$1945$lcssa;
+ while(1) {
+ $947 = ((($$29461822)) + 1|0);
+ $948 = HEAP8[$$29461822>>0]|0;
+ $949 = $948&255;
+ $950 = (($949) + ($$29401824))|0;
+ $951 = (($950) + ($$21825))|0;
+ $952 = (($$19421823) + 1)|0;
+ $exitcond = ($952|0)==($$01834|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$19421823 = $952;$$21825 = $951;$$29401824 = $950;$$29461822 = $947;
+ }
+ }
+ $scevgep1948 = (($$1945$lcssa) + ($903)|0);
+ $$2$lcssa = $951;$$2940$lcssa = $950;$$2946$lcssa = $scevgep1948;
+ } else {
+ $$2$lcssa = $$1$lcssa;$$2940$lcssa = $$1939$lcssa;$$2946$lcssa = $$1945$lcssa;
+ }
+ $953 = (($$2940$lcssa>>>0) % 65521)&-1;
+ $954 = (($$2$lcssa>>>0) % 65521)&-1;
+ $955 = (($$09431831) - ($$01834))|0;
+ $956 = ($955|0)==(0);
+ if ($956) {
+ $$0937$lcssa = $954;$$0938$lcssa = $953;
+ break;
+ } else {
+ $$01834 = 5552;$$09371833 = $954;$$09381832 = $953;$$09431831 = $955;$$09441830 = $$2946$lcssa;
+ }
+ }
+ }
+ $957 = $$0937$lcssa << 16;
+ $958 = $957 | $$0938$lcssa;
+ HEAP32[$892>>2] = $958;
+ $959 = ($$1961|0)!=(0);
+ $960 = $6 & 1;
+ $961 = ($960|0)==(0);
+ $or$cond1752 = $961 | $959;
+ if ($or$cond1752) {
+ $$0951 = $$1961;
+ STACKTOP = sp;return ($$0951|0);
+ } else {
+ $962 = ((($0)) + 16|0);
+ $963 = HEAP32[$962>>2]|0;
+ $964 = ($958|0)==($963|0);
+ $$1961$ = $964 ? $$1961 : -2;
+ STACKTOP = sp;return ($$1961$|0);
+ }
+ return (0)|0;
+}
+function _tinfl_decompress_mem_to_mem($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 11008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(11008|0);
+ $5 = sp + 11000|0;
+ $6 = sp;
+ $7 = sp + 8|0;
+ HEAP32[$5>>2] = $1;
+ HEAP32[$6>>2] = $3;
+ HEAP32[$7>>2] = 0;
+ $8 = $4 & -7;
+ $9 = $8 | 4;
+ $10 = (_tinfl_decompress($7,$2,$6,$0,$0,$5,$9)|0);
+ $11 = ($10|0)!=(0);
+ $12 = HEAP32[$5>>2]|0;
+ $13 = $11 ? -1 : $12;
+ STACKTOP = sp;return ($13|0);
+}
+function _LoadResource($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0$lcssa = 0, $$05665 = 0, $$05764 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond60 = 0;
+ var $or$cond62 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr11 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
+ $vararg_buffer8 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 64|0;
+ $3 = sp + 32|0;
+ $4 = (_fopen($0,6385)|0);
+ $5 = ($4|0)==(0|0);
+ if ($5) {
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(1,5315,$vararg_buffer);
+ $$2 = 0;
+ STACKTOP = sp;return ($$2|0);
+ }
+ (_fread($2,1,1,$4)|0);
+ $6 = ((($2)) + 1|0);
+ (_fread($6,1,1,$4)|0);
+ $7 = ((($2)) + 2|0);
+ (_fread($7,1,1,$4)|0);
+ $8 = ((($2)) + 3|0);
+ (_fread($8,1,1,$4)|0);
+ $9 = ((($2)) + 4|0);
+ (_fread($9,2,1,$4)|0);
+ $10 = ((($2)) + 6|0);
+ (_fread($10,2,1,$4)|0);
+ $11 = HEAP8[$2>>0]|0;
+ $12 = ($11<<24>>24)==(114);
+ $13 = HEAP8[$6>>0]|0;
+ $14 = ($13<<24>>24)==(82);
+ $or$cond = $12 | $14;
+ $15 = HEAP8[$7>>0]|0;
+ $16 = ($15<<24>>24)==(69);
+ $or$cond60 = $or$cond | $16;
+ $17 = HEAP8[$8>>0]|0;
+ $18 = ($17<<24>>24)==(83);
+ $or$cond62 = $or$cond60 | $18;
+ if ($or$cond62) {
+ $19 = HEAP16[$10>>1]|0;
+ $20 = ($19<<16>>16)==(0);
+ if ($20) {
+ $$0$lcssa = 0;
+ } else {
+ $21 = ((($3)) + 7|0);
+ $22 = HEAP16[$10>>1]|0;
+ $23 = $22&65535;
+ $24 = ((($3)) + 8|0);
+ $25 = ((($3)) + 4|0);
+ $26 = ((($3)) + 16|0);
+ $27 = ((($3)) + 20|0);
+ $28 = ((($3)) + 24|0);
+ $29 = ((($3)) + 28|0);
+ $30 = ((($3)) + 8|0);
+ $31 = ((($3)) + 5|0);
+ $32 = ((($3)) + 12|0);
+ $$05665 = 0;
+ while(1) {
+ (_fread($3,32,1,$4)|0);
+ $36 = HEAP8[$21>>0]|0;
+ $37 = $36&255;
+ $38 = ($37*24)|0;
+ $39 = (_malloc($38)|0);
+ $40 = HEAP32[$3>>2]|0;
+ $41 = ($40|0)==($1|0);
+ if ($41) {
+ $42 = HEAP8[$21>>0]|0;
+ $43 = ($42<<24>>24)==(0);
+ if (!($43)) {
+ $$05764 = 0;
+ while(1) {
+ $44 = HEAP8[$25>>0]|0;
+ $45 = $44&255;
+ $46 = (($39) + (($$05764*24)|0)|0);
+ HEAP32[$46>>2] = $45;
+ $47 = HEAP32[$26>>2]|0;
+ $48 = (((($39) + (($$05764*24)|0)|0)) + 4|0);
+ HEAP32[$48>>2] = $47;
+ $49 = HEAP32[$27>>2]|0;
+ $50 = (((($39) + (($$05764*24)|0)|0)) + 8|0);
+ HEAP32[$50>>2] = $49;
+ $51 = HEAP32[$28>>2]|0;
+ $52 = (((($39) + (($$05764*24)|0)|0)) + 12|0);
+ HEAP32[$52>>2] = $51;
+ $53 = HEAP32[$29>>2]|0;
+ $54 = (((($39) + (($$05764*24)|0)|0)) + 16|0);
+ HEAP32[$54>>2] = $53;
+ $55 = HEAP32[$30>>2]|0;
+ $56 = (_malloc($55)|0);
+ (_fread($56,$55,1,$4)|0);
+ $57 = HEAP8[$31>>0]|0;
+ $58 = ($57<<24>>24)==(1);
+ if ($58) {
+ $59 = HEAP32[$30>>2]|0;
+ $60 = HEAP32[$32>>2]|0;
+ $61 = (_DecompressData($56,$59,$60)|0);
+ $62 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
+ HEAP32[$62>>2] = $61;
+ _free($56);
+ } else {
+ $63 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
+ HEAP32[$63>>2] = $56;
+ }
+ $64 = (((($39) + (($$05764*24)|0)|0)) + 20|0);
+ $65 = HEAP32[$64>>2]|0;
+ $66 = ($65|0)==(0|0);
+ if (!($66)) {
+ $67 = HEAP32[$3>>2]|0;
+ HEAP32[$vararg_buffer4>>2] = $0;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = $67;
+ _TraceLog(0,5412,$vararg_buffer4);
+ }
+ (_fread($3,32,1,$4)|0);
+ $68 = (($$05764) + 1)|0;
+ $69 = HEAP8[$21>>0]|0;
+ $70 = $69&255;
+ $71 = ($68|0)<($70|0);
+ if ($71) {
+ $$05764 = $68;
+ } else {
+ break;
+ }
+ }
+ }
+ } else {
+ $72 = HEAP32[$24>>2]|0;
+ (_fseek($4,$72,1)|0);
+ }
+ $73 = (($$05665) + 1)|0;
+ $74 = ($73|0)<($23|0);
+ if ($74) {
+ $$05665 = $73;
+ } else {
+ $$0$lcssa = $39;
+ break;
+ }
+ }
+ }
+ $33 = ((($$0$lcssa)) + 20|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = ($34|0)==(0|0);
+ if ($35) {
+ HEAP32[$vararg_buffer8>>2] = $0;
+ $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
+ HEAP32[$vararg_ptr11>>2] = $1;
+ _TraceLog(1,5458,$vararg_buffer8);
+ $$1 = $$0$lcssa;
+ } else {
+ $$1 = $$0$lcssa;
+ }
+ } else {
+ HEAP32[$vararg_buffer1>>2] = $0;
+ _TraceLog(1,5366,$vararg_buffer1);
+ $$1 = 0;
+ }
+ (_fclose($4)|0);
+ $$2 = $$1;
+ STACKTOP = sp;return ($$2|0);
+}
+function _TraceLog($0,$1,$varargs) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $varargs = $varargs|0;
+ var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $endptr = 0, $strlen = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $2 = sp;
+ switch ($0|0) {
+ case 0: {
+ ;HEAP8[19312>>0]=HEAP8[5763>>0]|0;HEAP8[19312+1>>0]=HEAP8[5763+1>>0]|0;HEAP8[19312+2>>0]=HEAP8[5763+2>>0]|0;HEAP8[19312+3>>0]=HEAP8[5763+3>>0]|0;HEAP8[19312+4>>0]=HEAP8[5763+4>>0]|0;HEAP8[19312+5>>0]=HEAP8[5763+5>>0]|0;HEAP8[19312+6>>0]=HEAP8[5763+6>>0]|0;
+ break;
+ }
+ case 2: {
+ $3 = 19312;
+ $4 = $3;
+ HEAP32[$4>>2] = 1330795077;
+ $5 = (($3) + 4)|0;
+ $6 = $5;
+ HEAP32[$6>>2] = 2112082;
+ break;
+ }
+ case 1: {
+ dest=19312; src=5770; stop=dest+10|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ break;
+ }
+ case 3: {
+ $7 = 19312;
+ $8 = $7;
+ HEAP32[$8>>2] = 1430406468;
+ $9 = (($7) + 4)|0;
+ $10 = $9;
+ HEAP32[$10>>2] = 2112071;
+ break;
+ }
+ default: {
+ }
+ }
+ (_strcat(19312,$1)|0);
+ $strlen = (_strlen(19312)|0);
+ $endptr = (19312 + ($strlen)|0);
+ HEAP8[$endptr>>0]=10&255;HEAP8[$endptr+1>>0]=10>>8;
+ HEAP32[$2>>2] = $varargs;
+ $11 = ($0|0)==(3);
+ if ($11) {
+ STACKTOP = sp;return;
+ }
+ (_vprintf(19312,$2)|0);
+ $12 = ($0|0)==(2);
+ if ($12) {
+ _exit(1);
+ // unreachable;
+ } else {
+ STACKTOP = sp;return;
+ }
+}
+function _DecompressData($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $vararg_buffer10 = sp + 40|0;
+ $vararg_buffer7 = sp + 32|0;
+ $vararg_buffer5 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $3 = (_malloc($2)|0);
+ $4 = ($3|0)==(0|0);
+ if ($4) {
+ _TraceLog(1,5508,$vararg_buffer);
+ STACKTOP = sp;return ($3|0);
+ }
+ $5 = (_tinfl_decompress_mem_to_mem($3,$2,$0,$1,1)|0);
+ $6 = ($5|0)==(-1);
+ if ($6) {
+ _TraceLog(1,5547,$vararg_buffer1);
+ _free($3);
+ }
+ $7 = ($5|0)==($2|0);
+ if (!($7)) {
+ _TraceLog(1,5573,$vararg_buffer3);
+ HEAP32[$vararg_buffer5>>2] = $2;
+ _TraceLog(1,5636,$vararg_buffer5);
+ HEAP32[$vararg_buffer7>>2] = $5;
+ _TraceLog(1,5671,$vararg_buffer7);
+ }
+ HEAP32[$vararg_buffer10>>2] = $1;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $5;
+ _TraceLog(0,5706,$vararg_buffer10);
+ STACKTOP = sp;return ($3|0);
+}
+function _UnloadResource($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 20|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0|0);
+ if ($3) {
+ return;
+ }
+ _free($2);
+ return;
+}
+function _LoadDefaultFont() {
+ var $$ = 0, $$0101 = 0, $$090100 = 0, $$09299 = 0, $$095104 = 0, $$096103 = 0, $$097102 = 0, $$191 = 0, $$193 = 0, $$byval_copy1 = 0, $$lcssa = 0, $$sroa$0$0$$sroa_idx = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
+ var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $$byval_copy1 = sp + 44|0;
+ $vararg_buffer = sp;
+ $0 = sp + 4|0;
+ $1 = sp + 24|0;
+ HEAP32[(20632)>>2] = 224;
+ $2 = (_malloc(65536)|0);
+ _memset(($2|0),0,65536)|0;
+ $$095104 = 0;$$096103 = 0;
+ while(1) {
+ $3 = (116 + ($$095104<<2)|0);
+ $4 = HEAP32[$3>>2]|0;
+ $$097102 = 31;
+ while(1) {
+ $16 = 1 << $$097102;
+ $17 = $4 & $16;
+ $18 = ($17|0)==(0);
+ if (!($18)) {
+ $19 = (($$097102) + ($$096103))|0;
+ $$sroa$0$0$$sroa_idx = (($2) + ($19<<2)|0);
+ HEAP8[$$sroa$0$0$$sroa_idx>>0]=-1&255;HEAP8[$$sroa$0$0$$sroa_idx+1>>0]=(-1>>8)&255;HEAP8[$$sroa$0$0$$sroa_idx+2>>0]=(-1>>16)&255;HEAP8[$$sroa$0$0$$sroa_idx+3>>0]=-1>>24;
+ }
+ $20 = (($$097102) + -1)|0;
+ $21 = ($$097102|0)>(0);
+ if ($21) {
+ $$097102 = $20;
+ } else {
+ break;
+ }
+ }
+ $12 = (($$095104) + 1)|0;
+ $13 = ($$095104|0)>(511);
+ $$ = $13 ? 0 : $12;
+ $14 = (($$096103) + 32)|0;
+ $15 = ($14|0)<(16384);
+ if ($15) {
+ $$095104 = $$;$$096103 = $14;
+ } else {
+ break;
+ }
+ }
+ _LoadImageEx($0,$2,128,128);
+ _ImageFormat($0,2);
+ _free($2);
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
+ _LoadTextureFromImage($1,$$byval_copy1);
+ ;HEAP32[20608>>2]=HEAP32[$1>>2]|0;HEAP32[20608+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[20608+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[20608+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[20608+16>>2]=HEAP32[$1+16>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
+ _UnloadImage($$byval_copy1);
+ $5 = HEAP32[(20632)>>2]|0;
+ $6 = $5 << 5;
+ $7 = (_malloc($6)|0);
+ HEAP32[(20636)>>2] = $7;
+ $8 = ($5|0)>(0);
+ if (!($8)) {
+ $$lcssa = $7;
+ $22 = ((($$lcssa)) + 16|0);
+ $23 = HEAP32[$22>>2]|0;
+ HEAP32[(20628)>>2] = $23;
+ $24 = HEAP32[5152]|0;
+ HEAP32[$vararg_buffer>>2] = $24;
+ _TraceLog(0,5780,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ $9 = HEAP32[(20612)>>2]|0;
+ $10 = HEAP32[(20632)>>2]|0;
+ $11 = HEAP32[(20636)>>2]|0;
+ $$0101 = 0;$$090100 = 1;$$09299 = 0;$27 = $7;
+ while(1) {
+ $25 = (($$0101) + 32)|0;
+ $26 = (($27) + ($$0101<<5)|0);
+ HEAP32[$26>>2] = $25;
+ $28 = (((($27) + ($$0101<<5)|0)) + 4|0);
+ HEAP32[$28>>2] = $$090100;
+ $29 = ($$09299*11)|0;
+ $30 = (($29) + 1)|0;
+ $31 = (((($27) + ($$0101<<5)|0)) + 8|0);
+ HEAP32[$31>>2] = $30;
+ $32 = (2164 + ($$0101<<2)|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = (((($27) + ($$0101<<5)|0)) + 12|0);
+ HEAP32[$34>>2] = $33;
+ $35 = (((($27) + ($$0101<<5)|0)) + 16|0);
+ HEAP32[$35>>2] = 10;
+ $36 = (($$090100) + 1)|0;
+ $37 = (($36) + ($33))|0;
+ $38 = ($37|0)<($9|0);
+ $39 = (($$09299) + 1)|0;
+ if ($38) {
+ $$191 = $37;$$193 = $$09299;
+ } else {
+ $40 = ($39*11)|0;
+ $41 = (($40) + 1)|0;
+ $42 = (($33) + 2)|0;
+ HEAP32[$28>>2] = 1;
+ HEAP32[$31>>2] = $41;
+ $$191 = $42;$$193 = $39;
+ }
+ $43 = (((($27) + ($$0101<<5)|0)) + 20|0);
+ HEAP32[$43>>2] = 0;
+ $44 = (((($27) + ($$0101<<5)|0)) + 24|0);
+ HEAP32[$44>>2] = 0;
+ $45 = (((($27) + ($$0101<<5)|0)) + 28|0);
+ HEAP32[$45>>2] = 0;
+ $46 = (($$0101) + 1)|0;
+ $47 = ($46|0)<($10|0);
+ if ($47) {
+ $$0101 = $46;$$090100 = $$191;$$09299 = $$193;$27 = $11;
+ } else {
+ $$lcssa = $11;
+ break;
+ }
+ }
+ $22 = ((($$lcssa)) + 16|0);
+ $23 = HEAP32[$22>>2]|0;
+ HEAP32[(20628)>>2] = $23;
+ $24 = HEAP32[5152]|0;
+ HEAP32[$vararg_buffer>>2] = $24;
+ _TraceLog(0,5780,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _LoadImageEx($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$03334 = 0, $$035 = 0, $$sroa$12$0$$sroa_idx21 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$9$0$$sroa_idx18 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = $2 << 2;
+ $5 = Math_imul($4, $3)|0;
+ $6 = (_malloc($5)|0);
+ $7 = ($5|0)>(0);
+ if ($7) {
+ $8 = (($5) + -1)|0;
+ $9 = $8 >>> 2;
+ $$03334 = 0;$$035 = 0;
+ while(1) {
+ $10 = (($1) + ($$03334<<2)|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = (($6) + ($$035)|0);
+ HEAP8[$12>>0] = $11;
+ $13 = (((($1) + ($$03334<<2)|0)) + 1|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = $$035 | 1;
+ $16 = (($6) + ($15)|0);
+ HEAP8[$16>>0] = $14;
+ $17 = (((($1) + ($$03334<<2)|0)) + 2|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = $$035 | 2;
+ $20 = (($6) + ($19)|0);
+ HEAP8[$20>>0] = $18;
+ $21 = (((($1) + ($$03334<<2)|0)) + 3|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = $$035 | 3;
+ $24 = (($6) + ($23)|0);
+ HEAP8[$24>>0] = $22;
+ $25 = (($$03334) + 1)|0;
+ $26 = (($$035) + 4)|0;
+ $exitcond = ($$03334|0)==($9|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$03334 = $25;$$035 = $26;
+ }
+ }
+ }
+ HEAP32[$0>>2] = $6;
+ $$sroa$9$0$$sroa_idx18 = ((($0)) + 4|0);
+ HEAP32[$$sroa$9$0$$sroa_idx18>>2] = $2;
+ $$sroa$12$0$$sroa_idx21 = ((($0)) + 8|0);
+ HEAP32[$$sroa$12$0$$sroa_idx21>>2] = $3;
+ $$sroa$15$0$$sroa_idx24 = ((($0)) + 12|0);
+ HEAP32[$$sroa$15$0$$sroa_idx24>>2] = 1;
+ $$sroa$16$0$$sroa_idx26 = ((($0)) + 16|0);
+ HEAP32[$$sroa$16$0$$sroa_idx26>>2] = 7;
+ return;
+}
+function _ImageFormat($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0166199 = 0, $$0167197 = 0, $$0168195 = 0, $$0169192 = 0, $$0170190 = 0, $$0171188 = 0, $$0172189 = 0, $$0202 = 0, $$1194 = 0, $$2201 = 0, $$byval_copy = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0;
+ var $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0;
+ var $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0;
+ var $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0;
+ var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0;
+ var $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0;
+ var $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0;
+ var $216 = 0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0, $224 = 0.0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0;
+ var $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0;
+ var $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0;
+ var $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0;
+ var $289 = 0, $29 = 0.0, $290 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0;
+ var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0;
+ var $or$cond = 0, $roundf = 0.0, $roundf173 = 0.0, $roundf174 = 0.0, $roundf175 = 0.0, $roundf176 = 0.0, $roundf177 = 0.0, $roundf178 = 0.0, $roundf179 = 0.0, $roundf180 = 0.0, $roundf181 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $$byval_copy = sp + 4|0;
+ $vararg_buffer = sp;
+ $2 = ((($0)) + 16|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)==($1|0);
+ if ($4) {
+ STACKTOP = sp;return;
+ }
+ $5 = ($3|0)<(9);
+ $6 = ($1|0)<(9);
+ $or$cond = $6 & $5;
+ if (!($or$cond)) {
+ _TraceLog(1,6177,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
+ $7 = (_GetImageData($$byval_copy)|0);
+ $8 = HEAP32[$0>>2]|0;
+ _free($8);
+ HEAP32[$2>>2] = $1;
+ switch ($1|0) {
+ case 1: {
+ $9 = ((($0)) + 4|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($0)) + 8|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = Math_imul($12, $10)|0;
+ $14 = (_malloc($13)|0);
+ HEAP32[$0>>2] = $14;
+ $15 = Math_imul($12, $10)|0;
+ $16 = ($15|0)>(0);
+ if ($16) {
+ $$0171188 = 0;
+ while(1) {
+ $17 = (($7) + ($$0171188<<2)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = (+($18&255));
+ $20 = $19 * 0.29899999499320984;
+ $21 = (((($7) + ($$0171188<<2)|0)) + 1|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = (+($22&255));
+ $24 = $23 * 0.58700001239776611;
+ $25 = $20 + $24;
+ $26 = (((($7) + ($$0171188<<2)|0)) + 2|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = (+($27&255));
+ $29 = $28 * 0.11400000005960464;
+ $30 = $25 + $29;
+ $31 = (~~(($30))&255);
+ $32 = HEAP32[$0>>2]|0;
+ $33 = (($32) + ($$0171188)|0);
+ HEAP8[$33>>0] = $31;
+ $34 = (($$0171188) + 1)|0;
+ $35 = HEAP32[$9>>2]|0;
+ $36 = HEAP32[$11>>2]|0;
+ $37 = Math_imul($36, $35)|0;
+ $38 = ($34|0)<($37|0);
+ if ($38) {
+ $$0171188 = $34;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 2: {
+ $39 = ((($0)) + 4|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = ((($0)) + 8|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = $40 << 1;
+ $44 = Math_imul($43, $42)|0;
+ $45 = (_malloc($44)|0);
+ HEAP32[$0>>2] = $45;
+ $46 = HEAP32[$39>>2]|0;
+ $47 = $46 << 1;
+ $48 = Math_imul($47, $42)|0;
+ $49 = ($48|0)>(0);
+ if ($49) {
+ $$0170190 = 0;$$0172189 = 0;
+ while(1) {
+ $50 = (($7) + ($$0172189<<2)|0);
+ $51 = HEAP8[$50>>0]|0;
+ $52 = (+($51&255));
+ $53 = $52 * 0.29899999499320984;
+ $54 = (((($7) + ($$0172189<<2)|0)) + 1|0);
+ $55 = HEAP8[$54>>0]|0;
+ $56 = (+($55&255));
+ $57 = $56 * 0.58700001239776611;
+ $58 = $53 + $57;
+ $59 = (((($7) + ($$0172189<<2)|0)) + 2|0);
+ $60 = HEAP8[$59>>0]|0;
+ $61 = (+($60&255));
+ $62 = $61 * 0.11400000005960464;
+ $63 = $58 + $62;
+ $64 = (~~(($63))&255);
+ $65 = HEAP32[$0>>2]|0;
+ $66 = (($65) + ($$0170190)|0);
+ HEAP8[$66>>0] = $64;
+ $67 = (((($7) + ($$0172189<<2)|0)) + 3|0);
+ $68 = HEAP8[$67>>0]|0;
+ $69 = HEAP32[$0>>2]|0;
+ $70 = $$0170190 | 1;
+ $71 = (($69) + ($70)|0);
+ HEAP8[$71>>0] = $68;
+ $72 = (($$0172189) + 1)|0;
+ $73 = (($$0170190) + 2)|0;
+ $74 = HEAP32[$39>>2]|0;
+ $75 = HEAP32[$41>>2]|0;
+ $76 = $74 << 1;
+ $77 = Math_imul($76, $75)|0;
+ $78 = ($73|0)<($77|0);
+ if ($78) {
+ $$0170190 = $73;$$0172189 = $72;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 3: {
+ $79 = ((($0)) + 4|0);
+ $80 = HEAP32[$79>>2]|0;
+ $81 = ((($0)) + 8|0);
+ $82 = HEAP32[$81>>2]|0;
+ $83 = $80 << 1;
+ $84 = Math_imul($83, $82)|0;
+ $85 = (_malloc($84)|0);
+ HEAP32[$0>>2] = $85;
+ $86 = HEAP32[$79>>2]|0;
+ $87 = Math_imul($82, $86)|0;
+ $88 = ($87|0)>(0);
+ if ($88) {
+ $89 = HEAP8[$7>>0]|0;
+ $90 = (+($89&255));
+ $91 = $90 * 31.0;
+ $92 = $91 / 255.0;
+ $roundf179 = (+_roundf((+$92)));
+ $93 = (~~(($roundf179))&255);
+ $94 = ((($7)) + 1|0);
+ $95 = HEAP8[$94>>0]|0;
+ $96 = (+($95&255));
+ $97 = $96 * 63.0;
+ $98 = $97 / 255.0;
+ $roundf180 = (+_roundf((+$98)));
+ $99 = (~~(($roundf180))&255);
+ $100 = ((($7)) + 2|0);
+ $101 = HEAP8[$100>>0]|0;
+ $102 = (+($101&255));
+ $103 = $102 * 31.0;
+ $104 = $103 / 255.0;
+ $roundf181 = (+_roundf((+$104)));
+ $105 = (~~(($roundf181))&255);
+ $106 = $93&255;
+ $107 = $106 << 11;
+ $108 = $99&255;
+ $109 = $108 << 5;
+ $110 = $109 | $107;
+ $111 = $105&255;
+ $112 = $110 | $111;
+ $113 = $112&65535;
+ $114 = HEAP32[$0>>2]|0;
+ $115 = HEAP32[$79>>2]|0;
+ $116 = HEAP32[$81>>2]|0;
+ $117 = Math_imul($116, $115)|0;
+ $$0169192 = 0;
+ while(1) {
+ $118 = (($114) + ($$0169192<<1)|0);
+ HEAP16[$118>>1] = $113;
+ $119 = (($$0169192) + 1)|0;
+ $120 = ($119|0)<($117|0);
+ if ($120) {
+ $$0169192 = $119;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 4: {
+ $121 = ((($0)) + 4|0);
+ $122 = HEAP32[$121>>2]|0;
+ $123 = ((($0)) + 8|0);
+ $124 = HEAP32[$123>>2]|0;
+ $125 = ($122*3)|0;
+ $126 = Math_imul($125, $124)|0;
+ $127 = (_malloc($126)|0);
+ HEAP32[$0>>2] = $127;
+ $128 = HEAP32[$121>>2]|0;
+ $129 = ($128*3)|0;
+ $130 = Math_imul($129, $124)|0;
+ $131 = ($130|0)>(0);
+ if ($131) {
+ $$0168195 = 0;$$1194 = 0;
+ while(1) {
+ $132 = (($7) + ($$1194<<2)|0);
+ $133 = HEAP8[$132>>0]|0;
+ $134 = HEAP32[$0>>2]|0;
+ $135 = (($134) + ($$0168195)|0);
+ HEAP8[$135>>0] = $133;
+ $136 = (((($7) + ($$1194<<2)|0)) + 1|0);
+ $137 = HEAP8[$136>>0]|0;
+ $138 = HEAP32[$0>>2]|0;
+ $139 = (($$0168195) + 1)|0;
+ $140 = (($138) + ($139)|0);
+ HEAP8[$140>>0] = $137;
+ $141 = (((($7) + ($$1194<<2)|0)) + 2|0);
+ $142 = HEAP8[$141>>0]|0;
+ $143 = HEAP32[$0>>2]|0;
+ $144 = (($$0168195) + 2)|0;
+ $145 = (($143) + ($144)|0);
+ HEAP8[$145>>0] = $142;
+ $146 = (($$1194) + 1)|0;
+ $147 = (($$0168195) + 3)|0;
+ $148 = HEAP32[$121>>2]|0;
+ $149 = HEAP32[$123>>2]|0;
+ $150 = ($148*3)|0;
+ $151 = Math_imul($150, $149)|0;
+ $152 = ($147|0)<($151|0);
+ if ($152) {
+ $$0168195 = $147;$$1194 = $146;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 5: {
+ $153 = ((($0)) + 4|0);
+ $154 = HEAP32[$153>>2]|0;
+ $155 = ((($0)) + 8|0);
+ $156 = HEAP32[$155>>2]|0;
+ $157 = $154 << 1;
+ $158 = Math_imul($157, $156)|0;
+ $159 = (_malloc($158)|0);
+ HEAP32[$0>>2] = $159;
+ $160 = HEAP32[$153>>2]|0;
+ $161 = Math_imul($156, $160)|0;
+ $162 = ($161|0)>(0);
+ if ($162) {
+ $163 = HEAP32[$0>>2]|0;
+ $164 = HEAP32[$153>>2]|0;
+ $165 = HEAP32[$155>>2]|0;
+ $166 = Math_imul($165, $164)|0;
+ $$0167197 = 0;
+ while(1) {
+ $167 = (($7) + ($$0167197<<2)|0);
+ $168 = HEAP8[$167>>0]|0;
+ $169 = (+($168&255));
+ $170 = $169 * 31.0;
+ $171 = $170 / 255.0;
+ $roundf176 = (+_roundf((+$171)));
+ $172 = (~~(($roundf176))&255);
+ $173 = (((($7) + ($$0167197<<2)|0)) + 1|0);
+ $174 = HEAP8[$173>>0]|0;
+ $175 = (+($174&255));
+ $176 = $175 * 31.0;
+ $177 = $176 / 255.0;
+ $roundf177 = (+_roundf((+$177)));
+ $178 = (~~(($roundf177))&255);
+ $179 = (((($7) + ($$0167197<<2)|0)) + 2|0);
+ $180 = HEAP8[$179>>0]|0;
+ $181 = (+($180&255));
+ $182 = $181 * 31.0;
+ $183 = $182 / 255.0;
+ $roundf178 = (+_roundf((+$183)));
+ $184 = (~~(($roundf178))&255);
+ $185 = (((($7) + ($$0167197<<2)|0)) + 3|0);
+ $186 = HEAP8[$185>>0]|0;
+ $187 = ($186&255)>(50);
+ $188 = $172&255;
+ $189 = $188 << 11;
+ $190 = $178&255;
+ $191 = $190 << 6;
+ $192 = $191 | $189;
+ $193 = $184&255;
+ $194 = $193 << 1;
+ $195 = $192 | $194;
+ $196 = $187&1;
+ $197 = $195 | $196;
+ $198 = $197&65535;
+ $199 = (($163) + ($$0167197<<1)|0);
+ HEAP16[$199>>1] = $198;
+ $200 = (($$0167197) + 1)|0;
+ $201 = ($200|0)<($166|0);
+ if ($201) {
+ $$0167197 = $200;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 6: {
+ $202 = ((($0)) + 4|0);
+ $203 = HEAP32[$202>>2]|0;
+ $204 = ((($0)) + 8|0);
+ $205 = HEAP32[$204>>2]|0;
+ $206 = $203 << 1;
+ $207 = Math_imul($206, $205)|0;
+ $208 = (_malloc($207)|0);
+ HEAP32[$0>>2] = $208;
+ $209 = HEAP32[$202>>2]|0;
+ $210 = Math_imul($205, $209)|0;
+ $211 = ($210|0)>(0);
+ if ($211) {
+ $212 = HEAP32[$0>>2]|0;
+ $213 = HEAP32[$202>>2]|0;
+ $214 = HEAP32[$204>>2]|0;
+ $215 = Math_imul($214, $213)|0;
+ $$0166199 = 0;
+ while(1) {
+ $216 = (($7) + ($$0166199<<2)|0);
+ $217 = HEAP8[$216>>0]|0;
+ $218 = (+($217&255));
+ $219 = $218 * 15.0;
+ $220 = $219 / 255.0;
+ $roundf = (+_roundf((+$220)));
+ $221 = (~~(($roundf))&255);
+ $222 = (((($7) + ($$0166199<<2)|0)) + 1|0);
+ $223 = HEAP8[$222>>0]|0;
+ $224 = (+($223&255));
+ $225 = $224 * 15.0;
+ $226 = $225 / 255.0;
+ $roundf173 = (+_roundf((+$226)));
+ $227 = (~~(($roundf173))&255);
+ $228 = (((($7) + ($$0166199<<2)|0)) + 2|0);
+ $229 = HEAP8[$228>>0]|0;
+ $230 = (+($229&255));
+ $231 = $230 * 15.0;
+ $232 = $231 / 255.0;
+ $roundf174 = (+_roundf((+$232)));
+ $233 = (~~(($roundf174))&255);
+ $234 = (((($7) + ($$0166199<<2)|0)) + 3|0);
+ $235 = HEAP8[$234>>0]|0;
+ $236 = (+($235&255));
+ $237 = $236 * 15.0;
+ $238 = $237 / 255.0;
+ $roundf175 = (+_roundf((+$238)));
+ $239 = (~~(($roundf175))&255);
+ $240 = $221&255;
+ $241 = $240 << 12;
+ $242 = $227&255;
+ $243 = $242 << 8;
+ $244 = $243 | $241;
+ $245 = $233&255;
+ $246 = $245 << 4;
+ $247 = $244 | $246;
+ $248 = $239&255;
+ $249 = $247 | $248;
+ $250 = $249&65535;
+ $251 = (($212) + ($$0166199<<1)|0);
+ HEAP16[$251>>1] = $250;
+ $252 = (($$0166199) + 1)|0;
+ $253 = ($252|0)<($215|0);
+ if ($253) {
+ $$0166199 = $252;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 7: {
+ $254 = ((($0)) + 4|0);
+ $255 = HEAP32[$254>>2]|0;
+ $256 = ((($0)) + 8|0);
+ $257 = HEAP32[$256>>2]|0;
+ $258 = $255 << 2;
+ $259 = Math_imul($258, $257)|0;
+ $260 = (_malloc($259)|0);
+ HEAP32[$0>>2] = $260;
+ $261 = HEAP32[$254>>2]|0;
+ $262 = $261 << 2;
+ $263 = Math_imul($262, $257)|0;
+ $264 = ($263|0)>(0);
+ if ($264) {
+ $$0202 = 0;$$2201 = 0;
+ while(1) {
+ $265 = (($7) + ($$2201<<2)|0);
+ $266 = HEAP8[$265>>0]|0;
+ $267 = HEAP32[$0>>2]|0;
+ $268 = (($267) + ($$0202)|0);
+ HEAP8[$268>>0] = $266;
+ $269 = (((($7) + ($$2201<<2)|0)) + 1|0);
+ $270 = HEAP8[$269>>0]|0;
+ $271 = HEAP32[$0>>2]|0;
+ $272 = $$0202 | 1;
+ $273 = (($271) + ($272)|0);
+ HEAP8[$273>>0] = $270;
+ $274 = (((($7) + ($$2201<<2)|0)) + 2|0);
+ $275 = HEAP8[$274>>0]|0;
+ $276 = HEAP32[$0>>2]|0;
+ $277 = $$0202 | 2;
+ $278 = (($276) + ($277)|0);
+ HEAP8[$278>>0] = $275;
+ $279 = (((($7) + ($$2201<<2)|0)) + 3|0);
+ $280 = HEAP8[$279>>0]|0;
+ $281 = HEAP32[$0>>2]|0;
+ $282 = $$0202 | 3;
+ $283 = (($281) + ($282)|0);
+ HEAP8[$283>>0] = $280;
+ $284 = (($$2201) + 1)|0;
+ $285 = (($$0202) + 4)|0;
+ $286 = HEAP32[$254>>2]|0;
+ $287 = HEAP32[$256>>2]|0;
+ $288 = $286 << 2;
+ $289 = Math_imul($288, $287)|0;
+ $290 = ($285|0)<($289|0);
+ if ($290) {
+ $$0202 = $285;$$2201 = $284;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ _free($7);
+ STACKTOP = sp;return;
+}
+function _LoadTextureFromImage($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$sroa$10$0$$sroa_idx6 = 0, $$sroa$12$0$$sroa_idx8 = 0, $$sroa$6$0$$sroa_idx2 = 0, $$sroa$8$0$$sroa_idx4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0;
+ var $vararg_ptr4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer = sp;
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($1)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($1)) + 8|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($1)) + 16|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($1)) + 12|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (_rlglLoadTexture($2,$4,$6,$8,$10)|0);
+ $12 = HEAP32[$3>>2]|0;
+ $13 = HEAP32[$5>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $11;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $12;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $13;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $10;
+ $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
+ HEAP32[$vararg_ptr4>>2] = $8;
+ _TraceLog(3,5825,$vararg_buffer);
+ HEAP32[$0>>2] = $11;
+ $$sroa$6$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAP32[$$sroa$6$0$$sroa_idx2>>2] = $12;
+ $$sroa$8$0$$sroa_idx4 = ((($0)) + 8|0);
+ HEAP32[$$sroa$8$0$$sroa_idx4>>2] = $13;
+ $$sroa$10$0$$sroa_idx6 = ((($0)) + 12|0);
+ HEAP32[$$sroa$10$0$$sroa_idx6>>2] = $10;
+ $$sroa$12$0$$sroa_idx8 = ((($0)) + 16|0);
+ HEAP32[$$sroa$12$0$$sroa_idx8>>2] = $8;
+ STACKTOP = sp;return;
+}
+function _UnloadImage($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ _free($1);
+ return;
+}
+function _rlglLoadTexture($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0 = 0, $$off = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
+ var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond101 = 0, $or$cond7 = 0, $or$cond97 = 0, $or$cond99 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
+ var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
+ $vararg_buffer15 = sp + 64|0;
+ $vararg_buffer11 = sp + 48|0;
+ $vararg_buffer9 = sp + 40|0;
+ $vararg_buffer7 = sp + 32|0;
+ $vararg_buffer5 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $5 = sp + 68|0;
+ _glBindTexture(3553,0);
+ HEAP32[$5>>2] = 0;
+ $6 = HEAP32[5160]|0;
+ $7 = ($6|0)==(0);
+ $$off = (($3) + -9)|0;
+ $8 = ($$off>>>0)<(4);
+ $or$cond = $8 & $7;
+ if ($or$cond) {
+ _TraceLog(1,5875,$vararg_buffer);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $9 = HEAP32[5161]|0;
+ $10 = ($9|0)==(0);
+ $11 = ($3|0)==(13);
+ $or$cond7 = $11 & $10;
+ if ($or$cond7) {
+ _TraceLog(1,5919,$vararg_buffer1);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $12 = HEAP32[5162]|0;
+ $13 = ($12|0)==(0);
+ $14 = $3 | 1;
+ $15 = ($14|0)==(15);
+ $or$cond97 = $15 & $13;
+ if ($or$cond97) {
+ _TraceLog(1,5964,$vararg_buffer3);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $16 = HEAP32[5163]|0;
+ $17 = ($16|0)==(0);
+ $18 = ($14|0)==(17);
+ $or$cond99 = $18 & $17;
+ if ($or$cond99) {
+ _TraceLog(1,6009,$vararg_buffer5);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $19 = HEAP32[5164]|0;
+ $20 = ($19|0)==(0);
+ $21 = ($14|0)==(19);
+ $or$cond101 = $21 & $20;
+ if ($or$cond101) {
+ _TraceLog(1,6054,$vararg_buffer7);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ _glGenTextures(1,($5|0));
+ $22 = HEAP32[$5>>2]|0;
+ _glBindTexture(3553,($22|0));
+ do {
+ switch ($3|0) {
+ case 1: {
+ _glTexImage2D(3553,0,6409,($1|0),($2|0),0,6409,5121,($0|0));
+ break;
+ }
+ case 2: {
+ _glTexImage2D(3553,0,6410,($1|0),($2|0),0,6410,5121,($0|0));
+ break;
+ }
+ case 3: {
+ _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,33635,($0|0));
+ break;
+ }
+ case 4: {
+ _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,5121,($0|0));
+ break;
+ }
+ case 5: {
+ _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32820,($0|0));
+ break;
+ }
+ case 6: {
+ _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32819,($0|0));
+ break;
+ }
+ case 7: {
+ _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,5121,($0|0));
+ break;
+ }
+ case 8: {
+ $23 = HEAP32[5165]|0;
+ $24 = ($23|0)==(0);
+ if (!($24)) {
+ _glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,5126,($0|0));
+ }
+ break;
+ }
+ case 9: {
+ $25 = HEAP32[5160]|0;
+ $26 = ($25|0)==(0);
+ if (!($26)) {
+ _LoadCompressedTexture($0,$1,$2,$4,33776);
+ }
+ break;
+ }
+ case 10: {
+ $27 = HEAP32[5160]|0;
+ $28 = ($27|0)==(0);
+ if (!($28)) {
+ _LoadCompressedTexture($0,$1,$2,$4,33777);
+ }
+ break;
+ }
+ case 11: {
+ $29 = HEAP32[5160]|0;
+ $30 = ($29|0)==(0);
+ if (!($30)) {
+ _LoadCompressedTexture($0,$1,$2,$4,33778);
+ }
+ break;
+ }
+ case 12: {
+ $31 = HEAP32[5160]|0;
+ $32 = ($31|0)==(0);
+ if (!($32)) {
+ _LoadCompressedTexture($0,$1,$2,$4,33779);
+ }
+ break;
+ }
+ case 13: {
+ $33 = HEAP32[5161]|0;
+ $34 = ($33|0)==(0);
+ if (!($34)) {
+ _LoadCompressedTexture($0,$1,$2,$4,36196);
+ }
+ break;
+ }
+ case 14: {
+ $35 = HEAP32[5162]|0;
+ $36 = ($35|0)==(0);
+ if (!($36)) {
+ _LoadCompressedTexture($0,$1,$2,$4,37492);
+ }
+ break;
+ }
+ case 15: {
+ $37 = HEAP32[5162]|0;
+ $38 = ($37|0)==(0);
+ if (!($38)) {
+ _LoadCompressedTexture($0,$1,$2,$4,37496);
+ }
+ break;
+ }
+ case 16: {
+ $39 = HEAP32[5163]|0;
+ $40 = ($39|0)==(0);
+ if (!($40)) {
+ _LoadCompressedTexture($0,$1,$2,$4,35840);
+ }
+ break;
+ }
+ case 17: {
+ $41 = HEAP32[5163]|0;
+ $42 = ($41|0)==(0);
+ if (!($42)) {
+ _LoadCompressedTexture($0,$1,$2,$4,35842);
+ }
+ break;
+ }
+ case 18: {
+ $43 = HEAP32[5164]|0;
+ $44 = ($43|0)==(0);
+ if (!($44)) {
+ _LoadCompressedTexture($0,$1,$2,$4,37808);
+ }
+ break;
+ }
+ case 19: {
+ $45 = HEAP32[5164]|0;
+ $46 = ($45|0)==(0);
+ if (!($46)) {
+ _LoadCompressedTexture($0,$1,$2,$4,37815);
+ }
+ break;
+ }
+ default: {
+ _TraceLog(1,6099,$vararg_buffer9);
+ }
+ }
+ } while(0);
+ $47 = HEAP32[5166]|0;
+ $48 = ($47|0)==(0);
+ if ($48) {
+ _glTexParameteri(3553,10242,33071);
+ _glTexParameteri(3553,10243,33071);
+ } else {
+ _glTexParameteri(3553,10242,10497);
+ _glTexParameteri(3553,10243,10497);
+ }
+ _glTexParameteri(3553,10240,9728);
+ _glTexParameteri(3553,10241,9728);
+ _glBindTexture(3553,0);
+ $49 = HEAP32[$5>>2]|0;
+ $50 = ($49|0)==(0);
+ if ($50) {
+ _TraceLog(1,8347,$vararg_buffer15);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ HEAP32[$vararg_buffer11>>2] = $49;
+ $vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $1;
+ $vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
+ HEAP32[$vararg_ptr14>>2] = $2;
+ _TraceLog(0,6128,$vararg_buffer11);
+ $$0 = HEAP32[$5>>2]|0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ return (0)|0;
+}
+function _LoadCompressedTexture($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$ = 0, $$03645 = 0, $$03744 = 0, $$038 = 0, $$03943 = 0, $$046 = 0, $$140 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond42 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _glPixelStorei(3317,1);
+ switch ($4|0) {
+ case 33776: case 33777: case 36196: case 37492: {
+ $$038 = 8;
+ break;
+ }
+ default: {
+ $$038 = 16;
+ }
+ }
+ $5 = ($3|0)<(1);
+ $6 = $1 | $2;
+ $7 = ($6|0)==(0);
+ $or$cond42 = $5 | $7;
+ if ($or$cond42) {
+ return;
+ } else {
+ $$03645 = 0;$$03744 = 0;$$03943 = $2;$$046 = $1;
+ }
+ while(1) {
+ $8 = (($$046) + 3)|0;
+ $9 = (($8|0) / 4)&-1;
+ $10 = (($$03943) + 3)|0;
+ $11 = (($10|0) / 4)&-1;
+ $12 = Math_imul($11, $$038)|0;
+ $13 = Math_imul($12, $9)|0;
+ $14 = (($0) + ($$03744)|0);
+ _glCompressedTexImage2D(3553,($$03645|0),($4|0),($$046|0),($$03943|0),0,($13|0),($14|0));
+ $15 = (($13) + ($$03744))|0;
+ $16 = (($$046|0) / 2)&-1;
+ $17 = (($$03943|0) / 2)&-1;
+ $18 = ($$046|0)<(2);
+ $$ = $18 ? 1 : $16;
+ $19 = ($$03943|0)<(2);
+ $$140 = $19 ? 1 : $17;
+ $20 = (($$03645) + 1)|0;
+ $21 = ($20|0)>=($3|0);
+ $22 = $$ | $$140;
+ $23 = ($22|0)==(0);
+ $or$cond = $21 | $23;
+ if ($or$cond) {
+ break;
+ } else {
+ $$03645 = $20;$$03744 = $15;$$03943 = $$140;$$046 = $$;
+ }
+ }
+ return;
+}
+function _GetImageData($0) {
+ $0 = $0|0;
+ var $$0104105 = 0, $$0106 = 0, $$1 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
+ var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
+ var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
+ var $97 = 0.0, $98 = 0.0, $99 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = ((($0)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $2 << 2;
+ $6 = Math_imul($5, $4)|0;
+ $7 = (_malloc($6)|0);
+ $8 = HEAP32[$1>>2]|0;
+ $9 = Math_imul($4, $8)|0;
+ $10 = ($9|0)>(0);
+ if (!($10)) {
+ STACKTOP = sp;return ($7|0);
+ }
+ $11 = ((($0)) + 16|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = HEAP32[$0>>2]|0;
+ $$0104105 = 0;$$0106 = 0;
+ while(1) {
+ switch ($12|0) {
+ case 1: {
+ $14 = (($13) + ($$0106)|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$16>>0] = $15;
+ $17 = HEAP8[$14>>0]|0;
+ $18 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$18>>0] = $17;
+ $19 = HEAP8[$14>>0]|0;
+ $20 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$20>>0] = $19;
+ $21 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$21>>0] = -1;
+ $22 = (($$0106) + 1)|0;
+ $$1 = $22;
+ break;
+ }
+ case 2: {
+ $23 = (($13) + ($$0106)|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$25>>0] = $24;
+ $26 = HEAP8[$23>>0]|0;
+ $27 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$27>>0] = $26;
+ $28 = HEAP8[$23>>0]|0;
+ $29 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$29>>0] = $28;
+ $30 = (($$0106) + 1)|0;
+ $31 = (($13) + ($30)|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$33>>0] = $32;
+ $34 = (($$0106) + 2)|0;
+ $$1 = $34;
+ break;
+ }
+ case 5: {
+ $35 = (($13) + ($$0106<<1)|0);
+ $36 = HEAP16[$35>>1]|0;
+ $37 = $36&65535;
+ $38 = $37 >>> 11;
+ $39 = (+($38|0));
+ $40 = $39 * 8.0;
+ $41 = (~~(($40))&255);
+ $42 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$42>>0] = $41;
+ $43 = $37 >>> 6;
+ $44 = $43 & 31;
+ $45 = (+($44|0));
+ $46 = $45 * 8.0;
+ $47 = (~~(($46))&255);
+ $48 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$48>>0] = $47;
+ $49 = $37 >>> 1;
+ $50 = $49 & 31;
+ $51 = (+($50|0));
+ $52 = $51 * 8.0;
+ $53 = (~~(($52))&255);
+ $54 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$54>>0] = $53;
+ $55 = $37 & 1;
+ $56 = (0 - ($55))|0;
+ $57 = $56&255;
+ $58 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$58>>0] = $57;
+ $59 = (($$0106) + 1)|0;
+ $$1 = $59;
+ break;
+ }
+ case 3: {
+ $60 = (($13) + ($$0106<<1)|0);
+ $61 = HEAP16[$60>>1]|0;
+ $62 = $61&65535;
+ $63 = $62 >>> 11;
+ $64 = (+($63|0));
+ $65 = $64 * 8.0;
+ $66 = (~~(($65))&255);
+ $67 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$67>>0] = $66;
+ $68 = $62 >>> 5;
+ $69 = $68 & 63;
+ $70 = (+($69|0));
+ $71 = $70 * 4.0;
+ $72 = (~~(($71))&255);
+ $73 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$73>>0] = $72;
+ $74 = $62 & 31;
+ $75 = (+($74|0));
+ $76 = $75 * 8.0;
+ $77 = (~~(($76))&255);
+ $78 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$78>>0] = $77;
+ $79 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$79>>0] = -1;
+ $80 = (($$0106) + 1)|0;
+ $$1 = $80;
+ break;
+ }
+ case 6: {
+ $81 = (($13) + ($$0106<<1)|0);
+ $82 = HEAP16[$81>>1]|0;
+ $83 = $82&65535;
+ $84 = $83 >>> 12;
+ $85 = (+($84|0));
+ $86 = $85 * 17.0;
+ $87 = (~~(($86))&255);
+ $88 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$88>>0] = $87;
+ $89 = $83 >>> 8;
+ $90 = $89 & 15;
+ $91 = (+($90|0));
+ $92 = $91 * 17.0;
+ $93 = (~~(($92))&255);
+ $94 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$94>>0] = $93;
+ $95 = $83 >>> 4;
+ $96 = $95 & 15;
+ $97 = (+($96|0));
+ $98 = $97 * 17.0;
+ $99 = (~~(($98))&255);
+ $100 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$100>>0] = $99;
+ $101 = $83 & 15;
+ $102 = (+($101|0));
+ $103 = $102 * 17.0;
+ $104 = (~~(($103))&255);
+ $105 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$105>>0] = $104;
+ $106 = (($$0106) + 1)|0;
+ $$1 = $106;
+ break;
+ }
+ case 7: {
+ $107 = (($13) + ($$0106)|0);
+ $108 = HEAP8[$107>>0]|0;
+ $109 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$109>>0] = $108;
+ $110 = (($$0106) + 1)|0;
+ $111 = (($13) + ($110)|0);
+ $112 = HEAP8[$111>>0]|0;
+ $113 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$113>>0] = $112;
+ $114 = (($$0106) + 2)|0;
+ $115 = (($13) + ($114)|0);
+ $116 = HEAP8[$115>>0]|0;
+ $117 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$117>>0] = $116;
+ $118 = (($$0106) + 3)|0;
+ $119 = (($13) + ($118)|0);
+ $120 = HEAP8[$119>>0]|0;
+ $121 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$121>>0] = $120;
+ $122 = (($$0106) + 4)|0;
+ $$1 = $122;
+ break;
+ }
+ case 4: {
+ $123 = (($13) + ($$0106)|0);
+ $124 = HEAP8[$123>>0]|0;
+ $125 = (($7) + ($$0104105<<2)|0);
+ HEAP8[$125>>0] = $124;
+ $126 = (($$0106) + 1)|0;
+ $127 = (($13) + ($126)|0);
+ $128 = HEAP8[$127>>0]|0;
+ $129 = (((($7) + ($$0104105<<2)|0)) + 1|0);
+ HEAP8[$129>>0] = $128;
+ $130 = (($$0106) + 2)|0;
+ $131 = (($13) + ($130)|0);
+ $132 = HEAP8[$131>>0]|0;
+ $133 = (((($7) + ($$0104105<<2)|0)) + 2|0);
+ HEAP8[$133>>0] = $132;
+ $134 = (((($7) + ($$0104105<<2)|0)) + 3|0);
+ HEAP8[$134>>0] = -1;
+ $135 = (($$0106) + 3)|0;
+ $$1 = $135;
+ break;
+ }
+ default: {
+ _TraceLog(1,6231,$vararg_buffer);
+ $$1 = $$0106;
+ }
+ }
+ $136 = (($$0104105) + 1)|0;
+ $137 = HEAP32[$1>>2]|0;
+ $138 = HEAP32[$3>>2]|0;
+ $139 = Math_imul($138, $137)|0;
+ $140 = ($136|0)<($139|0);
+ if ($140) {
+ $$0104105 = $136;$$0106 = $$1;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return ($7|0);
+}
+function _UnloadDefaultFont() {
+ var $$byval_copy = 0, $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $$byval_copy = sp;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[20608>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[20608+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[20608+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[20608+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[20608+16>>2]|0;
+ _UnloadTexture($$byval_copy);
+ $0 = HEAP32[(20636)>>2]|0;
+ _free($0);
+ STACKTOP = sp;return;
+}
+function _UnloadTexture($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ _rlDeleteTextures($1);
+ $3 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $3;
+ _TraceLog(0,6277,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _rlDeleteTextures($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp;
+ HEAP32[$1>>2] = $0;
+ $2 = ($0|0)==(0);
+ if (!($2)) {
+ _glDeleteTextures(1,($1|0));
+ }
+ STACKTOP = sp;return;
+}
+function _GetDefaultFont($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ ;HEAP32[$0>>2]=HEAP32[20608>>2]|0;HEAP32[$0+4>>2]=HEAP32[20608+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[20608+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[20608+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[20608+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[20608+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[20608+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[20608+28>>2]|0;
+ return;
+}
+function _IsFileExtension($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$ = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_strrchr($0,46)|0);
+ $3 = ($2|0)==(0|0);
+ if ($3) {
+ return 0;
+ } else {
+ $4 = (_strcmp($2,$1)|0);
+ $5 = ($4|0)==(0);
+ $$ = $5&1;
+ return ($$|0);
+ }
+ return (0)|0;
+}
+function _LoadImagePro($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$byval_copy = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $$byval_copy = sp + 20|0;
+ $5 = sp;
+ HEAP32[$5>>2] = $1;
+ $6 = ((($5)) + 4|0);
+ HEAP32[$6>>2] = $2;
+ $7 = ((($5)) + 8|0);
+ HEAP32[$7>>2] = $3;
+ $8 = ((($5)) + 12|0);
+ HEAP32[$8>>2] = 1;
+ $9 = ((($5)) + 16|0);
+ HEAP32[$9>>2] = $4;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$5+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$5+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$5+16>>2]|0;
+ _ImageCopy($0,$$byval_copy);
+ STACKTOP = sp;return;
+}
+function _LoadImage($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
+ $$byval_copy = sp + 40|0;
+ $vararg_buffer12 = sp + 32|0;
+ $vararg_buffer7 = sp + 16|0;
+ $vararg_buffer4 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 72|0;
+ $3 = sp + 68|0;
+ $4 = sp + 64|0;
+ $5 = sp + 60|0;
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;
+ $6 = (_IsFileExtension($1,6327)|0);
+ $7 = ($6|0)==(0);
+ do {
+ if ($7) {
+ $19 = (_IsFileExtension($1,6380)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $30 = (_IsFileExtension($1,6388)|0);
+ $31 = ($30|0)==(0);
+ if ($31) {
+ HEAP32[$vararg_buffer4>>2] = $1;
+ _TraceLog(1,6460,$vararg_buffer4);
+ break;
+ }
+ HEAP32[$3>>2] = 0;
+ $32 = (_fopen($1,6385)|0);
+ _stbi_set_flip_vertically_on_load(1);
+ $33 = ((($2)) + 4|0);
+ $34 = ((($2)) + 8|0);
+ $35 = (_stbi_loadf_from_file($32,$33,$34,$3,0)|0);
+ HEAP32[$2>>2] = $35;
+ _stbi_set_flip_vertically_on_load(0);
+ (_fclose($32)|0);
+ $36 = ((($2)) + 12|0);
+ HEAP32[$36>>2] = 1;
+ $37 = HEAP32[$3>>2]|0;
+ $38 = ($37|0)==(3);
+ if ($38) {
+ $39 = ((($2)) + 16|0);
+ HEAP32[$39>>2] = 8;
+ } else {
+ HEAP32[$$byval_copy>>2] = $1;
+ _TraceLog(1,6393,$$byval_copy);
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$2+16>>2]|0;
+ _UnloadImage($$byval_copy);
+ }
+ break;
+ } else {
+ HEAP32[$3>>2] = 0;
+ HEAP32[$4>>2] = 0;
+ HEAP32[$5>>2] = 0;
+ $21 = (_fopen($1,6385)|0);
+ $22 = (_stbi_load_from_file($21,$3,$4,$5,0)|0);
+ HEAP32[$2>>2] = $22;
+ (_fclose($21)|0);
+ $23 = HEAP32[$3>>2]|0;
+ $24 = ((($2)) + 4|0);
+ HEAP32[$24>>2] = $23;
+ $25 = HEAP32[$4>>2]|0;
+ $26 = ((($2)) + 8|0);
+ HEAP32[$26>>2] = $25;
+ $27 = ((($2)) + 12|0);
+ HEAP32[$27>>2] = 1;
+ $28 = HEAP32[$5>>2]|0;
+ switch ($28|0) {
+ case 1: {
+ $$sink = 1;
+ label = 11;
+ break;
+ }
+ case 2: {
+ $$sink = 2;
+ label = 11;
+ break;
+ }
+ case 3: {
+ $$sink = 4;
+ label = 11;
+ break;
+ }
+ case 4: {
+ $$sink = 7;
+ label = 11;
+ break;
+ }
+ default: {
+ }
+ }
+ if ((label|0) == 11) {
+ $29 = ((($2)) + 16|0);
+ HEAP32[$29>>2] = $$sink;
+ }
+ break;
+ }
+ } else {
+ $8 = (_LoadResource($1,0)|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)==(1);
+ if ($10) {
+ $11 = ((($8)) + 20|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ((($8)) + 4|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ((($8)) + 8|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ((($8)) + 12|0);
+ $18 = HEAP32[$17>>2]|0;
+ _LoadImagePro($2,$12,$14,$16,$18);
+ } else {
+ HEAP32[$vararg_buffer>>2] = $1;
+ _TraceLog(1,6333,$vararg_buffer);
+ }
+ _UnloadResource($8);
+ }
+ } while(0);
+ $40 = HEAP32[$2>>2]|0;
+ $41 = ($40|0)==(0|0);
+ if ($41) {
+ HEAP32[$vararg_buffer12>>2] = $1;
+ _TraceLog(1,6535,$vararg_buffer12);
+ ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;
+ STACKTOP = sp;return;
+ } else {
+ $42 = ((($2)) + 4|0);
+ $43 = HEAP32[$42>>2]|0;
+ $44 = ((($2)) + 8|0);
+ $45 = HEAP32[$44>>2]|0;
+ HEAP32[$vararg_buffer7>>2] = $1;
+ $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
+ HEAP32[$vararg_ptr10>>2] = $43;
+ $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
+ HEAP32[$vararg_ptr11>>2] = $45;
+ _TraceLog(0,6496,$vararg_buffer7);
+ ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;
+ STACKTOP = sp;return;
+ }
+}
+function _stbi_load_from_file($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $10 = 0, $11 = 0, $12 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
+ $5 = sp;
+ _stbi__start_file($5,$0);
+ $6 = (_stbi__load_and_postprocess_8bit($5,$1,$2,$3,$4)|0);
+ $7 = ($6|0)==(0|0);
+ if ($7) {
+ STACKTOP = sp;return ($6|0);
+ }
+ $8 = ((($5)) + 172|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ((($5)) + 168|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = (($11) - ($9))|0;
+ (_fseek($0,$12,1)|0);
+ STACKTOP = sp;return ($6|0);
+}
+function _stbi_set_flip_vertically_on_load($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5170] = $0;
+ return;
+}
+function _stbi_loadf_from_file($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
+ $5 = sp;
+ _stbi__start_file($5,$0);
+ $6 = (_stbi__loadf_main($5,$1,$2,$3,$4)|0);
+ STACKTOP = sp;return ($6|0);
+}
+function _stbi__start_file($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _stbi__start_callbacks($0,3692,$1);
+ return;
+}
+function _stbi__loadf_main($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = (_stbi__hdr_test($0)|0);
+ $6 = ($5|0)==(0);
+ if (!($6)) {
+ $7 = (_stbi__hdr_load($0,$1,$2,$3,$4)|0);
+ $8 = ($7|0)==(0|0);
+ if ($8) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ _stbi__float_postprocess($7,$1,$2,$3,$4);
+ $$0 = $7;
+ return ($$0|0);
+ }
+ $9 = (_stbi__load_and_postprocess_8bit($0,$1,$2,$3,$4)|0);
+ $10 = ($9|0)==(0|0);
+ if ($10) {
+ _stbi__err(6566);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $11 = HEAP32[$1>>2]|0;
+ $12 = HEAP32[$2>>2]|0;
+ $13 = ($4|0)==(0);
+ if ($13) {
+ $14 = HEAP32[$3>>2]|0;
+ $15 = $14;
+ } else {
+ $15 = $4;
+ }
+ $16 = (_stbi__ldr_to_hdr($9,$11,$12,$15)|0);
+ $$0 = $16;
+ return ($$0|0);
+}
+function _stbi__hdr_test($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__hdr_test_core($0,8174)|0);
+ _stbi__rewind($0);
+ $2 = ($1|0)==(0);
+ if (!($2)) {
+ $$0 = $1;
+ return ($$0|0);
+ }
+ $3 = (_stbi__hdr_test_core($0,8186)|0);
+ _stbi__rewind($0);
+ $$0 = $3;
+ return ($$0|0);
+}
+function _stbi__hdr_load($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$ = 0, $$$0142 = 0, $$014033 = 0, $$014253 = 0, $$014344 = 0, $$014538 = 0, $$0146 = 0, $$0150 = 0, $$114131 = 0, $$1144 = 0, $$1147 = 0, $$1151 = 0, $$2148 = 0, $$2152$be = 0, $$215236 = 0, $$3 = 0, $$314943 = 0, $$315332 = 0, $$430 = 0, $$540 = 0;
+ var $$lcssa29 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $12 = 0, $13 = 0, $14 = 0;
+ var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
+ var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
+ var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
+ var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
+ var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond87 = 0, $exitcond88 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1040|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1040|0);
+ $5 = sp + 16|0;
+ $6 = sp;
+ $7 = sp + 4|0;
+ $8 = sp + 8|0;
+ $9 = (_stbi__hdr_gettoken($0,$5)|0);
+ $10 = (_strcmp($9,8034)|0);
+ $11 = ($10|0)==(0);
+ if (!($11)) {
+ $12 = (_strcmp($9,8045)|0);
+ $13 = ($12|0)==(0);
+ if (!($13)) {
+ _stbi__err(8052);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ }
+ $14 = (_stbi__hdr_gettoken($0,$5)|0);
+ HEAP32[$6>>2] = $14;
+ $15 = HEAP8[$14>>0]|0;
+ $16 = ($15<<24>>24)==(0);
+ if (!($16)) {
+ $$014253 = 0;$17 = $5;
+ while(1) {
+ $18 = (_strcmp($17,8060)|0);
+ $19 = ($18|0)==(0);
+ $$$0142 = $19 ? 1 : $$014253;
+ $20 = (_stbi__hdr_gettoken($0,$5)|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(0);
+ if ($22) {
+ break;
+ } else {
+ $$014253 = $$$0142;$17 = $5;
+ }
+ }
+ HEAP32[$6>>2] = $20;
+ $23 = ($$$0142|0)==(0);
+ if (!($23)) {
+ $24 = (_stbi__hdr_gettoken($0,$5)|0);
+ HEAP32[$6>>2] = $24;
+ $25 = (_strncmp($24,8102,3)|0);
+ $26 = ($25|0)==(0);
+ if (!($26)) {
+ _stbi__err(8106);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ $27 = ((($5)) + 3|0);
+ HEAP32[$6>>2] = $27;
+ $28 = (_strtol($27,$6,10)|0);
+ $29 = HEAP32[$6>>2]|0;
+ $30 = HEAP8[$29>>0]|0;
+ $31 = ($30<<24>>24)==(32);
+ if ($31) {
+ $33 = $29;
+ while(1) {
+ $32 = ((($33)) + 1|0);
+ $34 = HEAP8[$32>>0]|0;
+ $35 = ($34<<24>>24)==(32);
+ if ($35) {
+ $33 = $32;
+ } else {
+ break;
+ }
+ }
+ HEAP32[$6>>2] = $32;
+ $$lcssa29 = $32;
+ } else {
+ $$lcssa29 = $29;
+ }
+ $36 = (_strncmp($$lcssa29,8130,3)|0);
+ $37 = ($36|0)==(0);
+ if (!($37)) {
+ _stbi__err(8106);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ $38 = ((($$lcssa29)) + 3|0);
+ HEAP32[$6>>2] = $38;
+ $39 = (_strtol($38,0,10)|0);
+ HEAP32[$1>>2] = $39;
+ HEAP32[$2>>2] = $28;
+ $40 = ($3|0)==(0|0);
+ if (!($40)) {
+ HEAP32[$3>>2] = 3;
+ }
+ $41 = ($4|0)==(0);
+ $$ = $41 ? 3 : $4;
+ $42 = (_stbi__mad4sizes_valid($39,$28,$$)|0);
+ $43 = ($42|0)==(0);
+ if ($43) {
+ _stbi__err(6792);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ $44 = (_stbi__malloc_mad4($39,$28,$$)|0);
+ $45 = ($44|0)==(0|0);
+ if ($45) {
+ _stbi__err(6585);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ $$off = (($39) + -8)|0;
+ $46 = ($$off>>>0)>(32759);
+ do {
+ if ($46) {
+ $$0146 = 0;
+ label = 23;
+ } else {
+ $47 = ($28|0)>(0);
+ if ($47) {
+ $$014344 = 0;$$314943 = 0;
+ } else {
+ $$3 = $44;
+ STACKTOP = sp;return ($$3|0);
+ }
+ L39: while(1) {
+ $57 = (_stbi__get8($0)|0);
+ $58 = (_stbi__get8($0)|0);
+ $59 = (_stbi__get8($0)|0);
+ $60 = $59&255;
+ $notlhs = ($57<<24>>24)==(2);
+ $notrhs = ($58<<24>>24)==(2);
+ $or$cond3$not = $notlhs & $notrhs;
+ $61 = $60 & 128;
+ $62 = ($61|0)==(0);
+ $or$cond = $or$cond3$not & $62;
+ if (!($or$cond)) {
+ label = 28;
+ break;
+ }
+ $67 = $60 << 8;
+ $68 = (_stbi__get8($0)|0);
+ $69 = $68&255;
+ $70 = $69 | $67;
+ $71 = ($70|0)==($39|0);
+ if (!($71)) {
+ label = 30;
+ break;
+ }
+ $72 = ($$014344|0)==(0|0);
+ if ($72) {
+ $73 = (_stbi__malloc_mad2($39,4)|0);
+ $74 = ($73|0)==(0|0);
+ if ($74) {
+ label = 33;
+ break;
+ } else {
+ $$1144 = $73;
+ }
+ } else {
+ $$1144 = $$014344;
+ }
+ $$014538 = 0;
+ while(1) {
+ $$215236 = 0;$87 = $39;
+ while(1) {
+ $82 = (_stbi__get8($0)|0);
+ $79 = $82&255;
+ $83 = ($82&255)>(128);
+ do {
+ if ($83) {
+ $84 = (_stbi__get8($0)|0);
+ $85 = (($79) + 128)|0;
+ $77 = $85 & 255;
+ $86 = ($77|0)>($87|0);
+ if ($86) {
+ label = 43;
+ break L39;
+ }
+ $88 = ($77|0)==(0);
+ if ($88) {
+ $$2152$be = $$215236;
+ break;
+ } else {
+ $$014033 = 0;$$315332 = $$215236;
+ }
+ while(1) {
+ $89 = (($$315332) + 1)|0;
+ $90 = $$315332 << 2;
+ $91 = (($90) + ($$014538))|0;
+ $92 = (($$1144) + ($91)|0);
+ HEAP8[$92>>0] = $84;
+ $93 = (($$014033) + 1)|0;
+ $exitcond87 = ($93|0)==($77|0);
+ if ($exitcond87) {
+ break;
+ } else {
+ $$014033 = $93;$$315332 = $89;
+ }
+ }
+ $76 = (($$215236) + ($77))|0;
+ $$2152$be = $76;
+ } else {
+ $94 = ($79|0)>($87|0);
+ if ($94) {
+ label = 47;
+ break L39;
+ }
+ $95 = ($82<<24>>24)==(0);
+ if ($95) {
+ $$2152$be = $$215236;
+ break;
+ } else {
+ $$114131 = 0;$$430 = $$215236;
+ }
+ while(1) {
+ $96 = (_stbi__get8($0)|0);
+ $97 = (($$430) + 1)|0;
+ $98 = $$430 << 2;
+ $99 = (($98) + ($$014538))|0;
+ $100 = (($$1144) + ($99)|0);
+ HEAP8[$100>>0] = $96;
+ $101 = (($$114131) + 1)|0;
+ $exitcond = ($101|0)==($79|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$114131 = $101;$$430 = $97;
+ }
+ }
+ $78 = (($$215236) + ($79))|0;
+ $$2152$be = $78;
+ }
+ } while(0);
+ $80 = (($39) - ($$2152$be))|0;
+ $81 = ($80|0)>(0);
+ if ($81) {
+ $$215236 = $$2152$be;$87 = $80;
+ } else {
+ break;
+ }
+ }
+ $102 = (($$014538) + 1)|0;
+ $103 = ($102|0)<(4);
+ if ($103) {
+ $$014538 = $102;
+ } else {
+ break;
+ }
+ }
+ $75 = Math_imul($$314943, $39)|0;
+ $$540 = 0;
+ while(1) {
+ $104 = (($$540) + ($75))|0;
+ $105 = Math_imul($104, $$)|0;
+ $106 = (($44) + ($105<<2)|0);
+ $107 = $$540 << 2;
+ $108 = (($$1144) + ($107)|0);
+ _stbi__hdr_convert($106,$108,$$);
+ $109 = (($$540) + 1)|0;
+ $exitcond88 = ($109|0)==($39|0);
+ if ($exitcond88) {
+ break;
+ } else {
+ $$540 = $109;
+ }
+ }
+ $110 = (($$314943) + 1)|0;
+ $111 = ($110|0)<($28|0);
+ if ($111) {
+ $$014344 = $$1144;$$314943 = $110;
+ } else {
+ label = 52;
+ break;
+ }
+ }
+ if ((label|0) == 28) {
+ HEAP8[$8>>0] = $57;
+ $63 = ((($8)) + 1|0);
+ HEAP8[$63>>0] = $58;
+ $64 = ((($8)) + 2|0);
+ HEAP8[$64>>0] = $59;
+ $65 = (_stbi__get8($0)|0);
+ $66 = ((($8)) + 3|0);
+ HEAP8[$66>>0] = $65;
+ _stbi__hdr_convert($44,$8,$$);
+ _free($$014344);
+ $$1151 = 1;$$2148 = 0;
+ label = 25;
+ break;
+ }
+ else if ((label|0) == 30) {
+ _free($44);
+ _free($$014344);
+ _stbi__err(8134);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ else if ((label|0) == 33) {
+ _free($44);
+ _stbi__err(6585);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ else if ((label|0) == 43) {
+ _free($44);
+ _free($$1144);
+ _stbi__err(8166);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ else if ((label|0) == 47) {
+ _free($44);
+ _free($$1144);
+ _stbi__err(8166);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+ }
+ else if ((label|0) == 52) {
+ $112 = ($$1144|0)==(0|0);
+ if ($112) {
+ $$3 = $44;
+ STACKTOP = sp;return ($$3|0);
+ }
+ _free($$1144);
+ $$3 = $44;
+ STACKTOP = sp;return ($$3|0);
+ }
+ }
+ } while(0);
+ while(1) {
+ if ((label|0) == 23) {
+ label = 0;
+ $48 = ($$0146|0)<($28|0);
+ if ($48) {
+ $$0150 = 0;$$1147 = $$0146;
+ } else {
+ $$3 = $44;
+ break;
+ }
+ }
+ else if ((label|0) == 25) {
+ label = 0;
+ (_stbi__getn($0,$7,4)|0);
+ $50 = Math_imul($39, $$)|0;
+ $51 = Math_imul($50, $$2148)|0;
+ $52 = (($44) + ($51<<2)|0);
+ $53 = Math_imul($$1151, $$)|0;
+ $54 = (($52) + ($53<<2)|0);
+ _stbi__hdr_convert($54,$7,$$);
+ $55 = (($$1151) + 1)|0;
+ $$0150 = $55;$$1147 = $$2148;
+ }
+ $49 = ($$0150|0)<($39|0);
+ if ($49) {
+ $$1151 = $$0150;$$2148 = $$1147;
+ label = 25;
+ continue;
+ }
+ $56 = (($$1147) + 1)|0;
+ $$0146 = $56;
+ label = 23;
+ }
+ STACKTOP = sp;return ($$3|0);
+ }
+ }
+ _stbi__err(8083);
+ $$3 = 0;
+ STACKTOP = sp;return ($$3|0);
+}
+function _stbi__float_postprocess($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$05558 = 0, $$05659 = 0, $$061 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond64 = 0, $exitcond65 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = HEAP32[5170]|0;
+ $6 = ($5|0)!=(0);
+ $7 = ($0|0)!=(0|0);
+ $or$cond = $7 & $6;
+ if (!($or$cond)) {
+ return;
+ }
+ $8 = HEAP32[$1>>2]|0;
+ $9 = HEAP32[$2>>2]|0;
+ $10 = ($4|0)==(0);
+ if ($10) {
+ $11 = HEAP32[$3>>2]|0;
+ $16 = $11;
+ } else {
+ $16 = $4;
+ }
+ $12 = $9 >> 1;
+ $13 = ($12|0)>(0);
+ if (!($13)) {
+ return;
+ }
+ $14 = ($8|0)>(0);
+ $15 = ($16|0)>(0);
+ $17 = (($9) + -1)|0;
+ $$061 = 0;
+ while(1) {
+ if ($14) {
+ $18 = Math_imul($$061, $8)|0;
+ $19 = (($17) - ($$061))|0;
+ $20 = Math_imul($19, $8)|0;
+ $$05659 = 0;
+ while(1) {
+ if ($15) {
+ $21 = (($$05659) + ($18))|0;
+ $22 = Math_imul($21, $16)|0;
+ $23 = (($$05659) + ($20))|0;
+ $24 = Math_imul($23, $16)|0;
+ $$05558 = 0;
+ while(1) {
+ $25 = (($$05558) + ($22))|0;
+ $26 = (($0) + ($25<<2)|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (($$05558) + ($24))|0;
+ $29 = (($0) + ($28<<2)|0);
+ $30 = HEAP32[$29>>2]|0;
+ HEAP32[$26>>2] = $30;
+ HEAP32[$29>>2] = $27;
+ $31 = (($$05558) + 1)|0;
+ $exitcond = ($31|0)==($16|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$05558 = $31;
+ }
+ }
+ }
+ $32 = (($$05659) + 1)|0;
+ $exitcond64 = ($32|0)==($8|0);
+ if ($exitcond64) {
+ break;
+ } else {
+ $$05659 = $32;
+ }
+ }
+ }
+ $33 = (($$061) + 1)|0;
+ $exitcond65 = ($33|0)==($12|0);
+ if ($exitcond65) {
+ break;
+ } else {
+ $$061 = $33;
+ }
+ }
+ return;
+}
+function _stbi__load_and_postprocess_8bit($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0 = 0, $$070 = 0, $$07175 = 0, $$07276 = 0, $$07378 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond79 = 0, $exitcond80 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $5 = sp;
+ $6 = (_stbi__load_main($0,$1,$2,$3,$4,$5)|0);
+ $7 = ($6|0)==(0|0);
+ if ($7) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $8 = HEAP32[$5>>2]|0;
+ switch ($8|0) {
+ case 8: {
+ $$070 = $6;
+ break;
+ }
+ case 16: {
+ label = 4;
+ break;
+ }
+ default: {
+ ___assert_fail((6594|0),(6620|0),1041,(6643|0));
+ // unreachable;
+ }
+ }
+ if ((label|0) == 4) {
+ $9 = HEAP32[$1>>2]|0;
+ $10 = HEAP32[$2>>2]|0;
+ $11 = ($4|0)==(0);
+ if ($11) {
+ $12 = HEAP32[$3>>2]|0;
+ $13 = $12;
+ } else {
+ $13 = $4;
+ }
+ $14 = (_stbi__convert_16_to_8($6,$9,$10,$13)|0);
+ HEAP32[$5>>2] = 8;
+ $$070 = $14;
+ }
+ $15 = HEAP32[5170]|0;
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$0 = $$070;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $17 = HEAP32[$1>>2]|0;
+ $18 = HEAP32[$2>>2]|0;
+ $19 = ($4|0)==(0);
+ if ($19) {
+ $20 = HEAP32[$3>>2]|0;
+ $25 = $20;
+ } else {
+ $25 = $4;
+ }
+ $21 = $18 >> 1;
+ $22 = ($21|0)>(0);
+ if (!($22)) {
+ $$0 = $$070;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $23 = ($17|0)>(0);
+ $24 = ($25|0)>(0);
+ $26 = (($18) + -1)|0;
+ $$07378 = 0;
+ while(1) {
+ if ($23) {
+ $27 = Math_imul($$07378, $17)|0;
+ $28 = (($26) - ($$07378))|0;
+ $29 = Math_imul($28, $17)|0;
+ $$07276 = 0;
+ while(1) {
+ if ($24) {
+ $30 = (($$07276) + ($27))|0;
+ $31 = Math_imul($30, $25)|0;
+ $32 = (($$07276) + ($29))|0;
+ $33 = Math_imul($32, $25)|0;
+ $$07175 = 0;
+ while(1) {
+ $34 = (($$07175) + ($31))|0;
+ $35 = (($$070) + ($34)|0);
+ $36 = HEAP8[$35>>0]|0;
+ $37 = (($$07175) + ($33))|0;
+ $38 = (($$070) + ($37)|0);
+ $39 = HEAP8[$38>>0]|0;
+ HEAP8[$35>>0] = $39;
+ HEAP8[$38>>0] = $36;
+ $40 = (($$07175) + 1)|0;
+ $exitcond = ($40|0)==($25|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$07175 = $40;
+ }
+ }
+ }
+ $41 = (($$07276) + 1)|0;
+ $exitcond79 = ($41|0)==($17|0);
+ if ($exitcond79) {
+ break;
+ } else {
+ $$07276 = $41;
+ }
+ }
+ }
+ $42 = (($$07378) + 1)|0;
+ $exitcond80 = ($42|0)==($21|0);
+ if ($exitcond80) {
+ $$0 = $$070;
+ break;
+ } else {
+ $$07378 = $42;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__ldr_to_hdr($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$0 = 0, $$042 = 0, $$043$lcssa = 0, $$04345 = 0, $$04446 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond48 = 0, $sext = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = ($0|0)==(0|0);
+ if ($4) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = (_stbi__malloc_mad4($1,$2,$3)|0);
+ $6 = ($5|0)==(0|0);
+ if ($6) {
+ _free($0);
+ _stbi__err(6585);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $7 = $3 & 1;
+ $sext = (($3) + -1)|0;
+ $$042 = (($sext) + ($7))|0;
+ $8 = Math_imul($2, $1)|0;
+ $9 = ($8|0)>(0);
+ if ($9) {
+ $10 = ($$042|0)>(0);
+ $11 = +HEAPF32[765];
+ $12 = $11;
+ $13 = +HEAPF32[766];
+ $14 = $13;
+ $$04446 = 0;
+ while(1) {
+ if ($10) {
+ $15 = Math_imul($$04446, $3)|0;
+ $$04345 = 0;
+ while(1) {
+ $16 = (($$04345) + ($15))|0;
+ $17 = (($0) + ($16)|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = (+($18&255));
+ $20 = $19 / 255.0;
+ $21 = $20;
+ $22 = (+Math_pow((+$21),(+$12)));
+ $23 = $22 * $14;
+ $24 = $23;
+ $25 = (($5) + ($16<<2)|0);
+ HEAPF32[$25>>2] = $24;
+ $26 = (($$04345) + 1)|0;
+ $exitcond = ($26|0)==($$042|0);
+ if ($exitcond) {
+ $$043$lcssa = $$042;
+ break;
+ } else {
+ $$04345 = $26;
+ }
+ }
+ } else {
+ $$043$lcssa = 0;
+ }
+ $27 = ($$043$lcssa|0)<($3|0);
+ $28 = Math_imul($$04446, $3)|0;
+ $29 = (($$043$lcssa) + ($28))|0;
+ if ($27) {
+ $30 = (($5) + ($29<<2)|0);
+ $31 = (($0) + ($29)|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = (+($32&255));
+ $34 = $33 / 255.0;
+ HEAPF32[$30>>2] = $34;
+ }
+ $35 = (($$04446) + 1)|0;
+ $exitcond48 = ($35|0)==($8|0);
+ if ($exitcond48) {
+ break;
+ } else {
+ $$04446 = $35;
+ }
+ }
+ }
+ _free($0);
+ $$0 = $5;
+ return ($$0|0);
+}
+function _stbi__err($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5169] = $0;
+ return;
+}
+function _stbi__malloc_mad4($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_stbi__mad4sizes_valid($0,$1,$2)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = $0 << 2;
+ $6 = Math_imul($5, $1)|0;
+ $7 = Math_imul($6, $2)|0;
+ $8 = (_stbi__malloc($7)|0);
+ $$0 = $8;
+ return ($$0|0);
+}
+function _stbi__mad4sizes_valid($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_stbi__mul2sizes_valid($0,$1)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $15 = 0;
+ } else {
+ $5 = Math_imul($1, $0)|0;
+ $6 = (_stbi__mul2sizes_valid($5,$2)|0);
+ $7 = ($6|0)==(0);
+ if ($7) {
+ $15 = 0;
+ } else {
+ $8 = Math_imul($5, $2)|0;
+ $9 = (_stbi__mul2sizes_valid($8,4)|0);
+ $10 = ($9|0)==(0);
+ if ($10) {
+ $15 = 0;
+ } else {
+ $11 = $8 << 2;
+ $12 = (_stbi__addsizes_valid($11)|0);
+ $13 = ($12|0)!=(0);
+ $15 = $13;
+ }
+ }
+ }
+ $14 = $15&1;
+ return ($14|0);
+}
+function _stbi__malloc($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_malloc($0)|0);
+ return ($1|0);
+}
+function _stbi__mul2sizes_valid($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = $1 | $0;
+ $3 = ($2|0)<(0);
+ if ($3) {
+ $$0 = 0;
+ } else {
+ $4 = ($1|0)==(0);
+ if ($4) {
+ $$0 = 1;
+ } else {
+ $5 = (2147483647 / ($1|0))&-1;
+ $6 = ($5|0)>=($0|0);
+ $7 = $6&1;
+ $$0 = $7;
+ }
+ }
+ return ($$0|0);
+}
+function _stbi__addsizes_valid($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return 1;
+}
+function _stbi__load_main($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[$5>>2] = 8;
+ $6 = ((($5)) + 8|0);
+ HEAP32[$6>>2] = 0;
+ $7 = ((($5)) + 4|0);
+ HEAP32[$7>>2] = 0;
+ $8 = (_stbi__png_test($0)|0);
+ $9 = ($8|0)==(0);
+ if (!($9)) {
+ $10 = (_stbi__png_load($0,$1,$2,$3,$4,$5)|0);
+ $$0 = $10;
+ return ($$0|0);
+ }
+ $11 = (_stbi__hdr_test($0)|0);
+ $12 = ($11|0)==(0);
+ if ($12) {
+ _stbi__err(6566);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $13 = (_stbi__hdr_load($0,$1,$2,$3,$4)|0);
+ $14 = HEAP32[$1>>2]|0;
+ $15 = HEAP32[$2>>2]|0;
+ $16 = ($4|0)==(0);
+ if ($16) {
+ $17 = HEAP32[$3>>2]|0;
+ $18 = $17;
+ } else {
+ $18 = $4;
+ }
+ $19 = (_stbi__hdr_to_ldr($13,$14,$15,$18)|0);
+ $$0 = $19;
+ return ($$0|0);
+}
+function _stbi__convert_16_to_8($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$0 = 0, $$01819 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = Math_imul($2, $1)|0;
+ $5 = Math_imul($4, $3)|0;
+ $6 = (_stbi__malloc($5)|0);
+ $7 = ($6|0)==(0|0);
+ if ($7) {
+ _stbi__err(6585);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $8 = ($5|0)>(0);
+ if ($8) {
+ $$01819 = 0;
+ while(1) {
+ $9 = (($0) + ($$01819<<1)|0);
+ $10 = HEAP16[$9>>1]|0;
+ $11 = ($10&65535) >>> 8;
+ $12 = $11&255;
+ $13 = (($6) + ($$01819)|0);
+ HEAP8[$13>>0] = $12;
+ $14 = (($$01819) + 1)|0;
+ $exitcond = ($14|0)==($5|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$01819 = $14;
+ }
+ }
+ }
+ _free($0);
+ $$0 = $6;
+ return ($$0|0);
+}
+function _stbi__png_test($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__check_png_header($0)|0);
+ _stbi__rewind($0);
+ return ($1|0);
+}
+function _stbi__png_load($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $6 = sp;
+ HEAP32[$6>>2] = $0;
+ $7 = (_stbi__do_png($6,$1,$2,$3,$4,$5)|0);
+ STACKTOP = sp;return ($7|0);
+}
+function _stbi__hdr_to_ldr($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$0 = 0.0, $$052 = 0.0, $$054 = 0, $$055 = 0, $$056$lcssa = 0, $$05658 = 0, $$05759 = 0, $$1 = 0.0, $$153 = 0.0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0;
+ var $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
+ var $40 = 0, $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond61 = 0, $sext = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = ($0|0)==(0|0);
+ if ($4) {
+ $$054 = 0;
+ return ($$054|0);
+ }
+ $5 = (_stbi__malloc_mad3($1,$2,$3)|0);
+ $6 = ($5|0)==(0|0);
+ if ($6) {
+ _free($0);
+ _stbi__err(6585);
+ $$054 = 0;
+ return ($$054|0);
+ }
+ $7 = $3 & 1;
+ $sext = (($3) + -1)|0;
+ $$055 = (($sext) + ($7))|0;
+ $8 = Math_imul($2, $1)|0;
+ $9 = ($8|0)>(0);
+ if ($9) {
+ $10 = ($$055|0)>(0);
+ $11 = +HEAPF32[767];
+ $12 = +HEAPF32[768];
+ $13 = $12;
+ $$05759 = 0;
+ while(1) {
+ if ($10) {
+ $14 = Math_imul($$05759, $3)|0;
+ $$05658 = 0;
+ while(1) {
+ $15 = (($$05658) + ($14))|0;
+ $16 = (($0) + ($15<<2)|0);
+ $17 = +HEAPF32[$16>>2];
+ $18 = $17 * $11;
+ $19 = $18;
+ $20 = (+Math_pow((+$19),(+$13)));
+ $21 = $20;
+ $22 = $21 * 255.0;
+ $23 = $22 + 0.5;
+ $24 = $23 < 0.0;
+ $$052 = $24 ? 0.0 : $23;
+ $25 = $$052 > 255.0;
+ $$153 = $25 ? 255.0 : $$052;
+ $26 = (~~(($$153)));
+ $27 = $26&255;
+ $28 = (($5) + ($15)|0);
+ HEAP8[$28>>0] = $27;
+ $29 = (($$05658) + 1)|0;
+ $exitcond = ($29|0)==($$055|0);
+ if ($exitcond) {
+ $$056$lcssa = $$055;
+ break;
+ } else {
+ $$05658 = $29;
+ }
+ }
+ } else {
+ $$056$lcssa = 0;
+ }
+ $30 = ($$056$lcssa|0)<($3|0);
+ if ($30) {
+ $31 = Math_imul($$05759, $3)|0;
+ $32 = (($$056$lcssa) + ($31))|0;
+ $33 = (($0) + ($32<<2)|0);
+ $34 = +HEAPF32[$33>>2];
+ $35 = $34 * 255.0;
+ $36 = $35 + 0.5;
+ $37 = $36 < 0.0;
+ $$0 = $37 ? 0.0 : $36;
+ $38 = $$0 > 255.0;
+ $$1 = $38 ? 255.0 : $$0;
+ $39 = (~~(($$1)));
+ $40 = $39&255;
+ $41 = (($5) + ($32)|0);
+ HEAP8[$41>>0] = $40;
+ }
+ $42 = (($$05759) + 1)|0;
+ $exitcond61 = ($42|0)==($8|0);
+ if ($exitcond61) {
+ break;
+ } else {
+ $$05759 = $42;
+ }
+ }
+ }
+ _free($0);
+ $$054 = $5;
+ return ($$054|0);
+}
+function _stbi__malloc_mad3($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_stbi__mad3sizes_valid($0,$1,$2)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = Math_imul($1, $0)|0;
+ $6 = Math_imul($5, $2)|0;
+ $7 = (_stbi__malloc($6)|0);
+ $$0 = $7;
+ return ($$0|0);
+}
+function _stbi__mad3sizes_valid($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_stbi__mul2sizes_valid($0,$1)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $12 = 0;
+ } else {
+ $5 = Math_imul($1, $0)|0;
+ $6 = (_stbi__mul2sizes_valid($5,$2)|0);
+ $7 = ($6|0)==(0);
+ if ($7) {
+ $12 = 0;
+ } else {
+ $8 = Math_imul($5, $2)|0;
+ $9 = (_stbi__addsizes_valid($8)|0);
+ $10 = ($9|0)!=(0);
+ $12 = $10;
+ }
+ }
+ $11 = $12&1;
+ return ($11|0);
+}
+function _stbi__do_png($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$ = 0, $$0 = 0, $$045 = 0, $$1 = 0, $$2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $6 = ($4>>>0)>(4);
+ if ($6) {
+ _stbi__err(6675);
+ $$045 = 0;
+ return ($$045|0);
+ }
+ $7 = (_stbi__parse_png_file($0,0,$4)|0);
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$2 = 0;
+ } else {
+ $9 = ((($0)) + 16|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($10|0)>(8);
+ $$ = $11 ? $10 : 8;
+ HEAP32[$5>>2] = $$;
+ $12 = ((($0)) + 12|0);
+ $13 = HEAP32[$12>>2]|0;
+ HEAP32[$12>>2] = 0;
+ $14 = ($4|0)==(0);
+ if ($14) {
+ $$1 = $13;
+ } else {
+ $15 = HEAP32[$0>>2]|0;
+ $16 = ((($15)) + 12|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ($17|0)==($4|0);
+ if ($18) {
+ $$1 = $13;
+ } else {
+ $19 = HEAP32[$5>>2]|0;
+ $20 = ($19|0)==(8);
+ $21 = ((($15)) + 4|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = HEAP32[$15>>2]|0;
+ if ($20) {
+ $24 = (_stbi__convert_format($13,$17,$4,$23,$22)|0);
+ $$0 = $24;
+ } else {
+ $25 = (_stbi__convert_format16($13,$17,$4,$23,$22)|0);
+ $$0 = $25;
+ }
+ $26 = HEAP32[$0>>2]|0;
+ $27 = ((($26)) + 12|0);
+ HEAP32[$27>>2] = $4;
+ $28 = ($$0|0)==(0|0);
+ if ($28) {
+ $$045 = 0;
+ return ($$045|0);
+ } else {
+ $$1 = $$0;
+ }
+ }
+ }
+ $29 = HEAP32[$0>>2]|0;
+ $30 = HEAP32[$29>>2]|0;
+ HEAP32[$1>>2] = $30;
+ $31 = ((($29)) + 4|0);
+ $32 = HEAP32[$31>>2]|0;
+ HEAP32[$2>>2] = $32;
+ $33 = ($3|0)==(0|0);
+ if ($33) {
+ $$2 = $$1;
+ } else {
+ $34 = ((($29)) + 8|0);
+ $35 = HEAP32[$34>>2]|0;
+ HEAP32[$3>>2] = $35;
+ $$2 = $$1;
+ }
+ }
+ $36 = ((($0)) + 12|0);
+ $37 = HEAP32[$36>>2]|0;
+ _free($37);
+ HEAP32[$36>>2] = 0;
+ $38 = ((($0)) + 8|0);
+ $39 = HEAP32[$38>>2]|0;
+ _free($39);
+ HEAP32[$38>>2] = 0;
+ $40 = ((($0)) + 4|0);
+ $41 = HEAP32[$40>>2]|0;
+ _free($41);
+ HEAP32[$40>>2] = 0;
+ $$045 = $$2;
+ return ($$045|0);
+}
+function _stbi__parse_png_file($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$$0217 = 0, $$0206 = 0, $$0211 = 0, $$0214 = 0, $$0217 = 0, $$0226593 = 0, $$0228 = 0, $$0231 = 0, $$0235 = 0, $$0239591 = 0, $$0241 = 0, $$0245 = 0, $$1207 = 0, $$1212 = 0, $$1215 = 0, $$1218 = 0, $$1227588 = 0, $$1229 = 0, $$1240589 = 0;
+ var $$1246 = 0, $$2219 = 0, $$2233 = 0, $$2237 = 0, $$2243 = 0, $$254 = 0, $$3209 = 0, $$3220 = 0, $$4 = 0, $$6$ph = 0, $$7 = 0, $$lobit = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0;
+ var $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0;
+ var $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0;
+ var $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0;
+ var $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0;
+ var $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0;
+ var $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
+ var $97 = 0, $98 = 0, $99 = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond11 = 0, $or$cond248 = 0, $or$cond5$not = 0, $or$cond7 = 0, $switch$split112D = 0, $switch$split142D = 0, $switch$split2D = 0, $switch$split52D = 0, $switch$split82D = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
+ $3 = sp + 32|0;
+ $4 = sp + 22|0;
+ $5 = sp + 16|0;
+ $6 = sp + 8|0;
+ $7 = sp;
+ $8 = HEAP32[$0>>2]|0;
+ $9 = ((($0)) + 8|0);
+ HEAP32[$9>>2] = 0;
+ $10 = ((($0)) + 4|0);
+ HEAP32[$10>>2] = 0;
+ $11 = ((($0)) + 12|0);
+ HEAP32[$11>>2] = 0;
+ $12 = (_stbi__check_png_header($8)|0);
+ $13 = ($12|0)==(0);
+ if ($13) {
+ $$7 = 0;
+ STACKTOP = sp;return ($$7|0);
+ }
+ $14 = ($1|0)==(1);
+ if ($14) {
+ $$7 = 1;
+ STACKTOP = sp;return ($$7|0);
+ }
+ $15 = ((($6)) + 4|0);
+ $16 = ((($8)) + 4|0);
+ $17 = ((($0)) + 16|0);
+ $18 = ((($8)) + 8|0);
+ $19 = ($1|0)==(2);
+ $20 = ((($8)) + 8|0);
+ $21 = ((($8)) + 8|0);
+ $22 = ((($0)) + 16|0);
+ $23 = ($1|0)==(2);
+ $24 = ($1|0)==(2);
+ $$0206 = 0;$$0211 = 0;$$0214 = 0;$$0217 = 0;$$0228 = 0;$$0231 = 0;$$0235 = 0;$$0241 = 1;$$0245 = 0;
+ L7: while(1) {
+ _stbi__get_chunk_header($6,$8);
+ $25 = HEAP32[$15>>2]|0;
+ $switch$split2D = ($25|0)<(1229472850);
+ L9: do {
+ if ($switch$split2D) {
+ $switch$split52D = ($25|0)<(1229209940);
+ if ($switch$split52D) {
+ switch ($25|0) {
+ case 1130840649: {
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ $26 = HEAP32[$6>>2]|0;
+ _stbi__skip($8,$26);
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = 1;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
+ break;
+ }
+ $switch$split112D = ($25|0)<(1229278788);
+ if (!($switch$split112D)) {
+ switch ($25|0) {
+ case 1229278788: {
+ label = 85;
+ break L7;
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ }
+ switch ($25|0) {
+ case 1229209940: {
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ $130 = ($$0241|0)==(0);
+ if (!($130)) {
+ label = 70;
+ break L7;
+ }
+ $131 = ($$0206<<24>>24)==(0);
+ $132 = ($$0245|0)!=(0);
+ $or$cond = $132 | $131;
+ if (!($or$cond)) {
+ label = 72;
+ break L7;
+ }
+ if ($24) {
+ label = 74;
+ break L7;
+ }
+ $135 = HEAP32[$6>>2]|0;
+ $136 = (($135) + ($$0214))|0;
+ $137 = ($136|0)<($$0214|0);
+ if ($137) {
+ $$6$ph = 0;
+ break L7;
+ }
+ $138 = ($136>>>0)>($$0217>>>0);
+ if ($138) {
+ $139 = ($$0217|0)==(0);
+ $140 = ($135>>>0)>(4096);
+ $141 = $140 ? $135 : 4096;
+ $$$0217 = $139 ? $141 : $$0217;
+ $142 = HEAP32[$6>>2]|0;
+ $143 = (($142) + ($$0214))|0;
+ $$1218 = $$$0217;
+ while(1) {
+ $144 = ($143>>>0)>($$1218>>>0);
+ $145 = $$1218 << 1;
+ if ($144) {
+ $$1218 = $145;
+ } else {
+ break;
+ }
+ }
+ $146 = HEAP32[$10>>2]|0;
+ $147 = (_realloc($146,$$1218)|0);
+ $148 = ($147|0)==(0|0);
+ if ($148) {
+ label = 81;
+ break L7;
+ }
+ HEAP32[$10>>2] = $147;
+ $$2219 = $$1218;
+ } else {
+ $$2219 = $$0217;
+ }
+ $149 = HEAP32[$10>>2]|0;
+ $150 = (($149) + ($$0214)|0);
+ $151 = HEAP32[$6>>2]|0;
+ $152 = (_stbi__getn($8,$150,$151)|0);
+ $153 = ($152|0)==(0);
+ if ($153) {
+ label = 83;
+ break L7;
+ }
+ $154 = HEAP32[$6>>2]|0;
+ $155 = (($154) + ($$0214))|0;
+ $$1212 = $$0211;$$1215 = $155;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$2219;
+ } else {
+ $switch$split82D = ($25|0)<(1347179589);
+ if ($switch$split82D) {
+ switch ($25|0) {
+ case 1229472850: {
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ $27 = ($$0241|0)==(0);
+ if ($27) {
+ label = 7;
+ break L7;
+ }
+ $28 = HEAP32[$6>>2]|0;
+ $29 = ($28|0)==(13);
+ if (!($29)) {
+ label = 9;
+ break L7;
+ }
+ $30 = (_stbi__get32be($8)|0);
+ HEAP32[$8>>2] = $30;
+ $31 = ($30>>>0)>(16777216);
+ if ($31) {
+ label = 11;
+ break L7;
+ }
+ $32 = (_stbi__get32be($8)|0);
+ HEAP32[$16>>2] = $32;
+ $33 = ($32>>>0)>(16777216);
+ if ($33) {
+ label = 13;
+ break L7;
+ }
+ $34 = (_stbi__get8($8)|0);
+ $35 = $34&255;
+ HEAP32[$17>>2] = $35;
+ switch ($34<<24>>24) {
+ case 16: case 8: case 4: case 2: case 1: {
+ break;
+ }
+ default: {
+ label = 15;
+ break L7;
+ }
+ }
+ $36 = (_stbi__get8($8)|0);
+ $37 = $36&255;
+ $38 = ($36&255)>(6);
+ if ($38) {
+ label = 17;
+ break L7;
+ }
+ $39 = ($36<<24>>24)==(3);
+ if ($39) {
+ $40 = HEAP32[$17>>2]|0;
+ $41 = ($40|0)==(16);
+ if ($41) {
+ label = 20;
+ break L7;
+ } else {
+ $$1207 = 3;
+ }
+ } else {
+ $42 = $37 & 1;
+ $43 = ($42|0)==(0);
+ if ($43) {
+ $$1207 = $$0206;
+ } else {
+ label = 22;
+ break L7;
+ }
+ }
+ $44 = (_stbi__get8($8)|0);
+ $45 = ($44<<24>>24)==(0);
+ if (!($45)) {
+ label = 24;
+ break L7;
+ }
+ $46 = (_stbi__get8($8)|0);
+ $47 = ($46<<24>>24)==(0);
+ if (!($47)) {
+ label = 26;
+ break L7;
+ }
+ $48 = (_stbi__get8($8)|0);
+ $49 = $48&255;
+ $50 = ($48&255)>(1);
+ if ($50) {
+ label = 28;
+ break L7;
+ }
+ $51 = HEAP32[$8>>2]|0;
+ $52 = ($51|0)==(0);
+ if ($52) {
+ label = 31;
+ break L7;
+ }
+ $53 = HEAP32[$16>>2]|0;
+ $54 = ($53|0)==(0);
+ if ($54) {
+ label = 31;
+ break L7;
+ }
+ $55 = ($$1207<<24>>24)==(0);
+ $56 = (1073741824 / ($51>>>0))&-1;
+ if (!($55)) {
+ HEAP32[$20>>2] = 1;
+ $63 = $56 >>> 2;
+ $64 = ($63>>>0)<($53>>>0);
+ if ($64) {
+ label = 37;
+ break L7;
+ } else {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = $$1207;$$3220 = $$0217;
+ break;
+ }
+ }
+ $57 = $37 & 2;
+ $58 = $57 | 1;
+ $59 = $37 >>> 2;
+ $$lobit = $59 & 1;
+ $60 = (($58) + ($$lobit))|0;
+ HEAP32[$18>>2] = $60;
+ $61 = (($56>>>0) / ($60>>>0))&-1;
+ $62 = ($61>>>0)<($53>>>0);
+ if ($62) {
+ label = 34;
+ break L7;
+ }
+ if ($19) {
+ $$6$ph = 1;
+ break L7;
+ } else {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $37;$$2237 = $49;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
+ break;
+ }
+ }
+ $switch$split142D = ($25|0)<(1951551059);
+ if ($switch$split142D) {
+ switch ($25|0) {
+ case 1347179589: {
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ $65 = ($$0241|0)==(0);
+ if (!($65)) {
+ label = 39;
+ break L7;
+ }
+ $66 = HEAP32[$6>>2]|0;
+ $67 = ($66>>>0)>(768);
+ if ($67) {
+ label = 41;
+ break L7;
+ }
+ $68 = (($66>>>0) / 3)&-1;
+ $69 = ($68*3)|0;
+ $70 = ($69|0)==($66|0);
+ if (!($70)) {
+ label = 44;
+ break L7;
+ }
+ $71 = ($66>>>0)>(2);
+ if ($71) {
+ $$0226593 = 0;
+ } else {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
+ break;
+ }
+ while(1) {
+ $72 = (_stbi__get8($8)|0);
+ $73 = $$0226593 << 2;
+ $74 = (($3) + ($73)|0);
+ HEAP8[$74>>0] = $72;
+ $75 = (_stbi__get8($8)|0);
+ $76 = $73 | 1;
+ $77 = (($3) + ($76)|0);
+ HEAP8[$77>>0] = $75;
+ $78 = (_stbi__get8($8)|0);
+ $79 = $73 | 2;
+ $80 = (($3) + ($79)|0);
+ HEAP8[$80>>0] = $78;
+ $81 = $73 | 3;
+ $82 = (($3) + ($81)|0);
+ HEAP8[$82>>0] = -1;
+ $83 = (($$0226593) + 1)|0;
+ $84 = ($83>>>0)<($68>>>0);
+ if ($84) {
+ $$0226593 = $83;
+ } else {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $68;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
+ break L9;
+ }
+ }
+ }
+ switch ($25|0) {
+ case 1951551059: {
+ break;
+ }
+ default: {
+ label = 103;
+ break L9;
+ }
+ }
+ $85 = ($$0241|0)==(0);
+ if (!($85)) {
+ label = 47;
+ break L7;
+ }
+ $86 = HEAP32[$10>>2]|0;
+ $87 = ($86|0)==(0|0);
+ if (!($87)) {
+ label = 49;
+ break L7;
+ }
+ $88 = ($$0206<<24>>24)==(0);
+ if (!($88)) {
+ if ($23) {
+ label = 52;
+ break L7;
+ }
+ $90 = ($$0245|0)==(0);
+ if ($90) {
+ label = 54;
+ break L7;
+ }
+ $91 = HEAP32[$6>>2]|0;
+ $92 = ($91>>>0)>($$0245>>>0);
+ if ($92) {
+ label = 58;
+ break L7;
+ }
+ $93 = HEAP32[$6>>2]|0;
+ $94 = ($93|0)==(0);
+ if ($94) {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 4;$$3220 = $$0217;
+ break;
+ }
+ $95 = HEAP32[$6>>2]|0;
+ $$1227588 = 0;
+ while(1) {
+ $96 = (_stbi__get8($8)|0);
+ $97 = $$1227588 << 2;
+ $98 = $97 | 3;
+ $99 = (($3) + ($98)|0);
+ HEAP8[$99>>0] = $96;
+ $100 = (($$1227588) + 1)|0;
+ $101 = ($100>>>0)<($95>>>0);
+ if ($101) {
+ $$1227588 = $100;
+ } else {
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = 4;$$3220 = $$0217;
+ break L9;
+ }
+ }
+ }
+ $102 = HEAP32[$21>>2]|0;
+ $103 = $102 & 1;
+ $104 = ($103|0)==(0);
+ if ($104) {
+ label = 61;
+ break L7;
+ }
+ $105 = HEAP32[$6>>2]|0;
+ $106 = $102 << 1;
+ $107 = ($105|0)==($106|0);
+ if (!($107)) {
+ label = 63;
+ break L7;
+ }
+ $108 = HEAP32[$22>>2]|0;
+ $109 = ($108|0)==(16);
+ $110 = HEAP32[$21>>2]|0;
+ $111 = ($110|0)>(0);
+ if ($109) {
+ if ($111) {
+ $$0239591 = 0;
+ } else {
+ $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
+ break;
+ }
+ while(1) {
+ $112 = (_stbi__get16be($8)|0);
+ $113 = $112&65535;
+ $114 = (($5) + ($$0239591<<1)|0);
+ HEAP16[$114>>1] = $113;
+ $115 = (($$0239591) + 1)|0;
+ $116 = HEAP32[$21>>2]|0;
+ $117 = ($115|0)<($116|0);
+ if ($117) {
+ $$0239591 = $115;
+ } else {
+ $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
+ break;
+ }
+ }
+ } else {
+ if ($111) {
+ $$1240589 = 0;
+ } else {
+ $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = 0;$$3220 = $$0217;
+ break;
+ }
+ while(1) {
+ $118 = (_stbi__get16be($8)|0);
+ $119 = $118 & 255;
+ $120 = HEAP32[$22>>2]|0;
+ $121 = (6991 + ($120)|0);
+ $122 = HEAP8[$121>>0]|0;
+ $123 = $122&255;
+ $124 = Math_imul($123, $119)|0;
+ $125 = $124&255;
+ $126 = (($4) + ($$1240589)|0);
+ HEAP8[$126>>0] = $125;
+ $127 = (($$1240589) + 1)|0;
+ $128 = HEAP32[$21>>2]|0;
+ $129 = ($127|0)<($128|0);
+ if ($129) {
+ $$1240589 = $127;
+ } else {
+ $$1212 = 1;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = $$0241;$$3209 = $$0206;$$3220 = $$0217;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 103) {
+ label = 0;
+ $202 = ($$0241|0)==(0);
+ if (!($202)) {
+ label = 104;
+ break;
+ }
+ $203 = $25 & 536870912;
+ $204 = ($203|0)==(0);
+ if ($204) {
+ label = 106;
+ break;
+ }
+ $213 = HEAP32[$6>>2]|0;
+ _stbi__skip($8,$213);
+ $$1212 = $$0211;$$1215 = $$0214;$$1229 = $$0228;$$1246 = $$0245;$$2233 = $$0231;$$2237 = $$0235;$$2243 = 0;$$3209 = $$0206;$$3220 = $$0217;
+ }
+ (_stbi__get32be($8)|0);
+ $$0206 = $$3209;$$0211 = $$1212;$$0214 = $$1215;$$0217 = $$3220;$$0228 = $$1229;$$0231 = $$2233;$$0235 = $$2237;$$0241 = $$2243;$$0245 = $$1246;
+ }
+ switch (label|0) {
+ case 7: {
+ _stbi__err(6765);
+ $$6$ph = 0;
+ break;
+ }
+ case 9: {
+ _stbi__err(6779);
+ $$6$ph = 0;
+ break;
+ }
+ case 11: {
+ _stbi__err(6792);
+ $$6$ph = 0;
+ break;
+ }
+ case 13: {
+ _stbi__err(6792);
+ $$6$ph = 0;
+ break;
+ }
+ case 15: {
+ _stbi__err(6802);
+ $$6$ph = 0;
+ break;
+ }
+ case 17: {
+ _stbi__err(6822);
+ $$6$ph = 0;
+ break;
+ }
+ case 20: {
+ _stbi__err(6822);
+ $$6$ph = 0;
+ break;
+ }
+ case 22: {
+ _stbi__err(6822);
+ $$6$ph = 0;
+ break;
+ }
+ case 24: {
+ _stbi__err(6832);
+ $$6$ph = 0;
+ break;
+ }
+ case 26: {
+ _stbi__err(6848);
+ $$6$ph = 0;
+ break;
+ }
+ case 28: {
+ _stbi__err(6866);
+ $$6$ph = 0;
+ break;
+ }
+ case 31: {
+ _stbi__err(6887);
+ $$6$ph = 0;
+ break;
+ }
+ case 34: {
+ _stbi__err(6792);
+ $$6$ph = 0;
+ break;
+ }
+ case 37: {
+ _stbi__err(6792);
+ $$6$ph = 0;
+ break;
+ }
+ case 39: {
+ _stbi__err(6901);
+ $$6$ph = 0;
+ break;
+ }
+ case 41: {
+ _stbi__err(6916);
+ $$6$ph = 0;
+ break;
+ }
+ case 44: {
+ _stbi__err(6916);
+ $$6$ph = 0;
+ break;
+ }
+ case 47: {
+ _stbi__err(6901);
+ $$6$ph = 0;
+ break;
+ }
+ case 49: {
+ _stbi__err(6929);
+ $$6$ph = 0;
+ break;
+ }
+ case 52: {
+ $89 = ((($8)) + 8|0);
+ HEAP32[$89>>2] = 4;
+ $$6$ph = 1;
+ break;
+ }
+ case 54: {
+ _stbi__err(6945);
+ $$6$ph = 0;
+ break;
+ }
+ case 58: {
+ _stbi__err(6962);
+ $$6$ph = 0;
+ break;
+ }
+ case 61: {
+ _stbi__err(6975);
+ $$6$ph = 0;
+ break;
+ }
+ case 63: {
+ _stbi__err(6962);
+ $$6$ph = 0;
+ break;
+ }
+ case 70: {
+ _stbi__err(6901);
+ $$6$ph = 0;
+ break;
+ }
+ case 72: {
+ _stbi__err(7000);
+ $$6$ph = 0;
+ break;
+ }
+ case 74: {
+ $133 = $$0206&255;
+ $134 = ((($8)) + 8|0);
+ HEAP32[$134>>2] = $133;
+ $$6$ph = 1;
+ break;
+ }
+ case 81: {
+ _stbi__err(6585);
+ $$6$ph = 0;
+ break;
+ }
+ case 83: {
+ _stbi__err(7008);
+ $$6$ph = 0;
+ break;
+ }
+ case 85: {
+ $156 = ($$0241|0)==(0);
+ do {
+ if ($156) {
+ $157 = ($1|0)==(0);
+ if ($157) {
+ $158 = HEAP32[$10>>2]|0;
+ $159 = ($158|0)==(0|0);
+ if ($159) {
+ _stbi__err(7018);
+ $$4 = 0;
+ break;
+ }
+ $160 = HEAP32[$8>>2]|0;
+ $161 = ((($0)) + 16|0);
+ $162 = HEAP32[$161>>2]|0;
+ $163 = Math_imul($162, $160)|0;
+ $164 = (($163) + 7)|0;
+ $165 = $164 >>> 3;
+ $166 = ((($8)) + 4|0);
+ $167 = HEAP32[$166>>2]|0;
+ $168 = ((($8)) + 8|0);
+ $169 = HEAP32[$168>>2]|0;
+ $170 = Math_imul($169, $167)|0;
+ $171 = Math_imul($170, $165)|0;
+ $172 = (($171) + ($167))|0;
+ HEAP32[$7>>2] = $172;
+ $173 = ($$0228|0)!=(0);
+ $174 = $173 ^ 1;
+ $175 = $174&1;
+ $176 = (_stbi_zlib_decode_malloc_guesssize_headerflag($158,$$0214,$172,$7,$175)|0);
+ HEAP32[$9>>2] = $176;
+ $177 = ($176|0)==(0|0);
+ if ($177) {
+ $$4 = 0;
+ } else {
+ $178 = HEAP32[$10>>2]|0;
+ _free($178);
+ HEAP32[$10>>2] = 0;
+ $179 = HEAP32[$168>>2]|0;
+ $180 = (($179) + 1)|0;
+ $notlhs = ($180|0)!=($2|0);
+ $notrhs = ($2|0)==(3);
+ $or$cond5$not = $notrhs | $notlhs;
+ $181 = ($$0206<<24>>24)!=(0);
+ $or$cond7 = $181 | $or$cond5$not;
+ $182 = ($$0211<<24>>24)==(0);
+ $or$cond248 = $182 & $or$cond7;
+ $$254 = $or$cond248 ? $179 : $180;
+ $183 = ((($8)) + 12|0);
+ HEAP32[$183>>2] = $$254;
+ $184 = HEAP32[$9>>2]|0;
+ $185 = HEAP32[$7>>2]|0;
+ $186 = HEAP32[$161>>2]|0;
+ $187 = (_stbi__create_png_image($0,$184,$185,$$254,$186,$$0231,$$0235)|0);
+ $188 = ($187|0)==(0);
+ if ($188) {
+ $$4 = 0;
+ } else {
+ do {
+ if (!($182)) {
+ $189 = HEAP32[$161>>2]|0;
+ $190 = ($189|0)==(16);
+ if ($190) {
+ $191 = HEAP32[$183>>2]|0;
+ _stbi__compute_transparency16($0,$5,$191);
+ break;
+ } else {
+ $192 = HEAP32[$183>>2]|0;
+ _stbi__compute_transparency($0,$4,$192);
+ break;
+ }
+ }
+ } while(0);
+ $193 = HEAP32[5171]|0;
+ $194 = ($193|0)!=(0);
+ $or$cond11 = $173 & $194;
+ if ($or$cond11) {
+ $195 = HEAP32[$183>>2]|0;
+ $196 = ($195|0)>(2);
+ if ($196) {
+ _stbi__de_iphone($0);
+ }
+ }
+ if ($181) {
+ $197 = $$0206&255;
+ HEAP32[$168>>2] = $197;
+ $198 = ($2|0)>(2);
+ $$ = $198 ? $2 : $197;
+ HEAP32[$183>>2] = $$;
+ $199 = (_stbi__expand_png_palette($0,$3,$$)|0);
+ $200 = ($199|0)==(0);
+ if ($200) {
+ $$4 = 0;
+ break;
+ }
+ }
+ $201 = HEAP32[$9>>2]|0;
+ _free($201);
+ HEAP32[$9>>2] = 0;
+ $$4 = 1;
+ }
+ }
+ } else {
+ $$4 = 1;
+ }
+ } else {
+ _stbi__err(6901);
+ $$4 = 0;
+ }
+ } while(0);
+ $$6$ph = $$4;
+ break;
+ }
+ case 104: {
+ _stbi__err(6901);
+ $$6$ph = 0;
+ break;
+ }
+ case 106: {
+ $205 = $25 >>> 24;
+ $206 = $205&255;
+ HEAP8[7026] = $206;
+ $207 = HEAP32[$15>>2]|0;
+ $208 = $207 >>> 16;
+ $209 = $208&255;
+ HEAP8[(7027)>>0] = $209;
+ $210 = $207 >>> 8;
+ $211 = $210&255;
+ HEAP8[(7028)>>0] = $211;
+ $212 = $207&255;
+ HEAP8[(7029)>>0] = $212;
+ _stbi__err(7026);
+ $$6$ph = 0;
+ break;
+ }
+ }
+ $$7 = $$6$ph;
+ STACKTOP = sp;return ($$7|0);
+}
+function _stbi__convert_format($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
+ var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
+ var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
+ var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
+ var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
+ var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $5 = ($2|0)==($1|0);
+ if ($5) {
+ $$0163 = $0;
+ return ($$0163|0);
+ }
+ $$off = (($2) + -1)|0;
+ $6 = ($$off>>>0)<(4);
+ if (!($6)) {
+ ___assert_fail((6688|0),(6620|0),1477,(6744|0));
+ // unreachable;
+ }
+ $7 = (_stbi__malloc_mad3($2,$3,$4)|0);
+ $8 = ($7|0)==(0|0);
+ if ($8) {
+ _free($0);
+ _stbi__err(6585);
+ $$0163 = 0;
+ return ($$0163|0);
+ }
+ $9 = ($4|0)>(0);
+ L11: do {
+ if ($9) {
+ $10 = $1 << 3;
+ $11 = (($10) + ($2))|0;
+ $$0165254 = (($3) + -1)|0;
+ $12 = ($$0165254|0)>(-1);
+ $$1166249 = (($3) + -1)|0;
+ $13 = ($$1166249|0)>(-1);
+ $$2167244 = (($3) + -1)|0;
+ $14 = ($$2167244|0)>(-1);
+ $$3168239 = (($3) + -1)|0;
+ $15 = ($$3168239|0)>(-1);
+ $$4169234 = (($3) + -1)|0;
+ $16 = ($$4169234|0)>(-1);
+ $$5170229 = (($3) + -1)|0;
+ $17 = ($$5170229|0)>(-1);
+ $$6171224 = (($3) + -1)|0;
+ $18 = ($$6171224|0)>(-1);
+ $$7172219 = (($3) + -1)|0;
+ $19 = ($$7172219|0)>(-1);
+ $$8173214 = (($3) + -1)|0;
+ $20 = ($$8173214|0)>(-1);
+ $$9174209 = (($3) + -1)|0;
+ $21 = ($$9174209|0)>(-1);
+ $$10175204 = (($3) + -1)|0;
+ $22 = ($$10175204|0)>(-1);
+ $$11176200 = (($3) + -1)|0;
+ $23 = ($$11176200|0)>(-1);
+ $$0164259 = 0;
+ L13: while(1) {
+ $24 = Math_imul($$0164259, $3)|0;
+ $25 = Math_imul($24, $1)|0;
+ $26 = (($0) + ($25)|0);
+ $27 = Math_imul($24, $2)|0;
+ $28 = (($7) + ($27)|0);
+ do {
+ switch ($11|0) {
+ case 10: {
+ if ($12) {
+ $$0151255 = $26;$$0165257 = $$0165254;$$0256 = $28;
+ while(1) {
+ $29 = HEAP8[$$0151255>>0]|0;
+ HEAP8[$$0256>>0] = $29;
+ $30 = ((($$0256)) + 1|0);
+ HEAP8[$30>>0] = -1;
+ $31 = ((($$0151255)) + 1|0);
+ $32 = ((($$0256)) + 2|0);
+ $$0165 = (($$0165257) + -1)|0;
+ $33 = ($$0165|0)>(-1);
+ if ($33) {
+ $$0151255 = $31;$$0165257 = $$0165;$$0256 = $32;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 11: {
+ if ($13) {
+ $$1152250 = $26;$$1166252 = $$1166249;$$1251 = $28;
+ while(1) {
+ $34 = HEAP8[$$1152250>>0]|0;
+ $35 = ((($$1251)) + 2|0);
+ HEAP8[$35>>0] = $34;
+ $36 = ((($$1251)) + 1|0);
+ HEAP8[$36>>0] = $34;
+ HEAP8[$$1251>>0] = $34;
+ $37 = ((($$1152250)) + 1|0);
+ $38 = ((($$1251)) + 3|0);
+ $$1166 = (($$1166252) + -1)|0;
+ $39 = ($$1166|0)>(-1);
+ if ($39) {
+ $$1152250 = $37;$$1166252 = $$1166;$$1251 = $38;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 12: {
+ if ($14) {
+ $$2153245 = $26;$$2167247 = $$2167244;$$2246 = $28;
+ while(1) {
+ $40 = HEAP8[$$2153245>>0]|0;
+ $41 = ((($$2246)) + 2|0);
+ HEAP8[$41>>0] = $40;
+ $42 = ((($$2246)) + 1|0);
+ HEAP8[$42>>0] = $40;
+ HEAP8[$$2246>>0] = $40;
+ $43 = ((($$2246)) + 3|0);
+ HEAP8[$43>>0] = -1;
+ $44 = ((($$2153245)) + 1|0);
+ $45 = ((($$2246)) + 4|0);
+ $$2167 = (($$2167247) + -1)|0;
+ $46 = ($$2167|0)>(-1);
+ if ($46) {
+ $$2153245 = $44;$$2167247 = $$2167;$$2246 = $45;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 17: {
+ if ($15) {
+ $$3154240 = $26;$$3168242 = $$3168239;$$3241 = $28;
+ while(1) {
+ $47 = HEAP8[$$3154240>>0]|0;
+ HEAP8[$$3241>>0] = $47;
+ $48 = ((($$3154240)) + 2|0);
+ $49 = ((($$3241)) + 1|0);
+ $$3168 = (($$3168242) + -1)|0;
+ $50 = ($$3168|0)>(-1);
+ if ($50) {
+ $$3154240 = $48;$$3168242 = $$3168;$$3241 = $49;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 19: {
+ if ($16) {
+ $$4155235 = $26;$$4169237 = $$4169234;$$4236 = $28;
+ while(1) {
+ $51 = HEAP8[$$4155235>>0]|0;
+ $52 = ((($$4236)) + 2|0);
+ HEAP8[$52>>0] = $51;
+ $53 = ((($$4236)) + 1|0);
+ HEAP8[$53>>0] = $51;
+ HEAP8[$$4236>>0] = $51;
+ $54 = ((($$4155235)) + 2|0);
+ $55 = ((($$4236)) + 3|0);
+ $$4169 = (($$4169237) + -1)|0;
+ $56 = ($$4169|0)>(-1);
+ if ($56) {
+ $$4155235 = $54;$$4169237 = $$4169;$$4236 = $55;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 20: {
+ if ($17) {
+ $$5156230 = $26;$$5170232 = $$5170229;$$5231 = $28;
+ while(1) {
+ $57 = HEAP8[$$5156230>>0]|0;
+ $58 = ((($$5231)) + 2|0);
+ HEAP8[$58>>0] = $57;
+ $59 = ((($$5231)) + 1|0);
+ HEAP8[$59>>0] = $57;
+ HEAP8[$$5231>>0] = $57;
+ $60 = ((($$5156230)) + 1|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = ((($$5231)) + 3|0);
+ HEAP8[$62>>0] = $61;
+ $63 = ((($$5156230)) + 2|0);
+ $64 = ((($$5231)) + 4|0);
+ $$5170 = (($$5170232) + -1)|0;
+ $65 = ($$5170|0)>(-1);
+ if ($65) {
+ $$5156230 = $63;$$5170232 = $$5170;$$5231 = $64;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 28: {
+ if ($18) {
+ $$6157225 = $26;$$6171227 = $$6171224;$$6226 = $28;
+ while(1) {
+ $66 = HEAP8[$$6157225>>0]|0;
+ HEAP8[$$6226>>0] = $66;
+ $67 = ((($$6157225)) + 1|0);
+ $68 = HEAP8[$67>>0]|0;
+ $69 = ((($$6226)) + 1|0);
+ HEAP8[$69>>0] = $68;
+ $70 = ((($$6157225)) + 2|0);
+ $71 = HEAP8[$70>>0]|0;
+ $72 = ((($$6226)) + 2|0);
+ HEAP8[$72>>0] = $71;
+ $73 = ((($$6226)) + 3|0);
+ HEAP8[$73>>0] = -1;
+ $74 = ((($$6157225)) + 3|0);
+ $75 = ((($$6226)) + 4|0);
+ $$6171 = (($$6171227) + -1)|0;
+ $76 = ($$6171|0)>(-1);
+ if ($76) {
+ $$6157225 = $74;$$6171227 = $$6171;$$6226 = $75;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 25: {
+ if ($19) {
+ $$7158220 = $26;$$7172222 = $$7172219;$$7221 = $28;
+ while(1) {
+ $77 = HEAP8[$$7158220>>0]|0;
+ $78 = $77&255;
+ $79 = ((($$7158220)) + 1|0);
+ $80 = HEAP8[$79>>0]|0;
+ $81 = $80&255;
+ $82 = ((($$7158220)) + 2|0);
+ $83 = HEAP8[$82>>0]|0;
+ $84 = $83&255;
+ $85 = (_stbi__compute_y($78,$81,$84)|0);
+ HEAP8[$$7221>>0] = $85;
+ $86 = ((($$7158220)) + 3|0);
+ $87 = ((($$7221)) + 1|0);
+ $$7172 = (($$7172222) + -1)|0;
+ $88 = ($$7172|0)>(-1);
+ if ($88) {
+ $$7158220 = $86;$$7172222 = $$7172;$$7221 = $87;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 26: {
+ if ($20) {
+ $$8159215 = $26;$$8173217 = $$8173214;$$8216 = $28;
+ while(1) {
+ $89 = HEAP8[$$8159215>>0]|0;
+ $90 = $89&255;
+ $91 = ((($$8159215)) + 1|0);
+ $92 = HEAP8[$91>>0]|0;
+ $93 = $92&255;
+ $94 = ((($$8159215)) + 2|0);
+ $95 = HEAP8[$94>>0]|0;
+ $96 = $95&255;
+ $97 = (_stbi__compute_y($90,$93,$96)|0);
+ HEAP8[$$8216>>0] = $97;
+ $98 = ((($$8216)) + 1|0);
+ HEAP8[$98>>0] = -1;
+ $99 = ((($$8159215)) + 3|0);
+ $100 = ((($$8216)) + 2|0);
+ $$8173 = (($$8173217) + -1)|0;
+ $101 = ($$8173|0)>(-1);
+ if ($101) {
+ $$8159215 = $99;$$8173217 = $$8173;$$8216 = $100;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 33: {
+ if ($21) {
+ $$9160210 = $26;$$9174212 = $$9174209;$$9211 = $28;
+ while(1) {
+ $102 = HEAP8[$$9160210>>0]|0;
+ $103 = $102&255;
+ $104 = ((($$9160210)) + 1|0);
+ $105 = HEAP8[$104>>0]|0;
+ $106 = $105&255;
+ $107 = ((($$9160210)) + 2|0);
+ $108 = HEAP8[$107>>0]|0;
+ $109 = $108&255;
+ $110 = (_stbi__compute_y($103,$106,$109)|0);
+ HEAP8[$$9211>>0] = $110;
+ $111 = ((($$9160210)) + 4|0);
+ $112 = ((($$9211)) + 1|0);
+ $$9174 = (($$9174212) + -1)|0;
+ $113 = ($$9174|0)>(-1);
+ if ($113) {
+ $$9160210 = $111;$$9174212 = $$9174;$$9211 = $112;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 34: {
+ if ($22) {
+ $$10161205 = $26;$$10175207 = $$10175204;$$10206 = $28;
+ while(1) {
+ $114 = HEAP8[$$10161205>>0]|0;
+ $115 = $114&255;
+ $116 = ((($$10161205)) + 1|0);
+ $117 = HEAP8[$116>>0]|0;
+ $118 = $117&255;
+ $119 = ((($$10161205)) + 2|0);
+ $120 = HEAP8[$119>>0]|0;
+ $121 = $120&255;
+ $122 = (_stbi__compute_y($115,$118,$121)|0);
+ HEAP8[$$10206>>0] = $122;
+ $123 = ((($$10161205)) + 3|0);
+ $124 = HEAP8[$123>>0]|0;
+ $125 = ((($$10206)) + 1|0);
+ HEAP8[$125>>0] = $124;
+ $126 = ((($$10161205)) + 4|0);
+ $127 = ((($$10206)) + 2|0);
+ $$10175 = (($$10175207) + -1)|0;
+ $128 = ($$10175|0)>(-1);
+ if ($128) {
+ $$10161205 = $126;$$10175207 = $$10175;$$10206 = $127;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 35: {
+ if ($23) {
+ $$11162201 = $26;$$11176203 = $$11176200;$$11202 = $28;
+ while(1) {
+ $129 = HEAP8[$$11162201>>0]|0;
+ HEAP8[$$11202>>0] = $129;
+ $130 = ((($$11162201)) + 1|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = ((($$11202)) + 1|0);
+ HEAP8[$132>>0] = $131;
+ $133 = ((($$11162201)) + 2|0);
+ $134 = HEAP8[$133>>0]|0;
+ $135 = ((($$11202)) + 2|0);
+ HEAP8[$135>>0] = $134;
+ $136 = ((($$11162201)) + 4|0);
+ $137 = ((($$11202)) + 3|0);
+ $$11176 = (($$11176203) + -1)|0;
+ $138 = ($$11176|0)>(-1);
+ if ($138) {
+ $$11162201 = $136;$$11176203 = $$11176;$$11202 = $137;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ break L13;
+ }
+ }
+ } while(0);
+ $139 = (($$0164259) + 1)|0;
+ $140 = ($139|0)<($4|0);
+ if ($140) {
+ $$0164259 = $139;
+ } else {
+ break L11;
+ }
+ }
+ ___assert_fail((6742|0),(6620|0),1506,(6744|0));
+ // unreachable;
+ }
+ } while(0);
+ _free($0);
+ $$0163 = $7;
+ return ($$0163|0);
+}
+function _stbi__convert_format16($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0151255 = 0, $$0163 = 0, $$0164259 = 0, $$0165 = 0, $$0165254 = 0, $$0165257 = 0, $$0256 = 0, $$10161205 = 0, $$10175 = 0, $$10175204 = 0, $$10175207 = 0, $$10206 = 0, $$11162201 = 0, $$11176 = 0, $$11176200 = 0, $$11176203 = 0, $$11202 = 0, $$1152250 = 0, $$1166 = 0, $$1166249 = 0;
+ var $$1166252 = 0, $$1251 = 0, $$2153245 = 0, $$2167 = 0, $$2167244 = 0, $$2167247 = 0, $$2246 = 0, $$3154240 = 0, $$3168 = 0, $$3168239 = 0, $$3168242 = 0, $$3241 = 0, $$4155235 = 0, $$4169 = 0, $$4169234 = 0, $$4169237 = 0, $$4236 = 0, $$5156230 = 0, $$5170 = 0, $$5170229 = 0;
+ var $$5170232 = 0, $$5231 = 0, $$6157225 = 0, $$6171 = 0, $$6171224 = 0, $$6171227 = 0, $$6226 = 0, $$7158220 = 0, $$7172 = 0, $$7172219 = 0, $$7172222 = 0, $$7221 = 0, $$8159215 = 0, $$8173 = 0, $$8173214 = 0, $$8173217 = 0, $$8216 = 0, $$9160210 = 0, $$9174 = 0, $$9174209 = 0;
+ var $$9174212 = 0, $$9211 = 0, $$off = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
+ var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
+ var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
+ var $98 = 0, $99 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = ($2|0)==($1|0);
+ if ($5) {
+ $$0163 = $0;
+ return ($$0163|0);
+ }
+ $$off = (($2) + -1)|0;
+ $6 = ($$off>>>0)<(4);
+ if (!($6)) {
+ ___assert_fail((6688|0),(6620|0),1526,(6719|0));
+ // unreachable;
+ }
+ $7 = $2 << 1;
+ $8 = Math_imul($7, $3)|0;
+ $9 = Math_imul($8, $4)|0;
+ $10 = (_stbi__malloc($9)|0);
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ _free($0);
+ _stbi__err(6585);
+ $$0163 = 0;
+ return ($$0163|0);
+ }
+ $12 = ($4|0)>(0);
+ L11: do {
+ if ($12) {
+ $13 = $1 << 3;
+ $14 = (($13) + ($2))|0;
+ $$0165254 = (($3) + -1)|0;
+ $15 = ($$0165254|0)>(-1);
+ $$1166249 = (($3) + -1)|0;
+ $16 = ($$1166249|0)>(-1);
+ $$2167244 = (($3) + -1)|0;
+ $17 = ($$2167244|0)>(-1);
+ $$3168239 = (($3) + -1)|0;
+ $18 = ($$3168239|0)>(-1);
+ $$4169234 = (($3) + -1)|0;
+ $19 = ($$4169234|0)>(-1);
+ $$5170229 = (($3) + -1)|0;
+ $20 = ($$5170229|0)>(-1);
+ $$6171224 = (($3) + -1)|0;
+ $21 = ($$6171224|0)>(-1);
+ $$7172219 = (($3) + -1)|0;
+ $22 = ($$7172219|0)>(-1);
+ $$8173214 = (($3) + -1)|0;
+ $23 = ($$8173214|0)>(-1);
+ $$9174209 = (($3) + -1)|0;
+ $24 = ($$9174209|0)>(-1);
+ $$10175204 = (($3) + -1)|0;
+ $25 = ($$10175204|0)>(-1);
+ $$11176200 = (($3) + -1)|0;
+ $26 = ($$11176200|0)>(-1);
+ $$0164259 = 0;
+ L13: while(1) {
+ $27 = Math_imul($$0164259, $3)|0;
+ $28 = Math_imul($27, $1)|0;
+ $29 = (($0) + ($28<<1)|0);
+ $30 = Math_imul($27, $2)|0;
+ $31 = (($10) + ($30<<1)|0);
+ do {
+ switch ($14|0) {
+ case 10: {
+ if ($15) {
+ $$0151255 = $29;$$0165257 = $$0165254;$$0256 = $31;
+ while(1) {
+ $32 = HEAP16[$$0151255>>1]|0;
+ HEAP16[$$0256>>1] = $32;
+ $33 = ((($$0256)) + 2|0);
+ HEAP16[$33>>1] = -1;
+ $34 = ((($$0151255)) + 2|0);
+ $35 = ((($$0256)) + 4|0);
+ $$0165 = (($$0165257) + -1)|0;
+ $36 = ($$0165|0)>(-1);
+ if ($36) {
+ $$0151255 = $34;$$0165257 = $$0165;$$0256 = $35;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 11: {
+ if ($16) {
+ $$1152250 = $29;$$1166252 = $$1166249;$$1251 = $31;
+ while(1) {
+ $37 = HEAP16[$$1152250>>1]|0;
+ $38 = ((($$1251)) + 4|0);
+ HEAP16[$38>>1] = $37;
+ $39 = ((($$1251)) + 2|0);
+ HEAP16[$39>>1] = $37;
+ HEAP16[$$1251>>1] = $37;
+ $40 = ((($$1152250)) + 2|0);
+ $41 = ((($$1251)) + 6|0);
+ $$1166 = (($$1166252) + -1)|0;
+ $42 = ($$1166|0)>(-1);
+ if ($42) {
+ $$1152250 = $40;$$1166252 = $$1166;$$1251 = $41;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 12: {
+ if ($17) {
+ $$2153245 = $29;$$2167247 = $$2167244;$$2246 = $31;
+ while(1) {
+ $43 = HEAP16[$$2153245>>1]|0;
+ $44 = ((($$2246)) + 4|0);
+ HEAP16[$44>>1] = $43;
+ $45 = ((($$2246)) + 2|0);
+ HEAP16[$45>>1] = $43;
+ HEAP16[$$2246>>1] = $43;
+ $46 = ((($$2246)) + 6|0);
+ HEAP16[$46>>1] = -1;
+ $47 = ((($$2153245)) + 2|0);
+ $48 = ((($$2246)) + 8|0);
+ $$2167 = (($$2167247) + -1)|0;
+ $49 = ($$2167|0)>(-1);
+ if ($49) {
+ $$2153245 = $47;$$2167247 = $$2167;$$2246 = $48;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 17: {
+ if ($18) {
+ $$3154240 = $29;$$3168242 = $$3168239;$$3241 = $31;
+ while(1) {
+ $50 = HEAP16[$$3154240>>1]|0;
+ HEAP16[$$3241>>1] = $50;
+ $51 = ((($$3154240)) + 4|0);
+ $52 = ((($$3241)) + 2|0);
+ $$3168 = (($$3168242) + -1)|0;
+ $53 = ($$3168|0)>(-1);
+ if ($53) {
+ $$3154240 = $51;$$3168242 = $$3168;$$3241 = $52;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 19: {
+ if ($19) {
+ $$4155235 = $29;$$4169237 = $$4169234;$$4236 = $31;
+ while(1) {
+ $54 = HEAP16[$$4155235>>1]|0;
+ $55 = ((($$4236)) + 4|0);
+ HEAP16[$55>>1] = $54;
+ $56 = ((($$4236)) + 2|0);
+ HEAP16[$56>>1] = $54;
+ HEAP16[$$4236>>1] = $54;
+ $57 = ((($$4155235)) + 4|0);
+ $58 = ((($$4236)) + 6|0);
+ $$4169 = (($$4169237) + -1)|0;
+ $59 = ($$4169|0)>(-1);
+ if ($59) {
+ $$4155235 = $57;$$4169237 = $$4169;$$4236 = $58;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 20: {
+ if ($20) {
+ $$5156230 = $29;$$5170232 = $$5170229;$$5231 = $31;
+ while(1) {
+ $60 = HEAP16[$$5156230>>1]|0;
+ $61 = ((($$5231)) + 4|0);
+ HEAP16[$61>>1] = $60;
+ $62 = ((($$5231)) + 2|0);
+ HEAP16[$62>>1] = $60;
+ HEAP16[$$5231>>1] = $60;
+ $63 = ((($$5156230)) + 2|0);
+ $64 = HEAP16[$63>>1]|0;
+ $65 = ((($$5231)) + 6|0);
+ HEAP16[$65>>1] = $64;
+ $66 = ((($$5156230)) + 4|0);
+ $67 = ((($$5231)) + 8|0);
+ $$5170 = (($$5170232) + -1)|0;
+ $68 = ($$5170|0)>(-1);
+ if ($68) {
+ $$5156230 = $66;$$5170232 = $$5170;$$5231 = $67;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 28: {
+ if ($21) {
+ $$6157225 = $29;$$6171227 = $$6171224;$$6226 = $31;
+ while(1) {
+ $69 = HEAP16[$$6157225>>1]|0;
+ HEAP16[$$6226>>1] = $69;
+ $70 = ((($$6157225)) + 2|0);
+ $71 = HEAP16[$70>>1]|0;
+ $72 = ((($$6226)) + 2|0);
+ HEAP16[$72>>1] = $71;
+ $73 = ((($$6157225)) + 4|0);
+ $74 = HEAP16[$73>>1]|0;
+ $75 = ((($$6226)) + 4|0);
+ HEAP16[$75>>1] = $74;
+ $76 = ((($$6226)) + 6|0);
+ HEAP16[$76>>1] = -1;
+ $77 = ((($$6157225)) + 6|0);
+ $78 = ((($$6226)) + 8|0);
+ $$6171 = (($$6171227) + -1)|0;
+ $79 = ($$6171|0)>(-1);
+ if ($79) {
+ $$6157225 = $77;$$6171227 = $$6171;$$6226 = $78;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 25: {
+ if ($22) {
+ $$7158220 = $29;$$7172222 = $$7172219;$$7221 = $31;
+ while(1) {
+ $80 = HEAP16[$$7158220>>1]|0;
+ $81 = $80&65535;
+ $82 = ((($$7158220)) + 2|0);
+ $83 = HEAP16[$82>>1]|0;
+ $84 = $83&65535;
+ $85 = ((($$7158220)) + 4|0);
+ $86 = HEAP16[$85>>1]|0;
+ $87 = $86&65535;
+ $88 = (_stbi__compute_y_16($81,$84,$87)|0);
+ HEAP16[$$7221>>1] = $88;
+ $89 = ((($$7158220)) + 6|0);
+ $90 = ((($$7221)) + 2|0);
+ $$7172 = (($$7172222) + -1)|0;
+ $91 = ($$7172|0)>(-1);
+ if ($91) {
+ $$7158220 = $89;$$7172222 = $$7172;$$7221 = $90;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 26: {
+ if ($23) {
+ $$8159215 = $29;$$8173217 = $$8173214;$$8216 = $31;
+ while(1) {
+ $92 = HEAP16[$$8159215>>1]|0;
+ $93 = $92&65535;
+ $94 = ((($$8159215)) + 2|0);
+ $95 = HEAP16[$94>>1]|0;
+ $96 = $95&65535;
+ $97 = ((($$8159215)) + 4|0);
+ $98 = HEAP16[$97>>1]|0;
+ $99 = $98&65535;
+ $100 = (_stbi__compute_y_16($93,$96,$99)|0);
+ HEAP16[$$8216>>1] = $100;
+ $101 = ((($$8216)) + 2|0);
+ HEAP16[$101>>1] = -1;
+ $102 = ((($$8159215)) + 6|0);
+ $103 = ((($$8216)) + 4|0);
+ $$8173 = (($$8173217) + -1)|0;
+ $104 = ($$8173|0)>(-1);
+ if ($104) {
+ $$8159215 = $102;$$8173217 = $$8173;$$8216 = $103;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 33: {
+ if ($24) {
+ $$9160210 = $29;$$9174212 = $$9174209;$$9211 = $31;
+ while(1) {
+ $105 = HEAP16[$$9160210>>1]|0;
+ $106 = $105&65535;
+ $107 = ((($$9160210)) + 2|0);
+ $108 = HEAP16[$107>>1]|0;
+ $109 = $108&65535;
+ $110 = ((($$9160210)) + 4|0);
+ $111 = HEAP16[$110>>1]|0;
+ $112 = $111&65535;
+ $113 = (_stbi__compute_y_16($106,$109,$112)|0);
+ HEAP16[$$9211>>1] = $113;
+ $114 = ((($$9160210)) + 8|0);
+ $115 = ((($$9211)) + 2|0);
+ $$9174 = (($$9174212) + -1)|0;
+ $116 = ($$9174|0)>(-1);
+ if ($116) {
+ $$9160210 = $114;$$9174212 = $$9174;$$9211 = $115;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 34: {
+ if ($25) {
+ $$10161205 = $29;$$10175207 = $$10175204;$$10206 = $31;
+ while(1) {
+ $117 = HEAP16[$$10161205>>1]|0;
+ $118 = $117&65535;
+ $119 = ((($$10161205)) + 2|0);
+ $120 = HEAP16[$119>>1]|0;
+ $121 = $120&65535;
+ $122 = ((($$10161205)) + 4|0);
+ $123 = HEAP16[$122>>1]|0;
+ $124 = $123&65535;
+ $125 = (_stbi__compute_y_16($118,$121,$124)|0);
+ HEAP16[$$10206>>1] = $125;
+ $126 = ((($$10161205)) + 6|0);
+ $127 = HEAP16[$126>>1]|0;
+ $128 = ((($$10206)) + 2|0);
+ HEAP16[$128>>1] = $127;
+ $129 = ((($$10161205)) + 8|0);
+ $130 = ((($$10206)) + 4|0);
+ $$10175 = (($$10175207) + -1)|0;
+ $131 = ($$10175|0)>(-1);
+ if ($131) {
+ $$10161205 = $129;$$10175207 = $$10175;$$10206 = $130;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ case 35: {
+ if ($26) {
+ $$11162201 = $29;$$11176203 = $$11176200;$$11202 = $31;
+ while(1) {
+ $132 = HEAP16[$$11162201>>1]|0;
+ HEAP16[$$11202>>1] = $132;
+ $133 = ((($$11162201)) + 2|0);
+ $134 = HEAP16[$133>>1]|0;
+ $135 = ((($$11202)) + 2|0);
+ HEAP16[$135>>1] = $134;
+ $136 = ((($$11162201)) + 4|0);
+ $137 = HEAP16[$136>>1]|0;
+ $138 = ((($$11202)) + 4|0);
+ HEAP16[$138>>1] = $137;
+ $139 = ((($$11162201)) + 8|0);
+ $140 = ((($$11202)) + 6|0);
+ $$11176 = (($$11176203) + -1)|0;
+ $141 = ($$11176|0)>(-1);
+ if ($141) {
+ $$11162201 = $139;$$11176203 = $$11176;$$11202 = $140;
+ } else {
+ break;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ break L13;
+ }
+ }
+ } while(0);
+ $142 = (($$0164259) + 1)|0;
+ $143 = ($142|0)<($4|0);
+ if ($143) {
+ $$0164259 = $142;
+ } else {
+ break L11;
+ }
+ }
+ ___assert_fail((6742|0),(6620|0),1555,(6719|0));
+ // unreachable;
+ }
+ } while(0);
+ _free($0);
+ $$0163 = $10;
+ return ($$0163|0);
+}
+function _stbi__compute_y_16($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($0*77)|0;
+ $4 = ($1*150)|0;
+ $5 = (($4) + ($3))|0;
+ $6 = ($2*29)|0;
+ $7 = (($5) + ($6))|0;
+ $8 = $7 >>> 8;
+ $9 = $8&65535;
+ return ($9|0);
+}
+function _stbi__compute_y($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($0*77)|0;
+ $4 = ($1*150)|0;
+ $5 = (($4) + ($3))|0;
+ $6 = ($2*29)|0;
+ $7 = (($5) + ($6))|0;
+ $8 = $7 >>> 8;
+ $9 = $8&255;
+ return ($9|0);
+}
+function _stbi__check_png_header($0) {
+ $0 = $0|0;
+ var $$05 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__get8($0)|0);
+ $2 = ($1<<24>>24)==(-119);
+ if ($2) {
+ $3 = (_stbi__get8($0)|0);
+ $4 = ($3<<24>>24)==(80);
+ if ($4) {
+ $5 = (_stbi__get8($0)|0);
+ $6 = ($5<<24>>24)==(78);
+ if ($6) {
+ $7 = (_stbi__get8($0)|0);
+ $8 = ($7<<24>>24)==(71);
+ if ($8) {
+ $9 = (_stbi__get8($0)|0);
+ $10 = ($9<<24>>24)==(13);
+ if ($10) {
+ $11 = (_stbi__get8($0)|0);
+ $12 = ($11<<24>>24)==(10);
+ if ($12) {
+ $13 = (_stbi__get8($0)|0);
+ $14 = ($13<<24>>24)==(26);
+ if ($14) {
+ $15 = (_stbi__get8($0)|0);
+ $16 = ($15<<24>>24)==(10);
+ if ($16) {
+ $$05 = 1;
+ return ($$05|0);
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ _stbi__err(8022);
+ $$05 = 0;
+ return ($$05|0);
+}
+function _stbi__get_chunk_header($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$sroa$4$0$$sroa_idx2 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_stbi__get32be($1)|0);
+ $3 = (_stbi__get32be($1)|0);
+ HEAP32[$0>>2] = $2;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAP32[$$sroa$4$0$$sroa_idx2>>2] = $3;
+ return;
+}
+function _stbi__skip($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)<(0);
+ if ($2) {
+ $3 = ((($0)) + 172|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($0)) + 168|0);
+ HEAP32[$5>>2] = $4;
+ return;
+ }
+ $6 = ((($0)) + 16|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)==(0|0);
+ if (!($8)) {
+ $9 = ((($0)) + 172|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($0)) + 168|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = $10;
+ $14 = (($13) - ($12))|0;
+ $15 = ($14|0)<($1|0);
+ if ($15) {
+ HEAP32[$11>>2] = $10;
+ $16 = ((($0)) + 20|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($0)) + 28|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = (($1) - ($14))|0;
+ FUNCTION_TABLE_vii[$17 & 63]($19,$20);
+ return;
+ }
+ }
+ $21 = ((($0)) + 168|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (($22) + ($1)|0);
+ HEAP32[$21>>2] = $23;
+ return;
+}
+function _stbi__get32be($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__get16be($0)|0);
+ $2 = $1 << 16;
+ $3 = (_stbi__get16be($0)|0);
+ $4 = (($2) + ($3))|0;
+ return ($4|0);
+}
+function _stbi__get8($0) {
+ $0 = $0|0;
+ var $$0 = 0, $$sink6 = 0, $1 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 168|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 172|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($2>>>0)<($4>>>0);
+ do {
+ if ($5) {
+ $$sink6 = $2;
+ } else {
+ $6 = ((($0)) + 32|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ _stbi__refill_buffer($0);
+ $9 = HEAP32[$1>>2]|0;
+ $$sink6 = $9;
+ break;
+ }
+ }
+ } while(0);
+ $10 = ((($$sink6)) + 1|0);
+ HEAP32[$1>>2] = $10;
+ $11 = HEAP8[$$sink6>>0]|0;
+ $$0 = $11;
+ return ($$0|0);
+}
+function _stbi__get16be($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__get8($0)|0);
+ $2 = $1&255;
+ $3 = $2 << 8;
+ $4 = (_stbi__get8($0)|0);
+ $5 = $4&255;
+ $6 = $3 | $5;
+ return ($6|0);
+}
+function _stbi__getn($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
+ var $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($0)) + 16|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0|0);
+ if (!($5)) {
+ $6 = ((($0)) + 172|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($0)) + 168|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = $9;
+ $11 = (($7) - ($10))|0;
+ $12 = ($11|0)<($2|0);
+ if ($12) {
+ _memcpy(($1|0),($9|0),($11|0))|0;
+ $13 = HEAP32[$3>>2]|0;
+ $14 = ((($0)) + 28|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = (($1) + ($11)|0);
+ $17 = (($2) - ($11))|0;
+ $18 = (FUNCTION_TABLE_iiii[$13 & 15]($15,$16,$17)|0);
+ $19 = ($18|0)==($17|0);
+ $20 = $19&1;
+ $21 = HEAP32[$6>>2]|0;
+ HEAP32[$8>>2] = $21;
+ $$1 = $20;
+ return ($$1|0);
+ }
+ }
+ $22 = ((($0)) + 168|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = (($23) + ($2)|0);
+ $25 = ((($0)) + 172|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($24>>>0)>($26>>>0);
+ if ($27) {
+ $$1 = 0;
+ return ($$1|0);
+ }
+ _memcpy(($1|0),($23|0),($2|0))|0;
+ $28 = HEAP32[$22>>2]|0;
+ $29 = (($28) + ($2)|0);
+ HEAP32[$22>>2] = $29;
+ $$1 = 1;
+ return ($$1|0);
+}
+function _stbi_zlib_decode_malloc_guesssize_headerflag($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 4080|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(4080|0);
+ $5 = sp;
+ $6 = (_stbi__malloc($2)|0);
+ $7 = ($6|0)==(0|0);
+ do {
+ if ($7) {
+ $$0 = 0;
+ } else {
+ HEAP32[$5>>2] = $0;
+ $8 = (($0) + ($1)|0);
+ $9 = ((($5)) + 4|0);
+ HEAP32[$9>>2] = $8;
+ $10 = (_stbi__do_zlib($5,$6,$2,1,$4)|0);
+ $11 = ($10|0)==(0);
+ $12 = ((($5)) + 20|0);
+ $13 = HEAP32[$12>>2]|0;
+ if ($11) {
+ _free($13);
+ $$0 = 0;
+ break;
+ }
+ $14 = ($3|0)==(0|0);
+ if ($14) {
+ $$0 = $13;
+ } else {
+ $15 = ((($5)) + 16|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = $13;
+ $18 = (($16) - ($17))|0;
+ HEAP32[$3>>2] = $18;
+ $$0 = $13;
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function _stbi__create_png_image($0,$1,$2,$3,$4,$5,$6) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ $6 = $6|0;
+ var $$0103117 = 0, $$0106116 = 0, $$0107115 = 0, $$095119 = 0, $$099118 = 0, $$3102$ph = 0, $$398$ph = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $7 = ($4|0)==(16);
+ $8 = $7 ? 2 : 1;
+ $9 = Math_imul($8, $3)|0;
+ $10 = ($6|0)==(0);
+ $11 = HEAP32[$0>>2]|0;
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ((($11)) + 4|0);
+ $14 = HEAP32[$13>>2]|0;
+ if ($10) {
+ $15 = (_stbi__create_png_image_raw($0,$1,$2,$3,$12,$14,$4,$5)|0);
+ $$4 = $15;
+ return ($$4|0);
+ }
+ $16 = (_stbi__malloc_mad3($12,$14,$9)|0);
+ $17 = ((($0)) + 12|0);
+ $18 = ((($0)) + 12|0);
+ $$0103117 = 0;$$095119 = $1;$$099118 = $2;
+ while(1) {
+ $19 = HEAP32[$0>>2]|0;
+ $20 = HEAP32[$19>>2]|0;
+ $21 = (3076 + ($$0103117<<2)|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (3104 + ($$0103117<<2)|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = (($20) + -1)|0;
+ $26 = (($25) - ($22))|0;
+ $27 = (($26) + ($24))|0;
+ $28 = (($27>>>0) / ($24>>>0))&-1;
+ $29 = ((($19)) + 4|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = (3132 + ($$0103117<<2)|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = (3160 + ($$0103117<<2)|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = (($30) + -1)|0;
+ $36 = (($35) - ($32))|0;
+ $37 = (($36) + ($34))|0;
+ $38 = (($37>>>0) / ($34>>>0))&-1;
+ $39 = ($24>>>0)<=($27>>>0);
+ $40 = ($34>>>0)<=($37>>>0);
+ $or$cond = $39 & $40;
+ if ($or$cond) {
+ $41 = ((($19)) + 8|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = Math_imul($28, $4)|0;
+ $44 = Math_imul($43, $42)|0;
+ $45 = (($44) + 7)|0;
+ $46 = $45 >> 3;
+ $47 = (($46) + 1)|0;
+ $48 = Math_imul($47, $38)|0;
+ $49 = (_stbi__create_png_image_raw($0,$$095119,$$099118,$3,$28,$38,$4,$5)|0);
+ $50 = ($49|0)==(0);
+ if ($50) {
+ label = 13;
+ break;
+ }
+ $51 = ($38|0)>(0);
+ if ($51) {
+ $52 = ($28|0)>(0);
+ $$0106116 = 0;
+ while(1) {
+ if ($52) {
+ $53 = HEAP32[$33>>2]|0;
+ $54 = Math_imul($53, $$0106116)|0;
+ $55 = HEAP32[$31>>2]|0;
+ $56 = (($54) + ($55))|0;
+ $57 = HEAP32[$23>>2]|0;
+ $58 = HEAP32[$21>>2]|0;
+ $59 = Math_imul($56, $9)|0;
+ $60 = Math_imul($$0106116, $28)|0;
+ $$0107115 = 0;
+ while(1) {
+ $61 = Math_imul($57, $$0107115)|0;
+ $62 = (($61) + ($58))|0;
+ $63 = HEAP32[$0>>2]|0;
+ $64 = HEAP32[$63>>2]|0;
+ $65 = Math_imul($59, $64)|0;
+ $66 = (($16) + ($65)|0);
+ $67 = Math_imul($62, $9)|0;
+ $68 = (($66) + ($67)|0);
+ $69 = HEAP32[$18>>2]|0;
+ $70 = (($$0107115) + ($60))|0;
+ $71 = Math_imul($70, $9)|0;
+ $72 = (($69) + ($71)|0);
+ _memcpy(($68|0),($72|0),($9|0))|0;
+ $73 = (($$0107115) + 1)|0;
+ $74 = ($73|0)<($28|0);
+ if ($74) {
+ $$0107115 = $73;
+ } else {
+ break;
+ }
+ }
+ }
+ $75 = (($$0106116) + 1)|0;
+ $76 = ($75|0)<($38|0);
+ if ($76) {
+ $$0106116 = $75;
+ } else {
+ break;
+ }
+ }
+ }
+ $77 = HEAP32[$17>>2]|0;
+ _free($77);
+ $78 = (($$095119) + ($48)|0);
+ $79 = (($$099118) - ($48))|0;
+ $$3102$ph = $79;$$398$ph = $78;
+ } else {
+ $$3102$ph = $$099118;$$398$ph = $$095119;
+ }
+ $80 = (($$0103117) + 1)|0;
+ $81 = ($80|0)<(7);
+ if ($81) {
+ $$0103117 = $80;$$095119 = $$398$ph;$$099118 = $$3102$ph;
+ } else {
+ label = 15;
+ break;
+ }
+ }
+ if ((label|0) == 13) {
+ _free($16);
+ $$4 = 0;
+ return ($$4|0);
+ }
+ else if ((label|0) == 15) {
+ $82 = ((($0)) + 12|0);
+ HEAP32[$82>>2] = $16;
+ $$4 = 1;
+ return ($$4|0);
+ }
+ return (0)|0;
+}
+function _stbi__compute_transparency16($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($3)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($6, $4)|0;
+ $8 = ((($0)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ switch ($2|0) {
+ case 2: {
+ $13 = ($7|0)==(0);
+ if ($13) {
+ return;
+ } else {
+ $$0323 = 0;$$04 = $9;
+ }
+ while(1) {
+ $14 = HEAP16[$$04>>1]|0;
+ $15 = HEAP16[$1>>1]|0;
+ $not$ = ($14<<16>>16)!=($15<<16>>16);
+ $16 = $not$ << 31 >> 31;
+ $17 = ((($$04)) + 2|0);
+ HEAP16[$17>>1] = $16;
+ $18 = ((($$04)) + 4|0);
+ $19 = (($$0323) + 1)|0;
+ $exitcond = ($19|0)==($7|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$0323 = $19;$$04 = $18;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $10 = ($7|0)==(0);
+ if ($10) {
+ return;
+ }
+ $11 = ((($1)) + 2|0);
+ $12 = ((($1)) + 4|0);
+ $$1335 = 0;$$16 = $9;
+ while(1) {
+ $20 = HEAP16[$$16>>1]|0;
+ $21 = HEAP16[$1>>1]|0;
+ $22 = ($20<<16>>16)==($21<<16>>16);
+ if ($22) {
+ $23 = ((($$16)) + 2|0);
+ $24 = HEAP16[$23>>1]|0;
+ $25 = HEAP16[$11>>1]|0;
+ $26 = ($24<<16>>16)==($25<<16>>16);
+ if ($26) {
+ $27 = ((($$16)) + 4|0);
+ $28 = HEAP16[$27>>1]|0;
+ $29 = HEAP16[$12>>1]|0;
+ $30 = ($28<<16>>16)==($29<<16>>16);
+ if ($30) {
+ $31 = ((($$16)) + 6|0);
+ HEAP16[$31>>1] = 0;
+ }
+ }
+ }
+ $32 = ((($$16)) + 8|0);
+ $33 = (($$1335) + 1)|0;
+ $exitcond9 = ($33|0)==($7|0);
+ if ($exitcond9) {
+ break;
+ } else {
+ $$1335 = $33;$$16 = $32;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((7085|0),(6620|0),4569,(7137|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__compute_transparency($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0323 = 0, $$04 = 0, $$1335 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($3)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($6, $4)|0;
+ $8 = ((($0)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ switch ($2|0) {
+ case 2: {
+ $13 = ($7|0)==(0);
+ if ($13) {
+ return;
+ } else {
+ $$0323 = 0;$$04 = $9;
+ }
+ while(1) {
+ $14 = HEAP8[$$04>>0]|0;
+ $15 = HEAP8[$1>>0]|0;
+ $not$ = ($14<<24>>24)!=($15<<24>>24);
+ $16 = $not$ << 31 >> 31;
+ $17 = ((($$04)) + 1|0);
+ HEAP8[$17>>0] = $16;
+ $18 = ((($$04)) + 2|0);
+ $19 = (($$0323) + 1)|0;
+ $exitcond = ($19|0)==($7|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$0323 = $19;$$04 = $18;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $10 = ($7|0)==(0);
+ if ($10) {
+ return;
+ }
+ $11 = ((($1)) + 1|0);
+ $12 = ((($1)) + 2|0);
+ $$1335 = 0;$$16 = $9;
+ while(1) {
+ $20 = HEAP8[$$16>>0]|0;
+ $21 = HEAP8[$1>>0]|0;
+ $22 = ($20<<24>>24)==($21<<24>>24);
+ if ($22) {
+ $23 = ((($$16)) + 1|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = HEAP8[$11>>0]|0;
+ $26 = ($24<<24>>24)==($25<<24>>24);
+ if ($26) {
+ $27 = ((($$16)) + 2|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = HEAP8[$12>>0]|0;
+ $30 = ($28<<24>>24)==($29<<24>>24);
+ if ($30) {
+ $31 = ((($$16)) + 3|0);
+ HEAP8[$31>>0] = 0;
+ }
+ }
+ }
+ $32 = ((($$16)) + 4|0);
+ $33 = (($$1335) + 1)|0;
+ $exitcond9 = ($33|0)==($7|0);
+ if ($exitcond9) {
+ break;
+ } else {
+ $$1335 = $33;$$16 = $32;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((7085|0),(6620|0),4544,(7110|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__de_iphone($0) {
+ $0 = $0|0;
+ var $$05158 = 0, $$059 = 0, $$15263 = 0, $$164 = 0, $$25360 = 0, $$261 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond68 = 0, $exitcond69 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($1)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = Math_imul($4, $2)|0;
+ $6 = ((($0)) + 12|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($1)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ switch ($9|0) {
+ case 3: {
+ $10 = ($5|0)==(0);
+ if ($10) {
+ return;
+ } else {
+ $$05158 = $7;$$059 = 0;
+ }
+ while(1) {
+ $11 = HEAP8[$$05158>>0]|0;
+ $12 = ((($$05158)) + 2|0);
+ $13 = HEAP8[$12>>0]|0;
+ HEAP8[$$05158>>0] = $13;
+ HEAP8[$12>>0] = $11;
+ $14 = ((($$05158)) + 3|0);
+ $15 = (($$059) + 1)|0;
+ $exitcond = ($15|0)==($5|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$05158 = $14;$$059 = $15;
+ }
+ }
+ return;
+ break;
+ }
+ case 4: {
+ $16 = HEAP32[5172]|0;
+ $17 = ($16|0)==(0);
+ $18 = ($5|0)!=(0);
+ if ($17) {
+ if ($18) {
+ $$25360 = $7;$$261 = 0;
+ } else {
+ return;
+ }
+ while(1) {
+ $42 = HEAP8[$$25360>>0]|0;
+ $43 = ((($$25360)) + 2|0);
+ $44 = HEAP8[$43>>0]|0;
+ HEAP8[$$25360>>0] = $44;
+ HEAP8[$43>>0] = $42;
+ $45 = ((($$25360)) + 4|0);
+ $46 = (($$261) + 1)|0;
+ $exitcond68 = ($46|0)==($5|0);
+ if ($exitcond68) {
+ break;
+ } else {
+ $$25360 = $45;$$261 = $46;
+ }
+ }
+ return;
+ }
+ if ($18) {
+ $$15263 = $7;$$164 = 0;
+ } else {
+ return;
+ }
+ while(1) {
+ $19 = ((($$15263)) + 3|0);
+ $20 = HEAP8[$19>>0]|0;
+ $21 = HEAP8[$$15263>>0]|0;
+ $22 = ($20<<24>>24)==(0);
+ $23 = ((($$15263)) + 2|0);
+ $24 = HEAP8[$23>>0]|0;
+ if ($22) {
+ HEAP8[$$15263>>0] = $24;
+ $$sink = $21;
+ } else {
+ $25 = $24&255;
+ $26 = ($25*255)|0;
+ $27 = $20&255;
+ $28 = (($26>>>0) / ($27>>>0))&-1;
+ $29 = $28&255;
+ HEAP8[$$15263>>0] = $29;
+ $30 = ((($$15263)) + 1|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = $31&255;
+ $33 = ($32*255)|0;
+ $34 = (($33>>>0) / ($27>>>0))&-1;
+ $35 = $34&255;
+ HEAP8[$30>>0] = $35;
+ $36 = $21&255;
+ $37 = ($36*255)|0;
+ $38 = (($37>>>0) / ($27>>>0))&-1;
+ $39 = $38&255;
+ $$sink = $39;
+ }
+ HEAP8[$23>>0] = $$sink;
+ $40 = ((($$15263)) + 4|0);
+ $41 = (($$164) + 1)|0;
+ $exitcond69 = ($41|0)==($5|0);
+ if ($exitcond69) {
+ break;
+ } else {
+ $$15263 = $40;$$164 = $41;
+ }
+ }
+ return;
+ break;
+ }
+ default: {
+ ___assert_fail((7051|0),(6620|0),4650,(7069|0));
+ // unreachable;
+ }
+ }
+}
+function _stbi__expand_png_palette($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$0574 = 0, $$0583 = 0, $$1595 = 0, $$16 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($3)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = Math_imul($6, $4)|0;
+ $8 = ((($0)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (_stbi__malloc_mad2($7,$2)|0);
+ $11 = ($10|0)==(0|0);
+ if ($11) {
+ _stbi__err(6585);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $12 = ($2|0)==(3);
+ $13 = ($7|0)!=(0);
+ if ($12) {
+ if ($13) {
+ $$0574 = 0;$$0583 = $10;
+ while(1) {
+ $14 = (($9) + ($$0574)|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = $15&255;
+ $17 = $16 << 2;
+ $18 = (($1) + ($17)|0);
+ $19 = HEAP8[$18>>0]|0;
+ HEAP8[$$0583>>0] = $19;
+ $20 = $17 | 1;
+ $21 = (($1) + ($20)|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = ((($$0583)) + 1|0);
+ HEAP8[$23>>0] = $22;
+ $24 = $17 | 2;
+ $25 = (($1) + ($24)|0);
+ $26 = HEAP8[$25>>0]|0;
+ $27 = ((($$0583)) + 2|0);
+ HEAP8[$27>>0] = $26;
+ $28 = ((($$0583)) + 3|0);
+ $29 = (($$0574) + 1)|0;
+ $exitcond = ($29|0)==($7|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$0574 = $29;$$0583 = $28;
+ }
+ }
+ }
+ } else {
+ if ($13) {
+ $$1595 = $10;$$16 = 0;
+ while(1) {
+ $30 = (($9) + ($$16)|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = $31&255;
+ $33 = $32 << 2;
+ $34 = (($1) + ($33)|0);
+ $35 = HEAP8[$34>>0]|0;
+ HEAP8[$$1595>>0] = $35;
+ $36 = $33 | 1;
+ $37 = (($1) + ($36)|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = ((($$1595)) + 1|0);
+ HEAP8[$39>>0] = $38;
+ $40 = $33 | 2;
+ $41 = (($1) + ($40)|0);
+ $42 = HEAP8[$41>>0]|0;
+ $43 = ((($$1595)) + 2|0);
+ HEAP8[$43>>0] = $42;
+ $44 = $33 | 3;
+ $45 = (($1) + ($44)|0);
+ $46 = HEAP8[$45>>0]|0;
+ $47 = ((($$1595)) + 3|0);
+ HEAP8[$47>>0] = $46;
+ $48 = ((($$1595)) + 4|0);
+ $49 = (($$16) + 1)|0;
+ $exitcond9 = ($49|0)==($7|0);
+ if ($exitcond9) {
+ break;
+ } else {
+ $$1595 = $48;$$16 = $49;
+ }
+ }
+ }
+ }
+ $50 = HEAP32[$8>>2]|0;
+ _free($50);
+ HEAP32[$8>>2] = $10;
+ $$0 = 1;
+ return ($$0|0);
+}
+function _stbi__malloc_mad2($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_stbi__mad2sizes_valid($0,$1)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $4 = Math_imul($1, $0)|0;
+ $5 = (_stbi__malloc($4)|0);
+ $$0 = $5;
+ return ($$0|0);
+}
+function _stbi__mad2sizes_valid($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_stbi__mul2sizes_valid($0,$1)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $8 = 0;
+ $7 = $8&1;
+ return ($7|0);
+ }
+ $4 = Math_imul($1, $0)|0;
+ $5 = (_stbi__addsizes_valid($4)|0);
+ $6 = ($5|0)!=(0);
+ $8 = $6;
+ $7 = $8&1;
+ return ($7|0);
+}
+function _stbi__create_png_image_raw($0,$1,$2,$3,$4,$5,$6,$7) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ $6 = $6|0;
+ $7 = $7|0;
+ var $$0568 = 0, $$0568724 = 0, $$0568725 = 0, $$0571$lcssa = 0, $$0571715 = 0, $$0574$lcssa = 0, $$0574714 = 0, $$0577817 = 0, $$0588 = 0, $$0597 = 0, $$0608816 = 0, $$0611815 = 0, $$0614 = 0, $$0614793 = 0, $$0614796 = 0, $$0623814 = 0, $$0625734 = 0, $$0731 = 0, $$1 = 0, $$10635764 = 0;
+ var $$11$ph = 0, $$11636755 = 0, $$12747 = 0, $$13739 = 0, $$14$lcssa = 0, $$14713 = 0, $$15$lcssa = 0, $$15705 = 0, $$1572$lcssa = 0, $$1572707 = 0, $$1575$lcssa = 0, $$1575706 = 0, $$1578 = 0, $$16$lcssa = 0, $$1609 = 0, $$1612 = 0, $$1615 = 0, $$1615785 = 0, $$1615788 = 0, $$1624727 = 0;
+ var $$1626812 = 0, $$16700 = 0, $$1721 = 0, $$1722 = 0, $$2 = 0, $$2573$lcssa = 0, $$2573702 = 0, $$2579795 = 0, $$2599794 = 0, $$2616 = 0, $$2616776 = 0, $$2616780 = 0, $$2627810 = 0, $$3580787 = 0, $$3592778 = 0, $$3600786 = 0, $$3617 = 0, $$3617767 = 0, $$3617771 = 0, $$3628808 = 0;
+ var $$4$lcssa = 0, $$4581779 = 0, $$4593769 = 0, $$4601777 = 0, $$4618 = 0, $$4618758 = 0, $$4618762 = 0, $$4629806 = 0, $$4701 = 0, $$5582770 = 0, $$5594760 = 0, $$5602768 = 0, $$5619 = 0, $$5619750 = 0, $$5619753 = 0, $$5630804 = 0, $$6583761 = 0, $$6603759 = 0, $$6620 = 0, $$6620742 = 0;
+ var $$6620745 = 0, $$6631802 = 0, $$7584752 = 0, $$7604751 = 0, $$7621798 = 0, $$7632790 = 0, $$8585744 = 0, $$8605743 = 0, $$8622729 = 0, $$8633782 = 0, $$9586 = 0, $$9606799 = 0, $$9634773 = 0, $$not = 0, $$sink = 0, $$sink1 = 0, $$sink641 = 0, $10 = 0, $100 = 0, $101 = 0;
+ var $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
+ var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
+ var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0;
+ var $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
+ var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
+ var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0;
+ var $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0;
+ var $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0;
+ var $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0;
+ var $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0;
+ var $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0;
+ var $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0;
+ var $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0;
+ var $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0;
+ var $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0;
+ var $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0;
+ var $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0;
+ var $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0;
+ var $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0;
+ var $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0;
+ var $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0;
+ var $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $50 = 0, $500 = 0, $501 = 0;
+ var $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0;
+ var $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0;
+ var $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0;
+ var $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0;
+ var $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0;
+ var $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0;
+ var $611 = 0, $612 = 0, $613 = 0, $614 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0;
+ var $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0;
+ var $96 = 0, $97 = 0, $98 = 0, $99 = 0, $brmerge = 0, $brmerge894 = 0, $exitcond = 0, $exitcond864 = 0, $exitcond865 = 0, $exitcond867 = 0, $exitcond869 = 0, $exitcond871 = 0, $exitcond873 = 0, $exitcond875 = 0, $exitcond877 = 0, $exitcond880 = 0, $exitcond881 = 0, $exitcond882 = 0, $exitcond883 = 0, $exitcond884 = 0;
+ var $exitcond885 = 0, $exitcond886 = 0, $indvars$iv = 0, $indvars$iv$next = 0, $indvars$iv$next849 = 0, $indvars$iv$next852 = 0, $indvars$iv$next855 = 0, $indvars$iv$next858 = 0, $indvars$iv$next861 = 0, $indvars$iv848 = 0, $indvars$iv851 = 0, $indvars$iv854 = 0, $indvars$iv857 = 0, $indvars$iv860 = 0, $or$cond = 0, $scevgep = 0, $scevgep850 = 0, $scevgep853 = 0, $scevgep856 = 0, $scevgep859 = 0;
+ var $scevgep862 = 0, $scevgep866 = 0, $scevgep868 = 0, $scevgep870 = 0, $scevgep872 = 0, $scevgep874 = 0, $scevgep876 = 0, $scevgep879 = 0, $trunc = 0, $trunc637 = 0, $trunc638 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $8 = ($6|0)==(16);
+ $9 = $8 ? 2 : 1;
+ $10 = HEAP32[$0>>2]|0;
+ $11 = Math_imul($4, $3)|0;
+ $12 = Math_imul($9, $11)|0;
+ $13 = ((($10)) + 8|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = Math_imul($9, $3)|0;
+ $16 = Math_imul($14, $9)|0;
+ $17 = ($14|0)==($3|0);
+ $18 = (($14) + 1)|0;
+ $19 = ($18|0)==($3|0);
+ $or$cond = $17 | $19;
+ if (!($or$cond)) {
+ ___assert_fail((7166|0),(6620|0),4294,(7207|0));
+ // unreachable;
+ }
+ $20 = (_stbi__malloc_mad3($4,$5,$15)|0);
+ $21 = ((($0)) + 12|0);
+ HEAP32[$21>>2] = $20;
+ $22 = ($20|0)==(0|0);
+ if ($22) {
+ _stbi__err(6585);
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $23 = Math_imul($14, $4)|0;
+ $24 = Math_imul($23, $6)|0;
+ $25 = (($24) + 7)|0;
+ $26 = $25 >>> 3;
+ $27 = (($26) + 1)|0;
+ $28 = Math_imul($27, $5)|0;
+ $29 = HEAP32[$10>>2]|0;
+ $30 = ($29|0)==($4|0);
+ if ($30) {
+ $31 = ((($10)) + 4|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = ($32|0)==($5|0);
+ if ($33) {
+ $34 = ($28|0)==($2|0);
+ if (!($34)) {
+ _stbi__err(7234);
+ $$2 = 0;
+ return ($$2|0);
+ }
+ } else {
+ label = 9;
+ }
+ } else {
+ label = 9;
+ }
+ if ((label|0) == 9) {
+ $35 = ($28>>>0)>($2>>>0);
+ if ($35) {
+ _stbi__err(7234);
+ $$2 = 0;
+ return ($$2|0);
+ }
+ }
+ $36 = ($5|0)==(0);
+ L18: do {
+ if (!($36)) {
+ $37 = ($6|0)<(8);
+ $38 = ($26>>>0)>($4>>>0);
+ $39 = (($11) - ($26))|0;
+ $40 = (0 - ($12))|0;
+ $41 = ($6|0)==(8);
+ $brmerge = $37 | $17;
+ $42 = ($4|0)==(0);
+ $$0614793 = (($4) + -1)|0;
+ $43 = ($$0614793|0)==(0);
+ $$1615785 = (($4) + -1)|0;
+ $44 = ($$1615785|0)==(0);
+ $$2616776 = (($4) + -1)|0;
+ $45 = ($$2616776|0)==(0);
+ $$3617767 = (($4) + -1)|0;
+ $46 = ($$3617767|0)==(0);
+ $$4618758 = (($4) + -1)|0;
+ $47 = ($$4618758|0)==(0);
+ $$5619750 = (($4) + -1)|0;
+ $48 = ($$5619750|0)==(0);
+ $$6620742 = (($4) + -1)|0;
+ $49 = ($$6620742|0)==(0);
+ $$not = $8 ^ 1;
+ $brmerge894 = $42 | $$not;
+ $$0577817 = $1;$$0608816 = $4;$$0611815 = $16;$$0623814 = 0;
+ while(1) {
+ $50 = HEAP32[$21>>2]|0;
+ $51 = Math_imul($$0623814, $12)|0;
+ $52 = (($50) + ($51)|0);
+ $53 = ((($$0577817)) + 1|0);
+ $54 = HEAP8[$$0577817>>0]|0;
+ $55 = $54&255;
+ $56 = ($54&255)>(4);
+ if ($56) {
+ label = 105;
+ break;
+ }
+ if ($37) {
+ if ($38) {
+ label = 16;
+ break;
+ }
+ $57 = (($52) + ($39)|0);
+ $$0597 = $57;$$1609 = $26;$$1612 = 1;
+ } else {
+ $$0597 = $52;$$1609 = $$0608816;$$1612 = $$0611815;
+ }
+ $58 = (($$0597) + ($40)|0);
+ $59 = ($$0623814|0)==(0);
+ if ($59) {
+ $60 = (7273 + ($55)|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = $61&255;
+ $$0588 = $62;
+ } else {
+ $$0588 = $55;
+ }
+ $63 = ($$1612|0)>(0);
+ L30: do {
+ if ($63) {
+ $trunc638 = $$0588&255;
+ $$0625734 = 0;
+ while(1) {
+ switch ($trunc638<<24>>24) {
+ case 0: {
+ $64 = (($53) + ($$0625734)|0);
+ $65 = HEAP8[$64>>0]|0;
+ $$sink = $65;
+ label = 30;
+ break;
+ }
+ case 1: {
+ $66 = (($53) + ($$0625734)|0);
+ $67 = HEAP8[$66>>0]|0;
+ $$sink = $67;
+ label = 30;
+ break;
+ }
+ case 2: {
+ $68 = (($53) + ($$0625734)|0);
+ $69 = HEAP8[$68>>0]|0;
+ $70 = $69&255;
+ $71 = (($58) + ($$0625734)|0);
+ $72 = HEAP8[$71>>0]|0;
+ $73 = $72&255;
+ $74 = (($73) + ($70))|0;
+ $75 = $74&255;
+ $$sink = $75;
+ label = 30;
+ break;
+ }
+ case 3: {
+ $76 = (($53) + ($$0625734)|0);
+ $77 = HEAP8[$76>>0]|0;
+ $78 = $77&255;
+ $79 = (($58) + ($$0625734)|0);
+ $80 = HEAP8[$79>>0]|0;
+ $81 = $80&255;
+ $82 = $81 >>> 1;
+ $83 = (($82) + ($78))|0;
+ $84 = $83&255;
+ $$sink = $84;
+ label = 30;
+ break;
+ }
+ case 4: {
+ $85 = (($53) + ($$0625734)|0);
+ $86 = HEAP8[$85>>0]|0;
+ $87 = $86&255;
+ $88 = (($58) + ($$0625734)|0);
+ $89 = HEAP8[$88>>0]|0;
+ $90 = $89&255;
+ $91 = (_stbi__paeth(0,$90,0)|0);
+ $92 = (($91) + ($87))|0;
+ $93 = $92&255;
+ $$sink = $93;
+ label = 30;
+ break;
+ }
+ case 5: {
+ $94 = (($53) + ($$0625734)|0);
+ $95 = HEAP8[$94>>0]|0;
+ $$sink = $95;
+ label = 30;
+ break;
+ }
+ case 6: {
+ $96 = (($53) + ($$0625734)|0);
+ $97 = HEAP8[$96>>0]|0;
+ $$sink = $97;
+ label = 30;
+ break;
+ }
+ default: {
+ }
+ }
+ if ((label|0) == 30) {
+ label = 0;
+ $$sink1 = (($$0597) + ($$0625734)|0);
+ HEAP8[$$sink1>>0] = $$sink;
+ }
+ $98 = (($$0625734) + 1)|0;
+ $exitcond864 = ($98|0)==($$1612|0);
+ if ($exitcond864) {
+ break L30;
+ } else {
+ $$0625734 = $98;
+ }
+ }
+ }
+ } while(0);
+ do {
+ if ($41) {
+ if (!($17)) {
+ $99 = (($$0597) + ($14)|0);
+ HEAP8[$99>>0] = -1;
+ }
+ $100 = (($53) + ($14)|0);
+ $$1578 = $100;$$sink641 = $3;
+ } else {
+ if (!($8)) {
+ $105 = ((($$0577817)) + 2|0);
+ $$1578 = $105;$$sink641 = 1;
+ break;
+ }
+ if (!($17)) {
+ $101 = (($$1612) + 1)|0;
+ $102 = (($$0597) + ($101)|0);
+ $103 = (($$0597) + ($$1612)|0);
+ HEAP8[$103>>0] = -1;
+ HEAP8[$102>>0] = -1;
+ }
+ $104 = (($53) + ($$1612)|0);
+ $$1578 = $104;$$sink641 = $15;
+ }
+ } while(0);
+ $106 = (($$0597) + ($$sink641)|0);
+ $107 = (($58) + ($$sink641)|0);
+ if ($brmerge) {
+ $108 = (($$1609) + -1)|0;
+ $109 = Math_imul($108, $$1612)|0;
+ $trunc637 = $$0588&255;
+ switch ($trunc637<<24>>24) {
+ case 0: {
+ _memcpy(($106|0),($$1578|0),($109|0))|0;
+ break;
+ }
+ case 1: {
+ $115 = ($109|0)>(0);
+ if ($115) {
+ $$1626812 = 0;
+ while(1) {
+ $116 = (($$1578) + ($$1626812)|0);
+ $117 = HEAP8[$116>>0]|0;
+ $118 = $117&255;
+ $119 = (($$1626812) - ($$1612))|0;
+ $120 = (($106) + ($119)|0);
+ $121 = HEAP8[$120>>0]|0;
+ $122 = $121&255;
+ $123 = (($122) + ($118))|0;
+ $124 = $123&255;
+ $125 = (($106) + ($$1626812)|0);
+ HEAP8[$125>>0] = $124;
+ $126 = (($$1626812) + 1)|0;
+ $exitcond886 = ($126|0)==($109|0);
+ if ($exitcond886) {
+ break;
+ } else {
+ $$1626812 = $126;
+ }
+ }
+ }
+ break;
+ }
+ case 2: {
+ $114 = ($109|0)>(0);
+ if ($114) {
+ $$2627810 = 0;
+ while(1) {
+ $127 = (($$1578) + ($$2627810)|0);
+ $128 = HEAP8[$127>>0]|0;
+ $129 = $128&255;
+ $130 = (($107) + ($$2627810)|0);
+ $131 = HEAP8[$130>>0]|0;
+ $132 = $131&255;
+ $133 = (($132) + ($129))|0;
+ $134 = $133&255;
+ $135 = (($106) + ($$2627810)|0);
+ HEAP8[$135>>0] = $134;
+ $136 = (($$2627810) + 1)|0;
+ $exitcond885 = ($136|0)==($109|0);
+ if ($exitcond885) {
+ break;
+ } else {
+ $$2627810 = $136;
+ }
+ }
+ }
+ break;
+ }
+ case 3: {
+ $113 = ($109|0)>(0);
+ if ($113) {
+ $$3628808 = 0;
+ while(1) {
+ $137 = (($$1578) + ($$3628808)|0);
+ $138 = HEAP8[$137>>0]|0;
+ $139 = $138&255;
+ $140 = (($107) + ($$3628808)|0);
+ $141 = HEAP8[$140>>0]|0;
+ $142 = $141&255;
+ $143 = (($$3628808) - ($$1612))|0;
+ $144 = (($106) + ($143)|0);
+ $145 = HEAP8[$144>>0]|0;
+ $146 = $145&255;
+ $147 = (($146) + ($142))|0;
+ $148 = $147 >>> 1;
+ $149 = (($148) + ($139))|0;
+ $150 = $149&255;
+ $151 = (($106) + ($$3628808)|0);
+ HEAP8[$151>>0] = $150;
+ $152 = (($$3628808) + 1)|0;
+ $exitcond884 = ($152|0)==($109|0);
+ if ($exitcond884) {
+ break;
+ } else {
+ $$3628808 = $152;
+ }
+ }
+ }
+ break;
+ }
+ case 4: {
+ $112 = ($109|0)>(0);
+ if ($112) {
+ $$4629806 = 0;
+ while(1) {
+ $153 = (($$1578) + ($$4629806)|0);
+ $154 = HEAP8[$153>>0]|0;
+ $155 = $154&255;
+ $156 = (($$4629806) - ($$1612))|0;
+ $157 = (($106) + ($156)|0);
+ $158 = HEAP8[$157>>0]|0;
+ $159 = $158&255;
+ $160 = (($107) + ($$4629806)|0);
+ $161 = HEAP8[$160>>0]|0;
+ $162 = $161&255;
+ $163 = (($107) + ($156)|0);
+ $164 = HEAP8[$163>>0]|0;
+ $165 = $164&255;
+ $166 = (_stbi__paeth($159,$162,$165)|0);
+ $167 = (($166) + ($155))|0;
+ $168 = $167&255;
+ $169 = (($106) + ($$4629806)|0);
+ HEAP8[$169>>0] = $168;
+ $170 = (($$4629806) + 1)|0;
+ $exitcond883 = ($170|0)==($109|0);
+ if ($exitcond883) {
+ break;
+ } else {
+ $$4629806 = $170;
+ }
+ }
+ }
+ break;
+ }
+ case 5: {
+ $111 = ($109|0)>(0);
+ if ($111) {
+ $$5630804 = 0;
+ while(1) {
+ $171 = (($$1578) + ($$5630804)|0);
+ $172 = HEAP8[$171>>0]|0;
+ $173 = $172&255;
+ $174 = (($$5630804) - ($$1612))|0;
+ $175 = (($106) + ($174)|0);
+ $176 = HEAP8[$175>>0]|0;
+ $177 = $176&255;
+ $178 = $177 >>> 1;
+ $179 = (($178) + ($173))|0;
+ $180 = $179&255;
+ $181 = (($106) + ($$5630804)|0);
+ HEAP8[$181>>0] = $180;
+ $182 = (($$5630804) + 1)|0;
+ $exitcond882 = ($182|0)==($109|0);
+ if ($exitcond882) {
+ break;
+ } else {
+ $$5630804 = $182;
+ }
+ }
+ }
+ break;
+ }
+ case 6: {
+ $110 = ($109|0)>(0);
+ if ($110) {
+ $$6631802 = 0;
+ while(1) {
+ $183 = (($$1578) + ($$6631802)|0);
+ $184 = HEAP8[$183>>0]|0;
+ $185 = $184&255;
+ $186 = (($$6631802) - ($$1612))|0;
+ $187 = (($106) + ($186)|0);
+ $188 = HEAP8[$187>>0]|0;
+ $189 = $188&255;
+ $190 = (_stbi__paeth($189,0,0)|0);
+ $191 = (($190) + ($185))|0;
+ $192 = $191&255;
+ $193 = (($106) + ($$6631802)|0);
+ HEAP8[$193>>0] = $192;
+ $194 = (($$6631802) + 1)|0;
+ $exitcond881 = ($194|0)==($109|0);
+ if ($exitcond881) {
+ break;
+ } else {
+ $$6631802 = $194;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ $195 = (($$1578) + ($109)|0);
+ $$11$ph = $195;
+ } else {
+ if (!($19)) {
+ label = 58;
+ break;
+ }
+ $trunc = $$0588&255;
+ switch ($trunc<<24>>24) {
+ case 0: {
+ if ($43) {
+ $$9586 = $$1578;
+ } else {
+ $208 = ($$1612|0)>(0);
+ $209 = Math_imul($$6620742, $$1612)|0;
+ $$0614796 = $$0614793;$$2579795 = $$1578;$$2599794 = $106;
+ while(1) {
+ if ($208) {
+ $$7632790 = 0;
+ while(1) {
+ $210 = (($$2579795) + ($$7632790)|0);
+ $211 = HEAP8[$210>>0]|0;
+ $212 = (($$2599794) + ($$7632790)|0);
+ HEAP8[$212>>0] = $211;
+ $213 = (($$7632790) + 1)|0;
+ $exitcond877 = ($213|0)==($$1612|0);
+ if ($exitcond877) {
+ break;
+ } else {
+ $$7632790 = $213;
+ }
+ }
+ }
+ $214 = (($$2599794) + ($$1612)|0);
+ HEAP8[$214>>0] = -1;
+ $215 = (($$2579795) + ($$1612)|0);
+ $216 = (($$2599794) + ($15)|0);
+ $$0614 = (($$0614796) + -1)|0;
+ $217 = ($$0614|0)==(0);
+ if ($217) {
+ break;
+ } else {
+ $$0614796 = $$0614;$$2579795 = $215;$$2599794 = $216;
+ }
+ }
+ $scevgep879 = (($$1578) + ($209)|0);
+ $$9586 = $scevgep879;
+ }
+ break;
+ }
+ case 1: {
+ if ($44) {
+ $$9586 = $$1578;
+ } else {
+ $206 = ($$1612|0)>(0);
+ $207 = Math_imul($$6620742, $$1612)|0;
+ $$1615788 = $$1615785;$$3580787 = $$1578;$$3600786 = $106;
+ while(1) {
+ if ($206) {
+ $$8633782 = 0;
+ while(1) {
+ $218 = (($$3580787) + ($$8633782)|0);
+ $219 = HEAP8[$218>>0]|0;
+ $220 = $219&255;
+ $221 = (($$8633782) - ($15))|0;
+ $222 = (($$3600786) + ($221)|0);
+ $223 = HEAP8[$222>>0]|0;
+ $224 = $223&255;
+ $225 = (($224) + ($220))|0;
+ $226 = $225&255;
+ $227 = (($$3600786) + ($$8633782)|0);
+ HEAP8[$227>>0] = $226;
+ $228 = (($$8633782) + 1)|0;
+ $exitcond875 = ($228|0)==($$1612|0);
+ if ($exitcond875) {
+ break;
+ } else {
+ $$8633782 = $228;
+ }
+ }
+ }
+ $229 = (($$3600786) + ($$1612)|0);
+ HEAP8[$229>>0] = -1;
+ $230 = (($$3580787) + ($$1612)|0);
+ $231 = (($$3600786) + ($15)|0);
+ $$1615 = (($$1615788) + -1)|0;
+ $232 = ($$1615|0)==(0);
+ if ($232) {
+ break;
+ } else {
+ $$1615788 = $$1615;$$3580787 = $230;$$3600786 = $231;
+ }
+ }
+ $scevgep876 = (($$1578) + ($207)|0);
+ $$9586 = $scevgep876;
+ }
+ break;
+ }
+ case 2: {
+ if ($45) {
+ $$9586 = $$1578;
+ } else {
+ $204 = ($$1612|0)>(0);
+ $205 = Math_imul($$6620742, $$1612)|0;
+ $$2616780 = $$2616776;$$3592778 = $107;$$4581779 = $$1578;$$4601777 = $106;
+ while(1) {
+ if ($204) {
+ $$9634773 = 0;
+ while(1) {
+ $233 = (($$4581779) + ($$9634773)|0);
+ $234 = HEAP8[$233>>0]|0;
+ $235 = $234&255;
+ $236 = (($$3592778) + ($$9634773)|0);
+ $237 = HEAP8[$236>>0]|0;
+ $238 = $237&255;
+ $239 = (($238) + ($235))|0;
+ $240 = $239&255;
+ $241 = (($$4601777) + ($$9634773)|0);
+ HEAP8[$241>>0] = $240;
+ $242 = (($$9634773) + 1)|0;
+ $exitcond873 = ($242|0)==($$1612|0);
+ if ($exitcond873) {
+ break;
+ } else {
+ $$9634773 = $242;
+ }
+ }
+ }
+ $243 = (($$4601777) + ($$1612)|0);
+ HEAP8[$243>>0] = -1;
+ $244 = (($$4581779) + ($$1612)|0);
+ $245 = (($$4601777) + ($15)|0);
+ $246 = (($$3592778) + ($15)|0);
+ $$2616 = (($$2616780) + -1)|0;
+ $247 = ($$2616|0)==(0);
+ if ($247) {
+ break;
+ } else {
+ $$2616780 = $$2616;$$3592778 = $246;$$4581779 = $244;$$4601777 = $245;
+ }
+ }
+ $scevgep874 = (($$1578) + ($205)|0);
+ $$9586 = $scevgep874;
+ }
+ break;
+ }
+ case 3: {
+ if ($46) {
+ $$9586 = $$1578;
+ } else {
+ $202 = ($$1612|0)>(0);
+ $203 = Math_imul($$6620742, $$1612)|0;
+ $$3617771 = $$3617767;$$4593769 = $107;$$5582770 = $$1578;$$5602768 = $106;
+ while(1) {
+ if ($202) {
+ $$10635764 = 0;
+ while(1) {
+ $248 = (($$5582770) + ($$10635764)|0);
+ $249 = HEAP8[$248>>0]|0;
+ $250 = $249&255;
+ $251 = (($$4593769) + ($$10635764)|0);
+ $252 = HEAP8[$251>>0]|0;
+ $253 = $252&255;
+ $254 = (($$10635764) - ($15))|0;
+ $255 = (($$5602768) + ($254)|0);
+ $256 = HEAP8[$255>>0]|0;
+ $257 = $256&255;
+ $258 = (($257) + ($253))|0;
+ $259 = $258 >>> 1;
+ $260 = (($259) + ($250))|0;
+ $261 = $260&255;
+ $262 = (($$5602768) + ($$10635764)|0);
+ HEAP8[$262>>0] = $261;
+ $263 = (($$10635764) + 1)|0;
+ $exitcond871 = ($263|0)==($$1612|0);
+ if ($exitcond871) {
+ break;
+ } else {
+ $$10635764 = $263;
+ }
+ }
+ }
+ $264 = (($$5602768) + ($$1612)|0);
+ HEAP8[$264>>0] = -1;
+ $265 = (($$5582770) + ($$1612)|0);
+ $266 = (($$5602768) + ($15)|0);
+ $267 = (($$4593769) + ($15)|0);
+ $$3617 = (($$3617771) + -1)|0;
+ $268 = ($$3617|0)==(0);
+ if ($268) {
+ break;
+ } else {
+ $$3617771 = $$3617;$$4593769 = $267;$$5582770 = $265;$$5602768 = $266;
+ }
+ }
+ $scevgep872 = (($$1578) + ($203)|0);
+ $$9586 = $scevgep872;
+ }
+ break;
+ }
+ case 4: {
+ if ($47) {
+ $$9586 = $$1578;
+ } else {
+ $200 = ($$1612|0)>(0);
+ $201 = Math_imul($$6620742, $$1612)|0;
+ $$4618762 = $$4618758;$$5594760 = $107;$$6583761 = $$1578;$$6603759 = $106;
+ while(1) {
+ if ($200) {
+ $$11636755 = 0;
+ while(1) {
+ $269 = (($$6583761) + ($$11636755)|0);
+ $270 = HEAP8[$269>>0]|0;
+ $271 = $270&255;
+ $272 = (($$11636755) - ($15))|0;
+ $273 = (($$6603759) + ($272)|0);
+ $274 = HEAP8[$273>>0]|0;
+ $275 = $274&255;
+ $276 = (($$5594760) + ($$11636755)|0);
+ $277 = HEAP8[$276>>0]|0;
+ $278 = $277&255;
+ $279 = (($$5594760) + ($272)|0);
+ $280 = HEAP8[$279>>0]|0;
+ $281 = $280&255;
+ $282 = (_stbi__paeth($275,$278,$281)|0);
+ $283 = (($282) + ($271))|0;
+ $284 = $283&255;
+ $285 = (($$6603759) + ($$11636755)|0);
+ HEAP8[$285>>0] = $284;
+ $286 = (($$11636755) + 1)|0;
+ $exitcond869 = ($286|0)==($$1612|0);
+ if ($exitcond869) {
+ break;
+ } else {
+ $$11636755 = $286;
+ }
+ }
+ }
+ $287 = (($$6603759) + ($$1612)|0);
+ HEAP8[$287>>0] = -1;
+ $288 = (($$6583761) + ($$1612)|0);
+ $289 = (($$6603759) + ($15)|0);
+ $290 = (($$5594760) + ($15)|0);
+ $$4618 = (($$4618762) + -1)|0;
+ $291 = ($$4618|0)==(0);
+ if ($291) {
+ break;
+ } else {
+ $$4618762 = $$4618;$$5594760 = $290;$$6583761 = $288;$$6603759 = $289;
+ }
+ }
+ $scevgep870 = (($$1578) + ($201)|0);
+ $$9586 = $scevgep870;
+ }
+ break;
+ }
+ case 5: {
+ if ($48) {
+ $$9586 = $$1578;
+ } else {
+ $198 = ($$1612|0)>(0);
+ $199 = Math_imul($$6620742, $$1612)|0;
+ $$5619753 = $$5619750;$$7584752 = $$1578;$$7604751 = $106;
+ while(1) {
+ if ($198) {
+ $$12747 = 0;
+ while(1) {
+ $292 = (($$7584752) + ($$12747)|0);
+ $293 = HEAP8[$292>>0]|0;
+ $294 = $293&255;
+ $295 = (($$12747) - ($15))|0;
+ $296 = (($$7604751) + ($295)|0);
+ $297 = HEAP8[$296>>0]|0;
+ $298 = $297&255;
+ $299 = $298 >>> 1;
+ $300 = (($299) + ($294))|0;
+ $301 = $300&255;
+ $302 = (($$7604751) + ($$12747)|0);
+ HEAP8[$302>>0] = $301;
+ $303 = (($$12747) + 1)|0;
+ $exitcond867 = ($303|0)==($$1612|0);
+ if ($exitcond867) {
+ break;
+ } else {
+ $$12747 = $303;
+ }
+ }
+ }
+ $304 = (($$7604751) + ($$1612)|0);
+ HEAP8[$304>>0] = -1;
+ $305 = (($$7584752) + ($$1612)|0);
+ $306 = (($$7604751) + ($15)|0);
+ $$5619 = (($$5619753) + -1)|0;
+ $307 = ($$5619|0)==(0);
+ if ($307) {
+ break;
+ } else {
+ $$5619753 = $$5619;$$7584752 = $305;$$7604751 = $306;
+ }
+ }
+ $scevgep868 = (($$1578) + ($199)|0);
+ $$9586 = $scevgep868;
+ }
+ break;
+ }
+ case 6: {
+ if ($49) {
+ $$9586 = $$1578;
+ } else {
+ $196 = ($$1612|0)>(0);
+ $197 = Math_imul($$6620742, $$1612)|0;
+ $$6620745 = $$6620742;$$8585744 = $$1578;$$8605743 = $106;
+ while(1) {
+ if ($196) {
+ $$13739 = 0;
+ while(1) {
+ $308 = (($$8585744) + ($$13739)|0);
+ $309 = HEAP8[$308>>0]|0;
+ $310 = $309&255;
+ $311 = (($$13739) - ($15))|0;
+ $312 = (($$8605743) + ($311)|0);
+ $313 = HEAP8[$312>>0]|0;
+ $314 = $313&255;
+ $315 = (_stbi__paeth($314,0,0)|0);
+ $316 = (($315) + ($310))|0;
+ $317 = $316&255;
+ $318 = (($$8605743) + ($$13739)|0);
+ HEAP8[$318>>0] = $317;
+ $319 = (($$13739) + 1)|0;
+ $exitcond865 = ($319|0)==($$1612|0);
+ if ($exitcond865) {
+ break;
+ } else {
+ $$13739 = $319;
+ }
+ }
+ }
+ $320 = (($$8605743) + ($$1612)|0);
+ HEAP8[$320>>0] = -1;
+ $321 = (($$8585744) + ($$1612)|0);
+ $322 = (($$8605743) + ($15)|0);
+ $$6620 = (($$6620745) + -1)|0;
+ $323 = ($$6620|0)==(0);
+ if ($323) {
+ break;
+ } else {
+ $$6620745 = $$6620;$$8585744 = $321;$$8605743 = $322;
+ }
+ }
+ $scevgep866 = (($$1578) + ($197)|0);
+ $$9586 = $scevgep866;
+ }
+ break;
+ }
+ default: {
+ $$9586 = $$1578;
+ }
+ }
+ if ($brmerge894) {
+ $$11$ph = $$9586;
+ } else {
+ $324 = HEAP32[$21>>2]|0;
+ $325 = (($324) + ($51)|0);
+ $326 = (($$1612) + 1)|0;
+ $$7621798 = 0;$$9606799 = $325;
+ while(1) {
+ $327 = (($$9606799) + ($326)|0);
+ HEAP8[$327>>0] = -1;
+ $328 = (($$7621798) + 1)|0;
+ $329 = (($$9606799) + ($15)|0);
+ $exitcond880 = ($328|0)==($4|0);
+ if ($exitcond880) {
+ $$11$ph = $$9586;
+ break;
+ } else {
+ $$7621798 = $328;$$9606799 = $329;
+ }
+ }
+ }
+ }
+ $330 = (($$0623814) + 1)|0;
+ $331 = ($330>>>0)<($5>>>0);
+ if ($331) {
+ $$0577817 = $$11$ph;$$0608816 = $$1609;$$0611815 = $$1612;$$0623814 = $330;
+ } else {
+ break L18;
+ }
+ }
+ if ((label|0) == 16) {
+ ___assert_fail((7252|0),(6620|0),4315,(7207|0));
+ // unreachable;
+ }
+ else if ((label|0) == 58) {
+ ___assert_fail((7278|0),(6620|0),4377,(7207|0));
+ // unreachable;
+ }
+ else if ((label|0) == 105) {
+ _stbi__err(7295);
+ $$2 = 0;
+ return ($$2|0);
+ }
+ }
+ } while(0);
+ $332 = ($6|0)<(8);
+ if (!($332)) {
+ if (!($8)) {
+ $$2 = 1;
+ return ($$2|0);
+ }
+ $601 = Math_imul($4, $3)|0;
+ $602 = Math_imul($601, $5)|0;
+ $603 = ($602|0)==(0);
+ if ($603) {
+ $$2 = 1;
+ return ($$2|0);
+ }
+ $604 = HEAP32[$21>>2]|0;
+ $$0731 = $604;$$8622729 = 0;
+ while(1) {
+ $605 = HEAP8[$$0731>>0]|0;
+ $606 = $605&255;
+ $607 = $606 << 8;
+ $608 = ((($$0731)) + 1|0);
+ $609 = HEAP8[$608>>0]|0;
+ $610 = $609&255;
+ $611 = $607 | $610;
+ $612 = $611&65535;
+ HEAP16[$$0731>>1] = $612;
+ $613 = (($$8622729) + 1)|0;
+ $614 = ((($$0731)) + 2|0);
+ $exitcond = ($613|0)==($602|0);
+ if ($exitcond) {
+ $$2 = 1;
+ break;
+ } else {
+ $$0731 = $614;$$8622729 = $613;
+ }
+ }
+ return ($$2|0);
+ }
+ $333 = ($5|0)==(0);
+ if ($333) {
+ $$2 = 1;
+ return ($$2|0);
+ }
+ $334 = (0 - ($26))|0;
+ $335 = ($7|0)==(0);
+ $336 = (6991 + ($6)|0);
+ $$0568724 = (($4) + -1)|0;
+ $337 = ($$0568724|0)>(-1);
+ $$1721 = (($4) + -1)|0;
+ $338 = ($$1721|0)>(-1);
+ $339 = ($23|0)>(1);
+ $340 = ($23|0)>(3);
+ $341 = ($23|0)>(7);
+ $342 = (($23) + -8)|0;
+ $343 = $342 >>> 3;
+ $344 = $343 << 3;
+ $345 = (($344) + 8)|0;
+ $346 = (($342) - ($344))|0;
+ $347 = (($343) + ($11))|0;
+ $348 = (($347) + 1)|0;
+ $349 = (($348) - ($26))|0;
+ $350 = (($23) + -4)|0;
+ $351 = $350 >>> 2;
+ $352 = $351 << 2;
+ $353 = (($352) + 4)|0;
+ $354 = (($350) - ($352))|0;
+ $355 = (($351) + ($11))|0;
+ $356 = (($355) + 1)|0;
+ $357 = (($356) - ($26))|0;
+ $358 = (($23) + -2)|0;
+ $359 = $358 >>> 1;
+ $360 = $359 << 1;
+ $361 = (($360) + 2)|0;
+ $362 = (($358) - ($360))|0;
+ $363 = (($359) + ($11))|0;
+ $364 = (($363) + 1)|0;
+ $365 = (($364) - ($26))|0;
+ $$1624727 = 0;$indvars$iv = $345;$indvars$iv848 = $349;$indvars$iv851 = $353;$indvars$iv854 = $357;$indvars$iv857 = $361;$indvars$iv860 = $365;
+ L174: while(1) {
+ $366 = HEAP32[$21>>2]|0;
+ $367 = Math_imul($$1624727, $12)|0;
+ $368 = (($366) + ($367)|0);
+ $369 = (($368) + ($11)|0);
+ $370 = (($369) + ($334)|0);
+ if ($335) {
+ $371 = HEAP8[$336>>0]|0;
+ $372 = $371&255;
+ $377 = $372;
+ } else {
+ $377 = 1;
+ }
+ switch ($6|0) {
+ case 4: {
+ if ($339) {
+ $scevgep859 = (($366) + ($indvars$iv857)|0);
+ $$0571715 = $370;$$0574714 = $368;$$14713 = $23;
+ while(1) {
+ $373 = HEAP8[$$0571715>>0]|0;
+ $374 = $373&255;
+ $375 = $374 >>> 4;
+ $376 = Math_imul($375, $377)|0;
+ $378 = $376&255;
+ $379 = ((($$0574714)) + 1|0);
+ HEAP8[$$0574714>>0] = $378;
+ $380 = HEAP8[$$0571715>>0]|0;
+ $381 = $380 & 15;
+ $382 = $381&255;
+ $383 = Math_imul($382, $377)|0;
+ $384 = $383&255;
+ $385 = ((($$0574714)) + 2|0);
+ HEAP8[$379>>0] = $384;
+ $386 = (($$14713) + -2)|0;
+ $387 = ((($$0571715)) + 1|0);
+ $388 = ($386|0)>(1);
+ if ($388) {
+ $$0571715 = $387;$$0574714 = $385;$$14713 = $386;
+ } else {
+ break;
+ }
+ }
+ $scevgep862 = (($366) + ($indvars$iv860)|0);
+ $$0571$lcssa = $scevgep862;$$0574$lcssa = $scevgep859;$$14$lcssa = $362;
+ } else {
+ $$0571$lcssa = $370;$$0574$lcssa = $368;$$14$lcssa = $23;
+ }
+ $389 = ($$14$lcssa|0)==(1);
+ if ($389) {
+ $390 = HEAP8[$$0571$lcssa>>0]|0;
+ $391 = $390&255;
+ $392 = $391 >>> 4;
+ $393 = Math_imul($392, $377)|0;
+ $394 = $393&255;
+ HEAP8[$$0574$lcssa>>0] = $394;
+ }
+ break;
+ }
+ case 2: {
+ if ($340) {
+ $scevgep853 = (($366) + ($indvars$iv851)|0);
+ $$15705 = $23;$$1572707 = $370;$$1575706 = $368;
+ while(1) {
+ $395 = HEAP8[$$1572707>>0]|0;
+ $396 = $395&255;
+ $397 = $396 >>> 6;
+ $398 = Math_imul($397, $377)|0;
+ $399 = $398&255;
+ $400 = ((($$1575706)) + 1|0);
+ HEAP8[$$1575706>>0] = $399;
+ $401 = HEAP8[$$1572707>>0]|0;
+ $402 = $401&255;
+ $403 = $402 >>> 4;
+ $404 = $403 & 3;
+ $405 = Math_imul($404, $377)|0;
+ $406 = $405&255;
+ $407 = ((($$1575706)) + 2|0);
+ HEAP8[$400>>0] = $406;
+ $408 = HEAP8[$$1572707>>0]|0;
+ $409 = $408&255;
+ $410 = $409 >>> 2;
+ $411 = $410 & 3;
+ $412 = Math_imul($411, $377)|0;
+ $413 = $412&255;
+ $414 = ((($$1575706)) + 3|0);
+ HEAP8[$407>>0] = $413;
+ $415 = HEAP8[$$1572707>>0]|0;
+ $416 = $415 & 3;
+ $417 = $416&255;
+ $418 = Math_imul($417, $377)|0;
+ $419 = $418&255;
+ $420 = ((($$1575706)) + 4|0);
+ HEAP8[$414>>0] = $419;
+ $421 = (($$15705) + -4)|0;
+ $422 = ((($$1572707)) + 1|0);
+ $423 = ($421|0)>(3);
+ if ($423) {
+ $$15705 = $421;$$1572707 = $422;$$1575706 = $420;
+ } else {
+ break;
+ }
+ }
+ $scevgep856 = (($366) + ($indvars$iv854)|0);
+ $$15$lcssa = $354;$$1572$lcssa = $scevgep856;$$1575$lcssa = $scevgep853;
+ } else {
+ $$15$lcssa = $23;$$1572$lcssa = $370;$$1575$lcssa = $368;
+ }
+ $424 = ($$15$lcssa|0)>(0);
+ if ($424) {
+ $425 = HEAP8[$$1572$lcssa>>0]|0;
+ $426 = $425&255;
+ $427 = $426 >>> 6;
+ $428 = Math_imul($427, $377)|0;
+ $429 = $428&255;
+ HEAP8[$$1575$lcssa>>0] = $429;
+ $430 = ($$15$lcssa|0)==(1);
+ if (!($430)) {
+ $431 = ((($$1575$lcssa)) + 1|0);
+ $432 = HEAP8[$$1572$lcssa>>0]|0;
+ $433 = $432&255;
+ $434 = $433 >>> 4;
+ $435 = $434 & 3;
+ $436 = Math_imul($435, $377)|0;
+ $437 = $436&255;
+ HEAP8[$431>>0] = $437;
+ $438 = ($$15$lcssa|0)>(2);
+ if ($438) {
+ $439 = ((($$1575$lcssa)) + 2|0);
+ $440 = HEAP8[$$1572$lcssa>>0]|0;
+ $441 = $440&255;
+ $442 = $441 >>> 2;
+ $443 = $442 & 3;
+ $444 = Math_imul($443, $377)|0;
+ $445 = $444&255;
+ HEAP8[$439>>0] = $445;
+ }
+ }
+ }
+ break;
+ }
+ case 1: {
+ if ($341) {
+ $scevgep = (($366) + ($indvars$iv)|0);
+ $$16700 = $23;$$2573702 = $370;$$4701 = $368;
+ while(1) {
+ $446 = HEAP8[$$2573702>>0]|0;
+ $447 = $446&255;
+ $448 = $447 >>> 7;
+ $449 = (0 - ($448))|0;
+ $450 = $377 & $449;
+ $451 = $450&255;
+ $452 = ((($$4701)) + 1|0);
+ HEAP8[$$4701>>0] = $451;
+ $453 = HEAP8[$$2573702>>0]|0;
+ $454 = $453&255;
+ $455 = $454 >>> 6;
+ $456 = $455 & 1;
+ $457 = (0 - ($456))|0;
+ $458 = $377 & $457;
+ $459 = $458&255;
+ $460 = ((($$4701)) + 2|0);
+ HEAP8[$452>>0] = $459;
+ $461 = HEAP8[$$2573702>>0]|0;
+ $462 = $461&255;
+ $463 = $462 >>> 5;
+ $464 = $463 & 1;
+ $465 = (0 - ($464))|0;
+ $466 = $377 & $465;
+ $467 = $466&255;
+ $468 = ((($$4701)) + 3|0);
+ HEAP8[$460>>0] = $467;
+ $469 = HEAP8[$$2573702>>0]|0;
+ $470 = $469&255;
+ $471 = $470 >>> 4;
+ $472 = $471 & 1;
+ $473 = (0 - ($472))|0;
+ $474 = $377 & $473;
+ $475 = $474&255;
+ $476 = ((($$4701)) + 4|0);
+ HEAP8[$468>>0] = $475;
+ $477 = HEAP8[$$2573702>>0]|0;
+ $478 = $477&255;
+ $479 = $478 >>> 3;
+ $480 = $479 & 1;
+ $481 = (0 - ($480))|0;
+ $482 = $377 & $481;
+ $483 = $482&255;
+ $484 = ((($$4701)) + 5|0);
+ HEAP8[$476>>0] = $483;
+ $485 = HEAP8[$$2573702>>0]|0;
+ $486 = $485&255;
+ $487 = $486 >>> 2;
+ $488 = $487 & 1;
+ $489 = (0 - ($488))|0;
+ $490 = $377 & $489;
+ $491 = $490&255;
+ $492 = ((($$4701)) + 6|0);
+ HEAP8[$484>>0] = $491;
+ $493 = HEAP8[$$2573702>>0]|0;
+ $494 = $493&255;
+ $495 = $494 >>> 1;
+ $496 = $495 & 1;
+ $497 = (0 - ($496))|0;
+ $498 = $377 & $497;
+ $499 = $498&255;
+ $500 = ((($$4701)) + 7|0);
+ HEAP8[$492>>0] = $499;
+ $501 = HEAP8[$$2573702>>0]|0;
+ $502 = $501 & 1;
+ $503 = $502&255;
+ $504 = (0 - ($503))|0;
+ $505 = $377 & $504;
+ $506 = $505&255;
+ $507 = ((($$4701)) + 8|0);
+ HEAP8[$500>>0] = $506;
+ $508 = (($$16700) + -8)|0;
+ $509 = ((($$2573702)) + 1|0);
+ $510 = ($508|0)>(7);
+ if ($510) {
+ $$16700 = $508;$$2573702 = $509;$$4701 = $507;
+ } else {
+ break;
+ }
+ }
+ $scevgep850 = (($366) + ($indvars$iv848)|0);
+ $$16$lcssa = $346;$$2573$lcssa = $scevgep850;$$4$lcssa = $scevgep;
+ } else {
+ $$16$lcssa = $23;$$2573$lcssa = $370;$$4$lcssa = $368;
+ }
+ $511 = ($$16$lcssa|0)>(0);
+ if ($511) {
+ $512 = HEAP8[$$2573$lcssa>>0]|0;
+ $513 = $512&255;
+ $514 = $513 >>> 7;
+ $515 = (0 - ($514))|0;
+ $516 = $377 & $515;
+ $517 = $516&255;
+ HEAP8[$$4$lcssa>>0] = $517;
+ $518 = ($$16$lcssa|0)==(1);
+ if (!($518)) {
+ $519 = ((($$4$lcssa)) + 1|0);
+ $520 = HEAP8[$$2573$lcssa>>0]|0;
+ $521 = $520&255;
+ $522 = $521 >>> 6;
+ $523 = $522 & 1;
+ $524 = (0 - ($523))|0;
+ $525 = $377 & $524;
+ $526 = $525&255;
+ HEAP8[$519>>0] = $526;
+ $527 = ($$16$lcssa|0)>(2);
+ if ($527) {
+ $528 = ((($$4$lcssa)) + 2|0);
+ $529 = HEAP8[$$2573$lcssa>>0]|0;
+ $530 = $529&255;
+ $531 = $530 >>> 5;
+ $532 = $531 & 1;
+ $533 = (0 - ($532))|0;
+ $534 = $377 & $533;
+ $535 = $534&255;
+ HEAP8[$528>>0] = $535;
+ $536 = ($$16$lcssa|0)==(3);
+ if (!($536)) {
+ $537 = ((($$4$lcssa)) + 3|0);
+ $538 = HEAP8[$$2573$lcssa>>0]|0;
+ $539 = $538&255;
+ $540 = $539 >>> 4;
+ $541 = $540 & 1;
+ $542 = (0 - ($541))|0;
+ $543 = $377 & $542;
+ $544 = $543&255;
+ HEAP8[$537>>0] = $544;
+ $545 = ($$16$lcssa|0)>(4);
+ if ($545) {
+ $546 = ((($$4$lcssa)) + 4|0);
+ $547 = HEAP8[$$2573$lcssa>>0]|0;
+ $548 = $547&255;
+ $549 = $548 >>> 3;
+ $550 = $549 & 1;
+ $551 = (0 - ($550))|0;
+ $552 = $377 & $551;
+ $553 = $552&255;
+ HEAP8[$546>>0] = $553;
+ $554 = ($$16$lcssa|0)==(5);
+ if (!($554)) {
+ $555 = ((($$4$lcssa)) + 5|0);
+ $556 = HEAP8[$$2573$lcssa>>0]|0;
+ $557 = $556&255;
+ $558 = $557 >>> 2;
+ $559 = $558 & 1;
+ $560 = (0 - ($559))|0;
+ $561 = $377 & $560;
+ $562 = $561&255;
+ HEAP8[$555>>0] = $562;
+ $563 = ($$16$lcssa|0)>(6);
+ if ($563) {
+ $564 = ((($$4$lcssa)) + 6|0);
+ $565 = HEAP8[$$2573$lcssa>>0]|0;
+ $566 = $565&255;
+ $567 = $566 >>> 1;
+ $568 = $567 & 1;
+ $569 = (0 - ($568))|0;
+ $570 = $377 & $569;
+ $571 = $570&255;
+ HEAP8[$564>>0] = $571;
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ }
+ }
+ L213: do {
+ if (!($17)) {
+ $572 = HEAP32[$21>>2]|0;
+ $573 = (($572) + ($367)|0);
+ switch ($14|0) {
+ case 1: {
+ if ($337) {
+ $$0568725 = $$0568724;
+ } else {
+ break L213;
+ }
+ while(1) {
+ $574 = $$0568725 << 1;
+ $575 = $574 | 1;
+ $576 = (($573) + ($575)|0);
+ HEAP8[$576>>0] = -1;
+ $577 = (($573) + ($$0568725)|0);
+ $578 = HEAP8[$577>>0]|0;
+ $579 = (($573) + ($574)|0);
+ HEAP8[$579>>0] = $578;
+ $$0568 = (($$0568725) + -1)|0;
+ $580 = ($$0568|0)>(-1);
+ if ($580) {
+ $$0568725 = $$0568;
+ } else {
+ break;
+ }
+ }
+ break;
+ }
+ case 3: {
+ if ($338) {
+ $$1722 = $$1721;
+ } else {
+ break L213;
+ }
+ while(1) {
+ $581 = $$1722 << 2;
+ $582 = $581 | 3;
+ $583 = (($573) + ($582)|0);
+ HEAP8[$583>>0] = -1;
+ $584 = ($$1722*3)|0;
+ $585 = (($584) + 2)|0;
+ $586 = (($573) + ($585)|0);
+ $587 = HEAP8[$586>>0]|0;
+ $588 = $581 | 2;
+ $589 = (($573) + ($588)|0);
+ HEAP8[$589>>0] = $587;
+ $590 = (($584) + 1)|0;
+ $591 = (($573) + ($590)|0);
+ $592 = HEAP8[$591>>0]|0;
+ $593 = $581 | 1;
+ $594 = (($573) + ($593)|0);
+ HEAP8[$594>>0] = $592;
+ $595 = (($573) + ($584)|0);
+ $596 = HEAP8[$595>>0]|0;
+ $597 = (($573) + ($581)|0);
+ HEAP8[$597>>0] = $596;
+ $$1 = (($$1722) + -1)|0;
+ $598 = ($$1|0)>(-1);
+ if ($598) {
+ $$1722 = $$1;
+ } else {
+ break;
+ }
+ }
+ break;
+ }
+ default: {
+ label = 144;
+ break L174;
+ }
+ }
+ }
+ } while(0);
+ $599 = (($$1624727) + 1)|0;
+ $600 = ($599>>>0)<($5>>>0);
+ $indvars$iv$next = (($indvars$iv) + ($12))|0;
+ $indvars$iv$next849 = (($indvars$iv848) + ($12))|0;
+ $indvars$iv$next852 = (($indvars$iv851) + ($12))|0;
+ $indvars$iv$next855 = (($indvars$iv854) + ($12))|0;
+ $indvars$iv$next858 = (($indvars$iv857) + ($12))|0;
+ $indvars$iv$next861 = (($indvars$iv860) + ($12))|0;
+ if ($600) {
+ $$1624727 = $599;$indvars$iv = $indvars$iv$next;$indvars$iv848 = $indvars$iv$next849;$indvars$iv851 = $indvars$iv$next852;$indvars$iv854 = $indvars$iv$next855;$indvars$iv857 = $indvars$iv$next858;$indvars$iv860 = $indvars$iv$next861;
+ } else {
+ $$2 = 1;
+ label = 151;
+ break;
+ }
+ }
+ if ((label|0) == 144) {
+ ___assert_fail((7310|0),(6620|0),4466,(7207|0));
+ // unreachable;
+ }
+ else if ((label|0) == 151) {
+ return ($$2|0);
+ }
+ return (0)|0;
+}
+function _stbi__paeth($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $ispos = 0, $ispos26 = 0, $ispos28 = 0, $neg = 0, $neg27 = 0, $neg29 = 0, $or$cond = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (($1) + ($0))|0;
+ $4 = (($3) - ($2))|0;
+ $5 = (($4) - ($0))|0;
+ $ispos = ($5|0)>(-1);
+ $neg = (0 - ($5))|0;
+ $6 = $ispos ? $5 : $neg;
+ $7 = (($4) - ($1))|0;
+ $ispos26 = ($7|0)>(-1);
+ $neg27 = (0 - ($7))|0;
+ $8 = $ispos26 ? $7 : $neg27;
+ $9 = (($4) - ($2))|0;
+ $ispos28 = ($9|0)>(-1);
+ $neg29 = (0 - ($9))|0;
+ $10 = $ispos28 ? $9 : $neg29;
+ $11 = ($6|0)>($8|0);
+ $12 = ($6|0)>($10|0);
+ $or$cond = $11 | $12;
+ $13 = ($8|0)>($10|0);
+ $$ = $13 ? $2 : $1;
+ $$0 = $or$cond ? $$ : $0;
+ return ($$0|0);
+}
+function _stbi__do_zlib($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $10 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = ((($0)) + 20|0);
+ HEAP32[$5>>2] = $1;
+ $6 = ((($0)) + 16|0);
+ HEAP32[$6>>2] = $1;
+ $7 = (($1) + ($2)|0);
+ $8 = ((($0)) + 24|0);
+ HEAP32[$8>>2] = $7;
+ $9 = ((($0)) + 28|0);
+ HEAP32[$9>>2] = $3;
+ $10 = (_stbi__parse_zlib($0,$4)|0);
+ return ($10|0);
+}
+function _stbi__parse_zlib($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)==(0);
+ if (!($2)) {
+ $3 = (_stbi__parse_zlib_header($0)|0);
+ $4 = ($3|0)==(0);
+ if ($4) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ }
+ $5 = ((($0)) + 8|0);
+ HEAP32[$5>>2] = 0;
+ $6 = ((($0)) + 12|0);
+ HEAP32[$6>>2] = 0;
+ $7 = ((($0)) + 32|0);
+ $8 = ((($0)) + 2052|0);
+ L5: while(1) {
+ $9 = (_stbi__zreceive($0,1)|0);
+ $10 = (_stbi__zreceive($0,2)|0);
+ switch ($10|0) {
+ case 3: {
+ $$0 = 0;
+ label = 11;
+ break L5;
+ break;
+ }
+ case 0: {
+ $11 = (_stbi__parse_uncompressed_block($0)|0);
+ $12 = ($11|0)==(0);
+ if ($12) {
+ $$0 = 0;
+ label = 11;
+ break L5;
+ }
+ break;
+ }
+ case 1: {
+ $13 = (_stbi__zbuild_huffman($7,7321,288)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $$0 = 0;
+ label = 11;
+ break L5;
+ }
+ $15 = (_stbi__zbuild_huffman($8,7609,32)|0);
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$0 = 0;
+ label = 11;
+ break L5;
+ } else {
+ label = 9;
+ }
+ break;
+ }
+ default: {
+ $17 = (_stbi__compute_huffman_codes($0)|0);
+ $18 = ($17|0)==(0);
+ if ($18) {
+ $$0 = 0;
+ label = 11;
+ break L5;
+ } else {
+ label = 9;
+ }
+ }
+ }
+ if ((label|0) == 9) {
+ label = 0;
+ $19 = (_stbi__parse_huffman_block($0)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $$0 = 0;
+ label = 11;
+ break;
+ }
+ }
+ $21 = ($9|0)==(0);
+ if (!($21)) {
+ $$0 = 1;
+ label = 11;
+ break;
+ }
+ }
+ if ((label|0) == 11) {
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__parse_zlib_header($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_stbi__zget8($0)|0);
+ $2 = $1&255;
+ $3 = $2 & 15;
+ $4 = (_stbi__zget8($0)|0);
+ $5 = $4&255;
+ $6 = $2 << 8;
+ $7 = $6 | $5;
+ $8 = (($7>>>0) % 31)&-1;
+ $9 = ($8|0)==(0);
+ if (!($9)) {
+ _stbi__err(7975);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $10 = $5 & 32;
+ $11 = ($10|0)==(0);
+ if (!($11)) {
+ _stbi__err(7991);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $12 = ($3|0)==(8);
+ if ($12) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ _stbi__err(8006);
+ $$0 = 0;
+ return ($$0|0);
+}
+function _stbi__zreceive($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)<($1|0);
+ if ($4) {
+ _stbi__fill_bits($0);
+ }
+ $5 = ((($0)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = 1 << $1;
+ $8 = (($7) + -1)|0;
+ $9 = $6 & $8;
+ $10 = $6 >>> $1;
+ HEAP32[$5>>2] = $10;
+ $11 = HEAP32[$2>>2]|0;
+ $12 = (($11) - ($1))|0;
+ HEAP32[$2>>2] = $12;
+ return ($9|0);
+}
+function _stbi__parse_uncompressed_block($0) {
+ $0 = $0|0;
+ var $$0$lcssa = 0, $$034 = 0, $$037 = 0, $$136 = 0, $$lcssa = 0, $$ph = 0, $$pr = 0, $$promoted = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
+ var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0;
+ var $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $exitcond47 = 0, $smax = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp;
+ $2 = ((($0)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = $3 & 7;
+ $5 = ($4|0)==(0);
+ if ($5) {
+ $$ph = $3;
+ } else {
+ (_stbi__zreceive($0,$4)|0);
+ $$pr = HEAP32[$2>>2]|0;
+ $$ph = $$pr;
+ }
+ $6 = ($$ph|0)>(0);
+ if ($6) {
+ $7 = ((($0)) + 12|0);
+ $$promoted = HEAP32[$7>>2]|0;
+ $8 = $$ph ^ -1;
+ $9 = ($8|0)>(-9);
+ $smax = $9 ? $8 : -9;
+ $10 = (($$ph) + ($smax))|0;
+ $11 = (($10) + 8)|0;
+ $12 = $11 >>> 3;
+ $13 = (($12) + 1)|0;
+ $14 = $12 << 3;
+ $$037 = 0;$16 = $$promoted;
+ while(1) {
+ $15 = $16&255;
+ $17 = (($$037) + 1)|0;
+ $18 = (($1) + ($$037)|0);
+ HEAP8[$18>>0] = $15;
+ $19 = $16 >>> 8;
+ $exitcond47 = ($17|0)==($13|0);
+ if ($exitcond47) {
+ break;
+ } else {
+ $$037 = $17;$16 = $19;
+ }
+ }
+ $20 = (($$ph) + -8)|0;
+ $21 = (($20) - ($14))|0;
+ HEAP32[$7>>2] = $19;
+ HEAP32[$2>>2] = $21;
+ $$0$lcssa = $13;$$lcssa = $21;
+ } else {
+ $$0$lcssa = 0;$$lcssa = $$ph;
+ }
+ $22 = ($$lcssa|0)==(0);
+ if (!($22)) {
+ ___assert_fail((7897|0),(6620|0),4033,(7914|0));
+ // unreachable;
+ }
+ $23 = ($$0$lcssa|0)<(4);
+ if ($23) {
+ $$136 = $$0$lcssa;
+ while(1) {
+ $24 = (_stbi__zget8($0)|0);
+ $25 = (($$136) + 1)|0;
+ $26 = (($1) + ($$136)|0);
+ HEAP8[$26>>0] = $24;
+ $exitcond = ($25|0)==(4);
+ if ($exitcond) {
+ break;
+ } else {
+ $$136 = $25;
+ }
+ }
+ }
+ $27 = ((($1)) + 1|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = $28&255;
+ $30 = $29 << 8;
+ $31 = HEAP8[$1>>0]|0;
+ $32 = $31&255;
+ $33 = $30 | $32;
+ $34 = ((($1)) + 3|0);
+ $35 = HEAP8[$34>>0]|0;
+ $36 = $35&255;
+ $37 = $36 << 8;
+ $38 = ((($1)) + 2|0);
+ $39 = HEAP8[$38>>0]|0;
+ $40 = $39&255;
+ $41 = $37 | $40;
+ $42 = $33 ^ 65535;
+ $43 = ($41|0)==($42|0);
+ if (!($43)) {
+ _stbi__err(7945);
+ $$034 = 0;
+ STACKTOP = sp;return ($$034|0);
+ }
+ $44 = HEAP32[$0>>2]|0;
+ $45 = (($44) + ($33)|0);
+ $46 = ((($0)) + 4|0);
+ $47 = HEAP32[$46>>2]|0;
+ $48 = ($45>>>0)>($47>>>0);
+ if ($48) {
+ _stbi__err(7958);
+ $$034 = 0;
+ STACKTOP = sp;return ($$034|0);
+ }
+ $49 = ((($0)) + 16|0);
+ $50 = HEAP32[$49>>2]|0;
+ $51 = (($50) + ($33)|0);
+ $52 = ((($0)) + 24|0);
+ $53 = HEAP32[$52>>2]|0;
+ $54 = ($51>>>0)>($53>>>0);
+ if ($54) {
+ $55 = (_stbi__zexpand($0,$50,$33)|0);
+ $56 = ($55|0)==(0);
+ if ($56) {
+ $$034 = 0;
+ STACKTOP = sp;return ($$034|0);
+ }
+ }
+ $57 = HEAP32[$49>>2]|0;
+ $58 = HEAP32[$0>>2]|0;
+ _memcpy(($57|0),($58|0),($33|0))|0;
+ $59 = HEAP32[$0>>2]|0;
+ $60 = (($59) + ($33)|0);
+ HEAP32[$0>>2] = $60;
+ $61 = HEAP32[$49>>2]|0;
+ $62 = (($61) + ($33)|0);
+ HEAP32[$49>>2] = $62;
+ $$034 = 1;
+ STACKTOP = sp;return ($$034|0);
+}
+function _stbi__zbuild_huffman($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$075 = 0, $$07688 = 0, $$07785 = 0, $$07884 = 0, $$081 = 0, $$286 = 0, $$382 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
+ var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond91 = 0, $or$cond = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
+ $3 = sp + 72|0;
+ $4 = sp;
+ dest=$4; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ _memset(($0|0),0,1024)|0;
+ $5 = ($2|0)>(0);
+ if ($5) {
+ $$07688 = 0;
+ while(1) {
+ $6 = (($1) + ($$07688)|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = $7&255;
+ $9 = (($4) + ($8<<2)|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (($10) + 1)|0;
+ HEAP32[$9>>2] = $11;
+ $12 = (($$07688) + 1)|0;
+ $exitcond91 = ($12|0)==($2|0);
+ if ($exitcond91) {
+ break;
+ } else {
+ $$07688 = $12;
+ }
+ }
+ }
+ HEAP32[$4>>2] = 0;
+ $16 = ((($4)) + 4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ($17|0)>(2);
+ if (!($18)) {
+ $13 = ((($4)) + 8|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ($14|0)>(4);
+ if (!($15)) {
+ $69 = ((($4)) + 12|0);
+ $70 = HEAP32[$69>>2]|0;
+ $71 = ($70|0)>(8);
+ if (!($71)) {
+ $72 = ((($4)) + 16|0);
+ $73 = HEAP32[$72>>2]|0;
+ $74 = ($73|0)>(16);
+ if (!($74)) {
+ $75 = ((($4)) + 20|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = ($76|0)>(32);
+ if (!($77)) {
+ $78 = ((($4)) + 24|0);
+ $79 = HEAP32[$78>>2]|0;
+ $80 = ($79|0)>(64);
+ if (!($80)) {
+ $81 = ((($4)) + 28|0);
+ $82 = HEAP32[$81>>2]|0;
+ $83 = ($82|0)>(128);
+ if (!($83)) {
+ $84 = ((($4)) + 32|0);
+ $85 = HEAP32[$84>>2]|0;
+ $86 = ($85|0)>(256);
+ if (!($86)) {
+ $87 = ((($4)) + 36|0);
+ $88 = HEAP32[$87>>2]|0;
+ $89 = ($88|0)>(512);
+ if (!($89)) {
+ $90 = ((($4)) + 40|0);
+ $91 = HEAP32[$90>>2]|0;
+ $92 = ($91|0)>(1024);
+ if (!($92)) {
+ $93 = ((($4)) + 44|0);
+ $94 = HEAP32[$93>>2]|0;
+ $95 = ($94|0)>(2048);
+ if (!($95)) {
+ $96 = ((($4)) + 48|0);
+ $97 = HEAP32[$96>>2]|0;
+ $98 = ($97|0)>(4096);
+ if (!($98)) {
+ $99 = ((($4)) + 52|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = ($100|0)>(8192);
+ if (!($101)) {
+ $102 = ((($4)) + 56|0);
+ $103 = HEAP32[$102>>2]|0;
+ $104 = ($103|0)>(16384);
+ if (!($104)) {
+ $105 = ((($4)) + 60|0);
+ $106 = HEAP32[$105>>2]|0;
+ $107 = ($106|0)>(32768);
+ if (!($107)) {
+ $$07785 = 0;$$07884 = 0;$$286 = 1;
+ while(1) {
+ $19 = (($3) + ($$286<<2)|0);
+ HEAP32[$19>>2] = $$07884;
+ $20 = $$07884&65535;
+ $21 = (((($0)) + 1024|0) + ($$286<<1)|0);
+ HEAP16[$21>>1] = $20;
+ $22 = $$07785&65535;
+ $23 = (((($0)) + 1124|0) + ($$286<<1)|0);
+ HEAP16[$23>>1] = $22;
+ $24 = (($4) + ($$286<<2)|0);
+ $25 = HEAP32[$24>>2]|0;
+ $26 = (($25) + ($$07884))|0;
+ $27 = ($25|0)!=(0);
+ $28 = 1 << $$286;
+ $29 = ($26|0)>($28|0);
+ $or$cond = $27 & $29;
+ if ($or$cond) {
+ label = 7;
+ break;
+ }
+ $30 = (16 - ($$286))|0;
+ $31 = $26 << $30;
+ $32 = (((($0)) + 1056|0) + ($$286<<2)|0);
+ HEAP32[$32>>2] = $31;
+ $33 = $26 << 1;
+ $34 = (($25) + ($$07785))|0;
+ $35 = (($$286) + 1)|0;
+ $36 = ($35|0)<(16);
+ if ($36) {
+ $$07785 = $34;$$07884 = $33;$$286 = $35;
+ } else {
+ break;
+ }
+ }
+ if ((label|0) == 7) {
+ _stbi__err(7835);
+ $$075 = 0;
+ STACKTOP = sp;return ($$075|0);
+ }
+ $37 = ((($0)) + 1120|0);
+ HEAP32[$37>>2] = 65536;
+ $38 = ($2|0)>(0);
+ if ($38) {
+ $$382 = 0;
+ } else {
+ $$075 = 1;
+ STACKTOP = sp;return ($$075|0);
+ }
+ while(1) {
+ $39 = (($1) + ($$382)|0);
+ $40 = HEAP8[$39>>0]|0;
+ $41 = $40&255;
+ $42 = ($40<<24>>24)==(0);
+ if (!($42)) {
+ $43 = (($3) + ($41<<2)|0);
+ $44 = HEAP32[$43>>2]|0;
+ $45 = (((($0)) + 1024|0) + ($41<<1)|0);
+ $46 = HEAP16[$45>>1]|0;
+ $47 = $46&65535;
+ $48 = (($44) - ($47))|0;
+ $49 = (((($0)) + 1124|0) + ($41<<1)|0);
+ $50 = HEAP16[$49>>1]|0;
+ $51 = $50&65535;
+ $52 = (($48) + ($51))|0;
+ $53 = $41 << 9;
+ $54 = $53 | $$382;
+ $55 = $54&65535;
+ $56 = (((($0)) + 1156|0) + ($52)|0);
+ HEAP8[$56>>0] = $40;
+ $57 = $$382&65535;
+ $58 = (((($0)) + 1444|0) + ($52<<1)|0);
+ HEAP16[$58>>1] = $57;
+ $59 = ($40&255)<(10);
+ do {
+ if ($59) {
+ $60 = (_stbi__bit_reverse($44,$41)|0);
+ $61 = ($60|0)<(512);
+ if (!($61)) {
+ break;
+ }
+ $62 = 1 << $41;
+ $$081 = $60;
+ while(1) {
+ $63 = (($0) + ($$081<<1)|0);
+ HEAP16[$63>>1] = $55;
+ $64 = (($$081) + ($62))|0;
+ $65 = ($64|0)<(512);
+ if ($65) {
+ $$081 = $64;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $66 = HEAP32[$43>>2]|0;
+ $67 = (($66) + 1)|0;
+ HEAP32[$43>>2] = $67;
+ }
+ $68 = (($$382) + 1)|0;
+ $exitcond = ($68|0)==($2|0);
+ if ($exitcond) {
+ $$075 = 1;
+ break;
+ } else {
+ $$382 = $68;
+ }
+ }
+ STACKTOP = sp;return ($$075|0);
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ _stbi__err(7887);
+ $$075 = 0;
+ STACKTOP = sp;return ($$075|0);
+}
+function _stbi__compute_huffman_codes($0) {
+ $0 = $0|0;
+ var $$ = 0, $$0 = 0, $$061 = 0, $$06579 = 0, $$066$be = 0, $$066$lcssa = 0, $$06678 = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
+ var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, $not$ = 0, dest = 0;
+ var label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 2496|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2496|0);
+ $1 = sp;
+ $2 = sp + 2039|0;
+ $3 = sp + 2020|0;
+ $4 = (_stbi__zreceive($0,5)|0);
+ $5 = (($4) + 257)|0;
+ $6 = (_stbi__zreceive($0,5)|0);
+ $7 = (($6) + 1)|0;
+ $8 = (_stbi__zreceive($0,4)|0);
+ $9 = (($8) + 4)|0;
+ $10 = (($7) + ($5))|0;
+ dest=$3; stop=dest+19|0; do { HEAP8[dest>>0]=0|0; dest=dest+1|0; } while ((dest|0) < (stop|0));
+ $11 = ($9|0)>(0);
+ if ($11) {
+ $$06579 = 0;
+ while(1) {
+ $12 = (_stbi__zreceive($0,3)|0);
+ $13 = $12&255;
+ $14 = (7816 + ($$06579)|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = $15&255;
+ $17 = (($3) + ($16)|0);
+ HEAP8[$17>>0] = $13;
+ $18 = (($$06579) + 1)|0;
+ $exitcond = ($18|0)==($9|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$06579 = $18;
+ }
+ }
+ }
+ $19 = (_stbi__zbuild_huffman($1,$3,19)|0);
+ $20 = ($19|0)==(0);
+ if ($20) {
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ $21 = ($10|0)>(0);
+ L8: do {
+ if ($21) {
+ $$06678 = 0;
+ L9: while(1) {
+ $22 = (_stbi__zhuffman_decode($0,$1)|0);
+ $23 = ($22>>>0)>(18);
+ if ($23) {
+ label = 6;
+ break;
+ }
+ $24 = ($22|0)<(16);
+ if ($24) {
+ $25 = $22&255;
+ $26 = (($$06678) + 1)|0;
+ $27 = (($2) + ($$06678)|0);
+ HEAP8[$27>>0] = $25;
+ $$066$be = $26;
+ } else {
+ switch ($22|0) {
+ case 16: {
+ $28 = (_stbi__zreceive($0,2)|0);
+ $29 = ($$06678|0)==(0);
+ if ($29) {
+ label = 11;
+ break L9;
+ }
+ $30 = (($28) + 3)|0;
+ $31 = (($$06678) + -1)|0;
+ $32 = (($2) + ($31)|0);
+ $33 = HEAP8[$32>>0]|0;
+ $$0 = $33;$$061 = $30;
+ break;
+ }
+ case 17: {
+ $34 = (_stbi__zreceive($0,3)|0);
+ $35 = (($34) + 3)|0;
+ $$0 = 0;$$061 = $35;
+ break;
+ }
+ case 18: {
+ $36 = (_stbi__zreceive($0,7)|0);
+ $37 = (($36) + 11)|0;
+ $$0 = 0;$$061 = $37;
+ break;
+ }
+ default: {
+ label = 14;
+ break L9;
+ }
+ }
+ $38 = (($10) - ($$06678))|0;
+ $39 = ($38|0)<($$061|0);
+ if ($39) {
+ label = 17;
+ break;
+ }
+ $40 = (($2) + ($$06678)|0);
+ _memset(($40|0),($$0|0),($$061|0))|0;
+ $41 = (($$061) + ($$06678))|0;
+ $$066$be = $41;
+ }
+ $42 = ($10|0)>($$066$be|0);
+ if ($42) {
+ $$06678 = $$066$be;
+ } else {
+ $$066$lcssa = $$066$be;
+ break L8;
+ }
+ }
+ if ((label|0) == 6) {
+ _stbi__err(7835);
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ else if ((label|0) == 11) {
+ _stbi__err(7835);
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ else if ((label|0) == 14) {
+ ___assert_fail((7851|0),(6620|0),4006,(7859|0));
+ // unreachable;
+ }
+ else if ((label|0) == 17) {
+ _stbi__err(7835);
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ } else {
+ $$066$lcssa = 0;
+ }
+ } while(0);
+ $43 = ($10|0)==($$066$lcssa|0);
+ if (!($43)) {
+ _stbi__err(7835);
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ $44 = ((($0)) + 32|0);
+ $45 = (_stbi__zbuild_huffman($44,$2,$5)|0);
+ $46 = ($45|0)==(0);
+ if ($46) {
+ $$4 = 0;
+ STACKTOP = sp;return ($$4|0);
+ }
+ $47 = ((($0)) + 2052|0);
+ $48 = (($2) + ($5)|0);
+ $49 = (_stbi__zbuild_huffman($47,$48,$7)|0);
+ $not$ = ($49|0)!=(0);
+ $$ = $not$&1;
+ $$4 = $$;
+ STACKTOP = sp;return ($$4|0);
+}
+function _stbi__parse_huffman_block($0) {
+ $0 = $0|0;
+ var $$063 = 0, $$064 = 0, $$067 = 0, $$070 = 0, $$171 = 0, $$266 = 0, $$272 = 0, $$3$ph = 0, $$5 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
+ var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
+ var $56 = 0, $57 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep92 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 16|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 32|0);
+ $4 = ((($0)) + 24|0);
+ $5 = ((($0)) + 2052|0);
+ $6 = ((($0)) + 20|0);
+ $7 = ((($0)) + 24|0);
+ $$070 = $2;
+ while(1) {
+ $10 = (_stbi__zhuffman_decode($0,$3)|0);
+ $11 = ($10|0)<(256);
+ if ($11) {
+ $12 = ($10|0)<(0);
+ if ($12) {
+ label = 6;
+ break;
+ }
+ $13 = HEAP32[$4>>2]|0;
+ $14 = ($$070>>>0)<($13>>>0);
+ if ($14) {
+ $$171 = $$070;
+ } else {
+ $15 = (_stbi__zexpand($0,$$070,1)|0);
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$3$ph = 0;
+ label = 28;
+ break;
+ }
+ $17 = HEAP32[$1>>2]|0;
+ $$171 = $17;
+ }
+ $18 = $10&255;
+ $19 = ((($$171)) + 1|0);
+ HEAP8[$$171>>0] = $18;
+ $$070 = $19;
+ continue;
+ }
+ $20 = ($10|0)==(256);
+ if ($20) {
+ label = 12;
+ break;
+ }
+ $21 = (($10) + -257)|0;
+ $22 = (3188 + ($21<<2)|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = (($10) + -265)|0;
+ $25 = ($24>>>0)<(20);
+ if ($25) {
+ $26 = (3312 + ($21<<2)|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (_stbi__zreceive($0,$27)|0);
+ $29 = (($28) + ($23))|0;
+ $$064 = $29;
+ } else {
+ $$064 = $23;
+ }
+ $30 = (_stbi__zhuffman_decode($0,$5)|0);
+ $31 = ($30|0)<(0);
+ if ($31) {
+ label = 16;
+ break;
+ }
+ $32 = (3436 + ($30<<2)|0);
+ $33 = HEAP32[$32>>2]|0;
+ $34 = (($30) + -4)|0;
+ $35 = ($34>>>0)<(26);
+ if ($35) {
+ $36 = (3564 + ($30<<2)|0);
+ $37 = HEAP32[$36>>2]|0;
+ $38 = (_stbi__zreceive($0,$37)|0);
+ $39 = (($38) + ($33))|0;
+ $$063 = $39;
+ } else {
+ $$063 = $33;
+ }
+ $40 = HEAP32[$6>>2]|0;
+ $41 = $$070;
+ $42 = (($41) - ($40))|0;
+ $43 = ($42|0)<($$063|0);
+ if ($43) {
+ label = 20;
+ break;
+ }
+ $44 = (($$070) + ($$064)|0);
+ $45 = HEAP32[$7>>2]|0;
+ $46 = ($44>>>0)>($45>>>0);
+ if ($46) {
+ $47 = (_stbi__zexpand($0,$$070,$$064)|0);
+ $48 = ($47|0)==(0);
+ if ($48) {
+ $$3$ph = 0;
+ label = 28;
+ break;
+ }
+ $49 = HEAP32[$1>>2]|0;
+ $$272 = $49;
+ } else {
+ $$272 = $$070;
+ }
+ $50 = (0 - ($$063))|0;
+ $9 = (($$272) + ($50)|0);
+ $51 = ($$063|0)==(1);
+ $52 = ($$064|0)!=(0);
+ if ($51) {
+ if (!($52)) {
+ $$070 = $$272;
+ continue;
+ }
+ $8 = HEAP8[$9>>0]|0;
+ _memset(($$272|0),($8|0),($$064|0))|0;
+ $scevgep92 = (($$272) + ($$064)|0);
+ $$070 = $scevgep92;
+ continue;
+ }
+ if ($52) {
+ $$067 = $9;$$266 = $$064;$$5 = $$272;
+ } else {
+ $$070 = $$272;
+ continue;
+ }
+ while(1) {
+ $53 = ((($$067)) + 1|0);
+ $54 = HEAP8[$$067>>0]|0;
+ $55 = ((($$5)) + 1|0);
+ HEAP8[$$5>>0] = $54;
+ $56 = (($$266) + -1)|0;
+ $57 = ($56|0)==(0);
+ if ($57) {
+ break;
+ } else {
+ $$067 = $53;$$266 = $56;$$5 = $55;
+ }
+ }
+ $scevgep = (($$272) + ($$064)|0);
+ $$070 = $scevgep;
+ }
+ if ((label|0) == 6) {
+ _stbi__err(7641);
+ $$3$ph = 0;
+ return ($$3$ph|0);
+ }
+ else if ((label|0) == 12) {
+ HEAP32[$1>>2] = $$070;
+ $$3$ph = 1;
+ return ($$3$ph|0);
+ }
+ else if ((label|0) == 16) {
+ _stbi__err(7641);
+ $$3$ph = 0;
+ return ($$3$ph|0);
+ }
+ else if ((label|0) == 20) {
+ _stbi__err(7658);
+ $$3$ph = 0;
+ return ($$3$ph|0);
+ }
+ else if ((label|0) == 28) {
+ return ($$3$ph|0);
+ }
+ return (0)|0;
+}
+function _stbi__zhuffman_decode($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)<(16);
+ if ($4) {
+ _stbi__fill_bits($0);
+ }
+ $5 = ((($0)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $6 & 511;
+ $8 = (($1) + ($7<<1)|0);
+ $9 = HEAP16[$8>>1]|0;
+ $10 = $9&65535;
+ $11 = ($9<<16>>16)==(0);
+ if ($11) {
+ $17 = (_stbi__zhuffman_decode_slowpath($0,$1)|0);
+ $$0 = $17;
+ return ($$0|0);
+ } else {
+ $12 = $10 >>> 9;
+ $13 = $6 >>> $12;
+ HEAP32[$5>>2] = $13;
+ $14 = HEAP32[$2>>2]|0;
+ $15 = (($14) - ($12))|0;
+ HEAP32[$2>>2] = $15;
+ $16 = $10 & 511;
+ $$0 = $16;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__zexpand($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$029 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($0)) + 16|0);
+ HEAP32[$3>>2] = $1;
+ $4 = ((($0)) + 28|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==(0);
+ if ($6) {
+ _stbi__err(7667);
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $7 = ((($0)) + 20|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = $1;
+ $10 = $8;
+ $11 = (($9) - ($10))|0;
+ $12 = ((($0)) + 24|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (($13) - ($10))|0;
+ $15 = (($11) + ($2))|0;
+ $$029 = $14;
+ while(1) {
+ $16 = ($15|0)>($$029|0);
+ $17 = $$029 << 1;
+ if ($16) {
+ $$029 = $17;
+ } else {
+ break;
+ }
+ }
+ $18 = (_realloc($8,$$029)|0);
+ $19 = ($18|0)==(0|0);
+ if ($19) {
+ _stbi__err(6585);
+ $$0 = 0;
+ return ($$0|0);
+ } else {
+ HEAP32[$7>>2] = $18;
+ $20 = (($18) + ($11)|0);
+ HEAP32[$3>>2] = $20;
+ $21 = (($18) + ($$029)|0);
+ HEAP32[$12>>2] = $21;
+ $$0 = 1;
+ return ($$0|0);
+ }
+ return (0)|0;
+}
+function _stbi__fill_bits($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 12|0);
+ $2 = ((($0)) + 8|0);
+ while(1) {
+ $3 = HEAP32[$1>>2]|0;
+ $4 = HEAP32[$2>>2]|0;
+ $5 = 1 << $4;
+ $6 = ($3>>>0)<($5>>>0);
+ if (!($6)) {
+ label = 3;
+ break;
+ }
+ $7 = (_stbi__zget8($0)|0);
+ $8 = $7&255;
+ $9 = HEAP32[$2>>2]|0;
+ $10 = $8 << $9;
+ $11 = HEAP32[$1>>2]|0;
+ $12 = $11 | $10;
+ HEAP32[$1>>2] = $12;
+ $13 = (($9) + 8)|0;
+ HEAP32[$2>>2] = $13;
+ $14 = ($13|0)<(25);
+ if (!($14)) {
+ label = 5;
+ break;
+ }
+ }
+ if ((label|0) == 3) {
+ ___assert_fail((7763|0),(6620|0),3848,(7800|0));
+ // unreachable;
+ }
+ else if ((label|0) == 5) {
+ return;
+ }
+}
+function _stbi__zhuffman_decode_slowpath($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$025 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 12|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = (_stbi__bit_reverse($3,16)|0);
+ $$025 = 10;
+ while(1) {
+ $5 = (((($1)) + 1056|0) + ($$025<<2)|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ($4|0)<($6|0);
+ $8 = (($$025) + 1)|0;
+ if ($7) {
+ break;
+ } else {
+ $$025 = $8;
+ }
+ }
+ $9 = ($$025|0)==(16);
+ if ($9) {
+ $$0 = -1;
+ return ($$0|0);
+ }
+ $10 = (16 - ($$025))|0;
+ $11 = $4 >> $10;
+ $12 = (((($1)) + 1024|0) + ($$025<<1)|0);
+ $13 = HEAP16[$12>>1]|0;
+ $14 = $13&65535;
+ $15 = (($11) - ($14))|0;
+ $16 = (((($1)) + 1124|0) + ($$025<<1)|0);
+ $17 = HEAP16[$16>>1]|0;
+ $18 = $17&65535;
+ $19 = (($15) + ($18))|0;
+ $20 = (((($1)) + 1156|0) + ($19)|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = $21&255;
+ $23 = ($22|0)==($$025|0);
+ if (!($23)) {
+ ___assert_fail((7687|0),(6620|0),3876,(7703|0));
+ // unreachable;
+ }
+ $24 = HEAP32[$2>>2]|0;
+ $25 = $24 >>> $$025;
+ HEAP32[$2>>2] = $25;
+ $26 = ((($0)) + 8|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (($27) - ($$025))|0;
+ HEAP32[$26>>2] = $28;
+ $29 = (((($1)) + 1444|0) + ($19<<1)|0);
+ $30 = HEAP16[$29>>1]|0;
+ $31 = $30&65535;
+ $$0 = $31;
+ return ($$0|0);
+}
+function _stbi__bit_reverse($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)<(17);
+ if ($2) {
+ $3 = (_stbi__bitreverse16($0)|0);
+ $4 = (16 - ($1))|0;
+ $5 = $3 >> $4;
+ return ($5|0);
+ } else {
+ ___assert_fail((7734|0),(6620|0),3766,(7745|0));
+ // unreachable;
+ }
+ return (0)|0;
+}
+function _stbi__bitreverse16($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $1 = $0 >>> 1;
+ $2 = $1 & 21845;
+ $3 = $0 << 1;
+ $4 = $3 & 43690;
+ $5 = $2 | $4;
+ $6 = $5 >>> 2;
+ $7 = $6 & 13107;
+ $8 = $5 << 2;
+ $9 = $8 & 52428;
+ $10 = $7 | $9;
+ $11 = $10 >>> 4;
+ $12 = $11 & 3855;
+ $13 = $10 << 4;
+ $14 = $13 & 61680;
+ $15 = $12 | $14;
+ $16 = $15 >>> 8;
+ $17 = $15 << 8;
+ $18 = $17 & 65280;
+ $19 = $18 | $16;
+ return ($19|0);
+}
+function _stbi__zget8($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($1>>>0)<($3>>>0);
+ if (!($4)) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $5 = ((($1)) + 1|0);
+ HEAP32[$0>>2] = $5;
+ $6 = HEAP8[$1>>0]|0;
+ $$0 = $6;
+ return ($$0|0);
+}
+function _stbi__refill_buffer($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 16|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 28|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($0)) + 40|0);
+ $6 = ((($0)) + 36|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = (FUNCTION_TABLE_iiii[$2 & 15]($4,$5,$7)|0);
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $10 = ((($0)) + 32|0);
+ HEAP32[$10>>2] = 0;
+ $11 = ((($0)) + 168|0);
+ HEAP32[$11>>2] = $5;
+ $12 = ((($0)) + 41|0);
+ $13 = ((($0)) + 172|0);
+ HEAP32[$13>>2] = $12;
+ HEAP8[$5>>0] = 0;
+ return;
+ } else {
+ $14 = ((($0)) + 168|0);
+ HEAP32[$14>>2] = $5;
+ $15 = (((($0)) + 40|0) + ($8)|0);
+ $16 = ((($0)) + 172|0);
+ HEAP32[$16>>2] = $15;
+ return;
+ }
+}
+function _stbi__rewind($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 176|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 168|0);
+ HEAP32[$3>>2] = $2;
+ $4 = ((($0)) + 180|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($0)) + 172|0);
+ HEAP32[$6>>2] = $5;
+ return;
+}
+function _stbi__hdr_gettoken($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$014 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $$014 = 0;
+ while(1) {
+ $2 = (_stbi__get8($0)|0);
+ $3 = (_stbi__at_eof($0)|0);
+ $4 = ($3|0)!=(0);
+ $5 = ($2<<24>>24)==(10);
+ $or$cond = $5 | $4;
+ if ($or$cond) {
+ $$1 = $$014;
+ break;
+ }
+ $6 = (($$014) + 1)|0;
+ $7 = (($1) + ($$014)|0);
+ HEAP8[$7>>0] = $2;
+ $8 = ($6|0)==(1023);
+ if ($8) {
+ label = 4;
+ break;
+ } else {
+ $$014 = $6;
+ }
+ }
+ L4: do {
+ if ((label|0) == 4) {
+ while(1) {
+ label = 0;
+ $9 = (_stbi__at_eof($0)|0);
+ $10 = ($9|0)==(0);
+ if (!($10)) {
+ $$1 = $6;
+ break L4;
+ }
+ $11 = (_stbi__get8($0)|0);
+ $12 = ($11<<24>>24)==(10);
+ if ($12) {
+ $$1 = $6;
+ break;
+ } else {
+ label = 4;
+ }
+ }
+ }
+ } while(0);
+ $13 = (($1) + ($$1)|0);
+ HEAP8[$13>>0] = 0;
+ return ($1|0);
+}
+function _stbi__hdr_convert($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$sink = 0.0, $$sink1 = 0, $$sink30 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0;
+ var $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0;
+ var $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($1)) + 3|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ($4<<24>>24)==(0);
+ if ($5) {
+ switch ($2|0) {
+ case 4: {
+ $38 = ((($0)) + 12|0);
+ HEAPF32[$38>>2] = 1.0;
+ label = 10;
+ break;
+ }
+ case 3: {
+ label = 10;
+ break;
+ }
+ case 2: {
+ $$sink30 = 1.0;
+ label = 11;
+ break;
+ }
+ case 1: {
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+ if ((label|0) == 10) {
+ $39 = ((($0)) + 8|0);
+ HEAPF32[$39>>2] = 0.0;
+ $$sink30 = 0.0;
+ label = 11;
+ }
+ if ((label|0) == 11) {
+ $40 = ((($0)) + 4|0);
+ HEAPF32[$40>>2] = $$sink30;
+ }
+ HEAPF32[$0>>2] = 0.0;
+ return;
+ }
+ $6 = $4&255;
+ $7 = (($6) + -136)|0;
+ $8 = (+_ldexp(1.0,$7));
+ $9 = $8;
+ $10 = ($2|0)<(3);
+ $11 = HEAP8[$1>>0]|0;
+ if ($10) {
+ $12 = $11&255;
+ $13 = ((($1)) + 1|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = $14&255;
+ $16 = (($15) + ($12))|0;
+ $17 = ((($1)) + 2|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = $18&255;
+ $20 = (($16) + ($19))|0;
+ $21 = (+($20|0));
+ $22 = $9 * $21;
+ $23 = $22 / 3.0;
+ $$sink = $23;$$sink1 = $0;
+ } else {
+ $24 = (+($11&255));
+ $25 = $9 * $24;
+ HEAPF32[$0>>2] = $25;
+ $26 = ((($1)) + 1|0);
+ $27 = HEAP8[$26>>0]|0;
+ $28 = (+($27&255));
+ $29 = $9 * $28;
+ $30 = ((($0)) + 4|0);
+ HEAPF32[$30>>2] = $29;
+ $31 = ((($1)) + 2|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = (+($32&255));
+ $34 = $9 * $33;
+ $35 = ((($0)) + 8|0);
+ $$sink = $34;$$sink1 = $35;
+ }
+ HEAPF32[$$sink1>>2] = $$sink;
+ switch ($2|0) {
+ case 2: {
+ $36 = ((($0)) + 4|0);
+ HEAPF32[$36>>2] = 1.0;
+ return;
+ break;
+ }
+ case 4: {
+ $37 = ((($0)) + 12|0);
+ HEAPF32[$37>>2] = 1.0;
+ return;
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+}
+function _stbi__at_eof($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 16|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0|0);
+ if (!($3)) {
+ $4 = ((($0)) + 24|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($0)) + 28|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = (FUNCTION_TABLE_ii[$5 & 15]($7)|0);
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $$0 = 0;
+ return ($$0|0);
+ }
+ $10 = ((($0)) + 32|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ($11|0)==(0);
+ if ($12) {
+ $$0 = 1;
+ return ($$0|0);
+ }
+ }
+ $13 = ((($0)) + 168|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ((($0)) + 172|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ($14>>>0)>=($16>>>0);
+ $18 = $17&1;
+ $$0 = $18;
+ return ($$0|0);
+}
+function _stbi__hdr_test_core($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$07 = 0, $$08 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = ($2<<24>>24)==(0);
+ L1: do {
+ if (!($3)) {
+ $$08 = 0;$11 = $1;
+ while(1) {
+ $8 = (_stbi__get8($0)|0);
+ $9 = $8&255;
+ $10 = HEAP8[$11>>0]|0;
+ $12 = $10 << 24 >> 24;
+ $13 = ($9|0)==($12|0);
+ $5 = (($$08) + 1)|0;
+ if (!($13)) {
+ $$07 = 0;
+ break;
+ }
+ $4 = (($1) + ($5)|0);
+ $6 = HEAP8[$4>>0]|0;
+ $7 = ($6<<24>>24)==(0);
+ if ($7) {
+ break L1;
+ } else {
+ $$08 = $5;$11 = $4;
+ }
+ }
+ return ($$07|0);
+ }
+ } while(0);
+ _stbi__rewind($0);
+ $$07 = 1;
+ return ($$07|0);
+}
+function _stbi__start_callbacks($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($0)) + 16|0);
+ ;HEAP32[$3>>2]=HEAP32[$1>>2]|0;HEAP32[$3+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$3+8>>2]=HEAP32[$1+8>>2]|0;
+ $4 = ((($0)) + 28|0);
+ HEAP32[$4>>2] = $2;
+ $5 = ((($0)) + 36|0);
+ HEAP32[$5>>2] = 128;
+ $6 = ((($0)) + 32|0);
+ HEAP32[$6>>2] = 1;
+ $7 = ((($0)) + 40|0);
+ $8 = ((($0)) + 176|0);
+ HEAP32[$8>>2] = $7;
+ _stbi__refill_buffer($0);
+ $9 = ((($0)) + 172|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($0)) + 180|0);
+ HEAP32[$11>>2] = $10;
+ return;
+}
+function _stbi__stdio_read($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_fread($1,1,$2,$0)|0);
+ return ($3|0);
+}
+function _stbi__stdio_skip($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ (_fseek($0,$1,1)|0);
+ return;
+}
+function _stbi__stdio_eof($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_feof($0)|0);
+ return ($1|0);
+}
+function _ImageCopy($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$sroa$6$0 = 0, $$sroa$6$0$$sroa_idx11 = 0, $$sroa$7$0 = 0, $$sroa$7$0$$sroa_idx13 = 0, $$sroa$8$0 = 0, $$sroa$8$0$$sroa_idx15 = 0, $$sroa$9$0 = 0, $$sroa$9$0$$sroa_idx17 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $2 = ((($1)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($1)) + 8|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = Math_imul($5, $3)|0;
+ $7 = ((($1)) + 16|0);
+ $8 = HEAP32[$7>>2]|0;
+ switch ($8|0) {
+ case 18: case 15: case 12: case 11: case 1: {
+ $$0 = $6;
+ break;
+ }
+ case 6: case 5: case 3: case 2: {
+ $9 = $6 << 1;
+ $$0 = $9;
+ break;
+ }
+ case 4: {
+ $10 = ($6*3)|0;
+ $$0 = $10;
+ break;
+ }
+ case 7: {
+ $11 = $6 << 2;
+ $$0 = $11;
+ break;
+ }
+ case 8: {
+ $12 = ($6*12)|0;
+ $$0 = $12;
+ break;
+ }
+ case 17: case 16: case 14: case 13: case 10: case 9: {
+ $13 = (($6|0) / 2)&-1;
+ $$0 = $13;
+ break;
+ }
+ case 19: {
+ $14 = (($6|0) / 4)&-1;
+ $$0 = $14;
+ break;
+ }
+ default: {
+ _TraceLog(1,8194,$vararg_buffer);
+ $$0 = $6;
+ }
+ }
+ $15 = (_malloc($$0)|0);
+ $16 = ($15|0)==(0|0);
+ if ($16) {
+ $$sroa$6$0 = 0;$$sroa$7$0 = 0;$$sroa$8$0 = 0;$$sroa$9$0 = 0;
+ } else {
+ $17 = HEAP32[$1>>2]|0;
+ _memcpy(($15|0),($17|0),($$0|0))|0;
+ $18 = HEAP32[$2>>2]|0;
+ $19 = HEAP32[$4>>2]|0;
+ $20 = ((($1)) + 12|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = HEAP32[$7>>2]|0;
+ $$sroa$6$0 = $18;$$sroa$7$0 = $19;$$sroa$8$0 = $21;$$sroa$9$0 = $22;
+ }
+ HEAP32[$0>>2] = $15;
+ $$sroa$6$0$$sroa_idx11 = ((($0)) + 4|0);
+ HEAP32[$$sroa$6$0$$sroa_idx11>>2] = $$sroa$6$0;
+ $$sroa$7$0$$sroa_idx13 = ((($0)) + 8|0);
+ HEAP32[$$sroa$7$0$$sroa_idx13>>2] = $$sroa$7$0;
+ $$sroa$8$0$$sroa_idx15 = ((($0)) + 12|0);
+ HEAP32[$$sroa$8$0$$sroa_idx15>>2] = $$sroa$8$0;
+ $$sroa$9$0$$sroa_idx17 = ((($0)) + 16|0);
+ HEAP32[$$sroa$9$0$$sroa_idx17>>2] = $$sroa$9$0;
+ STACKTOP = sp;return;
+}
+function _DrawText($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$ = 0, $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
+ $$byval_copy2 = sp + 112|0;
+ $$byval_copy1 = sp + 104|0;
+ $$byval_copy = sp + 72|0;
+ $5 = sp + 32|0;
+ $6 = sp + 64|0;
+ $7 = sp;
+ _GetDefaultFont($5);
+ $8 = HEAP32[$5>>2]|0;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ STACKTOP = sp;return;
+ }
+ $10 = (+($1|0));
+ HEAPF32[$6>>2] = $10;
+ $11 = ((($6)) + 4|0);
+ $12 = (+($2|0));
+ HEAPF32[$11>>2] = $12;
+ $13 = ($3|0)>(10);
+ $$ = $13 ? $3 : 10;
+ $14 = (($$>>>0) / 10)&-1;
+ _GetDefaultFont($7);
+ $15 = (+($$|0));
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$7+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$7+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$7+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$7+28>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$6+4>>2]|0;
+ ;HEAP8[$$byval_copy2>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$4+3>>0]|0;
+ _DrawTextEx($$byval_copy,$0,$$byval_copy1,$15,$14,$$byval_copy2);
+ STACKTOP = sp;return;
+}
+function _DrawTextEx($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = +$3;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$04954 = 0, $$05153 = 0, $$055 = 0, $$1 = 0, $$150 = 0, $$152 = 0, $$2 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$sink = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0;
+ var $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
+ var $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0;
+ var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0;
+ var $75 = 0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
+ $$byval_copy5 = sp + 88|0;
+ $$byval_copy4 = sp + 80|0;
+ $$byval_copy3 = sp + 64|0;
+ $$byval_copy2 = sp + 48|0;
+ $$byval_copy1 = sp + 24|0;
+ $6 = sp + 8|0;
+ $7 = sp;
+ $8 = (_strlen($1)|0);
+ $9 = ((($0)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (+($10|0));
+ $12 = $3 / $11;
+ $13 = ($8|0)>(0);
+ if (!($13)) {
+ STACKTOP = sp;return;
+ }
+ $14 = ((($0)) + 28|0);
+ $15 = +HEAPF32[$2>>2];
+ $16 = ((($6)) + 4|0);
+ $17 = ((($2)) + 4|0);
+ $18 = ((($6)) + 8|0);
+ $19 = ((($6)) + 12|0);
+ $20 = ((($7)) + 4|0);
+ $21 = (+($4|0));
+ $$04954 = 0;$$05153 = 0;$$055 = 0;
+ while(1) {
+ $22 = (($1) + ($$055)|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = $23&255;
+ switch ($23<<24>>24) {
+ case 10: {
+ $25 = HEAP32[$9>>2]|0;
+ $26 = (($25|0) / 2)&-1;
+ $27 = (($26) + ($25))|0;
+ $28 = (+($27|0));
+ $29 = $12 * $28;
+ $30 = (~~(($29)));
+ $31 = (($30) + ($$05153))|0;
+ $$150 = 0;$$152 = $31;$$2 = $$055;
+ break;
+ }
+ case -62: {
+ $32 = (($$055) + 1)|0;
+ $33 = (($1) + ($32)|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = $34&255;
+ $$1 = $32;$$sink = $35;
+ label = 8;
+ break;
+ }
+ case -61: {
+ $36 = (($$055) + 1)|0;
+ $37 = (($1) + ($36)|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = $38&255;
+ $40 = (($39) + 64)|0;
+ $$1 = $36;$$sink = $40;
+ label = 8;
+ break;
+ }
+ default: {
+ $$1 = $$055;$$sink = $24;
+ label = 8;
+ }
+ }
+ do {
+ if ((label|0) == 8) {
+ label = 0;
+ ;HEAP32[$$byval_copy5>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$0+16>>2]|0;HEAP32[$$byval_copy5+20>>2]=HEAP32[$0+20>>2]|0;HEAP32[$$byval_copy5+24>>2]=HEAP32[$0+24>>2]|0;HEAP32[$$byval_copy5+28>>2]=HEAP32[$0+28>>2]|0;
+ $41 = (_GetCharIndex($$byval_copy5,$$sink)|0);
+ $42 = HEAP32[$14>>2]|0;
+ $43 = (((($42) + ($41<<5)|0)) + 4|0);
+ $44 = (+($$04954|0));
+ $45 = $44 + $15;
+ $46 = (((($42) + ($41<<5)|0)) + 20|0);
+ $47 = HEAP32[$46>>2]|0;
+ $48 = (+($47|0));
+ $49 = $12 * $48;
+ $50 = $45 + $49;
+ $51 = (~~(($50)));
+ HEAP32[$6>>2] = $51;
+ $52 = +HEAPF32[$17>>2];
+ $53 = (+($$05153|0));
+ $54 = $53 + $52;
+ $55 = (((($42) + ($41<<5)|0)) + 24|0);
+ $56 = HEAP32[$55>>2]|0;
+ $57 = (+($56|0));
+ $58 = $12 * $57;
+ $59 = $54 + $58;
+ $60 = (~~(($59)));
+ HEAP32[$16>>2] = $60;
+ $61 = (((($42) + ($41<<5)|0)) + 12|0);
+ $62 = HEAP32[$61>>2]|0;
+ $63 = (+($62|0));
+ $64 = $12 * $63;
+ $65 = (~~(($64)));
+ HEAP32[$18>>2] = $65;
+ $66 = (((($42) + ($41<<5)|0)) + 16|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = (+($67|0));
+ $69 = $12 * $68;
+ $70 = (~~(($69)));
+ HEAP32[$19>>2] = $70;
+ HEAPF32[$7>>2] = 0.0;
+ HEAPF32[$20>>2] = 0.0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[$43>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$43+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$43+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$43+12>>2]|0;
+ ;HEAP32[$$byval_copy3>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$6+12>>2]|0;
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$7+4>>2]|0;
+ ;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0;
+ _DrawTexturePro($$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4,0.0,$$byval_copy5);
+ $71 = HEAP32[$14>>2]|0;
+ $72 = (((($71) + ($41<<5)|0)) + 28|0);
+ $73 = HEAP32[$72>>2]|0;
+ $74 = ($73|0)==(0);
+ if ($74) {
+ $75 = (((($71) + ($41<<5)|0)) + 12|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = (+($76|0));
+ $78 = $12 * $77;
+ $79 = $21 + $78;
+ $80 = (~~(($79)));
+ $81 = (($80) + ($$04954))|0;
+ $$150 = $81;$$152 = $$05153;$$2 = $$1;
+ break;
+ } else {
+ $82 = (+($73|0));
+ $83 = $12 * $82;
+ $84 = $21 + $83;
+ $85 = (~~(($84)));
+ $86 = (($85) + ($$04954))|0;
+ $$150 = $86;$$152 = $$05153;$$2 = $$1;
+ break;
+ }
+ }
+ } while(0);
+ $87 = (($$2) + 1)|0;
+ $88 = ($87|0)<($8|0);
+ if ($88) {
+ $$04954 = $$150;$$05153 = $$152;$$055 = $87;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return;
+}
+function _GetCharIndex($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$08 = 0, $$09 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 24|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)>(0);
+ if (!($4)) {
+ $$08 = 0;
+ return ($$08|0);
+ }
+ $5 = ((($0)) + 28|0);
+ $6 = HEAP32[$5>>2]|0;
+ $$09 = 0;
+ while(1) {
+ $7 = (($6) + ($$09<<5)|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)==($1|0);
+ if ($9) {
+ $$08 = $$09;
+ label = 5;
+ break;
+ }
+ $10 = (($$09) + 1)|0;
+ $11 = HEAP32[$2>>2]|0;
+ $12 = ($10|0)<($11|0);
+ if ($12) {
+ $$09 = $10;
+ } else {
+ $$08 = 0;
+ label = 5;
+ break;
+ }
+ }
+ if ((label|0) == 5) {
+ return ($$08|0);
+ }
+ return (0)|0;
+}
+function _DrawTexturePro($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = +$4;
+ $5 = $5|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0;
+ var $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0;
+ var $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0;
+ var $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $6 = HEAP32[$0>>2]|0;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ return;
+ }
+ $8 = ((($1)) + 8|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($9|0)<(0);
+ if ($10) {
+ $11 = HEAP32[$1>>2]|0;
+ $12 = (($11) - ($9))|0;
+ HEAP32[$1>>2] = $12;
+ }
+ $13 = ((($1)) + 12|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ($14|0)<(0);
+ if ($15) {
+ $16 = ((($1)) + 4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (($17) - ($14))|0;
+ HEAP32[$16>>2] = $18;
+ }
+ $19 = HEAP32[$0>>2]|0;
+ _rlEnableTexture($19);
+ _rlPushMatrix();
+ $20 = HEAP32[$2>>2]|0;
+ $21 = (+($20|0));
+ $22 = ((($2)) + 4|0);
+ $23 = HEAP32[$22>>2]|0;
+ $24 = (+($23|0));
+ _rlTranslatef($21,$24,0.0);
+ _rlRotatef($4,0.0,0.0,1.0);
+ $25 = +HEAPF32[$3>>2];
+ $26 = -$25;
+ $27 = ((($3)) + 4|0);
+ $28 = +HEAPF32[$27>>2];
+ $29 = -$28;
+ _rlTranslatef($26,$29,0.0);
+ _rlBegin(7);
+ $30 = HEAP8[$5>>0]|0;
+ $31 = ((($5)) + 1|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = ((($5)) + 2|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = ((($5)) + 3|0);
+ $36 = HEAP8[$35>>0]|0;
+ _rlColor4ub($30,$32,$34,$36);
+ $37 = HEAP32[$1>>2]|0;
+ $38 = (+($37|0));
+ $39 = ((($0)) + 4|0);
+ $40 = HEAP32[$39>>2]|0;
+ $41 = (+($40|0));
+ $42 = $38 / $41;
+ $43 = ((($1)) + 4|0);
+ $44 = HEAP32[$43>>2]|0;
+ $45 = (+($44|0));
+ $46 = ((($0)) + 8|0);
+ $47 = HEAP32[$46>>2]|0;
+ $48 = (+($47|0));
+ $49 = $45 / $48;
+ _rlTexCoord2f($42,$49);
+ _rlVertex2f(0.0,0.0);
+ $50 = HEAP32[$1>>2]|0;
+ $51 = (+($50|0));
+ $52 = HEAP32[$39>>2]|0;
+ $53 = (+($52|0));
+ $54 = $51 / $53;
+ $55 = HEAP32[$43>>2]|0;
+ $56 = HEAP32[$13>>2]|0;
+ $57 = (($56) + ($55))|0;
+ $58 = (+($57|0));
+ $59 = HEAP32[$46>>2]|0;
+ $60 = (+($59|0));
+ $61 = $58 / $60;
+ _rlTexCoord2f($54,$61);
+ $62 = ((($2)) + 12|0);
+ $63 = HEAP32[$62>>2]|0;
+ $64 = (+($63|0));
+ _rlVertex2f(0.0,$64);
+ $65 = HEAP32[$1>>2]|0;
+ $66 = HEAP32[$8>>2]|0;
+ $67 = (($66) + ($65))|0;
+ $68 = (+($67|0));
+ $69 = HEAP32[$39>>2]|0;
+ $70 = (+($69|0));
+ $71 = $68 / $70;
+ $72 = HEAP32[$43>>2]|0;
+ $73 = HEAP32[$13>>2]|0;
+ $74 = (($73) + ($72))|0;
+ $75 = (+($74|0));
+ $76 = HEAP32[$46>>2]|0;
+ $77 = (+($76|0));
+ $78 = $75 / $77;
+ _rlTexCoord2f($71,$78);
+ $79 = ((($2)) + 8|0);
+ $80 = HEAP32[$79>>2]|0;
+ $81 = (+($80|0));
+ $82 = HEAP32[$62>>2]|0;
+ $83 = (+($82|0));
+ _rlVertex2f($81,$83);
+ $84 = HEAP32[$1>>2]|0;
+ $85 = HEAP32[$8>>2]|0;
+ $86 = (($85) + ($84))|0;
+ $87 = (+($86|0));
+ $88 = HEAP32[$39>>2]|0;
+ $89 = (+($88|0));
+ $90 = $87 / $89;
+ $91 = HEAP32[$43>>2]|0;
+ $92 = (+($91|0));
+ $93 = HEAP32[$46>>2]|0;
+ $94 = (+($93|0));
+ $95 = $92 / $94;
+ _rlTexCoord2f($90,$95);
+ $96 = HEAP32[$79>>2]|0;
+ $97 = (+($96|0));
+ _rlVertex2f($97,0.0);
+ _rlEnd();
+ _rlPopMatrix();
+ _rlDisableTexture();
+ return;
+}
+function _rlEnableTexture($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[5220]|0;
+ $2 = HEAP32[5218]|0;
+ $3 = (($2) + -1)|0;
+ $4 = (((($1) + (($3*144)|0)|0)) + 8|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==($0|0);
+ if ($6) {
+ return;
+ }
+ $7 = (($1) + (($3*144)|0)|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)>(0);
+ if ($9) {
+ $10 = (($2) + 1)|0;
+ HEAP32[5218] = $10;
+ }
+ $11 = HEAP32[5218]|0;
+ $12 = (($11) + -1)|0;
+ $13 = (((($1) + (($12*144)|0)|0)) + 8|0);
+ HEAP32[$13>>2] = $0;
+ $14 = (($1) + (($12*144)|0)|0);
+ HEAP32[$14>>2] = 0;
+ return;
+}
+function _rlPushMatrix() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $0 = HEAP32[5368]|0;
+ $1 = ($0|0)==(15);
+ if ($1) {
+ HEAP32[$vararg_buffer>>2] = 16;
+ _TraceLog(2,8301,$vararg_buffer);
+ }
+ $2 = HEAP32[5368]|0;
+ $3 = (21476 + ($2<<6)|0);
+ $4 = HEAP32[5625]|0;
+ dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _rlLoadIdentity();
+ $5 = HEAP32[5368]|0;
+ $6 = (($5) + 1)|0;
+ HEAP32[5368] = $6;
+ $7 = HEAP32[5630]|0;
+ $8 = ($7|0)==(5888);
+ if (!($8)) {
+ STACKTOP = sp;return;
+ }
+ HEAP32[5626] = 1;
+ STACKTOP = sp;return;
+}
+function _rlTranslatef($0,$1,$2) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $$byval_copy1 = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $3 = sp + 64|0;
+ $4 = sp;
+ _MatrixTranslate($3,$0,$1,$2);
+ _MatrixTranspose($3);
+ $5 = HEAP32[5625]|0;
+ dest=$$byval_copy; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy1; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($4,$$byval_copy,$$byval_copy1);
+ dest=$5; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlRotatef($0,$1,$2,$3) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ var $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
+ $$byval_copy2 = sp + 272|0;
+ $$byval_copy1 = sp + 208|0;
+ $4 = sp + 144|0;
+ $5 = sp + 64|0;
+ $6 = sp + 80|0;
+ $7 = sp;
+ _MatrixIdentity($4);
+ HEAPF32[$5>>2] = $1;
+ $8 = ((($5)) + 4|0);
+ HEAPF32[$8>>2] = $2;
+ $9 = ((($5)) + 8|0);
+ HEAPF32[$9>>2] = $3;
+ _VectorNormalize($5);
+ $10 = $0 * 0.01745329238474369;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
+ _MatrixRotate($6,$$byval_copy2,$10);
+ dest=$4; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixTranspose($4);
+ $11 = HEAP32[5625]|0;
+ dest=$$byval_copy1; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy2; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($7,$$byval_copy1,$$byval_copy2);
+ dest=$11; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlBegin($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5629] = $0;
+ return;
+}
+function _rlColor4ub($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$sink37 = 0, $$sink38 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = HEAP32[5629]|0;
+ switch ($4|0) {
+ case 1: {
+ $$sink37 = (20892);$$sink38 = (20904);
+ break;
+ }
+ case 4: {
+ $$sink37 = (20940);$$sink38 = (20952);
+ break;
+ }
+ case 7: {
+ $$sink37 = (20700);$$sink38 = (20712);
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+ $5 = HEAP32[$$sink38>>2]|0;
+ $6 = HEAP32[$$sink37>>2]|0;
+ $7 = $6 << 2;
+ $8 = (($5) + ($7)|0);
+ HEAP8[$8>>0] = $0;
+ $9 = HEAP32[$$sink38>>2]|0;
+ $10 = HEAP32[$$sink37>>2]|0;
+ $11 = $10 << 2;
+ $12 = $11 | 1;
+ $13 = (($9) + ($12)|0);
+ HEAP8[$13>>0] = $1;
+ $14 = HEAP32[$$sink38>>2]|0;
+ $15 = HEAP32[$$sink37>>2]|0;
+ $16 = $15 << 2;
+ $17 = $16 | 2;
+ $18 = (($14) + ($17)|0);
+ HEAP8[$18>>0] = $2;
+ $19 = HEAP32[$$sink38>>2]|0;
+ $20 = HEAP32[$$sink37>>2]|0;
+ $21 = $20 << 2;
+ $22 = $21 | 3;
+ $23 = (($19) + ($22)|0);
+ HEAP8[$23>>0] = $3;
+ $24 = HEAP32[$$sink37>>2]|0;
+ $25 = (($24) + 1)|0;
+ HEAP32[$$sink37>>2] = $25;
+ return;
+}
+function _rlNormal3f($0,$1,$2) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _rlTexCoord2f($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP32[5629]|0;
+ $3 = ($2|0)==(7);
+ if (!($3)) {
+ return;
+ }
+ $4 = HEAP32[(20708)>>2]|0;
+ $5 = HEAP32[(20696)>>2]|0;
+ $6 = $5 << 1;
+ $7 = (($4) + ($6<<2)|0);
+ HEAPF32[$7>>2] = $0;
+ $8 = $6 | 1;
+ $9 = (($4) + ($8<<2)|0);
+ HEAPF32[$9>>2] = $1;
+ $10 = (($5) + 1)|0;
+ HEAP32[(20696)>>2] = $10;
+ return;
+}
+function _rlVertex2f($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = +HEAPF32[926];
+ _rlVertex3f($0,$1,$2);
+ return;
+}
+function _rlEnd() {
+ var $$03956 = 0, $$04052 = 0, $$04154 = 0, $$04248 = 0, $$04347 = 0, $$byval_copy = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
+ var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
+ var $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0;
+ var $146 = 0, $147 = 0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
+ var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
+ var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
+ var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
+ var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond60 = 0, $exitcond63 = 0;
+ var $scevgep = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $$byval_copy = sp;
+ $0 = HEAP32[5626]|0;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP32[5627]|0;
+ $3 = ($2|0)>(0);
+ if ($3) {
+ $$03956 = 0;
+ while(1) {
+ $6 = HEAP32[5628]|0;
+ $7 = (($6) + (($$03956*12)|0)|0);
+ $8 = HEAP32[5625]|0;
+ dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _VectorTransform($7,$$byval_copy);
+ $9 = (($$03956) + 1)|0;
+ $5 = HEAP32[5627]|0;
+ $10 = ($9|0)<($5|0);
+ if ($10) {
+ $$03956 = $9;
+ } else {
+ break;
+ }
+ }
+ HEAP32[5626] = 0;
+ $4 = ($5|0)>(0);
+ if ($4) {
+ $$04154 = 0;
+ while(1) {
+ $11 = HEAP32[5628]|0;
+ $12 = (($11) + (($$04154*12)|0)|0);
+ $13 = +HEAPF32[$12>>2];
+ $14 = (((($11) + (($$04154*12)|0)|0)) + 4|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = (((($11) + (($$04154*12)|0)|0)) + 8|0);
+ $17 = +HEAPF32[$16>>2];
+ _rlVertex3f($13,$15,$17);
+ $18 = (($$04154) + 1)|0;
+ $19 = HEAP32[5627]|0;
+ $20 = ($18|0)<($19|0);
+ if ($20) {
+ $$04154 = $18;
+ } else {
+ break;
+ }
+ }
+ }
+ } else {
+ HEAP32[5626] = 0;
+ }
+ HEAP32[5627] = 0;
+ }
+ $21 = HEAP32[5629]|0;
+ switch ($21|0) {
+ case 1: {
+ $22 = HEAP32[5221]|0;
+ $23 = HEAP32[(20892)>>2]|0;
+ $24 = ($22|0)==($23|0);
+ if ($24) {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ $25 = (($22) - ($23))|0;
+ $26 = ($25|0)>(0);
+ if ($26) {
+ $$04347 = 0;
+ } else {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ while(1) {
+ $27 = HEAP32[(20904)>>2]|0;
+ $28 = HEAP32[(20892)>>2]|0;
+ $29 = $28 << 2;
+ $30 = (($29) + -4)|0;
+ $31 = (($27) + ($30)|0);
+ $32 = HEAP8[$31>>0]|0;
+ $33 = (($27) + ($29)|0);
+ HEAP8[$33>>0] = $32;
+ $34 = HEAP32[(20904)>>2]|0;
+ $35 = HEAP32[(20892)>>2]|0;
+ $36 = $35 << 2;
+ $37 = (($36) + -3)|0;
+ $38 = (($34) + ($37)|0);
+ $39 = HEAP8[$38>>0]|0;
+ $40 = $36 | 1;
+ $41 = (($34) + ($40)|0);
+ HEAP8[$41>>0] = $39;
+ $42 = HEAP32[(20904)>>2]|0;
+ $43 = HEAP32[(20892)>>2]|0;
+ $44 = $43 << 2;
+ $45 = (($44) + -2)|0;
+ $46 = (($42) + ($45)|0);
+ $47 = HEAP8[$46>>0]|0;
+ $48 = $44 | 2;
+ $49 = (($42) + ($48)|0);
+ HEAP8[$49>>0] = $47;
+ $50 = HEAP32[(20904)>>2]|0;
+ $51 = HEAP32[(20892)>>2]|0;
+ $52 = $51 << 2;
+ $53 = (($52) + -1)|0;
+ $54 = (($50) + ($53)|0);
+ $55 = HEAP8[$54>>0]|0;
+ $56 = $52 | 3;
+ $57 = (($50) + ($56)|0);
+ HEAP8[$57>>0] = $55;
+ $58 = HEAP32[(20892)>>2]|0;
+ $59 = (($58) + 1)|0;
+ HEAP32[(20892)>>2] = $59;
+ $60 = (($$04347) + 1)|0;
+ $exitcond = ($60|0)==($25|0);
+ if ($exitcond) {
+ break;
+ } else {
+ $$04347 = $60;
+ }
+ }
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 4: {
+ $61 = HEAP32[5233]|0;
+ $62 = HEAP32[(20940)>>2]|0;
+ $63 = ($61|0)==($62|0);
+ if ($63) {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ $64 = (($61) - ($62))|0;
+ $65 = ($64|0)>(0);
+ if ($65) {
+ $$04248 = 0;
+ } else {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ while(1) {
+ $66 = HEAP32[(20952)>>2]|0;
+ $67 = HEAP32[(20940)>>2]|0;
+ $68 = $67 << 2;
+ $69 = (($68) + -4)|0;
+ $70 = (($66) + ($69)|0);
+ $71 = HEAP8[$70>>0]|0;
+ $72 = (($66) + ($68)|0);
+ HEAP8[$72>>0] = $71;
+ $73 = HEAP32[(20952)>>2]|0;
+ $74 = HEAP32[(20940)>>2]|0;
+ $75 = $74 << 2;
+ $76 = (($75) + -3)|0;
+ $77 = (($73) + ($76)|0);
+ $78 = HEAP8[$77>>0]|0;
+ $79 = $75 | 1;
+ $80 = (($73) + ($79)|0);
+ HEAP8[$80>>0] = $78;
+ $81 = HEAP32[(20952)>>2]|0;
+ $82 = HEAP32[(20940)>>2]|0;
+ $83 = $82 << 2;
+ $84 = (($83) + -2)|0;
+ $85 = (($81) + ($84)|0);
+ $86 = HEAP8[$85>>0]|0;
+ $87 = $83 | 2;
+ $88 = (($81) + ($87)|0);
+ HEAP8[$88>>0] = $86;
+ $89 = HEAP32[(20952)>>2]|0;
+ $90 = HEAP32[(20940)>>2]|0;
+ $91 = $90 << 2;
+ $92 = (($91) + -1)|0;
+ $93 = (($89) + ($92)|0);
+ $94 = HEAP8[$93>>0]|0;
+ $95 = $91 | 3;
+ $96 = (($89) + ($95)|0);
+ HEAP8[$96>>0] = $94;
+ $97 = HEAP32[(20940)>>2]|0;
+ $98 = (($97) + 1)|0;
+ HEAP32[(20940)>>2] = $98;
+ $99 = (($$04248) + 1)|0;
+ $exitcond60 = ($99|0)==($64|0);
+ if ($exitcond60) {
+ break;
+ } else {
+ $$04248 = $99;
+ }
+ }
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 7: {
+ $100 = HEAP32[5173]|0;
+ $101 = HEAP32[(20700)>>2]|0;
+ $102 = ($100|0)==($101|0);
+ if (!($102)) {
+ $103 = (($100) - ($101))|0;
+ $104 = ($103|0)>(0);
+ if ($104) {
+ $$04052 = 0;
+ while(1) {
+ $105 = HEAP32[(20712)>>2]|0;
+ $106 = HEAP32[(20700)>>2]|0;
+ $107 = $106 << 2;
+ $108 = (($107) + -4)|0;
+ $109 = (($105) + ($108)|0);
+ $110 = HEAP8[$109>>0]|0;
+ $111 = (($105) + ($107)|0);
+ HEAP8[$111>>0] = $110;
+ $112 = HEAP32[(20712)>>2]|0;
+ $113 = HEAP32[(20700)>>2]|0;
+ $114 = $113 << 2;
+ $115 = (($114) + -3)|0;
+ $116 = (($112) + ($115)|0);
+ $117 = HEAP8[$116>>0]|0;
+ $118 = $114 | 1;
+ $119 = (($112) + ($118)|0);
+ HEAP8[$119>>0] = $117;
+ $120 = HEAP32[(20712)>>2]|0;
+ $121 = HEAP32[(20700)>>2]|0;
+ $122 = $121 << 2;
+ $123 = (($122) + -2)|0;
+ $124 = (($120) + ($123)|0);
+ $125 = HEAP8[$124>>0]|0;
+ $126 = $122 | 2;
+ $127 = (($120) + ($126)|0);
+ HEAP8[$127>>0] = $125;
+ $128 = HEAP32[(20712)>>2]|0;
+ $129 = HEAP32[(20700)>>2]|0;
+ $130 = $129 << 2;
+ $131 = (($130) + -1)|0;
+ $132 = (($128) + ($131)|0);
+ $133 = HEAP8[$132>>0]|0;
+ $134 = $130 | 3;
+ $135 = (($128) + ($134)|0);
+ HEAP8[$135>>0] = $133;
+ $136 = HEAP32[(20700)>>2]|0;
+ $137 = (($136) + 1)|0;
+ HEAP32[(20700)>>2] = $137;
+ $138 = (($$04052) + 1)|0;
+ $exitcond63 = ($138|0)==($103|0);
+ if ($exitcond63) {
+ break;
+ } else {
+ $$04052 = $138;
+ }
+ }
+ }
+ }
+ $139 = HEAP32[5173]|0;
+ $140 = HEAP32[(20696)>>2]|0;
+ $141 = ($139|0)>($140|0);
+ if (!($141)) {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ $142 = HEAP32[(20708)>>2]|0;
+ $$promoted = HEAP32[(20696)>>2]|0;
+ $143 = $$promoted << 1;
+ $scevgep = (($142) + ($143<<2)|0);
+ $144 = (($139) - ($140))|0;
+ $145 = $144 << 3;
+ _memset(($scevgep|0),0,($145|0))|0;
+ $146 = (($139) + ($$promoted))|0;
+ $147 = (($146) - ($140))|0;
+ HEAP32[(20696)>>2] = $147;
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ $148 = +HEAPF32[926];
+ $149 = $148 + 4.9999998736893758E-5;
+ HEAPF32[926] = $149;
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _rlPopMatrix() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5368]|0;
+ $1 = ($0|0)>(0);
+ if (!($1)) {
+ return;
+ }
+ $2 = HEAP32[5368]|0;
+ $3 = (($2) + -1)|0;
+ $4 = (21476 + ($3<<6)|0);
+ $5 = HEAP32[5625]|0;
+ _memmove(($5|0),($4|0),64)|0;
+ $6 = (($2) + -1)|0;
+ HEAP32[5368] = $6;
+ return;
+}
+function _rlDisableTexture() {
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5173]|0;
+ $1 = ($0|0)>(4095);
+ if (!($1)) {
+ return;
+ }
+ _rlglDraw();
+ return;
+}
+function _rlglDraw() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _UpdateDefaultBuffers();
+ _DrawDefaultBuffers();
+ return;
+}
+function _UpdateDefaultBuffers() {
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5221]|0;
+ $1 = ($0|0)>(0);
+ if ($1) {
+ $2 = HEAP32[5259]|0;
+ $3 = ($2|0)==(0);
+ if (!($3)) {
+ $4 = HEAP32[5260]|0;
+ $5 = HEAP32[(20912)>>2]|0;
+ FUNCTION_TABLE_vi[$4 & 31]($5);
+ }
+ $6 = HEAP32[(20916)>>2]|0;
+ _glBindBuffer(34962,($6|0));
+ $7 = HEAP32[5221]|0;
+ $8 = ($7*12)|0;
+ $9 = HEAP32[(20896)>>2]|0;
+ _glBufferSubData(34962,0,($8|0),($9|0));
+ $10 = HEAP32[(20920)>>2]|0;
+ _glBindBuffer(34962,($10|0));
+ $11 = HEAP32[(20892)>>2]|0;
+ $12 = $11 << 2;
+ $13 = HEAP32[(20904)>>2]|0;
+ _glBufferSubData(34962,0,($12|0),($13|0));
+ }
+ $14 = HEAP32[5233]|0;
+ $15 = ($14|0)>(0);
+ if ($15) {
+ $16 = HEAP32[5259]|0;
+ $17 = ($16|0)==(0);
+ if (!($17)) {
+ $18 = HEAP32[5260]|0;
+ $19 = HEAP32[(20960)>>2]|0;
+ FUNCTION_TABLE_vi[$18 & 31]($19);
+ }
+ $20 = HEAP32[(20964)>>2]|0;
+ _glBindBuffer(34962,($20|0));
+ $21 = HEAP32[5233]|0;
+ $22 = ($21*12)|0;
+ $23 = HEAP32[(20944)>>2]|0;
+ _glBufferSubData(34962,0,($22|0),($23|0));
+ $24 = HEAP32[(20968)>>2]|0;
+ _glBindBuffer(34962,($24|0));
+ $25 = HEAP32[(20940)>>2]|0;
+ $26 = $25 << 2;
+ $27 = HEAP32[(20952)>>2]|0;
+ _glBufferSubData(34962,0,($26|0),($27|0));
+ }
+ $28 = HEAP32[5173]|0;
+ $29 = ($28|0)>(0);
+ if ($29) {
+ $30 = HEAP32[5259]|0;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ $32 = HEAP32[5260]|0;
+ $33 = HEAP32[(20720)>>2]|0;
+ FUNCTION_TABLE_vi[$32 & 31]($33);
+ }
+ $34 = HEAP32[(20724)>>2]|0;
+ _glBindBuffer(34962,($34|0));
+ $35 = HEAP32[5173]|0;
+ $36 = ($35*12)|0;
+ $37 = HEAP32[(20704)>>2]|0;
+ _glBufferSubData(34962,0,($36|0),($37|0));
+ $38 = HEAP32[(20728)>>2]|0;
+ _glBindBuffer(34962,($38|0));
+ $39 = HEAP32[5173]|0;
+ $40 = $39 << 3;
+ $41 = HEAP32[(20708)>>2]|0;
+ _glBufferSubData(34962,0,($40|0),($41|0));
+ $42 = HEAP32[(20732)>>2]|0;
+ _glBindBuffer(34962,($42|0));
+ $43 = HEAP32[5173]|0;
+ $44 = $43 << 2;
+ $45 = HEAP32[(20712)>>2]|0;
+ _glBufferSubData(34962,0,($44|0),($45|0));
+ }
+ $46 = HEAP32[5259]|0;
+ $47 = ($46|0)==(0);
+ if ($47) {
+ return;
+ }
+ $48 = HEAP32[5260]|0;
+ FUNCTION_TABLE_vi[$48 & 31](0);
+ return;
+}
+function _DrawDefaultBuffers() {
+ var $$ = 0, $$02830 = 0, $$02932 = 0, $$031 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
+ var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
+ var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
+ var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $modelview$byval_copy = 0;
+ var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 320|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(320|0);
+ $$byval_copy2 = sp + 256|0;
+ $modelview$byval_copy = sp + 192|0;
+ $0 = sp + 128|0;
+ $1 = sp + 64|0;
+ $2 = sp;
+ dest=$0; src=20740; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$1; src=20804; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $3 = HEAP32[5217]|0;
+ $4 = ($3|0)!=(0);
+ $$ = $4 ? 2 : 1;
+ $$02932 = 0;
+ while(1) {
+ if ($4) {
+ dest=$modelview$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy2; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetStereoView($$02932,$modelview$byval_copy,$$byval_copy2);
+ }
+ $8 = HEAP32[5221]|0;
+ $9 = ($8|0)>(0);
+ $10 = HEAP32[5233]|0;
+ $11 = ($10|0)>(0);
+ $or$cond = $9 | $11;
+ $12 = HEAP32[5173]|0;
+ $13 = ($12|0)>(0);
+ $or$cond3 = $or$cond | $13;
+ if ($or$cond3) {
+ $14 = HEAP32[5245]|0;
+ _glUseProgram(($14|0));
+ dest=$modelview$byval_copy; src=20804; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy2; src=20740; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($2,$modelview$byval_copy,$$byval_copy2);
+ $15 = HEAP32[(21008)>>2]|0;
+ dest=$$byval_copy2; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $16 = (_MatrixToFloat($$byval_copy2)|0);
+ _glUniformMatrix4fv(($15|0),1,0,($16|0));
+ $17 = HEAP32[(21012)>>2]|0;
+ _glUniform4f(($17|0),1.0,1.0,1.0,1.0);
+ $18 = HEAP32[(21024)>>2]|0;
+ _glUniform1i(($18|0),0);
+ }
+ $19 = HEAP32[5221]|0;
+ $20 = ($19|0)>(0);
+ if ($20) {
+ $21 = HEAP32[5219]|0;
+ _glBindTexture(3553,($21|0));
+ $22 = HEAP32[5259]|0;
+ $23 = ($22|0)==(0);
+ if ($23) {
+ $26 = HEAP32[(20916)>>2]|0;
+ _glBindBuffer(34962,($26|0));
+ $27 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($27|0),3,5126,0,0,(0|0));
+ $28 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($28|0));
+ $29 = HEAP32[(20920)>>2]|0;
+ _glBindBuffer(34962,($29|0));
+ $30 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($30|0),4,5121,1,0,(0|0));
+ $31 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($31|0));
+ } else {
+ $24 = HEAP32[5260]|0;
+ $25 = HEAP32[(20912)>>2]|0;
+ FUNCTION_TABLE_vi[$24 & 31]($25);
+ }
+ $32 = HEAP32[5221]|0;
+ _glDrawArrays(1,0,($32|0));
+ $33 = HEAP32[5259]|0;
+ $34 = ($33|0)==(0);
+ if ($34) {
+ _glBindBuffer(34962,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $35 = HEAP32[5233]|0;
+ $36 = ($35|0)>(0);
+ if ($36) {
+ $37 = HEAP32[5219]|0;
+ _glBindTexture(3553,($37|0));
+ $38 = HEAP32[5259]|0;
+ $39 = ($38|0)==(0);
+ if ($39) {
+ $42 = HEAP32[(20964)>>2]|0;
+ _glBindBuffer(34962,($42|0));
+ $43 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($43|0),3,5126,0,0,(0|0));
+ $44 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($44|0));
+ $45 = HEAP32[(20968)>>2]|0;
+ _glBindBuffer(34962,($45|0));
+ $46 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($46|0),4,5121,1,0,(0|0));
+ $47 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($47|0));
+ } else {
+ $40 = HEAP32[5260]|0;
+ $41 = HEAP32[(20960)>>2]|0;
+ FUNCTION_TABLE_vi[$40 & 31]($41);
+ }
+ $48 = HEAP32[5233]|0;
+ _glDrawArrays(4,0,($48|0));
+ $49 = HEAP32[5259]|0;
+ $50 = ($49|0)==(0);
+ if ($50) {
+ _glBindBuffer(34962,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $51 = HEAP32[5173]|0;
+ $52 = ($51|0)>(0);
+ if ($52) {
+ $53 = HEAP32[5259]|0;
+ $54 = ($53|0)==(0);
+ if ($54) {
+ $57 = HEAP32[(20724)>>2]|0;
+ _glBindBuffer(34962,($57|0));
+ $58 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($58|0),3,5126,0,0,(0|0));
+ $59 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($59|0));
+ $60 = HEAP32[(20728)>>2]|0;
+ _glBindBuffer(34962,($60|0));
+ $61 = HEAP32[(20988)>>2]|0;
+ _glVertexAttribPointer(($61|0),2,5126,0,0,(0|0));
+ $62 = HEAP32[(20988)>>2]|0;
+ _glEnableVertexAttribArray(($62|0));
+ $63 = HEAP32[(20732)>>2]|0;
+ _glBindBuffer(34962,($63|0));
+ $64 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($64|0),4,5121,1,0,(0|0));
+ $65 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($65|0));
+ $66 = HEAP32[(20736)>>2]|0;
+ _glBindBuffer(34963,($66|0));
+ } else {
+ $55 = HEAP32[5260]|0;
+ $56 = HEAP32[(20720)>>2]|0;
+ FUNCTION_TABLE_vi[$55 & 31]($56);
+ }
+ $67 = HEAP32[5218]|0;
+ $68 = ($67|0)>(0);
+ if ($68) {
+ $$02830 = 0;$$031 = 0;
+ while(1) {
+ $71 = HEAP32[5220]|0;
+ $72 = (($71) + (($$031*144)|0)|0);
+ $73 = HEAP32[$72>>2]|0;
+ $74 = (($73|0) / 4)&-1;
+ $75 = ($74*6)|0;
+ $76 = (((($71) + (($$031*144)|0)|0)) + 8|0);
+ $77 = HEAP32[$76>>2]|0;
+ _glBindTexture(3553,($77|0));
+ $78 = $$02830 << 1;
+ $79 = $78;
+ _glDrawElements(4,($75|0),5123,($79|0));
+ $80 = HEAP32[5220]|0;
+ $81 = (($80) + (($$031*144)|0)|0);
+ $82 = HEAP32[$81>>2]|0;
+ $83 = (($82|0) / 4)&-1;
+ $84 = ($83*6)|0;
+ $85 = (($84) + ($$02830))|0;
+ $86 = (($$031) + 1)|0;
+ $87 = HEAP32[5218]|0;
+ $88 = ($86|0)<($87|0);
+ if ($88) {
+ $$02830 = $85;$$031 = $86;
+ } else {
+ break;
+ }
+ }
+ }
+ $69 = HEAP32[5259]|0;
+ $70 = ($69|0)==(0);
+ if ($70) {
+ _glBindBuffer(34962,0);
+ _glBindBuffer(34963,0);
+ }
+ _glBindTexture(3553,0);
+ }
+ $89 = HEAP32[5259]|0;
+ $90 = ($89|0)==(0);
+ if (!($90)) {
+ $91 = HEAP32[5260]|0;
+ FUNCTION_TABLE_vi[$91 & 31](0);
+ }
+ _glUseProgram(0);
+ $92 = (($$02932) + 1)|0;
+ $93 = ($92|0)<($$|0);
+ if ($93) {
+ $$02932 = $92;
+ } else {
+ break;
+ }
+ }
+ HEAP32[5218] = 1;
+ $5 = HEAP32[5219]|0;
+ $6 = HEAP32[5220]|0;
+ $7 = ((($6)) + 8|0);
+ HEAP32[$7>>2] = $5;
+ HEAP32[$6>>2] = 0;
+ HEAP32[5221] = 0;
+ HEAP32[(20892)>>2] = 0;
+ HEAP32[5233] = 0;
+ HEAP32[(20940)>>2] = 0;
+ HEAP32[5173] = 0;
+ HEAP32[(20696)>>2] = 0;
+ HEAP32[(20700)>>2] = 0;
+ HEAPF32[926] = -1.0;
+ dest=20740; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=20804; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _SetStereoView($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$byval_copy = 0, $$byval_copy3 = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $$byval_copy3 = sp + 192|0;
+ $$byval_copy = sp + 64|0;
+ $3 = sp;
+ $4 = sp + 128|0;
+ dest=$3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $5 = HEAP32[5277]|0;
+ $6 = Math_imul($5, $0)|0;
+ $7 = (($6|0) / 2)&-1;
+ $8 = (($5|0) / 2)&-1;
+ $9 = HEAP32[5278]|0;
+ _rlViewport($7,0,$8,$9);
+ $10 = (21344 + ($0<<6)|0);
+ dest=$$byval_copy; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy3; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($4,$$byval_copy,$$byval_copy3);
+ $11 = (21216 + ($0<<6)|0);
+ dest=$3; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetMatrixModelview($$byval_copy3);
+ dest=$$byval_copy3; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetMatrixProjection($$byval_copy3);
+ STACKTOP = sp;return;
+}
+function _MatrixMultiply($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0;
+ var $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0;
+ var $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0;
+ var $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0;
+ var $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0;
+ var $18 = 0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0;
+ var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0;
+ var $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0;
+ var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
+ var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = +HEAPF32[$2>>2];
+ $4 = +HEAPF32[$1>>2];
+ $5 = $3 * $4;
+ $6 = ((($2)) + 16|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = ((($1)) + 4|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = $7 * $9;
+ $11 = $5 + $10;
+ $12 = ((($2)) + 32|0);
+ $13 = +HEAPF32[$12>>2];
+ $14 = ((($1)) + 8|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = $13 * $15;
+ $17 = $11 + $16;
+ $18 = ((($2)) + 48|0);
+ $19 = +HEAPF32[$18>>2];
+ $20 = ((($1)) + 12|0);
+ $21 = +HEAPF32[$20>>2];
+ $22 = $19 * $21;
+ $23 = $17 + $22;
+ $24 = ((($1)) + 16|0);
+ $25 = +HEAPF32[$24>>2];
+ $26 = $3 * $25;
+ $27 = ((($1)) + 20|0);
+ $28 = +HEAPF32[$27>>2];
+ $29 = $7 * $28;
+ $30 = $26 + $29;
+ $31 = ((($1)) + 24|0);
+ $32 = +HEAPF32[$31>>2];
+ $33 = $13 * $32;
+ $34 = $30 + $33;
+ $35 = ((($1)) + 28|0);
+ $36 = +HEAPF32[$35>>2];
+ $37 = $19 * $36;
+ $38 = $34 + $37;
+ $39 = ((($1)) + 32|0);
+ $40 = +HEAPF32[$39>>2];
+ $41 = $3 * $40;
+ $42 = ((($1)) + 36|0);
+ $43 = +HEAPF32[$42>>2];
+ $44 = $7 * $43;
+ $45 = $41 + $44;
+ $46 = ((($1)) + 40|0);
+ $47 = +HEAPF32[$46>>2];
+ $48 = $13 * $47;
+ $49 = $45 + $48;
+ $50 = ((($1)) + 44|0);
+ $51 = +HEAPF32[$50>>2];
+ $52 = $19 * $51;
+ $53 = $49 + $52;
+ $54 = ((($1)) + 48|0);
+ $55 = +HEAPF32[$54>>2];
+ $56 = $3 * $55;
+ $57 = ((($1)) + 52|0);
+ $58 = +HEAPF32[$57>>2];
+ $59 = $7 * $58;
+ $60 = $56 + $59;
+ $61 = ((($1)) + 56|0);
+ $62 = +HEAPF32[$61>>2];
+ $63 = $13 * $62;
+ $64 = $60 + $63;
+ $65 = ((($1)) + 60|0);
+ $66 = +HEAPF32[$65>>2];
+ $67 = $19 * $66;
+ $68 = $64 + $67;
+ $69 = ((($2)) + 4|0);
+ $70 = +HEAPF32[$69>>2];
+ $71 = $4 * $70;
+ $72 = ((($2)) + 20|0);
+ $73 = +HEAPF32[$72>>2];
+ $74 = $9 * $73;
+ $75 = $71 + $74;
+ $76 = ((($2)) + 36|0);
+ $77 = +HEAPF32[$76>>2];
+ $78 = $15 * $77;
+ $79 = $75 + $78;
+ $80 = ((($2)) + 52|0);
+ $81 = +HEAPF32[$80>>2];
+ $82 = $21 * $81;
+ $83 = $79 + $82;
+ $84 = $25 * $70;
+ $85 = $28 * $73;
+ $86 = $84 + $85;
+ $87 = $32 * $77;
+ $88 = $86 + $87;
+ $89 = $36 * $81;
+ $90 = $88 + $89;
+ $91 = $40 * $70;
+ $92 = $43 * $73;
+ $93 = $91 + $92;
+ $94 = $47 * $77;
+ $95 = $93 + $94;
+ $96 = $51 * $81;
+ $97 = $95 + $96;
+ $98 = $55 * $70;
+ $99 = $58 * $73;
+ $100 = $98 + $99;
+ $101 = $62 * $77;
+ $102 = $100 + $101;
+ $103 = $66 * $81;
+ $104 = $102 + $103;
+ $105 = ((($2)) + 8|0);
+ $106 = +HEAPF32[$105>>2];
+ $107 = $4 * $106;
+ $108 = ((($2)) + 24|0);
+ $109 = +HEAPF32[$108>>2];
+ $110 = $9 * $109;
+ $111 = $107 + $110;
+ $112 = ((($2)) + 40|0);
+ $113 = +HEAPF32[$112>>2];
+ $114 = $15 * $113;
+ $115 = $111 + $114;
+ $116 = ((($2)) + 56|0);
+ $117 = +HEAPF32[$116>>2];
+ $118 = $21 * $117;
+ $119 = $115 + $118;
+ $120 = $25 * $106;
+ $121 = $28 * $109;
+ $122 = $120 + $121;
+ $123 = $32 * $113;
+ $124 = $122 + $123;
+ $125 = $36 * $117;
+ $126 = $124 + $125;
+ $127 = $40 * $106;
+ $128 = $43 * $109;
+ $129 = $127 + $128;
+ $130 = $47 * $113;
+ $131 = $129 + $130;
+ $132 = $51 * $117;
+ $133 = $131 + $132;
+ $134 = $55 * $106;
+ $135 = $58 * $109;
+ $136 = $134 + $135;
+ $137 = $62 * $113;
+ $138 = $136 + $137;
+ $139 = $66 * $117;
+ $140 = $138 + $139;
+ $141 = ((($2)) + 12|0);
+ $142 = +HEAPF32[$141>>2];
+ $143 = $4 * $142;
+ $144 = ((($2)) + 28|0);
+ $145 = +HEAPF32[$144>>2];
+ $146 = $9 * $145;
+ $147 = $143 + $146;
+ $148 = ((($2)) + 44|0);
+ $149 = +HEAPF32[$148>>2];
+ $150 = $15 * $149;
+ $151 = $147 + $150;
+ $152 = ((($2)) + 60|0);
+ $153 = +HEAPF32[$152>>2];
+ $154 = $21 * $153;
+ $155 = $151 + $154;
+ $156 = $25 * $142;
+ $157 = $28 * $145;
+ $158 = $156 + $157;
+ $159 = $32 * $149;
+ $160 = $158 + $159;
+ $161 = $36 * $153;
+ $162 = $160 + $161;
+ $163 = $40 * $142;
+ $164 = $43 * $145;
+ $165 = $163 + $164;
+ $166 = $47 * $149;
+ $167 = $165 + $166;
+ $168 = $51 * $153;
+ $169 = $167 + $168;
+ $170 = $55 * $142;
+ $171 = $58 * $145;
+ $172 = $170 + $171;
+ $173 = $62 * $149;
+ $174 = $172 + $173;
+ $175 = $66 * $153;
+ $176 = $174 + $175;
+ HEAPF32[$0>>2] = $23;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $83;
+ $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $119;
+ $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
+ HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = $155;
+ $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
+ HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $38;
+ $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $90;
+ $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
+ HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $126;
+ $$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
+ HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = $162;
+ $$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
+ HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $53;
+ $$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
+ HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $97;
+ $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $133;
+ $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
+ HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = $169;
+ $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $68;
+ $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $104;
+ $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $140;
+ $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = $176;
+ return;
+}
+function _MatrixToFloat($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ HEAP32[5261] = $1;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ HEAP32[(21048)>>2] = $3;
+ $4 = ((($0)) + 8|0);
+ $5 = HEAP32[$4>>2]|0;
+ HEAP32[(21052)>>2] = $5;
+ $6 = ((($0)) + 12|0);
+ $7 = HEAP32[$6>>2]|0;
+ HEAP32[(21056)>>2] = $7;
+ $8 = ((($0)) + 16|0);
+ $9 = HEAP32[$8>>2]|0;
+ HEAP32[(21060)>>2] = $9;
+ $10 = ((($0)) + 20|0);
+ $11 = HEAP32[$10>>2]|0;
+ HEAP32[(21064)>>2] = $11;
+ $12 = ((($0)) + 24|0);
+ $13 = HEAP32[$12>>2]|0;
+ HEAP32[(21068)>>2] = $13;
+ $14 = ((($0)) + 28|0);
+ $15 = HEAP32[$14>>2]|0;
+ HEAP32[(21072)>>2] = $15;
+ $16 = ((($0)) + 32|0);
+ $17 = HEAP32[$16>>2]|0;
+ HEAP32[(21076)>>2] = $17;
+ $18 = ((($0)) + 36|0);
+ $19 = HEAP32[$18>>2]|0;
+ HEAP32[(21080)>>2] = $19;
+ $20 = ((($0)) + 40|0);
+ $21 = HEAP32[$20>>2]|0;
+ HEAP32[(21084)>>2] = $21;
+ $22 = ((($0)) + 44|0);
+ $23 = HEAP32[$22>>2]|0;
+ HEAP32[(21088)>>2] = $23;
+ $24 = ((($0)) + 48|0);
+ $25 = HEAP32[$24>>2]|0;
+ HEAP32[(21092)>>2] = $25;
+ $26 = ((($0)) + 52|0);
+ $27 = HEAP32[$26>>2]|0;
+ HEAP32[(21096)>>2] = $27;
+ $28 = ((($0)) + 56|0);
+ $29 = HEAP32[$28>>2]|0;
+ HEAP32[(21100)>>2] = $29;
+ $30 = ((($0)) + 60|0);
+ $31 = HEAP32[$30>>2]|0;
+ HEAP32[(21104)>>2] = $31;
+ return (21044|0);
+}
+function _rlViewport($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glViewport(($0|0),($1|0),($2|0),($3|0));
+ return;
+}
+function _SetMatrixModelview($0) {
+ $0 = $0|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=20804; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _SetMatrixProjection($0) {
+ $0 = $0|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=20740; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _VectorTransform($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0;
+ var $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0;
+ var $47 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = +HEAPF32[$0>>2];
+ $3 = ((($0)) + 4|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($0)) + 8|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = +HEAPF32[$1>>2];
+ $8 = $2 * $7;
+ $9 = ((($1)) + 4|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = $4 * $10;
+ $12 = $8 + $11;
+ $13 = ((($1)) + 8|0);
+ $14 = +HEAPF32[$13>>2];
+ $15 = $6 * $14;
+ $16 = $12 + $15;
+ $17 = ((($1)) + 12|0);
+ $18 = +HEAPF32[$17>>2];
+ $19 = $18 + $16;
+ HEAPF32[$0>>2] = $19;
+ $20 = ((($1)) + 16|0);
+ $21 = +HEAPF32[$20>>2];
+ $22 = $2 * $21;
+ $23 = ((($1)) + 20|0);
+ $24 = +HEAPF32[$23>>2];
+ $25 = $4 * $24;
+ $26 = $22 + $25;
+ $27 = ((($1)) + 24|0);
+ $28 = +HEAPF32[$27>>2];
+ $29 = $6 * $28;
+ $30 = $26 + $29;
+ $31 = ((($1)) + 28|0);
+ $32 = +HEAPF32[$31>>2];
+ $33 = $32 + $30;
+ HEAPF32[$3>>2] = $33;
+ $34 = ((($1)) + 32|0);
+ $35 = +HEAPF32[$34>>2];
+ $36 = $2 * $35;
+ $37 = ((($1)) + 36|0);
+ $38 = +HEAPF32[$37>>2];
+ $39 = $4 * $38;
+ $40 = $36 + $39;
+ $41 = ((($1)) + 40|0);
+ $42 = +HEAPF32[$41>>2];
+ $43 = $6 * $42;
+ $44 = $40 + $43;
+ $45 = ((($1)) + 44|0);
+ $46 = +HEAPF32[$45>>2];
+ $47 = $46 + $44;
+ HEAPF32[$5>>2] = $47;
+ return;
+}
+function _rlVertex3f($0,$1,$2) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
+ var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $3 = HEAP32[5626]|0;
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = HEAP32[5628]|0;
+ $6 = HEAP32[5627]|0;
+ $7 = (($5) + (($6*12)|0)|0);
+ HEAPF32[$7>>2] = $0;
+ $8 = (((($5) + (($6*12)|0)|0)) + 4|0);
+ HEAPF32[$8>>2] = $1;
+ $9 = (((($5) + (($6*12)|0)|0)) + 8|0);
+ HEAPF32[$9>>2] = $2;
+ $10 = (($6) + 1)|0;
+ HEAP32[5627] = $10;
+ STACKTOP = sp;return;
+ }
+ $11 = HEAP32[5629]|0;
+ switch ($11|0) {
+ case 1: {
+ $12 = HEAP32[5221]|0;
+ $13 = ($12|0)<(2048);
+ if ($13) {
+ $14 = HEAP32[(20896)>>2]|0;
+ $15 = ($12*3)|0;
+ $16 = (($14) + ($15<<2)|0);
+ HEAPF32[$16>>2] = $0;
+ $17 = (($15) + 1)|0;
+ $18 = (($14) + ($17<<2)|0);
+ HEAPF32[$18>>2] = $1;
+ $19 = (($15) + 2)|0;
+ $20 = (($14) + ($19<<2)|0);
+ HEAPF32[$20>>2] = $2;
+ $21 = (($12) + 1)|0;
+ HEAP32[5221] = $21;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(2,8222,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ case 4: {
+ $22 = HEAP32[5233]|0;
+ $23 = ($22|0)<(6144);
+ if ($23) {
+ $24 = HEAP32[(20944)>>2]|0;
+ $25 = ($22*3)|0;
+ $26 = (($24) + ($25<<2)|0);
+ HEAPF32[$26>>2] = $0;
+ $27 = (($25) + 1)|0;
+ $28 = (($24) + ($27<<2)|0);
+ HEAPF32[$28>>2] = $1;
+ $29 = (($25) + 2)|0;
+ $30 = (($24) + ($29<<2)|0);
+ HEAPF32[$30>>2] = $2;
+ $31 = (($22) + 1)|0;
+ HEAP32[5233] = $31;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(2,8247,$vararg_buffer1);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ case 7: {
+ $32 = HEAP32[5173]|0;
+ $33 = ($32|0)<(4096);
+ if ($33) {
+ $34 = HEAP32[(20704)>>2]|0;
+ $35 = ($32*3)|0;
+ $36 = (($34) + ($35<<2)|0);
+ HEAPF32[$36>>2] = $0;
+ $37 = (($35) + 1)|0;
+ $38 = (($34) + ($37<<2)|0);
+ HEAPF32[$38>>2] = $1;
+ $39 = (($35) + 2)|0;
+ $40 = (($34) + ($39<<2)|0);
+ HEAPF32[$40>>2] = $2;
+ $41 = (($32) + 1)|0;
+ HEAP32[5173] = $41;
+ $42 = HEAP32[5220]|0;
+ $43 = HEAP32[5218]|0;
+ $44 = (($43) + -1)|0;
+ $45 = (($42) + (($44*144)|0)|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = (($46) + 1)|0;
+ HEAP32[$45>>2] = $47;
+ STACKTOP = sp;return;
+ } else {
+ _TraceLog(2,8276,$vararg_buffer3);
+ STACKTOP = sp;return;
+ }
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _MatrixIdentity($0) {
+ $0 = $0|0;
+ var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF32[$0>>2] = 1.0;
+ $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
+ ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = 1.0;
+ $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
+ ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = 1.0;
+ $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
+ ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
+ return;
+}
+function _VectorNormalize($0) {
+ $0 = $0|0;
+ var $$byval_copy = 0, $$op = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $$byval_copy = sp;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
+ $1 = (+_VectorLength($$byval_copy));
+ $2 = $1 == 0.0;
+ $$op = 1.0 / $1;
+ $3 = $2 ? 1.0 : $$op;
+ $4 = +HEAPF32[$0>>2];
+ $5 = $4 * $3;
+ HEAPF32[$0>>2] = $5;
+ $6 = ((($0)) + 4|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = $3 * $7;
+ HEAPF32[$6>>2] = $8;
+ $9 = ((($0)) + 8|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = $3 * $10;
+ HEAPF32[$9>>2] = $11;
+ STACKTOP = sp;return;
+}
+function _MatrixRotate($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = +$2;
+ var $$ = 0.0, $$221 = 0.0, $$222 = 0.0, $$sroa$10$0$$sroa_idx199 = 0, $$sroa$11$0$$sroa_idx201 = 0, $$sroa$12$0$$sroa_idx203 = 0, $$sroa$13$0$$sroa_idx205 = 0, $$sroa$14$0$$sroa_idx207 = 0, $$sroa$15$0$$sroa_idx209 = 0, $$sroa$16$0$$sroa_idx211 = 0, $$sroa$17$0$$sroa_idx213 = 0, $$sroa$18$0$$sroa_idx215 = 0, $$sroa$4$0$$sroa_idx187 = 0, $$sroa$5$0$$sroa_idx189 = 0, $$sroa$6$0$$sroa_idx191 = 0, $$sroa$7$0$$sroa_idx193 = 0, $$sroa$8$0$$sroa_idx195 = 0, $$sroa$9$0$$sroa_idx197 = 0, $10 = 0.0, $100 = 0.0;
+ var $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0;
+ var $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
+ var $138 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0;
+ var $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0;
+ var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0;
+ var $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0;
+ var $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $3 = sp;
+ _MatrixIdentity($3);
+ $4 = +HEAPF32[$1>>2];
+ $5 = ((($1)) + 4|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = ((($1)) + 8|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $4 * $4;
+ $10 = $6 * $6;
+ $11 = $9 + $10;
+ $12 = $8 * $8;
+ $13 = $11 + $12;
+ $14 = (+Math_sqrt((+$13)));
+ $15 = $14 != 1.0;
+ $16 = $14 != 0.0;
+ $or$cond = $15 & $16;
+ $17 = 1.0 / $14;
+ $18 = $4 * $17;
+ $19 = $6 * $17;
+ $20 = $8 * $17;
+ $$ = $or$cond ? $20 : $8;
+ $$221 = $or$cond ? $19 : $6;
+ $$222 = $or$cond ? $18 : $4;
+ $21 = (+Math_sin((+$2)));
+ $22 = (+Math_cos((+$2)));
+ $23 = 1.0 - $22;
+ $24 = +HEAPF32[$3>>2];
+ $25 = ((($3)) + 16|0);
+ $26 = +HEAPF32[$25>>2];
+ $27 = ((($3)) + 32|0);
+ $28 = +HEAPF32[$27>>2];
+ $29 = ((($3)) + 48|0);
+ $30 = +HEAPF32[$29>>2];
+ $31 = ((($3)) + 4|0);
+ $32 = +HEAPF32[$31>>2];
+ $33 = ((($3)) + 20|0);
+ $34 = +HEAPF32[$33>>2];
+ $35 = ((($3)) + 36|0);
+ $36 = +HEAPF32[$35>>2];
+ $37 = ((($3)) + 52|0);
+ $38 = +HEAPF32[$37>>2];
+ $39 = ((($3)) + 8|0);
+ $40 = +HEAPF32[$39>>2];
+ $41 = ((($3)) + 24|0);
+ $42 = +HEAPF32[$41>>2];
+ $43 = ((($3)) + 40|0);
+ $44 = +HEAPF32[$43>>2];
+ $45 = ((($3)) + 56|0);
+ $46 = +HEAPF32[$45>>2];
+ $47 = $$222 * $$222;
+ $48 = $23 * $47;
+ $49 = $22 + $48;
+ $50 = $$221 * $$222;
+ $51 = $23 * $50;
+ $52 = $21 * $$;
+ $53 = $52 + $51;
+ $54 = $$ * $$222;
+ $55 = $23 * $54;
+ $56 = $21 * $$221;
+ $57 = $55 - $56;
+ $58 = $51 - $52;
+ $59 = $$221 * $$221;
+ $60 = $23 * $59;
+ $61 = $22 + $60;
+ $62 = $$ * $$221;
+ $63 = $23 * $62;
+ $64 = $21 * $$222;
+ $65 = $64 + $63;
+ $66 = $56 + $55;
+ $67 = $63 - $64;
+ $68 = $$ * $$;
+ $69 = $23 * $68;
+ $70 = $22 + $69;
+ $71 = $24 * $49;
+ $72 = $53 * $32;
+ $73 = $71 + $72;
+ $74 = $57 * $40;
+ $75 = $73 + $74;
+ $76 = $26 * $49;
+ $77 = $53 * $34;
+ $78 = $76 + $77;
+ $79 = $57 * $42;
+ $80 = $78 + $79;
+ $81 = $28 * $49;
+ $82 = $53 * $36;
+ $83 = $81 + $82;
+ $84 = $57 * $44;
+ $85 = $83 + $84;
+ $86 = $30 * $49;
+ $87 = $53 * $38;
+ $88 = $86 + $87;
+ $89 = $57 * $46;
+ $90 = $88 + $89;
+ $91 = $24 * $58;
+ $92 = $61 * $32;
+ $93 = $91 + $92;
+ $94 = $65 * $40;
+ $95 = $93 + $94;
+ $96 = $26 * $58;
+ $97 = $61 * $34;
+ $98 = $96 + $97;
+ $99 = $65 * $42;
+ $100 = $98 + $99;
+ $101 = $28 * $58;
+ $102 = $61 * $36;
+ $103 = $101 + $102;
+ $104 = $65 * $44;
+ $105 = $103 + $104;
+ $106 = $30 * $58;
+ $107 = $61 * $38;
+ $108 = $106 + $107;
+ $109 = $65 * $46;
+ $110 = $108 + $109;
+ $111 = $24 * $66;
+ $112 = $67 * $32;
+ $113 = $111 + $112;
+ $114 = $70 * $40;
+ $115 = $113 + $114;
+ $116 = $26 * $66;
+ $117 = $67 * $34;
+ $118 = $116 + $117;
+ $119 = $70 * $42;
+ $120 = $118 + $119;
+ $121 = $28 * $66;
+ $122 = $67 * $36;
+ $123 = $121 + $122;
+ $124 = $70 * $44;
+ $125 = $123 + $124;
+ $126 = $30 * $66;
+ $127 = $67 * $38;
+ $128 = $126 + $127;
+ $129 = $70 * $46;
+ $130 = $128 + $129;
+ $131 = ((($3)) + 12|0);
+ $132 = HEAP32[$131>>2]|0;
+ $133 = ((($3)) + 28|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = ((($3)) + 44|0);
+ $136 = HEAP32[$135>>2]|0;
+ $137 = ((($3)) + 60|0);
+ $138 = HEAP32[$137>>2]|0;
+ HEAPF32[$0>>2] = $75;
+ $$sroa$4$0$$sroa_idx187 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx187>>2] = $95;
+ $$sroa$5$0$$sroa_idx189 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx189>>2] = $115;
+ $$sroa$6$0$$sroa_idx191 = ((($0)) + 12|0);
+ HEAP32[$$sroa$6$0$$sroa_idx191>>2] = $132;
+ $$sroa$7$0$$sroa_idx193 = ((($0)) + 16|0);
+ HEAPF32[$$sroa$7$0$$sroa_idx193>>2] = $80;
+ $$sroa$8$0$$sroa_idx195 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$8$0$$sroa_idx195>>2] = $100;
+ $$sroa$9$0$$sroa_idx197 = ((($0)) + 24|0);
+ HEAPF32[$$sroa$9$0$$sroa_idx197>>2] = $120;
+ $$sroa$10$0$$sroa_idx199 = ((($0)) + 28|0);
+ HEAP32[$$sroa$10$0$$sroa_idx199>>2] = $134;
+ $$sroa$11$0$$sroa_idx201 = ((($0)) + 32|0);
+ HEAPF32[$$sroa$11$0$$sroa_idx201>>2] = $85;
+ $$sroa$12$0$$sroa_idx203 = ((($0)) + 36|0);
+ HEAPF32[$$sroa$12$0$$sroa_idx203>>2] = $105;
+ $$sroa$13$0$$sroa_idx205 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$13$0$$sroa_idx205>>2] = $125;
+ $$sroa$14$0$$sroa_idx207 = ((($0)) + 44|0);
+ HEAP32[$$sroa$14$0$$sroa_idx207>>2] = $136;
+ $$sroa$15$0$$sroa_idx209 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx209>>2] = $90;
+ $$sroa$16$0$$sroa_idx211 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx211>>2] = $110;
+ $$sroa$17$0$$sroa_idx213 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx213>>2] = $130;
+ $$sroa$18$0$$sroa_idx215 = ((($0)) + 60|0);
+ HEAP32[$$sroa$18$0$$sroa_idx215>>2] = $138;
+ STACKTOP = sp;return;
+}
+function _MatrixTranspose($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($0)) + 12|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($0)) + 16|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($0)) + 24|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($0)) + 28|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = ((($0)) + 32|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ((($0)) + 36|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = ((($0)) + 44|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = ((($0)) + 48|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ((($0)) + 52|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = ((($0)) + 56|0);
+ $24 = HEAP32[$23>>2]|0;
+ HEAP32[$1>>2] = $8;
+ HEAP32[$3>>2] = $14;
+ HEAP32[$5>>2] = $20;
+ HEAP32[$7>>2] = $2;
+ HEAP32[$9>>2] = $16;
+ HEAP32[$11>>2] = $22;
+ HEAP32[$13>>2] = $4;
+ HEAP32[$15>>2] = $10;
+ HEAP32[$17>>2] = $24;
+ HEAP32[$19>>2] = $6;
+ HEAP32[$21>>2] = $12;
+ HEAP32[$23>>2] = $18;
+ return;
+}
+function _VectorLength($0) {
+ $0 = $0|0;
+ var $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = +HEAPF32[$0>>2];
+ $2 = $1 * $1;
+ $3 = ((($0)) + 4|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = $4 * $4;
+ $6 = $2 + $5;
+ $7 = ((($0)) + 8|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $8 * $8;
+ $10 = $6 + $9;
+ $11 = (+Math_sqrt((+$10)));
+ return (+$11);
+}
+function _MatrixTranslate($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ var $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF32[$0>>2] = 1.0;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
+ ;HEAP32[$$sroa$4$0$$sroa_idx2>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+4>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+8>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+12>>2]=0|0;
+ HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = 1.0;
+ $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
+ $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
+ ;HEAP32[$$sroa$9$0$$sroa_idx12>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+4>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+8>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+12>>2]=0|0;
+ HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = 1.0;
+ $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
+ HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
+ $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $1;
+ $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $2;
+ $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $3;
+ $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
+ return;
+}
+function _rlLoadIdentity() {
+ var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $0 = sp;
+ $1 = HEAP32[5625]|0;
+ _MatrixIdentity($0);
+ dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _FormatText($0,$varargs) {
+ $0 = $0|0;
+ $varargs = $varargs|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp;
+ HEAP32[$1>>2] = $varargs;
+ (_vsprintf(23512,$0,$1)|0);
+ STACKTOP = sp;return (23512|0);
+}
+function _DrawFPS($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $$byval_copy = sp;
+ $2 = sp + 4|0;
+ $3 = HEAP32[5631]|0;
+ $4 = HEAP32[927]|0;
+ $5 = ($3|0)<($4|0);
+ if ($5) {
+ $6 = (($3) + 1)|0;
+ $$sink = $6;
+ } else {
+ $7 = (_GetFPS()|0);
+ HEAP32[5632] = $7;
+ HEAP32[927] = $7;
+ $$sink = 0;
+ }
+ HEAP32[5631] = $$sink;
+ $8 = HEAP32[5632]|0;
+ HEAP32[$$byval_copy>>2] = $8;
+ (_FormatText(8339,$$byval_copy)|0);
+ HEAP8[$2>>0] = 0;
+ $9 = ((($2)) + 1|0);
+ HEAP8[$9>>0] = -98;
+ $10 = ((($2)) + 2|0);
+ HEAP8[$10>>0] = 47;
+ $11 = ((($2)) + 3|0);
+ HEAP8[$11>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$2+3>>0]|0;
+ _DrawText(23512,$0,$1,20,$$byval_copy);
+ STACKTOP = sp;return;
+}
+function _GetFPS() {
+ var $0 = 0.0, $1 = 0.0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_GetFrameTime());
+ $1 = 1.0 / $0;
+ $2 = (~~(($1)));
+ return ($2|0);
+}
+function _GetFrameTime() {
+ var $0 = 0.0, $1 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = +HEAPF64[2430];
+ $1 = $0;
+ return (+$1);
+}
+function _LoadTexture($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$byval_copy1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $$byval_copy1 = sp + 44|0;
+ $vararg_buffer = sp;
+ $2 = sp + 24|0;
+ $3 = sp + 4|0;
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;
+ _LoadImage($3,$1);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0|0);
+ if ($5) {
+ _TraceLog(1,8347,$vararg_buffer);
+ ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;
+ STACKTOP = sp;return;
+ } else {
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$3+16>>2]|0;
+ _LoadTextureFromImage($2,$$byval_copy1);
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$3+16>>2]|0;
+ _UnloadImage($$byval_copy1);
+ ;HEAP32[$0>>2]=HEAP32[$2>>2]|0;HEAP32[$0+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$2+16>>2]|0;
+ STACKTOP = sp;return;
+ }
+}
+function _LoadRenderTexture($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $3 = sp;
+ _rlglLoadRenderTexture($3,$1,$2);
+ dest=$0; src=$3; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlglLoadRenderTexture($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0;
+ var $vararg_buffer1 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0, $vararg_buffer9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
+ $vararg_buffer9 = sp + 40|0;
+ $vararg_buffer7 = sp + 32|0;
+ $vararg_buffer5 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $3 = sp + 44|0;
+ HEAP32[$3>>2] = 0;
+ $4 = ((($3)) + 4|0);
+ HEAP32[$4>>2] = 0;
+ $5 = ((($3)) + 8|0);
+ HEAP32[$5>>2] = $1;
+ $6 = ((($3)) + 12|0);
+ HEAP32[$6>>2] = $2;
+ $7 = ((($3)) + 20|0);
+ HEAP32[$7>>2] = 7;
+ $8 = ((($3)) + 16|0);
+ HEAP32[$8>>2] = 1;
+ $9 = ((($3)) + 24|0);
+ HEAP32[$9>>2] = 0;
+ $10 = ((($3)) + 28|0);
+ HEAP32[$10>>2] = $1;
+ $11 = ((($3)) + 32|0);
+ HEAP32[$11>>2] = $2;
+ $12 = ((($3)) + 40|0);
+ HEAP32[$12>>2] = 19;
+ $13 = ((($3)) + 36|0);
+ HEAP32[$13>>2] = 1;
+ _glGenTextures(1,($4|0));
+ $14 = HEAP32[$4>>2]|0;
+ _glBindTexture(3553,($14|0));
+ _glTexParameteri(3553,10242,33071);
+ _glTexParameteri(3553,10243,33071);
+ _glTexParameteri(3553,10241,9729);
+ _glTexParameteri(3553,10240,9729);
+ _glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,5121,(0|0));
+ _glBindTexture(3553,0);
+ _glGenRenderbuffers(1,($9|0));
+ $15 = HEAP32[$9>>2]|0;
+ _glBindRenderbuffer(36161,($15|0));
+ _glRenderbufferStorage(36161,33189,($1|0),($2|0));
+ _glGenFramebuffers(1,($3|0));
+ $16 = HEAP32[$3>>2]|0;
+ _glBindFramebuffer(36160,($16|0));
+ $17 = HEAP32[$4>>2]|0;
+ _glFramebufferTexture2D(36160,36064,3553,($17|0),0);
+ $18 = HEAP32[$9>>2]|0;
+ _glFramebufferRenderbuffer(36160,36096,36161,($18|0));
+ $19 = (_glCheckFramebufferStatus(36160)|0);
+ $20 = ($19|0)==(36053);
+ if ($20) {
+ $21 = HEAP32[$3>>2]|0;
+ HEAP32[$vararg_buffer9>>2] = $21;
+ _TraceLog(0,8556,$vararg_buffer9);
+ _glBindFramebuffer(36160,0);
+ dest=$0; src=$3; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ _TraceLog(1,8376,$vararg_buffer);
+ switch ($19|0) {
+ case 36061: {
+ _TraceLog(1,8419,$vararg_buffer1);
+ break;
+ }
+ case 36054: {
+ _TraceLog(1,8446,$vararg_buffer3);
+ break;
+ }
+ case 36057: {
+ _TraceLog(1,8480,$vararg_buffer5);
+ break;
+ }
+ case 36055: {
+ _TraceLog(1,8514,$vararg_buffer7);
+ break;
+ }
+ default: {
+ }
+ }
+ _glDeleteTextures(1,($4|0));
+ _glDeleteTextures(1,($9|0));
+ _glDeleteFramebuffers(1,($3|0));
+ _glBindFramebuffer(36160,0);
+ dest=$0; src=$3; stop=dest+44|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlGetVersion() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return 4;
+}
+function _DrawTextureRec($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $4 = 0, $5 = 0;
+ var $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, $ispos = 0, $ispos1 = 0, $neg = 0, $neg2 = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
+ $$byval_copy3 = sp + 88|0;
+ $tmpcast$byval_copy = sp + 80|0;
+ $$byval_copy2 = sp + 64|0;
+ $$byval_copy1 = sp + 48|0;
+ $$byval_copy = sp + 24|0;
+ $4 = sp + 8|0;
+ $5 = sp;
+ $6 = +HEAPF32[$2>>2];
+ $7 = (~~(($6)));
+ HEAP32[$4>>2] = $7;
+ $8 = ((($4)) + 4|0);
+ $9 = ((($2)) + 4|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = (~~(($10)));
+ HEAP32[$8>>2] = $11;
+ $12 = ((($4)) + 8|0);
+ $13 = ((($1)) + 8|0);
+ $14 = HEAP32[$13>>2]|0;
+ $ispos = ($14|0)>(-1);
+ $neg = (0 - ($14))|0;
+ $15 = $ispos ? $14 : $neg;
+ HEAP32[$12>>2] = $15;
+ $16 = ((($4)) + 12|0);
+ $17 = ((($1)) + 12|0);
+ $18 = HEAP32[$17>>2]|0;
+ $ispos1 = ($18|0)>(-1);
+ $neg2 = (0 - ($18))|0;
+ $19 = $ispos1 ? $18 : $neg2;
+ HEAP32[$16>>2] = $19;
+ $20 = $5;
+ $21 = $20;
+ HEAP32[$21>>2] = 0;
+ $22 = (($20) + 4)|0;
+ $23 = $22;
+ HEAP32[$23>>2] = 0;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$1+12>>2]|0;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$4+12>>2]|0;
+ ;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;
+ ;HEAP8[$$byval_copy3>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy3+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy3+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy3+3>>0]=HEAP8[$3+3>>0]|0;
+ _DrawTexturePro($$byval_copy,$$byval_copy1,$$byval_copy2,$tmpcast$byval_copy,0.0,$$byval_copy3);
+ STACKTOP = sp;return;
+}
+function _MatrixScale($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF32[$0>>2] = $1;
+ $$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
+ ;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = $2;
+ $$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
+ ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = $3;
+ $$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
+ ;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
+ $$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
+ return;
+}
+function _DrawGrid($0,$1) {
+ $0 = $0|0;
+ $1 = +$1;
+ var $$024 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (($0|0) / 2)&-1;
+ _rlBegin(1);
+ $3 = (0 - ($2))|0;
+ $4 = ($2|0)<($3|0);
+ if ($4) {
+ _rlEnd();
+ return;
+ }
+ $5 = (+($3|0));
+ $6 = $5 * $1;
+ $7 = (+($2|0));
+ $8 = $7 * $1;
+ $$024 = $3;
+ while(1) {
+ $9 = ($$024|0)==(0);
+ if ($9) {
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ _rlColor3f(0.5,0.5,0.5);
+ } else {
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ _rlColor3f(0.75,0.75,0.75);
+ }
+ $10 = (+($$024|0));
+ $11 = $10 * $1;
+ _rlVertex3f($11,0.0,$6);
+ _rlVertex3f($11,0.0,$8);
+ _rlVertex3f($6,0.0,$11);
+ _rlVertex3f($8,0.0,$11);
+ $12 = (($$024) + 1)|0;
+ $13 = ($$024|0)<($2|0);
+ if ($13) {
+ $$024 = $12;
+ } else {
+ break;
+ }
+ }
+ _rlEnd();
+ return;
+}
+function _rlColor3f($0,$1,$2) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ var $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = $0 * 255.0;
+ $4 = (~~(($3))&255);
+ $5 = $1 * 255.0;
+ $6 = (~~(($5))&255);
+ $7 = $2 * 255.0;
+ $8 = (~~(($7))&255);
+ _rlColor4ub($4,$6,$8,-1);
+ return;
+}
+function _LoadMesh($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
+ $vararg_buffer = sp;
+ $2 = sp + 72|0;
+ $3 = sp + 4|0;
+ dest=$2; stop=dest+68|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $4 = (_IsFileExtension($1,8608)|0);
+ $5 = ($4|0)==(0);
+ if (!($5)) {
+ _LoadOBJ($3,$1);
+ dest=$2; src=$3; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ }
+ $6 = HEAP32[$2>>2]|0;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ _TraceLog(1,8613,$vararg_buffer);
+ } else {
+ _rlglLoadMesh($2,0);
+ }
+ dest=$0; src=$2; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _LoadOBJ($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0$ph374433 = 0, $$0$ph377422 = 0, $$0$ph379$lcssa386 = 0, $$0$ph379412 = 0, $$0$ph445 = 0, $$0344$ph373432 = 0, $$0344$ph376$lcssa388 = 0, $$0344$ph376421 = 0, $$0344$ph444 = 0, $$0345$ph372$lcssa389 = 0, $$0345$ph372431 = 0, $$0345$ph443 = 0, $$0346$ph$lcssa = 0, $$0346$ph442 = 0, $$0347392 = 0, $$0348391 = 0, $$0350$ph = 0, $$0350$ph$ph = 0, $$0351$ph$ph = 0, $$0352$ph = 0;
+ var $$0352$ph$ph = 0, $$0353$ph365399 = 0, $$0353$ph367397 = 0, $$0353$ph402 = 0, $$0354$ph364398 = 0, $$0354$ph401 = 0, $$0355$ph400 = 0, $$0356 = 0, $$0357 = 0, $$1 = 0, $$byval_copy102 = 0, $$byval_copy103 = 0, $$sroa$12$0$$sroa_idx244 = 0, $$sroa$12247$0$$sroa_idx249 = 0, $$sroa$31$0$$sroa_idx270 = 0, $$sroa$45$0$$sroa_idx286 = 0, $$sroa$45289$0$$sroa_idx291 = 0, $$sroa$64$0 = 0, $$sroa$64$0$$sroa_idx312 = 0, $$sroa$74$0$$sroa_idx324 = 0;
+ var $$sroa$75 = 0, $$sroa$75$0$$sroa_idx = 0, $$sroa$75$0$$sroa_idx328 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
+ var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
+ var $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0;
+ var $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0;
+ var $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0;
+ var $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0;
+ var $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0.0;
+ var $26 = 0, $260 = 0.0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0;
+ var $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0;
+ var $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0.0, $312 = 0;
+ var $313 = 0, $314 = 0.0, $315 = 0, $316 = 0, $317 = 0.0, $318 = 0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0, $322 = 0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0.0, $327 = 0.0, $328 = 0.0, $329 = 0.0, $33 = 0, $330 = 0.0;
+ var $331 = 0.0, $332 = 0.0, $333 = 0.0, $334 = 0.0, $335 = 0.0, $336 = 0.0, $337 = 0.0, $338 = 0.0, $339 = 0.0, $34 = 0, $340 = 0.0, $341 = 0.0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0.0, $347 = 0, $348 = 0, $349 = 0;
+ var $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0;
+ var $368 = 0, $369 = 0, $37 = 0, $370 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer23 = 0, $vararg_buffer26 = 0, $vararg_buffer29 = 0, $vararg_buffer33 = 0, $vararg_buffer36 = 0;
+ var $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer44 = 0, $vararg_buffer49 = 0, $vararg_buffer52 = 0, $vararg_buffer55 = 0, $vararg_buffer58 = 0, $vararg_buffer63 = 0, $vararg_buffer7 = 0, $vararg_buffer71 = 0, $vararg_buffer79 = 0, $vararg_buffer90 = 0, $vararg_ptr10 = 0, $vararg_ptr14 = 0, $vararg_ptr18 = 0, $vararg_ptr22 = 0, $vararg_ptr32 = 0, $vararg_ptr39 = 0, $vararg_ptr40 = 0, $vararg_ptr47 = 0;
+ var $vararg_ptr48 = 0, $vararg_ptr61 = 0, $vararg_ptr62 = 0, $vararg_ptr66 = 0, $vararg_ptr67 = 0, $vararg_ptr68 = 0, $vararg_ptr69 = 0, $vararg_ptr70 = 0, $vararg_ptr74 = 0, $vararg_ptr75 = 0, $vararg_ptr76 = 0, $vararg_ptr77 = 0, $vararg_ptr78 = 0, $vararg_ptr82 = 0, $vararg_ptr83 = 0, $vararg_ptr84 = 0, $vararg_ptr85 = 0, $vararg_ptr86 = 0, $vararg_ptr87 = 0, $vararg_ptr88 = 0;
+ var $vararg_ptr89 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 672|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(672|0);
+ $$byval_copy103 = sp + 320|0;
+ $$byval_copy102 = sp + 304|0;
+ $vararg_buffer90 = sp + 296|0;
+ $vararg_buffer79 = sp + 256|0;
+ $vararg_buffer71 = sp + 232|0;
+ $vararg_buffer63 = sp + 208|0;
+ $vararg_buffer58 = sp + 192|0;
+ $vararg_buffer55 = sp + 184|0;
+ $vararg_buffer52 = sp + 176|0;
+ $vararg_buffer49 = sp + 168|0;
+ $vararg_buffer44 = sp + 152|0;
+ $vararg_buffer41 = sp + 144|0;
+ $vararg_buffer36 = sp + 128|0;
+ $vararg_buffer33 = sp + 120|0;
+ $vararg_buffer29 = sp + 112|0;
+ $vararg_buffer26 = sp + 104|0;
+ $vararg_buffer23 = sp + 96|0;
+ $vararg_buffer11 = sp + 80|0;
+ $vararg_buffer7 = sp + 64|0;
+ $vararg_buffer4 = sp + 56|0;
+ $vararg_buffer1 = sp + 48|0;
+ $vararg_buffer = sp + 40|0;
+ $$sroa$75 = sp;
+ $2 = sp + 664|0;
+ $3 = sp + 464|0;
+ $4 = sp + 428|0;
+ $5 = sp + 416|0;
+ $6 = sp + 452|0;
+ $7 = sp + 440|0;
+ $8 = sp + 404|0;
+ $9 = sp + 392|0;
+ $10 = sp + 380|0;
+ $11 = sp + 368|0;
+ $12 = sp + 356|0;
+ $13 = sp + 344|0;
+ $14 = sp + 332|0;
+ dest=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $15 = (_fopen($1,13533)|0);
+ $16 = ($15|0)==(0|0);
+ if ($16) {
+ HEAP32[$vararg_buffer>>2] = $1;
+ _TraceLog(1,8780,$vararg_buffer);
+ $$sroa$75$0$$sroa_idx = ((($0)) + 32|0);
+ ;HEAP32[$0>>2]=0|0;HEAP32[$0+4>>2]=0|0;HEAP32[$0+8>>2]=0|0;HEAP32[$0+12>>2]=0|0;HEAP32[$0+16>>2]=0|0;HEAP32[$0+20>>2]=0|0;HEAP32[$0+24>>2]=0|0;HEAP32[$0+28>>2]=0|0;
+ dest=$$sroa$75$0$$sroa_idx; src=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ $17 = (_feof($15)|0);
+ $18 = ($17|0)==(0);
+ L5: do {
+ if ($18) {
+ $$0$ph445 = 0;$$0344$ph444 = 0;$$0345$ph443 = 0;$$0346$ph442 = 0;
+ while(1) {
+ $$0$ph374433 = $$0$ph445;$$0344$ph373432 = $$0344$ph444;$$0345$ph372431 = $$0345$ph443;
+ L8: while(1) {
+ $$0$ph377422 = $$0$ph374433;$$0344$ph376421 = $$0344$ph373432;
+ L10: while(1) {
+ $$0$ph379412 = $$0$ph377422;
+ L12: while(1) {
+ L14: while(1) {
+ HEAP32[$vararg_buffer1>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer1)|0);
+ $19 = HEAP8[$2>>0]|0;
+ $20 = $19 << 24 >> 24;
+ switch ($20|0) {
+ case 102: {
+ break L8;
+ break;
+ }
+ case 118: {
+ break L14;
+ break;
+ }
+ case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($3,200,$15)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $21 = (_feof($15)|0);
+ $22 = ($21|0)==(0);
+ if (!($22)) {
+ $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
+ break L5;
+ }
+ }
+ HEAP32[$vararg_buffer4>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer4)|0);
+ $23 = HEAP8[$2>>0]|0;
+ switch ($23<<24>>24) {
+ case 116: {
+ break L10;
+ break;
+ }
+ case 110: {
+ break L12;
+ break;
+ }
+ default: {
+ }
+ }
+ $30 = (($$0$ph379412) + 1)|0;
+ (_fgets($3,200,$15)|0);
+ $31 = (_feof($15)|0);
+ $32 = ($31|0)==(0);
+ if ($32) {
+ $$0$ph379412 = $30;
+ } else {
+ $$0$ph379$lcssa386 = $30;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
+ break L5;
+ }
+ }
+ $27 = (($$0344$ph376421) + 1)|0;
+ (_fgets($3,200,$15)|0);
+ $28 = (_feof($15)|0);
+ $29 = ($28|0)==(0);
+ if ($29) {
+ $$0$ph377422 = $$0$ph379412;$$0344$ph376421 = $27;
+ } else {
+ $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $27;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $$0346$ph442;
+ break L5;
+ }
+ }
+ $24 = (($$0345$ph372431) + 1)|0;
+ (_fgets($3,200,$15)|0);
+ $25 = (_feof($15)|0);
+ $26 = ($25|0)==(0);
+ if ($26) {
+ $$0$ph374433 = $$0$ph379412;$$0344$ph373432 = $$0344$ph376421;$$0345$ph372431 = $24;
+ } else {
+ $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $24;$$0346$ph$lcssa = $$0346$ph442;
+ break L5;
+ }
+ }
+ $33 = (($$0346$ph442) + 1)|0;
+ (_fgets($3,200,$15)|0);
+ $34 = (_feof($15)|0);
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $$0$ph445 = $$0$ph379412;$$0344$ph444 = $$0344$ph376421;$$0345$ph443 = $$0345$ph372431;$$0346$ph442 = $33;
+ } else {
+ $$0$ph379$lcssa386 = $$0$ph379412;$$0344$ph376$lcssa388 = $$0344$ph376421;$$0345$ph372$lcssa389 = $$0345$ph372431;$$0346$ph$lcssa = $33;
+ break;
+ }
+ }
+ } else {
+ $$0$ph379$lcssa386 = 0;$$0344$ph376$lcssa388 = 0;$$0345$ph372$lcssa389 = 0;$$0346$ph$lcssa = 0;
+ }
+ } while(0);
+ HEAP32[$vararg_buffer7>>2] = $1;
+ $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
+ HEAP32[$vararg_ptr10>>2] = $$0$ph379$lcssa386;
+ _TraceLog(3,8817,$vararg_buffer7);
+ HEAP32[$vararg_buffer11>>2] = $1;
+ $vararg_ptr14 = ((($vararg_buffer11)) + 4|0);
+ HEAP32[$vararg_ptr14>>2] = $$0345$ph372$lcssa389;
+ _TraceLog(3,8841,$vararg_buffer11);
+ HEAP32[$$byval_copy102>>2] = $1;
+ $vararg_ptr18 = ((($$byval_copy102)) + 4|0);
+ HEAP32[$vararg_ptr18>>2] = $$0344$ph376$lcssa388;
+ _TraceLog(3,8866,$$byval_copy102);
+ HEAP32[$$byval_copy103>>2] = $1;
+ $vararg_ptr22 = ((($$byval_copy103)) + 4|0);
+ HEAP32[$vararg_ptr22>>2] = $$0346$ph$lcssa;
+ _TraceLog(3,8889,$$byval_copy103);
+ $36 = ($$0$ph379$lcssa386*12)|0;
+ $37 = (_malloc($36)|0);
+ $38 = ($$0344$ph376$lcssa388|0)>(0);
+ if ($38) {
+ $39 = ($$0344$ph376$lcssa388*12)|0;
+ $40 = (_malloc($39)|0);
+ $$0357 = $40;$369 = $40;
+ } else {
+ $$0357 = 0;$369 = 0;
+ }
+ $41 = ($$0345$ph372$lcssa389|0)>(0);
+ if ($41) {
+ $42 = $$0345$ph372$lcssa389 << 3;
+ $43 = (_malloc($42)|0);
+ $$0356 = $43;$370 = $43;
+ } else {
+ $$0356 = 0;$370 = 0;
+ }
+ _rewind($15);
+ $44 = (_feof($15)|0);
+ $45 = ($44|0)==(0);
+ L31: do {
+ if ($45) {
+ $$0353$ph402 = 0;$$0354$ph401 = 0;$$0355$ph400 = 0;
+ while(1) {
+ $$0353$ph365399 = $$0353$ph402;$$0354$ph364398 = $$0354$ph401;
+ L34: while(1) {
+ $$0353$ph367397 = $$0353$ph365399;
+ L36: while(1) {
+ L38: while(1) {
+ HEAP32[$vararg_buffer23>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer23)|0);
+ $46 = HEAP8[$2>>0]|0;
+ $47 = $46 << 24 >> 24;
+ switch ($47|0) {
+ case 118: {
+ break L38;
+ break;
+ }
+ case 102: case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($3,200,$15)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $48 = (_feof($15)|0);
+ $49 = ($48|0)==(0);
+ if (!($49)) {
+ break L31;
+ }
+ }
+ HEAP32[$vararg_buffer26>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer26)|0);
+ $50 = HEAP8[$2>>0]|0;
+ switch ($50<<24>>24) {
+ case 110: {
+ break L36;
+ break;
+ }
+ case 116: {
+ break;
+ }
+ default: {
+ break L34;
+ }
+ }
+ $51 = (($$0356) + ($$0353$ph367397<<3)|0);
+ $52 = (((($$0356) + ($$0353$ph367397<<3)|0)) + 4|0);
+ HEAP32[$vararg_buffer29>>2] = $51;
+ $vararg_ptr32 = ((($vararg_buffer29)) + 4|0);
+ HEAP32[$vararg_ptr32>>2] = $52;
+ (_fscanf($15,8914,$vararg_buffer29)|0);
+ $53 = (($$0353$ph367397) + 1)|0;
+ HEAP32[$vararg_buffer33>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer33)|0);
+ $54 = (_feof($15)|0);
+ $55 = ($54|0)==(0);
+ if ($55) {
+ $$0353$ph367397 = $53;
+ } else {
+ break L31;
+ }
+ }
+ $56 = (($$0357) + (($$0354$ph364398*12)|0)|0);
+ $57 = (((($$0357) + (($$0354$ph364398*12)|0)|0)) + 4|0);
+ $58 = (((($$0357) + (($$0354$ph364398*12)|0)|0)) + 8|0);
+ HEAP32[$vararg_buffer36>>2] = $56;
+ $vararg_ptr39 = ((($vararg_buffer36)) + 4|0);
+ HEAP32[$vararg_ptr39>>2] = $57;
+ $vararg_ptr40 = ((($vararg_buffer36)) + 8|0);
+ HEAP32[$vararg_ptr40>>2] = $58;
+ (_fscanf($15,8928,$vararg_buffer36)|0);
+ $59 = (($$0354$ph364398) + 1)|0;
+ HEAP32[$vararg_buffer41>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer41)|0);
+ $60 = (_feof($15)|0);
+ $61 = ($60|0)==(0);
+ if ($61) {
+ $$0353$ph365399 = $$0353$ph367397;$$0354$ph364398 = $59;
+ } else {
+ break L31;
+ }
+ }
+ $62 = (($37) + (($$0355$ph400*12)|0)|0);
+ $63 = (((($37) + (($$0355$ph400*12)|0)|0)) + 4|0);
+ $64 = (((($37) + (($$0355$ph400*12)|0)|0)) + 8|0);
+ HEAP32[$vararg_buffer44>>2] = $62;
+ $vararg_ptr47 = ((($vararg_buffer44)) + 4|0);
+ HEAP32[$vararg_ptr47>>2] = $63;
+ $vararg_ptr48 = ((($vararg_buffer44)) + 8|0);
+ HEAP32[$vararg_ptr48>>2] = $64;
+ (_fscanf($15,8928,$vararg_buffer44)|0);
+ $65 = (($$0355$ph400) + 1)|0;
+ HEAP32[$vararg_buffer49>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer49)|0);
+ $66 = (_feof($15)|0);
+ $67 = ($66|0)==(0);
+ if ($67) {
+ $$0353$ph402 = $$0353$ph367397;$$0354$ph401 = $$0354$ph364398;$$0355$ph400 = $65;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $68 = ($$0346$ph$lcssa*3)|0;
+ $69 = ($$0346$ph$lcssa*9)|0;
+ $70 = ($$0346$ph$lcssa*36)|0;
+ $71 = (_malloc($70)|0);
+ $72 = ($$0346$ph$lcssa*6)|0;
+ $73 = ($$0346$ph$lcssa*24)|0;
+ $74 = (_malloc($73)|0);
+ $75 = (_malloc($70)|0);
+ _rewind($15);
+ $76 = ($$0344$ph376$lcssa388|0)==(0);
+ if ($76) {
+ HEAP32[$vararg_buffer52>>2] = $1;
+ _TraceLog(0,8937,$vararg_buffer52);
+ }
+ $77 = ($$0345$ph372$lcssa389|0)==(0);
+ $78 = $$0344$ph376$lcssa388 | $$0345$ph372$lcssa389;
+ $79 = ($78|0)==(0);
+ $80 = ((($vararg_buffer11)) + 4|0);
+ $81 = ((($vararg_buffer11)) + 8|0);
+ $82 = ((($vararg_buffer11)) + 4|0);
+ $83 = ((($vararg_buffer11)) + 8|0);
+ $84 = ((($4)) + 4|0);
+ $85 = ((($4)) + 8|0);
+ $86 = ((($5)) + 4|0);
+ $87 = ((($5)) + 8|0);
+ $88 = ((($vararg_buffer11)) + 4|0);
+ $89 = ((($vararg_buffer7)) + 4|0);
+ $90 = ((($vararg_buffer11)) + 8|0);
+ $91 = ((($vararg_buffer7)) + 8|0);
+ $92 = ((($vararg_buffer11)) + 4|0);
+ $93 = ((($4)) + 4|0);
+ $94 = ((($vararg_buffer11)) + 8|0);
+ $95 = ((($4)) + 8|0);
+ $96 = ((($vararg_buffer11)) + 4|0);
+ $97 = ((($vararg_buffer7)) + 4|0);
+ $98 = ((($4)) + 4|0);
+ $99 = ((($vararg_buffer11)) + 8|0);
+ $100 = ((($vararg_buffer7)) + 8|0);
+ $101 = ((($4)) + 8|0);
+ $102 = ((($vararg_buffer7)) + 4|0);
+ $103 = ((($vararg_buffer7)) + 8|0);
+ $$0350$ph$ph = 0;$$0351$ph$ph = 0;$$0352$ph$ph = 0;
+ L51: while(1) {
+ $$0350$ph = $$0350$ph$ph;$$0352$ph = $$0352$ph$ph;
+ while(1) {
+ $104 = (_feof($15)|0);
+ $105 = ($104|0)==(0);
+ if (!($105)) {
+ break L51;
+ }
+ L55: while(1) {
+ HEAP32[$vararg_buffer55>>2] = $2;
+ (_fscanf($15,8814,$vararg_buffer55)|0);
+ $106 = HEAP8[$2>>0]|0;
+ $107 = $106 << 24 >> 24;
+ switch ($107|0) {
+ case 102: {
+ break L55;
+ break;
+ }
+ case 118: case 117: case 109: case 115: case 103: case 111: case 35: {
+ (_fgets($3,200,$15)|0);
+ break;
+ }
+ default: {
+ }
+ }
+ $108 = (_feof($15)|0);
+ $109 = ($108|0)==(0);
+ if (!($109)) {
+ break L51;
+ }
+ }
+ do {
+ if ($79) {
+ HEAP32[$vararg_buffer58>>2] = $vararg_buffer11;
+ $vararg_ptr61 = ((($vararg_buffer58)) + 4|0);
+ HEAP32[$vararg_ptr61>>2] = $80;
+ $vararg_ptr62 = ((($vararg_buffer58)) + 8|0);
+ HEAP32[$vararg_ptr62>>2] = $81;
+ (_fscanf($15,9008,$vararg_buffer58)|0);
+ } else {
+ if ($76) {
+ HEAP32[$vararg_buffer63>>2] = $vararg_buffer11;
+ $vararg_ptr66 = ((($vararg_buffer63)) + 4|0);
+ HEAP32[$vararg_ptr66>>2] = $vararg_buffer7;
+ $vararg_ptr67 = ((($vararg_buffer63)) + 8|0);
+ HEAP32[$vararg_ptr67>>2] = $88;
+ $vararg_ptr68 = ((($vararg_buffer63)) + 12|0);
+ HEAP32[$vararg_ptr68>>2] = $89;
+ $vararg_ptr69 = ((($vararg_buffer63)) + 16|0);
+ HEAP32[$vararg_ptr69>>2] = $90;
+ $vararg_ptr70 = ((($vararg_buffer63)) + 20|0);
+ HEAP32[$vararg_ptr70>>2] = $91;
+ (_fscanf($15,9017,$vararg_buffer63)|0);
+ break;
+ }
+ if ($77) {
+ HEAP32[$vararg_buffer71>>2] = $vararg_buffer11;
+ $vararg_ptr74 = ((($vararg_buffer71)) + 4|0);
+ HEAP32[$vararg_ptr74>>2] = $4;
+ $vararg_ptr75 = ((($vararg_buffer71)) + 8|0);
+ HEAP32[$vararg_ptr75>>2] = $92;
+ $vararg_ptr76 = ((($vararg_buffer71)) + 12|0);
+ HEAP32[$vararg_ptr76>>2] = $93;
+ $vararg_ptr77 = ((($vararg_buffer71)) + 16|0);
+ HEAP32[$vararg_ptr77>>2] = $94;
+ $vararg_ptr78 = ((($vararg_buffer71)) + 20|0);
+ HEAP32[$vararg_ptr78>>2] = $95;
+ (_fscanf($15,9035,$vararg_buffer71)|0);
+ break;
+ } else {
+ HEAP32[$vararg_buffer79>>2] = $vararg_buffer11;
+ $vararg_ptr82 = ((($vararg_buffer79)) + 4|0);
+ HEAP32[$vararg_ptr82>>2] = $vararg_buffer7;
+ $vararg_ptr83 = ((($vararg_buffer79)) + 8|0);
+ HEAP32[$vararg_ptr83>>2] = $4;
+ $vararg_ptr84 = ((($vararg_buffer79)) + 12|0);
+ HEAP32[$vararg_ptr84>>2] = $96;
+ $vararg_ptr85 = ((($vararg_buffer79)) + 16|0);
+ HEAP32[$vararg_ptr85>>2] = $97;
+ $vararg_ptr86 = ((($vararg_buffer79)) + 20|0);
+ HEAP32[$vararg_ptr86>>2] = $98;
+ $vararg_ptr87 = ((($vararg_buffer79)) + 24|0);
+ HEAP32[$vararg_ptr87>>2] = $99;
+ $vararg_ptr88 = ((($vararg_buffer79)) + 28|0);
+ HEAP32[$vararg_ptr88>>2] = $100;
+ $vararg_ptr89 = ((($vararg_buffer79)) + 32|0);
+ HEAP32[$vararg_ptr89>>2] = $101;
+ (_fscanf($15,9056,$vararg_buffer79)|0);
+ break;
+ }
+ }
+ } while(0);
+ $110 = HEAP32[$vararg_buffer11>>2]|0;
+ $111 = (($110) + -1)|0;
+ $112 = (($37) + (($111*12)|0)|0);
+ $113 = HEAP32[$112>>2]|0;
+ $114 = (($71) + ($$0352$ph<<2)|0);
+ HEAP32[$114>>2] = $113;
+ $115 = (((($37) + (($111*12)|0)|0)) + 4|0);
+ $116 = HEAP32[$115>>2]|0;
+ $117 = (($$0352$ph) + 1)|0;
+ $118 = (($71) + ($117<<2)|0);
+ HEAP32[$118>>2] = $116;
+ $119 = (((($37) + (($111*12)|0)|0)) + 8|0);
+ $120 = HEAP32[$119>>2]|0;
+ $121 = (($$0352$ph) + 2)|0;
+ $122 = (($71) + ($121<<2)|0);
+ HEAP32[$122>>2] = $120;
+ $123 = (($$0352$ph) + 3)|0;
+ $124 = HEAP32[$82>>2]|0;
+ $125 = (($124) + -1)|0;
+ $126 = (($37) + (($125*12)|0)|0);
+ $127 = HEAP32[$126>>2]|0;
+ $128 = (($71) + ($123<<2)|0);
+ HEAP32[$128>>2] = $127;
+ $129 = (((($37) + (($125*12)|0)|0)) + 4|0);
+ $130 = HEAP32[$129>>2]|0;
+ $131 = (($$0352$ph) + 4)|0;
+ $132 = (($71) + ($131<<2)|0);
+ HEAP32[$132>>2] = $130;
+ $133 = (((($37) + (($125*12)|0)|0)) + 8|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = (($$0352$ph) + 5)|0;
+ $136 = (($71) + ($135<<2)|0);
+ HEAP32[$136>>2] = $134;
+ $137 = (($$0352$ph) + 6)|0;
+ $138 = HEAP32[$83>>2]|0;
+ $139 = (($138) + -1)|0;
+ $140 = (($37) + (($139*12)|0)|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = (($71) + ($137<<2)|0);
+ HEAP32[$142>>2] = $141;
+ $143 = (((($37) + (($139*12)|0)|0)) + 4|0);
+ $144 = HEAP32[$143>>2]|0;
+ $145 = (($$0352$ph) + 7)|0;
+ $146 = (($71) + ($145<<2)|0);
+ HEAP32[$146>>2] = $144;
+ $147 = (((($37) + (($139*12)|0)|0)) + 8|0);
+ $148 = HEAP32[$147>>2]|0;
+ $149 = (($$0352$ph) + 8)|0;
+ $150 = (($71) + ($149<<2)|0);
+ HEAP32[$150>>2] = $148;
+ $151 = (($$0352$ph) + 9)|0;
+ if ($38) {
+ $152 = HEAP32[$4>>2]|0;
+ $153 = (($152) + -1)|0;
+ $154 = (($$0357) + (($153*12)|0)|0);
+ $155 = HEAP32[$154>>2]|0;
+ $156 = (($75) + ($$0350$ph<<2)|0);
+ HEAP32[$156>>2] = $155;
+ $157 = (((($$0357) + (($153*12)|0)|0)) + 4|0);
+ $158 = HEAP32[$157>>2]|0;
+ $159 = (($$0350$ph) + 1)|0;
+ $160 = (($75) + ($159<<2)|0);
+ HEAP32[$160>>2] = $158;
+ $161 = (((($$0357) + (($153*12)|0)|0)) + 8|0);
+ $162 = HEAP32[$161>>2]|0;
+ $163 = (($$0350$ph) + 2)|0;
+ $164 = (($75) + ($163<<2)|0);
+ HEAP32[$164>>2] = $162;
+ $165 = (($$0350$ph) + 3)|0;
+ $166 = HEAP32[$84>>2]|0;
+ $167 = (($166) + -1)|0;
+ $168 = (($$0357) + (($167*12)|0)|0);
+ $169 = HEAP32[$168>>2]|0;
+ $170 = (($75) + ($165<<2)|0);
+ HEAP32[$170>>2] = $169;
+ $171 = (((($$0357) + (($167*12)|0)|0)) + 4|0);
+ $172 = HEAP32[$171>>2]|0;
+ $173 = (($$0350$ph) + 4)|0;
+ $174 = (($75) + ($173<<2)|0);
+ HEAP32[$174>>2] = $172;
+ $175 = (((($$0357) + (($167*12)|0)|0)) + 8|0);
+ $176 = HEAP32[$175>>2]|0;
+ $177 = (($$0350$ph) + 5)|0;
+ $178 = (($75) + ($177<<2)|0);
+ HEAP32[$178>>2] = $176;
+ $179 = (($$0350$ph) + 6)|0;
+ $180 = HEAP32[$85>>2]|0;
+ $181 = (($180) + -1)|0;
+ $182 = (($$0357) + (($181*12)|0)|0);
+ $183 = HEAP32[$182>>2]|0;
+ $184 = (($75) + ($179<<2)|0);
+ HEAP32[$184>>2] = $183;
+ $185 = (((($$0357) + (($181*12)|0)|0)) + 4|0);
+ $186 = HEAP32[$185>>2]|0;
+ $187 = (($$0350$ph) + 7)|0;
+ $188 = (($75) + ($187<<2)|0);
+ HEAP32[$188>>2] = $186;
+ $189 = (((($$0357) + (($181*12)|0)|0)) + 8|0);
+ $190 = HEAP32[$189>>2]|0;
+ $191 = (($$0350$ph) + 8)|0;
+ $192 = (($75) + ($191<<2)|0);
+ HEAP32[$192>>2] = $190;
+ } else {
+ $193 = HEAP32[$82>>2]|0;
+ $194 = (($193) + -1)|0;
+ $195 = (($37) + (($194*12)|0)|0);
+ $196 = HEAP32[$vararg_buffer11>>2]|0;
+ $197 = (($196) + -1)|0;
+ $198 = (($37) + (($197*12)|0)|0);
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$195>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$195+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$195+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$198>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$198+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$198+8>>2]|0;
+ _VectorSubtract($6,$$byval_copy102,$$byval_copy103);
+ $199 = HEAP32[$83>>2]|0;
+ $200 = (($199) + -1)|0;
+ $201 = (($37) + (($200*12)|0)|0);
+ $202 = HEAP32[$vararg_buffer11>>2]|0;
+ $203 = (($202) + -1)|0;
+ $204 = (($37) + (($203*12)|0)|0);
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$201>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$201+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$201+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$204>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$204+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$204+8>>2]|0;
+ _VectorSubtract($7,$$byval_copy102,$$byval_copy103);
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$6+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$7+8>>2]|0;
+ _VectorCrossProduct($5,$$byval_copy102,$$byval_copy103);
+ _VectorNormalize($5);
+ $205 = HEAP32[$5>>2]|0;
+ $206 = (($75) + ($$0350$ph<<2)|0);
+ HEAP32[$206>>2] = $205;
+ $207 = HEAP32[$86>>2]|0;
+ $208 = (($$0350$ph) + 1)|0;
+ $209 = (($75) + ($208<<2)|0);
+ HEAP32[$209>>2] = $207;
+ $210 = HEAP32[$87>>2]|0;
+ $211 = (($$0350$ph) + 2)|0;
+ $212 = (($75) + ($211<<2)|0);
+ HEAP32[$212>>2] = $210;
+ $213 = (($$0350$ph) + 3)|0;
+ $214 = HEAP32[$5>>2]|0;
+ $215 = (($75) + ($213<<2)|0);
+ HEAP32[$215>>2] = $214;
+ $216 = HEAP32[$86>>2]|0;
+ $217 = (($$0350$ph) + 4)|0;
+ $218 = (($75) + ($217<<2)|0);
+ HEAP32[$218>>2] = $216;
+ $219 = HEAP32[$87>>2]|0;
+ $220 = (($$0350$ph) + 5)|0;
+ $221 = (($75) + ($220<<2)|0);
+ HEAP32[$221>>2] = $219;
+ $222 = (($$0350$ph) + 6)|0;
+ $223 = HEAP32[$5>>2]|0;
+ $224 = (($75) + ($222<<2)|0);
+ HEAP32[$224>>2] = $223;
+ $225 = HEAP32[$86>>2]|0;
+ $226 = (($$0350$ph) + 7)|0;
+ $227 = (($75) + ($226<<2)|0);
+ HEAP32[$227>>2] = $225;
+ $228 = HEAP32[$87>>2]|0;
+ $229 = (($$0350$ph) + 8)|0;
+ $230 = (($75) + ($229<<2)|0);
+ HEAP32[$230>>2] = $228;
+ }
+ $$1 = (($$0350$ph) + 9)|0;
+ if ($41) {
+ break;
+ } else {
+ $$0350$ph = $$1;$$0352$ph = $151;
+ }
+ }
+ $231 = HEAP32[$vararg_buffer7>>2]|0;
+ $232 = (($231) + -1)|0;
+ $233 = (($$0356) + ($232<<3)|0);
+ $234 = HEAP32[$233>>2]|0;
+ $235 = (($74) + ($$0351$ph$ph<<2)|0);
+ HEAP32[$235>>2] = $234;
+ $236 = (((($$0356) + ($232<<3)|0)) + 4|0);
+ $237 = +HEAPF32[$236>>2];
+ $238 = 1.0 - $237;
+ $239 = $$0351$ph$ph | 1;
+ $240 = (($74) + ($239<<2)|0);
+ HEAPF32[$240>>2] = $238;
+ $241 = (($$0351$ph$ph) + 2)|0;
+ $242 = HEAP32[$102>>2]|0;
+ $243 = (($242) + -1)|0;
+ $244 = (($$0356) + ($243<<3)|0);
+ $245 = HEAP32[$244>>2]|0;
+ $246 = (($74) + ($241<<2)|0);
+ HEAP32[$246>>2] = $245;
+ $247 = (((($$0356) + ($243<<3)|0)) + 4|0);
+ $248 = +HEAPF32[$247>>2];
+ $249 = 1.0 - $248;
+ $250 = (($$0351$ph$ph) + 3)|0;
+ $251 = (($74) + ($250<<2)|0);
+ HEAPF32[$251>>2] = $249;
+ $252 = (($$0351$ph$ph) + 4)|0;
+ $253 = HEAP32[$103>>2]|0;
+ $254 = (($253) + -1)|0;
+ $255 = (($$0356) + ($254<<3)|0);
+ $256 = HEAP32[$255>>2]|0;
+ $257 = (($74) + ($252<<2)|0);
+ HEAP32[$257>>2] = $256;
+ $258 = (((($$0356) + ($254<<3)|0)) + 4|0);
+ $259 = +HEAPF32[$258>>2];
+ $260 = 1.0 - $259;
+ $261 = (($$0351$ph$ph) + 5)|0;
+ $262 = (($74) + ($261<<2)|0);
+ HEAPF32[$262>>2] = $260;
+ $263 = (($$0351$ph$ph) + 6)|0;
+ $$0350$ph$ph = $$1;$$0351$ph$ph = $263;$$0352$ph$ph = $151;
+ }
+ (_fclose($15)|0);
+ $264 = ($$0345$ph372$lcssa389|0)==(0);
+ if ($264) {
+ $265 = ($72|0)>(0);
+ if ($265) {
+ $368 = ($$0346$ph$lcssa*24)|0;
+ _memset(($74|0),0,($368|0))|0;
+ $$sroa$64$0 = 0;
+ } else {
+ $$sroa$64$0 = 0;
+ }
+ } else {
+ $266 = (_malloc($70)|0);
+ $267 = ($69|0)>(0);
+ if ($267) {
+ $268 = ((($5)) + 4|0);
+ $269 = ((($5)) + 8|0);
+ $270 = ((($8)) + 4|0);
+ $271 = ((($8)) + 8|0);
+ $272 = ((($9)) + 4|0);
+ $273 = ((($9)) + 8|0);
+ $274 = ((($12)) + 4|0);
+ $275 = ((($10)) + 4|0);
+ $276 = ((($12)) + 8|0);
+ $277 = ((($10)) + 8|0);
+ $278 = ((($13)) + 4|0);
+ $279 = ((($11)) + 4|0);
+ $280 = ((($13)) + 8|0);
+ $281 = ((($11)) + 8|0);
+ $282 = ((($14)) + 4|0);
+ $283 = ((($14)) + 8|0);
+ $$0347392 = 0;$$0348391 = 0;
+ while(1) {
+ $284 = (($71) + ($$0348391<<2)|0);
+ $285 = HEAP32[$284>>2]|0;
+ HEAP32[$5>>2] = $285;
+ $286 = (($$0348391) + 1)|0;
+ $287 = (($71) + ($286<<2)|0);
+ $288 = HEAP32[$287>>2]|0;
+ HEAP32[$268>>2] = $288;
+ $289 = (($$0348391) + 2)|0;
+ $290 = (($71) + ($289<<2)|0);
+ $291 = HEAP32[$290>>2]|0;
+ HEAP32[$269>>2] = $291;
+ $292 = (($$0348391) + 3)|0;
+ $293 = (($71) + ($292<<2)|0);
+ $294 = HEAP32[$293>>2]|0;
+ HEAP32[$8>>2] = $294;
+ $295 = (($$0348391) + 4)|0;
+ $296 = (($71) + ($295<<2)|0);
+ $297 = HEAP32[$296>>2]|0;
+ HEAP32[$270>>2] = $297;
+ $298 = (($$0348391) + 5)|0;
+ $299 = (($71) + ($298<<2)|0);
+ $300 = HEAP32[$299>>2]|0;
+ HEAP32[$271>>2] = $300;
+ $301 = (($$0348391) + 6)|0;
+ $302 = (($71) + ($301<<2)|0);
+ $303 = HEAP32[$302>>2]|0;
+ HEAP32[$9>>2] = $303;
+ $304 = (($$0348391) + 7)|0;
+ $305 = (($71) + ($304<<2)|0);
+ $306 = HEAP32[$305>>2]|0;
+ HEAP32[$272>>2] = $306;
+ $307 = (($$0348391) + 8)|0;
+ $308 = (($71) + ($307<<2)|0);
+ $309 = HEAP32[$308>>2]|0;
+ HEAP32[$273>>2] = $309;
+ $310 = (($74) + ($$0347392<<2)|0);
+ $311 = +HEAPF32[$310>>2];
+ $312 = $$0347392 | 1;
+ $313 = (($74) + ($312<<2)|0);
+ $314 = +HEAPF32[$313>>2];
+ $315 = (($$0347392) + 2)|0;
+ $316 = (($74) + ($315<<2)|0);
+ $317 = +HEAPF32[$316>>2];
+ $318 = (($$0347392) + 3)|0;
+ $319 = (($74) + ($318<<2)|0);
+ $320 = +HEAPF32[$319>>2];
+ $321 = (($$0347392) + 4)|0;
+ $322 = (($74) + ($321<<2)|0);
+ $323 = +HEAPF32[$322>>2];
+ $324 = (($$0347392) + 5)|0;
+ $325 = (($74) + ($324<<2)|0);
+ $326 = +HEAPF32[$325>>2];
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$8>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$8+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$8+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$5+8>>2]|0;
+ _VectorSubtract($10,$$byval_copy102,$$byval_copy103);
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$9+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$5+8>>2]|0;
+ _VectorSubtract($11,$$byval_copy102,$$byval_copy103);
+ $327 = $317 - $311;
+ $328 = $320 - $314;
+ $329 = $323 - $311;
+ $330 = $326 - $314;
+ $331 = $327 * $330;
+ $332 = $328 * $329;
+ $333 = $331 - $332;
+ $334 = 1.0 / $333;
+ $335 = +HEAPF32[$10>>2];
+ $336 = $330 * $335;
+ HEAPF32[$12>>2] = $336;
+ $337 = +HEAPF32[$275>>2];
+ $338 = $330 * $337;
+ HEAPF32[$274>>2] = $338;
+ $339 = +HEAPF32[$277>>2];
+ $340 = $330 * $339;
+ HEAPF32[$276>>2] = $340;
+ $341 = +HEAPF32[$11>>2];
+ $342 = $328 * $341;
+ HEAPF32[$13>>2] = $342;
+ $343 = +HEAPF32[$279>>2];
+ $344 = $328 * $343;
+ HEAPF32[$278>>2] = $344;
+ $345 = +HEAPF32[$281>>2];
+ $346 = $328 * $345;
+ HEAPF32[$280>>2] = $346;
+ ;HEAP32[$$byval_copy102>>2]=HEAP32[$12>>2]|0;HEAP32[$$byval_copy102+4>>2]=HEAP32[$12+4>>2]|0;HEAP32[$$byval_copy102+8>>2]=HEAP32[$12+8>>2]|0;
+ ;HEAP32[$$byval_copy103>>2]=HEAP32[$13>>2]|0;HEAP32[$$byval_copy103+4>>2]=HEAP32[$13+4>>2]|0;HEAP32[$$byval_copy103+8>>2]=HEAP32[$13+8>>2]|0;
+ _VectorSubtract($14,$$byval_copy102,$$byval_copy103);
+ _VectorScale($14,$334);
+ $347 = HEAP32[$14>>2]|0;
+ $348 = (($266) + ($$0348391<<2)|0);
+ HEAP32[$348>>2] = $347;
+ $349 = HEAP32[$282>>2]|0;
+ $350 = (($266) + ($286<<2)|0);
+ HEAP32[$350>>2] = $349;
+ $351 = HEAP32[$283>>2]|0;
+ $352 = (($266) + ($289<<2)|0);
+ HEAP32[$352>>2] = $351;
+ $353 = HEAP32[$14>>2]|0;
+ $354 = (($266) + ($292<<2)|0);
+ HEAP32[$354>>2] = $353;
+ $355 = HEAP32[$282>>2]|0;
+ $356 = (($266) + ($295<<2)|0);
+ HEAP32[$356>>2] = $355;
+ $357 = HEAP32[$283>>2]|0;
+ $358 = (($266) + ($298<<2)|0);
+ HEAP32[$358>>2] = $357;
+ $359 = HEAP32[$14>>2]|0;
+ $360 = (($266) + ($301<<2)|0);
+ HEAP32[$360>>2] = $359;
+ $361 = HEAP32[$282>>2]|0;
+ $362 = (($266) + ($304<<2)|0);
+ HEAP32[$362>>2] = $361;
+ $363 = HEAP32[$283>>2]|0;
+ $364 = (($266) + ($307<<2)|0);
+ HEAP32[$364>>2] = $363;
+ $365 = (($$0348391) + 9)|0;
+ $366 = (($$0347392) + 6)|0;
+ $367 = ($365|0)<($69|0);
+ if ($367) {
+ $$0347392 = $366;$$0348391 = $365;
+ } else {
+ $$sroa$64$0 = $266;
+ break;
+ }
+ }
+ } else {
+ $$sroa$64$0 = $266;
+ }
+ }
+ _free($37);
+ _free($369);
+ _free($370);
+ HEAP32[$vararg_buffer90>>2] = $1;
+ _TraceLog(0,9083,$vararg_buffer90);
+ HEAP32[$0>>2] = $68;
+ $$sroa$12$0$$sroa_idx244 = ((($0)) + 4|0);
+ HEAP32[$$sroa$12$0$$sroa_idx244>>2] = 0;
+ $$sroa$12247$0$$sroa_idx249 = ((($0)) + 8|0);
+ HEAP32[$$sroa$12247$0$$sroa_idx249>>2] = $71;
+ $$sroa$31$0$$sroa_idx270 = ((($0)) + 12|0);
+ HEAP32[$$sroa$31$0$$sroa_idx270>>2] = $74;
+ $$sroa$45$0$$sroa_idx286 = ((($0)) + 16|0);
+ HEAP32[$$sroa$45$0$$sroa_idx286>>2] = 0;
+ $$sroa$45289$0$$sroa_idx291 = ((($0)) + 20|0);
+ HEAP32[$$sroa$45289$0$$sroa_idx291>>2] = $75;
+ $$sroa$64$0$$sroa_idx312 = ((($0)) + 24|0);
+ HEAP32[$$sroa$64$0$$sroa_idx312>>2] = $$sroa$64$0;
+ $$sroa$74$0$$sroa_idx324 = ((($0)) + 28|0);
+ HEAP32[$$sroa$74$0$$sroa_idx324>>2] = 0;
+ $$sroa$75$0$$sroa_idx328 = ((($0)) + 32|0);
+ dest=$$sroa$75$0$$sroa_idx328; src=$$sroa$75; stop=dest+36|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlglLoadMesh($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
+ var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
+ var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 48|0;
+ $3 = sp + 20|0;
+ $4 = ((($0)) + 36|0);
+ $5 = ((($0)) + 40|0);
+ $6 = ((($0)) + 44|0);
+ $7 = ((($0)) + 48|0);
+ $8 = ((($0)) + 52|0);
+ $9 = ((($0)) + 56|0);
+ $10 = ((($0)) + 60|0);
+ $11 = ((($0)) + 64|0);
+ $12 = ($1|0)!=(0);
+ $$ = $12 ? 35048 : 35044;
+ ;HEAP32[$4>>2]=0|0;HEAP32[$4+4>>2]=0|0;HEAP32[$4+8>>2]=0|0;HEAP32[$4+12>>2]=0|0;HEAP32[$4+16>>2]=0|0;HEAP32[$4+20>>2]=0|0;HEAP32[$4+24>>2]=0|0;HEAP32[$4+28>>2]=0|0;
+ HEAP32[$2>>2] = 0;
+ ;HEAP32[$3>>2]=0|0;HEAP32[$3+4>>2]=0|0;HEAP32[$3+8>>2]=0|0;HEAP32[$3+12>>2]=0|0;HEAP32[$3+16>>2]=0|0;HEAP32[$3+20>>2]=0|0;HEAP32[$3+24>>2]=0|0;
+ $13 = HEAP32[5259]|0;
+ $14 = ($13|0)==(0);
+ if (!($14)) {
+ $15 = HEAP32[5633]|0;
+ FUNCTION_TABLE_vii[$15 & 63](1,$2);
+ $16 = HEAP32[5260]|0;
+ $17 = HEAP32[$2>>2]|0;
+ FUNCTION_TABLE_vi[$16 & 31]($17);
+ }
+ _glGenBuffers(1,($3|0));
+ $18 = HEAP32[$3>>2]|0;
+ _glBindBuffer(34962,($18|0));
+ $19 = HEAP32[$0>>2]|0;
+ $20 = ($19*12)|0;
+ $21 = ((($0)) + 8|0);
+ $22 = HEAP32[$21>>2]|0;
+ _glBufferData(34962,($20|0),($22|0),($$|0));
+ _glVertexAttribPointer(0,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(0);
+ $23 = ((($3)) + 4|0);
+ _glGenBuffers(1,($23|0));
+ $24 = HEAP32[$23>>2]|0;
+ _glBindBuffer(34962,($24|0));
+ $25 = HEAP32[$0>>2]|0;
+ $26 = $25 << 3;
+ $27 = ((($0)) + 12|0);
+ $28 = HEAP32[$27>>2]|0;
+ _glBufferData(34962,($26|0),($28|0),($$|0));
+ _glVertexAttribPointer(1,2,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(1);
+ $29 = ((($0)) + 20|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = ($30|0)==(0|0);
+ if ($31) {
+ _glVertexAttrib3f(2,1.0,1.0,1.0);
+ _glDisableVertexAttribArray(2);
+ } else {
+ $32 = ((($3)) + 8|0);
+ _glGenBuffers(1,($32|0));
+ $33 = HEAP32[$32>>2]|0;
+ _glBindBuffer(34962,($33|0));
+ $34 = HEAP32[$0>>2]|0;
+ $35 = ($34*12)|0;
+ $36 = HEAP32[$29>>2]|0;
+ _glBufferData(34962,($35|0),($36|0),($$|0));
+ _glVertexAttribPointer(2,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(2);
+ }
+ $37 = ((($0)) + 28|0);
+ $38 = HEAP32[$37>>2]|0;
+ $39 = ($38|0)==(0|0);
+ if ($39) {
+ _glVertexAttrib4f(3,1.0,1.0,1.0,1.0);
+ _glDisableVertexAttribArray(3);
+ } else {
+ $40 = ((($3)) + 12|0);
+ _glGenBuffers(1,($40|0));
+ $41 = HEAP32[$40>>2]|0;
+ _glBindBuffer(34962,($41|0));
+ $42 = HEAP32[$0>>2]|0;
+ $43 = $42 << 2;
+ $44 = HEAP32[$37>>2]|0;
+ _glBufferData(34962,($43|0),($44|0),($$|0));
+ _glVertexAttribPointer(3,4,5121,1,0,(0|0));
+ _glEnableVertexAttribArray(3);
+ }
+ $45 = ((($0)) + 24|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = ($46|0)==(0|0);
+ if ($47) {
+ _glVertexAttrib3f(4,0.0,0.0,0.0);
+ _glDisableVertexAttribArray(4);
+ } else {
+ $48 = ((($3)) + 16|0);
+ _glGenBuffers(1,($48|0));
+ $49 = HEAP32[$48>>2]|0;
+ _glBindBuffer(34962,($49|0));
+ $50 = HEAP32[$0>>2]|0;
+ $51 = ($50*12)|0;
+ $52 = HEAP32[$45>>2]|0;
+ _glBufferData(34962,($51|0),($52|0),($$|0));
+ _glVertexAttribPointer(4,3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(4);
+ }
+ $53 = ((($0)) + 16|0);
+ $54 = HEAP32[$53>>2]|0;
+ $55 = ($54|0)==(0|0);
+ if ($55) {
+ _glVertexAttrib2f(5,0.0,0.0);
+ _glDisableVertexAttribArray(5);
+ } else {
+ $56 = ((($3)) + 20|0);
+ _glGenBuffers(1,($56|0));
+ $57 = HEAP32[$56>>2]|0;
+ _glBindBuffer(34962,($57|0));
+ $58 = HEAP32[$0>>2]|0;
+ $59 = $58 << 3;
+ $60 = HEAP32[$53>>2]|0;
+ _glBufferData(34962,($59|0),($60|0),($$|0));
+ _glVertexAttribPointer(5,2,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(5);
+ }
+ $61 = ((($0)) + 32|0);
+ $62 = HEAP32[$61>>2]|0;
+ $63 = ($62|0)==(0|0);
+ if (!($63)) {
+ $64 = ((($3)) + 24|0);
+ _glGenBuffers(1,($64|0));
+ $65 = HEAP32[$64>>2]|0;
+ _glBindBuffer(34963,($65|0));
+ $66 = ((($0)) + 4|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = ($67*6)|0;
+ $69 = HEAP32[$61>>2]|0;
+ _glBufferData(34963,($68|0),($69|0),35044);
+ }
+ $70 = HEAP32[$3>>2]|0;
+ HEAP32[$5>>2] = $70;
+ $71 = HEAP32[$23>>2]|0;
+ HEAP32[$6>>2] = $71;
+ $72 = ((($3)) + 8|0);
+ $73 = HEAP32[$72>>2]|0;
+ HEAP32[$7>>2] = $73;
+ $74 = ((($3)) + 12|0);
+ $75 = HEAP32[$74>>2]|0;
+ HEAP32[$8>>2] = $75;
+ $76 = ((($3)) + 16|0);
+ $77 = HEAP32[$76>>2]|0;
+ HEAP32[$9>>2] = $77;
+ $78 = ((($3)) + 20|0);
+ $79 = HEAP32[$78>>2]|0;
+ HEAP32[$10>>2] = $79;
+ $80 = ((($3)) + 24|0);
+ $81 = HEAP32[$80>>2]|0;
+ HEAP32[$11>>2] = $81;
+ $82 = HEAP32[5259]|0;
+ $83 = ($82|0)==(0);
+ if ($83) {
+ _TraceLog(0,8732,$vararg_buffer3);
+ STACKTOP = sp;return;
+ }
+ $84 = HEAP32[$2>>2]|0;
+ $85 = ($84|0)==(0);
+ if ($85) {
+ _TraceLog(1,8691,$vararg_buffer1);
+ STACKTOP = sp;return;
+ } else {
+ HEAP32[$4>>2] = $84;
+ HEAP32[$vararg_buffer>>2] = $84;
+ _TraceLog(0,8638,$vararg_buffer);
+ STACKTOP = sp;return;
+ }
+}
+function _VectorSubtract($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = +HEAPF32[$1>>2];
+ $4 = +HEAPF32[$2>>2];
+ $5 = $3 - $4;
+ HEAPF32[$0>>2] = $5;
+ $6 = ((($0)) + 4|0);
+ $7 = ((($1)) + 4|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = ((($2)) + 4|0);
+ $10 = +HEAPF32[$9>>2];
+ $11 = $8 - $10;
+ HEAPF32[$6>>2] = $11;
+ $12 = ((($0)) + 8|0);
+ $13 = ((($1)) + 8|0);
+ $14 = +HEAPF32[$13>>2];
+ $15 = ((($2)) + 8|0);
+ $16 = +HEAPF32[$15>>2];
+ $17 = $14 - $16;
+ HEAPF32[$12>>2] = $17;
+ return;
+}
+function _VectorCrossProduct($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $3 = 0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0;
+ var $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($1)) + 4|0);
+ $4 = +HEAPF32[$3>>2];
+ $5 = ((($2)) + 8|0);
+ $6 = +HEAPF32[$5>>2];
+ $7 = $4 * $6;
+ $8 = ((($1)) + 8|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = ((($2)) + 4|0);
+ $11 = +HEAPF32[$10>>2];
+ $12 = $9 * $11;
+ $13 = $7 - $12;
+ $14 = +HEAPF32[$2>>2];
+ $15 = $9 * $14;
+ $16 = +HEAPF32[$1>>2];
+ $17 = $6 * $16;
+ $18 = $15 - $17;
+ $19 = $11 * $16;
+ $20 = $4 * $14;
+ $21 = $19 - $20;
+ HEAPF32[$0>>2] = $13;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $18;
+ $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $21;
+ return;
+}
+function _VectorScale($0,$1) {
+ $0 = $0|0;
+ $1 = +$1;
+ var $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = +HEAPF32[$0>>2];
+ $3 = $2 * $1;
+ HEAPF32[$0>>2] = $3;
+ $4 = ((($0)) + 4|0);
+ $5 = +HEAPF32[$4>>2];
+ $6 = $5 * $1;
+ HEAPF32[$4>>2] = $6;
+ $7 = ((($0)) + 8|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $8 * $1;
+ HEAPF32[$7>>2] = $9;
+ return;
+}
+function _LoadModel($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(464|0);
+ $2 = sp + 200|0;
+ $3 = sp + 136|0;
+ $4 = sp;
+ _memset(($2|0),0,264)|0;
+ _LoadMesh($2,$1);
+ $5 = ((($2)) + 68|0);
+ _MatrixIdentity($3);
+ dest=$5; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $6 = ((($2)) + 132|0);
+ _LoadDefaultMaterial($4);
+ _memcpy(($6|0),($4|0),132)|0;
+ _memcpy(($0|0),($2|0),264)|0;
+ STACKTOP = sp;return;
+}
+function _LoadDefaultMaterial($0) {
+ $0 = $0|0;
+ var $$sroa$09 = 0, $$sroa$09$56$sroa_idx = 0, $$sroa$18$0$$sroa_idx15 = 0, $$sroa$6$0$$sroa_idx = 0, $1 = 0, $2 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 192|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(192|0);
+ $$sroa$09 = sp;
+ $1 = sp + 136|0;
+ $2 = sp + 116|0;
+ dest=$$sroa$09; stop=dest+116|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ _GetDefaultShader($1);
+ dest=$$sroa$09; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _GetDefaultTexture($2);
+ $$sroa$09$56$sroa_idx = ((($$sroa$09)) + 56|0);
+ ;HEAP32[$$sroa$09$56$sroa_idx>>2]=HEAP32[$2>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+12>>2]=HEAP32[$2+12>>2]|0;HEAP32[$$sroa$09$56$sroa_idx+16>>2]=HEAP32[$2+16>>2]|0;
+ dest=$0; src=$$sroa$09; stop=dest+116|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $$sroa$6$0$$sroa_idx = ((($0)) + 116|0);
+ $$sroa$18$0$$sroa_idx15 = ((($0)) + 128|0);
+ ;HEAP32[$$sroa$6$0$$sroa_idx>>2]=4294967295|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=4294967295|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=4294967295|0;
+ HEAPF32[$$sroa$18$0$$sroa_idx15>>2] = 100.0;
+ STACKTOP = sp;return;
+}
+function _GetDefaultShader($0) {
+ $0 = $0|0;
+ var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ dest=$0; src=22536; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _GetDefaultTexture($0) {
+ $0 = $0|0;
+ var $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[5219]|0;
+ HEAP32[$0>>2] = $1;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAP32[$$sroa$4$0$$sroa_idx2>>2] = 1;
+ $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
+ HEAP32[$$sroa$5$0$$sroa_idx4>>2] = 1;
+ $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
+ HEAP32[$$sroa$6$0$$sroa_idx6>>2] = 1;
+ $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
+ HEAP32[$$sroa$7$0$$sroa_idx8>>2] = 7;
+ return;
+}
+function _UnloadMesh($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglUnloadMesh($0);
+ return;
+}
+function _rlglUnloadMesh($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 8|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0|0);
+ if (!($3)) {
+ _free($2);
+ }
+ $4 = ((($0)) + 12|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==(0|0);
+ if (!($6)) {
+ _free($5);
+ }
+ $7 = ((($0)) + 20|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)==(0|0);
+ if (!($9)) {
+ _free($8);
+ }
+ $10 = ((($0)) + 28|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ($11|0)==(0|0);
+ if (!($12)) {
+ _free($11);
+ }
+ $13 = ((($0)) + 24|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ($14|0)==(0|0);
+ if (!($15)) {
+ _free($14);
+ }
+ $16 = ((($0)) + 16|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ($17|0)==(0|0);
+ if (!($18)) {
+ _free($17);
+ }
+ $19 = ((($0)) + 32|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ($20|0)==(0|0);
+ if (!($21)) {
+ _free($20);
+ }
+ $22 = ((($0)) + 40|0);
+ $23 = HEAP32[$22>>2]|0;
+ _rlDeleteBuffers($23);
+ $24 = ((($0)) + 44|0);
+ $25 = HEAP32[$24>>2]|0;
+ _rlDeleteBuffers($25);
+ $26 = ((($0)) + 48|0);
+ $27 = HEAP32[$26>>2]|0;
+ _rlDeleteBuffers($27);
+ $28 = ((($0)) + 52|0);
+ $29 = HEAP32[$28>>2]|0;
+ _rlDeleteBuffers($29);
+ $30 = ((($0)) + 56|0);
+ $31 = HEAP32[$30>>2]|0;
+ _rlDeleteBuffers($31);
+ $32 = ((($0)) + 60|0);
+ $33 = HEAP32[$32>>2]|0;
+ _rlDeleteBuffers($33);
+ $34 = ((($0)) + 64|0);
+ $35 = HEAP32[$34>>2]|0;
+ _rlDeleteBuffers($35);
+ $36 = ((($0)) + 36|0);
+ $37 = HEAP32[$36>>2]|0;
+ _rlDeleteVertexArrays($37);
+ return;
+}
+function _rlDeleteBuffers($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = sp + 4|0;
+ HEAP32[$1>>2] = $0;
+ $2 = ($0|0)==(0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ _glDeleteBuffers(1,($1|0));
+ $3 = HEAP32[5259]|0;
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ STACKTOP = sp;return;
+ }
+ $5 = HEAP32[$1>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $5;
+ _TraceLog(0,9175,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _rlDeleteVertexArrays($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = sp + 4|0;
+ HEAP32[$1>>2] = $0;
+ $2 = HEAP32[5259]|0;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ STACKTOP = sp;return;
+ }
+ $4 = ($0|0)==(0);
+ if (!($4)) {
+ $5 = HEAP32[5648]|0;
+ FUNCTION_TABLE_vii[$5 & 63](1,$1);
+ }
+ $6 = HEAP32[$1>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $6;
+ _TraceLog(0,9127,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _UnloadModel($0) {
+ $0 = $0|0;
+ var $$byval_copy = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
+ $$byval_copy = sp + 4|0;
+ $vararg_buffer = sp;
+ _UnloadMesh($0);
+ $1 = ((($0)) + 132|0);
+ _memcpy(($$byval_copy|0),($1|0),132)|0;
+ _UnloadMaterial($$byval_copy);
+ _TraceLog(0,9230,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _UnloadMaterial($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 56|0);
+ $2 = HEAP32[$1>>2]|0;
+ _rlDeleteTextures($2);
+ $3 = ((($0)) + 76|0);
+ $4 = HEAP32[$3>>2]|0;
+ _rlDeleteTextures($4);
+ $5 = ((($0)) + 96|0);
+ $6 = HEAP32[$5>>2]|0;
+ _rlDeleteTextures($6);
+ return;
+}
+function _DrawModel($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = +$2;
+ $3 = $3|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
+ $$byval_copy4 = sp + 324|0;
+ $$byval_copy3 = sp + 312|0;
+ $$byval_copy2 = sp + 300|0;
+ $$byval_copy1 = sp + 288|0;
+ $$byval_copy = sp + 24|0;
+ $4 = sp + 12|0;
+ $5 = sp;
+ HEAPF32[$4>>2] = $2;
+ $6 = ((($4)) + 4|0);
+ HEAPF32[$6>>2] = $2;
+ $7 = ((($4)) + 8|0);
+ HEAPF32[$7>>2] = $2;
+ ;HEAP32[$5>>2]=0|0;HEAP32[$5+4>>2]=0|0;HEAP32[$5+8>>2]=0|0;
+ _memcpy(($$byval_copy|0),($0|0),264)|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$1+8>>2]|0;
+ ;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
+ ;HEAP32[$$byval_copy3>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$4+8>>2]|0;
+ ;HEAP8[$$byval_copy4>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy4+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy4+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy4+3>>0]=HEAP8[$3+3>>0]|0;
+ _DrawModelEx($$byval_copy,$$byval_copy1,$$byval_copy2,0.0,$$byval_copy3,$$byval_copy4);
+ STACKTOP = sp;return;
+}
+function _DrawModelEx($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = +$3;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$byval_copy7 = 0, $$byval_copy8 = 0, $$byval_copy9 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 656|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(656|0);
+ $$byval_copy9 = sp + 584|0;
+ $$byval_copy8 = sp + 452|0;
+ $$byval_copy7 = sp + 384|0;
+ $6 = sp + 192|0;
+ $7 = sp + 128|0;
+ $8 = sp + 64|0;
+ $9 = sp;
+ $10 = sp + 320|0;
+ $11 = sp + 256|0;
+ $12 = $3 * 0.01745329238474369;
+ ;HEAP32[$$byval_copy9>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy9+8>>2]=HEAP32[$2+8>>2]|0;
+ _MatrixRotate($6,$$byval_copy9,$12);
+ $13 = +HEAPF32[$4>>2];
+ $14 = ((($4)) + 4|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = ((($4)) + 8|0);
+ $17 = +HEAPF32[$16>>2];
+ _MatrixScale($7,$13,$15,$17);
+ $18 = +HEAPF32[$1>>2];
+ $19 = ((($1)) + 4|0);
+ $20 = +HEAPF32[$19>>2];
+ $21 = ((($1)) + 8|0);
+ $22 = +HEAPF32[$21>>2];
+ _MatrixTranslate($8,$18,$20,$22);
+ dest=$$byval_copy8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy9; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($10,$$byval_copy8,$$byval_copy9);
+ dest=$$byval_copy8; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy9; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($9,$$byval_copy8,$$byval_copy9);
+ $23 = ((($0)) + 68|0);
+ dest=$$byval_copy8; src=$23; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy9; src=$9; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($11,$$byval_copy8,$$byval_copy9);
+ dest=$23; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $24 = ((($0)) + 132|0);
+ $25 = ((($0)) + 248|0);
+ $26 = HEAPU8[$5>>0]|(HEAPU8[$5+1>>0]<<8)|(HEAPU8[$5+2>>0]<<16)|(HEAPU8[$5+3>>0]<<24);
+ HEAP32[$25>>2] = $26;
+ dest=$$byval_copy7; src=$0; stop=dest+68|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _memcpy(($$byval_copy8|0),($24|0),132)|0;
+ dest=$$byval_copy9; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _rlglDrawMesh($$byval_copy7,$$byval_copy8,$$byval_copy9);
+ STACKTOP = sp;return;
+}
+function _rlglDrawMesh($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$020 = 0, $$byval_copy5 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
+ var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0;
+ var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0;
+ var $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0.0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0;
+ var $17 = 0.0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0;
+ var $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0;
+ var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0;
+ var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0;
+ var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $modelview$byval_copy4 = 0, dest = 0;
+ var label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 384|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(384|0);
+ $$byval_copy5 = sp + 320|0;
+ $modelview$byval_copy4 = sp + 256|0;
+ $3 = sp + 192|0;
+ $4 = sp + 128|0;
+ $5 = sp + 64|0;
+ $6 = sp;
+ $7 = HEAP32[$1>>2]|0;
+ _glUseProgram(($7|0));
+ $8 = ((($1)) + 32|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ((($1)) + 116|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = (+($11&255));
+ $13 = $12 / 255.0;
+ $14 = ((($1)) + 117|0);
+ $15 = HEAP8[$14>>0]|0;
+ $16 = (+($15&255));
+ $17 = $16 / 255.0;
+ $18 = ((($1)) + 118|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = (+($19&255));
+ $21 = $20 / 255.0;
+ $22 = ((($1)) + 119|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = (+($23&255));
+ $25 = $24 / 255.0;
+ _glUniform4f(($9|0),(+$13),(+$17),(+$21),(+$25));
+ $26 = ((($1)) + 36|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = ($27|0)==(-1);
+ if (!($28)) {
+ $29 = ((($1)) + 120|0);
+ $30 = HEAP8[$29>>0]|0;
+ $31 = (+($30&255));
+ $32 = $31 / 255.0;
+ $33 = ((($1)) + 121|0);
+ $34 = HEAP8[$33>>0]|0;
+ $35 = (+($34&255));
+ $36 = $35 / 255.0;
+ $37 = ((($1)) + 122|0);
+ $38 = HEAP8[$37>>0]|0;
+ $39 = (+($38&255));
+ $40 = $39 / 255.0;
+ $41 = ((($1)) + 123|0);
+ $42 = HEAP8[$41>>0]|0;
+ $43 = (+($42&255));
+ $44 = $43 / 255.0;
+ _glUniform4f(($27|0),(+$32),(+$36),(+$40),(+$44));
+ }
+ $45 = ((($1)) + 40|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = ($46|0)==(-1);
+ if (!($47)) {
+ $48 = ((($1)) + 124|0);
+ $49 = HEAP8[$48>>0]|0;
+ $50 = (+($49&255));
+ $51 = $50 / 255.0;
+ $52 = ((($1)) + 125|0);
+ $53 = HEAP8[$52>>0]|0;
+ $54 = (+($53&255));
+ $55 = $54 / 255.0;
+ $56 = ((($1)) + 126|0);
+ $57 = HEAP8[$56>>0]|0;
+ $58 = (+($57&255));
+ $59 = $58 / 255.0;
+ $60 = ((($1)) + 127|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = (+($61&255));
+ $63 = $62 / 255.0;
+ _glUniform4f(($46|0),(+$51),(+$55),(+$59),(+$63));
+ }
+ dest=$3; src=20804; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$4; src=20740; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$modelview$byval_copy4; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy5; src=20804; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($5,$modelview$byval_copy4,$$byval_copy5);
+ $64 = HEAP32[$1>>2]|0;
+ $65 = HEAP32[5634]|0;
+ $66 = ($64|0)==($65|0);
+ if (!($66)) {
+ $67 = (_glGetUniformLocation(($64|0),(9288|0))|0);
+ $68 = ($67|0)==(-1);
+ if (!($68)) {
+ dest=$modelview$byval_copy4; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixTranspose($modelview$byval_copy4);
+ _MatrixInvert($modelview$byval_copy4);
+ dest=$$byval_copy5; src=$modelview$byval_copy4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $69 = (_MatrixToFloat($$byval_copy5)|0);
+ _glUniformMatrix4fv(($67|0),1,0,($69|0));
+ }
+ $70 = HEAP32[$1>>2]|0;
+ $71 = (_glGetUniformLocation(($70|0),(9300|0))|0);
+ $72 = ($71|0)==(-1);
+ if (!($72)) {
+ $73 = ((($3)) + 8|0);
+ $74 = +HEAPF32[$73>>2];
+ $75 = ((($3)) + 24|0);
+ $76 = +HEAPF32[$75>>2];
+ $77 = ((($3)) + 40|0);
+ $78 = +HEAPF32[$77>>2];
+ _glUniform3f(($71|0),(+$74),(+$76),(+$78));
+ }
+ $79 = (_glGetUniformLocation(($70|0),(9308|0))|0);
+ $80 = ($79|0)==(-1);
+ if (!($80)) {
+ $81 = ((($1)) + 128|0);
+ $82 = +HEAPF32[$81>>2];
+ _glUniform1f(($79|0),(+$82));
+ }
+ }
+ _glActiveTexture(33984);
+ $83 = ((($1)) + 56|0);
+ $84 = HEAP32[$83>>2]|0;
+ _glBindTexture(3553,($84|0));
+ $85 = ((($1)) + 44|0);
+ $86 = HEAP32[$85>>2]|0;
+ _glUniform1i(($86|0),0);
+ $87 = ((($1)) + 76|0);
+ $88 = HEAP32[$87>>2]|0;
+ $89 = ($88|0)==(0);
+ if (!($89)) {
+ $90 = ((($1)) + 48|0);
+ $91 = HEAP32[$90>>2]|0;
+ $92 = ($91|0)==(-1);
+ if (!($92)) {
+ $93 = HEAP32[$1>>2]|0;
+ $94 = (_glGetUniformLocation(($93|0),(9319|0))|0);
+ _glUniform1i(($94|0),1);
+ _glActiveTexture(33985);
+ $95 = HEAP32[$87>>2]|0;
+ _glBindTexture(3553,($95|0));
+ $96 = HEAP32[$90>>2]|0;
+ _glUniform1i(($96|0),1);
+ }
+ }
+ $97 = ((($1)) + 96|0);
+ $98 = HEAP32[$97>>2]|0;
+ $99 = ($98|0)==(0);
+ if (!($99)) {
+ $100 = ((($1)) + 52|0);
+ $101 = HEAP32[$100>>2]|0;
+ $102 = ($101|0)==(-1);
+ if (!($102)) {
+ $103 = HEAP32[$1>>2]|0;
+ $104 = (_glGetUniformLocation(($103|0),(9329|0))|0);
+ _glUniform1i(($104|0),1);
+ _glActiveTexture(33986);
+ $105 = HEAP32[$97>>2]|0;
+ _glBindTexture(3553,($105|0));
+ $106 = HEAP32[$100>>2]|0;
+ _glUniform1i(($106|0),2);
+ }
+ }
+ $107 = HEAP32[5259]|0;
+ $108 = ($107|0)==(0);
+ if ($108) {
+ $112 = ((($0)) + 40|0);
+ $113 = HEAP32[$112>>2]|0;
+ _glBindBuffer(34962,($113|0));
+ $114 = ((($1)) + 4|0);
+ $115 = HEAP32[$114>>2]|0;
+ _glVertexAttribPointer(($115|0),3,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(($115|0));
+ $116 = ((($0)) + 44|0);
+ $117 = HEAP32[$116>>2]|0;
+ _glBindBuffer(34962,($117|0));
+ $118 = ((($1)) + 8|0);
+ $119 = HEAP32[$118>>2]|0;
+ _glVertexAttribPointer(($119|0),2,5126,0,0,(0|0));
+ _glEnableVertexAttribArray(($119|0));
+ $120 = ((($1)) + 16|0);
+ $121 = HEAP32[$120>>2]|0;
+ $122 = ($121|0)==(-1);
+ if (!($122)) {
+ $123 = ((($0)) + 48|0);
+ $124 = HEAP32[$123>>2]|0;
+ _glBindBuffer(34962,($124|0));
+ $125 = HEAP32[$120>>2]|0;
+ _glVertexAttribPointer(($125|0),3,5126,0,0,(0|0));
+ $126 = HEAP32[$120>>2]|0;
+ _glEnableVertexAttribArray(($126|0));
+ }
+ $127 = ((($1)) + 24|0);
+ $128 = HEAP32[$127>>2]|0;
+ $129 = ($128|0)==(-1);
+ do {
+ if (!($129)) {
+ $130 = ((($0)) + 52|0);
+ $131 = HEAP32[$130>>2]|0;
+ $132 = ($131|0)==(0);
+ if ($132) {
+ _glVertexAttrib4f(($128|0),1.0,1.0,1.0,1.0);
+ $135 = HEAP32[$127>>2]|0;
+ _glDisableVertexAttribArray(($135|0));
+ break;
+ } else {
+ _glBindBuffer(34962,($131|0));
+ $133 = HEAP32[$127>>2]|0;
+ _glVertexAttribPointer(($133|0),4,5121,1,0,(0|0));
+ $134 = HEAP32[$127>>2]|0;
+ _glEnableVertexAttribArray(($134|0));
+ break;
+ }
+ }
+ } while(0);
+ $136 = ((($1)) + 20|0);
+ $137 = HEAP32[$136>>2]|0;
+ $138 = ($137|0)==(-1);
+ if (!($138)) {
+ $139 = ((($0)) + 56|0);
+ $140 = HEAP32[$139>>2]|0;
+ _glBindBuffer(34962,($140|0));
+ $141 = HEAP32[$136>>2]|0;
+ _glVertexAttribPointer(($141|0),3,5126,0,0,(0|0));
+ $142 = HEAP32[$136>>2]|0;
+ _glEnableVertexAttribArray(($142|0));
+ }
+ $143 = ((($1)) + 12|0);
+ $144 = HEAP32[$143>>2]|0;
+ $145 = ($144|0)==(-1);
+ if (!($145)) {
+ $146 = ((($0)) + 60|0);
+ $147 = HEAP32[$146>>2]|0;
+ _glBindBuffer(34962,($147|0));
+ $148 = HEAP32[$143>>2]|0;
+ _glVertexAttribPointer(($148|0),2,5126,0,0,(0|0));
+ $149 = HEAP32[$143>>2]|0;
+ _glEnableVertexAttribArray(($149|0));
+ }
+ $150 = ((($0)) + 32|0);
+ $151 = HEAP32[$150>>2]|0;
+ $152 = ($151|0)==(0|0);
+ if (!($152)) {
+ $153 = HEAP32[(20736)>>2]|0;
+ _glBindBuffer(34963,($153|0));
+ }
+ } else {
+ $109 = HEAP32[5260]|0;
+ $110 = ((($0)) + 36|0);
+ $111 = HEAP32[$110>>2]|0;
+ FUNCTION_TABLE_vi[$109 & 31]($111);
+ }
+ $154 = HEAP32[5217]|0;
+ $155 = ($154|0)!=(0);
+ $$ = $155 ? 2 : 1;
+ $156 = ((($1)) + 28|0);
+ $157 = ((($0)) + 32|0);
+ $158 = HEAP32[$0>>2]|0;
+ $159 = ((($0)) + 4|0);
+ $$020 = 0;
+ while(1) {
+ if ($155) {
+ dest=$modelview$byval_copy4; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy5; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _SetStereoView($$020,$modelview$byval_copy4,$$byval_copy5);
+ } else {
+ dest=20804; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ }
+ dest=$modelview$byval_copy4; src=20804; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy5; src=20740; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($6,$modelview$byval_copy4,$$byval_copy5);
+ $162 = HEAP32[$156>>2]|0;
+ dest=$$byval_copy5; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $163 = (_MatrixToFloat($$byval_copy5)|0);
+ _glUniformMatrix4fv(($162|0),1,0,($163|0));
+ $164 = HEAP32[$157>>2]|0;
+ $165 = ($164|0)==(0|0);
+ if ($165) {
+ _glDrawArrays(4,0,($158|0));
+ } else {
+ $166 = HEAP32[$159>>2]|0;
+ $167 = ($166*3)|0;
+ _glDrawElements(4,($167|0),5123,(0|0));
+ }
+ $168 = (($$020) + 1)|0;
+ $169 = ($168|0)<($$|0);
+ if ($169) {
+ $$020 = $168;
+ } else {
+ break;
+ }
+ }
+ $160 = HEAP32[$87>>2]|0;
+ $161 = ($160|0)==(0);
+ if (!($161)) {
+ _glActiveTexture(33985);
+ _glBindTexture(3553,0);
+ }
+ $170 = HEAP32[$97>>2]|0;
+ $171 = ($170|0)==(0);
+ if (!($171)) {
+ _glActiveTexture(33986);
+ _glBindTexture(3553,0);
+ }
+ _glActiveTexture(33984);
+ _glBindTexture(3553,0);
+ $172 = HEAP32[5259]|0;
+ $173 = ($172|0)==(0);
+ if (!($173)) {
+ $174 = HEAP32[5260]|0;
+ FUNCTION_TABLE_vi[$174 & 31](0);
+ _glUseProgram(0);
+ dest=20740; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=20804; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ _glBindBuffer(34962,0);
+ $175 = ((($0)) + 32|0);
+ $176 = HEAP32[$175>>2]|0;
+ $177 = ($176|0)==(0|0);
+ if ($177) {
+ _glUseProgram(0);
+ dest=20740; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=20804; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+ }
+ _glBindBuffer(34963,0);
+ _glUseProgram(0);
+ dest=20740; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=20804; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _MatrixInvert($0) {
+ $0 = $0|0;
+ var $1 = 0.0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0;
+ var $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0;
+ var $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0.0;
+ var $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0;
+ var $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0.0;
+ var $3 = 0.0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0;
+ var $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0;
+ var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0;
+ var $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = +HEAPF32[$0>>2];
+ $2 = ((($0)) + 16|0);
+ $3 = +HEAPF32[$2>>2];
+ $4 = ((($0)) + 32|0);
+ $5 = +HEAPF32[$4>>2];
+ $6 = ((($0)) + 48|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = ((($0)) + 4|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = ((($0)) + 20|0);
+ $11 = +HEAPF32[$10>>2];
+ $12 = ((($0)) + 36|0);
+ $13 = +HEAPF32[$12>>2];
+ $14 = ((($0)) + 52|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = ((($0)) + 8|0);
+ $17 = +HEAPF32[$16>>2];
+ $18 = ((($0)) + 24|0);
+ $19 = +HEAPF32[$18>>2];
+ $20 = ((($0)) + 40|0);
+ $21 = +HEAPF32[$20>>2];
+ $22 = ((($0)) + 56|0);
+ $23 = +HEAPF32[$22>>2];
+ $24 = ((($0)) + 12|0);
+ $25 = +HEAPF32[$24>>2];
+ $26 = ((($0)) + 28|0);
+ $27 = +HEAPF32[$26>>2];
+ $28 = ((($0)) + 44|0);
+ $29 = +HEAPF32[$28>>2];
+ $30 = ((($0)) + 60|0);
+ $31 = +HEAPF32[$30>>2];
+ $32 = $1 * $11;
+ $33 = $3 * $9;
+ $34 = $32 - $33;
+ $35 = $1 * $13;
+ $36 = $5 * $9;
+ $37 = $35 - $36;
+ $38 = $1 * $15;
+ $39 = $7 * $9;
+ $40 = $38 - $39;
+ $41 = $3 * $13;
+ $42 = $5 * $11;
+ $43 = $41 - $42;
+ $44 = $3 * $15;
+ $45 = $7 * $11;
+ $46 = $44 - $45;
+ $47 = $5 * $15;
+ $48 = $7 * $13;
+ $49 = $47 - $48;
+ $50 = $17 * $27;
+ $51 = $19 * $25;
+ $52 = $50 - $51;
+ $53 = $17 * $29;
+ $54 = $21 * $25;
+ $55 = $53 - $54;
+ $56 = $17 * $31;
+ $57 = $23 * $25;
+ $58 = $56 - $57;
+ $59 = $19 * $29;
+ $60 = $21 * $27;
+ $61 = $59 - $60;
+ $62 = $19 * $31;
+ $63 = $23 * $27;
+ $64 = $62 - $63;
+ $65 = $21 * $31;
+ $66 = $23 * $29;
+ $67 = $65 - $66;
+ $68 = $34 * $67;
+ $69 = $37 * $64;
+ $70 = $68 - $69;
+ $71 = $40 * $61;
+ $72 = $71 + $70;
+ $73 = $43 * $58;
+ $74 = $73 + $72;
+ $75 = $46 * $55;
+ $76 = $74 - $75;
+ $77 = $49 * $52;
+ $78 = $77 + $76;
+ $79 = 1.0 / $78;
+ $80 = $11 * $67;
+ $81 = $13 * $64;
+ $82 = $80 - $81;
+ $83 = $15 * $61;
+ $84 = $83 + $82;
+ $85 = $84 * $79;
+ $86 = $3 * $67;
+ $87 = $5 * $64;
+ $88 = $87 - $86;
+ $89 = $7 * $61;
+ $90 = $88 - $89;
+ $91 = $90 * $79;
+ $92 = $49 * $27;
+ $93 = $46 * $29;
+ $94 = $92 - $93;
+ $95 = $43 * $31;
+ $96 = $94 + $95;
+ $97 = $96 * $79;
+ $98 = $19 * $49;
+ $99 = $46 * $21;
+ $100 = $99 - $98;
+ $101 = $43 * $23;
+ $102 = $100 - $101;
+ $103 = $102 * $79;
+ $104 = -$9;
+ $105 = $67 * $104;
+ $106 = $13 * $58;
+ $107 = $105 + $106;
+ $108 = $15 * $55;
+ $109 = $107 - $108;
+ $110 = $109 * $79;
+ $111 = $1 * $67;
+ $112 = $5 * $58;
+ $113 = $111 - $112;
+ $114 = $7 * $55;
+ $115 = $114 + $113;
+ $116 = $115 * $79;
+ $117 = -$25;
+ $118 = $49 * $117;
+ $119 = $40 * $29;
+ $120 = $118 + $119;
+ $121 = $37 * $31;
+ $122 = $120 - $121;
+ $123 = $122 * $79;
+ $124 = $17 * $49;
+ $125 = $40 * $21;
+ $126 = $124 - $125;
+ $127 = $37 * $23;
+ $128 = $126 + $127;
+ $129 = $128 * $79;
+ $130 = $9 * $64;
+ $131 = $11 * $58;
+ $132 = $130 - $131;
+ $133 = $15 * $52;
+ $134 = $133 + $132;
+ $135 = $134 * $79;
+ $136 = $1 * $64;
+ $137 = $3 * $58;
+ $138 = $137 - $136;
+ $139 = $7 * $52;
+ $140 = $138 - $139;
+ $141 = $140 * $79;
+ $142 = $46 * $25;
+ $143 = $40 * $27;
+ $144 = $142 - $143;
+ $145 = $34 * $31;
+ $146 = $144 + $145;
+ $147 = $146 * $79;
+ $148 = $17 * $46;
+ $149 = $19 * $40;
+ $150 = $149 - $148;
+ $151 = $34 * $23;
+ $152 = $150 - $151;
+ $153 = $152 * $79;
+ $154 = $61 * $104;
+ $155 = $11 * $55;
+ $156 = $154 + $155;
+ $157 = $13 * $52;
+ $158 = $156 - $157;
+ $159 = $158 * $79;
+ $160 = $1 * $61;
+ $161 = $3 * $55;
+ $162 = $160 - $161;
+ $163 = $5 * $52;
+ $164 = $163 + $162;
+ $165 = $164 * $79;
+ $166 = $43 * $117;
+ $167 = $37 * $27;
+ $168 = $166 + $167;
+ $169 = $34 * $29;
+ $170 = $168 - $169;
+ $171 = $170 * $79;
+ $172 = $17 * $43;
+ $173 = $37 * $19;
+ $174 = $172 - $173;
+ $175 = $34 * $21;
+ $176 = $174 + $175;
+ $177 = $176 * $79;
+ HEAPF32[$0>>2] = $85;
+ HEAPF32[$8>>2] = $110;
+ HEAPF32[$16>>2] = $135;
+ HEAPF32[$24>>2] = $159;
+ HEAPF32[$2>>2] = $91;
+ HEAPF32[$10>>2] = $116;
+ HEAPF32[$18>>2] = $141;
+ HEAPF32[$26>>2] = $165;
+ HEAPF32[$4>>2] = $97;
+ HEAPF32[$12>>2] = $123;
+ HEAPF32[$20>>2] = $147;
+ HEAPF32[$28>>2] = $171;
+ HEAPF32[$6>>2] = $103;
+ HEAPF32[$14>>2] = $129;
+ HEAPF32[$22>>2] = $153;
+ HEAPF32[$30>>2] = $177;
+ return;
+}
+function _MatrixLookAt($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$byval_copy4 = 0, $$byval_copy5 = 0, $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0, $11 = 0.0, $12 = 0.0;
+ var $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0;
+ var $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $$byval_copy5 = sp + 48|0;
+ $$byval_copy4 = sp + 36|0;
+ $4 = sp + 24|0;
+ $5 = sp + 12|0;
+ $6 = sp;
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$1+8>>2]|0;
+ ;HEAP32[$$byval_copy5>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$2+8>>2]|0;
+ _VectorSubtract($4,$$byval_copy4,$$byval_copy5);
+ _VectorNormalize($4);
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$3+8>>2]|0;
+ ;HEAP32[$$byval_copy5>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$4+8>>2]|0;
+ _VectorCrossProduct($5,$$byval_copy4,$$byval_copy5);
+ _VectorNormalize($5);
+ ;HEAP32[$$byval_copy4>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$$byval_copy4+8>>2]=HEAP32[$4+8>>2]|0;
+ ;HEAP32[$$byval_copy5>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$5+8>>2]|0;
+ _VectorCrossProduct($6,$$byval_copy4,$$byval_copy5);
+ _VectorNormalize($6);
+ $7 = +HEAPF32[$5>>2];
+ $8 = ((($5)) + 4|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = ((($5)) + 8|0);
+ $11 = +HEAPF32[$10>>2];
+ $12 = +HEAPF32[$1>>2];
+ $13 = $7 * $12;
+ $14 = ((($1)) + 4|0);
+ $15 = +HEAPF32[$14>>2];
+ $16 = $9 * $15;
+ $17 = $13 + $16;
+ $18 = ((($1)) + 8|0);
+ $19 = +HEAPF32[$18>>2];
+ $20 = $11 * $19;
+ $21 = $17 + $20;
+ $22 = -$21;
+ $23 = +HEAPF32[$6>>2];
+ $24 = ((($6)) + 4|0);
+ $25 = +HEAPF32[$24>>2];
+ $26 = ((($6)) + 8|0);
+ $27 = +HEAPF32[$26>>2];
+ $28 = $12 * $23;
+ $29 = $15 * $25;
+ $30 = $28 + $29;
+ $31 = $19 * $27;
+ $32 = $30 + $31;
+ $33 = -$32;
+ $34 = +HEAPF32[$4>>2];
+ $35 = ((($4)) + 4|0);
+ $36 = +HEAPF32[$35>>2];
+ $37 = ((($4)) + 8|0);
+ $38 = +HEAPF32[$37>>2];
+ $39 = $12 * $34;
+ $40 = $15 * $36;
+ $41 = $39 + $40;
+ $42 = $19 * $38;
+ $43 = $41 + $42;
+ $44 = -$43;
+ HEAPF32[$0>>2] = $7;
+ $$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $23;
+ $$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $34;
+ $$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
+ HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = 0.0;
+ $$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
+ HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $9;
+ $$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $25;
+ $$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
+ HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $36;
+ $$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
+ HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = 0.0;
+ $$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
+ HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $11;
+ $$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
+ HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $27;
+ $$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $38;
+ $$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
+ HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
+ $$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $22;
+ $$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $33;
+ $$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $44;
+ $$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
+ STACKTOP = sp;return;
+}
+function _rlVertex2i($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0.0, $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+($0|0));
+ $3 = (+($1|0));
+ $4 = +HEAPF32[926];
+ _rlVertex3f($2,$3,$4);
+ return;
+}
+function _DrawRectangle($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $$byval_copy2 = sp + 32|0;
+ $$byval_copy1 = sp + 24|0;
+ $$byval_copy = sp + 16|0;
+ $5 = sp + 8|0;
+ $6 = sp;
+ $7 = (+($0|0));
+ HEAPF32[$5>>2] = $7;
+ $8 = ((($5)) + 4|0);
+ $9 = (+($1|0));
+ HEAPF32[$8>>2] = $9;
+ $10 = (+($2|0));
+ HEAPF32[$6>>2] = $10;
+ $11 = ((($6)) + 4|0);
+ $12 = (+($3|0));
+ HEAPF32[$11>>2] = $12;
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$6+4>>2]|0;
+ ;HEAP8[$$byval_copy2>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$4+3>>0]|0;
+ _DrawRectangleV($$byval_copy,$$byval_copy1,$$byval_copy2);
+ STACKTOP = sp;return;
+}
+function _DrawRectangleV($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0.0, $17 = 0, $18 = 0, $19 = 0.0, $20 = 0.0, $21 = 0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0;
+ var $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0.0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0, $47 = 0;
+ var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0, $64 = 0.0, $65 = 0.0;
+ var $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $3 = sp;
+ $4 = (_rlGetVersion()|0);
+ $5 = ($4|0)==(1);
+ if ($5) {
+ _rlBegin(4);
+ $6 = HEAP8[$2>>0]|0;
+ $7 = ((($2)) + 1|0);
+ $8 = HEAP8[$7>>0]|0;
+ $9 = ((($2)) + 2|0);
+ $10 = HEAP8[$9>>0]|0;
+ $11 = ((($2)) + 3|0);
+ $12 = HEAP8[$11>>0]|0;
+ _rlColor4ub($6,$8,$10,$12);
+ $13 = +HEAPF32[$0>>2];
+ $14 = (~~(($13)));
+ $15 = ((($0)) + 4|0);
+ $16 = +HEAPF32[$15>>2];
+ $17 = (~~(($16)));
+ _rlVertex2i($14,$17);
+ $18 = ((($1)) + 4|0);
+ $19 = +HEAPF32[$18>>2];
+ $20 = $16 + $19;
+ $21 = (~~(($20)));
+ _rlVertex2i($14,$21);
+ $22 = +HEAPF32[$0>>2];
+ $23 = +HEAPF32[$1>>2];
+ $24 = $22 + $23;
+ $25 = (~~(($24)));
+ $26 = +HEAPF32[$15>>2];
+ $27 = +HEAPF32[$18>>2];
+ $28 = $26 + $27;
+ $29 = (~~(($28)));
+ _rlVertex2i($25,$29);
+ $30 = +HEAPF32[$0>>2];
+ $31 = (~~(($30)));
+ $32 = +HEAPF32[$15>>2];
+ $33 = (~~(($32)));
+ _rlVertex2i($31,$33);
+ $34 = +HEAPF32[$1>>2];
+ $35 = $30 + $34;
+ $36 = (~~(($35)));
+ $37 = +HEAPF32[$18>>2];
+ $38 = $32 + $37;
+ $39 = (~~(($38)));
+ _rlVertex2i($36,$39);
+ $40 = +HEAPF32[$0>>2];
+ $41 = +HEAPF32[$1>>2];
+ $42 = $40 + $41;
+ $43 = (~~(($42)));
+ $44 = +HEAPF32[$15>>2];
+ $45 = (~~(($44)));
+ _rlVertex2i($43,$45);
+ _rlEnd();
+ STACKTOP = sp;return;
+ }
+ $46 = (_rlGetVersion()|0);
+ $47 = ($46|0)==(2);
+ if (!($47)) {
+ $48 = (_rlGetVersion()|0);
+ $49 = ($48|0)==(3);
+ if (!($49)) {
+ $50 = (_rlGetVersion()|0);
+ $51 = ($50|0)==(4);
+ if (!($51)) {
+ STACKTOP = sp;return;
+ }
+ }
+ }
+ _GetDefaultTexture($3);
+ $52 = HEAP32[$3>>2]|0;
+ _rlEnableTexture($52);
+ _rlBegin(7);
+ $53 = HEAP8[$2>>0]|0;
+ $54 = ((($2)) + 1|0);
+ $55 = HEAP8[$54>>0]|0;
+ $56 = ((($2)) + 2|0);
+ $57 = HEAP8[$56>>0]|0;
+ $58 = ((($2)) + 3|0);
+ $59 = HEAP8[$58>>0]|0;
+ _rlColor4ub($53,$55,$57,$59);
+ _rlTexCoord2f(0.0,0.0);
+ $60 = +HEAPF32[$0>>2];
+ $61 = ((($0)) + 4|0);
+ $62 = +HEAPF32[$61>>2];
+ _rlVertex2f($60,$62);
+ _rlTexCoord2f(0.0,1.0);
+ $63 = ((($1)) + 4|0);
+ $64 = +HEAPF32[$63>>2];
+ $65 = $62 + $64;
+ _rlVertex2f($60,$65);
+ _rlTexCoord2f(1.0,1.0);
+ $66 = +HEAPF32[$0>>2];
+ $67 = +HEAPF32[$1>>2];
+ $68 = $66 + $67;
+ $69 = +HEAPF32[$61>>2];
+ $70 = +HEAPF32[$63>>2];
+ $71 = $69 + $70;
+ _rlVertex2f($68,$71);
+ _rlTexCoord2f(1.0,0.0);
+ $72 = +HEAPF32[$0>>2];
+ $73 = +HEAPF32[$1>>2];
+ $74 = $72 + $73;
+ $75 = +HEAPF32[$61>>2];
+ _rlVertex2f($74,$75);
+ _rlEnd();
+ _rlDisableTexture();
+ STACKTOP = sp;return;
+}
+function _Vector2Distance($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = +HEAPF32[$0>>2];
+ $3 = +HEAPF32[$1>>2];
+ $4 = $2 - $3;
+ $5 = $4 * $4;
+ $6 = ((($0)) + 4|0);
+ $7 = +HEAPF32[$6>>2];
+ $8 = ((($1)) + 4|0);
+ $9 = +HEAPF32[$8>>2];
+ $10 = $7 - $9;
+ $11 = $10 * $10;
+ $12 = $5 + $11;
+ $13 = (+Math_sqrt((+$12)));
+ return (+$13);
+}
+function _Vector2Angle($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($1)) + 4|0);
+ $3 = +HEAPF32[$2>>2];
+ $4 = ((($0)) + 4|0);
+ $5 = +HEAPF32[$4>>2];
+ $6 = $3 - $5;
+ $7 = +HEAPF32[$1>>2];
+ $8 = +HEAPF32[$0>>2];
+ $9 = $7 - $8;
+ $10 = (+Math_atan2((+$6),(+$9)));
+ $11 = $10 * 57.2957763671875;
+ $12 = $11 < 0.0;
+ $13 = $11 + 360.0;
+ $$0 = $12 ? $13 : $11;
+ return (+$$0);
+}
+function _VectorZero($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF32[$0>>2] = 0.0;
+ $1 = ((($0)) + 4|0);
+ HEAPF32[$1>>2] = 0.0;
+ $2 = ((($0)) + 8|0);
+ HEAPF32[$2>>2] = 0.0;
+ return;
+}
+function _MatrixFrustum($0,$1,$2,$3,$4,$5,$6) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ $4 = +$4;
+ $5 = +$5;
+ $6 = +$6;
+ var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
+ var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0;
+ var $35 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $7 = $2 - $1;
+ $8 = $7;
+ $9 = $4 - $3;
+ $10 = $9;
+ $11 = $6 - $5;
+ $12 = $11;
+ $13 = $5 * 2.0;
+ $14 = $8;
+ $15 = $13 / $14;
+ $16 = $15;
+ $17 = $10;
+ $18 = $13 / $17;
+ $19 = $18;
+ $20 = $1 + $2;
+ $21 = $20 / $14;
+ $22 = $21;
+ $23 = $3 + $4;
+ $24 = $23 / $17;
+ $25 = $24;
+ $26 = $5 + $6;
+ $27 = -$26;
+ $28 = $12;
+ $29 = $27 / $28;
+ $30 = $29;
+ $31 = $5 * $6;
+ $32 = $31 * 2.0;
+ $33 = -$32;
+ $34 = $33 / $28;
+ $35 = $34;
+ HEAPF32[$0>>2] = $16;
+ $$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
+ $$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = $22;
+ $$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
+ HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = 0.0;
+ $$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
+ HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
+ $$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $19;
+ $$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
+ HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = $25;
+ $$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
+ HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = 0.0;
+ $$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
+ HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
+ $$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
+ HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
+ $$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $30;
+ $$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
+ HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $35;
+ $$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
+ $$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
+ $$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = -1.0;
+ $$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 0.0;
+ return;
+}
+function _MatrixOrtho($0,$1,$2,$3,$4,$5,$6) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ $4 = +$4;
+ $5 = +$5;
+ $6 = +$6;
+ var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
+ var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $7 = $2 - $1;
+ $8 = $7;
+ $9 = $4 - $3;
+ $10 = $9;
+ $11 = $6 - $5;
+ $12 = $11;
+ $13 = 2.0 / $8;
+ $14 = 2.0 / $10;
+ $15 = -2.0 / $12;
+ $16 = $1 + $2;
+ $17 = -$16;
+ $18 = $8;
+ $19 = $17 / $18;
+ $20 = $19;
+ $21 = $3 + $4;
+ $22 = -$21;
+ $23 = $10;
+ $24 = $22 / $23;
+ $25 = $24;
+ $26 = $5 + $6;
+ $27 = -$26;
+ $28 = $12;
+ $29 = $27 / $28;
+ $30 = $29;
+ HEAPF32[$0>>2] = $13;
+ $$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
+ HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
+ $$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
+ HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = 0.0;
+ $$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
+ HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = $20;
+ $$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
+ HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
+ $$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
+ HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $14;
+ $$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
+ HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = 0.0;
+ $$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
+ HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = $25;
+ $$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
+ HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
+ $$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
+ HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
+ $$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
+ HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $15;
+ $$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
+ HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $30;
+ $$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
+ HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
+ $$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
+ HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
+ $$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
+ HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = 0.0;
+ $$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
+ HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 1.0;
+ return;
+}
+function _ProcessGestureEvent($0) {
+ $0 = $0|0;
+ var $$$sink = 0, $$sink = 0, $$sink10 = 0, $$sink11 = 0, $$sink16 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0;
+ var $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
+ var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
+ var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0;
+ var $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0.0, $174 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
+ var $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0;
+ var $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $moveDownPosition$byval_copy11 = 0;
+ var $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $moveDownPosition2$byval_copy12 = sp + 8|0;
+ $moveDownPosition$byval_copy11 = sp;
+ $1 = ((($0)) + 4|0);
+ $2 = HEAP32[$1>>2]|0;
+ HEAP32[5650] = $2;
+ $3 = ($2|0)<(2);
+ $4 = HEAP32[$0>>2]|0;
+ $5 = ($4|0)==(1);
+ if (!($3)) {
+ if ($5) {
+ $88 = ((($0)) + 24|0);
+ $89 = $88;
+ $90 = $89;
+ $91 = HEAP32[$90>>2]|0;
+ $92 = (($89) + 4)|0;
+ $93 = $92;
+ $94 = HEAP32[$93>>2]|0;
+ $95 = 19448;
+ $96 = $95;
+ HEAP32[$96>>2] = $91;
+ $97 = (($95) + 4)|0;
+ $98 = $97;
+ HEAP32[$98>>2] = $94;
+ $99 = ((($0)) + 32|0);
+ $100 = $99;
+ $101 = $100;
+ $102 = HEAP32[$101>>2]|0;
+ $103 = (($100) + 4)|0;
+ $104 = $103;
+ $105 = HEAP32[$104>>2]|0;
+ $106 = 19488;
+ $107 = $106;
+ HEAP32[$107>>2] = $102;
+ $108 = (($106) + 4)|0;
+ $109 = $108;
+ HEAP32[$109>>2] = $105;
+ $110 = +HEAPF32[4872];
+ $111 = +HEAPF32[4862];
+ $112 = $110 - $111;
+ HEAPF32[4874] = $112;
+ $113 = +HEAPF32[(19492)>>2];
+ $114 = +HEAPF32[(19452)>>2];
+ $115 = $113 - $114;
+ HEAPF32[(19500)>>2] = $115;
+ HEAP32[5649] = 4;
+ STACKTOP = sp;return;
+ }
+ switch ($4|0) {
+ case 2: {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19480>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19480+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19504>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19504+4>>2]|0;
+ $116 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ HEAPF32[5655] = $116;
+ $117 = 19480;
+ $118 = $117;
+ $119 = HEAP32[$118>>2]|0;
+ $120 = (($117) + 4)|0;
+ $121 = $120;
+ $122 = HEAP32[$121>>2]|0;
+ $123 = 19448;
+ $124 = $123;
+ HEAP32[$124>>2] = $119;
+ $125 = (($123) + 4)|0;
+ $126 = $125;
+ HEAP32[$126>>2] = $122;
+ $127 = 19504;
+ $128 = $127;
+ $129 = HEAP32[$128>>2]|0;
+ $130 = (($127) + 4)|0;
+ $131 = $130;
+ $132 = HEAP32[$131>>2]|0;
+ $133 = 19488;
+ $134 = $133;
+ HEAP32[$134>>2] = $129;
+ $135 = (($133) + 4)|0;
+ $136 = $135;
+ HEAP32[$136>>2] = $132;
+ $137 = ((($0)) + 24|0);
+ $138 = $137;
+ $139 = $138;
+ $140 = HEAP32[$139>>2]|0;
+ $141 = (($138) + 4)|0;
+ $142 = $141;
+ $143 = HEAP32[$142>>2]|0;
+ $144 = 19480;
+ $145 = $144;
+ HEAP32[$145>>2] = $140;
+ $146 = (($144) + 4)|0;
+ $147 = $146;
+ HEAP32[$147>>2] = $143;
+ $148 = ((($0)) + 32|0);
+ $149 = $148;
+ $150 = $149;
+ $151 = HEAP32[$150>>2]|0;
+ $152 = (($149) + 4)|0;
+ $153 = $152;
+ $154 = HEAP32[$153>>2]|0;
+ $155 = 19504;
+ $156 = $155;
+ HEAP32[$156>>2] = $151;
+ $157 = (($155) + 4)|0;
+ $158 = $157;
+ HEAP32[$158>>2] = $154;
+ $159 = +HEAPF32[4876];
+ $160 = +HEAPF32[4870];
+ $161 = $159 - $160;
+ HEAPF32[4874] = $161;
+ $162 = +HEAPF32[(19508)>>2];
+ $163 = +HEAPF32[(19484)>>2];
+ $164 = $162 - $163;
+ HEAPF32[(19500)>>2] = $164;
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19448>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19448+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19480>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19480+4>>2]|0;
+ $165 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $166 = !($165 >= 0.004999999888241291);
+ if ($166) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19488>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19488+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19504>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19504+4>>2]|0;
+ $167 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $168 = !($167 >= 0.004999999888241291);
+ if ($168) {
+ $$sink16 = 4;
+ } else {
+ label = 29;
+ }
+ } else {
+ label = 29;
+ }
+ if ((label|0) == 29) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19480>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19480+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19504>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19504+4>>2]|0;
+ $169 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $170 = +HEAPF32[5655];
+ $171 = $169 - $170;
+ $172 = $171 < 0.0;
+ $$sink11 = $172 ? 256 : 512;
+ $$sink16 = $$sink11;
+ }
+ HEAP32[5649] = $$sink16;
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19480>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19480+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19504>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19504+4>>2]|0;
+ $173 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $174 = 360.0 - $173;
+ HEAPF32[5656] = $174;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 0: {
+ HEAPF32[5655] = 0.0;
+ HEAPF32[5656] = 0.0;
+ HEAPF32[4874] = 0.0;
+ HEAPF32[(19500)>>2] = 0.0;
+ HEAP32[5650] = 0;
+ HEAP32[5649] = 0;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+ }
+ if ($5) {
+ $6 = HEAP32[5651]|0;
+ $7 = (($6) + 1)|0;
+ HEAP32[5651] = $7;
+ $8 = HEAP32[5649]|0;
+ $9 = ($8|0)==(0);
+ $10 = ($6|0)>(0);
+ $or$cond = $10 & $9;
+ if ($or$cond) {
+ $11 = ((($0)) + 24|0);
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19448>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19448+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0;
+ $12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $13 = $12 < 0.029999999329447746;
+ if ($13) {
+ HEAP32[5649] = 2;
+ HEAP32[5651] = 0;
+ } else {
+ label = 6;
+ }
+ } else {
+ label = 6;
+ }
+ if ((label|0) == 6) {
+ HEAP32[5651] = 1;
+ HEAP32[5649] = 1;
+ }
+ $14 = ((($0)) + 24|0);
+ $15 = $14;
+ $16 = $15;
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (($15) + 4)|0;
+ $19 = $18;
+ $20 = HEAP32[$19>>2]|0;
+ $21 = 19448;
+ $22 = $21;
+ HEAP32[$22>>2] = $17;
+ $23 = (($21) + 4)|0;
+ $24 = $23;
+ HEAP32[$24>>2] = $20;
+ $25 = 19456;
+ $26 = $25;
+ HEAP32[$26>>2] = $17;
+ $27 = (($25) + 4)|0;
+ $28 = $27;
+ HEAP32[$28>>2] = $20;
+ $29 = 19464;
+ $30 = $29;
+ HEAP32[$30>>2] = $17;
+ $31 = (($29) + 4)|0;
+ $32 = $31;
+ HEAP32[$32>>2] = $20;
+ $33 = ((($0)) + 8|0);
+ $34 = HEAP32[$33>>2]|0;
+ HEAP32[928] = $34;
+ HEAPF32[4868] = 0.0;
+ HEAPF32[(19476)>>2] = 0.0;
+ STACKTOP = sp;return;
+ }
+ switch ($4|0) {
+ case 0: {
+ $35 = HEAP32[5649]|0;
+ $36 = ($35|0)==(8);
+ if ($36) {
+ $37 = ((($0)) + 24|0);
+ $38 = $37;
+ $39 = $38;
+ $40 = HEAP32[$39>>2]|0;
+ $41 = (($38) + 4)|0;
+ $42 = $41;
+ $43 = HEAP32[$42>>2]|0;
+ $44 = 19464;
+ $45 = $44;
+ HEAP32[$45>>2] = $40;
+ $46 = (($44) + 4)|0;
+ $47 = $46;
+ HEAP32[$47>>2] = $43;
+ }
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19448>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19448+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19464>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19464+4>>2]|0;
+ $48 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $49 = $48 / 0.0;
+ HEAPF32[5652] = $49;
+ HEAP32[5653] = 0;
+ $50 = $49 > 5.0000002374872565E-4;
+ if ($50) {
+ $51 = HEAP32[928]|0;
+ $52 = ((($0)) + 8|0);
+ $53 = HEAP32[$52>>2]|0;
+ $54 = ($51|0)==($53|0);
+ if ($54) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19448>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19448+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19464>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19464+4>>2]|0;
+ $55 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $56 = 360.0 - $55;
+ HEAPF32[5654] = $56;
+ $57 = $56 < 30.0;
+ $58 = $56 > 330.0;
+ $or$cond3 = $57 | $58;
+ if ($or$cond3) {
+ $$sink10 = 16;
+ } else {
+ $59 = $56 > 30.0;
+ $60 = $56 < 120.0;
+ $or$cond5 = $59 & $60;
+ if ($or$cond5) {
+ $$sink10 = 64;
+ } else {
+ $61 = $56 > 120.0;
+ $62 = $56 < 210.0;
+ $or$cond7 = $61 & $62;
+ $63 = $56 > 210.0;
+ $64 = $56 < 300.0;
+ $or$cond9 = $63 & $64;
+ $$sink = $or$cond9 ? 128 : 0;
+ $$$sink = $or$cond7 ? 32 : $$sink;
+ $$sink10 = $$$sink;
+ }
+ }
+ } else {
+ label = 16;
+ }
+ } else {
+ label = 16;
+ }
+ if ((label|0) == 16) {
+ HEAPF32[5652] = 0.0;
+ HEAPF32[5654] = 0.0;
+ $$sink10 = 0;
+ }
+ HEAP32[5649] = $$sink10;
+ HEAPF32[4864] = 0.0;
+ HEAPF32[(19460)>>2] = 0.0;
+ HEAP32[5650] = 0;
+ STACKTOP = sp;return;
+ break;
+ }
+ case 2: {
+ $65 = HEAP32[5653]|0;
+ $66 = ($65|0)==(0);
+ if ($66) {
+ HEAP32[5653] = 1;
+ }
+ $67 = ((($0)) + 24|0);
+ $68 = $67;
+ $69 = $68;
+ $70 = HEAP32[$69>>2]|0;
+ $71 = (($68) + 4)|0;
+ $72 = $71;
+ $73 = HEAP32[$72>>2]|0;
+ $74 = 19480;
+ $75 = $74;
+ HEAP32[$75>>2] = $70;
+ $76 = (($74) + 4)|0;
+ $77 = $76;
+ HEAP32[$77>>2] = $73;
+ $78 = HEAP32[5649]|0;
+ $79 = ($78|0)==(4);
+ if ($79) {
+ ;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[19448>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[19448+4>>2]|0;
+ ;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[19480>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[19480+4>>2]|0;
+ $80 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
+ $81 = !($80 >= 0.014999999664723873);
+ if (!($81)) {
+ HEAP32[5649] = 8;
+ }
+ }
+ $82 = +HEAPF32[4870];
+ $83 = +HEAPF32[4864];
+ $84 = $82 - $83;
+ HEAPF32[4868] = $84;
+ $85 = +HEAPF32[(19484)>>2];
+ $86 = +HEAPF32[(19460)>>2];
+ $87 = $85 - $86;
+ HEAPF32[(19476)>>2] = $87;
+ STACKTOP = sp;return;
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+}
+function _UpdateGestures() {
+ var $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5649]|0;
+ $$off = (($0) + -1)|0;
+ $1 = ($$off>>>0)<(2);
+ $2 = HEAP32[5650]|0;
+ $3 = ($2|0)<(2);
+ $or$cond3 = $1 & $3;
+ if ($or$cond3) {
+ HEAP32[5649] = 4;
+ }
+ $4 = HEAP32[5649]|0;
+ $5 = (($4) + -16)|0;
+ $6 = $5 >>> 4;
+ $7 = $5 << 28;
+ $8 = $6 | $7;
+ switch ($8|0) {
+ case 0: case 1: case 3: case 7: {
+ break;
+ }
+ default: {
+ return;
+ }
+ }
+ HEAP32[5649] = 0;
+ return;
+}
+function _SetCameraMode($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$off = 0, $$sroa$024$0$$sroa_idx = 0, $$sroa$024$0$copyload = 0.0, $$sroa$031$0$copyload = 0.0, $$sroa$4$0$$sroa_idx26 = 0, $$sroa$4$0$copyload = 0.0, $$sroa$433$0$$sroa_idx34 = 0, $$sroa$433$0$copyload = 0.0, $$sroa$528$0$$sroa_idx29 = 0, $$sroa$528$0$copyload = 0.0, $$sroa$536$0$$sroa_idx37 = 0, $$sroa$536$0$copyload = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0;
+ var $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0.0, $21 = 0, $22 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $$sroa$031$0$copyload = +HEAPF32[$0>>2];
+ $$sroa$433$0$$sroa_idx34 = ((($0)) + 4|0);
+ $$sroa$433$0$copyload = +HEAPF32[$$sroa$433$0$$sroa_idx34>>2];
+ $$sroa$536$0$$sroa_idx37 = ((($0)) + 8|0);
+ $$sroa$536$0$copyload = +HEAPF32[$$sroa$536$0$$sroa_idx37>>2];
+ $$sroa$024$0$$sroa_idx = ((($0)) + 12|0);
+ $$sroa$024$0$copyload = +HEAPF32[$$sroa$024$0$$sroa_idx>>2];
+ $$sroa$4$0$$sroa_idx26 = ((($0)) + 16|0);
+ $$sroa$4$0$copyload = +HEAPF32[$$sroa$4$0$$sroa_idx26>>2];
+ $$sroa$528$0$$sroa_idx29 = ((($0)) + 20|0);
+ $$sroa$528$0$copyload = +HEAPF32[$$sroa$528$0$$sroa_idx29>>2];
+ $2 = $$sroa$024$0$copyload - $$sroa$031$0$copyload;
+ $3 = $$sroa$4$0$copyload - $$sroa$433$0$copyload;
+ $4 = $$sroa$528$0$copyload - $$sroa$536$0$copyload;
+ $5 = $2 * $2;
+ $6 = $3 * $3;
+ $7 = $5 + $6;
+ $8 = $4 * $4;
+ $9 = $7 + $8;
+ $10 = (+Math_sqrt((+$9)));
+ HEAPF32[5657] = $10;
+ $11 = $5 + $8;
+ $12 = (+Math_sqrt((+$11)));
+ $13 = (+Math_sqrt((+$7)));
+ $14 = (+Math_abs((+$2)));
+ $15 = $14 / $12;
+ $16 = (+Math_asin((+$15)));
+ HEAPF32[5658] = $16;
+ $17 = (+Math_abs((+$3)));
+ $18 = $17 / $13;
+ $19 = (+Math_asin((+$18)));
+ $20 = -$19;
+ HEAPF32[5659] = $20;
+ $21 = HEAP32[$$sroa$433$0$$sroa_idx34>>2]|0;
+ HEAP32[929] = $21;
+ $$off = (($1) + -3)|0;
+ $22 = ($$off>>>0)<(2);
+ if ($22) {
+ _DisableCursor();
+ HEAP32[5660] = $1;
+ return;
+ } else {
+ _EnableCursor();
+ HEAP32[5660] = $1;
+ return;
+ }
+}
+function _DisableCursor() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5661] = 1;
+ HEAP32[5662] = 1;
+ return;
+}
+function _EnableCursor() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5661] = 1;
+ HEAP32[5662] = 0;
+ return;
+}
+function _UpdateCamera($0) {
+ $0 = $0|0;
+ var $$ = 0, $$0 = 0, $$not = 0, $$not170 = 0, $$pr = 0, $$pr172 = 0, $$sink = 0.0, $$sink15 = 0, $$sink20 = 0.0, $$sink20$p = 0.0, $$sink24 = 0.0, $$sink26 = 0.0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0;
+ var $106 = 0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0;
+ var $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0;
+ var $142 = 0.0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0;
+ var $160 = 0.0, $161 = 0, $162 = 0, $163 = 0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0;
+ var $179 = 0.0, $18 = 0, $180 = 0.0, $181 = 0, $182 = 0, $183 = 0.0, $184 = 0.0, $185 = 0.0, $186 = 0.0, $187 = 0.0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0.0, $191 = 0.0, $192 = 0.0, $193 = 0.0, $194 = 0.0, $195 = 0.0, $196 = 0.0;
+ var $197 = 0, $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0.0, $202 = 0.0, $203 = 0, $204 = 0.0, $205 = 0.0, $206 = 0.0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0.0, $212 = 0, $213 = 0.0;
+ var $214 = 0.0, $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0, $230 = 0, $231 = 0.0;
+ var $232 = 0.0, $233 = 0.0, $234 = 0.0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0, $240 = 0.0, $241 = 0.0, $242 = 0.0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0, $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0;
+ var $250 = 0.0, $251 = 0, $252 = 0.0, $253 = 0.0, $254 = 0, $255 = 0.0, $256 = 0.0, $257 = 0.0, $258 = 0, $259 = 0.0, $26 = 0, $260 = 0.0, $261 = 0.0, $262 = 0.0, $263 = 0.0, $264 = 0.0, $265 = 0.0, $266 = 0.0, $267 = 0.0, $268 = 0.0;
+ var $269 = 0, $27 = 0, $270 = 0.0, $271 = 0.0, $272 = 0, $273 = 0, $274 = 0.0, $275 = 0.0, $276 = 0.0, $277 = 0.0, $278 = 0.0, $279 = 0.0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0.0, $285 = 0.0, $286 = 0.0;
+ var $287 = 0.0, $288 = 0, $289 = 0.0, $29 = 0.0, $290 = 0.0, $291 = 0.0, $292 = 0.0, $293 = 0.0, $294 = 0.0, $295 = 0.0, $296 = 0.0, $297 = 0, $298 = 0.0, $299 = 0.0, $3 = 0, $30 = 0.0, $300 = 0, $301 = 0.0, $302 = 0.0, $303 = 0.0;
+ var $304 = 0.0, $305 = 0, $306 = 0, $307 = 0.0, $308 = 0.0, $309 = 0.0, $31 = 0.0, $310 = 0.0, $311 = 0.0, $312 = 0, $313 = 0.0, $314 = 0.0, $315 = 0.0, $316 = 0.0, $317 = 0.0, $318 = 0, $319 = 0.0, $32 = 0, $320 = 0.0, $321 = 0.0;
+ var $322 = 0.0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0.0, $328 = 0, $329 = 0.0, $33 = 0.0, $330 = 0.0, $331 = 0.0, $332 = 0.0, $333 = 0.0, $334 = 0.0, $335 = 0.0, $336 = 0.0, $337 = 0, $338 = 0.0, $339 = 0.0, $34 = 0.0;
+ var $340 = 0, $341 = 0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0.0, $347 = 0.0, $348 = 0.0, $349 = 0, $35 = 0.0, $350 = 0.0, $351 = 0.0, $352 = 0, $353 = 0.0, $354 = 0.0, $355 = 0, $356 = 0.0, $357 = 0.0, $358 = 0.0;
+ var $359 = 0.0, $36 = 0, $360 = 0, $361 = 0.0, $362 = 0.0, $363 = 0.0, $364 = 0, $365 = 0.0, $366 = 0.0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0;
+ var $377 = 0, $378 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0;
+ var $54 = 0.0, $55 = 0, $56 = 0, $57 = 0.0, $58 = 0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0;
+ var $72 = 0.0, $73 = 0, $74 = 0.0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0;
+ var $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, $98 = 0, $99 = 0.0, $not$ = 0, $or$cond = 0, $or$cond11 = 0, $or$cond13 = 0, $or$cond169 = 0, $or$cond171 = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0;
+ var $storemerge = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $1 = sp;
+ $2 = sp + 8|0;
+ _GetMousePosition($1);
+ $3 = (_GetMouseWheelMove()|0);
+ $4 = HEAP32[930]|0;
+ $5 = (_IsMouseButtonDown($4)|0);
+ $6 = HEAP32[931]|0;
+ $7 = (_IsKeyDown($6)|0);
+ $8 = HEAP32[932]|0;
+ $9 = (_IsKeyDown($8)|0);
+ $10 = HEAP32[933]|0;
+ $11 = (_IsKeyDown($10)|0);
+ HEAP32[$2>>2] = $11;
+ $12 = ((($2)) + 4|0);
+ $13 = HEAP32[934]|0;
+ $14 = (_IsKeyDown($13)|0);
+ HEAP32[$12>>2] = $14;
+ $15 = ((($2)) + 8|0);
+ $16 = HEAP32[935]|0;
+ $17 = (_IsKeyDown($16)|0);
+ HEAP32[$15>>2] = $17;
+ $18 = ((($2)) + 12|0);
+ $19 = HEAP32[936]|0;
+ $20 = (_IsKeyDown($19)|0);
+ HEAP32[$18>>2] = $20;
+ $21 = ((($2)) + 16|0);
+ $22 = HEAP32[937]|0;
+ $23 = (_IsKeyDown($22)|0);
+ HEAP32[$21>>2] = $23;
+ $24 = ((($2)) + 20|0);
+ $25 = HEAP32[938]|0;
+ $26 = (_IsKeyDown($25)|0);
+ HEAP32[$24>>2] = $26;
+ $27 = HEAP32[5660]|0;
+ $28 = ($27|0)==(0);
+ L1: do {
+ if ($28) {
+ label = 47;
+ } else {
+ $29 = +HEAPF32[$1>>2];
+ $30 = +HEAPF32[4878];
+ $31 = $29 - $30;
+ $32 = ((($1)) + 4|0);
+ $33 = +HEAPF32[$32>>2];
+ $34 = +HEAPF32[(19516)>>2];
+ $35 = $33 - $34;
+ $36 = $1;
+ $37 = $36;
+ $38 = HEAP32[$37>>2]|0;
+ $39 = (($36) + 4)|0;
+ $40 = $39;
+ $41 = HEAP32[$40>>2]|0;
+ $42 = 19512;
+ $43 = $42;
+ HEAP32[$43>>2] = $38;
+ $44 = (($42) + 4)|0;
+ $45 = $44;
+ HEAP32[$45>>2] = $41;
+ $$pr = HEAP32[5660]|0;
+ switch ($$pr|0) {
+ case 1: {
+ $46 = +HEAPF32[5657];
+ $47 = $46 < 120.0;
+ $48 = ($3|0)<(0);
+ $or$cond = $48 & $47;
+ do {
+ if ($or$cond) {
+ $49 = (+($3|0));
+ $50 = $49 * 1.5;
+ $51 = $46 - $50;
+ HEAPF32[5657] = $51;
+ $52 = $51 > 120.0;
+ if ($52) {
+ HEAPF32[5657] = 120.0;
+ }
+ } else {
+ $53 = ((($0)) + 4|0);
+ $54 = +HEAPF32[$53>>2];
+ $55 = ((($0)) + 12|0);
+ $56 = ((($0)) + 16|0);
+ $57 = +HEAPF32[$56>>2];
+ $58 = $54 > $57;
+ $59 = $46 == 120.0;
+ $or$cond3 = $59 & $58;
+ $or$cond5 = $48 & $or$cond3;
+ if ($or$cond5) {
+ $60 = (+($3|0));
+ $61 = +HEAPF32[$55>>2];
+ $62 = +HEAPF32[$0>>2];
+ $63 = $61 - $62;
+ $64 = $60 * $63;
+ $65 = $64 * 1.5;
+ $66 = $65 / $46;
+ $67 = $61 + $66;
+ HEAPF32[$55>>2] = $67;
+ $68 = $57 - $54;
+ $69 = $60 * $68;
+ $70 = $69 * 1.5;
+ $71 = $70 / $46;
+ $72 = $57 + $71;
+ HEAPF32[$56>>2] = $72;
+ $73 = ((($0)) + 20|0);
+ $74 = +HEAPF32[$73>>2];
+ $75 = ((($0)) + 8|0);
+ $76 = +HEAPF32[$75>>2];
+ $77 = $74 - $76;
+ $78 = $60 * $77;
+ $79 = $78 * 1.5;
+ $80 = $79 / $46;
+ $81 = $74 + $80;
+ HEAPF32[$73>>2] = $81;
+ break;
+ }
+ $$not = $58 ^ 1;
+ $82 = !($57 >= 0.0);
+ $or$cond169 = $82 | $$not;
+ if (!($or$cond169)) {
+ $83 = (+($3|0));
+ $84 = +HEAPF32[$55>>2];
+ $85 = +HEAPF32[$0>>2];
+ $86 = $84 - $85;
+ $87 = $83 * $86;
+ $88 = $87 * 1.5;
+ $89 = $88 / $46;
+ $90 = $84 + $89;
+ HEAPF32[$55>>2] = $90;
+ $91 = $57 - $54;
+ $92 = $83 * $91;
+ $93 = $92 * 1.5;
+ $94 = $93 / $46;
+ $95 = $57 + $94;
+ HEAPF32[$56>>2] = $95;
+ $96 = ((($0)) + 20|0);
+ $97 = +HEAPF32[$96>>2];
+ $98 = ((($0)) + 8|0);
+ $99 = +HEAPF32[$98>>2];
+ $100 = $97 - $99;
+ $101 = $83 * $100;
+ $102 = $101 * 1.5;
+ $103 = $102 / $46;
+ $104 = $97 + $103;
+ HEAPF32[$96>>2] = $104;
+ break;
+ }
+ if ($58) {
+ $105 = $57 < 0.0;
+ $106 = ($3|0)>(0);
+ $or$cond7 = $106 & $105;
+ if ($or$cond7) {
+ $107 = (+($3|0));
+ $108 = $107 * 1.5;
+ $109 = $46 - $108;
+ HEAPF32[5657] = $109;
+ $110 = $109 < 0.30000001192092896;
+ if (!($110)) {
+ break;
+ }
+ HEAPF32[5657] = 0.30000001192092896;
+ break;
+ }
+ }
+ $111 = $54 < $57;
+ $or$cond9 = $59 & $111;
+ $or$cond11 = $48 & $or$cond9;
+ $112 = +HEAPF32[$56>>2];
+ $113 = +HEAPF32[$53>>2];
+ if ($or$cond11) {
+ $114 = (+($3|0));
+ $115 = +HEAPF32[$55>>2];
+ $116 = +HEAPF32[$0>>2];
+ $117 = $115 - $116;
+ $118 = $114 * $117;
+ $119 = $118 * 1.5;
+ $120 = $119 / $46;
+ $121 = $115 + $120;
+ HEAPF32[$55>>2] = $121;
+ $122 = $112 - $113;
+ $123 = $114 * $122;
+ $124 = $123 * 1.5;
+ $125 = +HEAPF32[5657];
+ $126 = $124 / $125;
+ $127 = $112 + $126;
+ HEAPF32[$56>>2] = $127;
+ $128 = ((($0)) + 20|0);
+ $129 = +HEAPF32[$128>>2];
+ $130 = ((($0)) + 8|0);
+ $131 = +HEAPF32[$130>>2];
+ $132 = $129 - $131;
+ $133 = $114 * $132;
+ $134 = $133 * 1.5;
+ $135 = $134 / $125;
+ $136 = $129 + $135;
+ HEAPF32[$128>>2] = $136;
+ break;
+ }
+ $$not170 = $111 ^ 1;
+ $137 = !($57 <= 0.0);
+ $or$cond171 = $137 | $$not170;
+ if (!($or$cond171)) {
+ $138 = (+($3|0));
+ $139 = +HEAPF32[$55>>2];
+ $140 = +HEAPF32[$0>>2];
+ $141 = $139 - $140;
+ $142 = $138 * $141;
+ $143 = $142 * 1.5;
+ $144 = $143 / $46;
+ $145 = $139 + $144;
+ HEAPF32[$55>>2] = $145;
+ $146 = $112 - $113;
+ $147 = $138 * $146;
+ $148 = $147 * 1.5;
+ $149 = +HEAPF32[5657];
+ $150 = $148 / $149;
+ $151 = $112 + $150;
+ HEAPF32[$56>>2] = $151;
+ $152 = ((($0)) + 20|0);
+ $153 = +HEAPF32[$152>>2];
+ $154 = ((($0)) + 8|0);
+ $155 = +HEAPF32[$154>>2];
+ $156 = $153 - $155;
+ $157 = $138 * $156;
+ $158 = $157 * 1.5;
+ $159 = $158 / $149;
+ $160 = $153 + $159;
+ HEAPF32[$152>>2] = $160;
+ break;
+ }
+ $161 = $113 < $112;
+ if ($161) {
+ $162 = $112 > 0.0;
+ $163 = ($3|0)>(0);
+ $or$cond13 = $163 & $162;
+ if ($or$cond13) {
+ $164 = (+($3|0));
+ $165 = $164 * 1.5;
+ $166 = +HEAPF32[5657];
+ $167 = $166 - $165;
+ HEAPF32[5657] = $167;
+ $168 = $167 < 0.30000001192092896;
+ if ($168) {
+ HEAPF32[5657] = 0.30000001192092896;
+ }
+ }
+ }
+ }
+ } while(0);
+ $169 = ($5|0)==(0);
+ if ($169) {
+ label = 47;
+ break L1;
+ }
+ $170 = ($7|0)==(0);
+ if ($170) {
+ $183 = $31 * -0.0099999997764825821;
+ $184 = +HEAPF32[5658];
+ $185 = (+Math_cos((+$184)));
+ $186 = $183 * $185;
+ $187 = $35 * 0.0099999997764825821;
+ $188 = (+Math_sin((+$184)));
+ $189 = $187 * $188;
+ $190 = +HEAPF32[5659];
+ $191 = (+Math_sin((+$190)));
+ $192 = $189 * $191;
+ $193 = $186 + $192;
+ $194 = +HEAPF32[5657];
+ $195 = $194 / 5.0999999046325684;
+ $196 = $193 * $195;
+ $197 = ((($0)) + 12|0);
+ $198 = +HEAPF32[$197>>2];
+ $199 = $198 + $196;
+ HEAPF32[$197>>2] = $199;
+ $200 = (+Math_cos((+$190)));
+ $201 = $187 * $200;
+ $202 = $195 * $201;
+ $203 = ((($0)) + 16|0);
+ $204 = +HEAPF32[$203>>2];
+ $205 = $204 + $202;
+ HEAPF32[$203>>2] = $205;
+ $206 = $31 * 0.0099999997764825821;
+ $207 = $206 * $188;
+ $208 = $187 * $185;
+ $209 = $208 * $191;
+ $210 = $207 + $209;
+ $211 = $210 * $195;
+ $212 = ((($0)) + 20|0);
+ $213 = +HEAPF32[$212>>2];
+ $214 = $211 + $213;
+ HEAPF32[$212>>2] = $214;
+ label = 47;
+ break L1;
+ }
+ $171 = ($9|0)==(0);
+ if (!($171)) {
+ $172 = $35 * 0.05000000074505806;
+ $173 = +HEAPF32[5657];
+ $174 = $172 + $173;
+ HEAPF32[5657] = $174;
+ label = 47;
+ break L1;
+ }
+ $175 = $31 * 0.0099999997764825821;
+ $176 = +HEAPF32[5658];
+ $177 = $176 - $175;
+ HEAPF32[5658] = $177;
+ $178 = $35 * 0.0099999997764825821;
+ $179 = +HEAPF32[5659];
+ $180 = $179 - $178;
+ HEAPF32[5659] = $180;
+ $181 = $180 > 1.483529806137085;
+ if ($181) {
+ HEAPF32[5659] = 1.483529806137085;
+ label = 47;
+ break L1;
+ }
+ $182 = $180 < -1.483529806137085;
+ if (!($182)) {
+ label = 47;
+ break L1;
+ }
+ HEAPF32[5659] = -1.483529806137085;
+ label = 47;
+ break L1;
+ break;
+ }
+ case 2: {
+ $215 = +HEAPF32[5658];
+ $216 = $215 + 0.0099999997764825821;
+ HEAPF32[5658] = $216;
+ $217 = (+($3|0));
+ $218 = $217 * 1.5;
+ $219 = +HEAPF32[5657];
+ $220 = $219 - $218;
+ HEAPF32[5657] = $220;
+ $221 = $220 < 1.2000000476837158;
+ if (!($221)) {
+ label = 47;
+ break L1;
+ }
+ HEAPF32[5657] = 1.2000000476837158;
+ label = 47;
+ break L1;
+ break;
+ }
+ case 4: case 3: {
+ $225 = +HEAPF32[5658];
+ $226 = (+Math_sin((+$225)));
+ $227 = HEAP32[$12>>2]|0;
+ $228 = (+($227>>>0));
+ $229 = $226 * $228;
+ $230 = HEAP32[$2>>2]|0;
+ $231 = (+($230>>>0));
+ $232 = $226 * $231;
+ $233 = $229 - $232;
+ $234 = (+Math_cos((+$225)));
+ $235 = HEAP32[$18>>2]|0;
+ $236 = (+($235>>>0));
+ $237 = $234 * $236;
+ $238 = $233 - $237;
+ $239 = HEAP32[$15>>2]|0;
+ $240 = (+($239>>>0));
+ $241 = $234 * $240;
+ $242 = $238 + $241;
+ $243 = $242 / 20.0;
+ $244 = +HEAPF32[$0>>2];
+ $245 = $244 + $243;
+ HEAPF32[$0>>2] = $245;
+ $246 = +HEAPF32[5659];
+ $247 = (+Math_sin((+$246)));
+ $248 = $231 * $247;
+ $249 = $228 * $247;
+ $250 = $248 - $249;
+ $251 = HEAP32[$21>>2]|0;
+ $252 = (+($251>>>0));
+ $253 = $250 + $252;
+ $254 = HEAP32[$24>>2]|0;
+ $255 = (+($254>>>0));
+ $256 = $253 - $255;
+ $257 = $256 / 20.0;
+ $258 = ((($0)) + 4|0);
+ $259 = +HEAPF32[$258>>2];
+ $260 = $259 + $257;
+ HEAPF32[$258>>2] = $260;
+ $261 = $228 * $234;
+ $262 = $234 * $231;
+ $263 = $261 - $262;
+ $264 = $226 * $236;
+ $265 = $263 + $264;
+ $266 = $226 * $240;
+ $267 = $265 - $266;
+ $268 = $267 / 20.0;
+ $269 = ((($0)) + 8|0);
+ $270 = +HEAPF32[$269>>2];
+ $271 = $268 + $270;
+ HEAPF32[$269>>2] = $271;
+ $272 = HEAP32[$2>>2]|0;
+ $273 = ($272|0)==(0);
+ if ($273) {
+ $222 = ((($2)) + 4|0);
+ $223 = HEAP32[$222>>2]|0;
+ $224 = ($223|0)==(0);
+ if ($224) {
+ $368 = ((($2)) + 8|0);
+ $369 = HEAP32[$368>>2]|0;
+ $370 = ($369|0)==(0);
+ if ($370) {
+ $371 = ((($2)) + 12|0);
+ $372 = HEAP32[$371>>2]|0;
+ $373 = ($372|0)==(0);
+ if ($373) {
+ $374 = ((($2)) + 16|0);
+ $375 = HEAP32[$374>>2]|0;
+ $376 = ($375|0)==(0);
+ if ($376) {
+ $377 = ((($2)) + 20|0);
+ $378 = HEAP32[$377>>2]|0;
+ $not$ = ($378|0)!=(0);
+ $$ = $not$&1;
+ $$0 = $$;
+ } else {
+ $$0 = 1;
+ }
+ } else {
+ $$0 = 1;
+ }
+ } else {
+ $$0 = 1;
+ }
+ } else {
+ $$0 = 1;
+ }
+ } else {
+ $$0 = 1;
+ }
+ $274 = $31 * 0.0030000000260770321;
+ $275 = +HEAPF32[5658];
+ $276 = $275 - $274;
+ HEAPF32[5658] = $276;
+ $277 = $35 * 0.0030000000260770321;
+ $278 = +HEAPF32[5659];
+ $279 = $278 - $277;
+ HEAPF32[5659] = $279;
+ $280 = HEAP32[5660]|0;
+ $281 = ($280|0)==(4);
+ if ($281) {
+ $282 = $279 > 0.087266460061073303;
+ if ($282) {
+ $$sink24 = 0.087266460061073303;
+ label = 38;
+ } else {
+ $283 = $279 < -1.483529806137085;
+ if ($283) {
+ $$sink24 = -1.483529806137085;
+ label = 38;
+ }
+ }
+ if ((label|0) == 38) {
+ HEAPF32[5659] = $$sink24;
+ }
+ $284 = (+($3|0));
+ $285 = $284 * 1.5;
+ $286 = +HEAPF32[5657];
+ $287 = $286 - $285;
+ $288 = $287 < 1.2000000476837158;
+ $storemerge = $288 ? 1.2000000476837158 : $287;
+ HEAPF32[5657] = $storemerge;
+ $289 = +HEAPF32[$0>>2];
+ $290 = +HEAPF32[5658];
+ $291 = (+Math_cos((+$290)));
+ $292 = $291 * 0.40000000596046448;
+ $293 = $289 + $292;
+ $294 = (+Math_sin((+$290)));
+ $295 = $294 * 0.0;
+ $296 = $293 + $295;
+ $297 = ((($0)) + 12|0);
+ HEAPF32[$297>>2] = $296;
+ $298 = +HEAPF32[$258>>2];
+ $299 = $298 + 0.0;
+ $300 = ((($0)) + 16|0);
+ HEAPF32[$300>>2] = $299;
+ $301 = +HEAPF32[$269>>2];
+ $302 = $295 + $301;
+ $303 = $294 * 0.40000000596046448;
+ $304 = $302 - $303;
+ $$sink = $304;$$sink15 = $297;
+ } else {
+ $305 = $279 > 1.483529806137085;
+ if ($305) {
+ $$sink26 = 1.483529806137085;
+ label = 42;
+ } else {
+ $306 = $279 < -1.483529806137085;
+ if ($306) {
+ $$sink26 = -1.483529806137085;
+ label = 42;
+ }
+ }
+ if ((label|0) == 42) {
+ HEAPF32[5659] = $$sink26;
+ }
+ $307 = +HEAPF32[$0>>2];
+ $308 = +HEAPF32[5658];
+ $309 = (+Math_sin((+$308)));
+ $310 = $309 * 25.0;
+ $311 = $307 - $310;
+ $312 = ((($0)) + 12|0);
+ HEAPF32[$312>>2] = $311;
+ $313 = +HEAPF32[$258>>2];
+ $314 = +HEAPF32[5659];
+ $315 = (+Math_sin((+$314)));
+ $316 = $315 * 25.0;
+ $317 = $313 + $316;
+ $318 = ((($0)) + 16|0);
+ HEAPF32[$318>>2] = $317;
+ $319 = +HEAPF32[$269>>2];
+ $320 = (+Math_cos((+$308)));
+ $321 = $320 * 25.0;
+ $322 = $319 - $321;
+ $323 = ((($0)) + 20|0);
+ HEAPF32[$323>>2] = $322;
+ $324 = ($$0|0)==(0);
+ if (!($324)) {
+ $325 = HEAP32[5663]|0;
+ $326 = (($325) + 1)|0;
+ HEAP32[5663] = $326;
+ }
+ $327 = +HEAPF32[929];
+ $328 = HEAP32[5663]|0;
+ $329 = (+($328|0));
+ $330 = $329 / 5.0;
+ $331 = (+Math_sin((+$330)));
+ $332 = $331 / 30.0;
+ $333 = $327 - $332;
+ HEAPF32[$258>>2] = $333;
+ $334 = $329 / 10.0;
+ $335 = (+Math_sin((+$334)));
+ $336 = $335 / 200.0;
+ $337 = ((($0)) + 24|0);
+ HEAPF32[$337>>2] = $336;
+ $338 = -$335;
+ $339 = $338 / 200.0;
+ $$sink = $339;$$sink15 = $337;
+ }
+ $340 = ((($$sink15)) + 8|0);
+ HEAPF32[$340>>2] = $$sink;
+ label = 47;
+ break L1;
+ break;
+ }
+ default: {
+ $341 = $$pr;
+ break L1;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 47) {
+ $$pr172 = HEAP32[5660]|0;
+ $341 = $$pr172;
+ }
+ switch ($341|0) {
+ case 1: case 2: case 4: {
+ break;
+ }
+ default: {
+ STACKTOP = sp;return;
+ }
+ }
+ $342 = +HEAPF32[5658];
+ $343 = (+Math_sin((+$342)));
+ $344 = +HEAPF32[5657];
+ $345 = $343 * $344;
+ $346 = +HEAPF32[5659];
+ $347 = (+Math_cos((+$346)));
+ $348 = $345 * $347;
+ $349 = ((($0)) + 12|0);
+ $350 = +HEAPF32[$349>>2];
+ $351 = $348 + $350;
+ HEAPF32[$0>>2] = $351;
+ $352 = !($346 <= 0.0);
+ $353 = (+Math_sin((+$346)));
+ $354 = +HEAPF32[5657];
+ $355 = ((($0)) + 16|0);
+ $356 = +HEAPF32[$355>>2];
+ $357 = $353 * $354;
+ $358 = $353 * $357;
+ $359 = -$358;
+ $$sink20$p = $352 ? $359 : $358;
+ $$sink20 = $356 + $$sink20$p;
+ $360 = ((($0)) + 4|0);
+ HEAPF32[$360>>2] = $$sink20;
+ $361 = (+Math_cos((+$342)));
+ $362 = $354 * $361;
+ $363 = $347 * $362;
+ $364 = ((($0)) + 20|0);
+ $365 = +HEAPF32[$364>>2];
+ $366 = $365 + $363;
+ $367 = ((($0)) + 8|0);
+ HEAPF32[$367>>2] = $366;
+ STACKTOP = sp;return;
+}
+function _GetMousePosition($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = 19520;
+ $2 = $1;
+ $3 = HEAP32[$2>>2]|0;
+ $4 = (($1) + 4)|0;
+ $5 = $4;
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $0;
+ $8 = $7;
+ HEAP32[$8>>2] = $3;
+ $9 = (($7) + 4)|0;
+ $10 = $9;
+ HEAP32[$10>>2] = $6;
+ return;
+}
+function _GetMouseWheelMove() {
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5665]|0;
+ $1 = (($0|0) / 100)&-1;
+ return ($1|0);
+}
+function _IsMouseButtonDown($0) {
+ $0 = $0|0;
+ var $$ = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_GetMouseButtonStatus($0)|0);
+ $2 = ($1|0)==(1);
+ $$ = $2&1;
+ return ($$|0);
+}
+function _IsKeyDown($0) {
+ $0 = $0|0;
+ var $$ = 0, $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_GetKeyStatus($0)|0);
+ $2 = ($1|0)==(1);
+ $$ = $2&1;
+ return ($$|0);
+}
+function _GetKeyStatus($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[5664]|0;
+ $2 = (_glfwGetKey(($1|0),($0|0))|0);
+ return ($2|0);
+}
+function _GetMouseButtonStatus($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[5664]|0;
+ $2 = (_glfwGetMouseButton(($1|0),($0|0))|0);
+ return ($2|0);
+}
+function _InitWindow($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ _TraceLog(0,9341,$vararg_buffer);
+ HEAP32[5666] = $2;
+ _InitGraphicsDevice($0,$1);
+ _LoadDefaultFont();
+ _InitTimer();
+ (_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(5|0))|0);
+ (_emscripten_set_keypress_callback((9370|0),(0|0),1,(6|0))|0);
+ (_emscripten_set_click_callback((9370|0),(0|0),1,(7|0))|0);
+ (_emscripten_set_touchstart_callback((9370|0),(0|0),1,(8|0))|0);
+ (_emscripten_set_touchend_callback((9370|0),(0|0),1,(8|0))|0);
+ (_emscripten_set_touchmove_callback((9370|0),(0|0),1,(8|0))|0);
+ (_emscripten_set_touchcancel_callback((9370|0),(0|0),1,(8|0))|0);
+ (_emscripten_set_gamepadconnected_callback((0|0),1,(9|0))|0);
+ (_emscripten_set_gamepaddisconnected_callback((0|0),1,(9|0))|0);
+ $3 = HEAP32[5667]|0;
+ $4 = (+($3|0));
+ $5 = $4 * 0.5;
+ HEAPF32[4880] = $5;
+ $6 = HEAP32[5668]|0;
+ $7 = (+($6|0));
+ $8 = $7 * 0.5;
+ HEAPF32[(19524)>>2] = $8;
+ $9 = HEAP32[5669]|0;
+ $10 = ($9|0)==(0);
+ if ($10) {
+ STACKTOP = sp;return;
+ }
+ _SetTargetFPS(60);
+ _LogoAnimation();
+ STACKTOP = sp;return;
+}
+function _InitGraphicsDevice($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$015 = 0, $$byval_copy = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0, $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0;
+ var label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
+ $$byval_copy = sp + 136|0;
+ $vararg_buffer22 = sp + 64|0;
+ $vararg_buffer18 = sp + 56|0;
+ $vararg_buffer14 = sp + 48|0;
+ $vararg_buffer10 = sp + 40|0;
+ $vararg_buffer8 = sp + 32|0;
+ $vararg_buffer6 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 72|0;
+ $3 = sp + 140|0;
+ HEAP32[5667] = $0;
+ HEAP32[5668] = $1;
+ _MatrixIdentity($2);
+ dest=22696; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_glfwSetErrorCallback((2|0))|0);
+ $4 = (_glfwInit()|0);
+ $5 = ($4|0)==(0);
+ if ($5) {
+ _TraceLog(2,9565,$vararg_buffer);
+ }
+ $6 = HEAP32[5667]|0;
+ HEAP32[5690] = $6;
+ $7 = HEAP32[5668]|0;
+ HEAP32[5691] = $7;
+ _glfwDefaultWindowHints();
+ $8 = HEAP8[23576]|0;
+ $9 = $8 & 4;
+ $10 = ($9<<24>>24)==(0);
+ if ($10) {
+ _glfwWindowHint(131075,0);
+ } else {
+ _glfwWindowHint(131075,1);
+ }
+ $11 = HEAP8[23576]|0;
+ $12 = $11 & 8;
+ $13 = ($12<<24>>24)==(0);
+ if (!($13)) {
+ _glfwWindowHint(131077,1);
+ }
+ $14 = HEAP8[23576]|0;
+ $15 = $14 & 32;
+ $16 = ($15<<24>>24)==(0);
+ if (!($16)) {
+ _glfwWindowHint(135181,4);
+ _TraceLog(0,9591,$vararg_buffer1);
+ }
+ $17 = (_rlGetVersion()|0);
+ $18 = ($17|0)==(2);
+ if ($18) {
+ _glfwWindowHint(139266,2);
+ _glfwWindowHint(139267,1);
+ } else {
+ $19 = (_rlGetVersion()|0);
+ $20 = ($19|0)==(3);
+ if ($20) {
+ _glfwWindowHint(139266,3);
+ _glfwWindowHint(139267,3);
+ _glfwWindowHint(139272,204801);
+ _glfwWindowHint(139270,0);
+ }
+ }
+ $21 = HEAP32[5692]|0;
+ $22 = ($21|0)==(0);
+ if ($22) {
+ $47 = HEAP32[5667]|0;
+ $48 = HEAP32[5668]|0;
+ $49 = HEAP32[5666]|0;
+ $50 = (_glfwCreateWindow(($47|0),($48|0),($49|0),(0|0),(0|0))|0);
+ HEAP32[5664] = $50;
+ $51 = HEAP32[5667]|0;
+ HEAP32[5693] = $51;
+ $52 = HEAP32[5668]|0;
+ HEAP32[5694] = $52;
+ $54 = $50;
+ } else {
+ $23 = (_glfwGetPrimaryMonitor()|0);
+ $24 = (_glfwGetVideoModes(($23|0),($$byval_copy|0))|0);
+ $25 = HEAP32[$$byval_copy>>2]|0;
+ $26 = ($25|0)>(0);
+ L22: do {
+ if ($26) {
+ $27 = HEAP32[5667]|0;
+ $28 = HEAP32[$$byval_copy>>2]|0;
+ $29 = HEAP32[5668]|0;
+ $$015 = 0;
+ while(1) {
+ $30 = (($24) + (($$015*24)|0)|0);
+ $31 = HEAP32[$30>>2]|0;
+ $32 = ($31|0)<($27|0);
+ if (!($32)) {
+ $33 = (((($24) + (($$015*24)|0)|0)) + 4|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = ($34|0)<($29|0);
+ if (!($35)) {
+ break;
+ }
+ }
+ $36 = (($$015) + 1)|0;
+ $37 = ($36|0)<($28|0);
+ if ($37) {
+ $$015 = $36;
+ } else {
+ break L22;
+ }
+ }
+ HEAP32[5690] = $31;
+ HEAP32[5691] = $34;
+ }
+ } while(0);
+ $38 = HEAP32[5690]|0;
+ $39 = HEAP32[5691]|0;
+ HEAP32[$vararg_buffer3>>2] = $38;
+ $vararg_ptr5 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr5>>2] = $39;
+ _TraceLog(1,9616,$vararg_buffer3);
+ $40 = HEAP32[5690]|0;
+ $41 = HEAP32[5691]|0;
+ _SetupFramebufferSize($40,$41);
+ $42 = HEAP32[5690]|0;
+ $43 = HEAP32[5691]|0;
+ $44 = HEAP32[5666]|0;
+ $45 = (_glfwGetPrimaryMonitor()|0);
+ $46 = (_glfwCreateWindow(($42|0),($43|0),($44|0),($45|0),(0|0))|0);
+ HEAP32[5664] = $46;
+ $54 = $46;
+ }
+ $53 = ($54|0)==(0|0);
+ if ($53) {
+ _glfwTerminate();
+ _TraceLog(2,9654,$vararg_buffer6);
+ } else {
+ _TraceLog(0,9687,$vararg_buffer8);
+ $55 = HEAP32[5693]|0;
+ $56 = HEAP32[5694]|0;
+ HEAP32[$vararg_buffer10>>2] = $55;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $56;
+ _TraceLog(0,9727,$vararg_buffer10);
+ $57 = HEAP32[5667]|0;
+ $58 = HEAP32[5668]|0;
+ HEAP32[$vararg_buffer14>>2] = $57;
+ $vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
+ HEAP32[$vararg_ptr17>>2] = $58;
+ _TraceLog(0,9748,$vararg_buffer14);
+ $59 = HEAP32[5695]|0;
+ $60 = HEAP32[5696]|0;
+ HEAP32[$vararg_buffer18>>2] = $59;
+ $vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
+ HEAP32[$vararg_ptr21>>2] = $60;
+ _TraceLog(0,9769,$vararg_buffer18);
+ }
+ $61 = HEAP32[5664]|0;
+ (_glfwSetWindowSizeCallback(($61|0),(1|0))|0);
+ $62 = HEAP32[5664]|0;
+ (_glfwSetCursorEnterCallback(($62|0),(3|0))|0);
+ $63 = HEAP32[5664]|0;
+ (_glfwSetKeyCallback(($63|0),(1|0))|0);
+ $64 = HEAP32[5664]|0;
+ (_glfwSetMouseButtonCallback(($64|0),(1|0))|0);
+ $65 = HEAP32[5664]|0;
+ (_glfwSetCursorPosCallback(($65|0),(1|0))|0);
+ $66 = HEAP32[5664]|0;
+ (_glfwSetCharCallback(($66|0),(4|0))|0);
+ $67 = HEAP32[5664]|0;
+ (_glfwSetScrollCallback(($67|0),(2|0))|0);
+ $68 = HEAP32[5664]|0;
+ (_glfwSetWindowIconifyCallback(($68|0),(5|0))|0);
+ $69 = HEAP32[5664]|0;
+ _glfwMakeContextCurrent(($69|0));
+ _glfwSwapInterval(0);
+ $70 = HEAP8[23576]|0;
+ $71 = $70 & 64;
+ $72 = ($71<<24>>24)==(0);
+ if ($72) {
+ $73 = HEAP32[5667]|0;
+ $74 = HEAP32[5668]|0;
+ _rlglInit($73,$74);
+ _SetupViewport();
+ _rlMatrixMode(5889);
+ _rlLoadIdentity();
+ $75 = HEAP32[5693]|0;
+ $76 = HEAP32[5695]|0;
+ $77 = (($75) - ($76))|0;
+ $78 = (+($77|0));
+ $79 = HEAP32[5694]|0;
+ $80 = HEAP32[5696]|0;
+ $81 = (($79) - ($80))|0;
+ $82 = (+($81|0));
+ _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ HEAP8[$3>>0] = -11;
+ $83 = ((($3)) + 1|0);
+ HEAP8[$83>>0] = -11;
+ $84 = ((($3)) + 2|0);
+ HEAP8[$84>>0] = -11;
+ $85 = ((($3)) + 3|0);
+ HEAP8[$85>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
+ _ClearBackground($$byval_copy);
+ STACKTOP = sp;return;
+ }
+ _glfwSwapInterval(1);
+ _TraceLog(0,9794,$vararg_buffer22);
+ $73 = HEAP32[5667]|0;
+ $74 = HEAP32[5668]|0;
+ _rlglInit($73,$74);
+ _SetupViewport();
+ _rlMatrixMode(5889);
+ _rlLoadIdentity();
+ $75 = HEAP32[5693]|0;
+ $76 = HEAP32[5695]|0;
+ $77 = (($75) - ($76))|0;
+ $78 = (+($77|0));
+ $79 = HEAP32[5694]|0;
+ $80 = HEAP32[5696]|0;
+ $81 = (($79) - ($80))|0;
+ $82 = (+($81|0));
+ _rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ HEAP8[$3>>0] = -11;
+ $83 = ((($3)) + 1|0);
+ HEAP8[$83>>0] = -11;
+ $84 = ((($3)) + 2|0);
+ HEAP8[$84>>0] = -11;
+ $85 = ((($3)) + 3|0);
+ HEAP8[$85>>0] = -1;
+ ;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
+ _ClearBackground($$byval_copy);
+ STACKTOP = sp;return;
+}
+function _InitTimer() {
+ var $0 = 0, $1 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_time((0|0))|0);
+ _srand($0);
+ $1 = (+_GetTime());
+ HEAPF64[2444] = $1;
+ return;
+}
+function _EmscriptenFullscreenChangeCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer = sp;
+ $3 = HEAP32[$1>>2]|0;
+ $4 = ($3|0)==(0);
+ $5 = ((($1)) + 264|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($1)) + 268|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($1)) + 272|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($1)) + 276|0);
+ $12 = HEAP32[$11>>2]|0;
+ if ($4) {
+ HEAP32[$vararg_buffer4>>2] = $6;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = $8;
+ $vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
+ HEAP32[$vararg_ptr8>>2] = $10;
+ $vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
+ HEAP32[$vararg_ptr9>>2] = $12;
+ _TraceLog(0,9498,$vararg_buffer4);
+ STACKTOP = sp;return 0;
+ } else {
+ HEAP32[$vararg_buffer>>2] = $6;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $8;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $10;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $12;
+ _TraceLog(0,9429,$vararg_buffer);
+ STACKTOP = sp;return 0;
+ }
+ return (0)|0;
+}
+function _EmscriptenKeyboardCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($0|0)==(1);
+ if (!($3)) {
+ return 0;
+ }
+ $4 = ((($1)) + 32|0);
+ $5 = (_strcmp($4,9422)|0);
+ $6 = ($5|0)==(0);
+ if (!($6)) {
+ return 0;
+ }
+ (_emscripten_exit_pointerlock()|0);
+ return 0;
+}
+function _EmscriptenMouseCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(272|0);
+ $3 = sp;
+ $4 = ($0|0)==(4);
+ $5 = HEAP32[5661]|0;
+ $6 = ($5|0)!=(0);
+ $or$cond = $4 & $6;
+ if (!($or$cond)) {
+ STACKTOP = sp;return 0;
+ }
+ (_emscripten_get_pointerlock_status(($3|0))|0);
+ $7 = HEAP32[$3>>2]|0;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ (_emscripten_request_pointerlock((0|0),1)|0);
+ } else {
+ (_emscripten_exit_pointerlock()|0);
+ (_emscripten_get_pointerlock_status(($3|0))|0);
+ }
+ HEAP32[5661] = 0;
+ STACKTOP = sp;return 0;
+}
+function _EmscriptenTouchCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$byval_copy = 0, $$sink = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$03$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx2 = 0, $$sroa$24$0$$sroa_idx5 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0;
+ var $60 = 0.0, $61 = 0.0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
+ $$byval_copy = sp + 56|0;
+ $3 = sp;
+ switch ($0|0) {
+ case 22: {
+ $$sink = 1;
+ label = 4;
+ break;
+ }
+ case 23: {
+ $$sink = 0;
+ label = 4;
+ break;
+ }
+ case 24: {
+ $$sink = 2;
+ label = 4;
+ break;
+ }
+ default: {
+ }
+ }
+ if ((label|0) == 4) {
+ HEAP32[$3>>2] = $$sink;
+ }
+ $4 = HEAP32[$1>>2]|0;
+ $5 = ((($3)) + 4|0);
+ HEAP32[$5>>2] = $4;
+ $6 = ((($1)) + 20|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($3)) + 8|0);
+ HEAP32[$8>>2] = $7;
+ $9 = ((($1)) + 72|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ((($3)) + 12|0);
+ HEAP32[$11>>2] = $10;
+ $12 = ((($1)) + 56|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = (+($13|0));
+ $15 = ((($1)) + 60|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = (+($16|0));
+ $$sroa$03$0$$sroa_idx = ((($3)) + 24|0);
+ HEAPF32[$$sroa$03$0$$sroa_idx>>2] = $14;
+ $$sroa$24$0$$sroa_idx5 = ((($3)) + 28|0);
+ HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $17;
+ $18 = ((($1)) + 108|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = (+($19|0));
+ $21 = ((($1)) + 112|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (+($22|0));
+ $$sroa$0$0$$sroa_idx = ((($3)) + 32|0);
+ HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $20;
+ $$sroa$2$0$$sroa_idx2 = ((($3)) + 36|0);
+ HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $23;
+ $24 = ((($3)) + 24|0);
+ $25 = $24;
+ $26 = $25;
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (($25) + 4)|0;
+ $29 = $28;
+ $30 = HEAP32[$29>>2]|0;
+ $31 = 19536;
+ $32 = $31;
+ HEAP32[$32>>2] = $27;
+ $33 = (($31) + 4)|0;
+ $34 = $33;
+ HEAP32[$34>>2] = $30;
+ $35 = ((($3)) + 32|0);
+ $36 = $35;
+ $37 = $36;
+ $38 = HEAP32[$37>>2]|0;
+ $39 = (($36) + 4)|0;
+ $40 = $39;
+ $41 = HEAP32[$40>>2]|0;
+ $42 = (19544);
+ $43 = $42;
+ HEAP32[$43>>2] = $38;
+ $44 = (($42) + 4)|0;
+ $45 = $44;
+ HEAP32[$45>>2] = $41;
+ $46 = (_GetScreenWidth()|0);
+ $47 = (+($46|0));
+ $48 = +HEAPF32[$24>>2];
+ $49 = $48 / $47;
+ HEAPF32[$24>>2] = $49;
+ $50 = (_GetScreenHeight()|0);
+ $51 = (+($50|0));
+ $52 = +HEAPF32[$$sroa$24$0$$sroa_idx5>>2];
+ $53 = $52 / $51;
+ HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $53;
+ $54 = (_GetScreenWidth()|0);
+ $55 = (+($54|0));
+ $56 = +HEAPF32[$35>>2];
+ $57 = $56 / $55;
+ HEAPF32[$35>>2] = $57;
+ $58 = (_GetScreenHeight()|0);
+ $59 = (+($58|0));
+ $60 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
+ $61 = $60 / $59;
+ HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $61;
+ dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _ProcessGestureEvent($$byval_copy);
+ STACKTOP = sp;return 1;
+}
+function _EmscriptenGamepadCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$sink = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($1)) + 1296|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0);
+ if ($5) {
+ label = 3;
+ } else {
+ $6 = ((($1)) + 1300|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)<(4);
+ if ($8) {
+ $$sink = 1;
+ } else {
+ label = 3;
+ }
+ }
+ if ((label|0) == 3) {
+ $$sink = 0;
+ }
+ $9 = ((($1)) + 1300|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (22680 + ($10<<2)|0);
+ HEAP32[$11>>2] = $$sink;
+ return 0;
+}
+function _SetTargetFPS($0) {
+ $0 = $0|0;
+ var $$ = 0.0, $$op = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = ($0|0)<(1);
+ $2 = (+($0|0));
+ $3 = 1.0 / $2;
+ $$ = $1 ? 0.0 : $3;
+ HEAPF64[2441] = $$;
+ $4 = $3;
+ $$op = $4 * 1000.0;
+ $5 = $$op;
+ $6 = $1 ? 0.0 : $5;
+ HEAPF64[$vararg_buffer>>3] = $6;
+ _TraceLog(0,9378,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _LogoAnimation() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[5669] = 0;
+ return;
+}
+function _GetScreenWidth() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5667]|0;
+ return ($0|0);
+}
+function _GetScreenHeight() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5668]|0;
+ return ($0|0);
+}
+function _GetTime() {
+ var $0 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (+_glfwGetTime());
+ return (+$0);
+}
+function _ErrorCallback($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ HEAP32[$vararg_buffer>>2] = $0;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $1;
+ _TraceLog(1,13403,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _SetupFramebufferSize($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$sink = 0, $$sink1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0;
+ var $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0;
+ var $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $or$cond = 0, $roundf = 0.0, $roundf38 = 0.0, $roundf39 = 0.0, $roundf40 = 0.0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0;
+ var $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
+ $vararg_buffer8 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer = sp;
+ $2 = sp + 40|0;
+ $3 = HEAP32[5667]|0;
+ $4 = ($3|0)>($0|0);
+ if (!($4)) {
+ $5 = HEAP32[5668]|0;
+ $6 = ($5|0)>($1|0);
+ if (!($6)) {
+ $30 = ($3|0)<($0|0);
+ $31 = ($5|0)<($1|0);
+ $or$cond = $30 | $31;
+ if (!($or$cond)) {
+ HEAP32[5693] = $3;
+ HEAP32[5694] = $5;
+ HEAP32[5695] = 0;
+ HEAP32[5696] = 0;
+ STACKTOP = sp;return;
+ }
+ HEAP32[$vararg_buffer8>>2] = $3;
+ $vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
+ HEAP32[$vararg_ptr11>>2] = $5;
+ $vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
+ HEAP32[$vararg_ptr12>>2] = $0;
+ $vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
+ HEAP32[$vararg_ptr13>>2] = $1;
+ _TraceLog(0,13337,$vararg_buffer8);
+ $32 = (+($0|0));
+ $33 = (+($1|0));
+ $34 = $32 / $33;
+ $35 = HEAP32[5667]|0;
+ $36 = (+($35|0));
+ $37 = HEAP32[5668]|0;
+ $38 = (+($37|0));
+ $39 = $36 / $38;
+ $40 = !($34 <= $39);
+ if ($40) {
+ $44 = $34 * $38;
+ $roundf = (+_roundf((+$44)));
+ $45 = (~~(($roundf)));
+ HEAP32[5693] = $45;
+ HEAP32[5694] = $37;
+ $46 = (($45) - ($35))|0;
+ HEAP32[5695] = $46;
+ $$sink1 = 0;
+ } else {
+ HEAP32[5693] = $35;
+ $41 = $36 / $34;
+ $roundf38 = (+_roundf((+$41)));
+ $42 = (~~(($roundf38)));
+ HEAP32[5694] = $42;
+ HEAP32[5695] = 0;
+ $43 = (($42) - ($37))|0;
+ $$sink1 = $43;
+ }
+ HEAP32[5696] = $$sink1;
+ STACKTOP = sp;return;
+ }
+ }
+ $7 = HEAP32[5668]|0;
+ HEAP32[$vararg_buffer>>2] = $3;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $7;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $0;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $1;
+ _TraceLog(1,13194,$vararg_buffer);
+ $8 = (+($0|0));
+ $9 = HEAP32[5667]|0;
+ $10 = (+($9|0));
+ $11 = $8 / $10;
+ $12 = (+($1|0));
+ $13 = HEAP32[5668]|0;
+ $14 = (+($13|0));
+ $15 = $12 / $14;
+ $16 = !($11 <= $15);
+ if ($16) {
+ $22 = $10 * $15;
+ $roundf39 = (+_roundf((+$22)));
+ $23 = (~~(($roundf39)));
+ HEAP32[5693] = $23;
+ HEAP32[5694] = $1;
+ $24 = (($0) - ($23))|0;
+ HEAP32[5695] = $24;
+ $$sink = 0;
+ } else {
+ HEAP32[5693] = $0;
+ $17 = HEAP32[5668]|0;
+ $18 = (+($17|0));
+ $19 = $11 * $18;
+ $roundf40 = (+_roundf((+$19)));
+ $20 = (~~(($roundf40)));
+ HEAP32[5694] = $20;
+ HEAP32[5695] = 0;
+ $21 = (($1) - ($20))|0;
+ $$sink = $21;
+ }
+ HEAP32[5696] = $$sink;
+ $25 = HEAP32[5693]|0;
+ $26 = (+($25|0));
+ $27 = HEAP32[5667]|0;
+ $28 = (+($27|0));
+ $29 = $26 / $28;
+ _MatrixScale($2,$29,$29,$29);
+ dest=22696; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[5693] = $0;
+ HEAP32[5694] = $1;
+ HEAP32[$vararg_buffer4>>2] = $0;
+ $vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
+ HEAP32[$vararg_ptr7>>2] = $1;
+ _TraceLog(1,13272,$vararg_buffer4);
+ STACKTOP = sp;return;
+}
+function _WindowSizeCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlViewport(0,0,$1,$2);
+ _rlMatrixMode(5889);
+ _rlLoadIdentity();
+ $3 = (+($1|0));
+ $4 = (+($2|0));
+ _rlOrtho(0.0,$3,$4,0.0,0.0,1.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ _rlClearScreenBuffers();
+ HEAP32[5667] = $1;
+ HEAP32[5668] = $2;
+ HEAP32[5693] = $1;
+ HEAP32[5694] = $2;
+ return;
+}
+function _CursorEnterCallback($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _KeyCallback($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = HEAP32[940]|0;
+ $6 = ($5|0)==($1|0);
+ $7 = ($3|0)==(1);
+ $or$cond = $7 & $6;
+ if ($or$cond) {
+ _glfwSetWindowShouldClose(($0|0),1);
+ return;
+ }
+ $8 = $3&255;
+ $9 = (23583 + ($1)|0);
+ HEAP8[$9>>0] = $8;
+ if (!($7)) {
+ return;
+ }
+ HEAP32[939] = $1;
+ return;
+}
+function _MouseButtonCallback($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0;
+ var $28 = 0.0, $29 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
+ $$byval_copy = sp + 64|0;
+ $4 = sp + 8|0;
+ $5 = sp;
+ $6 = $2&255;
+ $7 = (23577 + ($1)|0);
+ HEAP8[$7>>0] = $6;
+ $8 = (_IsMouseButtonPressed(0)|0);
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $10 = (_IsMouseButtonReleased(0)|0);
+ $11 = ($10|0)==(0);
+ if (!($11)) {
+ $$sink = 0;
+ label = 3;
+ }
+ } else {
+ $$sink = 1;
+ label = 3;
+ }
+ if ((label|0) == 3) {
+ HEAP32[$4>>2] = $$sink;
+ }
+ $12 = ((($4)) + 8|0);
+ HEAP32[$12>>2] = 0;
+ $13 = ((($4)) + 4|0);
+ HEAP32[$13>>2] = 1;
+ $14 = ((($4)) + 24|0);
+ _GetMousePosition($5);
+ $15 = $5;
+ $16 = $15;
+ $17 = HEAP32[$16>>2]|0;
+ $18 = (($15) + 4)|0;
+ $19 = $18;
+ $20 = HEAP32[$19>>2]|0;
+ $21 = $14;
+ $22 = $21;
+ HEAP32[$22>>2] = $17;
+ $23 = (($21) + 4)|0;
+ $24 = $23;
+ HEAP32[$24>>2] = $20;
+ $25 = (_GetScreenWidth()|0);
+ $26 = (+($25|0));
+ $27 = +HEAPF32[$14>>2];
+ $28 = $27 / $26;
+ HEAPF32[$14>>2] = $28;
+ $29 = (_GetScreenHeight()|0);
+ $30 = (+($29|0));
+ $31 = ((($4)) + 28|0);
+ $32 = +HEAPF32[$31>>2];
+ $33 = $32 / $30;
+ HEAPF32[$31>>2] = $33;
+ dest=$$byval_copy; src=$4; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _ProcessGestureEvent($$byval_copy);
+ STACKTOP = sp;return;
+}
+function _MouseCursorPosCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ var $$byval_copy = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
+ $$byval_copy = sp + 56|0;
+ $3 = sp;
+ HEAP32[$3>>2] = 2;
+ $4 = ((($3)) + 8|0);
+ HEAP32[$4>>2] = 0;
+ $5 = ((($3)) + 4|0);
+ HEAP32[$5>>2] = 1;
+ $6 = $1;
+ $7 = $2;
+ $$sroa$0$0$$sroa_idx = ((($3)) + 24|0);
+ HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $6;
+ $$sroa$2$0$$sroa_idx1 = ((($3)) + 28|0);
+ HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $7;
+ $8 = ((($3)) + 24|0);
+ $9 = $8;
+ $10 = $9;
+ $11 = HEAP32[$10>>2]|0;
+ $12 = (($9) + 4)|0;
+ $13 = $12;
+ $14 = HEAP32[$13>>2]|0;
+ $15 = 19536;
+ $16 = $15;
+ HEAP32[$16>>2] = $11;
+ $17 = (($15) + 4)|0;
+ $18 = $17;
+ HEAP32[$18>>2] = $14;
+ $19 = (_GetScreenWidth()|0);
+ $20 = (+($19|0));
+ $21 = +HEAPF32[$8>>2];
+ $22 = $21 / $20;
+ HEAPF32[$8>>2] = $22;
+ $23 = (_GetScreenHeight()|0);
+ $24 = (+($23|0));
+ $25 = +HEAPF32[$$sroa$2$0$$sroa_idx1>>2];
+ $26 = $25 / $24;
+ HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $26;
+ dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _ProcessGestureEvent($$byval_copy);
+ STACKTOP = sp;return;
+}
+function _CharCallback($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP32[939] = $1;
+ return;
+}
+function _ScrollCallback($0,$1,$2) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = +$2;
+ var $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (~~(($2)));
+ HEAP32[5699] = $3;
+ return;
+}
+function _WindowIconifyCallback($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$sink = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)!=(0);
+ $$sink = $2&1;
+ HEAP32[5698] = $$sink;
+ return;
+}
+function _rlglInit($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$06066 = 0, $$06167 = 0, $$06268 = 0, $$063 = 0, $$sink64 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $9 = 0, $exitcond = 0, $exitcond70 = 0, $exitcond71 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0;
+ var $vararg_buffer19 = 0, $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer39 = 0, $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 2464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2464|0);
+ $vararg_buffer41 = sp + 2184|0;
+ $vararg_buffer39 = sp + 2176|0;
+ $vararg_buffer36 = sp + 2168|0;
+ $vararg_buffer34 = sp + 2160|0;
+ $vararg_buffer31 = sp + 2152|0;
+ $vararg_buffer29 = sp + 2144|0;
+ $vararg_buffer27 = sp + 2136|0;
+ $vararg_buffer25 = sp + 2128|0;
+ $vararg_buffer23 = sp + 2120|0;
+ $vararg_buffer21 = sp + 2112|0;
+ $vararg_buffer19 = sp + 2104|0;
+ $vararg_buffer17 = sp + 2096|0;
+ $vararg_buffer15 = sp + 2088|0;
+ $vararg_buffer13 = sp + 2080|0;
+ $vararg_buffer10 = sp + 2072|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 2400|0;
+ $3 = sp + 2384|0;
+ $4 = sp + 2320|0;
+ $5 = sp + 2256|0;
+ $6 = sp + 2192|0;
+ $7 = (_glGetString(7936)|0);
+ HEAP32[$vararg_buffer>>2] = $7;
+ _TraceLog(0,9817,$vararg_buffer);
+ $8 = (_glGetString(7937)|0);
+ HEAP32[$vararg_buffer1>>2] = $8;
+ _TraceLog(0,9835,$vararg_buffer1);
+ $9 = (_glGetString(7938)|0);
+ HEAP32[$vararg_buffer4>>2] = $9;
+ _TraceLog(0,9853,$vararg_buffer4);
+ $10 = (_glGetString(35724)|0);
+ HEAP32[$vararg_buffer7>>2] = $10;
+ _TraceLog(0,9871,$vararg_buffer7);
+ $11 = (_glGetString(7939)|0);
+ $12 = (_strlen($11)|0);
+ $13 = (($12) + 1)|0;
+ $14 = (_malloc($13)|0);
+ _memcpy(($14|0),($11|0),($13|0))|0;
+ $$063 = 0;$$sink64 = $14;
+ while(1) {
+ $15 = (_strtok($$sink64,9889)|0);
+ $16 = (($vararg_buffer7) + ($$063<<2)|0);
+ HEAP32[$16>>2] = $15;
+ $17 = ($15|0)==(0|0);
+ $18 = (($$063) + 1)|0;
+ if ($17) {
+ break;
+ } else {
+ $$063 = $18;$$sink64 = 0;
+ }
+ }
+ _free($14);
+ $19 = (($$063) + -1)|0;
+ HEAP32[$vararg_buffer10>>2] = $19;
+ _TraceLog(0,9891,$vararg_buffer10);
+ $20 = ($$063|0)>(1);
+ if ($20) {
+ $$06268 = 0;
+ while(1) {
+ $23 = (($vararg_buffer7) + ($$06268<<2)|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = (_strcmp($24,9926)|0);
+ $26 = ($25|0)==(0);
+ if ($26) {
+ HEAP32[5259] = 1;
+ $27 = (_eglGetProcAddress((9953|0))|0);
+ HEAP32[5633] = $27;
+ $28 = (_eglGetProcAddress((9974|0))|0);
+ HEAP32[5260] = $28;
+ $29 = (_eglGetProcAddress((9995|0))|0);
+ HEAP32[5648] = $29;
+ }
+ $30 = (_strcmp($24,10019)|0);
+ $31 = ($30|0)==(0);
+ if ($31) {
+ HEAP32[5166] = 1;
+ }
+ $32 = (_strcmp($24,10039)|0);
+ $33 = ($32|0)==(0);
+ if ($33) {
+ HEAP32[5165] = 1;
+ }
+ $34 = (_strcmp($24,10057)|0);
+ $35 = ($34|0)==(0);
+ if ($35) {
+ label = 14;
+ } else {
+ $36 = HEAP32[$23>>2]|0;
+ $37 = (_strcmp($36,10089)|0);
+ $38 = ($37|0)==(0);
+ if ($38) {
+ label = 14;
+ } else {
+ $39 = (_strcmp($36,10122)|0);
+ $40 = ($39|0)==(0);
+ if ($40) {
+ label = 14;
+ }
+ }
+ }
+ if ((label|0) == 14) {
+ label = 0;
+ HEAP32[5160] = 1;
+ }
+ $41 = HEAP32[$23>>2]|0;
+ $42 = (_strcmp($41,10162)|0);
+ $43 = ($42|0)==(0);
+ if ($43) {
+ label = 17;
+ } else {
+ $44 = (_strcmp($41,10198)|0);
+ $45 = ($44|0)==(0);
+ if ($45) {
+ label = 17;
+ }
+ }
+ if ((label|0) == 17) {
+ label = 0;
+ HEAP32[5161] = 1;
+ }
+ $46 = (_strcmp($41,10231)|0);
+ $47 = ($46|0)==(0);
+ if ($47) {
+ HEAP32[5162] = 1;
+ }
+ $48 = HEAP32[$23>>2]|0;
+ $49 = (_strcmp($48,10256)|0);
+ $50 = ($49|0)==(0);
+ if ($50) {
+ HEAP32[5163] = 1;
+ }
+ $51 = (_strcmp($48,10289)|0);
+ $52 = ($51|0)==(0);
+ if ($52) {
+ HEAP32[5164] = 1;
+ }
+ $53 = (_strcmp($48,10325)|0);
+ $54 = ($53|0)==(0);
+ if ($54) {
+ HEAP32[5697] = 1;
+ _glGetFloatv(34047,(20672|0));
+ }
+ $55 = (_strcmp($48,10359)|0);
+ $56 = ($55|0)==(0);
+ if ($56) {
+ HEAP32[5167] = 1;
+ }
+ $57 = (($$06268) + 1)|0;
+ $exitcond71 = ($57|0)==($19|0);
+ if ($exitcond71) {
+ break;
+ } else {
+ $$06268 = $57;
+ }
+ }
+ }
+ $21 = HEAP32[5259]|0;
+ $22 = ($21|0)==(0);
+ if ($22) {
+ _TraceLog(1,10462,$vararg_buffer15);
+ } else {
+ _TraceLog(0,10387,$vararg_buffer13);
+ }
+ $58 = HEAP32[5166]|0;
+ $59 = ($58|0)==(0);
+ if ($59) {
+ _TraceLog(1,10598,$vararg_buffer19);
+ } else {
+ _TraceLog(0,10523,$vararg_buffer17);
+ }
+ $60 = HEAP32[5160]|0;
+ $61 = ($60|0)==(0);
+ if (!($61)) {
+ _TraceLog(0,10690,$vararg_buffer21);
+ }
+ $62 = HEAP32[5161]|0;
+ $63 = ($62|0)==(0);
+ if (!($63)) {
+ _TraceLog(0,10736,$vararg_buffer23);
+ }
+ $64 = HEAP32[5162]|0;
+ $65 = ($64|0)==(0);
+ if (!($65)) {
+ _TraceLog(0,10783,$vararg_buffer25);
+ }
+ $66 = HEAP32[5163]|0;
+ $67 = ($66|0)==(0);
+ if (!($67)) {
+ _TraceLog(0,10834,$vararg_buffer27);
+ }
+ $68 = HEAP32[5164]|0;
+ $69 = ($68|0)==(0);
+ if (!($69)) {
+ _TraceLog(0,10881,$vararg_buffer29);
+ }
+ $70 = HEAP32[5697]|0;
+ $71 = ($70|0)==(0);
+ if (!($71)) {
+ $72 = +HEAPF32[5168];
+ $73 = $72;
+ HEAPF64[$vararg_buffer31>>3] = $73;
+ _TraceLog(0,10928,$vararg_buffer31);
+ }
+ $74 = HEAP32[5167]|0;
+ $75 = ($74|0)==(0);
+ if (!($75)) {
+ _TraceLog(0,10994,$vararg_buffer34);
+ }
+ HEAP32[$vararg_buffer10>>2] = -1;
+ $76 = (_rlglLoadTexture($vararg_buffer10,1,1,7,1)|0);
+ HEAP32[5219] = $76;
+ $77 = ($76|0)==(0);
+ if ($77) {
+ _TraceLog(1,11098,$vararg_buffer39);
+ } else {
+ HEAP32[$vararg_buffer36>>2] = $76;
+ _TraceLog(0,11047,$vararg_buffer36);
+ }
+ _LoadDefaultShader($2);
+ dest=22536; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=20980; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _LoadDefaultBuffers();
+ $78 = (_malloc(49152)|0);
+ HEAP32[5628] = $78;
+ $$06167 = 0;
+ while(1) {
+ $80 = HEAP32[5628]|0;
+ $81 = (($80) + (($$06167*12)|0)|0);
+ _VectorZero($3);
+ ;HEAP32[$81>>2]=HEAP32[$3>>2]|0;HEAP32[$81+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$81+8>>2]=HEAP32[$3+8>>2]|0;
+ $82 = (($$06167) + 1)|0;
+ $exitcond70 = ($82|0)==(4096);
+ if ($exitcond70) {
+ break;
+ } else {
+ $$06167 = $82;
+ }
+ }
+ $79 = (_malloc(36864)|0);
+ HEAP32[5220] = $79;
+ $$06066 = 0;
+ while(1) {
+ $83 = (((($79) + (($$06066*144)|0)|0)) + 8|0);
+ HEAP32[$83>>2] = 0;
+ $84 = (($79) + (($$06066*144)|0)|0);
+ HEAP32[$84>>2] = 0;
+ $85 = (($$06066) + 1)|0;
+ $exitcond = ($85|0)==(256);
+ if ($exitcond) {
+ break;
+ } else {
+ $$06066 = $85;
+ }
+ }
+ HEAP32[5218] = 1;
+ $86 = HEAP32[5219]|0;
+ $87 = ((($79)) + 8|0);
+ HEAP32[$87>>2] = $86;
+ HEAP32[5629] = 4;
+ _MatrixIdentity($4);
+ dest=21476; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21540); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21604); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21668); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21732); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21796); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21860); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21924); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(21988); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22052); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22116); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22180); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22244); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22308); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22372); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($4);
+ dest=(22436); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($5);
+ dest=20740; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixIdentity($6);
+ dest=20804; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ HEAP32[5625] = 20804;
+ _glDepthFunc(515);
+ _glDisable(2929);
+ _glBlendFunc(770,771);
+ _glEnable(3042);
+ _glCullFace(1029);
+ _glFrontFace(2305);
+ _glEnable(2884);
+ _glClearColor(0.0,0.0,0.0,1.0);
+ _glClearDepthf(1.0);
+ _glClear(16640);
+ HEAP32[5277] = $0;
+ HEAP32[5278] = $1;
+ _TraceLog(0,11137,$vararg_buffer41);
+ STACKTOP = sp;return;
+}
+function _SetupViewport() {
+ var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5695]|0;
+ $1 = (($0|0) / 2)&-1;
+ $2 = HEAP32[5696]|0;
+ $3 = (($2|0) / 2)&-1;
+ $4 = HEAP32[5693]|0;
+ $5 = (($4) - ($0))|0;
+ $6 = HEAP32[5694]|0;
+ $7 = (($6) - ($2))|0;
+ _rlViewport($1,$3,$5,$7);
+ return;
+}
+function _rlMatrixMode($0) {
+ $0 = $0|0;
+ var $modelview$sink = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ switch ($0|0) {
+ case 5889: {
+ $modelview$sink = 20740;
+ label = 3;
+ break;
+ }
+ case 5888: {
+ $modelview$sink = 20804;
+ label = 3;
+ break;
+ }
+ default: {
+ }
+ }
+ if ((label|0) == 3) {
+ HEAP32[5625] = $modelview$sink;
+ }
+ HEAP32[5630] = $0;
+ return;
+}
+function _rlOrtho($0,$1,$2,$3,$4,$5) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ $4 = +$4;
+ $5 = +$5;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $$byval_copy1 = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $6 = sp + 64|0;
+ $7 = sp;
+ _MatrixOrtho($6,$0,$1,$2,$3,$4,$5);
+ _MatrixTranspose($6);
+ $8 = HEAP32[5625]|0;
+ dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($7,$$byval_copy,$$byval_copy1);
+ dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _ClearBackground($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP8[$0>>0]|0;
+ $2 = ((($0)) + 1|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = ((($0)) + 2|0);
+ $5 = HEAP8[$4>>0]|0;
+ $6 = ((($0)) + 3|0);
+ $7 = HEAP8[$6>>0]|0;
+ _rlClearColor($1,$3,$5,$7);
+ return;
+}
+function _rlClearColor($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $10 = 0.0, $11 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = (+($0&255));
+ $5 = $4 / 255.0;
+ $6 = (+($1&255));
+ $7 = $6 / 255.0;
+ $8 = (+($2&255));
+ $9 = $8 / 255.0;
+ $10 = (+($3&255));
+ $11 = $10 / 255.0;
+ _glClearColor((+$5),(+$7),(+$9),(+$11));
+ return;
+}
+function _LoadDefaultShader($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1008|0);
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $1 = sp + 16|0;
+ $2 = sp + 513|0;
+ $3 = sp + 72|0;
+ _memcpy(($2|0),(11713|0),489)|0;
+ _memcpy(($3|0),(12202|0),441)|0;
+ $4 = (_LoadShaderProgram($2,$3)|0);
+ HEAP32[$1>>2] = $4;
+ $5 = ($4|0)==(0);
+ if ($5) {
+ HEAP32[$vararg_buffer1>>2] = $4;
+ _TraceLog(1,12691,$vararg_buffer1);
+ } else {
+ HEAP32[$vararg_buffer>>2] = $4;
+ _TraceLog(0,12643,$vararg_buffer);
+ }
+ $6 = HEAP32[$1>>2]|0;
+ $7 = ($6|0)==(0);
+ if (!($7)) {
+ _LoadDefaultShaderLocations($1);
+ }
+ dest=$0; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _LoadDefaultBuffers() {
+ var $$05365 = 0, $$05467 = 0, $$05770 = 0, $$05972 = 0, $$066 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
+ var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
+ var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
+ var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
+ var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
+ var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond75 = 0, $exitcond78 = 0, $exitcond80 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer17 = 0;
+ var $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $vararg_buffer17 = sp + 48|0;
+ $vararg_buffer14 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $0 = (_malloc(24576)|0);
+ HEAP32[(20896)>>2] = $0;
+ $1 = (_malloc(8192)|0);
+ HEAP32[(20904)>>2] = $1;
+ HEAP32[(20900)>>2] = 0;
+ HEAP32[(20908)>>2] = 0;
+ _memset(($0|0),0,24576)|0;
+ $$05972 = 0;
+ while(1) {
+ $2 = HEAP32[(20904)>>2]|0;
+ $3 = (($2) + ($$05972)|0);
+ HEAP8[$3>>0] = 0;
+ $4 = (($$05972) + 1)|0;
+ $exitcond80 = ($4|0)==(8192);
+ if ($exitcond80) {
+ break;
+ } else {
+ $$05972 = $4;
+ }
+ }
+ HEAP32[5221] = 0;
+ HEAP32[(20892)>>2] = 0;
+ HEAP32[(20888)>>2] = 0;
+ $5 = (_malloc(73728)|0);
+ HEAP32[(20944)>>2] = $5;
+ $6 = (_malloc(24576)|0);
+ HEAP32[(20952)>>2] = $6;
+ HEAP32[(20948)>>2] = 0;
+ HEAP32[(20956)>>2] = 0;
+ _memset(($5|0),0,73728)|0;
+ $$05770 = 0;
+ while(1) {
+ $7 = HEAP32[(20952)>>2]|0;
+ $8 = (($7) + ($$05770)|0);
+ HEAP8[$8>>0] = 0;
+ $9 = (($$05770) + 1)|0;
+ $exitcond78 = ($9|0)==(24576);
+ if ($exitcond78) {
+ break;
+ } else {
+ $$05770 = $9;
+ }
+ }
+ HEAP32[5233] = 0;
+ HEAP32[(20940)>>2] = 0;
+ HEAP32[(20936)>>2] = 0;
+ $10 = (_malloc(49152)|0);
+ HEAP32[(20704)>>2] = $10;
+ $11 = (_malloc(32768)|0);
+ HEAP32[(20708)>>2] = $11;
+ $12 = (_malloc(16384)|0);
+ HEAP32[(20712)>>2] = $12;
+ $13 = (_malloc(12288)|0);
+ HEAP32[(20716)>>2] = $13;
+ $14 = HEAP32[(20704)>>2]|0;
+ _memset(($14|0),0,49152)|0;
+ $15 = HEAP32[(20708)>>2]|0;
+ _memset(($15|0),0,32768)|0;
+ $$05467 = 0;
+ while(1) {
+ $17 = HEAP32[(20712)>>2]|0;
+ $18 = (($17) + ($$05467)|0);
+ HEAP8[$18>>0] = 0;
+ $19 = (($$05467) + 1)|0;
+ $exitcond75 = ($19|0)==(16384);
+ if ($exitcond75) {
+ break;
+ } else {
+ $$05467 = $19;
+ }
+ }
+ $16 = HEAP32[(20716)>>2]|0;
+ $$05365 = 0;$$066 = 0;
+ while(1) {
+ $22 = $$05365 << 2;
+ $23 = $22&65535;
+ $24 = (($16) + ($$066<<1)|0);
+ HEAP16[$24>>1] = $23;
+ $25 = $22 | 1;
+ $26 = $25&65535;
+ $27 = $$066 | 1;
+ $28 = (($16) + ($27<<1)|0);
+ HEAP16[$28>>1] = $26;
+ $29 = $22 | 2;
+ $30 = $29&65535;
+ $31 = (($$066) + 2)|0;
+ $32 = (($16) + ($31<<1)|0);
+ HEAP16[$32>>1] = $30;
+ $33 = (($$066) + 3)|0;
+ $34 = (($16) + ($33<<1)|0);
+ HEAP16[$34>>1] = $23;
+ $35 = (($$066) + 4)|0;
+ $36 = (($16) + ($35<<1)|0);
+ HEAP16[$36>>1] = $30;
+ $37 = $22 | 3;
+ $38 = $37&65535;
+ $39 = (($$066) + 5)|0;
+ $40 = (($16) + ($39<<1)|0);
+ HEAP16[$40>>1] = $38;
+ $41 = (($$05365) + 1)|0;
+ $42 = (($$066) + 6)|0;
+ $exitcond = ($41|0)==(1024);
+ if ($exitcond) {
+ break;
+ } else {
+ $$05365 = $41;$$066 = $42;
+ }
+ }
+ HEAP32[5173] = 0;
+ HEAP32[(20696)>>2] = 0;
+ HEAP32[(20700)>>2] = 0;
+ _TraceLog(0,11184,$vararg_buffer);
+ $20 = HEAP32[5259]|0;
+ $21 = ($20|0)==(0);
+ if (!($21)) {
+ $43 = HEAP32[5633]|0;
+ FUNCTION_TABLE_vii[$43 & 63](1,(20912));
+ $44 = HEAP32[5260]|0;
+ $45 = HEAP32[(20912)>>2]|0;
+ FUNCTION_TABLE_vi[$44 & 31]($45);
+ }
+ _glGenBuffers(2,((20916)|0));
+ $46 = HEAP32[(20916)>>2]|0;
+ _glBindBuffer(34962,($46|0));
+ $47 = HEAP32[(20896)>>2]|0;
+ _glBufferData(34962,24576,($47|0),35048);
+ $48 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($48|0));
+ $49 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($49|0),3,5126,0,0,(0|0));
+ _glGenBuffers(2,((20920)|0));
+ $50 = HEAP32[(20920)>>2]|0;
+ _glBindBuffer(34962,($50|0));
+ $51 = HEAP32[(20904)>>2]|0;
+ _glBufferData(34962,8192,($51|0),35048);
+ $52 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($52|0));
+ $53 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($53|0),4,5121,1,0,(0|0));
+ $54 = HEAP32[5259]|0;
+ $55 = ($54|0)==(0);
+ if ($55) {
+ $57 = HEAP32[(20916)>>2]|0;
+ $58 = HEAP32[(20920)>>2]|0;
+ HEAP32[$vararg_buffer3>>2] = $57;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = $58;
+ _TraceLog(0,11322,$vararg_buffer3);
+ } else {
+ $56 = HEAP32[(20912)>>2]|0;
+ HEAP32[$vararg_buffer1>>2] = $56;
+ _TraceLog(0,11257,$vararg_buffer1);
+ }
+ $59 = HEAP32[5259]|0;
+ $60 = ($59|0)==(0);
+ if (!($60)) {
+ $61 = HEAP32[5633]|0;
+ FUNCTION_TABLE_vii[$61 & 63](1,(20960));
+ $62 = HEAP32[5260]|0;
+ $63 = HEAP32[(20960)>>2]|0;
+ FUNCTION_TABLE_vi[$62 & 31]($63);
+ }
+ _glGenBuffers(1,((20964)|0));
+ $64 = HEAP32[(20964)>>2]|0;
+ _glBindBuffer(34962,($64|0));
+ $65 = HEAP32[(20944)>>2]|0;
+ _glBufferData(34962,73728,($65|0),35048);
+ $66 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($66|0));
+ $67 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($67|0),3,5126,0,0,(0|0));
+ _glGenBuffers(1,((20968)|0));
+ $68 = HEAP32[(20968)>>2]|0;
+ _glBindBuffer(34962,($68|0));
+ $69 = HEAP32[(20952)>>2]|0;
+ _glBufferData(34962,24576,($69|0),35048);
+ $70 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($70|0));
+ $71 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($71|0),4,5121,1,0,(0|0));
+ $72 = HEAP32[5259]|0;
+ $73 = ($72|0)==(0);
+ if ($73) {
+ $75 = HEAP32[(20964)>>2]|0;
+ $76 = HEAP32[(20968)>>2]|0;
+ HEAP32[$vararg_buffer10>>2] = $75;
+ $vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
+ HEAP32[$vararg_ptr13>>2] = $76;
+ _TraceLog(0,11468,$vararg_buffer10);
+ } else {
+ $74 = HEAP32[(20960)>>2]|0;
+ HEAP32[$vararg_buffer7>>2] = $74;
+ _TraceLog(0,11399,$vararg_buffer7);
+ }
+ $77 = HEAP32[5259]|0;
+ $78 = ($77|0)==(0);
+ if (!($78)) {
+ $79 = HEAP32[5633]|0;
+ FUNCTION_TABLE_vii[$79 & 63](1,(20720));
+ $80 = HEAP32[5260]|0;
+ $81 = HEAP32[(20720)>>2]|0;
+ FUNCTION_TABLE_vi[$80 & 31]($81);
+ }
+ _glGenBuffers(1,((20724)|0));
+ $82 = HEAP32[(20724)>>2]|0;
+ _glBindBuffer(34962,($82|0));
+ $83 = HEAP32[(20704)>>2]|0;
+ _glBufferData(34962,49152,($83|0),35048);
+ $84 = HEAP32[(20984)>>2]|0;
+ _glEnableVertexAttribArray(($84|0));
+ $85 = HEAP32[(20984)>>2]|0;
+ _glVertexAttribPointer(($85|0),3,5126,0,0,(0|0));
+ _glGenBuffers(1,((20728)|0));
+ $86 = HEAP32[(20728)>>2]|0;
+ _glBindBuffer(34962,($86|0));
+ $87 = HEAP32[(20708)>>2]|0;
+ _glBufferData(34962,32768,($87|0),35048);
+ $88 = HEAP32[(20988)>>2]|0;
+ _glEnableVertexAttribArray(($88|0));
+ $89 = HEAP32[(20988)>>2]|0;
+ _glVertexAttribPointer(($89|0),2,5126,0,0,(0|0));
+ _glGenBuffers(1,((20732)|0));
+ $90 = HEAP32[(20732)>>2]|0;
+ _glBindBuffer(34962,($90|0));
+ $91 = HEAP32[(20712)>>2]|0;
+ _glBufferData(34962,16384,($91|0),35048);
+ $92 = HEAP32[(21004)>>2]|0;
+ _glEnableVertexAttribArray(($92|0));
+ $93 = HEAP32[(21004)>>2]|0;
+ _glVertexAttribPointer(($93|0),4,5121,1,0,(0|0));
+ _glGenBuffers(1,((20736)|0));
+ $94 = HEAP32[(20736)>>2]|0;
+ _glBindBuffer(34963,($94|0));
+ $95 = HEAP32[(20716)>>2]|0;
+ _glBufferData(34963,12288,($95|0),35044);
+ $96 = HEAP32[5259]|0;
+ $97 = ($96|0)==(0);
+ if ($97) {
+ $99 = HEAP32[(20724)>>2]|0;
+ $100 = HEAP32[(20728)>>2]|0;
+ $101 = HEAP32[(20732)>>2]|0;
+ $102 = HEAP32[(20736)>>2]|0;
+ HEAP32[$vararg_buffer17>>2] = $99;
+ $vararg_ptr20 = ((($vararg_buffer17)) + 4|0);
+ HEAP32[$vararg_ptr20>>2] = $100;
+ $vararg_ptr21 = ((($vararg_buffer17)) + 8|0);
+ HEAP32[$vararg_ptr21>>2] = $101;
+ $vararg_ptr22 = ((($vararg_buffer17)) + 12|0);
+ HEAP32[$vararg_ptr22>>2] = $102;
+ _TraceLog(0,11614,$vararg_buffer17);
+ } else {
+ $98 = HEAP32[(20720)>>2]|0;
+ HEAP32[$vararg_buffer14>>2] = $98;
+ _TraceLog(0,11549,$vararg_buffer14);
+ }
+ $103 = HEAP32[5259]|0;
+ $104 = ($103|0)==(0);
+ if ($104) {
+ STACKTOP = sp;return;
+ }
+ $105 = HEAP32[5260]|0;
+ FUNCTION_TABLE_vi[$105 & 31](0);
+ STACKTOP = sp;return;
+}
+function _LoadShaderProgram($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$alloca_mul = 0, $$alloca_mul34 = 0, $$alloca_mul36 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
+ $vararg_buffer22 = sp + 64|0;
+ $vararg_buffer19 = sp + 56|0;
+ $vararg_buffer16 = sp + 48|0;
+ $vararg_buffer13 = sp + 40|0;
+ $vararg_buffer10 = sp + 32|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer4 = sp + 16|0;
+ $vararg_buffer1 = sp + 8|0;
+ $vararg_buffer = sp;
+ $2 = sp + 80|0;
+ $3 = sp + 76|0;
+ $4 = sp + 72|0;
+ $5 = sp + 68|0;
+ $6 = (_glCreateShader(35633)|0);
+ $7 = (_glCreateShader(35632)|0);
+ HEAP32[$2>>2] = $0;
+ HEAP32[$3>>2] = $1;
+ _glShaderSource(($6|0),1,($2|0),(0|0));
+ _glShaderSource(($7|0),1,($3|0),(0|0));
+ HEAP32[$4>>2] = 0;
+ _glCompileShader(($6|0));
+ _glGetShaderiv(($6|0),35713,($4|0));
+ $8 = HEAP32[$4>>2]|0;
+ $9 = ($8|0)==(1);
+ if ($9) {
+ HEAP32[$vararg_buffer4>>2] = $6;
+ _TraceLog(0,12947,$vararg_buffer4);
+ } else {
+ HEAP32[$vararg_buffer>>2] = $6;
+ _TraceLog(1,12895,$vararg_buffer);
+ HEAP32[$vararg_buffer>>2] = 0;
+ _glGetShaderiv(($6|0),35716,($vararg_buffer|0));
+ $10 = HEAP32[$vararg_buffer>>2]|0;
+ $11 = (_llvm_stacksave()|0);
+ $$alloca_mul = $10;
+ $12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul)|0)+15)&-16)|0);;
+ $13 = HEAP32[$vararg_buffer>>2]|0;
+ _glGetShaderInfoLog(($6|0),($13|0),($5|0),($12|0));
+ HEAP32[$vararg_buffer1>>2] = $12;
+ _TraceLog(0,12944,$vararg_buffer1);
+ _llvm_stackrestore(($11|0));
+ }
+ _glCompileShader(($7|0));
+ _glGetShaderiv(($7|0),35713,($4|0));
+ $14 = HEAP32[$4>>2]|0;
+ $15 = ($14|0)==(1);
+ if ($15) {
+ HEAP32[$vararg_buffer13>>2] = $7;
+ _TraceLog(0,13048,$vararg_buffer13);
+ } else {
+ HEAP32[$vararg_buffer7>>2] = $7;
+ _TraceLog(1,12997,$vararg_buffer7);
+ HEAP32[$vararg_buffer7>>2] = 0;
+ _glGetShaderiv(($7|0),35716,($vararg_buffer7|0));
+ $16 = HEAP32[$vararg_buffer7>>2]|0;
+ $17 = (_llvm_stacksave()|0);
+ $$alloca_mul34 = $16;
+ $18 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul34)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul34)|0)+15)&-16)|0);;
+ $19 = HEAP32[$vararg_buffer7>>2]|0;
+ _glGetShaderInfoLog(($7|0),($19|0),($5|0),($18|0));
+ HEAP32[$vararg_buffer10>>2] = $18;
+ _TraceLog(0,12944,$vararg_buffer10);
+ _llvm_stackrestore(($17|0));
+ }
+ $20 = (_glCreateProgram()|0);
+ _glAttachShader(($20|0),($6|0));
+ _glAttachShader(($20|0),($7|0));
+ _glBindAttribLocation(($20|0),0,(12739|0));
+ _glBindAttribLocation(($20|0),1,(12754|0));
+ _glBindAttribLocation(($20|0),2,(12785|0));
+ _glBindAttribLocation(($20|0),3,(12812|0));
+ _glBindAttribLocation(($20|0),4,(12798|0));
+ _glBindAttribLocation(($20|0),5,(12769|0));
+ _glLinkProgram(($20|0));
+ _glGetProgramiv(($20|0),35714,($4|0));
+ $21 = HEAP32[$4>>2]|0;
+ $22 = ($21|0)==(0);
+ if ($22) {
+ HEAP32[$vararg_buffer16>>2] = $20;
+ _TraceLog(1,13100,$vararg_buffer16);
+ HEAP32[$vararg_buffer16>>2] = 0;
+ _glGetProgramiv(($20|0),35716,($vararg_buffer16|0));
+ $23 = HEAP32[$vararg_buffer16>>2]|0;
+ $24 = (_llvm_stacksave()|0);
+ $$alloca_mul36 = $23;
+ $25 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul36)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul36)|0)+15)&-16)|0);;
+ $26 = HEAP32[$vararg_buffer16>>2]|0;
+ _glGetProgramInfoLog(($20|0),($26|0),($5|0),($25|0));
+ HEAP32[$vararg_buffer19>>2] = $25;
+ _TraceLog(0,12944,$vararg_buffer19);
+ _glDeleteProgram(($20|0));
+ _llvm_stackrestore(($24|0));
+ $$0 = 0;
+ _glDeleteShader(($6|0));
+ _glDeleteShader(($7|0));
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ HEAP32[$vararg_buffer22>>2] = $20;
+ _TraceLog(0,13146,$vararg_buffer22);
+ $$0 = $20;
+ _glDeleteShader(($6|0));
+ _glDeleteShader(($7|0));
+ STACKTOP = sp;return ($$0|0);
+ }
+ return (0)|0;
+}
+function _LoadDefaultShaderLocations($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = (_glGetAttribLocation(($1|0),(12739|0))|0);
+ $3 = ((($0)) + 4|0);
+ HEAP32[$3>>2] = $2;
+ $4 = HEAP32[$0>>2]|0;
+ $5 = (_glGetAttribLocation(($4|0),(12754|0))|0);
+ $6 = ((($0)) + 8|0);
+ HEAP32[$6>>2] = $5;
+ $7 = HEAP32[$0>>2]|0;
+ $8 = (_glGetAttribLocation(($7|0),(12769|0))|0);
+ $9 = ((($0)) + 12|0);
+ HEAP32[$9>>2] = $8;
+ $10 = HEAP32[$0>>2]|0;
+ $11 = (_glGetAttribLocation(($10|0),(12785|0))|0);
+ $12 = ((($0)) + 16|0);
+ HEAP32[$12>>2] = $11;
+ $13 = HEAP32[$0>>2]|0;
+ $14 = (_glGetAttribLocation(($13|0),(12798|0))|0);
+ $15 = ((($0)) + 20|0);
+ HEAP32[$15>>2] = $14;
+ $16 = HEAP32[$0>>2]|0;
+ $17 = (_glGetAttribLocation(($16|0),(12812|0))|0);
+ $18 = ((($0)) + 24|0);
+ HEAP32[$18>>2] = $17;
+ $19 = HEAP32[$0>>2]|0;
+ $20 = (_glGetUniformLocation(($19|0),(12824|0))|0);
+ $21 = ((($0)) + 28|0);
+ HEAP32[$21>>2] = $20;
+ $22 = HEAP32[$0>>2]|0;
+ $23 = (_glGetUniformLocation(($22|0),(12834|0))|0);
+ $24 = ((($0)) + 32|0);
+ HEAP32[$24>>2] = $23;
+ $25 = HEAP32[$0>>2]|0;
+ $26 = (_glGetUniformLocation(($25|0),(12845|0))|0);
+ $27 = ((($0)) + 36|0);
+ HEAP32[$27>>2] = $26;
+ $28 = HEAP32[$0>>2]|0;
+ $29 = (_glGetUniformLocation(($28|0),(12856|0))|0);
+ $30 = ((($0)) + 40|0);
+ HEAP32[$30>>2] = $29;
+ $31 = HEAP32[$0>>2]|0;
+ $32 = (_glGetUniformLocation(($31|0),(12868|0))|0);
+ $33 = ((($0)) + 44|0);
+ HEAP32[$33>>2] = $32;
+ $34 = HEAP32[$0>>2]|0;
+ $35 = (_glGetUniformLocation(($34|0),(12877|0))|0);
+ $36 = ((($0)) + 48|0);
+ HEAP32[$36>>2] = $35;
+ $37 = HEAP32[$0>>2]|0;
+ $38 = (_glGetUniformLocation(($37|0),(12886|0))|0);
+ $39 = ((($0)) + 52|0);
+ HEAP32[$39>>2] = $38;
+ return;
+}
+function _IsMouseButtonPressed($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (23577 + ($0)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = (23580 + ($0)|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ($2<<24>>24)!=($4<<24>>24);
+ $6 = ($2<<24>>24)==(1);
+ $or$cond = $6 & $5;
+ $$0 = $or$cond&1;
+ return ($$0|0);
+}
+function _IsMouseButtonReleased($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (23577 + ($0)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = (23580 + ($0)|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ($2<<24>>24)!=($4<<24>>24);
+ $6 = ($2<<24>>24)==(0);
+ $or$cond = $6 & $5;
+ $$0 = $or$cond&1;
+ return ($$0|0);
+}
+function _rlClearScreenBuffers() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glClear(16640);
+ return;
+}
+function _CloseWindow() {
+ var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ _UnloadDefaultFont();
+ _rlglClose();
+ $0 = HEAP32[5664]|0;
+ _glfwDestroyWindow(($0|0));
+ _glfwTerminate();
+ _TraceLog(0,13441,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _rlglClose() {
+ var $0 = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ _UnloadDefaultShader();
+ _UnloadDefaultBuffers();
+ _glDeleteTextures(1,(20876|0));
+ $0 = HEAP32[5219]|0;
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(0,13468,$vararg_buffer);
+ $1 = HEAP32[5220]|0;
+ _free($1);
+ STACKTOP = sp;return;
+}
+function _UnloadDefaultShader() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _glUseProgram(0);
+ $0 = HEAP32[5634]|0;
+ _glDeleteProgram(($0|0));
+ return;
+}
+function _UnloadDefaultBuffers() {
+ var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5259]|0;
+ $1 = ($0|0)==(0);
+ if (!($1)) {
+ $2 = HEAP32[5260]|0;
+ FUNCTION_TABLE_vi[$2 & 31](0);
+ }
+ _glDisableVertexAttribArray(0);
+ _glDisableVertexAttribArray(1);
+ _glDisableVertexAttribArray(2);
+ _glDisableVertexAttribArray(3);
+ _glBindBuffer(34962,0);
+ _glBindBuffer(34963,0);
+ _glDeleteBuffers(1,((20916)|0));
+ _glDeleteBuffers(1,((20920)|0));
+ _glDeleteBuffers(1,((20964)|0));
+ _glDeleteBuffers(1,((20968)|0));
+ _glDeleteBuffers(1,((20724)|0));
+ _glDeleteBuffers(1,((20728)|0));
+ _glDeleteBuffers(1,((20732)|0));
+ _glDeleteBuffers(1,((20736)|0));
+ $3 = HEAP32[5259]|0;
+ $4 = ($3|0)==(0);
+ if (!($4)) {
+ $5 = HEAP32[5648]|0;
+ FUNCTION_TABLE_vii[$5 & 63](1,(20912));
+ $6 = HEAP32[5648]|0;
+ FUNCTION_TABLE_vii[$6 & 63](1,(20960));
+ $7 = HEAP32[5648]|0;
+ FUNCTION_TABLE_vii[$7 & 63](1,(20720));
+ }
+ $8 = HEAP32[(20896)>>2]|0;
+ _free($8);
+ $9 = HEAP32[(20904)>>2]|0;
+ _free($9);
+ $10 = HEAP32[(20944)>>2]|0;
+ _free($10);
+ $11 = HEAP32[(20952)>>2]|0;
+ _free($11);
+ $12 = HEAP32[(20704)>>2]|0;
+ _free($12);
+ $13 = HEAP32[(20708)>>2]|0;
+ _free($13);
+ $14 = HEAP32[(20712)>>2]|0;
+ _free($14);
+ $15 = HEAP32[(20716)>>2]|0;
+ _free($15);
+ return;
+}
+function _BeginDrawing() {
+ var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $downscaleView$byval_copy = sp;
+ $0 = (+_GetTime());
+ HEAPF64[2445] = $0;
+ $1 = +HEAPF64[2444];
+ $2 = $0 - $1;
+ HEAPF64[2446] = $2;
+ HEAPF64[2444] = $0;
+ _rlClearScreenBuffers();
+ _rlLoadIdentity();
+ dest=$downscaleView$byval_copy; src=22696; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_MatrixToFloat($downscaleView$byval_copy)|0);
+ _rlMultMatrixf(21044);
+ STACKTOP = sp;return;
+}
+function _rlMultMatrixf($0) {
+ $0 = $0|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $$byval_copy1 = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $1 = sp + 64|0;
+ $2 = sp;
+ $3 = HEAP32[$0>>2]|0;
+ HEAP32[$1>>2] = $3;
+ $4 = ((($1)) + 4|0);
+ $5 = ((($0)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ HEAP32[$4>>2] = $6;
+ $7 = ((($1)) + 8|0);
+ $8 = ((($0)) + 8|0);
+ $9 = HEAP32[$8>>2]|0;
+ HEAP32[$7>>2] = $9;
+ $10 = ((($1)) + 12|0);
+ $11 = ((($0)) + 12|0);
+ $12 = HEAP32[$11>>2]|0;
+ HEAP32[$10>>2] = $12;
+ $13 = ((($1)) + 16|0);
+ $14 = ((($0)) + 16|0);
+ $15 = HEAP32[$14>>2]|0;
+ HEAP32[$13>>2] = $15;
+ $16 = ((($1)) + 20|0);
+ $17 = ((($0)) + 20|0);
+ $18 = HEAP32[$17>>2]|0;
+ HEAP32[$16>>2] = $18;
+ $19 = ((($1)) + 24|0);
+ $20 = ((($0)) + 24|0);
+ $21 = HEAP32[$20>>2]|0;
+ HEAP32[$19>>2] = $21;
+ $22 = ((($1)) + 28|0);
+ $23 = ((($0)) + 28|0);
+ $24 = HEAP32[$23>>2]|0;
+ HEAP32[$22>>2] = $24;
+ $25 = ((($1)) + 32|0);
+ $26 = ((($0)) + 32|0);
+ $27 = HEAP32[$26>>2]|0;
+ HEAP32[$25>>2] = $27;
+ $28 = ((($1)) + 36|0);
+ $29 = ((($0)) + 36|0);
+ $30 = HEAP32[$29>>2]|0;
+ HEAP32[$28>>2] = $30;
+ $31 = ((($1)) + 40|0);
+ $32 = ((($0)) + 40|0);
+ $33 = HEAP32[$32>>2]|0;
+ HEAP32[$31>>2] = $33;
+ $34 = ((($1)) + 44|0);
+ $35 = ((($0)) + 44|0);
+ $36 = HEAP32[$35>>2]|0;
+ HEAP32[$34>>2] = $36;
+ $37 = ((($1)) + 48|0);
+ $38 = ((($0)) + 48|0);
+ $39 = HEAP32[$38>>2]|0;
+ HEAP32[$37>>2] = $39;
+ $40 = ((($1)) + 52|0);
+ $41 = ((($0)) + 52|0);
+ $42 = HEAP32[$41>>2]|0;
+ HEAP32[$40>>2] = $42;
+ $43 = ((($1)) + 56|0);
+ $44 = ((($0)) + 56|0);
+ $45 = HEAP32[$44>>2]|0;
+ HEAP32[$43>>2] = $45;
+ $46 = ((($1)) + 60|0);
+ $47 = ((($0)) + 60|0);
+ $48 = HEAP32[$47>>2]|0;
+ HEAP32[$46>>2] = $48;
+ $49 = HEAP32[5625]|0;
+ dest=$$byval_copy; src=$49; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy1; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($2,$$byval_copy,$$byval_copy1);
+ dest=$49; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _EndDrawing() {
+ var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ _SwapBuffers();
+ _PollInputEvents();
+ $0 = (+_GetTime());
+ HEAPF64[2445] = $0;
+ $1 = +HEAPF64[2444];
+ $2 = $0 - $1;
+ HEAPF64[2447] = $2;
+ HEAPF64[2444] = $0;
+ $3 = +HEAPF64[2446];
+ $4 = $2 + $3;
+ HEAPF64[2430] = $4;
+ $5 = +HEAPF64[2441];
+ $6 = $4 < $5;
+ if (!($6)) {
+ return;
+ }
+ $7 = $5 - $4;
+ $8 = $7 * 1000.0;
+ $9 = $8;
+ _Wait($9);
+ $10 = (+_GetTime());
+ HEAPF64[2445] = $10;
+ $11 = +HEAPF64[2444];
+ $12 = $10 - $11;
+ HEAPF64[2444] = $10;
+ $13 = +HEAPF64[2430];
+ $14 = $12 + $13;
+ HEAPF64[2430] = $14;
+ return;
+}
+function _SwapBuffers() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = HEAP32[5664]|0;
+ _glfwSwapBuffers(($0|0));
+ return;
+}
+function _PollInputEvents() {
+ var $$04857 = 0, $$05160 = 0, $$058 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0;
+ var $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep67 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1456|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1456|0);
+ $0 = sp + 1440|0;
+ $1 = sp + 1432|0;
+ $2 = sp;
+ _UpdateGestures();
+ HEAP32[939] = -1;
+ HEAP32[941] = -1;
+ HEAP32[5700] = 0;
+ $3 = HEAP32[5664]|0;
+ _glfwGetCursorPos(($3|0),($0|0),($1|0));
+ $4 = +HEAPF64[$0>>3];
+ $5 = $4;
+ HEAPF32[4880] = $5;
+ $6 = +HEAPF64[$1>>3];
+ $7 = $6;
+ HEAPF32[(19524)>>2] = $7;
+ _memcpy((24095|0),(23583|0),512)|0;
+ ;HEAP8[23580>>0]=HEAP8[23577>>0]|0;HEAP8[23580+1>>0]=HEAP8[23577+1>>0]|0;HEAP8[23580+2>>0]=HEAP8[23577+2>>0]|0;
+ $8 = HEAP32[5699]|0;
+ HEAP32[5665] = $8;
+ HEAP32[5699] = 0;
+ $9 = (_emscripten_get_num_gamepads()|0);
+ $10 = ($9|0)>(0);
+ if (!($10)) {
+ STACKTOP = sp;return;
+ }
+ $11 = ((($2)) + 12|0);
+ $12 = ((($2)) + 8|0);
+ $$05160 = 0;
+ while(1) {
+ $scevgep = (24607 + ($$05160<<5)|0);
+ $scevgep67 = (24735 + ($$05160<<5)|0);
+ dest=$scevgep; src=$scevgep67; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
+ $13 = (_emscripten_get_gamepad_status(($$05160|0),($2|0))|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ $15 = HEAP32[$11>>2]|0;
+ $16 = ($15|0)>(0);
+ if ($16) {
+ $17 = HEAP32[$11>>2]|0;
+ $$04857 = 0;
+ while(1) {
+ $21 = (((($2)) + 1040|0) + ($$04857<<2)|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = ($22|0)==(1);
+ $24 = ((24735 + ($$05160<<5)|0) + ($$04857)|0);
+ if ($23) {
+ HEAP8[$24>>0] = 1;
+ HEAP32[941] = $$04857;
+ } else {
+ HEAP8[$24>>0] = 0;
+ }
+ $25 = (($$04857) + 1)|0;
+ $26 = ($25|0)<($17|0);
+ $27 = ($25|0)<(32);
+ $28 = $27 & $26;
+ if ($28) {
+ $$04857 = $25;
+ } else {
+ break;
+ }
+ }
+ }
+ $18 = HEAP32[$12>>2]|0;
+ $19 = ($18|0)>(0);
+ if ($19) {
+ $20 = HEAP32[$12>>2]|0;
+ $$058 = 0;
+ while(1) {
+ $29 = (((($2)) + 16|0) + ($$058<<3)|0);
+ $30 = +HEAPF64[$29>>3];
+ $31 = $30;
+ $32 = ((22804 + ($$05160<<5)|0) + ($$058<<2)|0);
+ HEAPF32[$32>>2] = $31;
+ $33 = (($$058) + 1)|0;
+ $34 = ($33|0)<($20|0);
+ $35 = ($33|0)<(8);
+ $36 = $35 & $34;
+ if ($36) {
+ $$058 = $33;
+ } else {
+ $$lcssa = $20;
+ break;
+ }
+ }
+ } else {
+ $$lcssa = $18;
+ }
+ HEAP32[5700] = $$lcssa;
+ }
+ $37 = (($$05160) + 1)|0;
+ $38 = ($37|0)<($9|0);
+ $39 = ($37|0)<(4);
+ $40 = $38 & $39;
+ if ($40) {
+ $$05160 = $37;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return;
+}
+function _Wait($0) {
+ $0 = +$0;
+ var $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (+_GetTime());
+ $2 = 0.0 - $1;
+ $3 = $0 / 1000.0;
+ $4 = $3;
+ $5 = $2 < $4;
+ if (!($5)) {
+ return;
+ }
+ while(1) {
+ $6 = (+_GetTime());
+ $7 = $6 - $1;
+ $8 = $7 < $4;
+ if (!($8)) {
+ break;
+ }
+ }
+ return;
+}
+function _Begin3dMode($0) {
+ $0 = $0|0;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy3 = 0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0;
+ var $8 = 0.0, $9 = 0.0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 160|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(160|0);
+ $$byval_copy3 = sp + 88|0;
+ $$byval_copy1 = sp + 76|0;
+ $$byval_copy = sp + 64|0;
+ $1 = sp;
+ _rlglDraw();
+ _rlMatrixMode(5889);
+ _rlPushMatrix();
+ _rlLoadIdentity();
+ $2 = HEAP32[5667]|0;
+ $3 = (+($2|0));
+ $4 = HEAP32[5668]|0;
+ $5 = (+($4|0));
+ $6 = $3 / $5;
+ $7 = ((($0)) + 36|0);
+ $8 = +HEAPF32[$7>>2];
+ $9 = $8 * 3.1415927410125732;
+ $10 = $9;
+ $11 = $10 / 360.0;
+ $12 = (+Math_tan((+$11)));
+ $13 = $12 * 0.01;
+ $14 = $6;
+ $15 = $13 * $14;
+ $16 = -$15;
+ $17 = -$13;
+ _rlFrustum($16,$15,$17,$13,0.01,1000.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ $18 = ((($0)) + 12|0);
+ $19 = ((($0)) + 24|0);
+ ;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
+ ;HEAP32[$$byval_copy1>>2]=HEAP32[$18>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$18+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$18+8>>2]|0;
+ ;HEAP32[$$byval_copy3>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$19+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$19+8>>2]|0;
+ _MatrixLookAt($1,$$byval_copy,$$byval_copy1,$$byval_copy3);
+ dest=$$byval_copy3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ (_MatrixToFloat($$byval_copy3)|0);
+ _rlMultMatrixf(21044);
+ _rlEnableDepthTest();
+ STACKTOP = sp;return;
+}
+function _rlFrustum($0,$1,$2,$3,$4,$5) {
+ $0 = +$0;
+ $1 = +$1;
+ $2 = +$2;
+ $3 = +$3;
+ $4 = +$4;
+ $5 = +$5;
+ var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $$byval_copy1 = sp + 192|0;
+ $$byval_copy = sp + 128|0;
+ $6 = sp + 64|0;
+ $7 = sp;
+ _MatrixFrustum($6,$0,$1,$2,$3,$4,$5);
+ _MatrixTranspose($6);
+ $8 = HEAP32[5625]|0;
+ dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _MatrixMultiply($7,$$byval_copy,$$byval_copy1);
+ dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _rlEnableDepthTest() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glEnable(2929);
+ return;
+}
+function _End3dMode() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ _rlMatrixMode(5889);
+ _rlPopMatrix();
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ _rlDisableDepthTest();
+ return;
+}
+function _rlDisableDepthTest() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glDisable(2929);
+ return;
+}
+function _BeginTextureMode($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ $1 = HEAP32[$0>>2]|0;
+ _rlEnableRenderTexture($1);
+ _rlClearScreenBuffers();
+ $2 = ((($0)) + 8|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($0)) + 12|0);
+ $5 = HEAP32[$4>>2]|0;
+ _rlViewport(0,0,$3,$5);
+ _rlMatrixMode(5889);
+ _rlLoadIdentity();
+ $6 = (+($3|0));
+ $7 = (+($5|0));
+ _rlOrtho(0.0,$6,$7,0.0,0.0,1.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ return;
+}
+function _rlEnableRenderTexture($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glBindFramebuffer(36160,($0|0));
+ return;
+}
+function _EndTextureMode() {
+ var $0 = 0, $1 = 0.0, $2 = 0, $3 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ _rlglDraw();
+ _rlDisableRenderTexture();
+ _SetupViewport();
+ _rlMatrixMode(5889);
+ _rlLoadIdentity();
+ $0 = (_GetScreenWidth()|0);
+ $1 = (+($0|0));
+ $2 = (_GetScreenHeight()|0);
+ $3 = (+($2|0));
+ _rlOrtho(0.0,$1,$3,0.0,0.0,1.0);
+ _rlMatrixMode(5888);
+ _rlLoadIdentity();
+ return;
+}
+function _rlDisableRenderTexture() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ _glBindFramebuffer(36160,0);
+ return;
+}
+function _Fade($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = +$2;
+ var $$0 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = $2 < 0.0;
+ if ($3) {
+ $$0 = 0.0;
+ } else {
+ $4 = $2 > 1.0;
+ if ($4) {
+ $$0 = 1.0;
+ } else {
+ $$0 = $2;
+ }
+ }
+ $5 = ((($1)) + 3|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = (+($6&255));
+ $8 = $$0 * $7;
+ $9 = HEAP8[$1>>0]|0;
+ HEAP8[$0>>0] = $9;
+ $10 = ((($0)) + 1|0);
+ $11 = ((($1)) + 1|0);
+ $12 = HEAP8[$11>>0]|0;
+ HEAP8[$10>>0] = $12;
+ $13 = ((($0)) + 2|0);
+ $14 = ((($1)) + 2|0);
+ $15 = HEAP8[$14>>0]|0;
+ HEAP8[$13>>0] = $15;
+ $16 = ((($0)) + 3|0);
+ $17 = (~~(($8))&255);
+ HEAP8[$16>>0] = $17;
+ return;
+}
+function _SetConfigFlags($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAP8[23576] = $0;
+ $1 = $0 & 1;
+ $2 = ($1<<24>>24)==(0);
+ if (!($2)) {
+ HEAP32[5669] = 1;
+ }
+ $3 = HEAP8[23576]|0;
+ $4 = $3 & 2;
+ $5 = ($4<<24>>24)==(0);
+ if ($5) {
+ return;
+ }
+ HEAP32[5692] = 1;
+ return;
+}
+function _IsKeyPressed($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (23583 + ($0)|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = (24095 + ($0)|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = ($2<<24>>24)!=($4<<24>>24);
+ $6 = ($2<<24>>24)==(1);
+ $or$cond = $6 & $5;
+ $$0 = $or$cond&1;
+ return ($$0|0);
+}
+function _rlDeleteShader($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0|0)==(0);
+ if ($1) {
+ return;
+ }
+ _glDeleteProgram(($0|0));
+ return;
+}
+function _LoadText($0) {
+ $0 = $0|0;
+ var $$0 = 0, $$1 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ $$1 = 0;
+ STACKTOP = sp;return ($$1|0);
+ }
+ $2 = (_fopen($0,13533)|0);
+ $3 = ($2|0)==(0|0);
+ if ($3) {
+ HEAP32[$vararg_buffer>>2] = $0;
+ _TraceLog(1,13536,$vararg_buffer);
+ $$1 = 0;
+ STACKTOP = sp;return ($$1|0);
+ }
+ (_fseek($2,0,2)|0);
+ $4 = (_ftell($2)|0);
+ _rewind($2);
+ $5 = ($4|0)>(0);
+ if ($5) {
+ $6 = (($4) + 1)|0;
+ $7 = (_malloc($6)|0);
+ $8 = (_fread($7,1,$4,$2)|0);
+ $9 = (($7) + ($8)|0);
+ HEAP8[$9>>0] = 0;
+ $$0 = $7;
+ } else {
+ $$0 = 0;
+ }
+ (_fclose($2)|0);
+ $$1 = $$0;
+ STACKTOP = sp;return ($$1|0);
+}
+function _LoadShader($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $vararg_buffer = sp;
+ $3 = sp + 8|0;
+ dest=$3; stop=dest+56|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $4 = (_LoadText($1)|0);
+ $5 = (_LoadText($2)|0);
+ $6 = ($4|0)!=(0|0);
+ $7 = ($5|0)!=(0|0);
+ $or$cond = $6 & $7;
+ if ($or$cond) {
+ $8 = (_LoadShaderProgram($4,$5)|0);
+ HEAP32[$3>>2] = $8;
+ $9 = ($8|0)==(0);
+ if (!($9)) {
+ _LoadDefaultShaderLocations($3);
+ }
+ _free($4);
+ _free($5);
+ }
+ $10 = HEAP32[$3>>2]|0;
+ $11 = ($10|0)==(0);
+ if ($11) {
+ _TraceLog(1,13571,$vararg_buffer);
+ dest=$3; src=22536; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ }
+ dest=$0; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ STACKTOP = sp;return;
+}
+function _UnloadShader($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = ($1|0)==(0);
+ if ($2) {
+ STACKTOP = sp;return;
+ }
+ _rlDeleteShader($1);
+ $3 = HEAP32[$0>>2]|0;
+ HEAP32[$vararg_buffer>>2] = $3;
+ _TraceLog(0,13605,$vararg_buffer);
+ STACKTOP = sp;return;
+}
+function _BeginShaderMode($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[5245]|0;
+ $2 = HEAP32[$0>>2]|0;
+ $3 = ($1|0)==($2|0);
+ if ($3) {
+ return;
+ }
+ _rlglDraw();
+ dest=20980; src=$0; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ return;
+}
+function _EndShaderMode() {
+ var $defaultShader$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $defaultShader$byval_copy = sp;
+ dest=$defaultShader$byval_copy; src=22536; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ _BeginShaderMode($defaultShader$byval_copy);
+ STACKTOP = sp;return;
+}
+function _emscripten_GetProcAddress($0) {
+ $0 = $0|0;
+ var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
+ var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
+ var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
+ var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
+ var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
+ var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
+ var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
+ var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
+ var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
+ var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
+ var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
+ var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
+ var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
+ var $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0;
+ var $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0;
+ var $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0;
+ var $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0;
+ var $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0;
+ var $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0;
+ var $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0;
+ var $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0;
+ var $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0;
+ var $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0;
+ var $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0;
+ var $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0;
+ var $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
+ var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
+ var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp + 12|0;
+ $2 = sp + 8|0;
+ $3 = sp + 4|0;
+ $4 = sp;
+ HEAP32[$2>>2] = $0;
+ $5 = HEAP32[$2>>2]|0;
+ $6 = (_strlen($5)|0);
+ $7 = (($6) + 1)|0;
+ $8 = (_malloc($7)|0);
+ HEAP32[$3>>2] = $8;
+ $9 = HEAP32[$3>>2]|0;
+ $10 = HEAP32[$2>>2]|0;
+ (_strcpy($9,$10)|0);
+ $11 = HEAP32[$3>>2]|0;
+ $12 = (_strstr($11,13647)|0);
+ HEAP32[$4>>2] = $12;
+ $13 = HEAP32[$4>>2]|0;
+ $14 = ($13|0)!=(0|0);
+ if ($14) {
+ $15 = HEAP32[$4>>2]|0;
+ HEAP8[$15>>0] = 0;
+ }
+ $16 = HEAP32[$3>>2]|0;
+ $17 = (_strstr($16,13651)|0);
+ HEAP32[$4>>2] = $17;
+ $18 = HEAP32[$4>>2]|0;
+ $19 = ($18|0)!=(0|0);
+ if ($19) {
+ $20 = HEAP32[$4>>2]|0;
+ HEAP8[$20>>0] = 0;
+ }
+ $21 = HEAP32[$3>>2]|0;
+ $22 = (_strstr($21,13655)|0);
+ HEAP32[$4>>2] = $22;
+ $23 = HEAP32[$4>>2]|0;
+ $24 = ($23|0)!=(0|0);
+ if ($24) {
+ $25 = HEAP32[$4>>2]|0;
+ HEAP8[$25>>0] = 0;
+ }
+ $26 = HEAP32[$3>>2]|0;
+ $27 = (_strstr($26,13659)|0);
+ HEAP32[$4>>2] = $27;
+ $28 = HEAP32[$4>>2]|0;
+ $29 = ($28|0)!=(0|0);
+ if ($29) {
+ $30 = HEAP32[$4>>2]|0;
+ HEAP8[$30>>0] = 0;
+ }
+ $31 = HEAP32[$3>>2]|0;
+ $32 = (_strcmp($31,13665)|0);
+ $33 = ($32|0)!=(0);
+ do {
+ if ($33) {
+ $34 = HEAP32[$3>>2]|0;
+ $35 = (_strcmp($34,13703)|0);
+ $36 = ($35|0)!=(0);
+ if (!($36)) {
+ HEAP32[$3>>2] = 13722;
+ break;
+ }
+ $37 = HEAP32[$3>>2]|0;
+ $38 = (_strcmp($37,13735)|0);
+ $39 = ($38|0)!=(0);
+ if (!($39)) {
+ HEAP32[$3>>2] = 13756;
+ break;
+ }
+ $40 = HEAP32[$3>>2]|0;
+ $41 = (_strcmp($40,13771)|0);
+ $42 = ($41|0)!=(0);
+ if (!($42)) {
+ HEAP32[$3>>2] = 13786;
+ break;
+ }
+ $43 = HEAP32[$3>>2]|0;
+ $44 = (_strcmp($43,13801)|0);
+ $45 = ($44|0)!=(0);
+ if (!($45)) {
+ HEAP32[$3>>2] = 13816;
+ }
+ } else {
+ HEAP32[$3>>2] = 13687;
+ }
+ } while(0);
+ $46 = HEAP32[$3>>2]|0;
+ $47 = (_strcmp($46,13831)|0);
+ $48 = ($47|0)!=(0);
+ do {
+ if ($48) {
+ $49 = HEAP32[$3>>2]|0;
+ $50 = (_strcmp($49,13845)|0);
+ $51 = ($50|0)!=(0);
+ if (!($51)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $52 = HEAP32[$3>>2]|0;
+ $53 = (_strcmp($52,13857)|0);
+ $54 = ($53|0)!=(0);
+ if (!($54)) {
+ HEAP32[$1>>2] = 7;
+ break;
+ }
+ $55 = HEAP32[$3>>2]|0;
+ $56 = (_strcmp($55,13871)|0);
+ $57 = ($56|0)!=(0);
+ if (!($57)) {
+ HEAP32[$1>>2] = 8;
+ break;
+ }
+ $58 = HEAP32[$3>>2]|0;
+ $59 = (_strcmp($58,13883)|0);
+ $60 = ($59|0)!=(0);
+ if (!($60)) {
+ HEAP32[$1>>2] = 9;
+ break;
+ }
+ $61 = HEAP32[$3>>2]|0;
+ $62 = (_strcmp($61,13897)|0);
+ $63 = ($62|0)!=(0);
+ if (!($63)) {
+ HEAP32[$1>>2] = 10;
+ break;
+ }
+ $64 = HEAP32[$3>>2]|0;
+ $65 = (_strcmp($64,13911)|0);
+ $66 = ($65|0)!=(0);
+ if (!($66)) {
+ HEAP32[$1>>2] = 11;
+ break;
+ }
+ $67 = HEAP32[$3>>2]|0;
+ $68 = (_strcmp($67,13928)|0);
+ $69 = ($68|0)!=(0);
+ if (!($69)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $70 = HEAP32[$3>>2]|0;
+ $71 = (_strcmp($70,13951)|0);
+ $72 = ($71|0)!=(0);
+ if (!($72)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $73 = HEAP32[$3>>2]|0;
+ $74 = (_strcmp($73,13977)|0);
+ $75 = ($74|0)!=(0);
+ if (!($75)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $76 = HEAP32[$3>>2]|0;
+ $77 = (_strcmp($76,13990)|0);
+ $78 = ($77|0)!=(0);
+ if (!($78)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $79 = HEAP32[$3>>2]|0;
+ $80 = (_strcmp($79,14006)|0);
+ $81 = ($80|0)!=(0);
+ if (!($81)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $82 = HEAP32[$3>>2]|0;
+ $83 = (_strcmp($82,14019)|0);
+ $84 = ($83|0)!=(0);
+ if (!($84)) {
+ HEAP32[$1>>2] = 12;
+ break;
+ }
+ $85 = HEAP32[$3>>2]|0;
+ $86 = (_strcmp($85,14033)|0);
+ $87 = ($86|0)!=(0);
+ if (!($87)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $88 = HEAP32[$3>>2]|0;
+ $89 = (_strcmp($88,14053)|0);
+ $90 = ($89|0)!=(0);
+ if (!($90)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $91 = HEAP32[$3>>2]|0;
+ $92 = (_strcmp($91,14073)|0);
+ $93 = ($92|0)!=(0);
+ if (!($93)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $94 = HEAP32[$3>>2]|0;
+ $95 = (_strcmp($94,14090)|0);
+ $96 = ($95|0)!=(0);
+ if (!($96)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $97 = HEAP32[$3>>2]|0;
+ $98 = (_strcmp($97,14107)|0);
+ $99 = ($98|0)!=(0);
+ if (!($99)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $100 = HEAP32[$3>>2]|0;
+ $101 = (_strcmp($100,14119)|0);
+ $102 = ($101|0)!=(0);
+ if (!($102)) {
+ HEAP32[$1>>2] = 13;
+ break;
+ }
+ $103 = HEAP32[$3>>2]|0;
+ $104 = (_strcmp($103,14132)|0);
+ $105 = ($104|0)!=(0);
+ if (!($105)) {
+ HEAP32[$1>>2] = 14;
+ break;
+ }
+ $106 = HEAP32[$3>>2]|0;
+ $107 = (_strcmp($106,14148)|0);
+ $108 = ($107|0)!=(0);
+ if (!($108)) {
+ HEAP32[$1>>2] = 6;
+ break;
+ }
+ $109 = HEAP32[$3>>2]|0;
+ $110 = (_strcmp($109,14171)|0);
+ $111 = ($110|0)!=(0);
+ if (!($111)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $112 = HEAP32[$3>>2]|0;
+ $113 = (_strcmp($112,14184)|0);
+ $114 = ($113|0)!=(0);
+ if (!($114)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $115 = HEAP32[$3>>2]|0;
+ $116 = (_strcmp($115,14200)|0);
+ $117 = ($116|0)!=(0);
+ if (!($117)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $118 = HEAP32[$3>>2]|0;
+ $119 = (_strcmp($118,14211)|0);
+ $120 = ($119|0)!=(0);
+ if (!($120)) {
+ HEAP32[$1>>2] = 15;
+ break;
+ }
+ $121 = HEAP32[$3>>2]|0;
+ $122 = (_strcmp($121,14230)|0);
+ $123 = ($122|0)!=(0);
+ if (!($123)) {
+ HEAP32[$1>>2] = 16;
+ break;
+ }
+ $124 = HEAP32[$3>>2]|0;
+ $125 = (_strcmp($124,14252)|0);
+ $126 = ($125|0)!=(0);
+ if (!($126)) {
+ HEAP32[$1>>2] = 17;
+ break;
+ }
+ $127 = HEAP32[$3>>2]|0;
+ $128 = (_strcmp($127,14271)|0);
+ $129 = ($128|0)!=(0);
+ if (!($129)) {
+ HEAP32[$1>>2] = 7;
+ break;
+ }
+ $130 = HEAP32[$3>>2]|0;
+ $131 = (_strcmp($130,14300)|0);
+ $132 = ($131|0)!=(0);
+ if (!($132)) {
+ HEAP32[$1>>2] = 6;
+ break;
+ }
+ $133 = HEAP32[$3>>2]|0;
+ $134 = (_strcmp($133,14317)|0);
+ $135 = ($134|0)!=(0);
+ if (!($135)) {
+ HEAP32[$1>>2] = 8;
+ break;
+ }
+ $136 = HEAP32[$3>>2]|0;
+ $137 = (_strcmp($136,14332)|0);
+ $138 = ($137|0)!=(0);
+ if (!($138)) {
+ HEAP32[$1>>2] = 9;
+ break;
+ }
+ $139 = HEAP32[$3>>2]|0;
+ $140 = (_strcmp($139,14347)|0);
+ $141 = ($140|0)!=(0);
+ if (!($141)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $142 = HEAP32[$3>>2]|0;
+ $143 = (_strcmp($142,14368)|0);
+ $144 = ($143|0)!=(0);
+ if (!($144)) {
+ HEAP32[$1>>2] = 10;
+ break;
+ }
+ $145 = HEAP32[$3>>2]|0;
+ $146 = (_strcmp($145,14388)|0);
+ $147 = ($146|0)!=(0);
+ if (!($147)) {
+ HEAP32[$1>>2] = 11;
+ break;
+ }
+ $148 = HEAP32[$3>>2]|0;
+ $149 = (_strcmp($148,14408)|0);
+ $150 = ($149|0)!=(0);
+ if (!($150)) {
+ HEAP32[$1>>2] = 12;
+ break;
+ }
+ $151 = HEAP32[$3>>2]|0;
+ $152 = (_strcmp($151,14434)|0);
+ $153 = ($152|0)!=(0);
+ if (!($153)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $154 = HEAP32[$3>>2]|0;
+ $155 = (_strcmp($154,14453)|0);
+ $156 = ($155|0)!=(0);
+ if (!($156)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $157 = HEAP32[$3>>2]|0;
+ $158 = (_strcmp($157,14465)|0);
+ $159 = ($158|0)!=(0);
+ if (!($159)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $160 = HEAP32[$3>>2]|0;
+ $161 = (_strcmp($160,14477)|0);
+ $162 = ($161|0)!=(0);
+ if (!($162)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $163 = HEAP32[$3>>2]|0;
+ $164 = (_strcmp($163,14489)|0);
+ $165 = ($164|0)!=(0);
+ if (!($165)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $166 = HEAP32[$3>>2]|0;
+ $167 = (_strcmp($166,14501)|0);
+ $168 = ($167|0)!=(0);
+ if (!($168)) {
+ HEAP32[$1>>2] = 18;
+ break;
+ }
+ $169 = HEAP32[$3>>2]|0;
+ $170 = (_strcmp($169,14513)|0);
+ $171 = ($170|0)!=(0);
+ if (!($171)) {
+ HEAP32[$1>>2] = 13;
+ break;
+ }
+ $172 = HEAP32[$3>>2]|0;
+ $173 = (_strcmp($172,14525)|0);
+ $174 = ($173|0)!=(0);
+ if (!($174)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $175 = HEAP32[$3>>2]|0;
+ $176 = (_strcmp($175,14537)|0);
+ $177 = ($176|0)!=(0);
+ if (!($177)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $178 = HEAP32[$3>>2]|0;
+ $179 = (_strcmp($178,14549)|0);
+ $180 = ($179|0)!=(0);
+ if (!($180)) {
+ HEAP32[$1>>2] = 14;
+ break;
+ }
+ $181 = HEAP32[$3>>2]|0;
+ $182 = (_strcmp($181,14562)|0);
+ $183 = ($182|0)!=(0);
+ if (!($183)) {
+ HEAP32[$1>>2] = 15;
+ break;
+ }
+ $184 = HEAP32[$3>>2]|0;
+ $185 = (_strcmp($184,14575)|0);
+ $186 = ($185|0)!=(0);
+ if (!($186)) {
+ HEAP32[$1>>2] = 16;
+ break;
+ }
+ $187 = HEAP32[$3>>2]|0;
+ $188 = (_strcmp($187,14588)|0);
+ $189 = ($188|0)!=(0);
+ if (!($189)) {
+ HEAP32[$1>>2] = 17;
+ break;
+ }
+ $190 = HEAP32[$3>>2]|0;
+ $191 = (_strcmp($190,14601)|0);
+ $192 = ($191|0)!=(0);
+ if (!($192)) {
+ HEAP32[$1>>2] = 18;
+ break;
+ }
+ $193 = HEAP32[$3>>2]|0;
+ $194 = (_strcmp($193,14614)|0);
+ $195 = ($194|0)!=(0);
+ if (!($195)) {
+ HEAP32[$1>>2] = 19;
+ break;
+ }
+ $196 = HEAP32[$3>>2]|0;
+ $197 = (_strcmp($196,14627)|0);
+ $198 = ($197|0)!=(0);
+ if (!($198)) {
+ HEAP32[$1>>2] = 20;
+ break;
+ }
+ $199 = HEAP32[$3>>2]|0;
+ $200 = (_strcmp($199,14640)|0);
+ $201 = ($200|0)!=(0);
+ if (!($201)) {
+ HEAP32[$1>>2] = 21;
+ break;
+ }
+ $202 = HEAP32[$3>>2]|0;
+ $203 = (_strcmp($202,14653)|0);
+ $204 = ($203|0)!=(0);
+ if (!($204)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $205 = HEAP32[$3>>2]|0;
+ $206 = (_strcmp($205,14672)|0);
+ $207 = ($206|0)!=(0);
+ if (!($207)) {
+ HEAP32[$1>>2] = 6;
+ break;
+ }
+ $208 = HEAP32[$3>>2]|0;
+ $209 = (_strcmp($208,14691)|0);
+ $210 = ($209|0)!=(0);
+ if (!($210)) {
+ HEAP32[$1>>2] = 7;
+ break;
+ }
+ $211 = HEAP32[$3>>2]|0;
+ $212 = (_strcmp($211,14710)|0);
+ $213 = ($212|0)!=(0);
+ if (!($213)) {
+ HEAP32[$1>>2] = 19;
+ break;
+ }
+ $214 = HEAP32[$3>>2]|0;
+ $215 = (_strcmp($214,14723)|0);
+ $216 = ($215|0)!=(0);
+ if (!($216)) {
+ HEAP32[$1>>2] = 20;
+ break;
+ }
+ $217 = HEAP32[$3>>2]|0;
+ $218 = (_strcmp($217,14741)|0);
+ $219 = ($218|0)!=(0);
+ if (!($219)) {
+ HEAP32[$1>>2] = 21;
+ break;
+ }
+ $220 = HEAP32[$3>>2]|0;
+ $221 = (_strcmp($220,14759)|0);
+ $222 = ($221|0)!=(0);
+ if (!($222)) {
+ HEAP32[$1>>2] = 22;
+ break;
+ }
+ $223 = HEAP32[$3>>2]|0;
+ $224 = (_strcmp($223,14777)|0);
+ $225 = ($224|0)!=(0);
+ if (!($225)) {
+ HEAP32[$1>>2] = 23;
+ break;
+ }
+ $226 = HEAP32[$3>>2]|0;
+ $227 = (_strcmp($226,14795)|0);
+ $228 = ($227|0)!=(0);
+ if (!($228)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $229 = HEAP32[$3>>2]|0;
+ $230 = (_strcmp($229,14815)|0);
+ $231 = ($230|0)!=(0);
+ if (!($231)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $232 = HEAP32[$3>>2]|0;
+ $233 = (_strcmp($232,13756)|0);
+ $234 = ($233|0)!=(0);
+ if (!($234)) {
+ HEAP32[$1>>2] = 7;
+ break;
+ }
+ $235 = HEAP32[$3>>2]|0;
+ $236 = (_strcmp($235,14833)|0);
+ $237 = ($236|0)!=(0);
+ if (!($237)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $238 = HEAP32[$3>>2]|0;
+ $239 = (_strcmp($238,14848)|0);
+ $240 = ($239|0)!=(0);
+ if (!($240)) {
+ HEAP32[$1>>2] = 8;
+ break;
+ }
+ $241 = HEAP32[$3>>2]|0;
+ $242 = (_strcmp($241,14869)|0);
+ $243 = ($242|0)!=(0);
+ if (!($243)) {
+ HEAP32[$1>>2] = 9;
+ break;
+ }
+ $244 = HEAP32[$3>>2]|0;
+ $245 = (_strcmp($244,14884)|0);
+ $246 = ($245|0)!=(0);
+ if (!($246)) {
+ HEAP32[$1>>2] = 10;
+ break;
+ }
+ $247 = HEAP32[$3>>2]|0;
+ $248 = (_strcmp($247,14902)|0);
+ $249 = ($248|0)!=(0);
+ if (!($249)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $250 = HEAP32[$3>>2]|0;
+ $251 = (_strcmp($250,14918)|0);
+ $252 = ($251|0)!=(0);
+ if (!($252)) {
+ HEAP32[$1>>2] = 11;
+ break;
+ }
+ $253 = HEAP32[$3>>2]|0;
+ $254 = (_strcmp($253,14937)|0);
+ $255 = ($254|0)!=(0);
+ if (!($255)) {
+ HEAP32[$1>>2] = 22;
+ break;
+ }
+ $256 = HEAP32[$3>>2]|0;
+ $257 = (_strcmp($256,14951)|0);
+ $258 = ($257|0)!=(0);
+ if (!($258)) {
+ HEAP32[$1>>2] = 23;
+ break;
+ }
+ $259 = HEAP32[$3>>2]|0;
+ $260 = (_strcmp($259,14966)|0);
+ $261 = ($260|0)!=(0);
+ if (!($261)) {
+ HEAP32[$1>>2] = 8;
+ break;
+ }
+ $262 = HEAP32[$3>>2]|0;
+ $263 = (_strcmp($262,13687)|0);
+ $264 = ($263|0)!=(0);
+ if (!($264)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $265 = HEAP32[$3>>2]|0;
+ $266 = (_strcmp($265,14977)|0);
+ $267 = ($266|0)!=(0);
+ if (!($267)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $268 = HEAP32[$3>>2]|0;
+ $269 = (_strcmp($268,13786)|0);
+ $270 = ($269|0)!=(0);
+ if (!($270)) {
+ HEAP32[$1>>2] = 24;
+ break;
+ }
+ $271 = HEAP32[$3>>2]|0;
+ $272 = (_strcmp($271,13816)|0);
+ $273 = ($272|0)!=(0);
+ if (!($273)) {
+ HEAP32[$1>>2] = 25;
+ break;
+ }
+ $274 = HEAP32[$3>>2]|0;
+ $275 = (_strcmp($274,14993)|0);
+ $276 = ($275|0)!=(0);
+ if (!($276)) {
+ HEAP32[$1>>2] = 12;
+ break;
+ }
+ $277 = HEAP32[$3>>2]|0;
+ $278 = (_strcmp($277,15020)|0);
+ $279 = ($278|0)!=(0);
+ if (!($279)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $280 = HEAP32[$3>>2]|0;
+ $281 = (_strcmp($280,15034)|0);
+ $282 = ($281|0)!=(0);
+ if (!($282)) {
+ HEAP32[$1>>2] = 13;
+ break;
+ }
+ $283 = HEAP32[$3>>2]|0;
+ $284 = (_strcmp($283,13722)|0);
+ $285 = ($284|0)!=(0);
+ if (!($285)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $286 = HEAP32[$3>>2]|0;
+ $287 = (_strcmp($286,15054)|0);
+ $288 = ($287|0)!=(0);
+ if (!($288)) {
+ HEAP32[$1>>2] = 6;
+ break;
+ }
+ $289 = HEAP32[$3>>2]|0;
+ $290 = (_strcmp($289,15072)|0);
+ $291 = ($290|0)!=(0);
+ if (!($291)) {
+ HEAP32[$1>>2] = 9;
+ break;
+ }
+ $292 = HEAP32[$3>>2]|0;
+ $293 = (_strcmp($292,15084)|0);
+ $294 = ($293|0)!=(0);
+ if (!($294)) {
+ HEAP32[$1>>2] = 24;
+ break;
+ }
+ $295 = HEAP32[$3>>2]|0;
+ $296 = (_strcmp($295,15105)|0);
+ $297 = ($296|0)!=(0);
+ if (!($297)) {
+ HEAP32[$1>>2] = 26;
+ break;
+ }
+ $298 = HEAP32[$3>>2]|0;
+ $299 = (_strcmp($298,15123)|0);
+ $300 = ($299|0)!=(0);
+ if (!($300)) {
+ HEAP32[$1>>2] = 27;
+ break;
+ }
+ $301 = HEAP32[$3>>2]|0;
+ $302 = (_strcmp($301,15141)|0);
+ $303 = ($302|0)!=(0);
+ if (!($303)) {
+ HEAP32[$1>>2] = 28;
+ break;
+ }
+ $304 = HEAP32[$3>>2]|0;
+ $305 = (_strcmp($304,15162)|0);
+ $306 = ($305|0)!=(0);
+ if (!($306)) {
+ HEAP32[$1>>2] = 14;
+ break;
+ }
+ $307 = HEAP32[$3>>2]|0;
+ $308 = (_strcmp($307,15188)|0);
+ $309 = ($308|0)!=(0);
+ if (!($309)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $310 = HEAP32[$3>>2]|0;
+ $311 = (_strcmp($310,15211)|0);
+ $312 = ($311|0)!=(0);
+ if (!($312)) {
+ HEAP32[$1>>2] = 15;
+ break;
+ }
+ $313 = HEAP32[$3>>2]|0;
+ $314 = (_strcmp($313,15249)|0);
+ $315 = ($314|0)!=(0);
+ if (!($315)) {
+ HEAP32[$1>>2] = 10;
+ break;
+ }
+ $316 = HEAP32[$3>>2]|0;
+ $317 = (_strcmp($316,15265)|0);
+ $318 = ($317|0)!=(0);
+ if (!($318)) {
+ HEAP32[$1>>2] = 7;
+ break;
+ }
+ $319 = HEAP32[$3>>2]|0;
+ $320 = (_strcmp($319,15280)|0);
+ $321 = ($320|0)!=(0);
+ if (!($321)) {
+ HEAP32[$1>>2] = 25;
+ break;
+ }
+ $322 = HEAP32[$3>>2]|0;
+ $323 = (_strcmp($322,15303)|0);
+ $324 = ($323|0)!=(0);
+ if (!($324)) {
+ HEAP32[$1>>2] = 16;
+ break;
+ }
+ $325 = HEAP32[$3>>2]|0;
+ $326 = (_strcmp($325,15316)|0);
+ $327 = ($326|0)!=(0);
+ if (!($327)) {
+ HEAP32[$1>>2] = 29;
+ break;
+ }
+ $328 = HEAP32[$3>>2]|0;
+ $329 = (_strcmp($328,15330)|0);
+ $330 = ($329|0)!=(0);
+ if (!($330)) {
+ HEAP32[$1>>2] = 30;
+ break;
+ }
+ $331 = HEAP32[$3>>2]|0;
+ $332 = (_strcmp($331,15344)|0);
+ $333 = ($332|0)!=(0);
+ if (!($333)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $334 = HEAP32[$3>>2]|0;
+ $335 = (_strcmp($334,15364)|0);
+ $336 = ($335|0)!=(0);
+ if (!($336)) {
+ HEAP32[$1>>2] = 8;
+ break;
+ }
+ $337 = HEAP32[$3>>2]|0;
+ $338 = (_strcmp($337,15384)|0);
+ $339 = ($338|0)!=(0);
+ if (!($339)) {
+ HEAP32[$1>>2] = 17;
+ break;
+ }
+ $340 = HEAP32[$3>>2]|0;
+ $341 = (_strcmp($340,15400)|0);
+ $342 = ($341|0)!=(0);
+ if (!($342)) {
+ HEAP32[$1>>2] = 18;
+ break;
+ }
+ $343 = HEAP32[$3>>2]|0;
+ $344 = (_strcmp($343,15418)|0);
+ $345 = ($344|0)!=(0);
+ if (!($345)) {
+ HEAP32[$1>>2] = 26;
+ break;
+ }
+ $346 = HEAP32[$3>>2]|0;
+ $347 = (_strcmp($346,15434)|0);
+ $348 = ($347|0)!=(0);
+ if (!($348)) {
+ HEAP32[$1>>2] = 19;
+ break;
+ }
+ $349 = HEAP32[$3>>2]|0;
+ $350 = (_strcmp($349,15449)|0);
+ $351 = ($350|0)!=(0);
+ if (!($351)) {
+ HEAP32[$1>>2] = 9;
+ break;
+ }
+ $352 = HEAP32[$3>>2]|0;
+ $353 = (_strcmp($352,15471)|0);
+ $354 = ($353|0)!=(0);
+ if (!($354)) {
+ HEAP32[$1>>2] = 31;
+ break;
+ }
+ $355 = HEAP32[$3>>2]|0;
+ $356 = (_strcmp($355,15489)|0);
+ $357 = ($356|0)!=(0);
+ if (!($357)) {
+ HEAP32[$1>>2] = 32;
+ break;
+ }
+ $358 = HEAP32[$3>>2]|0;
+ $359 = (_strcmp($358,15510)|0);
+ $360 = ($359|0)!=(0);
+ if (!($360)) {
+ HEAP32[$1>>2] = 10;
+ break;
+ }
+ $361 = HEAP32[$3>>2]|0;
+ $362 = (_strcmp($361,15528)|0);
+ $363 = ($362|0)!=(0);
+ if (!($363)) {
+ HEAP32[$1>>2] = 11;
+ break;
+ }
+ $364 = HEAP32[$3>>2]|0;
+ $365 = (_strcmp($364,15541)|0);
+ $366 = ($365|0)!=(0);
+ if (!($366)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $367 = HEAP32[$3>>2]|0;
+ $368 = (_strcmp($367,15556)|0);
+ $369 = ($368|0)!=(0);
+ if (!($369)) {
+ HEAP32[$1>>2] = 12;
+ break;
+ }
+ $370 = HEAP32[$3>>2]|0;
+ $371 = (_strcmp($370,15570)|0);
+ $372 = ($371|0)!=(0);
+ if (!($372)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $373 = HEAP32[$3>>2]|0;
+ $374 = (_strcmp($373,15580)|0);
+ $375 = ($374|0)!=(0);
+ if (!($375)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $376 = HEAP32[$3>>2]|0;
+ $377 = (_strcmp($376,15590)|0);
+ $378 = ($377|0)!=(0);
+ if (!($378)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $379 = HEAP32[$3>>2]|0;
+ $380 = (_strcmp($379,15612)|0);
+ $381 = ($380|0)!=(0);
+ if (!($381)) {
+ HEAP32[$1>>2] = 13;
+ break;
+ }
+ $382 = HEAP32[$3>>2]|0;
+ $383 = (_strcmp($382,15638)|0);
+ $384 = ($383|0)!=(0);
+ if (!($384)) {
+ HEAP32[$1>>2] = 14;
+ break;
+ }
+ $385 = HEAP32[$3>>2]|0;
+ $386 = (_strcmp($385,15665)|0);
+ $387 = ($386|0)!=(0);
+ if (!($387)) {
+ HEAP32[$1>>2] = 27;
+ break;
+ }
+ $388 = HEAP32[$3>>2]|0;
+ $389 = (_strcmp($388,15678)|0);
+ $390 = ($389|0)!=(0);
+ if (!($390)) {
+ HEAP32[$1>>2] = 20;
+ break;
+ }
+ $391 = HEAP32[$3>>2]|0;
+ $392 = (_strcmp($391,15693)|0);
+ $393 = ($392|0)!=(0);
+ if (!($393)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $394 = HEAP32[$3>>2]|0;
+ $395 = (_strcmp($394,15708)|0);
+ $396 = ($395|0)!=(0);
+ if (!($396)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $397 = HEAP32[$3>>2]|0;
+ $398 = (_strcmp($397,15732)|0);
+ $399 = ($398|0)!=(0);
+ if (!($399)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $400 = HEAP32[$3>>2]|0;
+ $401 = (_strcmp($400,15743)|0);
+ $402 = ($401|0)!=(0);
+ if (!($402)) {
+ HEAP32[$1>>2] = 33;
+ break;
+ }
+ $403 = HEAP32[$3>>2]|0;
+ $404 = (_strcmp($403,15765)|0);
+ $405 = ($404|0)!=(0);
+ if (!($405)) {
+ HEAP32[$1>>2] = 21;
+ break;
+ }
+ $406 = HEAP32[$3>>2]|0;
+ $407 = (_strcmp($406,15787)|0);
+ $408 = ($407|0)!=(0);
+ if (!($408)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $409 = HEAP32[$3>>2]|0;
+ $410 = (_strcmp($409,15811)|0);
+ $411 = ($410|0)!=(0);
+ if (!($411)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $412 = HEAP32[$3>>2]|0;
+ $413 = (_strcmp($412,15820)|0);
+ $414 = ($413|0)!=(0);
+ if (!($414)) {
+ HEAP32[$1>>2] = 5;
+ break;
+ }
+ $415 = HEAP32[$3>>2]|0;
+ $416 = (_strcmp($415,15828)|0);
+ $417 = ($416|0)!=(0);
+ if (!($417)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $418 = HEAP32[$3>>2]|0;
+ $419 = (_strcmp($418,15841)|0);
+ $420 = ($419|0)!=(0);
+ if (!($420)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $421 = HEAP32[$3>>2]|0;
+ $422 = (_strcmp($421,15855)|0);
+ $423 = ($422|0)!=(0);
+ if (!($423)) {
+ HEAP32[$1>>2] = 15;
+ break;
+ }
+ $424 = HEAP32[$3>>2]|0;
+ $425 = (_strcmp($424,15867)|0);
+ $426 = ($425|0)!=(0);
+ if (!($426)) {
+ HEAP32[$1>>2] = 16;
+ break;
+ }
+ $427 = HEAP32[$3>>2]|0;
+ $428 = (_strcmp($427,15876)|0);
+ $429 = ($428|0)!=(0);
+ if (!($429)) {
+ HEAP32[$1>>2] = 17;
+ break;
+ }
+ $430 = HEAP32[$3>>2]|0;
+ $431 = (_strcmp($430,15886)|0);
+ $432 = ($431|0)!=(0);
+ if (!($432)) {
+ HEAP32[$1>>2] = 18;
+ break;
+ }
+ $433 = HEAP32[$3>>2]|0;
+ $434 = (_strcmp($433,15898)|0);
+ $435 = ($434|0)!=(0);
+ if (!($435)) {
+ HEAP32[$1>>2] = 19;
+ break;
+ }
+ $436 = HEAP32[$3>>2]|0;
+ $437 = (_strcmp($436,15909)|0);
+ $438 = ($437|0)!=(0);
+ if (!($438)) {
+ HEAP32[$1>>2] = 20;
+ break;
+ }
+ $439 = HEAP32[$3>>2]|0;
+ $440 = (_strcmp($439,15917)|0);
+ $441 = ($440|0)!=(0);
+ if (!($441)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $442 = HEAP32[$3>>2]|0;
+ $443 = (_strcmp($442,15929)|0);
+ $444 = ($443|0)!=(0);
+ if (!($444)) {
+ HEAP32[$1>>2] = 21;
+ break;
+ }
+ $445 = HEAP32[$3>>2]|0;
+ $446 = (_strcmp($445,15944)|0);
+ $447 = ($446|0)!=(0);
+ if (!($447)) {
+ HEAP32[$1>>2] = 22;
+ break;
+ }
+ $448 = HEAP32[$3>>2]|0;
+ $449 = (_strcmp($448,15956)|0);
+ $450 = ($449|0)!=(0);
+ if (!($450)) {
+ HEAP32[$1>>2] = 23;
+ break;
+ }
+ $451 = HEAP32[$3>>2]|0;
+ $452 = (_strcmp($451,15970)|0);
+ $453 = ($452|0)!=(0);
+ if (!($453)) {
+ HEAP32[$1>>2] = 11;
+ break;
+ }
+ $454 = HEAP32[$3>>2]|0;
+ $455 = (_strcmp($454,15995)|0);
+ $456 = ($455|0)!=(0);
+ if (!($456)) {
+ HEAP32[$1>>2] = 24;
+ break;
+ }
+ $457 = HEAP32[$3>>2]|0;
+ $458 = (_strcmp($457,16012)|0);
+ $459 = ($458|0)!=(0);
+ if (!($459)) {
+ HEAP32[$1>>2] = 25;
+ break;
+ }
+ $460 = HEAP32[$3>>2]|0;
+ $461 = (_strcmp($460,16028)|0);
+ $462 = ($461|0)!=(0);
+ if (!($462)) {
+ HEAP32[$1>>2] = 26;
+ break;
+ }
+ $463 = HEAP32[$3>>2]|0;
+ $464 = (_strcmp($463,16044)|0);
+ $465 = ($464|0)!=(0);
+ if (!($465)) {
+ HEAP32[$1>>2] = 12;
+ break;
+ }
+ $466 = HEAP32[$3>>2]|0;
+ $467 = (_strcmp($466,16056)|0);
+ $468 = ($467|0)!=(0);
+ if (!($468)) {
+ HEAP32[$1>>2] = 34;
+ break;
+ }
+ $469 = HEAP32[$3>>2]|0;
+ $470 = (_strcmp($469,16068)|0);
+ $471 = ($470|0)!=(0);
+ if (!($471)) {
+ HEAP32[$1>>2] = 35;
+ break;
+ }
+ $472 = HEAP32[$3>>2]|0;
+ $473 = (_strcmp($472,16092)|0);
+ $474 = ($473|0)!=(0);
+ if (!($474)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $475 = HEAP32[$3>>2]|0;
+ $476 = (_strcmp($475,16105)|0);
+ $477 = ($476|0)!=(0);
+ if (!($477)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $478 = HEAP32[$3>>2]|0;
+ $479 = (_strcmp($478,16119)|0);
+ $480 = ($479|0)!=(0);
+ if (!($480)) {
+ HEAP32[$1>>2] = 36;
+ break;
+ }
+ $481 = HEAP32[$3>>2]|0;
+ $482 = (_strcmp($481,16141)|0);
+ $483 = ($482|0)!=(0);
+ if (!($483)) {
+ HEAP32[$1>>2] = 37;
+ break;
+ }
+ $484 = HEAP32[$3>>2]|0;
+ $485 = (_strcmp($484,16148)|0);
+ $486 = ($485|0)!=(0);
+ if (!($486)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $487 = HEAP32[$3>>2]|0;
+ $488 = (_strcmp($487,16164)|0);
+ $489 = ($488|0)!=(0);
+ if (!($489)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $490 = HEAP32[$3>>2]|0;
+ $491 = (_strcmp($490,16181)|0);
+ $492 = ($491|0)!=(0);
+ if (!($492)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $493 = HEAP32[$3>>2]|0;
+ $494 = (_strcmp($493,16198)|0);
+ $495 = ($494|0)!=(0);
+ if (!($495)) {
+ HEAP32[$1>>2] = 28;
+ break;
+ }
+ $496 = HEAP32[$3>>2]|0;
+ $497 = (_strcmp($496,16214)|0);
+ $498 = ($497|0)!=(0);
+ if (!($498)) {
+ HEAP32[$1>>2] = 1;
+ break;
+ }
+ $499 = HEAP32[$3>>2]|0;
+ $500 = (_strcmp($499,16230)|0);
+ $501 = ($500|0)!=(0);
+ if (!($501)) {
+ HEAP32[$1>>2] = 4;
+ break;
+ }
+ $502 = HEAP32[$3>>2]|0;
+ $503 = (_strcmp($502,16247)|0);
+ $504 = ($503|0)!=(0);
+ if (!($504)) {
+ HEAP32[$1>>2] = 29;
+ break;
+ }
+ $505 = HEAP32[$3>>2]|0;
+ $506 = (_strcmp($505,16261)|0);
+ $507 = ($506|0)!=(0);
+ if (!($507)) {
+ HEAP32[$1>>2] = 30;
+ break;
+ }
+ $508 = HEAP32[$3>>2]|0;
+ $509 = (_strcmp($508,16273)|0);
+ $510 = ($509|0)!=(0);
+ if (!($510)) {
+ HEAP32[$1>>2] = 22;
+ break;
+ }
+ $511 = HEAP32[$3>>2]|0;
+ $512 = (_strcmp($511,16284)|0);
+ $513 = ($512|0)!=(0);
+ if (!($513)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $514 = HEAP32[$3>>2]|0;
+ $515 = (_strcmp($514,16297)|0);
+ $516 = ($515|0)!=(0);
+ if (!($516)) {
+ HEAP32[$1>>2] = 23;
+ break;
+ }
+ $517 = HEAP32[$3>>2]|0;
+ $518 = (_strcmp($517,16307)|0);
+ $519 = ($518|0)!=(0);
+ if (!($519)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $520 = HEAP32[$3>>2]|0;
+ $521 = (_strcmp($520,16324)|0);
+ $522 = ($521|0)!=(0);
+ if (!($522)) {
+ HEAP32[$1>>2] = 24;
+ break;
+ }
+ $523 = HEAP32[$3>>2]|0;
+ $524 = (_strcmp($523,16336)|0);
+ $525 = ($524|0)!=(0);
+ if (!($525)) {
+ HEAP32[$1>>2] = 25;
+ break;
+ }
+ $526 = HEAP32[$3>>2]|0;
+ $527 = (_strcmp($526,16358)|0);
+ $528 = ($527|0)!=(0);
+ if (!($528)) {
+ HEAP32[$1>>2] = 26;
+ break;
+ }
+ $529 = HEAP32[$3>>2]|0;
+ $530 = (_strcmp($529,16378)|0);
+ $531 = ($530|0)!=(0);
+ if (!($531)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $532 = HEAP32[$3>>2]|0;
+ $533 = (_strcmp($532,16391)|0);
+ $534 = ($533|0)!=(0);
+ if (!($534)) {
+ HEAP32[$1>>2] = 27;
+ break;
+ }
+ $535 = HEAP32[$3>>2]|0;
+ $536 = (_strcmp($535,16413)|0);
+ $537 = ($536|0)!=(0);
+ if (!($537)) {
+ HEAP32[$1>>2] = 28;
+ break;
+ }
+ $538 = HEAP32[$3>>2]|0;
+ $539 = (_strcmp($538,16433)|0);
+ $540 = ($539|0)!=(0);
+ if (!($540)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $541 = HEAP32[$3>>2]|0;
+ $542 = (_strcmp($541,16450)|0);
+ $543 = ($542|0)!=(0);
+ if (!($543)) {
+ HEAP32[$1>>2] = 2;
+ break;
+ }
+ $544 = HEAP32[$3>>2]|0;
+ $545 = (_strcmp($544,16467)|0);
+ $546 = ($545|0)!=(0);
+ if (!($546)) {
+ HEAP32[$1>>2] = 3;
+ break;
+ }
+ $547 = HEAP32[$3>>2]|0;
+ $548 = (_strcmp($547,16487)|0);
+ $549 = ($548|0)!=(0);
+ if ($549) {
+ $550 = HEAP32[$2>>2]|0;
+ $551 = HEAP32[$3>>2]|0;
+ $552 = _emscripten_asm_const_iii(0, ($550|0), ($551|0))|0;
+ HEAP32[$1>>2] = 0;
+ break;
+ } else {
+ HEAP32[$1>>2] = 38;
+ break;
+ }
+ } else {
+ HEAP32[$1>>2] = 6;
+ }
+ } while(0);
+ $553 = HEAP32[$1>>2]|0;
+ STACKTOP = sp;return ($553|0);
+}
+function _emscripten_get_global_libc() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return (22932|0);
+}
+function ___stdio_close($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $vararg_buffer = sp;
+ $1 = ((($0)) + 60|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = (_dummy_738($2)|0);
+ HEAP32[$vararg_buffer>>2] = $3;
+ $4 = (___syscall6(6,($vararg_buffer|0))|0);
+ $5 = (___syscall_ret($4)|0);
+ STACKTOP = sp;return ($5|0);
+}
+function ___stdio_write($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$04756 = 0, $$04855 = 0, $$04954 = 0, $$051 = 0, $$1 = 0, $$150 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
+ var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0;
+ var $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $3 = sp + 32|0;
+ $4 = ((($0)) + 28|0);
+ $5 = HEAP32[$4>>2]|0;
+ HEAP32[$3>>2] = $5;
+ $6 = ((($3)) + 4|0);
+ $7 = ((($0)) + 20|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = (($8) - ($5))|0;
+ HEAP32[$6>>2] = $9;
+ $10 = ((($3)) + 8|0);
+ HEAP32[$10>>2] = $1;
+ $11 = ((($3)) + 12|0);
+ HEAP32[$11>>2] = $2;
+ $12 = (($9) + ($2))|0;
+ $13 = ((($0)) + 60|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = $3;
+ HEAP32[$vararg_buffer>>2] = $14;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $15;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 2;
+ $16 = (___syscall146(146,($vararg_buffer|0))|0);
+ $17 = (___syscall_ret($16)|0);
+ $18 = ($12|0)==($17|0);
+ L1: do {
+ if ($18) {
+ label = 3;
+ } else {
+ $$04756 = 2;$$04855 = $12;$$04954 = $3;$26 = $17;
+ while(1) {
+ $25 = ($26|0)<(0);
+ if ($25) {
+ break;
+ }
+ $34 = (($$04855) - ($26))|0;
+ $35 = ((($$04954)) + 4|0);
+ $36 = HEAP32[$35>>2]|0;
+ $37 = ($26>>>0)>($36>>>0);
+ $38 = ((($$04954)) + 8|0);
+ $$150 = $37 ? $38 : $$04954;
+ $39 = $37 << 31 >> 31;
+ $$1 = (($39) + ($$04756))|0;
+ $40 = $37 ? $36 : 0;
+ $$0 = (($26) - ($40))|0;
+ $41 = HEAP32[$$150>>2]|0;
+ $42 = (($41) + ($$0)|0);
+ HEAP32[$$150>>2] = $42;
+ $43 = ((($$150)) + 4|0);
+ $44 = HEAP32[$43>>2]|0;
+ $45 = (($44) - ($$0))|0;
+ HEAP32[$43>>2] = $45;
+ $46 = HEAP32[$13>>2]|0;
+ $47 = $$150;
+ HEAP32[$vararg_buffer3>>2] = $46;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = $47;
+ $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
+ HEAP32[$vararg_ptr7>>2] = $$1;
+ $48 = (___syscall146(146,($vararg_buffer3|0))|0);
+ $49 = (___syscall_ret($48)|0);
+ $50 = ($34|0)==($49|0);
+ if ($50) {
+ label = 3;
+ break L1;
+ } else {
+ $$04756 = $$1;$$04855 = $34;$$04954 = $$150;$26 = $49;
+ }
+ }
+ $27 = ((($0)) + 16|0);
+ HEAP32[$27>>2] = 0;
+ HEAP32[$4>>2] = 0;
+ HEAP32[$7>>2] = 0;
+ $28 = HEAP32[$0>>2]|0;
+ $29 = $28 | 32;
+ HEAP32[$0>>2] = $29;
+ $30 = ($$04756|0)==(2);
+ if ($30) {
+ $$051 = 0;
+ } else {
+ $31 = ((($$04954)) + 4|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = (($2) - ($32))|0;
+ $$051 = $33;
+ }
+ }
+ } while(0);
+ if ((label|0) == 3) {
+ $19 = ((($0)) + 44|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ((($0)) + 48|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (($20) + ($22)|0);
+ $24 = ((($0)) + 16|0);
+ HEAP32[$24>>2] = $23;
+ HEAP32[$4>>2] = $20;
+ HEAP32[$7>>2] = $20;
+ $$051 = $2;
+ }
+ STACKTOP = sp;return ($$051|0);
+}
+function ___stdio_seek($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$pre = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer = sp;
+ $3 = sp + 20|0;
+ $4 = ((($0)) + 60|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = $3;
+ HEAP32[$vararg_buffer>>2] = $5;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 0;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $1;
+ $vararg_ptr3 = ((($vararg_buffer)) + 12|0);
+ HEAP32[$vararg_ptr3>>2] = $6;
+ $vararg_ptr4 = ((($vararg_buffer)) + 16|0);
+ HEAP32[$vararg_ptr4>>2] = $2;
+ $7 = (___syscall140(140,($vararg_buffer|0))|0);
+ $8 = (___syscall_ret($7)|0);
+ $9 = ($8|0)<(0);
+ if ($9) {
+ HEAP32[$3>>2] = -1;
+ $10 = -1;
+ } else {
+ $$pre = HEAP32[$3>>2]|0;
+ $10 = $$pre;
+ }
+ STACKTOP = sp;return ($10|0);
+}
+function ___syscall_ret($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0>>>0)>(4294963200);
+ if ($1) {
+ $2 = (0 - ($0))|0;
+ $3 = (___errno_location()|0);
+ HEAP32[$3>>2] = $2;
+ $$0 = -1;
+ } else {
+ $$0 = $0;
+ }
+ return ($$0|0);
+}
+function ___errno_location() {
+ var $0 = 0, $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (___pthread_self_108()|0);
+ $1 = ((($0)) + 64|0);
+ return ($1|0);
+}
+function ___pthread_self_108() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_pthread_self()|0);
+ return ($0|0);
+}
+function _pthread_self() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return (3972|0);
+}
+function _dummy_738($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return ($0|0);
+}
+function ___stdio_read($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
+ var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer = sp;
+ $3 = sp + 16|0;
+ HEAP32[$3>>2] = $1;
+ $4 = ((($3)) + 4|0);
+ $5 = ((($0)) + 48|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ($6|0)!=(0);
+ $8 = $7&1;
+ $9 = (($2) - ($8))|0;
+ HEAP32[$4>>2] = $9;
+ $10 = ((($3)) + 8|0);
+ $11 = ((($0)) + 44|0);
+ $12 = HEAP32[$11>>2]|0;
+ HEAP32[$10>>2] = $12;
+ $13 = ((($3)) + 12|0);
+ HEAP32[$13>>2] = $6;
+ $14 = ((($0)) + 60|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = $3;
+ HEAP32[$vararg_buffer>>2] = $15;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $16;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 2;
+ $17 = (___syscall145(145,($vararg_buffer|0))|0);
+ $18 = (___syscall_ret($17)|0);
+ $19 = ($18|0)<(1);
+ if ($19) {
+ $20 = $18 & 48;
+ $21 = $20 ^ 16;
+ $22 = HEAP32[$0>>2]|0;
+ $23 = $22 | $21;
+ HEAP32[$0>>2] = $23;
+ $$0 = $18;
+ } else {
+ $24 = HEAP32[$4>>2]|0;
+ $25 = ($18>>>0)>($24>>>0);
+ if ($25) {
+ $26 = (($18) - ($24))|0;
+ $27 = HEAP32[$11>>2]|0;
+ $28 = ((($0)) + 4|0);
+ HEAP32[$28>>2] = $27;
+ $29 = (($27) + ($26)|0);
+ $30 = ((($0)) + 8|0);
+ HEAP32[$30>>2] = $29;
+ $31 = HEAP32[$5>>2]|0;
+ $32 = ($31|0)==(0);
+ if ($32) {
+ $$0 = $2;
+ } else {
+ $33 = ((($27)) + 1|0);
+ HEAP32[$28>>2] = $33;
+ $34 = HEAP8[$27>>0]|0;
+ $35 = (($2) + -1)|0;
+ $36 = (($1) + ($35)|0);
+ HEAP8[$36>>0] = $34;
+ $$0 = $2;
+ }
+ } else {
+ $$0 = $18;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___stdout_write($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $vararg_buffer = sp;
+ $3 = sp + 16|0;
+ $4 = ((($0)) + 36|0);
+ HEAP32[$4>>2] = 10;
+ $5 = HEAP32[$0>>2]|0;
+ $6 = $5 & 64;
+ $7 = ($6|0)==(0);
+ if ($7) {
+ $8 = ((($0)) + 60|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = $3;
+ HEAP32[$vararg_buffer>>2] = $9;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 21523;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = $10;
+ $11 = (___syscall54(54,($vararg_buffer|0))|0);
+ $12 = ($11|0)==(0);
+ if (!($12)) {
+ $13 = ((($0)) + 75|0);
+ HEAP8[$13>>0] = -1;
+ }
+ }
+ $14 = (___stdio_write($0,$1,$2)|0);
+ STACKTOP = sp;return ($14|0);
+}
+function _strtox_768($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
+ $5 = sp;
+ HEAP32[$5>>2] = 0;
+ $6 = ((($5)) + 4|0);
+ HEAP32[$6>>2] = $0;
+ $7 = ((($5)) + 44|0);
+ HEAP32[$7>>2] = $0;
+ $8 = ($0|0)<(0|0);
+ $9 = ((($0)) + 2147483647|0);
+ $$sink = $8 ? (-1) : $9;
+ $10 = ((($5)) + 8|0);
+ HEAP32[$10>>2] = $$sink;
+ $11 = ((($5)) + 76|0);
+ HEAP32[$11>>2] = -1;
+ ___shlim($5,0);
+ $12 = (___intscan($5,$2,1,$3,$4)|0);
+ $13 = tempRet0;
+ $14 = ($1|0)==(0|0);
+ if (!($14)) {
+ $15 = ((($5)) + 108|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = HEAP32[$6>>2]|0;
+ $18 = HEAP32[$10>>2]|0;
+ $19 = (($17) + ($16))|0;
+ $20 = (($19) - ($18))|0;
+ $21 = (($0) + ($20)|0);
+ HEAP32[$1>>2] = $21;
+ }
+ tempRet0 = ($13);
+ STACKTOP = sp;return ($12|0);
+}
+function ___shlim($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 104|0);
+ HEAP32[$2>>2] = $1;
+ $3 = ((($0)) + 8|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($0)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $4;
+ $8 = $6;
+ $9 = (($7) - ($8))|0;
+ $10 = ((($0)) + 108|0);
+ HEAP32[$10>>2] = $9;
+ $11 = ($1|0)!=(0);
+ $12 = ($9|0)>($1|0);
+ $or$cond = $11 & $12;
+ $13 = (($6) + ($1)|0);
+ $$sink = $or$cond ? $13 : $4;
+ $14 = ((($0)) + 100|0);
+ HEAP32[$14>>2] = $$sink;
+ return;
+}
+function ___intscan($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0154222 = 0, $$0157 = 0, $$0157$ = 0, $$0159 = 0, $$1155192 = 0, $$1158 = 0, $$1160 = 0, $$1160169 = 0, $$1165 = 0, $$1165167 = 0, $$1165168 = 0, $$166 = 0, $$2156210 = 0, $$2161$be = 0, $$2161$lcssa = 0, $$3162$be = 0, $$3162215 = 0, $$4163$be = 0, $$4163$lcssa = 0, $$5$be = 0;
+ var $$6$be = 0, $$6$lcssa = 0, $$7$be = 0, $$7198 = 0, $$8 = 0, $$9$be = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0;
+ var $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
+ var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
+ var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0;
+ var $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0;
+ var $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0;
+ var $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0;
+ var $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0;
+ var $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0;
+ var $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0;
+ var $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0;
+ var $294 = 0, $295 = 0, $296 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
+ var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
+ var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0;
+ var $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond12 = 0;
+ var $or$cond187 = 0, $or$cond5 = 0, $or$cond7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = ($1>>>0)>(36);
+ L1: do {
+ if ($5) {
+ $8 = (___errno_location()|0);
+ HEAP32[$8>>2] = 22;
+ $289 = 0;$290 = 0;
+ } else {
+ $6 = ((($0)) + 4|0);
+ $7 = ((($0)) + 100|0);
+ while(1) {
+ $9 = HEAP32[$6>>2]|0;
+ $10 = HEAP32[$7>>2]|0;
+ $11 = ($9>>>0)<($10>>>0);
+ if ($11) {
+ $12 = ((($9)) + 1|0);
+ HEAP32[$6>>2] = $12;
+ $13 = HEAP8[$9>>0]|0;
+ $14 = $13&255;
+ $16 = $14;
+ } else {
+ $15 = (___shgetc($0)|0);
+ $16 = $15;
+ }
+ $17 = (_isspace($16)|0);
+ $18 = ($17|0)==(0);
+ if ($18) {
+ break;
+ }
+ }
+ L11: do {
+ switch ($16|0) {
+ case 43: case 45: {
+ $19 = ($16|0)==(45);
+ $20 = $19 << 31 >> 31;
+ $21 = HEAP32[$6>>2]|0;
+ $22 = HEAP32[$7>>2]|0;
+ $23 = ($21>>>0)<($22>>>0);
+ if ($23) {
+ $24 = ((($21)) + 1|0);
+ HEAP32[$6>>2] = $24;
+ $25 = HEAP8[$21>>0]|0;
+ $26 = $25&255;
+ $$0157 = $20;$$0159 = $26;
+ break L11;
+ } else {
+ $27 = (___shgetc($0)|0);
+ $$0157 = $20;$$0159 = $27;
+ break L11;
+ }
+ break;
+ }
+ default: {
+ $$0157 = 0;$$0159 = $16;
+ }
+ }
+ } while(0);
+ $28 = ($1|0)==(0);
+ $29 = $1 | 16;
+ $30 = ($29|0)==(16);
+ $31 = ($$0159|0)==(48);
+ $or$cond5 = $30 & $31;
+ do {
+ if ($or$cond5) {
+ $32 = HEAP32[$6>>2]|0;
+ $33 = HEAP32[$7>>2]|0;
+ $34 = ($32>>>0)<($33>>>0);
+ if ($34) {
+ $35 = ((($32)) + 1|0);
+ HEAP32[$6>>2] = $35;
+ $36 = HEAP8[$32>>0]|0;
+ $37 = $36&255;
+ $40 = $37;
+ } else {
+ $38 = (___shgetc($0)|0);
+ $40 = $38;
+ }
+ $39 = $40 | 32;
+ $41 = ($39|0)==(120);
+ if (!($41)) {
+ if ($28) {
+ $$1160169 = $40;$$1165168 = 8;
+ label = 46;
+ break;
+ } else {
+ $$1160 = $40;$$1165 = $1;
+ label = 32;
+ break;
+ }
+ }
+ $42 = HEAP32[$6>>2]|0;
+ $43 = HEAP32[$7>>2]|0;
+ $44 = ($42>>>0)<($43>>>0);
+ if ($44) {
+ $45 = ((($42)) + 1|0);
+ HEAP32[$6>>2] = $45;
+ $46 = HEAP8[$42>>0]|0;
+ $47 = $46&255;
+ $50 = $47;
+ } else {
+ $48 = (___shgetc($0)|0);
+ $50 = $48;
+ }
+ $49 = ((16604) + ($50)|0);
+ $51 = HEAP8[$49>>0]|0;
+ $52 = ($51&255)>(15);
+ if ($52) {
+ $53 = HEAP32[$7>>2]|0;
+ $54 = ($53|0)!=(0|0);
+ if ($54) {
+ $55 = HEAP32[$6>>2]|0;
+ $56 = ((($55)) + -1|0);
+ HEAP32[$6>>2] = $56;
+ }
+ $57 = ($2|0)==(0);
+ if ($57) {
+ ___shlim($0,0);
+ $289 = 0;$290 = 0;
+ break L1;
+ }
+ if (!($54)) {
+ $289 = 0;$290 = 0;
+ break L1;
+ }
+ $58 = HEAP32[$6>>2]|0;
+ $59 = ((($58)) + -1|0);
+ HEAP32[$6>>2] = $59;
+ $289 = 0;$290 = 0;
+ break L1;
+ } else {
+ $$1160169 = $50;$$1165168 = 16;
+ label = 46;
+ }
+ } else {
+ $$166 = $28 ? 10 : $1;
+ $60 = ((16604) + ($$0159)|0);
+ $61 = HEAP8[$60>>0]|0;
+ $62 = $61&255;
+ $63 = ($62>>>0)<($$166>>>0);
+ if ($63) {
+ $$1160 = $$0159;$$1165 = $$166;
+ label = 32;
+ } else {
+ $64 = HEAP32[$7>>2]|0;
+ $65 = ($64|0)==(0|0);
+ if (!($65)) {
+ $66 = HEAP32[$6>>2]|0;
+ $67 = ((($66)) + -1|0);
+ HEAP32[$6>>2] = $67;
+ }
+ ___shlim($0,0);
+ $68 = (___errno_location()|0);
+ HEAP32[$68>>2] = 22;
+ $289 = 0;$290 = 0;
+ break L1;
+ }
+ }
+ } while(0);
+ L43: do {
+ if ((label|0) == 32) {
+ $69 = ($$1165|0)==(10);
+ if ($69) {
+ $70 = (($$1160) + -48)|0;
+ $71 = ($70>>>0)<(10);
+ if ($71) {
+ $$0154222 = 0;$74 = $70;
+ while(1) {
+ $72 = ($$0154222*10)|0;
+ $73 = (($72) + ($74))|0;
+ $75 = HEAP32[$6>>2]|0;
+ $76 = HEAP32[$7>>2]|0;
+ $77 = ($75>>>0)<($76>>>0);
+ if ($77) {
+ $78 = ((($75)) + 1|0);
+ HEAP32[$6>>2] = $78;
+ $79 = HEAP8[$75>>0]|0;
+ $80 = $79&255;
+ $$2161$be = $80;
+ } else {
+ $81 = (___shgetc($0)|0);
+ $$2161$be = $81;
+ }
+ $82 = (($$2161$be) + -48)|0;
+ $83 = ($82>>>0)<(10);
+ $84 = ($73>>>0)<(429496729);
+ $85 = $83 & $84;
+ if ($85) {
+ $$0154222 = $73;$74 = $82;
+ } else {
+ break;
+ }
+ }
+ $$2161$lcssa = $$2161$be;$291 = $73;$292 = 0;
+ } else {
+ $$2161$lcssa = $$1160;$291 = 0;$292 = 0;
+ }
+ $86 = (($$2161$lcssa) + -48)|0;
+ $87 = ($86>>>0)<(10);
+ if ($87) {
+ $$3162215 = $$2161$lcssa;$88 = $291;$89 = $292;$93 = $86;
+ while(1) {
+ $90 = (___muldi3(($88|0),($89|0),10,0)|0);
+ $91 = tempRet0;
+ $92 = ($93|0)<(0);
+ $94 = $92 << 31 >> 31;
+ $95 = $93 ^ -1;
+ $96 = $94 ^ -1;
+ $97 = ($91>>>0)>($96>>>0);
+ $98 = ($90>>>0)>($95>>>0);
+ $99 = ($91|0)==($96|0);
+ $100 = $99 & $98;
+ $101 = $97 | $100;
+ if ($101) {
+ $$1165167 = 10;$$8 = $$3162215;$293 = $88;$294 = $89;
+ label = 72;
+ break L43;
+ }
+ $102 = (_i64Add(($90|0),($91|0),($93|0),($94|0))|0);
+ $103 = tempRet0;
+ $104 = HEAP32[$6>>2]|0;
+ $105 = HEAP32[$7>>2]|0;
+ $106 = ($104>>>0)<($105>>>0);
+ if ($106) {
+ $107 = ((($104)) + 1|0);
+ HEAP32[$6>>2] = $107;
+ $108 = HEAP8[$104>>0]|0;
+ $109 = $108&255;
+ $$3162$be = $109;
+ } else {
+ $110 = (___shgetc($0)|0);
+ $$3162$be = $110;
+ }
+ $111 = (($$3162$be) + -48)|0;
+ $112 = ($111>>>0)<(10);
+ $113 = ($103>>>0)<(429496729);
+ $114 = ($102>>>0)<(2576980378);
+ $115 = ($103|0)==(429496729);
+ $116 = $115 & $114;
+ $117 = $113 | $116;
+ $or$cond7 = $112 & $117;
+ if ($or$cond7) {
+ $$3162215 = $$3162$be;$88 = $102;$89 = $103;$93 = $111;
+ } else {
+ break;
+ }
+ }
+ $118 = ($111>>>0)>(9);
+ if ($118) {
+ $$1158 = $$0157;$263 = $103;$265 = $102;
+ } else {
+ $$1165167 = 10;$$8 = $$3162$be;$293 = $102;$294 = $103;
+ label = 72;
+ }
+ } else {
+ $$1158 = $$0157;$263 = $292;$265 = $291;
+ }
+ } else {
+ $$1160169 = $$1160;$$1165168 = $$1165;
+ label = 46;
+ }
+ }
+ } while(0);
+ L63: do {
+ if ((label|0) == 46) {
+ $119 = (($$1165168) + -1)|0;
+ $120 = $119 & $$1165168;
+ $121 = ($120|0)==(0);
+ if ($121) {
+ $126 = ($$1165168*23)|0;
+ $127 = $126 >>> 5;
+ $128 = $127 & 7;
+ $129 = (16860 + ($128)|0);
+ $130 = HEAP8[$129>>0]|0;
+ $131 = $130 << 24 >> 24;
+ $132 = ((16604) + ($$1160169)|0);
+ $133 = HEAP8[$132>>0]|0;
+ $134 = $133&255;
+ $135 = ($134>>>0)<($$1165168>>>0);
+ if ($135) {
+ $$1155192 = 0;$138 = $134;
+ while(1) {
+ $136 = $$1155192 << $131;
+ $137 = $138 | $136;
+ $139 = HEAP32[$6>>2]|0;
+ $140 = HEAP32[$7>>2]|0;
+ $141 = ($139>>>0)<($140>>>0);
+ if ($141) {
+ $142 = ((($139)) + 1|0);
+ HEAP32[$6>>2] = $142;
+ $143 = HEAP8[$139>>0]|0;
+ $144 = $143&255;
+ $$4163$be = $144;
+ } else {
+ $145 = (___shgetc($0)|0);
+ $$4163$be = $145;
+ }
+ $146 = ((16604) + ($$4163$be)|0);
+ $147 = HEAP8[$146>>0]|0;
+ $148 = $147&255;
+ $149 = ($148>>>0)<($$1165168>>>0);
+ $150 = ($137>>>0)<(134217728);
+ $151 = $150 & $149;
+ if ($151) {
+ $$1155192 = $137;$138 = $148;
+ } else {
+ break;
+ }
+ }
+ $$4163$lcssa = $$4163$be;$155 = $147;$158 = 0;$160 = $137;
+ } else {
+ $$4163$lcssa = $$1160169;$155 = $133;$158 = 0;$160 = 0;
+ }
+ $152 = (_bitshift64Lshr(-1,-1,($131|0))|0);
+ $153 = tempRet0;
+ $154 = $155&255;
+ $156 = ($154>>>0)>=($$1165168>>>0);
+ $157 = ($158>>>0)>($153>>>0);
+ $159 = ($160>>>0)>($152>>>0);
+ $161 = ($158|0)==($153|0);
+ $162 = $161 & $159;
+ $163 = $157 | $162;
+ $or$cond187 = $156 | $163;
+ if ($or$cond187) {
+ $$1165167 = $$1165168;$$8 = $$4163$lcssa;$293 = $160;$294 = $158;
+ label = 72;
+ break;
+ } else {
+ $164 = $160;$165 = $158;$169 = $155;
+ }
+ while(1) {
+ $166 = (_bitshift64Shl(($164|0),($165|0),($131|0))|0);
+ $167 = tempRet0;
+ $168 = $169&255;
+ $170 = $168 | $166;
+ $171 = HEAP32[$6>>2]|0;
+ $172 = HEAP32[$7>>2]|0;
+ $173 = ($171>>>0)<($172>>>0);
+ if ($173) {
+ $174 = ((($171)) + 1|0);
+ HEAP32[$6>>2] = $174;
+ $175 = HEAP8[$171>>0]|0;
+ $176 = $175&255;
+ $$5$be = $176;
+ } else {
+ $177 = (___shgetc($0)|0);
+ $$5$be = $177;
+ }
+ $178 = ((16604) + ($$5$be)|0);
+ $179 = HEAP8[$178>>0]|0;
+ $180 = $179&255;
+ $181 = ($180>>>0)>=($$1165168>>>0);
+ $182 = ($167>>>0)>($153>>>0);
+ $183 = ($170>>>0)>($152>>>0);
+ $184 = ($167|0)==($153|0);
+ $185 = $184 & $183;
+ $186 = $182 | $185;
+ $or$cond = $181 | $186;
+ if ($or$cond) {
+ $$1165167 = $$1165168;$$8 = $$5$be;$293 = $170;$294 = $167;
+ label = 72;
+ break L63;
+ } else {
+ $164 = $170;$165 = $167;$169 = $179;
+ }
+ }
+ }
+ $122 = ((16604) + ($$1160169)|0);
+ $123 = HEAP8[$122>>0]|0;
+ $124 = $123&255;
+ $125 = ($124>>>0)<($$1165168>>>0);
+ if ($125) {
+ $$2156210 = 0;$189 = $124;
+ while(1) {
+ $187 = Math_imul($$2156210, $$1165168)|0;
+ $188 = (($189) + ($187))|0;
+ $190 = HEAP32[$6>>2]|0;
+ $191 = HEAP32[$7>>2]|0;
+ $192 = ($190>>>0)<($191>>>0);
+ if ($192) {
+ $193 = ((($190)) + 1|0);
+ HEAP32[$6>>2] = $193;
+ $194 = HEAP8[$190>>0]|0;
+ $195 = $194&255;
+ $$6$be = $195;
+ } else {
+ $196 = (___shgetc($0)|0);
+ $$6$be = $196;
+ }
+ $197 = ((16604) + ($$6$be)|0);
+ $198 = HEAP8[$197>>0]|0;
+ $199 = $198&255;
+ $200 = ($199>>>0)<($$1165168>>>0);
+ $201 = ($188>>>0)<(119304647);
+ $202 = $201 & $200;
+ if ($202) {
+ $$2156210 = $188;$189 = $199;
+ } else {
+ break;
+ }
+ }
+ $$6$lcssa = $$6$be;$204 = $198;$295 = $188;$296 = 0;
+ } else {
+ $$6$lcssa = $$1160169;$204 = $123;$295 = 0;$296 = 0;
+ }
+ $203 = $204&255;
+ $205 = ($203>>>0)<($$1165168>>>0);
+ if ($205) {
+ $206 = (___udivdi3(-1,-1,($$1165168|0),0)|0);
+ $207 = tempRet0;
+ $$7198 = $$6$lcssa;$209 = $296;$211 = $295;$218 = $204;
+ while(1) {
+ $208 = ($209>>>0)>($207>>>0);
+ $210 = ($211>>>0)>($206>>>0);
+ $212 = ($209|0)==($207|0);
+ $213 = $212 & $210;
+ $214 = $208 | $213;
+ if ($214) {
+ $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
+ label = 72;
+ break L63;
+ }
+ $215 = (___muldi3(($211|0),($209|0),($$1165168|0),0)|0);
+ $216 = tempRet0;
+ $217 = $218&255;
+ $219 = $217 ^ -1;
+ $220 = ($216>>>0)>(4294967295);
+ $221 = ($215>>>0)>($219>>>0);
+ $222 = ($216|0)==(-1);
+ $223 = $222 & $221;
+ $224 = $220 | $223;
+ if ($224) {
+ $$1165167 = $$1165168;$$8 = $$7198;$293 = $211;$294 = $209;
+ label = 72;
+ break L63;
+ }
+ $225 = (_i64Add(($217|0),0,($215|0),($216|0))|0);
+ $226 = tempRet0;
+ $227 = HEAP32[$6>>2]|0;
+ $228 = HEAP32[$7>>2]|0;
+ $229 = ($227>>>0)<($228>>>0);
+ if ($229) {
+ $230 = ((($227)) + 1|0);
+ HEAP32[$6>>2] = $230;
+ $231 = HEAP8[$227>>0]|0;
+ $232 = $231&255;
+ $$7$be = $232;
+ } else {
+ $233 = (___shgetc($0)|0);
+ $$7$be = $233;
+ }
+ $234 = ((16604) + ($$7$be)|0);
+ $235 = HEAP8[$234>>0]|0;
+ $236 = $235&255;
+ $237 = ($236>>>0)<($$1165168>>>0);
+ if ($237) {
+ $$7198 = $$7$be;$209 = $226;$211 = $225;$218 = $235;
+ } else {
+ $$1165167 = $$1165168;$$8 = $$7$be;$293 = $225;$294 = $226;
+ label = 72;
+ break;
+ }
+ }
+ } else {
+ $$1165167 = $$1165168;$$8 = $$6$lcssa;$293 = $295;$294 = $296;
+ label = 72;
+ }
+ }
+ } while(0);
+ if ((label|0) == 72) {
+ $238 = ((16604) + ($$8)|0);
+ $239 = HEAP8[$238>>0]|0;
+ $240 = $239&255;
+ $241 = ($240>>>0)<($$1165167>>>0);
+ if ($241) {
+ while(1) {
+ $242 = HEAP32[$6>>2]|0;
+ $243 = HEAP32[$7>>2]|0;
+ $244 = ($242>>>0)<($243>>>0);
+ if ($244) {
+ $245 = ((($242)) + 1|0);
+ HEAP32[$6>>2] = $245;
+ $246 = HEAP8[$242>>0]|0;
+ $247 = $246&255;
+ $$9$be = $247;
+ } else {
+ $248 = (___shgetc($0)|0);
+ $$9$be = $248;
+ }
+ $249 = ((16604) + ($$9$be)|0);
+ $250 = HEAP8[$249>>0]|0;
+ $251 = $250&255;
+ $252 = ($251>>>0)<($$1165167>>>0);
+ if (!($252)) {
+ break;
+ }
+ }
+ $253 = (___errno_location()|0);
+ HEAP32[$253>>2] = 34;
+ $254 = $3 & 1;
+ $255 = ($254|0)==(0);
+ $256 = (0)==(0);
+ $257 = $255 & $256;
+ $$0157$ = $257 ? $$0157 : 0;
+ $$1158 = $$0157$;$263 = $4;$265 = $3;
+ } else {
+ $$1158 = $$0157;$263 = $294;$265 = $293;
+ }
+ }
+ $258 = HEAP32[$7>>2]|0;
+ $259 = ($258|0)==(0|0);
+ if (!($259)) {
+ $260 = HEAP32[$6>>2]|0;
+ $261 = ((($260)) + -1|0);
+ HEAP32[$6>>2] = $261;
+ }
+ $262 = ($263>>>0)<($4>>>0);
+ $264 = ($265>>>0)<($3>>>0);
+ $266 = ($263|0)==($4|0);
+ $267 = $266 & $264;
+ $268 = $262 | $267;
+ if (!($268)) {
+ $269 = $3 & 1;
+ $270 = ($269|0)!=(0);
+ $271 = (0)!=(0);
+ $272 = $270 | $271;
+ $273 = ($$1158|0)!=(0);
+ $or$cond12 = $272 | $273;
+ if (!($or$cond12)) {
+ $274 = (___errno_location()|0);
+ HEAP32[$274>>2] = 34;
+ $275 = (_i64Add(($3|0),($4|0),-1,-1)|0);
+ $276 = tempRet0;
+ $289 = $276;$290 = $275;
+ break;
+ }
+ $277 = ($263>>>0)>($4>>>0);
+ $278 = ($265>>>0)>($3>>>0);
+ $279 = ($263|0)==($4|0);
+ $280 = $279 & $278;
+ $281 = $277 | $280;
+ if ($281) {
+ $282 = (___errno_location()|0);
+ HEAP32[$282>>2] = 34;
+ $289 = $4;$290 = $3;
+ break;
+ }
+ }
+ $283 = ($$1158|0)<(0);
+ $284 = $283 << 31 >> 31;
+ $285 = $265 ^ $$1158;
+ $286 = $263 ^ $284;
+ $287 = (_i64Subtract(($285|0),($286|0),($$1158|0),($284|0))|0);
+ $288 = tempRet0;
+ $289 = $288;$290 = $287;
+ }
+ } while(0);
+ tempRet0 = ($289);
+ return ($290|0);
+}
+function ___shgetc($0) {
+ $0 = $0|0;
+ var $$0 = 0, $$phi$trans$insert = 0, $$phi$trans$insert28$phi$trans$insert = 0, $$pre = 0, $$pre$phi34Z2D = 0, $$pre29$pre = 0, $$pre35 = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 104|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ label = 3;
+ } else {
+ $4 = ((($0)) + 108|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)<($2|0);
+ if ($6) {
+ label = 3;
+ } else {
+ label = 4;
+ }
+ }
+ if ((label|0) == 3) {
+ $7 = (___uflow($0)|0);
+ $8 = ($7|0)<(0);
+ if ($8) {
+ label = 4;
+ } else {
+ $10 = HEAP32[$1>>2]|0;
+ $11 = ($10|0)==(0);
+ $$phi$trans$insert = ((($0)) + 8|0);
+ if ($11) {
+ $$pre = HEAP32[$$phi$trans$insert>>2]|0;
+ $$phi$trans$insert28$phi$trans$insert = ((($0)) + 4|0);
+ $$pre29$pre = HEAP32[$$phi$trans$insert28$phi$trans$insert>>2]|0;
+ $$pre35 = ((($0)) + 108|0);
+ $$pre$phi34Z2D = $$pre35;$$sink = $$pre;$26 = $$pre;$29 = $$pre29$pre;
+ } else {
+ $12 = HEAP32[$$phi$trans$insert>>2]|0;
+ $13 = ((($0)) + 4|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = $14;
+ $16 = (($12) - ($15))|0;
+ $17 = ((($0)) + 108|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = (($10) - ($18))|0;
+ $20 = ($16|0)<($19|0);
+ $21 = $12;
+ if ($20) {
+ $$pre$phi34Z2D = $17;$$sink = $21;$26 = $21;$29 = $14;
+ } else {
+ $22 = (($19) + -1)|0;
+ $23 = (($14) + ($22)|0);
+ $$pre$phi34Z2D = $17;$$sink = $23;$26 = $21;$29 = $14;
+ }
+ }
+ $24 = ((($0)) + 100|0);
+ HEAP32[$24>>2] = $$sink;
+ $25 = ($26|0)==(0|0);
+ if (!($25)) {
+ $27 = $26;
+ $28 = $29;
+ $30 = HEAP32[$$pre$phi34Z2D>>2]|0;
+ $31 = (($27) + 1)|0;
+ $32 = (($31) - ($28))|0;
+ $33 = (($32) + ($30))|0;
+ HEAP32[$$pre$phi34Z2D>>2] = $33;
+ }
+ $34 = ((($29)) + -1|0);
+ $35 = HEAP8[$34>>0]|0;
+ $36 = $35&255;
+ $37 = ($36|0)==($7|0);
+ if ($37) {
+ $$0 = $7;
+ } else {
+ $38 = $7&255;
+ HEAP8[$34>>0] = $38;
+ $$0 = $7;
+ }
+ }
+ }
+ if ((label|0) == 4) {
+ $9 = ((($0)) + 100|0);
+ HEAP32[$9>>2] = 0;
+ $$0 = -1;
+ }
+ return ($$0|0);
+}
+function _isspace($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0|0)==(32);
+ $2 = (($0) + -9)|0;
+ $3 = ($2>>>0)<(5);
+ $4 = $1 | $3;
+ $5 = $4&1;
+ return ($5|0);
+}
+function ___uflow($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp;
+ $2 = (___toread($0)|0);
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $4 = ((($0)) + 32|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = (FUNCTION_TABLE_iiii[$5 & 15]($0,$1,1)|0);
+ $7 = ($6|0)==(1);
+ if ($7) {
+ $8 = HEAP8[$1>>0]|0;
+ $9 = $8&255;
+ $$0 = $9;
+ } else {
+ $$0 = -1;
+ }
+ } else {
+ $$0 = -1;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___toread($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $sext = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 74|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2 << 24 >> 24;
+ $4 = (($3) + 255)|0;
+ $5 = $4 | $3;
+ $6 = $5&255;
+ HEAP8[$1>>0] = $6;
+ $7 = ((($0)) + 20|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ((($0)) + 28|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($8>>>0)>($10>>>0);
+ if ($11) {
+ $12 = ((($0)) + 36|0);
+ $13 = HEAP32[$12>>2]|0;
+ (FUNCTION_TABLE_iiii[$13 & 15]($0,0,0)|0);
+ }
+ $14 = ((($0)) + 16|0);
+ HEAP32[$14>>2] = 0;
+ HEAP32[$9>>2] = 0;
+ HEAP32[$7>>2] = 0;
+ $15 = HEAP32[$0>>2]|0;
+ $16 = $15 & 4;
+ $17 = ($16|0)==(0);
+ if ($17) {
+ $19 = ((($0)) + 44|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ((($0)) + 48|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (($20) + ($22)|0);
+ $24 = ((($0)) + 8|0);
+ HEAP32[$24>>2] = $23;
+ $25 = ((($0)) + 4|0);
+ HEAP32[$25>>2] = $23;
+ $26 = $15 << 27;
+ $sext = $26 >> 31;
+ $$0 = $sext;
+ } else {
+ $18 = $15 | 32;
+ HEAP32[$0>>2] = $18;
+ $$0 = -1;
+ }
+ return ($$0|0);
+}
+function _strtol($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_strtox_768($0,$1,$2,-2147483648,0)|0);
+ $4 = tempRet0;
+ return ($3|0);
+}
+function _copysign($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
+ $3 = HEAP32[tempDoublePtr+4>>2]|0;
+ HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
+ $5 = HEAP32[tempDoublePtr+4>>2]|0;
+ $6 = $3 & 2147483647;
+ $7 = $5 & -2147483648;
+ $8 = $7 | $6;
+ HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $8;$9 = +HEAPF64[tempDoublePtr>>3];
+ return (+$9);
+}
+function _strcmp($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$011 = 0, $$0710 = 0, $$lcssa = 0, $$lcssa8 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$0>>0]|0;
+ $3 = HEAP8[$1>>0]|0;
+ $4 = ($2<<24>>24)!=($3<<24>>24);
+ $5 = ($2<<24>>24)==(0);
+ $or$cond9 = $5 | $4;
+ if ($or$cond9) {
+ $$lcssa = $3;$$lcssa8 = $2;
+ } else {
+ $$011 = $1;$$0710 = $0;
+ while(1) {
+ $6 = ((($$0710)) + 1|0);
+ $7 = ((($$011)) + 1|0);
+ $8 = HEAP8[$6>>0]|0;
+ $9 = HEAP8[$7>>0]|0;
+ $10 = ($8<<24>>24)!=($9<<24>>24);
+ $11 = ($8<<24>>24)==(0);
+ $or$cond = $11 | $10;
+ if ($or$cond) {
+ $$lcssa = $9;$$lcssa8 = $8;
+ break;
+ } else {
+ $$011 = $7;$$0710 = $6;
+ }
+ }
+ }
+ $12 = $$lcssa8&255;
+ $13 = $$lcssa&255;
+ $14 = (($12) - ($13))|0;
+ return ($14|0);
+}
+function _memcmp($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$01318 = 0, $$01417 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($2|0)==(0);
+ L1: do {
+ if ($3) {
+ $14 = 0;
+ } else {
+ $$01318 = $0;$$01417 = $2;$$019 = $1;
+ while(1) {
+ $4 = HEAP8[$$01318>>0]|0;
+ $5 = HEAP8[$$019>>0]|0;
+ $6 = ($4<<24>>24)==($5<<24>>24);
+ if (!($6)) {
+ break;
+ }
+ $7 = (($$01417) + -1)|0;
+ $8 = ((($$01318)) + 1|0);
+ $9 = ((($$019)) + 1|0);
+ $10 = ($7|0)==(0);
+ if ($10) {
+ $14 = 0;
+ break L1;
+ } else {
+ $$01318 = $8;$$01417 = $7;$$019 = $9;
+ }
+ }
+ $11 = $4&255;
+ $12 = $5&255;
+ $13 = (($11) - ($12))|0;
+ $14 = $13;
+ }
+ } while(0);
+ return ($14|0);
+}
+function _strncmp($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$01824 = 0, $$01926 = 0, $$01926$in = 0, $$020 = 0, $$025 = 0, $$lcssa = 0, $$lcssa22 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond21 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($2|0)==(0);
+ if ($3) {
+ $$020 = 0;
+ } else {
+ $4 = HEAP8[$0>>0]|0;
+ $5 = $4&255;
+ $6 = ($4<<24>>24)==(0);
+ $7 = HEAP8[$1>>0]|0;
+ $8 = $7&255;
+ L3: do {
+ if ($6) {
+ $$lcssa = $8;$$lcssa22 = $5;
+ } else {
+ $$01824 = $0;$$01926$in = $2;$$025 = $1;$10 = $7;$13 = $4;$22 = $8;$23 = $5;
+ while(1) {
+ $$01926 = (($$01926$in) + -1)|0;
+ $9 = ($10<<24>>24)!=(0);
+ $11 = ($$01926|0)!=(0);
+ $or$cond = $11 & $9;
+ $12 = ($13<<24>>24)==($10<<24>>24);
+ $or$cond21 = $12 & $or$cond;
+ if (!($or$cond21)) {
+ $$lcssa = $22;$$lcssa22 = $23;
+ break L3;
+ }
+ $14 = ((($$01824)) + 1|0);
+ $15 = ((($$025)) + 1|0);
+ $16 = HEAP8[$14>>0]|0;
+ $17 = $16&255;
+ $18 = ($16<<24>>24)==(0);
+ $19 = HEAP8[$15>>0]|0;
+ $20 = $19&255;
+ if ($18) {
+ $$lcssa = $20;$$lcssa22 = $17;
+ break;
+ } else {
+ $$01824 = $14;$$01926$in = $$01926;$$025 = $15;$10 = $19;$13 = $16;$22 = $20;$23 = $17;
+ }
+ }
+ }
+ } while(0);
+ $21 = (($$lcssa22) - ($$lcssa))|0;
+ $$020 = $21;
+ }
+ return ($$020|0);
+}
+function _vsprintf($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (_vsnprintf($0,2147483647,$1,$2)|0);
+ return ($3|0);
+}
+function _vsnprintf($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$$015 = 0, $$0 = 0, $$014 = 0, $$015 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
+ $4 = sp + 124|0;
+ $5 = sp;
+ dest=$5; src=4348; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
+ $6 = (($1) + -1)|0;
+ $7 = ($6>>>0)>(2147483646);
+ if ($7) {
+ $8 = ($1|0)==(0);
+ if ($8) {
+ $$014 = $4;$$015 = 1;
+ label = 4;
+ } else {
+ $9 = (___errno_location()|0);
+ HEAP32[$9>>2] = 75;
+ $$0 = -1;
+ }
+ } else {
+ $$014 = $0;$$015 = $1;
+ label = 4;
+ }
+ if ((label|0) == 4) {
+ $10 = $$014;
+ $11 = (-2 - ($10))|0;
+ $12 = ($$015>>>0)>($11>>>0);
+ $$$015 = $12 ? $11 : $$015;
+ $13 = ((($5)) + 48|0);
+ HEAP32[$13>>2] = $$$015;
+ $14 = ((($5)) + 20|0);
+ HEAP32[$14>>2] = $$014;
+ $15 = ((($5)) + 44|0);
+ HEAP32[$15>>2] = $$014;
+ $16 = (($$014) + ($$$015)|0);
+ $17 = ((($5)) + 16|0);
+ HEAP32[$17>>2] = $16;
+ $18 = ((($5)) + 28|0);
+ HEAP32[$18>>2] = $16;
+ $19 = (_vfprintf($5,$2,$3)|0);
+ $20 = ($$$015|0)==(0);
+ if ($20) {
+ $$0 = $19;
+ } else {
+ $21 = HEAP32[$14>>2]|0;
+ $22 = HEAP32[$17>>2]|0;
+ $23 = ($21|0)==($22|0);
+ $24 = $23 << 31 >> 31;
+ $25 = (($21) + ($24)|0);
+ HEAP8[$25>>0] = 0;
+ $$0 = $19;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _vfprintf($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(224|0);
+ $3 = sp + 120|0;
+ $4 = sp + 80|0;
+ $5 = sp;
+ $6 = sp + 136|0;
+ dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $vacopy_currentptr = HEAP32[$2>>2]|0;
+ HEAP32[$3>>2] = $vacopy_currentptr;
+ $7 = (_printf_core(0,$1,$3,$5,$4)|0);
+ $8 = ($7|0)<(0);
+ if ($8) {
+ $$0 = -1;
+ } else {
+ $9 = ((($0)) + 76|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($10|0)>(-1);
+ if ($11) {
+ $12 = (___lockfile($0)|0);
+ $40 = $12;
+ } else {
+ $40 = 0;
+ }
+ $13 = HEAP32[$0>>2]|0;
+ $14 = $13 & 32;
+ $15 = ((($0)) + 74|0);
+ $16 = HEAP8[$15>>0]|0;
+ $17 = ($16<<24>>24)<(1);
+ if ($17) {
+ $18 = $13 & -33;
+ HEAP32[$0>>2] = $18;
+ }
+ $19 = ((($0)) + 48|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ($20|0)==(0);
+ if ($21) {
+ $23 = ((($0)) + 44|0);
+ $24 = HEAP32[$23>>2]|0;
+ HEAP32[$23>>2] = $6;
+ $25 = ((($0)) + 28|0);
+ HEAP32[$25>>2] = $6;
+ $26 = ((($0)) + 20|0);
+ HEAP32[$26>>2] = $6;
+ HEAP32[$19>>2] = 80;
+ $27 = ((($6)) + 80|0);
+ $28 = ((($0)) + 16|0);
+ HEAP32[$28>>2] = $27;
+ $29 = (_printf_core($0,$1,$3,$5,$4)|0);
+ $30 = ($24|0)==(0|0);
+ if ($30) {
+ $$1 = $29;
+ } else {
+ $31 = ((($0)) + 36|0);
+ $32 = HEAP32[$31>>2]|0;
+ (FUNCTION_TABLE_iiii[$32 & 15]($0,0,0)|0);
+ $33 = HEAP32[$26>>2]|0;
+ $34 = ($33|0)==(0|0);
+ $$ = $34 ? -1 : $29;
+ HEAP32[$23>>2] = $24;
+ HEAP32[$19>>2] = 0;
+ HEAP32[$28>>2] = 0;
+ HEAP32[$25>>2] = 0;
+ HEAP32[$26>>2] = 0;
+ $$1 = $$;
+ }
+ } else {
+ $22 = (_printf_core($0,$1,$3,$5,$4)|0);
+ $$1 = $22;
+ }
+ $35 = HEAP32[$0>>2]|0;
+ $36 = $35 & 32;
+ $37 = ($36|0)==(0);
+ $$1$ = $37 ? $$1 : -1;
+ $38 = $35 | $14;
+ HEAP32[$0>>2] = $38;
+ $39 = ($40|0)==(0);
+ if (!($39)) {
+ ___unlockfile($0);
+ }
+ $$0 = $$1$;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function _printf_core($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$ = 0, $$$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$4266 = 0, $$$5 = 0, $$0 = 0, $$0228 = 0, $$0228$ = 0, $$0229322 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0, $$0240$lcssa = 0, $$0240$lcssa357 = 0, $$0240321 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0;
+ var $$0249306 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$$0254$ = 0, $$0259 = 0, $$0262$lcssa = 0, $$0262311 = 0, $$0269 = 0, $$0269$phi = 0, $$1 = 0, $$1230333 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241332 = 0, $$1244320 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0;
+ var $$1260 = 0, $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$2 = 0, $$2234 = 0, $$2239 = 0, $$2242305 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2256$$$2256 = 0, $$2261 = 0, $$2271 = 0, $$284$ = 0, $$289 = 0, $$290 = 0, $$3257 = 0, $$3265 = 0;
+ var $$3272 = 0, $$3303 = 0, $$377 = 0, $$4258355 = 0, $$4266 = 0, $$5 = 0, $$6268 = 0, $$lcssa295 = 0, $$pre = 0, $$pre346 = 0, $$pre347 = 0, $$pre347$pre = 0, $$pre349 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
+ var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
+ var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
+ var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
+ var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
+ var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
+ var $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0;
+ var $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
+ var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
+ var $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0;
+ var $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0;
+ var $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0;
+ var $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0;
+ var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
+ var $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit275 = 0, $isdigit277 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp274 = 0;
+ var $isdigittmp276 = 0, $narrow = 0, $or$cond = 0, $or$cond281 = 0, $or$cond283 = 0, $or$cond286 = 0, $storemerge = 0, $storemerge273310 = 0, $storemerge278 = 0, $trunc = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $5 = sp + 16|0;
+ $6 = sp;
+ $7 = sp + 24|0;
+ $8 = sp + 8|0;
+ $9 = sp + 20|0;
+ HEAP32[$5>>2] = $1;
+ $10 = ($0|0)!=(0|0);
+ $11 = ((($7)) + 40|0);
+ $12 = $11;
+ $13 = ((($7)) + 39|0);
+ $14 = ((($8)) + 4|0);
+ $$0243 = 0;$$0247 = 0;$$0269 = 0;$21 = $1;
+ L1: while(1) {
+ $15 = ($$0247|0)>(-1);
+ do {
+ if ($15) {
+ $16 = (2147483647 - ($$0247))|0;
+ $17 = ($$0243|0)>($16|0);
+ if ($17) {
+ $18 = (___errno_location()|0);
+ HEAP32[$18>>2] = 75;
+ $$1248 = -1;
+ break;
+ } else {
+ $19 = (($$0243) + ($$0247))|0;
+ $$1248 = $19;
+ break;
+ }
+ } else {
+ $$1248 = $$0247;
+ }
+ } while(0);
+ $20 = HEAP8[$21>>0]|0;
+ $22 = ($20<<24>>24)==(0);
+ if ($22) {
+ label = 87;
+ break;
+ } else {
+ $23 = $20;$25 = $21;
+ }
+ L9: while(1) {
+ switch ($23<<24>>24) {
+ case 37: {
+ $$0249306 = $25;$27 = $25;
+ label = 9;
+ break L9;
+ break;
+ }
+ case 0: {
+ $$0249$lcssa = $25;$39 = $25;
+ break L9;
+ break;
+ }
+ default: {
+ }
+ }
+ $24 = ((($25)) + 1|0);
+ HEAP32[$5>>2] = $24;
+ $$pre = HEAP8[$24>>0]|0;
+ $23 = $$pre;$25 = $24;
+ }
+ L12: do {
+ if ((label|0) == 9) {
+ while(1) {
+ label = 0;
+ $26 = ((($27)) + 1|0);
+ $28 = HEAP8[$26>>0]|0;
+ $29 = ($28<<24>>24)==(37);
+ if (!($29)) {
+ $$0249$lcssa = $$0249306;$39 = $27;
+ break L12;
+ }
+ $30 = ((($$0249306)) + 1|0);
+ $31 = ((($27)) + 2|0);
+ HEAP32[$5>>2] = $31;
+ $32 = HEAP8[$31>>0]|0;
+ $33 = ($32<<24>>24)==(37);
+ if ($33) {
+ $$0249306 = $30;$27 = $31;
+ label = 9;
+ } else {
+ $$0249$lcssa = $30;$39 = $31;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $34 = $$0249$lcssa;
+ $35 = $21;
+ $36 = (($34) - ($35))|0;
+ if ($10) {
+ _out($0,$21,$36);
+ }
+ $37 = ($36|0)==(0);
+ if (!($37)) {
+ $$0269$phi = $$0269;$$0243 = $36;$$0247 = $$1248;$21 = $39;$$0269 = $$0269$phi;
+ continue;
+ }
+ $38 = ((($39)) + 1|0);
+ $40 = HEAP8[$38>>0]|0;
+ $41 = $40 << 24 >> 24;
+ $isdigittmp = (($41) + -48)|0;
+ $isdigit = ($isdigittmp>>>0)<(10);
+ if ($isdigit) {
+ $42 = ((($39)) + 2|0);
+ $43 = HEAP8[$42>>0]|0;
+ $44 = ($43<<24>>24)==(36);
+ $45 = ((($39)) + 3|0);
+ $$377 = $44 ? $45 : $38;
+ $$$0269 = $44 ? 1 : $$0269;
+ $isdigittmp$ = $44 ? $isdigittmp : -1;
+ $$0253 = $isdigittmp$;$$1270 = $$$0269;$storemerge = $$377;
+ } else {
+ $$0253 = -1;$$1270 = $$0269;$storemerge = $38;
+ }
+ HEAP32[$5>>2] = $storemerge;
+ $46 = HEAP8[$storemerge>>0]|0;
+ $47 = $46 << 24 >> 24;
+ $48 = (($47) + -32)|0;
+ $49 = ($48>>>0)<(32);
+ L24: do {
+ if ($49) {
+ $$0262311 = 0;$329 = $46;$51 = $48;$storemerge273310 = $storemerge;
+ while(1) {
+ $50 = 1 << $51;
+ $52 = $50 & 75913;
+ $53 = ($52|0)==(0);
+ if ($53) {
+ $$0262$lcssa = $$0262311;$$lcssa295 = $329;$62 = $storemerge273310;
+ break L24;
+ }
+ $54 = $50 | $$0262311;
+ $55 = ((($storemerge273310)) + 1|0);
+ HEAP32[$5>>2] = $55;
+ $56 = HEAP8[$55>>0]|0;
+ $57 = $56 << 24 >> 24;
+ $58 = (($57) + -32)|0;
+ $59 = ($58>>>0)<(32);
+ if ($59) {
+ $$0262311 = $54;$329 = $56;$51 = $58;$storemerge273310 = $55;
+ } else {
+ $$0262$lcssa = $54;$$lcssa295 = $56;$62 = $55;
+ break;
+ }
+ }
+ } else {
+ $$0262$lcssa = 0;$$lcssa295 = $46;$62 = $storemerge;
+ }
+ } while(0);
+ $60 = ($$lcssa295<<24>>24)==(42);
+ if ($60) {
+ $61 = ((($62)) + 1|0);
+ $63 = HEAP8[$61>>0]|0;
+ $64 = $63 << 24 >> 24;
+ $isdigittmp276 = (($64) + -48)|0;
+ $isdigit277 = ($isdigittmp276>>>0)<(10);
+ if ($isdigit277) {
+ $65 = ((($62)) + 2|0);
+ $66 = HEAP8[$65>>0]|0;
+ $67 = ($66<<24>>24)==(36);
+ if ($67) {
+ $68 = (($4) + ($isdigittmp276<<2)|0);
+ HEAP32[$68>>2] = 10;
+ $69 = HEAP8[$61>>0]|0;
+ $70 = $69 << 24 >> 24;
+ $71 = (($70) + -48)|0;
+ $72 = (($3) + ($71<<3)|0);
+ $73 = $72;
+ $74 = $73;
+ $75 = HEAP32[$74>>2]|0;
+ $76 = (($73) + 4)|0;
+ $77 = $76;
+ $78 = HEAP32[$77>>2]|0;
+ $79 = ((($62)) + 3|0);
+ $$0259 = $75;$$2271 = 1;$storemerge278 = $79;
+ } else {
+ label = 23;
+ }
+ } else {
+ label = 23;
+ }
+ if ((label|0) == 23) {
+ label = 0;
+ $80 = ($$1270|0)==(0);
+ if (!($80)) {
+ $$0 = -1;
+ break;
+ }
+ if ($10) {
+ $arglist_current = HEAP32[$2>>2]|0;
+ $81 = $arglist_current;
+ $82 = ((0) + 4|0);
+ $expanded4 = $82;
+ $expanded = (($expanded4) - 1)|0;
+ $83 = (($81) + ($expanded))|0;
+ $84 = ((0) + 4|0);
+ $expanded8 = $84;
+ $expanded7 = (($expanded8) - 1)|0;
+ $expanded6 = $expanded7 ^ -1;
+ $85 = $83 & $expanded6;
+ $86 = $85;
+ $87 = HEAP32[$86>>2]|0;
+ $arglist_next = ((($86)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next;
+ $$0259 = $87;$$2271 = 0;$storemerge278 = $61;
+ } else {
+ $$0259 = 0;$$2271 = 0;$storemerge278 = $61;
+ }
+ }
+ HEAP32[$5>>2] = $storemerge278;
+ $88 = ($$0259|0)<(0);
+ $89 = $$0262$lcssa | 8192;
+ $90 = (0 - ($$0259))|0;
+ $$$0262 = $88 ? $89 : $$0262$lcssa;
+ $$$0259 = $88 ? $90 : $$0259;
+ $$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$94 = $storemerge278;
+ } else {
+ $91 = (_getint($5)|0);
+ $92 = ($91|0)<(0);
+ if ($92) {
+ $$0 = -1;
+ break;
+ }
+ $$pre346 = HEAP32[$5>>2]|0;
+ $$1260 = $91;$$1263 = $$0262$lcssa;$$3272 = $$1270;$94 = $$pre346;
+ }
+ $93 = HEAP8[$94>>0]|0;
+ $95 = ($93<<24>>24)==(46);
+ do {
+ if ($95) {
+ $96 = ((($94)) + 1|0);
+ $97 = HEAP8[$96>>0]|0;
+ $98 = ($97<<24>>24)==(42);
+ if (!($98)) {
+ $125 = ((($94)) + 1|0);
+ HEAP32[$5>>2] = $125;
+ $126 = (_getint($5)|0);
+ $$pre347$pre = HEAP32[$5>>2]|0;
+ $$0254 = $126;$$pre347 = $$pre347$pre;
+ break;
+ }
+ $99 = ((($94)) + 2|0);
+ $100 = HEAP8[$99>>0]|0;
+ $101 = $100 << 24 >> 24;
+ $isdigittmp274 = (($101) + -48)|0;
+ $isdigit275 = ($isdigittmp274>>>0)<(10);
+ if ($isdigit275) {
+ $102 = ((($94)) + 3|0);
+ $103 = HEAP8[$102>>0]|0;
+ $104 = ($103<<24>>24)==(36);
+ if ($104) {
+ $105 = (($4) + ($isdigittmp274<<2)|0);
+ HEAP32[$105>>2] = 10;
+ $106 = HEAP8[$99>>0]|0;
+ $107 = $106 << 24 >> 24;
+ $108 = (($107) + -48)|0;
+ $109 = (($3) + ($108<<3)|0);
+ $110 = $109;
+ $111 = $110;
+ $112 = HEAP32[$111>>2]|0;
+ $113 = (($110) + 4)|0;
+ $114 = $113;
+ $115 = HEAP32[$114>>2]|0;
+ $116 = ((($94)) + 4|0);
+ HEAP32[$5>>2] = $116;
+ $$0254 = $112;$$pre347 = $116;
+ break;
+ }
+ }
+ $117 = ($$3272|0)==(0);
+ if (!($117)) {
+ $$0 = -1;
+ break L1;
+ }
+ if ($10) {
+ $arglist_current2 = HEAP32[$2>>2]|0;
+ $118 = $arglist_current2;
+ $119 = ((0) + 4|0);
+ $expanded11 = $119;
+ $expanded10 = (($expanded11) - 1)|0;
+ $120 = (($118) + ($expanded10))|0;
+ $121 = ((0) + 4|0);
+ $expanded15 = $121;
+ $expanded14 = (($expanded15) - 1)|0;
+ $expanded13 = $expanded14 ^ -1;
+ $122 = $120 & $expanded13;
+ $123 = $122;
+ $124 = HEAP32[$123>>2]|0;
+ $arglist_next3 = ((($123)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next3;
+ $330 = $124;
+ } else {
+ $330 = 0;
+ }
+ HEAP32[$5>>2] = $99;
+ $$0254 = $330;$$pre347 = $99;
+ } else {
+ $$0254 = -1;$$pre347 = $94;
+ }
+ } while(0);
+ $$0252 = 0;$128 = $$pre347;
+ while(1) {
+ $127 = HEAP8[$128>>0]|0;
+ $129 = $127 << 24 >> 24;
+ $130 = (($129) + -65)|0;
+ $131 = ($130>>>0)>(57);
+ if ($131) {
+ $$0 = -1;
+ break L1;
+ }
+ $132 = ((($128)) + 1|0);
+ HEAP32[$5>>2] = $132;
+ $133 = HEAP8[$128>>0]|0;
+ $134 = $133 << 24 >> 24;
+ $135 = (($134) + -65)|0;
+ $136 = ((16869 + (($$0252*58)|0)|0) + ($135)|0);
+ $137 = HEAP8[$136>>0]|0;
+ $138 = $137&255;
+ $139 = (($138) + -1)|0;
+ $140 = ($139>>>0)<(8);
+ if ($140) {
+ $$0252 = $138;$128 = $132;
+ } else {
+ break;
+ }
+ }
+ $141 = ($137<<24>>24)==(0);
+ if ($141) {
+ $$0 = -1;
+ break;
+ }
+ $142 = ($137<<24>>24)==(19);
+ $143 = ($$0253|0)>(-1);
+ do {
+ if ($142) {
+ if ($143) {
+ $$0 = -1;
+ break L1;
+ } else {
+ label = 49;
+ }
+ } else {
+ if ($143) {
+ $144 = (($4) + ($$0253<<2)|0);
+ HEAP32[$144>>2] = $138;
+ $145 = (($3) + ($$0253<<3)|0);
+ $146 = $145;
+ $147 = $146;
+ $148 = HEAP32[$147>>2]|0;
+ $149 = (($146) + 4)|0;
+ $150 = $149;
+ $151 = HEAP32[$150>>2]|0;
+ $152 = $6;
+ $153 = $152;
+ HEAP32[$153>>2] = $148;
+ $154 = (($152) + 4)|0;
+ $155 = $154;
+ HEAP32[$155>>2] = $151;
+ label = 49;
+ break;
+ }
+ if (!($10)) {
+ $$0 = 0;
+ break L1;
+ }
+ _pop_arg($6,$138,$2);
+ }
+ } while(0);
+ if ((label|0) == 49) {
+ label = 0;
+ if (!($10)) {
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue;
+ }
+ }
+ $156 = HEAP8[$128>>0]|0;
+ $157 = $156 << 24 >> 24;
+ $158 = ($$0252|0)!=(0);
+ $159 = $157 & 15;
+ $160 = ($159|0)==(3);
+ $or$cond281 = $158 & $160;
+ $161 = $157 & -33;
+ $$0235 = $or$cond281 ? $161 : $157;
+ $162 = $$1263 & 8192;
+ $163 = ($162|0)==(0);
+ $164 = $$1263 & -65537;
+ $$1263$ = $163 ? $$1263 : $164;
+ L71: do {
+ switch ($$0235|0) {
+ case 110: {
+ $trunc = $$0252&255;
+ switch ($trunc<<24>>24) {
+ case 0: {
+ $171 = HEAP32[$6>>2]|0;
+ HEAP32[$171>>2] = $$1248;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 1: {
+ $172 = HEAP32[$6>>2]|0;
+ HEAP32[$172>>2] = $$1248;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 2: {
+ $173 = ($$1248|0)<(0);
+ $174 = $173 << 31 >> 31;
+ $175 = HEAP32[$6>>2]|0;
+ $176 = $175;
+ $177 = $176;
+ HEAP32[$177>>2] = $$1248;
+ $178 = (($176) + 4)|0;
+ $179 = $178;
+ HEAP32[$179>>2] = $174;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 3: {
+ $180 = $$1248&65535;
+ $181 = HEAP32[$6>>2]|0;
+ HEAP16[$181>>1] = $180;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 4: {
+ $182 = $$1248&255;
+ $183 = HEAP32[$6>>2]|0;
+ HEAP8[$183>>0] = $182;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 6: {
+ $184 = HEAP32[$6>>2]|0;
+ HEAP32[$184>>2] = $$1248;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ case 7: {
+ $185 = ($$1248|0)<(0);
+ $186 = $185 << 31 >> 31;
+ $187 = HEAP32[$6>>2]|0;
+ $188 = $187;
+ $189 = $188;
+ HEAP32[$189>>2] = $$1248;
+ $190 = (($188) + 4)|0;
+ $191 = $190;
+ HEAP32[$191>>2] = $186;
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ default: {
+ $$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ }
+ }
+ break;
+ }
+ case 112: {
+ $192 = ($$0254>>>0)>(8);
+ $193 = $192 ? $$0254 : 8;
+ $194 = $$1263$ | 8;
+ $$1236 = 120;$$1255 = $193;$$3265 = $194;
+ label = 61;
+ break;
+ }
+ case 88: case 120: {
+ $$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
+ label = 61;
+ break;
+ }
+ case 111: {
+ $210 = $6;
+ $211 = $210;
+ $212 = HEAP32[$211>>2]|0;
+ $213 = (($210) + 4)|0;
+ $214 = $213;
+ $215 = HEAP32[$214>>2]|0;
+ $216 = (_fmt_o($212,$215,$11)|0);
+ $217 = $$1263$ & 8;
+ $218 = ($217|0)==(0);
+ $219 = $216;
+ $220 = (($12) - ($219))|0;
+ $221 = ($$0254|0)>($220|0);
+ $222 = (($220) + 1)|0;
+ $223 = $218 | $221;
+ $$0254$$0254$ = $223 ? $$0254 : $222;
+ $$0228 = $216;$$1233 = 0;$$1238 = 17333;$$2256 = $$0254$$0254$;$$4266 = $$1263$;$248 = $212;$250 = $215;
+ label = 67;
+ break;
+ }
+ case 105: case 100: {
+ $224 = $6;
+ $225 = $224;
+ $226 = HEAP32[$225>>2]|0;
+ $227 = (($224) + 4)|0;
+ $228 = $227;
+ $229 = HEAP32[$228>>2]|0;
+ $230 = ($229|0)<(0);
+ if ($230) {
+ $231 = (_i64Subtract(0,0,($226|0),($229|0))|0);
+ $232 = tempRet0;
+ $233 = $6;
+ $234 = $233;
+ HEAP32[$234>>2] = $231;
+ $235 = (($233) + 4)|0;
+ $236 = $235;
+ HEAP32[$236>>2] = $232;
+ $$0232 = 1;$$0237 = 17333;$242 = $231;$243 = $232;
+ label = 66;
+ break L71;
+ } else {
+ $237 = $$1263$ & 2048;
+ $238 = ($237|0)==(0);
+ $239 = $$1263$ & 1;
+ $240 = ($239|0)==(0);
+ $$ = $240 ? 17333 : (17335);
+ $$$ = $238 ? $$ : (17334);
+ $241 = $$1263$ & 2049;
+ $narrow = ($241|0)!=(0);
+ $$284$ = $narrow&1;
+ $$0232 = $$284$;$$0237 = $$$;$242 = $226;$243 = $229;
+ label = 66;
+ break L71;
+ }
+ break;
+ }
+ case 117: {
+ $165 = $6;
+ $166 = $165;
+ $167 = HEAP32[$166>>2]|0;
+ $168 = (($165) + 4)|0;
+ $169 = $168;
+ $170 = HEAP32[$169>>2]|0;
+ $$0232 = 0;$$0237 = 17333;$242 = $167;$243 = $170;
+ label = 66;
+ break;
+ }
+ case 99: {
+ $259 = $6;
+ $260 = $259;
+ $261 = HEAP32[$260>>2]|0;
+ $262 = (($259) + 4)|0;
+ $263 = $262;
+ $264 = HEAP32[$263>>2]|0;
+ $265 = $261&255;
+ HEAP8[$13>>0] = $265;
+ $$2 = $13;$$2234 = 0;$$2239 = 17333;$$2251 = $11;$$5 = 1;$$6268 = $164;
+ break;
+ }
+ case 109: {
+ $266 = (___errno_location()|0);
+ $267 = HEAP32[$266>>2]|0;
+ $268 = (_strerror($267)|0);
+ $$1 = $268;
+ label = 71;
+ break;
+ }
+ case 115: {
+ $269 = HEAP32[$6>>2]|0;
+ $270 = ($269|0)!=(0|0);
+ $271 = $270 ? $269 : 17343;
+ $$1 = $271;
+ label = 71;
+ break;
+ }
+ case 67: {
+ $278 = $6;
+ $279 = $278;
+ $280 = HEAP32[$279>>2]|0;
+ $281 = (($278) + 4)|0;
+ $282 = $281;
+ $283 = HEAP32[$282>>2]|0;
+ HEAP32[$8>>2] = $280;
+ HEAP32[$14>>2] = 0;
+ HEAP32[$6>>2] = $8;
+ $$4258355 = -1;$331 = $8;
+ label = 75;
+ break;
+ }
+ case 83: {
+ $$pre349 = HEAP32[$6>>2]|0;
+ $284 = ($$0254|0)==(0);
+ if ($284) {
+ _pad_674($0,32,$$1260,0,$$1263$);
+ $$0240$lcssa357 = 0;
+ label = 84;
+ } else {
+ $$4258355 = $$0254;$331 = $$pre349;
+ label = 75;
+ }
+ break;
+ }
+ case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
+ $306 = +HEAPF64[$6>>3];
+ $307 = (_fmt_fp($0,$306,$$1260,$$0254,$$1263$,$$0235)|0);
+ $$0243 = $307;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue L1;
+ break;
+ }
+ default: {
+ $$2 = $21;$$2234 = 0;$$2239 = 17333;$$2251 = $11;$$5 = $$0254;$$6268 = $$1263$;
+ }
+ }
+ } while(0);
+ L95: do {
+ if ((label|0) == 61) {
+ label = 0;
+ $195 = $6;
+ $196 = $195;
+ $197 = HEAP32[$196>>2]|0;
+ $198 = (($195) + 4)|0;
+ $199 = $198;
+ $200 = HEAP32[$199>>2]|0;
+ $201 = $$1236 & 32;
+ $202 = (_fmt_x($197,$200,$11,$201)|0);
+ $203 = ($197|0)==(0);
+ $204 = ($200|0)==(0);
+ $205 = $203 & $204;
+ $206 = $$3265 & 8;
+ $207 = ($206|0)==(0);
+ $or$cond283 = $207 | $205;
+ $208 = $$1236 >> 4;
+ $209 = (17333 + ($208)|0);
+ $$289 = $or$cond283 ? 17333 : $209;
+ $$290 = $or$cond283 ? 0 : 2;
+ $$0228 = $202;$$1233 = $$290;$$1238 = $$289;$$2256 = $$1255;$$4266 = $$3265;$248 = $197;$250 = $200;
+ label = 67;
+ }
+ else if ((label|0) == 66) {
+ label = 0;
+ $244 = (_fmt_u($242,$243,$11)|0);
+ $$0228 = $244;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;$248 = $242;$250 = $243;
+ label = 67;
+ }
+ else if ((label|0) == 71) {
+ label = 0;
+ $272 = (_memchr($$1,0,$$0254)|0);
+ $273 = ($272|0)==(0|0);
+ $274 = $272;
+ $275 = $$1;
+ $276 = (($274) - ($275))|0;
+ $277 = (($$1) + ($$0254)|0);
+ $$3257 = $273 ? $$0254 : $276;
+ $$1250 = $273 ? $277 : $272;
+ $$2 = $$1;$$2234 = 0;$$2239 = 17333;$$2251 = $$1250;$$5 = $$3257;$$6268 = $164;
+ }
+ else if ((label|0) == 75) {
+ label = 0;
+ $$0229322 = $331;$$0240321 = 0;$$1244320 = 0;
+ while(1) {
+ $285 = HEAP32[$$0229322>>2]|0;
+ $286 = ($285|0)==(0);
+ if ($286) {
+ $$0240$lcssa = $$0240321;$$2245 = $$1244320;
+ break;
+ }
+ $287 = (_wctomb($9,$285)|0);
+ $288 = ($287|0)<(0);
+ $289 = (($$4258355) - ($$0240321))|0;
+ $290 = ($287>>>0)>($289>>>0);
+ $or$cond286 = $288 | $290;
+ if ($or$cond286) {
+ $$0240$lcssa = $$0240321;$$2245 = $287;
+ break;
+ }
+ $291 = ((($$0229322)) + 4|0);
+ $292 = (($287) + ($$0240321))|0;
+ $293 = ($$4258355>>>0)>($292>>>0);
+ if ($293) {
+ $$0229322 = $291;$$0240321 = $292;$$1244320 = $287;
+ } else {
+ $$0240$lcssa = $292;$$2245 = $287;
+ break;
+ }
+ }
+ $294 = ($$2245|0)<(0);
+ if ($294) {
+ $$0 = -1;
+ break L1;
+ }
+ _pad_674($0,32,$$1260,$$0240$lcssa,$$1263$);
+ $295 = ($$0240$lcssa|0)==(0);
+ if ($295) {
+ $$0240$lcssa357 = 0;
+ label = 84;
+ } else {
+ $$1230333 = $331;$$1241332 = 0;
+ while(1) {
+ $296 = HEAP32[$$1230333>>2]|0;
+ $297 = ($296|0)==(0);
+ if ($297) {
+ $$0240$lcssa357 = $$0240$lcssa;
+ label = 84;
+ break L95;
+ }
+ $298 = (_wctomb($9,$296)|0);
+ $299 = (($298) + ($$1241332))|0;
+ $300 = ($299|0)>($$0240$lcssa|0);
+ if ($300) {
+ $$0240$lcssa357 = $$0240$lcssa;
+ label = 84;
+ break L95;
+ }
+ $301 = ((($$1230333)) + 4|0);
+ _out($0,$9,$298);
+ $302 = ($299>>>0)<($$0240$lcssa>>>0);
+ if ($302) {
+ $$1230333 = $301;$$1241332 = $299;
+ } else {
+ $$0240$lcssa357 = $$0240$lcssa;
+ label = 84;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 67) {
+ label = 0;
+ $245 = ($$2256|0)>(-1);
+ $246 = $$4266 & -65537;
+ $$$4266 = $245 ? $246 : $$4266;
+ $247 = ($248|0)!=(0);
+ $249 = ($250|0)!=(0);
+ $251 = $247 | $249;
+ $252 = ($$2256|0)!=(0);
+ $or$cond = $252 | $251;
+ $253 = $$0228;
+ $254 = (($12) - ($253))|0;
+ $255 = $251 ^ 1;
+ $256 = $255&1;
+ $257 = (($256) + ($254))|0;
+ $258 = ($$2256|0)>($257|0);
+ $$2256$ = $258 ? $$2256 : $257;
+ $$2256$$$2256 = $or$cond ? $$2256$ : $$2256;
+ $$0228$ = $or$cond ? $$0228 : $11;
+ $$2 = $$0228$;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $11;$$5 = $$2256$$$2256;$$6268 = $$$4266;
+ }
+ else if ((label|0) == 84) {
+ label = 0;
+ $303 = $$1263$ ^ 8192;
+ _pad_674($0,32,$$1260,$$0240$lcssa357,$303);
+ $304 = ($$1260|0)>($$0240$lcssa357|0);
+ $305 = $304 ? $$1260 : $$0240$lcssa357;
+ $$0243 = $305;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ continue;
+ }
+ $308 = $$2251;
+ $309 = $$2;
+ $310 = (($308) - ($309))|0;
+ $311 = ($$5|0)<($310|0);
+ $$$5 = $311 ? $310 : $$5;
+ $312 = (($$$5) + ($$2234))|0;
+ $313 = ($$1260|0)<($312|0);
+ $$2261 = $313 ? $312 : $$1260;
+ _pad_674($0,32,$$2261,$312,$$6268);
+ _out($0,$$2239,$$2234);
+ $314 = $$6268 ^ 65536;
+ _pad_674($0,48,$$2261,$312,$314);
+ _pad_674($0,48,$$$5,$310,0);
+ _out($0,$$2,$310);
+ $315 = $$6268 ^ 8192;
+ _pad_674($0,32,$$2261,$312,$315);
+ $$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
+ }
+ L114: do {
+ if ((label|0) == 87) {
+ $316 = ($0|0)==(0|0);
+ if ($316) {
+ $317 = ($$0269|0)==(0);
+ if ($317) {
+ $$0 = 0;
+ } else {
+ $$2242305 = 1;
+ while(1) {
+ $318 = (($4) + ($$2242305<<2)|0);
+ $319 = HEAP32[$318>>2]|0;
+ $320 = ($319|0)==(0);
+ if ($320) {
+ $$3303 = $$2242305;
+ break;
+ }
+ $321 = (($3) + ($$2242305<<3)|0);
+ _pop_arg($321,$319,$2);
+ $322 = (($$2242305) + 1)|0;
+ $323 = ($322|0)<(10);
+ if ($323) {
+ $$2242305 = $322;
+ } else {
+ $$0 = 1;
+ break L114;
+ }
+ }
+ while(1) {
+ $326 = (($4) + ($$3303<<2)|0);
+ $327 = HEAP32[$326>>2]|0;
+ $328 = ($327|0)==(0);
+ $325 = (($$3303) + 1)|0;
+ if (!($328)) {
+ $$0 = -1;
+ break L114;
+ }
+ $324 = ($325|0)<(10);
+ if ($324) {
+ $$3303 = $325;
+ } else {
+ $$0 = 1;
+ break;
+ }
+ }
+ }
+ } else {
+ $$0 = $$1248;
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function ___lockfile($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return 0;
+}
+function ___unlockfile($0) {
+ $0 = $0|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ return;
+}
+function _out($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = $3 & 32;
+ $5 = ($4|0)==(0);
+ if ($5) {
+ (___fwritex($1,$2,$0)|0);
+ }
+ return;
+}
+function _getint($0) {
+ $0 = $0|0;
+ var $$0$lcssa = 0, $$06 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit5 = 0, $isdigittmp = 0, $isdigittmp4 = 0, $isdigittmp7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = HEAP32[$0>>2]|0;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2 << 24 >> 24;
+ $isdigittmp4 = (($3) + -48)|0;
+ $isdigit5 = ($isdigittmp4>>>0)<(10);
+ if ($isdigit5) {
+ $$06 = 0;$7 = $1;$isdigittmp7 = $isdigittmp4;
+ while(1) {
+ $4 = ($$06*10)|0;
+ $5 = (($isdigittmp7) + ($4))|0;
+ $6 = ((($7)) + 1|0);
+ HEAP32[$0>>2] = $6;
+ $8 = HEAP8[$6>>0]|0;
+ $9 = $8 << 24 >> 24;
+ $isdigittmp = (($9) + -48)|0;
+ $isdigit = ($isdigittmp>>>0)<(10);
+ if ($isdigit) {
+ $$06 = $5;$7 = $6;$isdigittmp7 = $isdigittmp;
+ } else {
+ $$0$lcssa = $5;
+ break;
+ }
+ }
+ } else {
+ $$0$lcssa = 0;
+ }
+ return ($$0$lcssa|0);
+}
+function _pop_arg($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
+ var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
+ var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
+ var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
+ var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
+ var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
+ var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
+ var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($1>>>0)>(20);
+ L1: do {
+ if (!($3)) {
+ do {
+ switch ($1|0) {
+ case 9: {
+ $arglist_current = HEAP32[$2>>2]|0;
+ $4 = $arglist_current;
+ $5 = ((0) + 4|0);
+ $expanded28 = $5;
+ $expanded = (($expanded28) - 1)|0;
+ $6 = (($4) + ($expanded))|0;
+ $7 = ((0) + 4|0);
+ $expanded32 = $7;
+ $expanded31 = (($expanded32) - 1)|0;
+ $expanded30 = $expanded31 ^ -1;
+ $8 = $6 & $expanded30;
+ $9 = $8;
+ $10 = HEAP32[$9>>2]|0;
+ $arglist_next = ((($9)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next;
+ HEAP32[$0>>2] = $10;
+ break L1;
+ break;
+ }
+ case 10: {
+ $arglist_current2 = HEAP32[$2>>2]|0;
+ $11 = $arglist_current2;
+ $12 = ((0) + 4|0);
+ $expanded35 = $12;
+ $expanded34 = (($expanded35) - 1)|0;
+ $13 = (($11) + ($expanded34))|0;
+ $14 = ((0) + 4|0);
+ $expanded39 = $14;
+ $expanded38 = (($expanded39) - 1)|0;
+ $expanded37 = $expanded38 ^ -1;
+ $15 = $13 & $expanded37;
+ $16 = $15;
+ $17 = HEAP32[$16>>2]|0;
+ $arglist_next3 = ((($16)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next3;
+ $18 = ($17|0)<(0);
+ $19 = $18 << 31 >> 31;
+ $20 = $0;
+ $21 = $20;
+ HEAP32[$21>>2] = $17;
+ $22 = (($20) + 4)|0;
+ $23 = $22;
+ HEAP32[$23>>2] = $19;
+ break L1;
+ break;
+ }
+ case 11: {
+ $arglist_current5 = HEAP32[$2>>2]|0;
+ $24 = $arglist_current5;
+ $25 = ((0) + 4|0);
+ $expanded42 = $25;
+ $expanded41 = (($expanded42) - 1)|0;
+ $26 = (($24) + ($expanded41))|0;
+ $27 = ((0) + 4|0);
+ $expanded46 = $27;
+ $expanded45 = (($expanded46) - 1)|0;
+ $expanded44 = $expanded45 ^ -1;
+ $28 = $26 & $expanded44;
+ $29 = $28;
+ $30 = HEAP32[$29>>2]|0;
+ $arglist_next6 = ((($29)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next6;
+ $31 = $0;
+ $32 = $31;
+ HEAP32[$32>>2] = $30;
+ $33 = (($31) + 4)|0;
+ $34 = $33;
+ HEAP32[$34>>2] = 0;
+ break L1;
+ break;
+ }
+ case 12: {
+ $arglist_current8 = HEAP32[$2>>2]|0;
+ $35 = $arglist_current8;
+ $36 = ((0) + 8|0);
+ $expanded49 = $36;
+ $expanded48 = (($expanded49) - 1)|0;
+ $37 = (($35) + ($expanded48))|0;
+ $38 = ((0) + 8|0);
+ $expanded53 = $38;
+ $expanded52 = (($expanded53) - 1)|0;
+ $expanded51 = $expanded52 ^ -1;
+ $39 = $37 & $expanded51;
+ $40 = $39;
+ $41 = $40;
+ $42 = $41;
+ $43 = HEAP32[$42>>2]|0;
+ $44 = (($41) + 4)|0;
+ $45 = $44;
+ $46 = HEAP32[$45>>2]|0;
+ $arglist_next9 = ((($40)) + 8|0);
+ HEAP32[$2>>2] = $arglist_next9;
+ $47 = $0;
+ $48 = $47;
+ HEAP32[$48>>2] = $43;
+ $49 = (($47) + 4)|0;
+ $50 = $49;
+ HEAP32[$50>>2] = $46;
+ break L1;
+ break;
+ }
+ case 13: {
+ $arglist_current11 = HEAP32[$2>>2]|0;
+ $51 = $arglist_current11;
+ $52 = ((0) + 4|0);
+ $expanded56 = $52;
+ $expanded55 = (($expanded56) - 1)|0;
+ $53 = (($51) + ($expanded55))|0;
+ $54 = ((0) + 4|0);
+ $expanded60 = $54;
+ $expanded59 = (($expanded60) - 1)|0;
+ $expanded58 = $expanded59 ^ -1;
+ $55 = $53 & $expanded58;
+ $56 = $55;
+ $57 = HEAP32[$56>>2]|0;
+ $arglist_next12 = ((($56)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next12;
+ $58 = $57&65535;
+ $59 = $58 << 16 >> 16;
+ $60 = ($59|0)<(0);
+ $61 = $60 << 31 >> 31;
+ $62 = $0;
+ $63 = $62;
+ HEAP32[$63>>2] = $59;
+ $64 = (($62) + 4)|0;
+ $65 = $64;
+ HEAP32[$65>>2] = $61;
+ break L1;
+ break;
+ }
+ case 14: {
+ $arglist_current14 = HEAP32[$2>>2]|0;
+ $66 = $arglist_current14;
+ $67 = ((0) + 4|0);
+ $expanded63 = $67;
+ $expanded62 = (($expanded63) - 1)|0;
+ $68 = (($66) + ($expanded62))|0;
+ $69 = ((0) + 4|0);
+ $expanded67 = $69;
+ $expanded66 = (($expanded67) - 1)|0;
+ $expanded65 = $expanded66 ^ -1;
+ $70 = $68 & $expanded65;
+ $71 = $70;
+ $72 = HEAP32[$71>>2]|0;
+ $arglist_next15 = ((($71)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next15;
+ $$mask31 = $72 & 65535;
+ $73 = $0;
+ $74 = $73;
+ HEAP32[$74>>2] = $$mask31;
+ $75 = (($73) + 4)|0;
+ $76 = $75;
+ HEAP32[$76>>2] = 0;
+ break L1;
+ break;
+ }
+ case 15: {
+ $arglist_current17 = HEAP32[$2>>2]|0;
+ $77 = $arglist_current17;
+ $78 = ((0) + 4|0);
+ $expanded70 = $78;
+ $expanded69 = (($expanded70) - 1)|0;
+ $79 = (($77) + ($expanded69))|0;
+ $80 = ((0) + 4|0);
+ $expanded74 = $80;
+ $expanded73 = (($expanded74) - 1)|0;
+ $expanded72 = $expanded73 ^ -1;
+ $81 = $79 & $expanded72;
+ $82 = $81;
+ $83 = HEAP32[$82>>2]|0;
+ $arglist_next18 = ((($82)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next18;
+ $84 = $83&255;
+ $85 = $84 << 24 >> 24;
+ $86 = ($85|0)<(0);
+ $87 = $86 << 31 >> 31;
+ $88 = $0;
+ $89 = $88;
+ HEAP32[$89>>2] = $85;
+ $90 = (($88) + 4)|0;
+ $91 = $90;
+ HEAP32[$91>>2] = $87;
+ break L1;
+ break;
+ }
+ case 16: {
+ $arglist_current20 = HEAP32[$2>>2]|0;
+ $92 = $arglist_current20;
+ $93 = ((0) + 4|0);
+ $expanded77 = $93;
+ $expanded76 = (($expanded77) - 1)|0;
+ $94 = (($92) + ($expanded76))|0;
+ $95 = ((0) + 4|0);
+ $expanded81 = $95;
+ $expanded80 = (($expanded81) - 1)|0;
+ $expanded79 = $expanded80 ^ -1;
+ $96 = $94 & $expanded79;
+ $97 = $96;
+ $98 = HEAP32[$97>>2]|0;
+ $arglist_next21 = ((($97)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next21;
+ $$mask = $98 & 255;
+ $99 = $0;
+ $100 = $99;
+ HEAP32[$100>>2] = $$mask;
+ $101 = (($99) + 4)|0;
+ $102 = $101;
+ HEAP32[$102>>2] = 0;
+ break L1;
+ break;
+ }
+ case 17: {
+ $arglist_current23 = HEAP32[$2>>2]|0;
+ $103 = $arglist_current23;
+ $104 = ((0) + 8|0);
+ $expanded84 = $104;
+ $expanded83 = (($expanded84) - 1)|0;
+ $105 = (($103) + ($expanded83))|0;
+ $106 = ((0) + 8|0);
+ $expanded88 = $106;
+ $expanded87 = (($expanded88) - 1)|0;
+ $expanded86 = $expanded87 ^ -1;
+ $107 = $105 & $expanded86;
+ $108 = $107;
+ $109 = +HEAPF64[$108>>3];
+ $arglist_next24 = ((($108)) + 8|0);
+ HEAP32[$2>>2] = $arglist_next24;
+ HEAPF64[$0>>3] = $109;
+ break L1;
+ break;
+ }
+ case 18: {
+ $arglist_current26 = HEAP32[$2>>2]|0;
+ $110 = $arglist_current26;
+ $111 = ((0) + 8|0);
+ $expanded91 = $111;
+ $expanded90 = (($expanded91) - 1)|0;
+ $112 = (($110) + ($expanded90))|0;
+ $113 = ((0) + 8|0);
+ $expanded95 = $113;
+ $expanded94 = (($expanded95) - 1)|0;
+ $expanded93 = $expanded94 ^ -1;
+ $114 = $112 & $expanded93;
+ $115 = $114;
+ $116 = +HEAPF64[$115>>3];
+ $arglist_next27 = ((($115)) + 8|0);
+ HEAP32[$2>>2] = $arglist_next27;
+ HEAPF64[$0>>3] = $116;
+ break L1;
+ break;
+ }
+ default: {
+ break L1;
+ }
+ }
+ } while(0);
+ }
+ } while(0);
+ return;
+}
+function _fmt_x($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$05$lcssa = 0, $$056 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ $4 = ($0|0)==(0);
+ $5 = ($1|0)==(0);
+ $6 = $4 & $5;
+ if ($6) {
+ $$05$lcssa = $2;
+ } else {
+ $$056 = $2;$15 = $1;$8 = $0;
+ while(1) {
+ $7 = $8 & 15;
+ $9 = (17381 + ($7)|0);
+ $10 = HEAP8[$9>>0]|0;
+ $11 = $10&255;
+ $12 = $11 | $3;
+ $13 = $12&255;
+ $14 = ((($$056)) + -1|0);
+ HEAP8[$14>>0] = $13;
+ $16 = (_bitshift64Lshr(($8|0),($15|0),4)|0);
+ $17 = tempRet0;
+ $18 = ($16|0)==(0);
+ $19 = ($17|0)==(0);
+ $20 = $18 & $19;
+ if ($20) {
+ $$05$lcssa = $14;
+ break;
+ } else {
+ $$056 = $14;$15 = $17;$8 = $16;
+ }
+ }
+ }
+ return ($$05$lcssa|0);
+}
+function _fmt_o($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0$lcssa = 0, $$06 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($0|0)==(0);
+ $4 = ($1|0)==(0);
+ $5 = $3 & $4;
+ if ($5) {
+ $$0$lcssa = $2;
+ } else {
+ $$06 = $2;$11 = $1;$7 = $0;
+ while(1) {
+ $6 = $7&255;
+ $8 = $6 & 7;
+ $9 = $8 | 48;
+ $10 = ((($$06)) + -1|0);
+ HEAP8[$10>>0] = $9;
+ $12 = (_bitshift64Lshr(($7|0),($11|0),3)|0);
+ $13 = tempRet0;
+ $14 = ($12|0)==(0);
+ $15 = ($13|0)==(0);
+ $16 = $14 & $15;
+ if ($16) {
+ $$0$lcssa = $10;
+ break;
+ } else {
+ $$06 = $10;$11 = $13;$7 = $12;
+ }
+ }
+ }
+ return ($$0$lcssa|0);
+}
+function _fmt_u($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($1>>>0)>(0);
+ $4 = ($0>>>0)>(4294967295);
+ $5 = ($1|0)==(0);
+ $6 = $5 & $4;
+ $7 = $3 | $6;
+ if ($7) {
+ $$0914 = $2;$8 = $0;$9 = $1;
+ while(1) {
+ $10 = (___uremdi3(($8|0),($9|0),10,0)|0);
+ $11 = tempRet0;
+ $12 = $10&255;
+ $13 = $12 | 48;
+ $14 = ((($$0914)) + -1|0);
+ HEAP8[$14>>0] = $13;
+ $15 = (___udivdi3(($8|0),($9|0),10,0)|0);
+ $16 = tempRet0;
+ $17 = ($9>>>0)>(9);
+ $18 = ($8>>>0)>(4294967295);
+ $19 = ($9|0)==(9);
+ $20 = $19 & $18;
+ $21 = $17 | $20;
+ if ($21) {
+ $$0914 = $14;$8 = $15;$9 = $16;
+ } else {
+ break;
+ }
+ }
+ $$010$lcssa$off0 = $15;$$09$lcssa = $14;
+ } else {
+ $$010$lcssa$off0 = $0;$$09$lcssa = $2;
+ }
+ $22 = ($$010$lcssa$off0|0)==(0);
+ if ($22) {
+ $$1$lcssa = $$09$lcssa;
+ } else {
+ $$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
+ while(1) {
+ $23 = (($$012>>>0) % 10)&-1;
+ $24 = $23 | 48;
+ $25 = $24&255;
+ $26 = ((($$111)) + -1|0);
+ HEAP8[$26>>0] = $25;
+ $27 = (($$012>>>0) / 10)&-1;
+ $28 = ($$012>>>0)<(10);
+ if ($28) {
+ $$1$lcssa = $26;
+ break;
+ } else {
+ $$012 = $27;$$111 = $26;
+ }
+ }
+ }
+ return ($$1$lcssa|0);
+}
+function _strerror($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (___pthread_self_105()|0);
+ $2 = ((($1)) + 188|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = (___strerror_l($0,$3)|0);
+ return ($4|0);
+}
+function _memchr($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
+ var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = $1 & 255;
+ $4 = $0;
+ $5 = $4 & 3;
+ $6 = ($5|0)!=(0);
+ $7 = ($2|0)!=(0);
+ $or$cond53 = $7 & $6;
+ L1: do {
+ if ($or$cond53) {
+ $8 = $1&255;
+ $$03555 = $0;$$03654 = $2;
+ while(1) {
+ $9 = HEAP8[$$03555>>0]|0;
+ $10 = ($9<<24>>24)==($8<<24>>24);
+ if ($10) {
+ $$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
+ label = 6;
+ break L1;
+ }
+ $11 = ((($$03555)) + 1|0);
+ $12 = (($$03654) + -1)|0;
+ $13 = $11;
+ $14 = $13 & 3;
+ $15 = ($14|0)!=(0);
+ $16 = ($12|0)!=(0);
+ $or$cond = $16 & $15;
+ if ($or$cond) {
+ $$03555 = $11;$$03654 = $12;
+ } else {
+ $$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
+ label = 5;
+ break;
+ }
+ }
+ } else {
+ $$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
+ label = 5;
+ }
+ } while(0);
+ if ((label|0) == 5) {
+ if ($$lcssa) {
+ $$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
+ label = 6;
+ } else {
+ $$2 = $$035$lcssa;$$3 = 0;
+ }
+ }
+ L8: do {
+ if ((label|0) == 6) {
+ $17 = HEAP8[$$035$lcssa65>>0]|0;
+ $18 = $1&255;
+ $19 = ($17<<24>>24)==($18<<24>>24);
+ if ($19) {
+ $$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
+ } else {
+ $20 = Math_imul($3, 16843009)|0;
+ $21 = ($$036$lcssa64>>>0)>(3);
+ L11: do {
+ if ($21) {
+ $$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
+ while(1) {
+ $22 = HEAP32[$$046>>2]|0;
+ $23 = $22 ^ $20;
+ $24 = (($23) + -16843009)|0;
+ $25 = $23 & -2139062144;
+ $26 = $25 ^ -2139062144;
+ $27 = $26 & $24;
+ $28 = ($27|0)==(0);
+ if (!($28)) {
+ break;
+ }
+ $29 = ((($$046)) + 4|0);
+ $30 = (($$13745) + -4)|0;
+ $31 = ($30>>>0)>(3);
+ if ($31) {
+ $$046 = $29;$$13745 = $30;
+ } else {
+ $$0$lcssa = $29;$$137$lcssa = $30;
+ label = 11;
+ break L11;
+ }
+ }
+ $$140 = $$046;$$23839 = $$13745;
+ } else {
+ $$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
+ label = 11;
+ }
+ } while(0);
+ if ((label|0) == 11) {
+ $32 = ($$137$lcssa|0)==(0);
+ if ($32) {
+ $$2 = $$0$lcssa;$$3 = 0;
+ break;
+ } else {
+ $$140 = $$0$lcssa;$$23839 = $$137$lcssa;
+ }
+ }
+ while(1) {
+ $33 = HEAP8[$$140>>0]|0;
+ $34 = ($33<<24>>24)==($18<<24>>24);
+ if ($34) {
+ $$2 = $$140;$$3 = $$23839;
+ break L8;
+ }
+ $35 = ((($$140)) + 1|0);
+ $36 = (($$23839) + -1)|0;
+ $37 = ($36|0)==(0);
+ if ($37) {
+ $$2 = $35;$$3 = 0;
+ break;
+ } else {
+ $$140 = $35;$$23839 = $36;
+ }
+ }
+ }
+ }
+ } while(0);
+ $38 = ($$3|0)!=(0);
+ $39 = $38 ? $$2 : 0;
+ return ($39|0);
+}
+function _pad_674($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0$lcssa = 0, $$011 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
+ $5 = sp;
+ $6 = $4 & 73728;
+ $7 = ($6|0)==(0);
+ $8 = ($2|0)>($3|0);
+ $or$cond = $8 & $7;
+ if ($or$cond) {
+ $9 = (($2) - ($3))|0;
+ $10 = ($9>>>0)<(256);
+ $11 = $10 ? $9 : 256;
+ _memset(($5|0),($1|0),($11|0))|0;
+ $12 = ($9>>>0)>(255);
+ if ($12) {
+ $13 = (($2) - ($3))|0;
+ $$011 = $9;
+ while(1) {
+ _out($0,$5,256);
+ $14 = (($$011) + -256)|0;
+ $15 = ($14>>>0)>(255);
+ if ($15) {
+ $$011 = $14;
+ } else {
+ break;
+ }
+ }
+ $16 = $13 & 255;
+ $$0$lcssa = $16;
+ } else {
+ $$0$lcssa = $9;
+ }
+ _out($0,$5,$$0$lcssa);
+ }
+ STACKTOP = sp;return;
+}
+function _wctomb($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($0|0)==(0|0);
+ if ($2) {
+ $$0 = 0;
+ } else {
+ $3 = (_wcrtomb($0,$1,0)|0);
+ $$0 = $3;
+ }
+ return ($$0|0);
+}
+function _fmt_fp($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = +$1;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$ = 0, $$$ = 0, $$$$559 = 0.0, $$$3484 = 0, $$$3484691 = 0, $$$3484692 = 0, $$$3501 = 0, $$$4502 = 0, $$$542 = 0.0, $$$559 = 0.0, $$0 = 0, $$0463$lcssa = 0, $$0463584 = 0, $$0464594 = 0, $$0471 = 0.0, $$0479 = 0, $$0487642 = 0, $$0488 = 0, $$0488653 = 0, $$0488655 = 0;
+ var $$0496$$9 = 0, $$0497654 = 0, $$0498 = 0, $$0509582 = 0.0, $$0510 = 0, $$0511 = 0, $$0514637 = 0, $$0520 = 0, $$0521 = 0, $$0521$ = 0, $$0523 = 0, $$0525 = 0, $$0527 = 0, $$0527629 = 0, $$0527631 = 0, $$0530636 = 0, $$1465 = 0, $$1467 = 0.0, $$1469 = 0.0, $$1472 = 0.0;
+ var $$1480 = 0, $$1482$lcssa = 0, $$1482661 = 0, $$1489641 = 0, $$1499$lcssa = 0, $$1499660 = 0, $$1508583 = 0, $$1512$lcssa = 0, $$1512607 = 0, $$1515 = 0, $$1524 = 0, $$1526 = 0, $$1528614 = 0, $$1531$lcssa = 0, $$1531630 = 0, $$1598 = 0, $$2 = 0, $$2473 = 0.0, $$2476 = 0, $$2476$$547 = 0;
+ var $$2476$$549 = 0, $$2483$ph = 0, $$2500 = 0, $$2513 = 0, $$2516618 = 0, $$2529 = 0, $$2532617 = 0, $$3 = 0.0, $$3477 = 0, $$3484$lcssa = 0, $$3484648 = 0, $$3501$lcssa = 0, $$3501647 = 0, $$3533613 = 0, $$4 = 0.0, $$4478$lcssa = 0, $$4478590 = 0, $$4492 = 0, $$4502 = 0, $$4518 = 0;
+ var $$5$lcssa = 0, $$534$ = 0, $$539 = 0, $$539$ = 0, $$542 = 0.0, $$546 = 0, $$548 = 0, $$5486$lcssa = 0, $$5486623 = 0, $$5493597 = 0, $$5519$ph = 0, $$555 = 0, $$556 = 0, $$559 = 0.0, $$5602 = 0, $$6 = 0, $$6494589 = 0, $$7495601 = 0, $$7505 = 0, $$7505$ = 0;
+ var $$7505$ph = 0, $$8 = 0, $$9$ph = 0, $$lcssa673 = 0, $$neg = 0, $$neg567 = 0, $$pn = 0, $$pn566 = 0, $$pr = 0, $$pr564 = 0, $$pre = 0, $$pre$phi690Z2D = 0, $$pre689 = 0, $$sink545$lcssa = 0, $$sink545622 = 0, $$sink562 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
+ var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0;
+ var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
+ var $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
+ var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
+ var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
+ var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
+ var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0;
+ var $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
+ var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
+ var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
+ var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
+ var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
+ var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
+ var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0.0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
+ var $358 = 0, $359 = 0, $36 = 0.0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
+ var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0;
+ var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
+ var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0;
+ var $narrow = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond537 = 0, $or$cond541 = 0, $or$cond544 = 0, $or$cond554 = 0, $or$cond6 = 0, $scevgep684 = 0, $scevgep684685 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
+ $6 = sp + 8|0;
+ $7 = sp;
+ $8 = sp + 524|0;
+ $9 = $8;
+ $10 = sp + 512|0;
+ HEAP32[$7>>2] = 0;
+ $11 = ((($10)) + 12|0);
+ (___DOUBLE_BITS_675($1)|0);
+ $12 = tempRet0;
+ $13 = ($12|0)<(0);
+ if ($13) {
+ $14 = -$1;
+ $$0471 = $14;$$0520 = 1;$$0521 = 17350;
+ } else {
+ $15 = $4 & 2048;
+ $16 = ($15|0)==(0);
+ $17 = $4 & 1;
+ $18 = ($17|0)==(0);
+ $$ = $18 ? (17351) : (17356);
+ $$$ = $16 ? $$ : (17353);
+ $19 = $4 & 2049;
+ $narrow = ($19|0)!=(0);
+ $$534$ = $narrow&1;
+ $$0471 = $1;$$0520 = $$534$;$$0521 = $$$;
+ }
+ (___DOUBLE_BITS_675($$0471)|0);
+ $20 = tempRet0;
+ $21 = $20 & 2146435072;
+ $22 = ($21>>>0)<(2146435072);
+ $23 = (0)<(0);
+ $24 = ($21|0)==(2146435072);
+ $25 = $24 & $23;
+ $26 = $22 | $25;
+ do {
+ if ($26) {
+ $35 = (+_frexpl($$0471,$7));
+ $36 = $35 * 2.0;
+ $37 = $36 != 0.0;
+ if ($37) {
+ $38 = HEAP32[$7>>2]|0;
+ $39 = (($38) + -1)|0;
+ HEAP32[$7>>2] = $39;
+ }
+ $40 = $5 | 32;
+ $41 = ($40|0)==(97);
+ if ($41) {
+ $42 = $5 & 32;
+ $43 = ($42|0)==(0);
+ $44 = ((($$0521)) + 9|0);
+ $$0521$ = $43 ? $$0521 : $44;
+ $45 = $$0520 | 2;
+ $46 = ($3>>>0)>(11);
+ $47 = (12 - ($3))|0;
+ $48 = ($47|0)==(0);
+ $49 = $46 | $48;
+ do {
+ if ($49) {
+ $$1472 = $36;
+ } else {
+ $$0509582 = 8.0;$$1508583 = $47;
+ while(1) {
+ $50 = (($$1508583) + -1)|0;
+ $51 = $$0509582 * 16.0;
+ $52 = ($50|0)==(0);
+ if ($52) {
+ break;
+ } else {
+ $$0509582 = $51;$$1508583 = $50;
+ }
+ }
+ $53 = HEAP8[$$0521$>>0]|0;
+ $54 = ($53<<24>>24)==(45);
+ if ($54) {
+ $55 = -$36;
+ $56 = $55 - $51;
+ $57 = $51 + $56;
+ $58 = -$57;
+ $$1472 = $58;
+ break;
+ } else {
+ $59 = $36 + $51;
+ $60 = $59 - $51;
+ $$1472 = $60;
+ break;
+ }
+ }
+ } while(0);
+ $61 = HEAP32[$7>>2]|0;
+ $62 = ($61|0)<(0);
+ $63 = (0 - ($61))|0;
+ $64 = $62 ? $63 : $61;
+ $65 = ($64|0)<(0);
+ $66 = $65 << 31 >> 31;
+ $67 = (_fmt_u($64,$66,$11)|0);
+ $68 = ($67|0)==($11|0);
+ if ($68) {
+ $69 = ((($10)) + 11|0);
+ HEAP8[$69>>0] = 48;
+ $$0511 = $69;
+ } else {
+ $$0511 = $67;
+ }
+ $70 = $61 >> 31;
+ $71 = $70 & 2;
+ $72 = (($71) + 43)|0;
+ $73 = $72&255;
+ $74 = ((($$0511)) + -1|0);
+ HEAP8[$74>>0] = $73;
+ $75 = (($5) + 15)|0;
+ $76 = $75&255;
+ $77 = ((($$0511)) + -2|0);
+ HEAP8[$77>>0] = $76;
+ $notrhs = ($3|0)<(1);
+ $78 = $4 & 8;
+ $79 = ($78|0)==(0);
+ $$0523 = $8;$$2473 = $$1472;
+ while(1) {
+ $80 = (~~(($$2473)));
+ $81 = (17381 + ($80)|0);
+ $82 = HEAP8[$81>>0]|0;
+ $83 = $82&255;
+ $84 = $83 | $42;
+ $85 = $84&255;
+ $86 = ((($$0523)) + 1|0);
+ HEAP8[$$0523>>0] = $85;
+ $87 = (+($80|0));
+ $88 = $$2473 - $87;
+ $89 = $88 * 16.0;
+ $90 = $86;
+ $91 = (($90) - ($9))|0;
+ $92 = ($91|0)==(1);
+ if ($92) {
+ $notlhs = $89 == 0.0;
+ $or$cond3$not = $notrhs & $notlhs;
+ $or$cond = $79 & $or$cond3$not;
+ if ($or$cond) {
+ $$1524 = $86;
+ } else {
+ $93 = ((($$0523)) + 2|0);
+ HEAP8[$86>>0] = 46;
+ $$1524 = $93;
+ }
+ } else {
+ $$1524 = $86;
+ }
+ $94 = $89 != 0.0;
+ if ($94) {
+ $$0523 = $$1524;$$2473 = $89;
+ } else {
+ break;
+ }
+ }
+ $95 = ($3|0)!=(0);
+ $96 = $77;
+ $97 = $11;
+ $98 = $$1524;
+ $99 = (($98) - ($9))|0;
+ $100 = (($97) - ($96))|0;
+ $101 = (($99) + -2)|0;
+ $102 = ($101|0)<($3|0);
+ $or$cond537 = $95 & $102;
+ $103 = (($3) + 2)|0;
+ $$pn = $or$cond537 ? $103 : $99;
+ $$0525 = (($100) + ($45))|0;
+ $104 = (($$0525) + ($$pn))|0;
+ _pad_674($0,32,$2,$104,$4);
+ _out($0,$$0521$,$45);
+ $105 = $4 ^ 65536;
+ _pad_674($0,48,$2,$104,$105);
+ _out($0,$8,$99);
+ $106 = (($$pn) - ($99))|0;
+ _pad_674($0,48,$106,0,0);
+ _out($0,$77,$100);
+ $107 = $4 ^ 8192;
+ _pad_674($0,32,$2,$104,$107);
+ $$sink562 = $104;
+ break;
+ }
+ $108 = ($3|0)<(0);
+ $$539 = $108 ? 6 : $3;
+ if ($37) {
+ $109 = $36 * 268435456.0;
+ $110 = HEAP32[$7>>2]|0;
+ $111 = (($110) + -28)|0;
+ HEAP32[$7>>2] = $111;
+ $$3 = $109;$$pr = $111;
+ } else {
+ $$pre = HEAP32[$7>>2]|0;
+ $$3 = $36;$$pr = $$pre;
+ }
+ $112 = ($$pr|0)<(0);
+ $113 = ((($6)) + 288|0);
+ $$556 = $112 ? $6 : $113;
+ $$0498 = $$556;$$4 = $$3;
+ while(1) {
+ $114 = (~~(($$4))>>>0);
+ HEAP32[$$0498>>2] = $114;
+ $115 = ((($$0498)) + 4|0);
+ $116 = (+($114>>>0));
+ $117 = $$4 - $116;
+ $118 = $117 * 1.0E+9;
+ $119 = $118 != 0.0;
+ if ($119) {
+ $$0498 = $115;$$4 = $118;
+ } else {
+ break;
+ }
+ }
+ $120 = ($$pr|0)>(0);
+ if ($120) {
+ $$1482661 = $$556;$$1499660 = $115;$122 = $$pr;
+ while(1) {
+ $121 = ($122|0)<(29);
+ $123 = $121 ? $122 : 29;
+ $$0488653 = ((($$1499660)) + -4|0);
+ $124 = ($$0488653>>>0)<($$1482661>>>0);
+ if ($124) {
+ $$2483$ph = $$1482661;
+ } else {
+ $$0488655 = $$0488653;$$0497654 = 0;
+ while(1) {
+ $125 = HEAP32[$$0488655>>2]|0;
+ $126 = (_bitshift64Shl(($125|0),0,($123|0))|0);
+ $127 = tempRet0;
+ $128 = (_i64Add(($126|0),($127|0),($$0497654|0),0)|0);
+ $129 = tempRet0;
+ $130 = (___uremdi3(($128|0),($129|0),1000000000,0)|0);
+ $131 = tempRet0;
+ HEAP32[$$0488655>>2] = $130;
+ $132 = (___udivdi3(($128|0),($129|0),1000000000,0)|0);
+ $133 = tempRet0;
+ $$0488 = ((($$0488655)) + -4|0);
+ $134 = ($$0488>>>0)<($$1482661>>>0);
+ if ($134) {
+ break;
+ } else {
+ $$0488655 = $$0488;$$0497654 = $132;
+ }
+ }
+ $135 = ($132|0)==(0);
+ if ($135) {
+ $$2483$ph = $$1482661;
+ } else {
+ $136 = ((($$1482661)) + -4|0);
+ HEAP32[$136>>2] = $132;
+ $$2483$ph = $136;
+ }
+ }
+ $$2500 = $$1499660;
+ while(1) {
+ $137 = ($$2500>>>0)>($$2483$ph>>>0);
+ if (!($137)) {
+ break;
+ }
+ $138 = ((($$2500)) + -4|0);
+ $139 = HEAP32[$138>>2]|0;
+ $140 = ($139|0)==(0);
+ if ($140) {
+ $$2500 = $138;
+ } else {
+ break;
+ }
+ }
+ $141 = HEAP32[$7>>2]|0;
+ $142 = (($141) - ($123))|0;
+ HEAP32[$7>>2] = $142;
+ $143 = ($142|0)>(0);
+ if ($143) {
+ $$1482661 = $$2483$ph;$$1499660 = $$2500;$122 = $142;
+ } else {
+ $$1482$lcssa = $$2483$ph;$$1499$lcssa = $$2500;$$pr564 = $142;
+ break;
+ }
+ }
+ } else {
+ $$1482$lcssa = $$556;$$1499$lcssa = $115;$$pr564 = $$pr;
+ }
+ $144 = ($$pr564|0)<(0);
+ if ($144) {
+ $145 = (($$539) + 25)|0;
+ $146 = (($145|0) / 9)&-1;
+ $147 = (($146) + 1)|0;
+ $148 = ($40|0)==(102);
+ $$3484648 = $$1482$lcssa;$$3501647 = $$1499$lcssa;$150 = $$pr564;
+ while(1) {
+ $149 = (0 - ($150))|0;
+ $151 = ($149|0)<(9);
+ $152 = $151 ? $149 : 9;
+ $153 = ($$3484648>>>0)<($$3501647>>>0);
+ if ($153) {
+ $157 = 1 << $152;
+ $158 = (($157) + -1)|0;
+ $159 = 1000000000 >>> $152;
+ $$0487642 = 0;$$1489641 = $$3484648;
+ while(1) {
+ $160 = HEAP32[$$1489641>>2]|0;
+ $161 = $160 & $158;
+ $162 = $160 >>> $152;
+ $163 = (($162) + ($$0487642))|0;
+ HEAP32[$$1489641>>2] = $163;
+ $164 = Math_imul($161, $159)|0;
+ $165 = ((($$1489641)) + 4|0);
+ $166 = ($165>>>0)<($$3501647>>>0);
+ if ($166) {
+ $$0487642 = $164;$$1489641 = $165;
+ } else {
+ break;
+ }
+ }
+ $167 = HEAP32[$$3484648>>2]|0;
+ $168 = ($167|0)==(0);
+ $169 = ((($$3484648)) + 4|0);
+ $$$3484 = $168 ? $169 : $$3484648;
+ $170 = ($164|0)==(0);
+ if ($170) {
+ $$$3484692 = $$$3484;$$4502 = $$3501647;
+ } else {
+ $171 = ((($$3501647)) + 4|0);
+ HEAP32[$$3501647>>2] = $164;
+ $$$3484692 = $$$3484;$$4502 = $171;
+ }
+ } else {
+ $154 = HEAP32[$$3484648>>2]|0;
+ $155 = ($154|0)==(0);
+ $156 = ((($$3484648)) + 4|0);
+ $$$3484691 = $155 ? $156 : $$3484648;
+ $$$3484692 = $$$3484691;$$4502 = $$3501647;
+ }
+ $172 = $148 ? $$556 : $$$3484692;
+ $173 = $$4502;
+ $174 = $172;
+ $175 = (($173) - ($174))|0;
+ $176 = $175 >> 2;
+ $177 = ($176|0)>($147|0);
+ $178 = (($172) + ($147<<2)|0);
+ $$$4502 = $177 ? $178 : $$4502;
+ $179 = HEAP32[$7>>2]|0;
+ $180 = (($179) + ($152))|0;
+ HEAP32[$7>>2] = $180;
+ $181 = ($180|0)<(0);
+ if ($181) {
+ $$3484648 = $$$3484692;$$3501647 = $$$4502;$150 = $180;
+ } else {
+ $$3484$lcssa = $$$3484692;$$3501$lcssa = $$$4502;
+ break;
+ }
+ }
+ } else {
+ $$3484$lcssa = $$1482$lcssa;$$3501$lcssa = $$1499$lcssa;
+ }
+ $182 = ($$3484$lcssa>>>0)<($$3501$lcssa>>>0);
+ $183 = $$556;
+ if ($182) {
+ $184 = $$3484$lcssa;
+ $185 = (($183) - ($184))|0;
+ $186 = $185 >> 2;
+ $187 = ($186*9)|0;
+ $188 = HEAP32[$$3484$lcssa>>2]|0;
+ $189 = ($188>>>0)<(10);
+ if ($189) {
+ $$1515 = $187;
+ } else {
+ $$0514637 = $187;$$0530636 = 10;
+ while(1) {
+ $190 = ($$0530636*10)|0;
+ $191 = (($$0514637) + 1)|0;
+ $192 = ($188>>>0)<($190>>>0);
+ if ($192) {
+ $$1515 = $191;
+ break;
+ } else {
+ $$0514637 = $191;$$0530636 = $190;
+ }
+ }
+ }
+ } else {
+ $$1515 = 0;
+ }
+ $193 = ($40|0)!=(102);
+ $194 = $193 ? $$1515 : 0;
+ $195 = (($$539) - ($194))|0;
+ $196 = ($40|0)==(103);
+ $197 = ($$539|0)!=(0);
+ $198 = $197 & $196;
+ $$neg = $198 << 31 >> 31;
+ $199 = (($195) + ($$neg))|0;
+ $200 = $$3501$lcssa;
+ $201 = (($200) - ($183))|0;
+ $202 = $201 >> 2;
+ $203 = ($202*9)|0;
+ $204 = (($203) + -9)|0;
+ $205 = ($199|0)<($204|0);
+ if ($205) {
+ $206 = ((($$556)) + 4|0);
+ $207 = (($199) + 9216)|0;
+ $208 = (($207|0) / 9)&-1;
+ $209 = (($208) + -1024)|0;
+ $210 = (($206) + ($209<<2)|0);
+ $211 = (($207|0) % 9)&-1;
+ $$0527629 = (($211) + 1)|0;
+ $212 = ($$0527629|0)<(9);
+ if ($212) {
+ $$0527631 = $$0527629;$$1531630 = 10;
+ while(1) {
+ $213 = ($$1531630*10)|0;
+ $$0527 = (($$0527631) + 1)|0;
+ $exitcond = ($$0527|0)==(9);
+ if ($exitcond) {
+ $$1531$lcssa = $213;
+ break;
+ } else {
+ $$0527631 = $$0527;$$1531630 = $213;
+ }
+ }
+ } else {
+ $$1531$lcssa = 10;
+ }
+ $214 = HEAP32[$210>>2]|0;
+ $215 = (($214>>>0) % ($$1531$lcssa>>>0))&-1;
+ $216 = ($215|0)==(0);
+ $217 = ((($210)) + 4|0);
+ $218 = ($217|0)==($$3501$lcssa|0);
+ $or$cond541 = $218 & $216;
+ if ($or$cond541) {
+ $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
+ } else {
+ $219 = (($214>>>0) / ($$1531$lcssa>>>0))&-1;
+ $220 = $219 & 1;
+ $221 = ($220|0)==(0);
+ $$542 = $221 ? 9007199254740992.0 : 9007199254740994.0;
+ $222 = (($$1531$lcssa|0) / 2)&-1;
+ $223 = ($215>>>0)<($222>>>0);
+ $224 = ($215|0)==($222|0);
+ $or$cond544 = $218 & $224;
+ $$559 = $or$cond544 ? 1.0 : 1.5;
+ $$$559 = $223 ? 0.5 : $$559;
+ $225 = ($$0520|0)==(0);
+ if ($225) {
+ $$1467 = $$$559;$$1469 = $$542;
+ } else {
+ $226 = HEAP8[$$0521>>0]|0;
+ $227 = ($226<<24>>24)==(45);
+ $228 = -$$542;
+ $229 = -$$$559;
+ $$$542 = $227 ? $228 : $$542;
+ $$$$559 = $227 ? $229 : $$$559;
+ $$1467 = $$$$559;$$1469 = $$$542;
+ }
+ $230 = (($214) - ($215))|0;
+ HEAP32[$210>>2] = $230;
+ $231 = $$1469 + $$1467;
+ $232 = $231 != $$1469;
+ if ($232) {
+ $233 = (($230) + ($$1531$lcssa))|0;
+ HEAP32[$210>>2] = $233;
+ $234 = ($233>>>0)>(999999999);
+ if ($234) {
+ $$5486623 = $$3484$lcssa;$$sink545622 = $210;
+ while(1) {
+ $235 = ((($$sink545622)) + -4|0);
+ HEAP32[$$sink545622>>2] = 0;
+ $236 = ($235>>>0)<($$5486623>>>0);
+ if ($236) {
+ $237 = ((($$5486623)) + -4|0);
+ HEAP32[$237>>2] = 0;
+ $$6 = $237;
+ } else {
+ $$6 = $$5486623;
+ }
+ $238 = HEAP32[$235>>2]|0;
+ $239 = (($238) + 1)|0;
+ HEAP32[$235>>2] = $239;
+ $240 = ($239>>>0)>(999999999);
+ if ($240) {
+ $$5486623 = $$6;$$sink545622 = $235;
+ } else {
+ $$5486$lcssa = $$6;$$sink545$lcssa = $235;
+ break;
+ }
+ }
+ } else {
+ $$5486$lcssa = $$3484$lcssa;$$sink545$lcssa = $210;
+ }
+ $241 = $$5486$lcssa;
+ $242 = (($183) - ($241))|0;
+ $243 = $242 >> 2;
+ $244 = ($243*9)|0;
+ $245 = HEAP32[$$5486$lcssa>>2]|0;
+ $246 = ($245>>>0)<(10);
+ if ($246) {
+ $$4492 = $$sink545$lcssa;$$4518 = $244;$$8 = $$5486$lcssa;
+ } else {
+ $$2516618 = $244;$$2532617 = 10;
+ while(1) {
+ $247 = ($$2532617*10)|0;
+ $248 = (($$2516618) + 1)|0;
+ $249 = ($245>>>0)<($247>>>0);
+ if ($249) {
+ $$4492 = $$sink545$lcssa;$$4518 = $248;$$8 = $$5486$lcssa;
+ break;
+ } else {
+ $$2516618 = $248;$$2532617 = $247;
+ }
+ }
+ }
+ } else {
+ $$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
+ }
+ }
+ $250 = ((($$4492)) + 4|0);
+ $251 = ($$3501$lcssa>>>0)>($250>>>0);
+ $$$3501 = $251 ? $250 : $$3501$lcssa;
+ $$5519$ph = $$4518;$$7505$ph = $$$3501;$$9$ph = $$8;
+ } else {
+ $$5519$ph = $$1515;$$7505$ph = $$3501$lcssa;$$9$ph = $$3484$lcssa;
+ }
+ $$7505 = $$7505$ph;
+ while(1) {
+ $252 = ($$7505>>>0)>($$9$ph>>>0);
+ if (!($252)) {
+ $$lcssa673 = 0;
+ break;
+ }
+ $253 = ((($$7505)) + -4|0);
+ $254 = HEAP32[$253>>2]|0;
+ $255 = ($254|0)==(0);
+ if ($255) {
+ $$7505 = $253;
+ } else {
+ $$lcssa673 = 1;
+ break;
+ }
+ }
+ $256 = (0 - ($$5519$ph))|0;
+ do {
+ if ($196) {
+ $not$ = $197 ^ 1;
+ $257 = $not$&1;
+ $$539$ = (($257) + ($$539))|0;
+ $258 = ($$539$|0)>($$5519$ph|0);
+ $259 = ($$5519$ph|0)>(-5);
+ $or$cond6 = $258 & $259;
+ if ($or$cond6) {
+ $260 = (($5) + -1)|0;
+ $$neg567 = (($$539$) + -1)|0;
+ $261 = (($$neg567) - ($$5519$ph))|0;
+ $$0479 = $260;$$2476 = $261;
+ } else {
+ $262 = (($5) + -2)|0;
+ $263 = (($$539$) + -1)|0;
+ $$0479 = $262;$$2476 = $263;
+ }
+ $264 = $4 & 8;
+ $265 = ($264|0)==(0);
+ if ($265) {
+ if ($$lcssa673) {
+ $266 = ((($$7505)) + -4|0);
+ $267 = HEAP32[$266>>2]|0;
+ $268 = ($267|0)==(0);
+ if ($268) {
+ $$2529 = 9;
+ } else {
+ $269 = (($267>>>0) % 10)&-1;
+ $270 = ($269|0)==(0);
+ if ($270) {
+ $$1528614 = 0;$$3533613 = 10;
+ while(1) {
+ $271 = ($$3533613*10)|0;
+ $272 = (($$1528614) + 1)|0;
+ $273 = (($267>>>0) % ($271>>>0))&-1;
+ $274 = ($273|0)==(0);
+ if ($274) {
+ $$1528614 = $272;$$3533613 = $271;
+ } else {
+ $$2529 = $272;
+ break;
+ }
+ }
+ } else {
+ $$2529 = 0;
+ }
+ }
+ } else {
+ $$2529 = 9;
+ }
+ $275 = $$0479 | 32;
+ $276 = ($275|0)==(102);
+ $277 = $$7505;
+ $278 = (($277) - ($183))|0;
+ $279 = $278 >> 2;
+ $280 = ($279*9)|0;
+ $281 = (($280) + -9)|0;
+ if ($276) {
+ $282 = (($281) - ($$2529))|0;
+ $283 = ($282|0)>(0);
+ $$546 = $283 ? $282 : 0;
+ $284 = ($$2476|0)<($$546|0);
+ $$2476$$547 = $284 ? $$2476 : $$546;
+ $$1480 = $$0479;$$3477 = $$2476$$547;$$pre$phi690Z2D = 0;
+ break;
+ } else {
+ $285 = (($281) + ($$5519$ph))|0;
+ $286 = (($285) - ($$2529))|0;
+ $287 = ($286|0)>(0);
+ $$548 = $287 ? $286 : 0;
+ $288 = ($$2476|0)<($$548|0);
+ $$2476$$549 = $288 ? $$2476 : $$548;
+ $$1480 = $$0479;$$3477 = $$2476$$549;$$pre$phi690Z2D = 0;
+ break;
+ }
+ } else {
+ $$1480 = $$0479;$$3477 = $$2476;$$pre$phi690Z2D = $264;
+ }
+ } else {
+ $$pre689 = $4 & 8;
+ $$1480 = $5;$$3477 = $$539;$$pre$phi690Z2D = $$pre689;
+ }
+ } while(0);
+ $289 = $$3477 | $$pre$phi690Z2D;
+ $290 = ($289|0)!=(0);
+ $291 = $290&1;
+ $292 = $$1480 | 32;
+ $293 = ($292|0)==(102);
+ if ($293) {
+ $294 = ($$5519$ph|0)>(0);
+ $295 = $294 ? $$5519$ph : 0;
+ $$2513 = 0;$$pn566 = $295;
+ } else {
+ $296 = ($$5519$ph|0)<(0);
+ $297 = $296 ? $256 : $$5519$ph;
+ $298 = ($297|0)<(0);
+ $299 = $298 << 31 >> 31;
+ $300 = (_fmt_u($297,$299,$11)|0);
+ $301 = $11;
+ $302 = $300;
+ $303 = (($301) - ($302))|0;
+ $304 = ($303|0)<(2);
+ if ($304) {
+ $$1512607 = $300;
+ while(1) {
+ $305 = ((($$1512607)) + -1|0);
+ HEAP8[$305>>0] = 48;
+ $306 = $305;
+ $307 = (($301) - ($306))|0;
+ $308 = ($307|0)<(2);
+ if ($308) {
+ $$1512607 = $305;
+ } else {
+ $$1512$lcssa = $305;
+ break;
+ }
+ }
+ } else {
+ $$1512$lcssa = $300;
+ }
+ $309 = $$5519$ph >> 31;
+ $310 = $309 & 2;
+ $311 = (($310) + 43)|0;
+ $312 = $311&255;
+ $313 = ((($$1512$lcssa)) + -1|0);
+ HEAP8[$313>>0] = $312;
+ $314 = $$1480&255;
+ $315 = ((($$1512$lcssa)) + -2|0);
+ HEAP8[$315>>0] = $314;
+ $316 = $315;
+ $317 = (($301) - ($316))|0;
+ $$2513 = $315;$$pn566 = $317;
+ }
+ $318 = (($$0520) + 1)|0;
+ $319 = (($318) + ($$3477))|0;
+ $$1526 = (($319) + ($291))|0;
+ $320 = (($$1526) + ($$pn566))|0;
+ _pad_674($0,32,$2,$320,$4);
+ _out($0,$$0521,$$0520);
+ $321 = $4 ^ 65536;
+ _pad_674($0,48,$2,$320,$321);
+ if ($293) {
+ $322 = ($$9$ph>>>0)>($$556>>>0);
+ $$0496$$9 = $322 ? $$556 : $$9$ph;
+ $323 = ((($8)) + 9|0);
+ $324 = $323;
+ $325 = ((($8)) + 8|0);
+ $$5493597 = $$0496$$9;
+ while(1) {
+ $326 = HEAP32[$$5493597>>2]|0;
+ $327 = (_fmt_u($326,0,$323)|0);
+ $328 = ($$5493597|0)==($$0496$$9|0);
+ if ($328) {
+ $334 = ($327|0)==($323|0);
+ if ($334) {
+ HEAP8[$325>>0] = 48;
+ $$1465 = $325;
+ } else {
+ $$1465 = $327;
+ }
+ } else {
+ $329 = ($327>>>0)>($8>>>0);
+ if ($329) {
+ $330 = $327;
+ $331 = (($330) - ($9))|0;
+ _memset(($8|0),48,($331|0))|0;
+ $$0464594 = $327;
+ while(1) {
+ $332 = ((($$0464594)) + -1|0);
+ $333 = ($332>>>0)>($8>>>0);
+ if ($333) {
+ $$0464594 = $332;
+ } else {
+ $$1465 = $332;
+ break;
+ }
+ }
+ } else {
+ $$1465 = $327;
+ }
+ }
+ $335 = $$1465;
+ $336 = (($324) - ($335))|0;
+ _out($0,$$1465,$336);
+ $337 = ((($$5493597)) + 4|0);
+ $338 = ($337>>>0)>($$556>>>0);
+ if ($338) {
+ break;
+ } else {
+ $$5493597 = $337;
+ }
+ }
+ $339 = ($289|0)==(0);
+ if (!($339)) {
+ _out($0,17397,1);
+ }
+ $340 = ($337>>>0)<($$7505>>>0);
+ $341 = ($$3477|0)>(0);
+ $342 = $340 & $341;
+ if ($342) {
+ $$4478590 = $$3477;$$6494589 = $337;
+ while(1) {
+ $343 = HEAP32[$$6494589>>2]|0;
+ $344 = (_fmt_u($343,0,$323)|0);
+ $345 = ($344>>>0)>($8>>>0);
+ if ($345) {
+ $346 = $344;
+ $347 = (($346) - ($9))|0;
+ _memset(($8|0),48,($347|0))|0;
+ $$0463584 = $344;
+ while(1) {
+ $348 = ((($$0463584)) + -1|0);
+ $349 = ($348>>>0)>($8>>>0);
+ if ($349) {
+ $$0463584 = $348;
+ } else {
+ $$0463$lcssa = $348;
+ break;
+ }
+ }
+ } else {
+ $$0463$lcssa = $344;
+ }
+ $350 = ($$4478590|0)<(9);
+ $351 = $350 ? $$4478590 : 9;
+ _out($0,$$0463$lcssa,$351);
+ $352 = ((($$6494589)) + 4|0);
+ $353 = (($$4478590) + -9)|0;
+ $354 = ($352>>>0)<($$7505>>>0);
+ $355 = ($$4478590|0)>(9);
+ $356 = $354 & $355;
+ if ($356) {
+ $$4478590 = $353;$$6494589 = $352;
+ } else {
+ $$4478$lcssa = $353;
+ break;
+ }
+ }
+ } else {
+ $$4478$lcssa = $$3477;
+ }
+ $357 = (($$4478$lcssa) + 9)|0;
+ _pad_674($0,48,$357,9,0);
+ } else {
+ $358 = ((($$9$ph)) + 4|0);
+ $$7505$ = $$lcssa673 ? $$7505 : $358;
+ $359 = ($$3477|0)>(-1);
+ if ($359) {
+ $360 = ((($8)) + 9|0);
+ $361 = ($$pre$phi690Z2D|0)==(0);
+ $362 = $360;
+ $363 = (0 - ($9))|0;
+ $364 = ((($8)) + 8|0);
+ $$5602 = $$3477;$$7495601 = $$9$ph;
+ while(1) {
+ $365 = HEAP32[$$7495601>>2]|0;
+ $366 = (_fmt_u($365,0,$360)|0);
+ $367 = ($366|0)==($360|0);
+ if ($367) {
+ HEAP8[$364>>0] = 48;
+ $$0 = $364;
+ } else {
+ $$0 = $366;
+ }
+ $368 = ($$7495601|0)==($$9$ph|0);
+ do {
+ if ($368) {
+ $372 = ((($$0)) + 1|0);
+ _out($0,$$0,1);
+ $373 = ($$5602|0)<(1);
+ $or$cond554 = $361 & $373;
+ if ($or$cond554) {
+ $$2 = $372;
+ break;
+ }
+ _out($0,17397,1);
+ $$2 = $372;
+ } else {
+ $369 = ($$0>>>0)>($8>>>0);
+ if (!($369)) {
+ $$2 = $$0;
+ break;
+ }
+ $scevgep684 = (($$0) + ($363)|0);
+ $scevgep684685 = $scevgep684;
+ _memset(($8|0),48,($scevgep684685|0))|0;
+ $$1598 = $$0;
+ while(1) {
+ $370 = ((($$1598)) + -1|0);
+ $371 = ($370>>>0)>($8>>>0);
+ if ($371) {
+ $$1598 = $370;
+ } else {
+ $$2 = $370;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $374 = $$2;
+ $375 = (($362) - ($374))|0;
+ $376 = ($$5602|0)>($375|0);
+ $377 = $376 ? $375 : $$5602;
+ _out($0,$$2,$377);
+ $378 = (($$5602) - ($375))|0;
+ $379 = ((($$7495601)) + 4|0);
+ $380 = ($379>>>0)<($$7505$>>>0);
+ $381 = ($378|0)>(-1);
+ $382 = $380 & $381;
+ if ($382) {
+ $$5602 = $378;$$7495601 = $379;
+ } else {
+ $$5$lcssa = $378;
+ break;
+ }
+ }
+ } else {
+ $$5$lcssa = $$3477;
+ }
+ $383 = (($$5$lcssa) + 18)|0;
+ _pad_674($0,48,$383,18,0);
+ $384 = $11;
+ $385 = $$2513;
+ $386 = (($384) - ($385))|0;
+ _out($0,$$2513,$386);
+ }
+ $387 = $4 ^ 8192;
+ _pad_674($0,32,$2,$320,$387);
+ $$sink562 = $320;
+ } else {
+ $27 = $5 & 32;
+ $28 = ($27|0)!=(0);
+ $29 = $28 ? 17369 : 17373;
+ $30 = ($$0471 != $$0471) | (0.0 != 0.0);
+ $31 = $28 ? 19300 : 17377;
+ $$0510 = $30 ? $31 : $29;
+ $32 = (($$0520) + 3)|0;
+ $33 = $4 & -65537;
+ _pad_674($0,32,$2,$32,$33);
+ _out($0,$$0521,$$0520);
+ _out($0,$$0510,3);
+ $34 = $4 ^ 8192;
+ _pad_674($0,32,$2,$32,$34);
+ $$sink562 = $32;
+ }
+ } while(0);
+ $388 = ($$sink562|0)<($2|0);
+ $$555 = $388 ? $2 : $$sink562;
+ STACKTOP = sp;return ($$555|0);
+}
+function ___DOUBLE_BITS_675($0) {
+ $0 = +$0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
+ $2 = HEAP32[tempDoublePtr+4>>2]|0;
+ tempRet0 = ($2);
+ return ($1|0);
+}
+function _frexpl($0,$1) {
+ $0 = +$0;
+ $1 = $1|0;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+_frexp($0,$1));
+ return (+$2);
+}
+function _frexp($0,$1) {
+ $0 = +$0;
+ $1 = $1|0;
+ var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
+ $3 = HEAP32[tempDoublePtr+4>>2]|0;
+ $4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
+ $5 = tempRet0;
+ $6 = $4&65535;
+ $trunc$clear = $6 & 2047;
+ switch ($trunc$clear<<16>>16) {
+ case 0: {
+ $7 = $0 != 0.0;
+ if ($7) {
+ $8 = $0 * 1.8446744073709552E+19;
+ $9 = (+_frexp($8,$1));
+ $10 = HEAP32[$1>>2]|0;
+ $11 = (($10) + -64)|0;
+ $$016 = $9;$storemerge = $11;
+ } else {
+ $$016 = $0;$storemerge = 0;
+ }
+ HEAP32[$1>>2] = $storemerge;
+ $$0 = $$016;
+ break;
+ }
+ case 2047: {
+ $$0 = $0;
+ break;
+ }
+ default: {
+ $12 = $4 & 2047;
+ $13 = (($12) + -1022)|0;
+ HEAP32[$1>>2] = $13;
+ $14 = $3 & -2146435073;
+ $15 = $14 | 1071644672;
+ HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
+ $$0 = $16;
+ }
+ }
+ return (+$$0);
+}
+function _wcrtomb($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
+ var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
+ var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $not$ = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($0|0)==(0|0);
+ do {
+ if ($3) {
+ $$0 = 1;
+ } else {
+ $4 = ($1>>>0)<(128);
+ if ($4) {
+ $5 = $1&255;
+ HEAP8[$0>>0] = $5;
+ $$0 = 1;
+ break;
+ }
+ $6 = (___pthread_self_448()|0);
+ $7 = ((($6)) + 188|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = HEAP32[$8>>2]|0;
+ $not$ = ($9|0)==(0|0);
+ if ($not$) {
+ $10 = $1 & -128;
+ $11 = ($10|0)==(57216);
+ if ($11) {
+ $13 = $1&255;
+ HEAP8[$0>>0] = $13;
+ $$0 = 1;
+ break;
+ } else {
+ $12 = (___errno_location()|0);
+ HEAP32[$12>>2] = 84;
+ $$0 = -1;
+ break;
+ }
+ }
+ $14 = ($1>>>0)<(2048);
+ if ($14) {
+ $15 = $1 >>> 6;
+ $16 = $15 | 192;
+ $17 = $16&255;
+ $18 = ((($0)) + 1|0);
+ HEAP8[$0>>0] = $17;
+ $19 = $1 & 63;
+ $20 = $19 | 128;
+ $21 = $20&255;
+ HEAP8[$18>>0] = $21;
+ $$0 = 2;
+ break;
+ }
+ $22 = ($1>>>0)<(55296);
+ $23 = $1 & -8192;
+ $24 = ($23|0)==(57344);
+ $or$cond = $22 | $24;
+ if ($or$cond) {
+ $25 = $1 >>> 12;
+ $26 = $25 | 224;
+ $27 = $26&255;
+ $28 = ((($0)) + 1|0);
+ HEAP8[$0>>0] = $27;
+ $29 = $1 >>> 6;
+ $30 = $29 & 63;
+ $31 = $30 | 128;
+ $32 = $31&255;
+ $33 = ((($0)) + 2|0);
+ HEAP8[$28>>0] = $32;
+ $34 = $1 & 63;
+ $35 = $34 | 128;
+ $36 = $35&255;
+ HEAP8[$33>>0] = $36;
+ $$0 = 3;
+ break;
+ }
+ $37 = (($1) + -65536)|0;
+ $38 = ($37>>>0)<(1048576);
+ if ($38) {
+ $39 = $1 >>> 18;
+ $40 = $39 | 240;
+ $41 = $40&255;
+ $42 = ((($0)) + 1|0);
+ HEAP8[$0>>0] = $41;
+ $43 = $1 >>> 12;
+ $44 = $43 & 63;
+ $45 = $44 | 128;
+ $46 = $45&255;
+ $47 = ((($0)) + 2|0);
+ HEAP8[$42>>0] = $46;
+ $48 = $1 >>> 6;
+ $49 = $48 & 63;
+ $50 = $49 | 128;
+ $51 = $50&255;
+ $52 = ((($0)) + 3|0);
+ HEAP8[$47>>0] = $51;
+ $53 = $1 & 63;
+ $54 = $53 | 128;
+ $55 = $54&255;
+ HEAP8[$52>>0] = $55;
+ $$0 = 4;
+ break;
+ } else {
+ $56 = (___errno_location()|0);
+ HEAP32[$56>>2] = 84;
+ $$0 = -1;
+ break;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function ___pthread_self_448() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_pthread_self()|0);
+ return ($0|0);
+}
+function ___pthread_self_105() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_pthread_self()|0);
+ return ($0|0);
+}
+function ___strerror_l($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$012$lcssa = 0, $$01214 = 0, $$016 = 0, $$113 = 0, $$115 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $$016 = 0;
+ while(1) {
+ $3 = (17399 + ($$016)|0);
+ $4 = HEAP8[$3>>0]|0;
+ $5 = $4&255;
+ $6 = ($5|0)==($0|0);
+ if ($6) {
+ label = 2;
+ break;
+ }
+ $7 = (($$016) + 1)|0;
+ $8 = ($7|0)==(87);
+ if ($8) {
+ $$01214 = 17487;$$115 = 87;
+ label = 5;
+ break;
+ } else {
+ $$016 = $7;
+ }
+ }
+ if ((label|0) == 2) {
+ $2 = ($$016|0)==(0);
+ if ($2) {
+ $$012$lcssa = 17487;
+ } else {
+ $$01214 = 17487;$$115 = $$016;
+ label = 5;
+ }
+ }
+ if ((label|0) == 5) {
+ while(1) {
+ label = 0;
+ $$113 = $$01214;
+ while(1) {
+ $9 = HEAP8[$$113>>0]|0;
+ $10 = ($9<<24>>24)==(0);
+ $11 = ((($$113)) + 1|0);
+ if ($10) {
+ break;
+ } else {
+ $$113 = $11;
+ }
+ }
+ $12 = (($$115) + -1)|0;
+ $13 = ($12|0)==(0);
+ if ($13) {
+ $$012$lcssa = $11;
+ break;
+ } else {
+ $$01214 = $11;$$115 = $12;
+ label = 5;
+ }
+ }
+ }
+ $14 = ((($1)) + 20|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = (___lctrans($$012$lcssa,$15)|0);
+ return ($16|0);
+}
+function ___lctrans($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (___lctrans_impl($0,$1)|0);
+ return ($2|0);
+}
+function ___lctrans_impl($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)==(0|0);
+ if ($2) {
+ $$0 = 0;
+ } else {
+ $3 = HEAP32[$1>>2]|0;
+ $4 = ((($1)) + 4|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = (___mo_lookup($3,$5,$0)|0);
+ $$0 = $6;
+ }
+ $7 = ($$0|0)!=(0|0);
+ $8 = $7 ? $$0 : $0;
+ return ($8|0);
+}
+function ___mo_lookup($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$090 = 0, $$094 = 0, $$191 = 0, $$195 = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond102 = 0, $or$cond104 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = (($3) + 1794895138)|0;
+ $5 = ((($0)) + 8|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = (_swapc($6,$4)|0);
+ $8 = ((($0)) + 12|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = (_swapc($9,$4)|0);
+ $11 = ((($0)) + 16|0);
+ $12 = HEAP32[$11>>2]|0;
+ $13 = (_swapc($12,$4)|0);
+ $14 = $1 >>> 2;
+ $15 = ($7>>>0)<($14>>>0);
+ L1: do {
+ if ($15) {
+ $16 = $7 << 2;
+ $17 = (($1) - ($16))|0;
+ $18 = ($10>>>0)<($17>>>0);
+ $19 = ($13>>>0)<($17>>>0);
+ $or$cond = $18 & $19;
+ if ($or$cond) {
+ $20 = $13 | $10;
+ $21 = $20 & 3;
+ $22 = ($21|0)==(0);
+ if ($22) {
+ $23 = $10 >>> 2;
+ $24 = $13 >>> 2;
+ $$090 = 0;$$094 = $7;
+ while(1) {
+ $25 = $$094 >>> 1;
+ $26 = (($$090) + ($25))|0;
+ $27 = $26 << 1;
+ $28 = (($27) + ($23))|0;
+ $29 = (($0) + ($28<<2)|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = (_swapc($30,$4)|0);
+ $32 = (($28) + 1)|0;
+ $33 = (($0) + ($32<<2)|0);
+ $34 = HEAP32[$33>>2]|0;
+ $35 = (_swapc($34,$4)|0);
+ $36 = ($35>>>0)<($1>>>0);
+ $37 = (($1) - ($35))|0;
+ $38 = ($31>>>0)<($37>>>0);
+ $or$cond102 = $36 & $38;
+ if (!($or$cond102)) {
+ $$4 = 0;
+ break L1;
+ }
+ $39 = (($35) + ($31))|0;
+ $40 = (($0) + ($39)|0);
+ $41 = HEAP8[$40>>0]|0;
+ $42 = ($41<<24>>24)==(0);
+ if (!($42)) {
+ $$4 = 0;
+ break L1;
+ }
+ $43 = (($0) + ($35)|0);
+ $44 = (_strcmp($2,$43)|0);
+ $45 = ($44|0)==(0);
+ if ($45) {
+ break;
+ }
+ $62 = ($$094|0)==(1);
+ $63 = ($44|0)<(0);
+ $64 = (($$094) - ($25))|0;
+ $$195 = $63 ? $25 : $64;
+ $$191 = $63 ? $$090 : $26;
+ if ($62) {
+ $$4 = 0;
+ break L1;
+ } else {
+ $$090 = $$191;$$094 = $$195;
+ }
+ }
+ $46 = (($27) + ($24))|0;
+ $47 = (($0) + ($46<<2)|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = (_swapc($48,$4)|0);
+ $50 = (($46) + 1)|0;
+ $51 = (($0) + ($50<<2)|0);
+ $52 = HEAP32[$51>>2]|0;
+ $53 = (_swapc($52,$4)|0);
+ $54 = ($53>>>0)<($1>>>0);
+ $55 = (($1) - ($53))|0;
+ $56 = ($49>>>0)<($55>>>0);
+ $or$cond104 = $54 & $56;
+ if ($or$cond104) {
+ $57 = (($0) + ($53)|0);
+ $58 = (($53) + ($49))|0;
+ $59 = (($0) + ($58)|0);
+ $60 = HEAP8[$59>>0]|0;
+ $61 = ($60<<24>>24)==(0);
+ $$ = $61 ? $57 : 0;
+ $$4 = $$;
+ } else {
+ $$4 = 0;
+ }
+ } else {
+ $$4 = 0;
+ }
+ } else {
+ $$4 = 0;
+ }
+ } else {
+ $$4 = 0;
+ }
+ } while(0);
+ return ($$4|0);
+}
+function _swapc($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$ = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)==(0);
+ $3 = (_llvm_bswap_i32(($0|0))|0);
+ $$ = $2 ? $0 : $3;
+ return ($$|0);
+}
+function ___fwritex($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$038 = 0, $$042 = 0, $$1 = 0, $$139 = 0, $$141 = 0, $$143 = 0, $$pre = 0, $$pre47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
+ var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($2)) + 16|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)==(0|0);
+ if ($5) {
+ $7 = (___towrite($2)|0);
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$pre = HEAP32[$3>>2]|0;
+ $12 = $$pre;
+ label = 5;
+ } else {
+ $$1 = 0;
+ }
+ } else {
+ $6 = $4;
+ $12 = $6;
+ label = 5;
+ }
+ L5: do {
+ if ((label|0) == 5) {
+ $9 = ((($2)) + 20|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = (($12) - ($10))|0;
+ $13 = ($11>>>0)<($1>>>0);
+ $14 = $10;
+ if ($13) {
+ $15 = ((($2)) + 36|0);
+ $16 = HEAP32[$15>>2]|0;
+ $17 = (FUNCTION_TABLE_iiii[$16 & 15]($2,$0,$1)|0);
+ $$1 = $17;
+ break;
+ }
+ $18 = ((($2)) + 75|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = ($19<<24>>24)>(-1);
+ L10: do {
+ if ($20) {
+ $$038 = $1;
+ while(1) {
+ $21 = ($$038|0)==(0);
+ if ($21) {
+ $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
+ break L10;
+ }
+ $22 = (($$038) + -1)|0;
+ $23 = (($0) + ($22)|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = ($24<<24>>24)==(10);
+ if ($25) {
+ break;
+ } else {
+ $$038 = $22;
+ }
+ }
+ $26 = ((($2)) + 36|0);
+ $27 = HEAP32[$26>>2]|0;
+ $28 = (FUNCTION_TABLE_iiii[$27 & 15]($2,$0,$$038)|0);
+ $29 = ($28>>>0)<($$038>>>0);
+ if ($29) {
+ $$1 = $28;
+ break L5;
+ }
+ $30 = (($0) + ($$038)|0);
+ $$042 = (($1) - ($$038))|0;
+ $$pre47 = HEAP32[$9>>2]|0;
+ $$139 = $$038;$$141 = $30;$$143 = $$042;$31 = $$pre47;
+ } else {
+ $$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
+ }
+ } while(0);
+ _memcpy(($31|0),($$141|0),($$143|0))|0;
+ $32 = HEAP32[$9>>2]|0;
+ $33 = (($32) + ($$143)|0);
+ HEAP32[$9>>2] = $33;
+ $34 = (($$139) + ($$143))|0;
+ $$1 = $34;
+ }
+ } while(0);
+ return ($$1|0);
+}
+function ___towrite($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 74|0);
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2 << 24 >> 24;
+ $4 = (($3) + 255)|0;
+ $5 = $4 | $3;
+ $6 = $5&255;
+ HEAP8[$1>>0] = $6;
+ $7 = HEAP32[$0>>2]|0;
+ $8 = $7 & 8;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $11 = ((($0)) + 8|0);
+ HEAP32[$11>>2] = 0;
+ $12 = ((($0)) + 4|0);
+ HEAP32[$12>>2] = 0;
+ $13 = ((($0)) + 44|0);
+ $14 = HEAP32[$13>>2]|0;
+ $15 = ((($0)) + 28|0);
+ HEAP32[$15>>2] = $14;
+ $16 = ((($0)) + 20|0);
+ HEAP32[$16>>2] = $14;
+ $17 = ((($0)) + 48|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = (($14) + ($18)|0);
+ $20 = ((($0)) + 16|0);
+ HEAP32[$20>>2] = $19;
+ $$0 = 0;
+ } else {
+ $10 = $7 | 32;
+ HEAP32[$0>>2] = $10;
+ $$0 = -1;
+ }
+ return ($$0|0);
+}
+function _sn_write($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($0)) + 16|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ((($0)) + 20|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $6;
+ $8 = (($4) - ($7))|0;
+ $9 = ($8>>>0)>($2>>>0);
+ $$ = $9 ? $2 : $8;
+ _memcpy(($6|0),($1|0),($$|0))|0;
+ $10 = HEAP32[$5>>2]|0;
+ $11 = (($10) + ($$)|0);
+ HEAP32[$5>>2] = $11;
+ return ($2|0);
+}
+function ___floatscan($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$0105$ph = 0, $$0106$ph = 0, $$0107$lcssa = 0, $$0107127 = 0, $$0113 = 0, $$0114 = 0.0, $$1$lcssa = 0, $$1108 = 0, $$1128 = 0, $$2 = 0, $$2109125 = 0, $$3110 = 0, $$3126 = 0, $$4 = 0, $$4111 = 0, $$5 = 0, $$6 = 0, $$in = 0, $$old8 = 0;
+ var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
+ var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0.0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0.0, $14 = 0, $15 = 0;
+ var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
+ var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
+ var $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
+ var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
+ var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ switch ($1|0) {
+ case 0: {
+ $$0105$ph = -149;$$0106$ph = 24;
+ label = 4;
+ break;
+ }
+ case 1: {
+ $$0105$ph = -1074;$$0106$ph = 53;
+ label = 4;
+ break;
+ }
+ case 2: {
+ $$0105$ph = -1074;$$0106$ph = 53;
+ label = 4;
+ break;
+ }
+ default: {
+ $$0114 = 0.0;
+ }
+ }
+ L4: do {
+ if ((label|0) == 4) {
+ $3 = ((($0)) + 4|0);
+ $4 = ((($0)) + 100|0);
+ while(1) {
+ $5 = HEAP32[$3>>2]|0;
+ $6 = HEAP32[$4>>2]|0;
+ $7 = ($5>>>0)<($6>>>0);
+ if ($7) {
+ $8 = ((($5)) + 1|0);
+ HEAP32[$3>>2] = $8;
+ $9 = HEAP8[$5>>0]|0;
+ $10 = $9&255;
+ $12 = $10;
+ } else {
+ $11 = (___shgetc($0)|0);
+ $12 = $11;
+ }
+ $13 = (_isspace($12)|0);
+ $14 = ($13|0)==(0);
+ if ($14) {
+ break;
+ }
+ }
+ L13: do {
+ switch ($12|0) {
+ case 43: case 45: {
+ $15 = ($12|0)==(45);
+ $16 = $15&1;
+ $17 = $16 << 1;
+ $18 = (1 - ($17))|0;
+ $19 = HEAP32[$3>>2]|0;
+ $20 = HEAP32[$4>>2]|0;
+ $21 = ($19>>>0)<($20>>>0);
+ if ($21) {
+ $22 = ((($19)) + 1|0);
+ HEAP32[$3>>2] = $22;
+ $23 = HEAP8[$19>>0]|0;
+ $24 = $23&255;
+ $$0 = $24;$$0113 = $18;
+ break L13;
+ } else {
+ $25 = (___shgetc($0)|0);
+ $$0 = $25;$$0113 = $18;
+ break L13;
+ }
+ break;
+ }
+ default: {
+ $$0 = $12;$$0113 = 1;
+ }
+ }
+ } while(0);
+ $$0107127 = 0;$$1128 = $$0;
+ while(1) {
+ $26 = $$1128 | 32;
+ $27 = (19291 + ($$0107127)|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = $28 << 24 >> 24;
+ $30 = ($26|0)==($29|0);
+ if (!($30)) {
+ $$0107$lcssa = $$0107127;$$1$lcssa = $$1128;
+ break;
+ }
+ $31 = ($$0107127>>>0)<(7);
+ do {
+ if ($31) {
+ $32 = HEAP32[$3>>2]|0;
+ $33 = HEAP32[$4>>2]|0;
+ $34 = ($32>>>0)<($33>>>0);
+ if ($34) {
+ $35 = ((($32)) + 1|0);
+ HEAP32[$3>>2] = $35;
+ $36 = HEAP8[$32>>0]|0;
+ $37 = $36&255;
+ $$2 = $37;
+ break;
+ } else {
+ $38 = (___shgetc($0)|0);
+ $$2 = $38;
+ break;
+ }
+ } else {
+ $$2 = $$1128;
+ }
+ } while(0);
+ $39 = (($$0107127) + 1)|0;
+ $40 = ($39>>>0)<(8);
+ if ($40) {
+ $$0107127 = $39;$$1128 = $$2;
+ } else {
+ $$0107$lcssa = $39;$$1$lcssa = $$2;
+ break;
+ }
+ }
+ L29: do {
+ switch ($$0107$lcssa|0) {
+ case 8: {
+ break;
+ }
+ case 3: {
+ label = 23;
+ break;
+ }
+ default: {
+ $41 = ($$0107$lcssa>>>0)>(3);
+ $42 = ($2|0)!=(0);
+ $or$cond5 = $42 & $41;
+ if ($or$cond5) {
+ $43 = ($$0107$lcssa|0)==(8);
+ if ($43) {
+ break L29;
+ } else {
+ label = 23;
+ break L29;
+ }
+ }
+ $56 = ($$0107$lcssa|0)==(0);
+ L34: do {
+ if ($56) {
+ $$2109125 = 0;$$3126 = $$1$lcssa;
+ while(1) {
+ $57 = $$3126 | 32;
+ $58 = (19300 + ($$2109125)|0);
+ $59 = HEAP8[$58>>0]|0;
+ $60 = $59 << 24 >> 24;
+ $61 = ($57|0)==($60|0);
+ if (!($61)) {
+ $$3110 = $$2109125;$$5 = $$3126;
+ break L34;
+ }
+ $62 = ($$2109125>>>0)<(2);
+ do {
+ if ($62) {
+ $63 = HEAP32[$3>>2]|0;
+ $64 = HEAP32[$4>>2]|0;
+ $65 = ($63>>>0)<($64>>>0);
+ if ($65) {
+ $66 = ((($63)) + 1|0);
+ HEAP32[$3>>2] = $66;
+ $67 = HEAP8[$63>>0]|0;
+ $68 = $67&255;
+ $$4 = $68;
+ break;
+ } else {
+ $69 = (___shgetc($0)|0);
+ $$4 = $69;
+ break;
+ }
+ } else {
+ $$4 = $$3126;
+ }
+ } while(0);
+ $70 = (($$2109125) + 1)|0;
+ $71 = ($70>>>0)<(3);
+ if ($71) {
+ $$2109125 = $70;$$3126 = $$4;
+ } else {
+ $$3110 = $70;$$5 = $$4;
+ break;
+ }
+ }
+ } else {
+ $$3110 = $$0107$lcssa;$$5 = $$1$lcssa;
+ }
+ } while(0);
+ switch ($$3110|0) {
+ case 3: {
+ $72 = HEAP32[$3>>2]|0;
+ $73 = HEAP32[$4>>2]|0;
+ $74 = ($72>>>0)<($73>>>0);
+ if ($74) {
+ $75 = ((($72)) + 1|0);
+ HEAP32[$3>>2] = $75;
+ $76 = HEAP8[$72>>0]|0;
+ $77 = $76&255;
+ $80 = $77;
+ } else {
+ $78 = (___shgetc($0)|0);
+ $80 = $78;
+ }
+ $79 = ($80|0)==(40);
+ if ($79) {
+ $$4111 = 1;
+ } else {
+ $81 = HEAP32[$4>>2]|0;
+ $82 = ($81|0)==(0|0);
+ if ($82) {
+ $$0114 = nan;
+ break L4;
+ }
+ $83 = HEAP32[$3>>2]|0;
+ $84 = ((($83)) + -1|0);
+ HEAP32[$3>>2] = $84;
+ $$0114 = nan;
+ break L4;
+ }
+ while(1) {
+ $85 = HEAP32[$3>>2]|0;
+ $86 = HEAP32[$4>>2]|0;
+ $87 = ($85>>>0)<($86>>>0);
+ if ($87) {
+ $88 = ((($85)) + 1|0);
+ HEAP32[$3>>2] = $88;
+ $89 = HEAP8[$85>>0]|0;
+ $90 = $89&255;
+ $93 = $90;
+ } else {
+ $91 = (___shgetc($0)|0);
+ $93 = $91;
+ }
+ $92 = (($93) + -48)|0;
+ $94 = ($92>>>0)<(10);
+ $95 = (($93) + -65)|0;
+ $96 = ($95>>>0)<(26);
+ $or$cond = $94 | $96;
+ if (!($or$cond)) {
+ $97 = (($93) + -97)|0;
+ $98 = ($97>>>0)<(26);
+ $99 = ($93|0)==(95);
+ $or$cond7 = $99 | $98;
+ if (!($or$cond7)) {
+ break;
+ }
+ }
+ $111 = (($$4111) + 1)|0;
+ $$4111 = $111;
+ }
+ $100 = ($93|0)==(41);
+ if ($100) {
+ $$0114 = nan;
+ break L4;
+ }
+ $101 = HEAP32[$4>>2]|0;
+ $102 = ($101|0)==(0|0);
+ if (!($102)) {
+ $103 = HEAP32[$3>>2]|0;
+ $104 = ((($103)) + -1|0);
+ HEAP32[$3>>2] = $104;
+ }
+ if (!($42)) {
+ $106 = (___errno_location()|0);
+ HEAP32[$106>>2] = 22;
+ ___shlim($0,0);
+ $$0114 = 0.0;
+ break L4;
+ }
+ $105 = ($$4111|0)==(0);
+ if ($105) {
+ $$0114 = nan;
+ break L4;
+ } else {
+ $$in = $$4111;
+ }
+ while(1) {
+ $107 = (($$in) + -1)|0;
+ if (!($102)) {
+ $108 = HEAP32[$3>>2]|0;
+ $109 = ((($108)) + -1|0);
+ HEAP32[$3>>2] = $109;
+ }
+ $110 = ($107|0)==(0);
+ if ($110) {
+ $$0114 = nan;
+ break L4;
+ } else {
+ $$in = $107;
+ }
+ }
+ break;
+ }
+ case 0: {
+ $117 = ($$5|0)==(48);
+ if ($117) {
+ $118 = HEAP32[$3>>2]|0;
+ $119 = HEAP32[$4>>2]|0;
+ $120 = ($118>>>0)<($119>>>0);
+ if ($120) {
+ $121 = ((($118)) + 1|0);
+ HEAP32[$3>>2] = $121;
+ $122 = HEAP8[$118>>0]|0;
+ $123 = $122&255;
+ $126 = $123;
+ } else {
+ $124 = (___shgetc($0)|0);
+ $126 = $124;
+ }
+ $125 = $126 | 32;
+ $127 = ($125|0)==(120);
+ if ($127) {
+ $128 = (+_hexfloat($0,$$0106$ph,$$0105$ph,$$0113,$2));
+ $$0114 = $128;
+ break L4;
+ }
+ $129 = HEAP32[$4>>2]|0;
+ $130 = ($129|0)==(0|0);
+ if ($130) {
+ $$6 = 48;
+ } else {
+ $131 = HEAP32[$3>>2]|0;
+ $132 = ((($131)) + -1|0);
+ HEAP32[$3>>2] = $132;
+ $$6 = 48;
+ }
+ } else {
+ $$6 = $$5;
+ }
+ $133 = (+_decfloat($0,$$6,$$0106$ph,$$0105$ph,$$0113,$2));
+ $$0114 = $133;
+ break L4;
+ break;
+ }
+ default: {
+ $112 = HEAP32[$4>>2]|0;
+ $113 = ($112|0)==(0|0);
+ if (!($113)) {
+ $114 = HEAP32[$3>>2]|0;
+ $115 = ((($114)) + -1|0);
+ HEAP32[$3>>2] = $115;
+ }
+ $116 = (___errno_location()|0);
+ HEAP32[$116>>2] = 22;
+ ___shlim($0,0);
+ $$0114 = 0.0;
+ break L4;
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 23) {
+ $44 = HEAP32[$4>>2]|0;
+ $45 = ($44|0)==(0|0);
+ if (!($45)) {
+ $46 = HEAP32[$3>>2]|0;
+ $47 = ((($46)) + -1|0);
+ HEAP32[$3>>2] = $47;
+ }
+ $48 = ($2|0)!=(0);
+ $49 = ($$0107$lcssa>>>0)>(3);
+ $or$cond9 = $48 & $49;
+ if ($or$cond9) {
+ $$1108 = $$0107$lcssa;
+ while(1) {
+ if (!($45)) {
+ $50 = HEAP32[$3>>2]|0;
+ $51 = ((($50)) + -1|0);
+ HEAP32[$3>>2] = $51;
+ }
+ $52 = (($$1108) + -1)|0;
+ $$old8 = ($52>>>0)>(3);
+ if ($$old8) {
+ $$1108 = $52;
+ } else {
+ break;
+ }
+ }
+ }
+ }
+ $53 = (+($$0113|0));
+ $54 = $53 * inf;
+ $55 = $54;
+ $$0114 = $55;
+ }
+ } while(0);
+ return (+$$0114);
+}
+function _hexfloat($0,$1,$2,$3,$4) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ var $$0 = 0, $$0133 = 0, $$0142 = 0, $$0146 = 0, $$0148 = 0, $$0148$ = 0, $$0151 = 0.0, $$0152 = 0.0, $$0155 = 0.0, $$0155$ = 0.0, $$0159 = 0, $$0165 = 0.0, $$0166 = 0, $$0166169 = 0, $$0166170 = 0, $$1$ph = 0, $$1147 = 0, $$1149 = 0, $$1153 = 0.0, $$1156 = 0.0;
+ var $$1160 = 0, $$2 = 0, $$2$lcssa = 0, $$2144 = 0, $$2150 = 0, $$2154 = 0.0, $$2157 = 0.0, $$2161 = 0, $$3145 = 0, $$3158$lcssa = 0.0, $$3158179 = 0.0, $$3162$lcssa = 0, $$3162183 = 0, $$4 = 0.0, $$4163$lcssa = 0, $$4163178 = 0, $$5 = 0.0, $$5164 = 0, $$6 = 0, $$pn = 0.0;
+ var $$pre = 0.0, $$pre$phiZ2D = 0.0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0, $17 = 0;
+ var $170 = 0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
+ var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0.0, $197 = 0, $198 = 0.0, $199 = 0.0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0.0, $206 = 0.0;
+ var $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0, $212 = 0, $213 = 0.0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
+ var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0;
+ var $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0.0, $67 = 0.0;
+ var $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0.0, $73 = 0.0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0;
+ var $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0.0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $not$ = 0, $or$cond = 0, $or$cond168 = 0, $or$cond206 = 0, $or$cond4 = 0;
+ var $or$cond6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $5 = ((($0)) + 4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = ((($0)) + 100|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($6>>>0)<($8>>>0);
+ if ($9) {
+ $10 = ((($6)) + 1|0);
+ HEAP32[$5>>2] = $10;
+ $11 = HEAP8[$6>>0]|0;
+ $12 = $11&255;
+ $$0 = $12;$$0142 = 0;
+ } else {
+ $13 = (___shgetc($0)|0);
+ $$0 = $13;$$0142 = 0;
+ }
+ L4: while(1) {
+ switch ($$0|0) {
+ case 46: {
+ label = 8;
+ break L4;
+ break;
+ }
+ case 48: {
+ break;
+ }
+ default: {
+ $$0146 = 0;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$0;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
+ break L4;
+ }
+ }
+ $14 = HEAP32[$5>>2]|0;
+ $15 = HEAP32[$7>>2]|0;
+ $16 = ($14>>>0)<($15>>>0);
+ if ($16) {
+ $17 = ((($14)) + 1|0);
+ HEAP32[$5>>2] = $17;
+ $18 = HEAP8[$14>>0]|0;
+ $19 = $18&255;
+ $$0 = $19;$$0142 = 1;
+ continue;
+ } else {
+ $20 = (___shgetc($0)|0);
+ $$0 = $20;$$0142 = 1;
+ continue;
+ }
+ }
+ if ((label|0) == 8) {
+ $21 = HEAP32[$5>>2]|0;
+ $22 = HEAP32[$7>>2]|0;
+ $23 = ($21>>>0)<($22>>>0);
+ if ($23) {
+ $24 = ((($21)) + 1|0);
+ HEAP32[$5>>2] = $24;
+ $25 = HEAP8[$21>>0]|0;
+ $26 = $25&255;
+ $$1$ph = $26;
+ } else {
+ $27 = (___shgetc($0)|0);
+ $$1$ph = $27;
+ }
+ $28 = ($$1$ph|0)==(48);
+ if ($28) {
+ $36 = 0;$37 = 0;
+ while(1) {
+ $29 = HEAP32[$5>>2]|0;
+ $30 = HEAP32[$7>>2]|0;
+ $31 = ($29>>>0)<($30>>>0);
+ if ($31) {
+ $32 = ((($29)) + 1|0);
+ HEAP32[$5>>2] = $32;
+ $33 = HEAP8[$29>>0]|0;
+ $34 = $33&255;
+ $41 = $34;
+ } else {
+ $35 = (___shgetc($0)|0);
+ $41 = $35;
+ }
+ $38 = (_i64Add(($36|0),($37|0),-1,-1)|0);
+ $39 = tempRet0;
+ $40 = ($41|0)==(48);
+ if ($40) {
+ $36 = $38;$37 = $39;
+ } else {
+ $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $41;$$2144 = 1;$101 = $39;$53 = 0;$55 = 0;$99 = $38;
+ break;
+ }
+ }
+ } else {
+ $$0146 = 1;$$0148 = 0;$$0152 = 1.0;$$0155 = 0.0;$$0159 = 0;$$2 = $$1$ph;$$2144 = $$0142;$101 = 0;$53 = 0;$55 = 0;$99 = 0;
+ }
+ }
+ while(1) {
+ $42 = (($$2) + -48)|0;
+ $43 = ($42>>>0)<(10);
+ $44 = ($$2|0)==(46);
+ if (!($43)) {
+ $45 = $$2 | 32;
+ $46 = (($45) + -97)|0;
+ $47 = ($46>>>0)<(6);
+ $or$cond6 = $44 | $47;
+ if (!($or$cond6)) {
+ $$2$lcssa = $$2;
+ break;
+ }
+ }
+ if ($44) {
+ $48 = ($$0146|0)==(0);
+ if ($48) {
+ $$1147 = 1;$$2150 = $$0148;$$2154 = $$0152;$$2157 = $$0155;$$2161 = $$0159;$$3145 = $$2144;$214 = $55;$215 = $53;$216 = $55;$217 = $53;
+ } else {
+ $$2$lcssa = 46;
+ break;
+ }
+ } else {
+ $49 = ($$2|0)>(57);
+ $50 = $$2 | 32;
+ $51 = (($50) + -87)|0;
+ $$0133 = $49 ? $51 : $42;
+ $52 = ($53|0)<(0);
+ $54 = ($55>>>0)<(8);
+ $56 = ($53|0)==(0);
+ $57 = $56 & $54;
+ $58 = $52 | $57;
+ do {
+ if ($58) {
+ $59 = $$0159 << 4;
+ $60 = (($$0133) + ($59))|0;
+ $$1149 = $$0148;$$1153 = $$0152;$$1156 = $$0155;$$1160 = $60;
+ } else {
+ $61 = ($53|0)<(0);
+ $62 = ($55>>>0)<(14);
+ $63 = ($53|0)==(0);
+ $64 = $63 & $62;
+ $65 = $61 | $64;
+ if ($65) {
+ $66 = (+($$0133|0));
+ $67 = $$0152 * 0.0625;
+ $68 = $67 * $66;
+ $69 = $$0155 + $68;
+ $$1149 = $$0148;$$1153 = $67;$$1156 = $69;$$1160 = $$0159;
+ break;
+ } else {
+ $70 = ($$0133|0)==(0);
+ $71 = ($$0148|0)!=(0);
+ $or$cond = $71 | $70;
+ $72 = $$0152 * 0.5;
+ $73 = $$0155 + $72;
+ $$0155$ = $or$cond ? $$0155 : $73;
+ $$0148$ = $or$cond ? $$0148 : 1;
+ $$1149 = $$0148$;$$1153 = $$0152;$$1156 = $$0155$;$$1160 = $$0159;
+ break;
+ }
+ }
+ } while(0);
+ $74 = (_i64Add(($55|0),($53|0),1,0)|0);
+ $75 = tempRet0;
+ $$1147 = $$0146;$$2150 = $$1149;$$2154 = $$1153;$$2157 = $$1156;$$2161 = $$1160;$$3145 = 1;$214 = $99;$215 = $101;$216 = $74;$217 = $75;
+ }
+ $76 = HEAP32[$5>>2]|0;
+ $77 = HEAP32[$7>>2]|0;
+ $78 = ($76>>>0)<($77>>>0);
+ if ($78) {
+ $79 = ((($76)) + 1|0);
+ HEAP32[$5>>2] = $79;
+ $80 = HEAP8[$76>>0]|0;
+ $81 = $80&255;
+ $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $81;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
+ continue;
+ } else {
+ $82 = (___shgetc($0)|0);
+ $$0146 = $$1147;$$0148 = $$2150;$$0152 = $$2154;$$0155 = $$2157;$$0159 = $$2161;$$2 = $82;$$2144 = $$3145;$101 = $215;$53 = $217;$55 = $216;$99 = $214;
+ continue;
+ }
+ }
+ $83 = ($$2144|0)==(0);
+ do {
+ if ($83) {
+ $84 = HEAP32[$7>>2]|0;
+ $85 = ($84|0)!=(0|0);
+ if ($85) {
+ $86 = HEAP32[$5>>2]|0;
+ $87 = ((($86)) + -1|0);
+ HEAP32[$5>>2] = $87;
+ }
+ $88 = ($4|0)==(0);
+ if ($88) {
+ ___shlim($0,0);
+ } else {
+ if ($85) {
+ $89 = HEAP32[$5>>2]|0;
+ $90 = ((($89)) + -1|0);
+ HEAP32[$5>>2] = $90;
+ }
+ $91 = ($$0146|0)==(0);
+ $92 = ($84|0)==(0|0);
+ $or$cond206 = $91 | $92;
+ if (!($or$cond206)) {
+ $93 = HEAP32[$5>>2]|0;
+ $94 = ((($93)) + -1|0);
+ HEAP32[$5>>2] = $94;
+ }
+ }
+ $95 = (+($3|0));
+ $96 = $95 * 0.0;
+ $$0165 = $96;
+ } else {
+ $97 = ($$0146|0)==(0);
+ $98 = $97 ? $55 : $99;
+ $100 = $97 ? $53 : $101;
+ $102 = ($53|0)<(0);
+ $103 = ($55>>>0)<(8);
+ $104 = ($53|0)==(0);
+ $105 = $104 & $103;
+ $106 = $102 | $105;
+ if ($106) {
+ $$3162183 = $$0159;$108 = $55;$109 = $53;
+ while(1) {
+ $107 = $$3162183 << 4;
+ $110 = (_i64Add(($108|0),($109|0),1,0)|0);
+ $111 = tempRet0;
+ $112 = ($111|0)<(0);
+ $113 = ($110>>>0)<(8);
+ $114 = ($111|0)==(0);
+ $115 = $114 & $113;
+ $116 = $112 | $115;
+ if ($116) {
+ $$3162183 = $107;$108 = $110;$109 = $111;
+ } else {
+ $$3162$lcssa = $107;
+ break;
+ }
+ }
+ } else {
+ $$3162$lcssa = $$0159;
+ }
+ $117 = $$2$lcssa | 32;
+ $118 = ($117|0)==(112);
+ if ($118) {
+ $119 = (_scanexp($0,$4)|0);
+ $120 = tempRet0;
+ $121 = ($119|0)==(0);
+ $122 = ($120|0)==(-2147483648);
+ $123 = $121 & $122;
+ if ($123) {
+ $124 = ($4|0)==(0);
+ if ($124) {
+ ___shlim($0,0);
+ $$0165 = 0.0;
+ break;
+ }
+ $125 = HEAP32[$7>>2]|0;
+ $126 = ($125|0)==(0|0);
+ if ($126) {
+ $137 = 0;$138 = 0;
+ } else {
+ $127 = HEAP32[$5>>2]|0;
+ $128 = ((($127)) + -1|0);
+ HEAP32[$5>>2] = $128;
+ $137 = 0;$138 = 0;
+ }
+ } else {
+ $137 = $119;$138 = $120;
+ }
+ } else {
+ $129 = HEAP32[$7>>2]|0;
+ $130 = ($129|0)==(0|0);
+ if ($130) {
+ $137 = 0;$138 = 0;
+ } else {
+ $131 = HEAP32[$5>>2]|0;
+ $132 = ((($131)) + -1|0);
+ HEAP32[$5>>2] = $132;
+ $137 = 0;$138 = 0;
+ }
+ }
+ $133 = (_bitshift64Shl(($98|0),($100|0),2)|0);
+ $134 = tempRet0;
+ $135 = (_i64Add(($133|0),($134|0),-32,-1)|0);
+ $136 = tempRet0;
+ $139 = (_i64Add(($135|0),($136|0),($137|0),($138|0))|0);
+ $140 = tempRet0;
+ $141 = ($$3162$lcssa|0)==(0);
+ if ($141) {
+ $142 = (+($3|0));
+ $143 = $142 * 0.0;
+ $$0165 = $143;
+ break;
+ }
+ $144 = (0 - ($2))|0;
+ $145 = ($144|0)<(0);
+ $146 = $145 << 31 >> 31;
+ $147 = ($140|0)>($146|0);
+ $148 = ($139>>>0)>($144>>>0);
+ $149 = ($140|0)==($146|0);
+ $150 = $149 & $148;
+ $151 = $147 | $150;
+ if ($151) {
+ $152 = (___errno_location()|0);
+ HEAP32[$152>>2] = 34;
+ $153 = (+($3|0));
+ $154 = $153 * 1.7976931348623157E+308;
+ $155 = $154 * 1.7976931348623157E+308;
+ $$0165 = $155;
+ break;
+ }
+ $156 = (($2) + -106)|0;
+ $157 = ($156|0)<(0);
+ $158 = $157 << 31 >> 31;
+ $159 = ($140|0)<($158|0);
+ $160 = ($139>>>0)<($156>>>0);
+ $161 = ($140|0)==($158|0);
+ $162 = $161 & $160;
+ $163 = $159 | $162;
+ if ($163) {
+ $165 = (___errno_location()|0);
+ HEAP32[$165>>2] = 34;
+ $166 = (+($3|0));
+ $167 = $166 * 2.2250738585072014E-308;
+ $168 = $167 * 2.2250738585072014E-308;
+ $$0165 = $168;
+ break;
+ }
+ $164 = ($$3162$lcssa|0)>(-1);
+ if ($164) {
+ $$3158179 = $$0155;$$4163178 = $$3162$lcssa;$173 = $139;$174 = $140;
+ while(1) {
+ $169 = !($$3158179 >= 0.5);
+ $170 = $$4163178 << 1;
+ $171 = $$3158179 + -1.0;
+ $not$ = $169 ^ 1;
+ $172 = $not$&1;
+ $$5164 = $170 | $172;
+ $$pn = $169 ? $$3158179 : $171;
+ $$4 = $$3158179 + $$pn;
+ $175 = (_i64Add(($173|0),($174|0),-1,-1)|0);
+ $176 = tempRet0;
+ $177 = ($$5164|0)>(-1);
+ if ($177) {
+ $$3158179 = $$4;$$4163178 = $$5164;$173 = $175;$174 = $176;
+ } else {
+ $$3158$lcssa = $$4;$$4163$lcssa = $$5164;$184 = $175;$185 = $176;
+ break;
+ }
+ }
+ } else {
+ $$3158$lcssa = $$0155;$$4163$lcssa = $$3162$lcssa;$184 = $139;$185 = $140;
+ }
+ $178 = ($1|0)<(0);
+ $179 = $178 << 31 >> 31;
+ $180 = ($2|0)<(0);
+ $181 = $180 << 31 >> 31;
+ $182 = (_i64Subtract(32,0,($2|0),($181|0))|0);
+ $183 = tempRet0;
+ $186 = (_i64Add(($182|0),($183|0),($184|0),($185|0))|0);
+ $187 = tempRet0;
+ $188 = ($179|0)>($187|0);
+ $189 = ($1>>>0)>($186>>>0);
+ $190 = ($179|0)==($187|0);
+ $191 = $190 & $189;
+ $192 = $188 | $191;
+ if ($192) {
+ $193 = ($186|0)>(0);
+ if ($193) {
+ $$0166 = $186;
+ label = 59;
+ } else {
+ $$0166170 = 0;$197 = 84;
+ label = 61;
+ }
+ } else {
+ $$0166 = $1;
+ label = 59;
+ }
+ if ((label|0) == 59) {
+ $194 = ($$0166|0)<(53);
+ $195 = (84 - ($$0166))|0;
+ if ($194) {
+ $$0166170 = $$0166;$197 = $195;
+ label = 61;
+ } else {
+ $$pre = (+($3|0));
+ $$0151 = 0.0;$$0166169 = $$0166;$$pre$phiZ2D = $$pre;
+ }
+ }
+ if ((label|0) == 61) {
+ $196 = (+($3|0));
+ $198 = (+_scalbn(1.0,$197));
+ $199 = (+_copysignl($198,$196));
+ $$0151 = $199;$$0166169 = $$0166170;$$pre$phiZ2D = $196;
+ }
+ $200 = ($$0166169|0)<(32);
+ $201 = $$3158$lcssa != 0.0;
+ $or$cond4 = $201 & $200;
+ $202 = $$4163$lcssa & 1;
+ $203 = ($202|0)==(0);
+ $or$cond168 = $203 & $or$cond4;
+ $204 = $or$cond168&1;
+ $$6 = (($204) + ($$4163$lcssa))|0;
+ $$5 = $or$cond168 ? 0.0 : $$3158$lcssa;
+ $205 = (+($$6>>>0));
+ $206 = $$pre$phiZ2D * $205;
+ $207 = $$0151 + $206;
+ $208 = $$pre$phiZ2D * $$5;
+ $209 = $208 + $207;
+ $210 = $209 - $$0151;
+ $211 = $210 != 0.0;
+ if (!($211)) {
+ $212 = (___errno_location()|0);
+ HEAP32[$212>>2] = 34;
+ }
+ $213 = (+_scalbnl($210,$184));
+ $$0165 = $213;
+ }
+ } while(0);
+ return (+$$0165);
+}
+function _decfloat($0,$1,$2,$3,$4,$5) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ $4 = $4|0;
+ $5 = $5|0;
+ var $$ = 0, $$$0345 = 0, $$$0350 = 0, $$$0385 = 0, $$$0401 = 0, $$$5355 = 0, $$$5390 = 0, $$0329 = 0, $$0332490 = 0, $$0333 = 0, $$0334 = 0, $$0336486 = 0, $$0340496 = 0, $$0341$lcssa = 0, $$0341463 = 0, $$0341464 = 0, $$0341465 = 0, $$0341513 = 0, $$0345$lcssa = 0, $$0345467 = 0;
+ var $$0345468 = 0, $$0345469 = 0, $$0345512 = 0, $$0350$lcssa554 = 0, $$0350494 = 0, $$0360 = 0.0, $$0361 = 0.0, $$0365484 = 0.0, $$0372 = 0, $$0380 = 0, $$0380$ph = 0, $$0385$lcssa553 = 0, $$0385493 = 0, $$0393 = 0, $$0396 = 0, $$0401$lcssa = 0, $$0401473 = 0, $$0401474 = 0, $$0401475 = 0, $$0401509 = 0;
+ var $$1 = 0.0, $$10 = 0, $$1330$be = 0, $$1330$ph = 0, $$1335 = 0, $$1337 = 0, $$1362 = 0.0, $$1366 = 0.0, $$1373 = 0, $$1373$ph448 = 0, $$1381 = 0, $$1381$ph = 0, $$1381$ph558 = 0, $$1394$lcssa = 0, $$1394511 = 0, $$2 = 0, $$2343 = 0, $$2347 = 0, $$2352$ph449 = 0, $$2367 = 0.0;
+ var $$2371$v = 0, $$2374 = 0, $$2387$ph447 = 0, $$2395 = 0, $$2398 = 0, $$2403 = 0, $$3$be = 0, $$3$lcssa = 0, $$3344503 = 0, $$3348 = 0, $$3364 = 0.0, $$3368 = 0.0, $$3375 = 0, $$3383 = 0, $$3399$lcssa = 0, $$3399510 = 0, $$3514 = 0, $$413 = 0, $$425 = 0, $$4349495 = 0;
+ var $$4354 = 0, $$4354$ph = 0, $$4354$ph559 = 0, $$4376 = 0, $$4384 = 0, $$4389$ph = 0, $$4389$ph445 = 0, $$4400 = 0, $$4485 = 0, $$5 = 0, $$5$in = 0, $$5355488 = 0, $$5390487 = 0, $$6378$ph = 0, $$6489 = 0, $$9483 = 0, $$neg442 = 0, $$neg443 = 0, $$pre = 0, $$promoted = 0;
+ var $$sink = 0, $$sink421$off0 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
+ var $116 = 0, $117 = 0, $118 = 0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0.0, $132 = 0.0, $133 = 0.0;
+ var $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0.0, $144 = 0.0, $145 = 0.0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0;
+ var $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0, $166 = 0, $167 = 0, $168 = 0.0, $169 = 0.0, $17 = 0;
+ var $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0.0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0;
+ var $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
+ var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
+ var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
+ var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
+ var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
+ var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
+ var $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0.0, $304 = 0, $305 = 0, $306 = 0.0, $307 = 0.0, $308 = 0, $309 = 0.0, $31 = 0, $310 = 0.0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0;
+ var $316 = 0, $317 = 0.0, $318 = 0.0, $319 = 0, $32 = 0, $320 = 0.0, $321 = 0.0, $322 = 0.0, $323 = 0.0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0;
+ var $334 = 0.0, $335 = 0.0, $336 = 0, $337 = 0.0, $338 = 0.0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0.0, $343 = 0.0, $344 = 0.0, $345 = 0.0, $346 = 0, $347 = 0, $348 = 0.0, $349 = 0, $35 = 0, $350 = 0.0, $351 = 0.0;
+ var $352 = 0.0, $353 = 0, $354 = 0, $355 = 0, $356 = 0.0, $357 = 0, $358 = 0.0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0.0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0;
+ var $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $39 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
+ var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
+ var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
+ var $98 = 0, $99 = 0, $cond = 0, $exitcond = 0, $exitcond551 = 0, $narrow = 0, $not$ = 0, $or$cond = 0, $or$cond11 = 0, $or$cond14 = 0, $or$cond415 = 0, $or$cond417 = 0, $or$cond419 = 0, $or$cond420 = 0, $or$cond422 = 0, $or$cond422$not = 0, $or$cond423 = 0, $or$cond426 = 0, $or$cond5 = 0, $sum = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 512|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(512|0);
+ $6 = sp;
+ $sum = (($3) + ($2))|0;
+ $7 = (0 - ($sum))|0;
+ $8 = ((($0)) + 4|0);
+ $9 = ((($0)) + 100|0);
+ $$0329 = $1;$$0396 = 0;
+ L1: while(1) {
+ switch ($$0329|0) {
+ case 46: {
+ label = 6;
+ break L1;
+ break;
+ }
+ case 48: {
+ break;
+ }
+ default: {
+ $$0393 = 0;$$2 = $$0329;$$2398 = $$0396;$366 = 0;$367 = 0;
+ break L1;
+ }
+ }
+ $10 = HEAP32[$8>>2]|0;
+ $11 = HEAP32[$9>>2]|0;
+ $12 = ($10>>>0)<($11>>>0);
+ if ($12) {
+ $13 = ((($10)) + 1|0);
+ HEAP32[$8>>2] = $13;
+ $14 = HEAP8[$10>>0]|0;
+ $15 = $14&255;
+ $$0329 = $15;$$0396 = 1;
+ continue;
+ } else {
+ $16 = (___shgetc($0)|0);
+ $$0329 = $16;$$0396 = 1;
+ continue;
+ }
+ }
+ if ((label|0) == 6) {
+ $17 = HEAP32[$8>>2]|0;
+ $18 = HEAP32[$9>>2]|0;
+ $19 = ($17>>>0)<($18>>>0);
+ if ($19) {
+ $20 = ((($17)) + 1|0);
+ HEAP32[$8>>2] = $20;
+ $21 = HEAP8[$17>>0]|0;
+ $22 = $21&255;
+ $$1330$ph = $22;
+ } else {
+ $23 = (___shgetc($0)|0);
+ $$1330$ph = $23;
+ }
+ $24 = ($$1330$ph|0)==(48);
+ if ($24) {
+ $25 = 0;$26 = 0;
+ while(1) {
+ $27 = (_i64Add(($25|0),($26|0),-1,-1)|0);
+ $28 = tempRet0;
+ $29 = HEAP32[$8>>2]|0;
+ $30 = HEAP32[$9>>2]|0;
+ $31 = ($29>>>0)<($30>>>0);
+ if ($31) {
+ $32 = ((($29)) + 1|0);
+ HEAP32[$8>>2] = $32;
+ $33 = HEAP8[$29>>0]|0;
+ $34 = $33&255;
+ $$1330$be = $34;
+ } else {
+ $35 = (___shgetc($0)|0);
+ $$1330$be = $35;
+ }
+ $36 = ($$1330$be|0)==(48);
+ if ($36) {
+ $25 = $27;$26 = $28;
+ } else {
+ $$0393 = 1;$$2 = $$1330$be;$$2398 = 1;$366 = $27;$367 = $28;
+ break;
+ }
+ }
+ } else {
+ $$0393 = 1;$$2 = $$1330$ph;$$2398 = $$0396;$366 = 0;$367 = 0;
+ }
+ }
+ HEAP32[$6>>2] = 0;
+ $37 = (($$2) + -48)|0;
+ $38 = ($37>>>0)<(10);
+ $39 = ($$2|0)==(46);
+ $40 = $39 | $38;
+ L20: do {
+ if ($40) {
+ $41 = ((($6)) + 496|0);
+ $$0341513 = 0;$$0345512 = 0;$$0401509 = 0;$$1394511 = $$0393;$$3399510 = $$2398;$$3514 = $$2;$368 = $39;$369 = $37;$370 = $366;$371 = $367;$44 = 0;$45 = 0;
+ L22: while(1) {
+ do {
+ if ($368) {
+ $cond = ($$1394511|0)==(0);
+ if ($cond) {
+ $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = 1;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $44;$373 = $45;$374 = $44;$375 = $45;
+ } else {
+ break L22;
+ }
+ } else {
+ $43 = ($$0345512|0)<(125);
+ $46 = (_i64Add(($44|0),($45|0),1,0)|0);
+ $47 = tempRet0;
+ $48 = ($$3514|0)!=(48);
+ if (!($43)) {
+ if (!($48)) {
+ $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
+ break;
+ }
+ $57 = HEAP32[$41>>2]|0;
+ $58 = $57 | 1;
+ HEAP32[$41>>2] = $58;
+ $$2343 = $$0341513;$$2347 = $$0345512;$$2395 = $$1394511;$$2403 = $$0401509;$$4400 = $$3399510;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
+ break;
+ }
+ $$$0401 = $48 ? $46 : $$0401509;
+ $49 = ($$0341513|0)==(0);
+ $$pre = (($6) + ($$0345512<<2)|0);
+ if ($49) {
+ $$sink = $369;
+ } else {
+ $50 = HEAP32[$$pre>>2]|0;
+ $51 = ($50*10)|0;
+ $52 = (($$3514) + -48)|0;
+ $53 = (($52) + ($51))|0;
+ $$sink = $53;
+ }
+ HEAP32[$$pre>>2] = $$sink;
+ $54 = (($$0341513) + 1)|0;
+ $55 = ($54|0)==(9);
+ $56 = $55&1;
+ $$$0345 = (($56) + ($$0345512))|0;
+ $$413 = $55 ? 0 : $54;
+ $$2343 = $$413;$$2347 = $$$0345;$$2395 = $$1394511;$$2403 = $$$0401;$$4400 = 1;$372 = $370;$373 = $371;$374 = $46;$375 = $47;
+ }
+ } while(0);
+ $59 = HEAP32[$8>>2]|0;
+ $60 = HEAP32[$9>>2]|0;
+ $61 = ($59>>>0)<($60>>>0);
+ if ($61) {
+ $62 = ((($59)) + 1|0);
+ HEAP32[$8>>2] = $62;
+ $63 = HEAP8[$59>>0]|0;
+ $64 = $63&255;
+ $$3$be = $64;
+ } else {
+ $65 = (___shgetc($0)|0);
+ $$3$be = $65;
+ }
+ $66 = (($$3$be) + -48)|0;
+ $67 = ($66>>>0)<(10);
+ $68 = ($$3$be|0)==(46);
+ $69 = $68 | $67;
+ if ($69) {
+ $$0341513 = $$2343;$$0345512 = $$2347;$$0401509 = $$2403;$$1394511 = $$2395;$$3399510 = $$4400;$$3514 = $$3$be;$368 = $68;$369 = $66;$370 = $372;$371 = $373;$44 = $374;$45 = $375;
+ } else {
+ $$0341$lcssa = $$2343;$$0345$lcssa = $$2347;$$0401$lcssa = $$2403;$$1394$lcssa = $$2395;$$3$lcssa = $$3$be;$$3399$lcssa = $$4400;$72 = $372;$73 = $374;$75 = $373;$76 = $375;
+ label = 29;
+ break L20;
+ }
+ }
+ $42 = ($$3399510|0)!=(0);
+ $$0341465 = $$0341513;$$0345469 = $$0345512;$$0401475 = $$0401509;$376 = $44;$377 = $45;$378 = $370;$379 = $371;$380 = $42;
+ label = 37;
+ } else {
+ $$0341$lcssa = 0;$$0345$lcssa = 0;$$0401$lcssa = 0;$$1394$lcssa = $$0393;$$3$lcssa = $$2;$$3399$lcssa = $$2398;$72 = $366;$73 = 0;$75 = $367;$76 = 0;
+ label = 29;
+ }
+ } while(0);
+ do {
+ if ((label|0) == 29) {
+ $70 = ($$1394$lcssa|0)==(0);
+ $71 = $70 ? $73 : $72;
+ $74 = $70 ? $76 : $75;
+ $77 = ($$3399$lcssa|0)!=(0);
+ $78 = $$3$lcssa | 32;
+ $79 = ($78|0)==(101);
+ $or$cond415 = $77 & $79;
+ if (!($or$cond415)) {
+ $94 = ($$3$lcssa|0)>(-1);
+ if ($94) {
+ $$0341465 = $$0341$lcssa;$$0345469 = $$0345$lcssa;$$0401475 = $$0401$lcssa;$376 = $73;$377 = $76;$378 = $71;$379 = $74;$380 = $77;
+ label = 37;
+ break;
+ } else {
+ $$0341464 = $$0341$lcssa;$$0345468 = $$0345$lcssa;$$0401474 = $$0401$lcssa;$381 = $73;$382 = $76;$383 = $77;$384 = $71;$385 = $74;
+ label = 39;
+ break;
+ }
+ }
+ $80 = (_scanexp($0,$5)|0);
+ $81 = tempRet0;
+ $82 = ($80|0)==(0);
+ $83 = ($81|0)==(-2147483648);
+ $84 = $82 & $83;
+ if ($84) {
+ $85 = ($5|0)==(0);
+ if ($85) {
+ ___shlim($0,0);
+ $$1 = 0.0;
+ break;
+ }
+ $86 = HEAP32[$9>>2]|0;
+ $87 = ($86|0)==(0|0);
+ if ($87) {
+ $90 = 0;$91 = 0;
+ } else {
+ $88 = HEAP32[$8>>2]|0;
+ $89 = ((($88)) + -1|0);
+ HEAP32[$8>>2] = $89;
+ $90 = 0;$91 = 0;
+ }
+ } else {
+ $90 = $80;$91 = $81;
+ }
+ $92 = (_i64Add(($90|0),($91|0),($71|0),($74|0))|0);
+ $93 = tempRet0;
+ $$0341463 = $$0341$lcssa;$$0345467 = $$0345$lcssa;$$0401473 = $$0401$lcssa;$105 = $92;$106 = $73;$108 = $93;$109 = $76;
+ label = 41;
+ }
+ } while(0);
+ if ((label|0) == 37) {
+ $95 = HEAP32[$9>>2]|0;
+ $96 = ($95|0)==(0|0);
+ if ($96) {
+ $$0341464 = $$0341465;$$0345468 = $$0345469;$$0401474 = $$0401475;$381 = $376;$382 = $377;$383 = $380;$384 = $378;$385 = $379;
+ label = 39;
+ } else {
+ $97 = HEAP32[$8>>2]|0;
+ $98 = ((($97)) + -1|0);
+ HEAP32[$8>>2] = $98;
+ if ($380) {
+ $$0341463 = $$0341465;$$0345467 = $$0345469;$$0401473 = $$0401475;$105 = $378;$106 = $376;$108 = $379;$109 = $377;
+ label = 41;
+ } else {
+ label = 40;
+ }
+ }
+ }
+ if ((label|0) == 39) {
+ if ($383) {
+ $$0341463 = $$0341464;$$0345467 = $$0345468;$$0401473 = $$0401474;$105 = $384;$106 = $381;$108 = $385;$109 = $382;
+ label = 41;
+ } else {
+ label = 40;
+ }
+ }
+ do {
+ if ((label|0) == 40) {
+ $99 = (___errno_location()|0);
+ HEAP32[$99>>2] = 22;
+ ___shlim($0,0);
+ $$1 = 0.0;
+ }
+ else if ((label|0) == 41) {
+ $100 = HEAP32[$6>>2]|0;
+ $101 = ($100|0)==(0);
+ if ($101) {
+ $102 = (+($4|0));
+ $103 = $102 * 0.0;
+ $$1 = $103;
+ break;
+ }
+ $104 = ($105|0)==($106|0);
+ $107 = ($108|0)==($109|0);
+ $110 = $104 & $107;
+ $111 = ($109|0)<(0);
+ $112 = ($106>>>0)<(10);
+ $113 = ($109|0)==(0);
+ $114 = $113 & $112;
+ $115 = $111 | $114;
+ $or$cond = $115 & $110;
+ if ($or$cond) {
+ $116 = ($2|0)>(30);
+ $117 = $100 >>> $2;
+ $118 = ($117|0)==(0);
+ $or$cond417 = $116 | $118;
+ if ($or$cond417) {
+ $119 = (+($4|0));
+ $120 = (+($100>>>0));
+ $121 = $119 * $120;
+ $$1 = $121;
+ break;
+ }
+ }
+ $122 = (($3|0) / -2)&-1;
+ $123 = ($122|0)<(0);
+ $124 = $123 << 31 >> 31;
+ $125 = ($108|0)>($124|0);
+ $126 = ($105>>>0)>($122>>>0);
+ $127 = ($108|0)==($124|0);
+ $128 = $127 & $126;
+ $129 = $125 | $128;
+ if ($129) {
+ $130 = (___errno_location()|0);
+ HEAP32[$130>>2] = 34;
+ $131 = (+($4|0));
+ $132 = $131 * 1.7976931348623157E+308;
+ $133 = $132 * 1.7976931348623157E+308;
+ $$1 = $133;
+ break;
+ }
+ $134 = (($3) + -106)|0;
+ $135 = ($134|0)<(0);
+ $136 = $135 << 31 >> 31;
+ $137 = ($108|0)<($136|0);
+ $138 = ($105>>>0)<($134>>>0);
+ $139 = ($108|0)==($136|0);
+ $140 = $139 & $138;
+ $141 = $137 | $140;
+ if ($141) {
+ $142 = (___errno_location()|0);
+ HEAP32[$142>>2] = 34;
+ $143 = (+($4|0));
+ $144 = $143 * 2.2250738585072014E-308;
+ $145 = $144 * 2.2250738585072014E-308;
+ $$1 = $145;
+ break;
+ }
+ $146 = ($$0341463|0)==(0);
+ if ($146) {
+ $$3348 = $$0345467;
+ } else {
+ $147 = ($$0341463|0)<(9);
+ if ($147) {
+ $148 = (($6) + ($$0345467<<2)|0);
+ $$promoted = HEAP32[$148>>2]|0;
+ $$3344503 = $$0341463;$150 = $$promoted;
+ while(1) {
+ $149 = ($150*10)|0;
+ $151 = (($$3344503) + 1)|0;
+ $exitcond551 = ($151|0)==(9);
+ if ($exitcond551) {
+ break;
+ } else {
+ $$3344503 = $151;$150 = $149;
+ }
+ }
+ HEAP32[$148>>2] = $149;
+ }
+ $152 = (($$0345467) + 1)|0;
+ $$3348 = $152;
+ }
+ $153 = ($$0401473|0)<(9);
+ if ($153) {
+ $154 = ($$0401473|0)<=($105|0);
+ $155 = ($105|0)<(18);
+ $or$cond5 = $154 & $155;
+ if ($or$cond5) {
+ $156 = ($105|0)==(9);
+ $157 = HEAP32[$6>>2]|0;
+ if ($156) {
+ $158 = (+($4|0));
+ $159 = (+($157>>>0));
+ $160 = $158 * $159;
+ $$1 = $160;
+ break;
+ }
+ $161 = ($105|0)<(9);
+ if ($161) {
+ $162 = (+($4|0));
+ $163 = (+($157>>>0));
+ $164 = $162 * $163;
+ $165 = (8 - ($105))|0;
+ $166 = (4472 + ($165<<2)|0);
+ $167 = HEAP32[$166>>2]|0;
+ $168 = (+($167|0));
+ $169 = $164 / $168;
+ $$1 = $169;
+ break;
+ }
+ $$neg442 = Math_imul($105, -3)|0;
+ $$neg443 = (($2) + 27)|0;
+ $170 = (($$neg443) + ($$neg442))|0;
+ $171 = ($170|0)>(30);
+ $172 = $157 >>> $170;
+ $173 = ($172|0)==(0);
+ $or$cond419 = $171 | $173;
+ if ($or$cond419) {
+ $174 = (($105) + -10)|0;
+ $175 = (4472 + ($174<<2)|0);
+ $176 = (+($4|0));
+ $177 = (+($157>>>0));
+ $178 = $176 * $177;
+ $179 = HEAP32[$175>>2]|0;
+ $180 = (+($179|0));
+ $181 = $178 * $180;
+ $$1 = $181;
+ break;
+ }
+ }
+ }
+ $182 = (($105|0) % 9)&-1;
+ $183 = ($182|0)==(0);
+ if ($183) {
+ $$0380$ph = 0;$$1373$ph448 = $$3348;$$2352$ph449 = 0;$$2387$ph447 = $105;
+ } else {
+ $184 = ($105|0)>(-1);
+ $185 = (($182) + 9)|0;
+ $186 = $184 ? $182 : $185;
+ $187 = (8 - ($186))|0;
+ $188 = (4472 + ($187<<2)|0);
+ $189 = HEAP32[$188>>2]|0;
+ $190 = ($$3348|0)==(0);
+ if ($190) {
+ $$0350$lcssa554 = 0;$$0372 = 0;$$0385$lcssa553 = $105;
+ } else {
+ $191 = (1000000000 / ($189|0))&-1;
+ $$0340496 = 0;$$0350494 = 0;$$0385493 = $105;$$4349495 = 0;
+ while(1) {
+ $192 = (($6) + ($$4349495<<2)|0);
+ $193 = HEAP32[$192>>2]|0;
+ $194 = (($193>>>0) % ($189>>>0))&-1;
+ $195 = (($193>>>0) / ($189>>>0))&-1;
+ $196 = (($195) + ($$0340496))|0;
+ HEAP32[$192>>2] = $196;
+ $197 = Math_imul($191, $194)|0;
+ $198 = ($$4349495|0)==($$0350494|0);
+ $199 = ($196|0)==(0);
+ $or$cond420 = $198 & $199;
+ $200 = (($$0350494) + 1)|0;
+ $201 = $200 & 127;
+ $202 = (($$0385493) + -9)|0;
+ $$$0385 = $or$cond420 ? $202 : $$0385493;
+ $$$0350 = $or$cond420 ? $201 : $$0350494;
+ $203 = (($$4349495) + 1)|0;
+ $204 = ($203|0)==($$3348|0);
+ if ($204) {
+ break;
+ } else {
+ $$0340496 = $197;$$0350494 = $$$0350;$$0385493 = $$$0385;$$4349495 = $203;
+ }
+ }
+ $205 = ($197|0)==(0);
+ if ($205) {
+ $$0350$lcssa554 = $$$0350;$$0372 = $$3348;$$0385$lcssa553 = $$$0385;
+ } else {
+ $206 = (($6) + ($$3348<<2)|0);
+ $207 = (($$3348) + 1)|0;
+ HEAP32[$206>>2] = $197;
+ $$0350$lcssa554 = $$$0350;$$0372 = $207;$$0385$lcssa553 = $$$0385;
+ }
+ }
+ $208 = (9 - ($186))|0;
+ $209 = (($208) + ($$0385$lcssa553))|0;
+ $$0380$ph = 0;$$1373$ph448 = $$0372;$$2352$ph449 = $$0350$lcssa554;$$2387$ph447 = $209;
+ }
+ L101: while(1) {
+ $210 = ($$2387$ph447|0)<(18);
+ $211 = ($$2387$ph447|0)==(18);
+ $212 = (($6) + ($$2352$ph449<<2)|0);
+ $$0380 = $$0380$ph;$$1373 = $$1373$ph448;
+ while(1) {
+ if (!($210)) {
+ if (!($211)) {
+ $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = $$2387$ph447;$$6378$ph = $$1373;
+ break L101;
+ }
+ $213 = HEAP32[$212>>2]|0;
+ $214 = ($213>>>0)<(9007199);
+ if (!($214)) {
+ $$1381$ph = $$0380;$$4354$ph = $$2352$ph449;$$4389$ph445 = 18;$$6378$ph = $$1373;
+ break L101;
+ }
+ }
+ $215 = (($$1373) + 127)|0;
+ $$0334 = 0;$$2374 = $$1373;$$5$in = $215;
+ while(1) {
+ $$5 = $$5$in & 127;
+ $216 = (($6) + ($$5<<2)|0);
+ $217 = HEAP32[$216>>2]|0;
+ $218 = (_bitshift64Shl(($217|0),0,29)|0);
+ $219 = tempRet0;
+ $220 = (_i64Add(($218|0),($219|0),($$0334|0),0)|0);
+ $221 = tempRet0;
+ $222 = ($221>>>0)>(0);
+ $223 = ($220>>>0)>(1000000000);
+ $224 = ($221|0)==(0);
+ $225 = $224 & $223;
+ $226 = $222 | $225;
+ if ($226) {
+ $227 = (___udivdi3(($220|0),($221|0),1000000000,0)|0);
+ $228 = tempRet0;
+ $229 = (___uremdi3(($220|0),($221|0),1000000000,0)|0);
+ $230 = tempRet0;
+ $$1335 = $227;$$sink421$off0 = $229;
+ } else {
+ $$1335 = 0;$$sink421$off0 = $220;
+ }
+ HEAP32[$216>>2] = $$sink421$off0;
+ $231 = (($$2374) + 127)|0;
+ $232 = $231 & 127;
+ $233 = ($$5|0)!=($232|0);
+ $234 = ($$5|0)==($$2352$ph449|0);
+ $or$cond422 = $233 | $234;
+ $or$cond422$not = $or$cond422 ^ 1;
+ $235 = ($$sink421$off0|0)==(0);
+ $or$cond423 = $235 & $or$cond422$not;
+ $$3375 = $or$cond423 ? $$5 : $$2374;
+ $236 = (($$5) + -1)|0;
+ if ($234) {
+ break;
+ } else {
+ $$0334 = $$1335;$$2374 = $$3375;$$5$in = $236;
+ }
+ }
+ $237 = (($$0380) + -29)|0;
+ $238 = ($$1335|0)==(0);
+ if ($238) {
+ $$0380 = $237;$$1373 = $$3375;
+ } else {
+ break;
+ }
+ }
+ $239 = (($$2387$ph447) + 9)|0;
+ $240 = (($$2352$ph449) + 127)|0;
+ $241 = $240 & 127;
+ $242 = ($241|0)==($$3375|0);
+ $243 = (($$3375) + 127)|0;
+ $244 = $243 & 127;
+ $245 = (($$3375) + 126)|0;
+ $246 = $245 & 127;
+ $247 = (($6) + ($246<<2)|0);
+ if ($242) {
+ $248 = (($6) + ($244<<2)|0);
+ $249 = HEAP32[$248>>2]|0;
+ $250 = HEAP32[$247>>2]|0;
+ $251 = $250 | $249;
+ HEAP32[$247>>2] = $251;
+ $$4376 = $244;
+ } else {
+ $$4376 = $$3375;
+ }
+ $252 = (($6) + ($241<<2)|0);
+ HEAP32[$252>>2] = $$1335;
+ $$0380$ph = $237;$$1373$ph448 = $$4376;$$2352$ph449 = $241;$$2387$ph447 = $239;
+ }
+ L119: while(1) {
+ $289 = (($$6378$ph) + 1)|0;
+ $287 = $289 & 127;
+ $290 = (($$6378$ph) + 127)|0;
+ $291 = $290 & 127;
+ $292 = (($6) + ($291<<2)|0);
+ $$1381$ph558 = $$1381$ph;$$4354$ph559 = $$4354$ph;$$4389$ph = $$4389$ph445;
+ while(1) {
+ $265 = ($$4389$ph|0)==(18);
+ $293 = ($$4389$ph|0)>(27);
+ $$425 = $293 ? 9 : 1;
+ $$1381 = $$1381$ph558;$$4354 = $$4354$ph559;
+ while(1) {
+ $$0336486 = 0;
+ while(1) {
+ $253 = (($$0336486) + ($$4354))|0;
+ $254 = $253 & 127;
+ $255 = ($254|0)==($$6378$ph|0);
+ if ($255) {
+ $$1337 = 2;
+ label = 88;
+ break;
+ }
+ $256 = (($6) + ($254<<2)|0);
+ $257 = HEAP32[$256>>2]|0;
+ $258 = (4504 + ($$0336486<<2)|0);
+ $259 = HEAP32[$258>>2]|0;
+ $260 = ($257>>>0)<($259>>>0);
+ if ($260) {
+ $$1337 = 2;
+ label = 88;
+ break;
+ }
+ $261 = ($257>>>0)>($259>>>0);
+ if ($261) {
+ break;
+ }
+ $262 = (($$0336486) + 1)|0;
+ $263 = ($262|0)<(2);
+ if ($263) {
+ $$0336486 = $262;
+ } else {
+ $$1337 = $262;
+ label = 88;
+ break;
+ }
+ }
+ if ((label|0) == 88) {
+ label = 0;
+ $264 = ($$1337|0)==(2);
+ $or$cond11 = $265 & $264;
+ if ($or$cond11) {
+ $$0365484 = 0.0;$$4485 = 0;$$9483 = $$6378$ph;
+ break L119;
+ }
+ }
+ $266 = (($$425) + ($$1381))|0;
+ $267 = ($$4354|0)==($$6378$ph|0);
+ if ($267) {
+ $$1381 = $266;$$4354 = $$6378$ph;
+ } else {
+ break;
+ }
+ }
+ $268 = 1 << $$425;
+ $269 = (($268) + -1)|0;
+ $270 = 1000000000 >>> $$425;
+ $$0332490 = 0;$$5355488 = $$4354;$$5390487 = $$4389$ph;$$6489 = $$4354;
+ while(1) {
+ $271 = (($6) + ($$6489<<2)|0);
+ $272 = HEAP32[$271>>2]|0;
+ $273 = $272 & $269;
+ $274 = $272 >>> $$425;
+ $275 = (($274) + ($$0332490))|0;
+ HEAP32[$271>>2] = $275;
+ $276 = Math_imul($273, $270)|0;
+ $277 = ($$6489|0)==($$5355488|0);
+ $278 = ($275|0)==(0);
+ $or$cond426 = $277 & $278;
+ $279 = (($$5355488) + 1)|0;
+ $280 = $279 & 127;
+ $281 = (($$5390487) + -9)|0;
+ $$$5390 = $or$cond426 ? $281 : $$5390487;
+ $$$5355 = $or$cond426 ? $280 : $$5355488;
+ $282 = (($$6489) + 1)|0;
+ $283 = $282 & 127;
+ $284 = ($283|0)==($$6378$ph|0);
+ if ($284) {
+ break;
+ } else {
+ $$0332490 = $276;$$5355488 = $$$5355;$$5390487 = $$$5390;$$6489 = $283;
+ }
+ }
+ $285 = ($276|0)==(0);
+ if ($285) {
+ $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
+ continue;
+ }
+ $286 = ($287|0)==($$$5355|0);
+ if (!($286)) {
+ break;
+ }
+ $294 = HEAP32[$292>>2]|0;
+ $295 = $294 | 1;
+ HEAP32[$292>>2] = $295;
+ $$1381$ph558 = $266;$$4354$ph559 = $$$5355;$$4389$ph = $$$5390;
+ }
+ $288 = (($6) + ($$6378$ph<<2)|0);
+ HEAP32[$288>>2] = $276;
+ $$1381$ph = $266;$$4354$ph = $$$5355;$$4389$ph445 = $$$5390;$$6378$ph = $287;
+ }
+ while(1) {
+ $296 = (($$4485) + ($$4354))|0;
+ $297 = $296 & 127;
+ $298 = ($297|0)==($$9483|0);
+ $299 = (($$9483) + 1)|0;
+ $300 = $299 & 127;
+ if ($298) {
+ $301 = (($300) + -1)|0;
+ $302 = (($6) + ($301<<2)|0);
+ HEAP32[$302>>2] = 0;
+ $$10 = $300;
+ } else {
+ $$10 = $$9483;
+ }
+ $303 = $$0365484 * 1.0E+9;
+ $304 = (($6) + ($297<<2)|0);
+ $305 = HEAP32[$304>>2]|0;
+ $306 = (+($305>>>0));
+ $307 = $303 + $306;
+ $308 = (($$4485) + 1)|0;
+ $exitcond = ($308|0)==(2);
+ if ($exitcond) {
+ break;
+ } else {
+ $$0365484 = $307;$$4485 = $308;$$9483 = $$10;
+ }
+ }
+ $309 = (+($4|0));
+ $310 = $309 * $307;
+ $311 = (($$1381) + 53)|0;
+ $312 = (($311) - ($3))|0;
+ $313 = ($312|0)<($2|0);
+ $314 = ($312|0)>(0);
+ $$ = $314 ? $312 : 0;
+ $$0333 = $313 ? $$ : $2;
+ $315 = ($$0333|0)<(53);
+ if ($315) {
+ $316 = (105 - ($$0333))|0;
+ $317 = (+_scalbn(1.0,$316));
+ $318 = (+_copysignl($317,$310));
+ $319 = (53 - ($$0333))|0;
+ $320 = (+_scalbn(1.0,$319));
+ $321 = (+_fmodl($310,$320));
+ $322 = $310 - $321;
+ $323 = $318 + $322;
+ $$0360 = $318;$$0361 = $321;$$1366 = $323;
+ } else {
+ $$0360 = 0.0;$$0361 = 0.0;$$1366 = $310;
+ }
+ $324 = (($$4354) + 2)|0;
+ $325 = $324 & 127;
+ $326 = ($325|0)==($$10|0);
+ if ($326) {
+ $$3364 = $$0361;
+ } else {
+ $327 = (($6) + ($325<<2)|0);
+ $328 = HEAP32[$327>>2]|0;
+ $329 = ($328>>>0)<(500000000);
+ do {
+ if ($329) {
+ $330 = ($328|0)==(0);
+ if ($330) {
+ $331 = (($$4354) + 3)|0;
+ $332 = $331 & 127;
+ $333 = ($332|0)==($$10|0);
+ if ($333) {
+ $$1362 = $$0361;
+ break;
+ }
+ }
+ $334 = $309 * 0.25;
+ $335 = $334 + $$0361;
+ $$1362 = $335;
+ } else {
+ $336 = ($328|0)==(500000000);
+ if (!($336)) {
+ $337 = $309 * 0.75;
+ $338 = $337 + $$0361;
+ $$1362 = $338;
+ break;
+ }
+ $339 = (($$4354) + 3)|0;
+ $340 = $339 & 127;
+ $341 = ($340|0)==($$10|0);
+ if ($341) {
+ $342 = $309 * 0.5;
+ $343 = $342 + $$0361;
+ $$1362 = $343;
+ break;
+ } else {
+ $344 = $309 * 0.75;
+ $345 = $344 + $$0361;
+ $$1362 = $345;
+ break;
+ }
+ }
+ } while(0);
+ $346 = (53 - ($$0333))|0;
+ $347 = ($346|0)>(1);
+ if ($347) {
+ $348 = (+_fmodl($$1362,1.0));
+ $349 = $348 != 0.0;
+ if ($349) {
+ $$3364 = $$1362;
+ } else {
+ $350 = $$1362 + 1.0;
+ $$3364 = $350;
+ }
+ } else {
+ $$3364 = $$1362;
+ }
+ }
+ $351 = $$1366 + $$3364;
+ $352 = $351 - $$0360;
+ $353 = $311 & 2147483647;
+ $354 = (-2 - ($sum))|0;
+ $355 = ($353|0)>($354|0);
+ do {
+ if ($355) {
+ $356 = (+Math_abs((+$352)));
+ $357 = !($356 >= 9007199254740992.0);
+ $358 = $352 * 0.5;
+ $not$ = $357 ^ 1;
+ $359 = $not$&1;
+ $$3383 = (($359) + ($$1381))|0;
+ $$2367 = $357 ? $352 : $358;
+ $360 = (($$3383) + 50)|0;
+ $361 = ($360|0)>($7|0);
+ if (!($361)) {
+ $362 = ($$0333|0)!=($312|0);
+ $narrow = $362 | $357;
+ $$2371$v = $313 & $narrow;
+ $363 = $$3364 != 0.0;
+ $or$cond14 = $363 & $$2371$v;
+ if (!($or$cond14)) {
+ $$3368 = $$2367;$$4384 = $$3383;
+ break;
+ }
+ }
+ $364 = (___errno_location()|0);
+ HEAP32[$364>>2] = 34;
+ $$3368 = $$2367;$$4384 = $$3383;
+ } else {
+ $$3368 = $352;$$4384 = $$1381;
+ }
+ } while(0);
+ $365 = (+_scalbnl($$3368,$$4384));
+ $$1 = $365;
+ }
+ } while(0);
+ STACKTOP = sp;return (+$$1);
+}
+function _scanexp($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$04861 = 0, $$049 = 0, $$1$be = 0, $$160 = 0, $$2$be = 0, $$2$lcssa = 0, $$254 = 0, $$3$be = 0, $$lcssa = 0, $$pre = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
+ var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ((($0)) + 100|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($3>>>0)<($5>>>0);
+ if ($6) {
+ $7 = ((($3)) + 1|0);
+ HEAP32[$2>>2] = $7;
+ $8 = HEAP8[$3>>0]|0;
+ $9 = $8&255;
+ $11 = $9;
+ } else {
+ $10 = (___shgetc($0)|0);
+ $11 = $10;
+ }
+ switch ($11|0) {
+ case 43: case 45: {
+ $12 = ($11|0)==(45);
+ $13 = $12&1;
+ $14 = HEAP32[$2>>2]|0;
+ $15 = HEAP32[$4>>2]|0;
+ $16 = ($14>>>0)<($15>>>0);
+ if ($16) {
+ $17 = ((($14)) + 1|0);
+ HEAP32[$2>>2] = $17;
+ $18 = HEAP8[$14>>0]|0;
+ $19 = $18&255;
+ $22 = $19;
+ } else {
+ $20 = (___shgetc($0)|0);
+ $22 = $20;
+ }
+ $21 = (($22) + -48)|0;
+ $23 = ($21>>>0)>(9);
+ $24 = ($1|0)!=(0);
+ $or$cond3 = $24 & $23;
+ if ($or$cond3) {
+ $25 = HEAP32[$4>>2]|0;
+ $26 = ($25|0)==(0|0);
+ if ($26) {
+ $$0 = $13;$$049 = $22;
+ } else {
+ $27 = HEAP32[$2>>2]|0;
+ $28 = ((($27)) + -1|0);
+ HEAP32[$2>>2] = $28;
+ $$0 = $13;$$049 = $22;
+ }
+ } else {
+ $$0 = $13;$$049 = $22;
+ }
+ break;
+ }
+ default: {
+ $$0 = 0;$$049 = $11;
+ }
+ }
+ $29 = (($$049) + -48)|0;
+ $30 = ($29>>>0)>(9);
+ if ($30) {
+ $31 = HEAP32[$4>>2]|0;
+ $32 = ($31|0)==(0|0);
+ if ($32) {
+ $100 = -2147483648;$101 = 0;
+ } else {
+ $33 = HEAP32[$2>>2]|0;
+ $34 = ((($33)) + -1|0);
+ HEAP32[$2>>2] = $34;
+ $100 = -2147483648;$101 = 0;
+ }
+ } else {
+ $$04861 = 0;$$160 = $$049;
+ while(1) {
+ $35 = ($$04861*10)|0;
+ $36 = (($$160) + -48)|0;
+ $37 = (($36) + ($35))|0;
+ $38 = HEAP32[$2>>2]|0;
+ $39 = HEAP32[$4>>2]|0;
+ $40 = ($38>>>0)<($39>>>0);
+ if ($40) {
+ $41 = ((($38)) + 1|0);
+ HEAP32[$2>>2] = $41;
+ $42 = HEAP8[$38>>0]|0;
+ $43 = $42&255;
+ $$1$be = $43;
+ } else {
+ $44 = (___shgetc($0)|0);
+ $$1$be = $44;
+ }
+ $45 = (($$1$be) + -48)|0;
+ $46 = ($45>>>0)<(10);
+ $47 = ($37|0)<(214748364);
+ $48 = $46 & $47;
+ if ($48) {
+ $$04861 = $37;$$160 = $$1$be;
+ } else {
+ break;
+ }
+ }
+ $49 = ($37|0)<(0);
+ $50 = $49 << 31 >> 31;
+ $51 = (($$1$be) + -48)|0;
+ $52 = ($51>>>0)<(10);
+ if ($52) {
+ $$254 = $$1$be;$56 = $37;$57 = $50;
+ while(1) {
+ $58 = (___muldi3(($56|0),($57|0),10,0)|0);
+ $59 = tempRet0;
+ $60 = ($$254|0)<(0);
+ $61 = $60 << 31 >> 31;
+ $62 = (_i64Add(($$254|0),($61|0),-48,-1)|0);
+ $63 = tempRet0;
+ $64 = (_i64Add(($62|0),($63|0),($58|0),($59|0))|0);
+ $65 = tempRet0;
+ $66 = HEAP32[$2>>2]|0;
+ $67 = HEAP32[$4>>2]|0;
+ $68 = ($66>>>0)<($67>>>0);
+ if ($68) {
+ $69 = ((($66)) + 1|0);
+ HEAP32[$2>>2] = $69;
+ $70 = HEAP8[$66>>0]|0;
+ $71 = $70&255;
+ $$2$be = $71;
+ } else {
+ $72 = (___shgetc($0)|0);
+ $$2$be = $72;
+ }
+ $73 = (($$2$be) + -48)|0;
+ $74 = ($73>>>0)<(10);
+ $75 = ($65|0)<(21474836);
+ $76 = ($64>>>0)<(2061584302);
+ $77 = ($65|0)==(21474836);
+ $78 = $77 & $76;
+ $79 = $75 | $78;
+ $80 = $74 & $79;
+ if ($80) {
+ $$254 = $$2$be;$56 = $64;$57 = $65;
+ } else {
+ $$2$lcssa = $$2$be;$94 = $64;$95 = $65;
+ break;
+ }
+ }
+ } else {
+ $$2$lcssa = $$1$be;$94 = $37;$95 = $50;
+ }
+ $53 = (($$2$lcssa) + -48)|0;
+ $54 = ($53>>>0)<(10);
+ $55 = HEAP32[$4>>2]|0;
+ if ($54) {
+ $83 = $55;
+ while(1) {
+ $81 = HEAP32[$2>>2]|0;
+ $82 = ($81>>>0)<($83>>>0);
+ if ($82) {
+ $84 = ((($81)) + 1|0);
+ HEAP32[$2>>2] = $84;
+ $85 = HEAP8[$81>>0]|0;
+ $86 = $85&255;
+ $$3$be = $86;$102 = $83;
+ } else {
+ $87 = (___shgetc($0)|0);
+ $$pre = HEAP32[$4>>2]|0;
+ $$3$be = $87;$102 = $$pre;
+ }
+ $88 = (($$3$be) + -48)|0;
+ $89 = ($88>>>0)<(10);
+ if ($89) {
+ $83 = $102;
+ } else {
+ $$lcssa = $102;
+ break;
+ }
+ }
+ } else {
+ $$lcssa = $55;
+ }
+ $90 = ($$lcssa|0)==(0|0);
+ if (!($90)) {
+ $91 = HEAP32[$2>>2]|0;
+ $92 = ((($91)) + -1|0);
+ HEAP32[$2>>2] = $92;
+ }
+ $93 = ($$0|0)!=(0);
+ $96 = (_i64Subtract(0,0,($94|0),($95|0))|0);
+ $97 = tempRet0;
+ $98 = $93 ? $96 : $94;
+ $99 = $93 ? $97 : $95;
+ $100 = $99;$101 = $98;
+ }
+ tempRet0 = ($100);
+ return ($101|0);
+}
+function _scalbn($0,$1) {
+ $0 = +$0;
+ $1 = $1|0;
+ var $$ = 0, $$$ = 0, $$0 = 0.0, $$020 = 0, $$1 = 0, $$1$ = 0, $$21 = 0.0, $$22 = 0.0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0;
+ var $3 = 0.0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($1|0)>(1023);
+ if ($2) {
+ $3 = $0 * 8.9884656743115795E+307;
+ $4 = (($1) + -1023)|0;
+ $5 = ($4|0)>(1023);
+ $6 = $3 * 8.9884656743115795E+307;
+ $7 = (($1) + -2046)|0;
+ $8 = ($7|0)<(1023);
+ $$ = $8 ? $7 : 1023;
+ $$$ = $5 ? $$ : $4;
+ $$21 = $5 ? $6 : $3;
+ $$0 = $$21;$$020 = $$$;
+ } else {
+ $9 = ($1|0)<(-1022);
+ if ($9) {
+ $10 = $0 * 2.2250738585072014E-308;
+ $11 = (($1) + 1022)|0;
+ $12 = ($11|0)<(-1022);
+ $13 = $10 * 2.2250738585072014E-308;
+ $14 = (($1) + 2044)|0;
+ $15 = ($14|0)>(-1022);
+ $$1 = $15 ? $14 : -1022;
+ $$1$ = $12 ? $$1 : $11;
+ $$22 = $12 ? $13 : $10;
+ $$0 = $$22;$$020 = $$1$;
+ } else {
+ $$0 = $0;$$020 = $1;
+ }
+ }
+ $16 = (($$020) + 1023)|0;
+ $17 = (_bitshift64Shl(($16|0),0,52)|0);
+ $18 = tempRet0;
+ HEAP32[tempDoublePtr>>2] = $17;HEAP32[tempDoublePtr+4>>2] = $18;$19 = +HEAPF64[tempDoublePtr>>3];
+ $20 = $$0 * $19;
+ return (+$20);
+}
+function _copysignl($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+_copysign($0,$1));
+ return (+$2);
+}
+function _fmodl($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+_fmod($0,$1));
+ return (+$2);
+}
+function _scalbnl($0,$1) {
+ $0 = +$0;
+ $1 = $1|0;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+_scalbn($0,$1));
+ return (+$2);
+}
+function _fmod($0,$1) {
+ $0 = +$0;
+ $1 = +$1;
+ var $$ = 0.0, $$070 = 0.0, $$071$lcssa = 0, $$07194 = 0, $$073$lcssa = 0, $$073100 = 0, $$172$ph = 0, $$174 = 0, $$275$lcssa = 0, $$27586 = 0, $$376$lcssa = 0, $$37683 = 0, $$lcssa = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0.0, $104 = 0, $105 = 0;
+ var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
+ var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0.0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
+ var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0.0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
+ var $160 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
+ var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0;
+ var $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0;
+ var $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0;
+ var $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $or$cond = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
+ $3 = HEAP32[tempDoublePtr+4>>2]|0;
+ HEAPF64[tempDoublePtr>>3] = $1;$4 = HEAP32[tempDoublePtr>>2]|0;
+ $5 = HEAP32[tempDoublePtr+4>>2]|0;
+ $6 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
+ $7 = tempRet0;
+ $8 = $6 & 2047;
+ $9 = (_bitshift64Lshr(($4|0),($5|0),52)|0);
+ $10 = tempRet0;
+ $11 = $9 & 2047;
+ $12 = $3 & -2147483648;
+ $13 = (_bitshift64Shl(($4|0),($5|0),1)|0);
+ $14 = tempRet0;
+ $15 = ($13|0)==(0);
+ $16 = ($14|0)==(0);
+ $17 = $15 & $16;
+ L1: do {
+ if ($17) {
+ label = 3;
+ } else {
+ $18 = (___DOUBLE_BITS_272($1)|0);
+ $19 = tempRet0;
+ $20 = $19 & 2147483647;
+ $21 = ($20>>>0)>(2146435072);
+ $22 = ($18>>>0)>(0);
+ $23 = ($20|0)==(2146435072);
+ $24 = $23 & $22;
+ $25 = $21 | $24;
+ $26 = ($8|0)==(2047);
+ $or$cond = $26 | $25;
+ if ($or$cond) {
+ label = 3;
+ } else {
+ $29 = (_bitshift64Shl(($2|0),($3|0),1)|0);
+ $30 = tempRet0;
+ $31 = ($30>>>0)>($14>>>0);
+ $32 = ($29>>>0)>($13>>>0);
+ $33 = ($30|0)==($14|0);
+ $34 = $33 & $32;
+ $35 = $31 | $34;
+ if (!($35)) {
+ $36 = ($29|0)==($13|0);
+ $37 = ($30|0)==($14|0);
+ $38 = $36 & $37;
+ $39 = $0 * 0.0;
+ $$ = $38 ? $39 : $0;
+ return (+$$);
+ }
+ $40 = ($8|0)==(0);
+ if ($40) {
+ $41 = (_bitshift64Shl(($2|0),($3|0),12)|0);
+ $42 = tempRet0;
+ $43 = ($42|0)>(-1);
+ $44 = ($41>>>0)>(4294967295);
+ $45 = ($42|0)==(-1);
+ $46 = $45 & $44;
+ $47 = $43 | $46;
+ if ($47) {
+ $$073100 = 0;$49 = $41;$50 = $42;
+ while(1) {
+ $48 = (($$073100) + -1)|0;
+ $51 = (_bitshift64Shl(($49|0),($50|0),1)|0);
+ $52 = tempRet0;
+ $53 = ($52|0)>(-1);
+ $54 = ($51>>>0)>(4294967295);
+ $55 = ($52|0)==(-1);
+ $56 = $55 & $54;
+ $57 = $53 | $56;
+ if ($57) {
+ $$073100 = $48;$49 = $51;$50 = $52;
+ } else {
+ $$073$lcssa = $48;
+ break;
+ }
+ }
+ } else {
+ $$073$lcssa = 0;
+ }
+ $58 = (1 - ($$073$lcssa))|0;
+ $59 = (_bitshift64Shl(($2|0),($3|0),($58|0))|0);
+ $60 = tempRet0;
+ $$174 = $$073$lcssa;$87 = $59;$88 = $60;
+ } else {
+ $61 = $3 & 1048575;
+ $62 = $61 | 1048576;
+ $$174 = $8;$87 = $2;$88 = $62;
+ }
+ $63 = ($11|0)==(0);
+ if ($63) {
+ $64 = (_bitshift64Shl(($4|0),($5|0),12)|0);
+ $65 = tempRet0;
+ $66 = ($65|0)>(-1);
+ $67 = ($64>>>0)>(4294967295);
+ $68 = ($65|0)==(-1);
+ $69 = $68 & $67;
+ $70 = $66 | $69;
+ if ($70) {
+ $$07194 = 0;$72 = $64;$73 = $65;
+ while(1) {
+ $71 = (($$07194) + -1)|0;
+ $74 = (_bitshift64Shl(($72|0),($73|0),1)|0);
+ $75 = tempRet0;
+ $76 = ($75|0)>(-1);
+ $77 = ($74>>>0)>(4294967295);
+ $78 = ($75|0)==(-1);
+ $79 = $78 & $77;
+ $80 = $76 | $79;
+ if ($80) {
+ $$07194 = $71;$72 = $74;$73 = $75;
+ } else {
+ $$071$lcssa = $71;
+ break;
+ }
+ }
+ } else {
+ $$071$lcssa = 0;
+ }
+ $81 = (1 - ($$071$lcssa))|0;
+ $82 = (_bitshift64Shl(($4|0),($5|0),($81|0))|0);
+ $83 = tempRet0;
+ $$172$ph = $$071$lcssa;$89 = $82;$90 = $83;
+ } else {
+ $84 = $5 & 1048575;
+ $85 = $84 | 1048576;
+ $$172$ph = $11;$89 = $4;$90 = $85;
+ }
+ $86 = ($$174|0)>($$172$ph|0);
+ $91 = (_i64Subtract(($87|0),($88|0),($89|0),($90|0))|0);
+ $92 = tempRet0;
+ $93 = ($92|0)>(-1);
+ $94 = ($91>>>0)>(4294967295);
+ $95 = ($92|0)==(-1);
+ $96 = $95 & $94;
+ $97 = $93 | $96;
+ L23: do {
+ if ($86) {
+ $$27586 = $$174;$101 = $92;$156 = $97;$157 = $87;$158 = $88;$99 = $91;
+ while(1) {
+ if ($156) {
+ $98 = ($99|0)==(0);
+ $100 = ($101|0)==(0);
+ $102 = $98 & $100;
+ if ($102) {
+ break;
+ } else {
+ $104 = $99;$105 = $101;
+ }
+ } else {
+ $104 = $157;$105 = $158;
+ }
+ $106 = (_bitshift64Shl(($104|0),($105|0),1)|0);
+ $107 = tempRet0;
+ $108 = (($$27586) + -1)|0;
+ $109 = ($108|0)>($$172$ph|0);
+ $110 = (_i64Subtract(($106|0),($107|0),($89|0),($90|0))|0);
+ $111 = tempRet0;
+ $112 = ($111|0)>(-1);
+ $113 = ($110>>>0)>(4294967295);
+ $114 = ($111|0)==(-1);
+ $115 = $114 & $113;
+ $116 = $112 | $115;
+ if ($109) {
+ $$27586 = $108;$101 = $111;$156 = $116;$157 = $106;$158 = $107;$99 = $110;
+ } else {
+ $$275$lcssa = $108;$$lcssa = $116;$118 = $110;$120 = $111;$159 = $106;$160 = $107;
+ break L23;
+ }
+ }
+ $103 = $0 * 0.0;
+ $$070 = $103;
+ break L1;
+ } else {
+ $$275$lcssa = $$174;$$lcssa = $97;$118 = $91;$120 = $92;$159 = $87;$160 = $88;
+ }
+ } while(0);
+ if ($$lcssa) {
+ $117 = ($118|0)==(0);
+ $119 = ($120|0)==(0);
+ $121 = $117 & $119;
+ if ($121) {
+ $129 = $0 * 0.0;
+ $$070 = $129;
+ break;
+ } else {
+ $123 = $120;$125 = $118;
+ }
+ } else {
+ $123 = $160;$125 = $159;
+ }
+ $122 = ($123>>>0)<(1048576);
+ $124 = ($125>>>0)<(0);
+ $126 = ($123|0)==(1048576);
+ $127 = $126 & $124;
+ $128 = $122 | $127;
+ if ($128) {
+ $$37683 = $$275$lcssa;$130 = $125;$131 = $123;
+ while(1) {
+ $132 = (_bitshift64Shl(($130|0),($131|0),1)|0);
+ $133 = tempRet0;
+ $134 = (($$37683) + -1)|0;
+ $135 = ($133>>>0)<(1048576);
+ $136 = ($132>>>0)<(0);
+ $137 = ($133|0)==(1048576);
+ $138 = $137 & $136;
+ $139 = $135 | $138;
+ if ($139) {
+ $$37683 = $134;$130 = $132;$131 = $133;
+ } else {
+ $$376$lcssa = $134;$141 = $132;$142 = $133;
+ break;
+ }
+ }
+ } else {
+ $$376$lcssa = $$275$lcssa;$141 = $125;$142 = $123;
+ }
+ $140 = ($$376$lcssa|0)>(0);
+ if ($140) {
+ $143 = (_i64Add(($141|0),($142|0),0,-1048576)|0);
+ $144 = tempRet0;
+ $145 = (_bitshift64Shl(($$376$lcssa|0),0,52)|0);
+ $146 = tempRet0;
+ $147 = $143 | $145;
+ $148 = $144 | $146;
+ $153 = $148;$155 = $147;
+ } else {
+ $149 = (1 - ($$376$lcssa))|0;
+ $150 = (_bitshift64Lshr(($141|0),($142|0),($149|0))|0);
+ $151 = tempRet0;
+ $153 = $151;$155 = $150;
+ }
+ $152 = $153 | $12;
+ HEAP32[tempDoublePtr>>2] = $155;HEAP32[tempDoublePtr+4>>2] = $152;$154 = +HEAPF64[tempDoublePtr>>3];
+ $$070 = $154;
+ }
+ }
+ } while(0);
+ if ((label|0) == 3) {
+ $27 = $0 * $1;
+ $28 = $27 / $27;
+ $$070 = $28;
+ }
+ return (+$$070);
+}
+function ___DOUBLE_BITS_272($0) {
+ $0 = +$0;
+ var $1 = 0, $2 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
+ $2 = HEAP32[tempDoublePtr+4>>2]|0;
+ tempRet0 = ($2);
+ return ($1|0);
+}
+function _strlen($0) {
+ $0 = $0|0;
+ var $$0 = 0, $$015$lcssa = 0, $$01519 = 0, $$1$lcssa = 0, $$pn = 0, $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = $0;
+ $2 = $1 & 3;
+ $3 = ($2|0)==(0);
+ L1: do {
+ if ($3) {
+ $$015$lcssa = $0;
+ label = 4;
+ } else {
+ $$01519 = $0;$23 = $1;
+ while(1) {
+ $4 = HEAP8[$$01519>>0]|0;
+ $5 = ($4<<24>>24)==(0);
+ if ($5) {
+ $$sink = $23;
+ break L1;
+ }
+ $6 = ((($$01519)) + 1|0);
+ $7 = $6;
+ $8 = $7 & 3;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ $$015$lcssa = $6;
+ label = 4;
+ break;
+ } else {
+ $$01519 = $6;$23 = $7;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 4) {
+ $$0 = $$015$lcssa;
+ while(1) {
+ $10 = HEAP32[$$0>>2]|0;
+ $11 = (($10) + -16843009)|0;
+ $12 = $10 & -2139062144;
+ $13 = $12 ^ -2139062144;
+ $14 = $13 & $11;
+ $15 = ($14|0)==(0);
+ $16 = ((($$0)) + 4|0);
+ if ($15) {
+ $$0 = $16;
+ } else {
+ break;
+ }
+ }
+ $17 = $10&255;
+ $18 = ($17<<24>>24)==(0);
+ if ($18) {
+ $$1$lcssa = $$0;
+ } else {
+ $$pn = $$0;
+ while(1) {
+ $19 = ((($$pn)) + 1|0);
+ $$pre = HEAP8[$19>>0]|0;
+ $20 = ($$pre<<24>>24)==(0);
+ if ($20) {
+ $$1$lcssa = $19;
+ break;
+ } else {
+ $$pn = $19;
+ }
+ }
+ }
+ $21 = $$1$lcssa;
+ $$sink = $21;
+ }
+ $22 = (($$sink) - ($1))|0;
+ return ($22|0);
+}
+function _strchr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (___strchrnul($0,$1)|0);
+ $3 = HEAP8[$2>>0]|0;
+ $4 = $1&255;
+ $5 = ($3<<24>>24)==($4<<24>>24);
+ $6 = $5 ? $2 : 0;
+ return ($6|0);
+}
+function ___strchrnul($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
+ var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = $1 & 255;
+ $3 = ($2|0)==(0);
+ L1: do {
+ if ($3) {
+ $8 = (_strlen($0)|0);
+ $9 = (($0) + ($8)|0);
+ $$0 = $9;
+ } else {
+ $4 = $0;
+ $5 = $4 & 3;
+ $6 = ($5|0)==(0);
+ if ($6) {
+ $$030$lcssa = $0;
+ } else {
+ $7 = $1&255;
+ $$03039 = $0;
+ while(1) {
+ $10 = HEAP8[$$03039>>0]|0;
+ $11 = ($10<<24>>24)==(0);
+ $12 = ($10<<24>>24)==($7<<24>>24);
+ $or$cond = $11 | $12;
+ if ($or$cond) {
+ $$0 = $$03039;
+ break L1;
+ }
+ $13 = ((($$03039)) + 1|0);
+ $14 = $13;
+ $15 = $14 & 3;
+ $16 = ($15|0)==(0);
+ if ($16) {
+ $$030$lcssa = $13;
+ break;
+ } else {
+ $$03039 = $13;
+ }
+ }
+ }
+ $17 = Math_imul($2, 16843009)|0;
+ $18 = HEAP32[$$030$lcssa>>2]|0;
+ $19 = (($18) + -16843009)|0;
+ $20 = $18 & -2139062144;
+ $21 = $20 ^ -2139062144;
+ $22 = $21 & $19;
+ $23 = ($22|0)==(0);
+ L10: do {
+ if ($23) {
+ $$02936 = $$030$lcssa;$25 = $18;
+ while(1) {
+ $24 = $25 ^ $17;
+ $26 = (($24) + -16843009)|0;
+ $27 = $24 & -2139062144;
+ $28 = $27 ^ -2139062144;
+ $29 = $28 & $26;
+ $30 = ($29|0)==(0);
+ if (!($30)) {
+ $$029$lcssa = $$02936;
+ break L10;
+ }
+ $31 = ((($$02936)) + 4|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = (($32) + -16843009)|0;
+ $34 = $32 & -2139062144;
+ $35 = $34 ^ -2139062144;
+ $36 = $35 & $33;
+ $37 = ($36|0)==(0);
+ if ($37) {
+ $$02936 = $31;$25 = $32;
+ } else {
+ $$029$lcssa = $31;
+ break;
+ }
+ }
+ } else {
+ $$029$lcssa = $$030$lcssa;
+ }
+ } while(0);
+ $38 = $1&255;
+ $$1 = $$029$lcssa;
+ while(1) {
+ $39 = HEAP8[$$1>>0]|0;
+ $40 = ($39<<24>>24)==(0);
+ $41 = ($39<<24>>24)==($38<<24>>24);
+ $or$cond33 = $40 | $41;
+ $42 = ((($$1)) + 1|0);
+ if ($or$cond33) {
+ $$0 = $$1;
+ break;
+ } else {
+ $$1 = $42;
+ }
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _mbrtowc($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$ = 0, $$0 = 0, $$03952 = 0, $$04051 = 0, $$04350 = 0, $$1 = 0, $$141 = 0, $$144 = 0, $$2 = 0, $$47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0;
+ var $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $4 = sp;
+ $5 = ($3|0)==(0|0);
+ $$ = $5 ? 22996 : $3;
+ $6 = HEAP32[$$>>2]|0;
+ $7 = ($1|0)==(0|0);
+ L1: do {
+ if ($7) {
+ $8 = ($6|0)==(0);
+ if ($8) {
+ $$0 = 0;
+ } else {
+ label = 17;
+ }
+ } else {
+ $9 = ($0|0)==(0|0);
+ $$47 = $9 ? $4 : $0;
+ $10 = ($2|0)==(0);
+ if ($10) {
+ $$0 = -2;
+ } else {
+ $11 = ($6|0)==(0);
+ if ($11) {
+ $12 = HEAP8[$1>>0]|0;
+ $13 = ($12<<24>>24)>(-1);
+ if ($13) {
+ $14 = $12&255;
+ HEAP32[$$47>>2] = $14;
+ $15 = ($12<<24>>24)!=(0);
+ $16 = $15&1;
+ $$0 = $16;
+ break;
+ }
+ $17 = (___pthread_self_439()|0);
+ $18 = ((($17)) + 188|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = HEAP32[$19>>2]|0;
+ $not$ = ($20|0)==(0|0);
+ $21 = HEAP8[$1>>0]|0;
+ if ($not$) {
+ $22 = $21 << 24 >> 24;
+ $23 = $22 & 57343;
+ HEAP32[$$47>>2] = $23;
+ $$0 = 1;
+ break;
+ }
+ $24 = $21&255;
+ $25 = (($24) + -194)|0;
+ $26 = ($25>>>0)>(50);
+ if ($26) {
+ label = 17;
+ break;
+ }
+ $27 = ((($1)) + 1|0);
+ $28 = (3768 + ($25<<2)|0);
+ $29 = HEAP32[$28>>2]|0;
+ $30 = (($2) + -1)|0;
+ $31 = ($30|0)==(0);
+ if ($31) {
+ $$2 = $29;
+ } else {
+ $$03952 = $27;$$04051 = $29;$$04350 = $30;
+ label = 11;
+ }
+ } else {
+ $$03952 = $1;$$04051 = $6;$$04350 = $2;
+ label = 11;
+ }
+ L14: do {
+ if ((label|0) == 11) {
+ $32 = HEAP8[$$03952>>0]|0;
+ $33 = $32&255;
+ $34 = $33 >>> 3;
+ $35 = (($34) + -16)|0;
+ $36 = $$04051 >> 26;
+ $37 = (($34) + ($36))|0;
+ $38 = $35 | $37;
+ $39 = ($38>>>0)>(7);
+ if ($39) {
+ label = 17;
+ break L1;
+ } else {
+ $$1 = $$03952;$$141 = $$04051;$$144 = $$04350;$43 = $32;
+ }
+ while(1) {
+ $40 = $$141 << 6;
+ $41 = ((($$1)) + 1|0);
+ $42 = $43&255;
+ $44 = (($42) + -128)|0;
+ $45 = $44 | $40;
+ $46 = (($$144) + -1)|0;
+ $47 = ($45|0)<(0);
+ if (!($47)) {
+ break;
+ }
+ $49 = ($46|0)==(0);
+ if ($49) {
+ $$2 = $45;
+ break L14;
+ }
+ $50 = HEAP8[$41>>0]|0;
+ $51 = $50 & -64;
+ $52 = ($51<<24>>24)==(-128);
+ if ($52) {
+ $$1 = $41;$$141 = $45;$$144 = $46;$43 = $50;
+ } else {
+ label = 17;
+ break L1;
+ }
+ }
+ HEAP32[$$>>2] = 0;
+ HEAP32[$$47>>2] = $45;
+ $48 = (($2) - ($46))|0;
+ $$0 = $48;
+ break L1;
+ }
+ } while(0);
+ HEAP32[$$>>2] = $$2;
+ $$0 = -2;
+ }
+ }
+ } while(0);
+ if ((label|0) == 17) {
+ HEAP32[$$>>2] = 0;
+ $53 = (___errno_location()|0);
+ HEAP32[$53>>2] = 84;
+ $$0 = -1;
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___pthread_self_439() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_pthread_self()|0);
+ return ($0|0);
+}
+function _strcpy($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ (___stpcpy($0,$1)|0);
+ return ($0|0);
+}
+function ___stpcpy($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0$lcssa = 0, $$025$lcssa = 0, $$02536 = 0, $$026$lcssa = 0, $$02642 = 0, $$027$lcssa = 0, $$02741 = 0, $$029 = 0, $$037 = 0, $$1$ph = 0, $$128$ph = 0, $$12834 = 0, $$135 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
+ var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
+ var $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = $1;
+ $3 = $0;
+ $4 = $2 ^ $3;
+ $5 = $4 & 3;
+ $6 = ($5|0)==(0);
+ L1: do {
+ if ($6) {
+ $7 = $2 & 3;
+ $8 = ($7|0)==(0);
+ if ($8) {
+ $$026$lcssa = $1;$$027$lcssa = $0;
+ } else {
+ $$02642 = $1;$$02741 = $0;
+ while(1) {
+ $9 = HEAP8[$$02642>>0]|0;
+ HEAP8[$$02741>>0] = $9;
+ $10 = ($9<<24>>24)==(0);
+ if ($10) {
+ $$029 = $$02741;
+ break L1;
+ }
+ $11 = ((($$02642)) + 1|0);
+ $12 = ((($$02741)) + 1|0);
+ $13 = $11;
+ $14 = $13 & 3;
+ $15 = ($14|0)==(0);
+ if ($15) {
+ $$026$lcssa = $11;$$027$lcssa = $12;
+ break;
+ } else {
+ $$02642 = $11;$$02741 = $12;
+ }
+ }
+ }
+ $16 = HEAP32[$$026$lcssa>>2]|0;
+ $17 = (($16) + -16843009)|0;
+ $18 = $16 & -2139062144;
+ $19 = $18 ^ -2139062144;
+ $20 = $19 & $17;
+ $21 = ($20|0)==(0);
+ if ($21) {
+ $$02536 = $$027$lcssa;$$037 = $$026$lcssa;$24 = $16;
+ while(1) {
+ $22 = ((($$037)) + 4|0);
+ $23 = ((($$02536)) + 4|0);
+ HEAP32[$$02536>>2] = $24;
+ $25 = HEAP32[$22>>2]|0;
+ $26 = (($25) + -16843009)|0;
+ $27 = $25 & -2139062144;
+ $28 = $27 ^ -2139062144;
+ $29 = $28 & $26;
+ $30 = ($29|0)==(0);
+ if ($30) {
+ $$02536 = $23;$$037 = $22;$24 = $25;
+ } else {
+ $$0$lcssa = $22;$$025$lcssa = $23;
+ break;
+ }
+ }
+ } else {
+ $$0$lcssa = $$026$lcssa;$$025$lcssa = $$027$lcssa;
+ }
+ $$1$ph = $$0$lcssa;$$128$ph = $$025$lcssa;
+ label = 8;
+ } else {
+ $$1$ph = $1;$$128$ph = $0;
+ label = 8;
+ }
+ } while(0);
+ if ((label|0) == 8) {
+ $31 = HEAP8[$$1$ph>>0]|0;
+ HEAP8[$$128$ph>>0] = $31;
+ $32 = ($31<<24>>24)==(0);
+ if ($32) {
+ $$029 = $$128$ph;
+ } else {
+ $$12834 = $$128$ph;$$135 = $$1$ph;
+ while(1) {
+ $33 = ((($$135)) + 1|0);
+ $34 = ((($$12834)) + 1|0);
+ $35 = HEAP8[$33>>0]|0;
+ HEAP8[$34>>0] = $35;
+ $36 = ($35<<24>>24)==(0);
+ if ($36) {
+ $$029 = $34;
+ break;
+ } else {
+ $$12834 = $34;$$135 = $33;
+ }
+ }
+ }
+ }
+ return ($$029|0);
+}
+function _ldexp($0,$1) {
+ $0 = +$0;
+ $1 = $1|0;
+ var $2 = 0.0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (+_scalbn($0,$1));
+ return (+$2);
+}
+function ___unlist_locked_file($0) {
+ $0 = $0|0;
+ var $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 68|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)==(0);
+ if (!($3)) {
+ $4 = ((($0)) + 116|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ($5|0)==(0|0);
+ $$pre = ((($0)) + 112|0);
+ if (!($6)) {
+ $7 = HEAP32[$$pre>>2]|0;
+ $8 = ((($5)) + 112|0);
+ HEAP32[$8>>2] = $7;
+ }
+ $9 = HEAP32[$$pre>>2]|0;
+ $10 = ($9|0)==(0|0);
+ if ($10) {
+ $12 = (___pthread_self_607()|0);
+ $13 = ((($12)) + 232|0);
+ $$sink = $13;
+ } else {
+ $11 = ((($9)) + 116|0);
+ $$sink = $11;
+ }
+ HEAP32[$$sink>>2] = $5;
+ }
+ return;
+}
+function ___pthread_self_607() {
+ var $0 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $0 = (_pthread_self()|0);
+ return ($0|0);
+}
+function _fopen($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0;
+ var $vararg_ptr2 = 0, $vararg_ptr6 = 0, $vararg_ptr7 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
+ $vararg_buffer8 = sp + 32|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2 << 24 >> 24;
+ $memchr = (_memchr(19304,$3,4)|0);
+ $4 = ($memchr|0)==(0|0);
+ if ($4) {
+ $5 = (___errno_location()|0);
+ HEAP32[$5>>2] = 22;
+ $$0 = 0;
+ } else {
+ $6 = (___fmodeflags($1)|0);
+ $7 = $0;
+ $8 = $6 | 32768;
+ HEAP32[$vararg_buffer>>2] = $7;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = $8;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 438;
+ $9 = (___syscall5(5,($vararg_buffer|0))|0);
+ $10 = (___syscall_ret($9)|0);
+ $11 = ($10|0)<(0);
+ if ($11) {
+ $$0 = 0;
+ } else {
+ $12 = $6 & 524288;
+ $13 = ($12|0)==(0);
+ if (!($13)) {
+ HEAP32[$vararg_buffer3>>2] = $10;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = 2;
+ $vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
+ HEAP32[$vararg_ptr7>>2] = 1;
+ (___syscall221(221,($vararg_buffer3|0))|0);
+ }
+ $14 = (___fdopen($10,$1)|0);
+ $15 = ($14|0)==(0|0);
+ if ($15) {
+ HEAP32[$vararg_buffer8>>2] = $10;
+ (___syscall6(6,($vararg_buffer8|0))|0);
+ $$0 = 0;
+ } else {
+ $$0 = $14;
+ }
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___fmodeflags($0) {
+ $0 = $0|0;
+ var $$ = 0, $$$4 = 0, $$0 = 0, $$0$ = 0, $$2 = 0, $$2$ = 0, $$4 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
+ var $8 = 0, $9 = 0, $not$ = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (_strchr($0,43)|0);
+ $2 = ($1|0)==(0|0);
+ $3 = HEAP8[$0>>0]|0;
+ $not$ = ($3<<24>>24)!=(114);
+ $$ = $not$&1;
+ $$0 = $2 ? $$ : 2;
+ $4 = (_strchr($0,120)|0);
+ $5 = ($4|0)==(0|0);
+ $6 = $$0 | 128;
+ $$0$ = $5 ? $$0 : $6;
+ $7 = (_strchr($0,101)|0);
+ $8 = ($7|0)==(0|0);
+ $9 = $$0$ | 524288;
+ $$2 = $8 ? $$0$ : $9;
+ $10 = ($3<<24>>24)==(114);
+ $11 = $$2 | 64;
+ $$2$ = $10 ? $$2 : $11;
+ $12 = ($3<<24>>24)==(119);
+ $13 = $$2$ | 512;
+ $$4 = $12 ? $13 : $$2$;
+ $14 = ($3<<24>>24)==(97);
+ $15 = $$4 | 1024;
+ $$$4 = $14 ? $15 : $$4;
+ return ($$$4|0);
+}
+function ___fdopen($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$pre = 0, $$pre31 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $memchr = 0, $vararg_buffer = 0, $vararg_buffer12 = 0, $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr1 = 0, $vararg_ptr10 = 0, $vararg_ptr11 = 0, $vararg_ptr15 = 0, $vararg_ptr16 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0, dest = 0, label = 0, sp = 0, stop = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
+ $vararg_buffer12 = sp + 40|0;
+ $vararg_buffer7 = sp + 24|0;
+ $vararg_buffer3 = sp + 16|0;
+ $vararg_buffer = sp;
+ $2 = sp + 56|0;
+ $3 = HEAP8[$1>>0]|0;
+ $4 = $3 << 24 >> 24;
+ $memchr = (_memchr(19304,$4,4)|0);
+ $5 = ($memchr|0)==(0|0);
+ if ($5) {
+ $6 = (___errno_location()|0);
+ HEAP32[$6>>2] = 22;
+ $$0 = 0;
+ } else {
+ $7 = (_malloc(1156)|0);
+ $8 = ($7|0)==(0|0);
+ if ($8) {
+ $$0 = 0;
+ } else {
+ dest=$7; stop=dest+124|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
+ $9 = (_strchr($1,43)|0);
+ $10 = ($9|0)==(0|0);
+ if ($10) {
+ $11 = ($3<<24>>24)==(114);
+ $12 = $11 ? 8 : 4;
+ HEAP32[$7>>2] = $12;
+ }
+ $13 = (_strchr($1,101)|0);
+ $14 = ($13|0)==(0|0);
+ if ($14) {
+ $16 = $3;
+ } else {
+ HEAP32[$vararg_buffer>>2] = $0;
+ $vararg_ptr1 = ((($vararg_buffer)) + 4|0);
+ HEAP32[$vararg_ptr1>>2] = 2;
+ $vararg_ptr2 = ((($vararg_buffer)) + 8|0);
+ HEAP32[$vararg_ptr2>>2] = 1;
+ (___syscall221(221,($vararg_buffer|0))|0);
+ $$pre = HEAP8[$1>>0]|0;
+ $16 = $$pre;
+ }
+ $15 = ($16<<24>>24)==(97);
+ if ($15) {
+ HEAP32[$vararg_buffer3>>2] = $0;
+ $vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
+ HEAP32[$vararg_ptr6>>2] = 3;
+ $17 = (___syscall221(221,($vararg_buffer3|0))|0);
+ $18 = $17 & 1024;
+ $19 = ($18|0)==(0);
+ if ($19) {
+ $20 = $17 | 1024;
+ HEAP32[$vararg_buffer7>>2] = $0;
+ $vararg_ptr10 = ((($vararg_buffer7)) + 4|0);
+ HEAP32[$vararg_ptr10>>2] = 4;
+ $vararg_ptr11 = ((($vararg_buffer7)) + 8|0);
+ HEAP32[$vararg_ptr11>>2] = $20;
+ (___syscall221(221,($vararg_buffer7|0))|0);
+ }
+ $21 = HEAP32[$7>>2]|0;
+ $22 = $21 | 128;
+ HEAP32[$7>>2] = $22;
+ $29 = $22;
+ } else {
+ $$pre31 = HEAP32[$7>>2]|0;
+ $29 = $$pre31;
+ }
+ $23 = ((($7)) + 60|0);
+ HEAP32[$23>>2] = $0;
+ $24 = ((($7)) + 132|0);
+ $25 = ((($7)) + 44|0);
+ HEAP32[$25>>2] = $24;
+ $26 = ((($7)) + 48|0);
+ HEAP32[$26>>2] = 1024;
+ $27 = ((($7)) + 75|0);
+ HEAP8[$27>>0] = -1;
+ $28 = $29 & 8;
+ $30 = ($28|0)==(0);
+ if ($30) {
+ $31 = $2;
+ HEAP32[$vararg_buffer12>>2] = $0;
+ $vararg_ptr15 = ((($vararg_buffer12)) + 4|0);
+ HEAP32[$vararg_ptr15>>2] = 21523;
+ $vararg_ptr16 = ((($vararg_buffer12)) + 8|0);
+ HEAP32[$vararg_ptr16>>2] = $31;
+ $32 = (___syscall54(54,($vararg_buffer12|0))|0);
+ $33 = ($32|0)==(0);
+ if ($33) {
+ HEAP8[$27>>0] = 10;
+ }
+ }
+ $34 = ((($7)) + 32|0);
+ HEAP32[$34>>2] = 11;
+ $35 = ((($7)) + 36|0);
+ HEAP32[$35>>2] = 10;
+ $36 = ((($7)) + 40|0);
+ HEAP32[$36>>2] = 3;
+ $37 = ((($7)) + 12|0);
+ HEAP32[$37>>2] = 2;
+ $38 = HEAP32[(22936)>>2]|0;
+ $39 = ($38|0)==(0);
+ if ($39) {
+ $40 = ((($7)) + 76|0);
+ HEAP32[$40>>2] = -1;
+ }
+ $41 = (___ofl_add($7)|0);
+ $$0 = $7;
+ }
+ }
+ STACKTOP = sp;return ($$0|0);
+}
+function ___ofl_add($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (___ofl_lock()|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 56|0);
+ HEAP32[$3>>2] = $2;
+ $4 = HEAP32[$1>>2]|0;
+ $5 = ($4|0)==(0|0);
+ if (!($5)) {
+ $6 = ((($4)) + 52|0);
+ HEAP32[$6>>2] = $0;
+ }
+ HEAP32[$1>>2] = $0;
+ ___ofl_unlock();
+ return ($0|0);
+}
+function ___ofl_lock() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ ___lock((23000|0));
+ return (23008|0);
+}
+function ___ofl_unlock() {
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ ___unlock((23000|0));
+ return;
+}
+function _fclose($0) {
+ $0 = $0|0;
+ var $$pre = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $4 = (___lockfile($0)|0);
+ $29 = $4;
+ } else {
+ $29 = 0;
+ }
+ ___unlist_locked_file($0);
+ $5 = HEAP32[$0>>2]|0;
+ $6 = $5 & 1;
+ $7 = ($6|0)!=(0);
+ if (!($7)) {
+ $8 = (___ofl_lock()|0);
+ $9 = ((($0)) + 52|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = ($10|0)==(0|0);
+ $12 = $10;
+ $$pre = ((($0)) + 56|0);
+ if (!($11)) {
+ $13 = HEAP32[$$pre>>2]|0;
+ $14 = ((($10)) + 56|0);
+ HEAP32[$14>>2] = $13;
+ }
+ $15 = HEAP32[$$pre>>2]|0;
+ $16 = ($15|0)==(0|0);
+ if (!($16)) {
+ $17 = ((($15)) + 52|0);
+ HEAP32[$17>>2] = $12;
+ }
+ $18 = HEAP32[$8>>2]|0;
+ $19 = ($18|0)==($0|0);
+ if ($19) {
+ HEAP32[$8>>2] = $15;
+ }
+ ___ofl_unlock();
+ }
+ $20 = (_fflush($0)|0);
+ $21 = ((($0)) + 12|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = (FUNCTION_TABLE_ii[$22 & 15]($0)|0);
+ $24 = $23 | $20;
+ $25 = ((($0)) + 92|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = ($26|0)==(0|0);
+ if (!($27)) {
+ _free($26);
+ }
+ if ($7) {
+ $28 = ($29|0)==(0);
+ if (!($28)) {
+ ___unlockfile($0);
+ }
+ } else {
+ _free($0);
+ }
+ return ($24|0);
+}
+function _fflush($0) {
+ $0 = $0|0;
+ var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
+ var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0|0)==(0|0);
+ do {
+ if ($1) {
+ $8 = HEAP32[1086]|0;
+ $9 = ($8|0)==(0|0);
+ if ($9) {
+ $29 = 0;
+ } else {
+ $10 = HEAP32[1086]|0;
+ $11 = (_fflush($10)|0);
+ $29 = $11;
+ }
+ $12 = (___ofl_lock()|0);
+ $$02325 = HEAP32[$12>>2]|0;
+ $13 = ($$02325|0)==(0|0);
+ if ($13) {
+ $$024$lcssa = $29;
+ } else {
+ $$02327 = $$02325;$$02426 = $29;
+ while(1) {
+ $14 = ((($$02327)) + 76|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = ($15|0)>(-1);
+ if ($16) {
+ $17 = (___lockfile($$02327)|0);
+ $26 = $17;
+ } else {
+ $26 = 0;
+ }
+ $18 = ((($$02327)) + 20|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ((($$02327)) + 28|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = ($19>>>0)>($21>>>0);
+ if ($22) {
+ $23 = (___fflush_unlocked($$02327)|0);
+ $24 = $23 | $$02426;
+ $$1 = $24;
+ } else {
+ $$1 = $$02426;
+ }
+ $25 = ($26|0)==(0);
+ if (!($25)) {
+ ___unlockfile($$02327);
+ }
+ $27 = ((($$02327)) + 56|0);
+ $$023 = HEAP32[$27>>2]|0;
+ $28 = ($$023|0)==(0|0);
+ if ($28) {
+ $$024$lcssa = $$1;
+ break;
+ } else {
+ $$02327 = $$023;$$02426 = $$1;
+ }
+ }
+ }
+ ___ofl_unlock();
+ $$0 = $$024$lcssa;
+ } else {
+ $2 = ((($0)) + 76|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = ($3|0)>(-1);
+ if (!($4)) {
+ $5 = (___fflush_unlocked($0)|0);
+ $$0 = $5;
+ break;
+ }
+ $6 = (___lockfile($0)|0);
+ $phitmp = ($6|0)==(0);
+ $7 = (___fflush_unlocked($0)|0);
+ if ($phitmp) {
+ $$0 = $7;
+ } else {
+ ___unlockfile($0);
+ $$0 = $7;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function ___fflush_unlocked($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
+ var $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 20|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ((($0)) + 28|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($2>>>0)>($4>>>0);
+ if ($5) {
+ $6 = ((($0)) + 36|0);
+ $7 = HEAP32[$6>>2]|0;
+ (FUNCTION_TABLE_iiii[$7 & 15]($0,0,0)|0);
+ $8 = HEAP32[$1>>2]|0;
+ $9 = ($8|0)==(0|0);
+ if ($9) {
+ $$0 = -1;
+ } else {
+ label = 3;
+ }
+ } else {
+ label = 3;
+ }
+ if ((label|0) == 3) {
+ $10 = ((($0)) + 4|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ((($0)) + 8|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($11>>>0)<($13>>>0);
+ if ($14) {
+ $15 = $11;
+ $16 = $13;
+ $17 = (($15) - ($16))|0;
+ $18 = ((($0)) + 40|0);
+ $19 = HEAP32[$18>>2]|0;
+ (FUNCTION_TABLE_iiii[$19 & 15]($0,$17,1)|0);
+ }
+ $20 = ((($0)) + 16|0);
+ HEAP32[$20>>2] = 0;
+ HEAP32[$3>>2] = 0;
+ HEAP32[$1>>2] = 0;
+ HEAP32[$12>>2] = 0;
+ HEAP32[$10>>2] = 0;
+ $$0 = 0;
+ }
+ return ($$0|0);
+}
+function _fgets($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$06266 = 0, $$063 = 0, $$064 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
+ var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
+ var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0;
+ var $sext$mask = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($2)) + 76|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)>(-1);
+ if ($5) {
+ $6 = (___lockfile($2)|0);
+ $17 = $6;
+ } else {
+ $17 = 0;
+ }
+ $7 = (($1) + -1)|0;
+ $8 = ($1|0)<(2);
+ $9 = ($7|0)!=(0);
+ if ($8) {
+ $10 = ((($2)) + 74|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11 << 24 >> 24;
+ $13 = (($12) + 255)|0;
+ $14 = $13 | $12;
+ $15 = $14&255;
+ HEAP8[$10>>0] = $15;
+ $16 = ($17|0)==(0);
+ if (!($16)) {
+ ___unlockfile($2);
+ }
+ if ($9) {
+ $$0 = 0;
+ } else {
+ HEAP8[$0>>0] = 0;
+ $$0 = $0;
+ }
+ } else {
+ L11: do {
+ if ($9) {
+ $18 = ((($2)) + 4|0);
+ $19 = ((($2)) + 8|0);
+ $$063 = $7;$$064 = $0;
+ while(1) {
+ $20 = HEAP32[$18>>2]|0;
+ $21 = HEAP32[$19>>2]|0;
+ $22 = $20;
+ $23 = (($21) - ($22))|0;
+ $24 = (_memchr($20,10,$23)|0);
+ $25 = ($24|0)==(0|0);
+ $26 = $24;
+ $27 = (1 - ($22))|0;
+ $28 = (($27) + ($26))|0;
+ $29 = $25 ? $23 : $28;
+ $30 = ($29>>>0)<($$063>>>0);
+ $31 = $30 ? $29 : $$063;
+ _memcpy(($$064|0),($20|0),($31|0))|0;
+ $32 = HEAP32[$18>>2]|0;
+ $33 = (($32) + ($31)|0);
+ HEAP32[$18>>2] = $33;
+ $34 = (($$064) + ($31)|0);
+ $35 = (($$063) - ($31))|0;
+ $36 = ($35|0)!=(0);
+ $or$cond = $25 & $36;
+ if (!($or$cond)) {
+ $$1 = $34;
+ label = 17;
+ break L11;
+ }
+ $37 = HEAP32[$19>>2]|0;
+ $38 = ($33>>>0)<($37>>>0);
+ if ($38) {
+ $39 = ((($33)) + 1|0);
+ HEAP32[$18>>2] = $39;
+ $40 = HEAP8[$33>>0]|0;
+ $41 = $40&255;
+ $50 = $41;
+ } else {
+ $42 = (___uflow($2)|0);
+ $43 = ($42|0)<(0);
+ if ($43) {
+ break;
+ } else {
+ $50 = $42;
+ }
+ }
+ $48 = (($35) + -1)|0;
+ $49 = $50&255;
+ $51 = ((($34)) + 1|0);
+ HEAP8[$34>>0] = $49;
+ $sext$mask = $50 & 255;
+ $52 = ($sext$mask|0)!=(10);
+ $53 = ($48|0)!=(0);
+ $or$cond3 = $53 & $52;
+ if ($or$cond3) {
+ $$063 = $48;$$064 = $51;
+ } else {
+ $$1 = $51;
+ label = 17;
+ break L11;
+ }
+ }
+ $44 = ($34|0)==($0|0);
+ if ($44) {
+ $$06266 = 0;
+ } else {
+ $45 = HEAP32[$2>>2]|0;
+ $46 = $45 & 16;
+ $47 = ($46|0)==(0);
+ if ($47) {
+ $$06266 = 0;
+ } else {
+ $$1 = $34;
+ label = 17;
+ }
+ }
+ } else {
+ $$1 = $0;
+ label = 17;
+ }
+ } while(0);
+ if ((label|0) == 17) {
+ $54 = ($0|0)==(0|0);
+ if ($54) {
+ $$06266 = 0;
+ } else {
+ HEAP8[$$1>>0] = 0;
+ $$06266 = $0;
+ }
+ }
+ $55 = ($17|0)==(0);
+ if ($55) {
+ $$0 = $$06266;
+ } else {
+ ___unlockfile($2);
+ $$0 = $$06266;
+ }
+ }
+ return ($$0|0);
+}
+function _feof($0) {
+ $0 = $0|0;
+ var $$lobit = 0, $$lobit8 = 0, $$lobit9 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $6 = (___lockfile($0)|0);
+ $phitmp = ($6|0)==(0);
+ $7 = HEAP32[$0>>2]|0;
+ $8 = $7 >>> 4;
+ $$lobit = $8 & 1;
+ if ($phitmp) {
+ $$lobit9 = $$lobit;
+ } else {
+ ___unlockfile($0);
+ $$lobit9 = $$lobit;
+ }
+ } else {
+ $4 = HEAP32[$0>>2]|0;
+ $5 = $4 >>> 4;
+ $$lobit8 = $5 & 1;
+ $$lobit9 = $$lobit8;
+ }
+ return ($$lobit9|0);
+}
+function _fscanf($0,$1,$varargs) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $varargs = $varargs|0;
+ var $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $2 = sp;
+ HEAP32[$2>>2] = $varargs;
+ $3 = (_vfscanf($0,$1,$2)|0);
+ STACKTOP = sp;return ($3|0);
+}
+function _vfscanf($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$ = 0, $$$0266 = 0, $$$0268 = 0, $$$0305 = 0, $$$3 = 0, $$0266$lcssa = 0, $$0266417 = 0, $$0268 = 0, $$0272 = 0, $$0273429 = 0, $$0276$ph = 0, $$0278$ph = 0, $$0278$ph$phi = 0, $$0278$ph336 = 0, $$0283428 = 0, $$0286420 = 0, $$0288$ = 0, $$0288425 = 0, $$0292 = 0, $$0293 = 0;
+ var $$0305423 = 0, $$10 = 0, $$11 = 0, $$1267 = 0, $$1271 = 0, $$1274 = 0, $$1277$ph = 0, $$1279 = 0, $$1284 = 0, $$1289 = 0, $$2 = 0, $$2275 = 0, $$2280 = 0, $$2280$ph = 0, $$2280$ph$phi = 0, $$2285 = 0, $$2290 = 0, $$2307$ph = 0, $$3$lcssa = 0, $$319 = 0;
+ var $$320 = 0, $$321 = 0, $$322 = 0, $$327 = 0, $$328$le439 = 0, $$328$le441 = 0, $$3281 = 0, $$3291 = 0, $$3416 = 0, $$4282 = 0, $$4309 = 0, $$5 = 0, $$5299 = 0, $$5310 = 0, $$6 = 0, $$6311 = 0, $$7 = 0, $$7$ph = 0, $$7312 = 0, $$8 = 0;
+ var $$8313 = 0, $$9 = 0, $$9314 = 0, $$9314$ph = 0, $$lcssa355 = 0, $$not = 0, $$old4 = 0, $$ph = 0, $$ph353 = 0, $$pre = 0, $$pre$phi516Z2D = 0, $$pre507 = 0, $$pre509 = 0, $$pre511 = 0, $$pre512 = 0, $$pre513 = 0, $$pre514 = 0, $$pre515 = 0, $$sink443 = 0, $$sroa$2$0$$sroa_idx13 = 0;
+ var $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0;
+ var $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0;
+ var $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0;
+ var $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0;
+ var $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0;
+ var $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0;
+ var $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0;
+ var $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0;
+ var $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0;
+ var $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0;
+ var $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0.0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0.0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0;
+ var $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0;
+ var $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0;
+ var $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0;
+ var $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0;
+ var $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $factor = 0, $factor331 = 0, $isdigit = 0;
+ var $isdigit316 = 0, $isdigit316415 = 0, $isdigittmp = 0, $isdigittmp315 = 0, $isdigittmp315414 = 0, $narrow = 0, $narrow469 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond318 = 0, $or$cond5 = 0, $trunc = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 288|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(288|0);
+ $3 = sp + 8|0;
+ $4 = sp + 17|0;
+ $5 = sp;
+ $6 = sp + 16|0;
+ $7 = ((($0)) + 76|0);
+ $8 = HEAP32[$7>>2]|0;
+ $9 = ($8|0)>(-1);
+ if ($9) {
+ $10 = (___lockfile($0)|0);
+ $306 = $10;
+ } else {
+ $306 = 0;
+ }
+ $11 = HEAP8[$1>>0]|0;
+ $12 = ($11<<24>>24)==(0);
+ L4: do {
+ if ($12) {
+ $$3291 = 0;
+ } else {
+ $13 = ((($0)) + 4|0);
+ $14 = ((($0)) + 100|0);
+ $15 = ((($0)) + 108|0);
+ $16 = ((($0)) + 8|0);
+ $17 = ((($4)) + 10|0);
+ $18 = ((($4)) + 33|0);
+ $$sroa$2$0$$sroa_idx13 = ((($3)) + 4|0);
+ $19 = ((($4)) + 46|0);
+ $20 = ((($4)) + 94|0);
+ $21 = ((($4)) + 1|0);
+ $22 = ((($4)) + 1|0);
+ $$0273429 = $1;$$0283428 = 0;$$0288425 = 0;$$0305423 = 0;$102 = 0;$24 = $11;
+ L6: while(1) {
+ $23 = $24&255;
+ $25 = (_isspace($23)|0);
+ $26 = ($25|0)==(0);
+ L8: do {
+ if ($26) {
+ $53 = ($24<<24>>24)==(37);
+ L10: do {
+ if ($53) {
+ $54 = ((($$0273429)) + 1|0);
+ $55 = HEAP8[$54>>0]|0;
+ L12: do {
+ switch ($55<<24>>24) {
+ case 37: {
+ break L10;
+ break;
+ }
+ case 42: {
+ $76 = ((($$0273429)) + 2|0);
+ $$0293 = 0;$$2275 = $76;
+ break;
+ }
+ default: {
+ $77 = $55&255;
+ $isdigittmp = (($77) + -48)|0;
+ $isdigit = ($isdigittmp>>>0)<(10);
+ if ($isdigit) {
+ $78 = ((($$0273429)) + 2|0);
+ $79 = HEAP8[$78>>0]|0;
+ $80 = ($79<<24>>24)==(36);
+ if ($80) {
+ $81 = (_arg_n($2,$isdigittmp)|0);
+ $82 = ((($$0273429)) + 3|0);
+ $$0293 = $81;$$2275 = $82;
+ break L12;
+ }
+ }
+ $arglist_current = HEAP32[$2>>2]|0;
+ $83 = $arglist_current;
+ $84 = ((0) + 4|0);
+ $expanded1 = $84;
+ $expanded = (($expanded1) - 1)|0;
+ $85 = (($83) + ($expanded))|0;
+ $86 = ((0) + 4|0);
+ $expanded5 = $86;
+ $expanded4 = (($expanded5) - 1)|0;
+ $expanded3 = $expanded4 ^ -1;
+ $87 = $85 & $expanded3;
+ $88 = $87;
+ $89 = HEAP32[$88>>2]|0;
+ $arglist_next = ((($88)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next;
+ $$0293 = $89;$$2275 = $54;
+ }
+ }
+ } while(0);
+ $90 = HEAP8[$$2275>>0]|0;
+ $91 = $90&255;
+ $isdigittmp315414 = (($91) + -48)|0;
+ $isdigit316415 = ($isdigittmp315414>>>0)<(10);
+ if ($isdigit316415) {
+ $$0266417 = 0;$$3416 = $$2275;$95 = $91;
+ while(1) {
+ $92 = ($$0266417*10)|0;
+ $93 = (($92) + -48)|0;
+ $94 = (($93) + ($95))|0;
+ $96 = ((($$3416)) + 1|0);
+ $97 = HEAP8[$96>>0]|0;
+ $98 = $97&255;
+ $isdigittmp315 = (($98) + -48)|0;
+ $isdigit316 = ($isdigittmp315>>>0)<(10);
+ if ($isdigit316) {
+ $$0266417 = $94;$$3416 = $96;$95 = $98;
+ } else {
+ $$0266$lcssa = $94;$$3$lcssa = $96;$$lcssa355 = $97;
+ break;
+ }
+ }
+ } else {
+ $$0266$lcssa = 0;$$3$lcssa = $$2275;$$lcssa355 = $90;
+ }
+ $99 = ($$lcssa355<<24>>24)==(109);
+ $100 = ($$0293|0)!=(0|0);
+ $101 = ((($$3$lcssa)) + 1|0);
+ $$$0305 = $99 ? 0 : $$0305423;
+ $$327 = $99 ? 0 : $102;
+ $$$3 = $99 ? $101 : $$3$lcssa;
+ $narrow = $100 & $99;
+ $103 = ((($$$3)) + 1|0);
+ $104 = HEAP8[$$$3>>0]|0;
+ switch ($104<<24>>24) {
+ case 104: {
+ $105 = HEAP8[$103>>0]|0;
+ $106 = ($105<<24>>24)==(104);
+ $107 = ((($$$3)) + 2|0);
+ $$319 = $106 ? $107 : $103;
+ $$320 = $106 ? -2 : -1;
+ $$0268 = $$320;$$5 = $$319;
+ break;
+ }
+ case 108: {
+ $108 = HEAP8[$103>>0]|0;
+ $109 = ($108<<24>>24)==(108);
+ $110 = ((($$$3)) + 2|0);
+ $$321 = $109 ? $110 : $103;
+ $$322 = $109 ? 3 : 1;
+ $$0268 = $$322;$$5 = $$321;
+ break;
+ }
+ case 106: {
+ $$0268 = 3;$$5 = $103;
+ break;
+ }
+ case 116: case 122: {
+ $$0268 = 1;$$5 = $103;
+ break;
+ }
+ case 76: {
+ $$0268 = 2;$$5 = $103;
+ break;
+ }
+ case 110: case 112: case 67: case 83: case 91: case 99: case 115: case 88: case 71: case 70: case 69: case 65: case 103: case 102: case 101: case 97: case 120: case 117: case 111: case 105: case 100: {
+ $$0268 = 0;$$5 = $$$3;
+ break;
+ }
+ default: {
+ $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
+ label = 137;
+ break L6;
+ }
+ }
+ $111 = HEAP8[$$5>>0]|0;
+ $112 = $111&255;
+ $113 = $112 & 47;
+ $114 = ($113|0)==(3);
+ $115 = $112 | 32;
+ $$ = $114 ? $115 : $112;
+ $$$0268 = $114 ? 1 : $$0268;
+ $trunc = $$&255;
+ switch ($trunc<<24>>24) {
+ case 99: {
+ $116 = ($$0266$lcssa|0)>(1);
+ $$$0266 = $116 ? $$0266$lcssa : 1;
+ $$1267 = $$$0266;$$1284 = $$0283428;
+ break;
+ }
+ case 91: {
+ $$1267 = $$0266$lcssa;$$1284 = $$0283428;
+ break;
+ }
+ case 110: {
+ $117 = ($$0283428|0)<(0);
+ $118 = $117 << 31 >> 31;
+ _store_int($$0293,$$$0268,$$0283428,$118);
+ $$11 = $$5;$$1289 = $$0288425;$$2285 = $$0283428;$$6311 = $$$0305;$307 = $$327;
+ break L8;
+ break;
+ }
+ default: {
+ ___shlim($0,0);
+ while(1) {
+ $119 = HEAP32[$13>>2]|0;
+ $120 = HEAP32[$14>>2]|0;
+ $121 = ($119>>>0)<($120>>>0);
+ if ($121) {
+ $122 = ((($119)) + 1|0);
+ HEAP32[$13>>2] = $122;
+ $123 = HEAP8[$119>>0]|0;
+ $124 = $123&255;
+ $126 = $124;
+ } else {
+ $125 = (___shgetc($0)|0);
+ $126 = $125;
+ }
+ $127 = (_isspace($126)|0);
+ $128 = ($127|0)==(0);
+ if ($128) {
+ break;
+ }
+ }
+ $129 = HEAP32[$14>>2]|0;
+ $130 = ($129|0)==(0|0);
+ if ($130) {
+ $$pre507 = HEAP32[$13>>2]|0;
+ $138 = $$pre507;
+ } else {
+ $131 = HEAP32[$13>>2]|0;
+ $132 = ((($131)) + -1|0);
+ HEAP32[$13>>2] = $132;
+ $133 = $132;
+ $138 = $133;
+ }
+ $134 = HEAP32[$15>>2]|0;
+ $135 = HEAP32[$16>>2]|0;
+ $136 = (($134) + ($$0283428))|0;
+ $137 = (($136) + ($138))|0;
+ $139 = (($137) - ($135))|0;
+ $$1267 = $$0266$lcssa;$$1284 = $139;
+ }
+ }
+ ___shlim($0,$$1267);
+ $140 = HEAP32[$13>>2]|0;
+ $141 = HEAP32[$14>>2]|0;
+ $142 = ($140>>>0)<($141>>>0);
+ if ($142) {
+ $143 = ((($140)) + 1|0);
+ HEAP32[$13>>2] = $143;
+ $147 = $141;
+ } else {
+ $144 = (___shgetc($0)|0);
+ $145 = ($144|0)<(0);
+ if ($145) {
+ $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
+ label = 137;
+ break L6;
+ }
+ $$pre509 = HEAP32[$14>>2]|0;
+ $147 = $$pre509;
+ }
+ $146 = ($147|0)==(0|0);
+ if (!($146)) {
+ $148 = HEAP32[$13>>2]|0;
+ $149 = ((($148)) + -1|0);
+ HEAP32[$13>>2] = $149;
+ }
+ L55: do {
+ switch ($trunc<<24>>24) {
+ case 91: case 99: case 115: {
+ $150 = ($$|0)==(99);
+ $151 = $$ | 16;
+ $152 = ($151|0)==(115);
+ L57: do {
+ if ($152) {
+ $153 = ($$|0)==(115);
+ _memset(($21|0),-1,256)|0;
+ HEAP8[$4>>0] = 0;
+ if ($153) {
+ HEAP8[$18>>0] = 0;
+ ;HEAP8[$17>>0]=0|0;HEAP8[$17+1>>0]=0|0;HEAP8[$17+2>>0]=0|0;HEAP8[$17+3>>0]=0|0;HEAP8[$17+4>>0]=0|0;
+ $$9 = $$5;
+ } else {
+ $$9 = $$5;
+ }
+ } else {
+ $154 = ((($$5)) + 1|0);
+ $155 = HEAP8[$154>>0]|0;
+ $156 = ($155<<24>>24)==(94);
+ $157 = ((($$5)) + 2|0);
+ $$0292 = $156&1;
+ $$6 = $156 ? $157 : $154;
+ $158 = $156&1;
+ _memset(($22|0),($158|0),256)|0;
+ HEAP8[$4>>0] = 0;
+ $159 = HEAP8[$$6>>0]|0;
+ switch ($159<<24>>24) {
+ case 45: {
+ $$sink443 = $19;
+ label = 64;
+ break;
+ }
+ case 93: {
+ $$sink443 = $20;
+ label = 64;
+ break;
+ }
+ default: {
+ $$pre514 = $$0292 ^ 1;
+ $$pre515 = $$pre514&255;
+ $$7$ph = $$6;$$pre$phi516Z2D = $$pre515;
+ }
+ }
+ if ((label|0) == 64) {
+ label = 0;
+ $160 = ((($$6)) + 1|0);
+ $161 = $$0292 ^ 1;
+ $162 = $161&255;
+ HEAP8[$$sink443>>0] = $162;
+ $$7$ph = $160;$$pre$phi516Z2D = $162;
+ }
+ $$7 = $$7$ph;
+ while(1) {
+ $163 = HEAP8[$$7>>0]|0;
+ L69: do {
+ switch ($163<<24>>24) {
+ case 0: {
+ $$7312 = $$$0305;$309 = $$327;$narrow469 = $narrow;
+ label = 137;
+ break L6;
+ break;
+ }
+ case 93: {
+ $$9 = $$7;
+ break L57;
+ break;
+ }
+ case 45: {
+ $164 = ((($$7)) + 1|0);
+ $165 = HEAP8[$164>>0]|0;
+ switch ($165<<24>>24) {
+ case 93: case 0: {
+ $$8 = $$7;$176 = 45;
+ break L69;
+ break;
+ }
+ default: {
+ }
+ }
+ $166 = ((($$7)) + -1|0);
+ $167 = HEAP8[$166>>0]|0;
+ $168 = ($167&255)<($165&255);
+ if ($168) {
+ $169 = $167&255;
+ $$0286420 = $169;
+ while(1) {
+ $170 = (($$0286420) + 1)|0;
+ $171 = (($4) + ($170)|0);
+ HEAP8[$171>>0] = $$pre$phi516Z2D;
+ $172 = HEAP8[$164>>0]|0;
+ $173 = $172&255;
+ $174 = ($170|0)<($173|0);
+ if ($174) {
+ $$0286420 = $170;
+ } else {
+ $$8 = $164;$176 = $172;
+ break;
+ }
+ }
+ } else {
+ $$8 = $164;$176 = $165;
+ }
+ break;
+ }
+ default: {
+ $$8 = $$7;$176 = $163;
+ }
+ }
+ } while(0);
+ $175 = $176&255;
+ $177 = (($175) + 1)|0;
+ $178 = (($4) + ($177)|0);
+ HEAP8[$178>>0] = $$pre$phi516Z2D;
+ $179 = ((($$8)) + 1|0);
+ $$7 = $179;
+ }
+ }
+ } while(0);
+ $180 = (($$1267) + 1)|0;
+ $181 = $150 ? $180 : 31;
+ $182 = ($$$0268|0)==(1);
+ L77: do {
+ if ($182) {
+ if ($narrow) {
+ $183 = $181 << 2;
+ $184 = (_malloc($183)|0);
+ $185 = ($184|0)==(0|0);
+ if ($185) {
+ $$7312 = 0;$309 = 0;$narrow469 = 1;
+ label = 137;
+ break L6;
+ } else {
+ $311 = $184;
+ }
+ } else {
+ $311 = $$0293;
+ }
+ HEAP32[$3>>2] = 0;
+ HEAP32[$$sroa$2$0$$sroa_idx13>>2] = 0;
+ $$0276$ph = $181;$$0278$ph = 0;$$ph = $311;
+ L82: while(1) {
+ $186 = ($$ph|0)==(0|0);
+ $$0278$ph336 = $$0278$ph;
+ while(1) {
+ L86: while(1) {
+ $187 = HEAP32[$13>>2]|0;
+ $188 = HEAP32[$14>>2]|0;
+ $189 = ($187>>>0)<($188>>>0);
+ if ($189) {
+ $190 = ((($187)) + 1|0);
+ HEAP32[$13>>2] = $190;
+ $191 = HEAP8[$187>>0]|0;
+ $192 = $191&255;
+ $195 = $192;
+ } else {
+ $193 = (___shgetc($0)|0);
+ $195 = $193;
+ }
+ $194 = (($195) + 1)|0;
+ $196 = (($4) + ($194)|0);
+ $197 = HEAP8[$196>>0]|0;
+ $198 = ($197<<24>>24)==(0);
+ if ($198) {
+ break L82;
+ }
+ $199 = $195&255;
+ HEAP8[$6>>0] = $199;
+ $200 = (_mbrtowc($5,$6,1,$3)|0);
+ switch ($200|0) {
+ case -1: {
+ $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
+ label = 137;
+ break L6;
+ break;
+ }
+ case -2: {
+ break;
+ }
+ default: {
+ break L86;
+ }
+ }
+ }
+ if ($186) {
+ $$1279 = $$0278$ph336;
+ } else {
+ $201 = (($$ph) + ($$0278$ph336<<2)|0);
+ $202 = (($$0278$ph336) + 1)|0;
+ $203 = HEAP32[$5>>2]|0;
+ HEAP32[$201>>2] = $203;
+ $$1279 = $202;
+ }
+ $204 = ($$1279|0)==($$0276$ph|0);
+ $or$cond = $narrow & $204;
+ if ($or$cond) {
+ break;
+ } else {
+ $$0278$ph336 = $$1279;
+ }
+ }
+ $factor331 = $$0276$ph << 1;
+ $205 = $factor331 | 1;
+ $206 = $205 << 2;
+ $207 = (_realloc($$ph,$206)|0);
+ $208 = ($207|0)==(0|0);
+ if ($208) {
+ $$7312 = 0;$309 = $$ph;$narrow469 = 1;
+ label = 137;
+ break L6;
+ } else {
+ $$0278$ph$phi = $$0276$ph;$$0276$ph = $205;$$ph = $207;$$0278$ph = $$0278$ph$phi;
+ }
+ }
+ $209 = (_mbsinit($3)|0);
+ $210 = ($209|0)==(0);
+ if ($210) {
+ $$7312 = 0;$309 = $$ph;$narrow469 = $narrow;
+ label = 137;
+ break L6;
+ } else {
+ $$4282 = $$0278$ph336;$$4309 = 0;$$5299 = $$ph;$312 = $$ph;
+ }
+ } else {
+ if ($narrow) {
+ $211 = (_malloc($181)|0);
+ $212 = ($211|0)==(0|0);
+ if ($212) {
+ $$7312 = 0;$309 = 0;$narrow469 = 1;
+ label = 137;
+ break L6;
+ } else {
+ $$1277$ph = $181;$$2280$ph = 0;$$2307$ph = $211;
+ }
+ while(1) {
+ $$2280 = $$2280$ph;
+ while(1) {
+ $213 = HEAP32[$13>>2]|0;
+ $214 = HEAP32[$14>>2]|0;
+ $215 = ($213>>>0)<($214>>>0);
+ if ($215) {
+ $216 = ((($213)) + 1|0);
+ HEAP32[$13>>2] = $216;
+ $217 = HEAP8[$213>>0]|0;
+ $218 = $217&255;
+ $221 = $218;
+ } else {
+ $219 = (___shgetc($0)|0);
+ $221 = $219;
+ }
+ $220 = (($221) + 1)|0;
+ $222 = (($4) + ($220)|0);
+ $223 = HEAP8[$222>>0]|0;
+ $224 = ($223<<24>>24)==(0);
+ if ($224) {
+ $$4282 = $$2280;$$4309 = $$2307$ph;$$5299 = 0;$312 = 0;
+ break L77;
+ }
+ $225 = $221&255;
+ $226 = (($$2280) + 1)|0;
+ $227 = (($$2307$ph) + ($$2280)|0);
+ HEAP8[$227>>0] = $225;
+ $228 = ($226|0)==($$1277$ph|0);
+ if ($228) {
+ break;
+ } else {
+ $$2280 = $226;
+ }
+ }
+ $factor = $$1277$ph << 1;
+ $229 = $factor | 1;
+ $230 = (_realloc($$2307$ph,$229)|0);
+ $231 = ($230|0)==(0|0);
+ if ($231) {
+ $$7312 = $$2307$ph;$309 = 0;$narrow469 = 1;
+ label = 137;
+ break L6;
+ } else {
+ $$2280$ph$phi = $$1277$ph;$$1277$ph = $229;$$2307$ph = $230;$$2280$ph = $$2280$ph$phi;
+ }
+ }
+ }
+ $232 = ($$0293|0)==(0|0);
+ if ($232) {
+ $250 = $147;
+ while(1) {
+ $248 = HEAP32[$13>>2]|0;
+ $249 = ($248>>>0)<($250>>>0);
+ if ($249) {
+ $251 = ((($248)) + 1|0);
+ HEAP32[$13>>2] = $251;
+ $252 = HEAP8[$248>>0]|0;
+ $253 = $252&255;
+ $256 = $253;
+ } else {
+ $254 = (___shgetc($0)|0);
+ $256 = $254;
+ }
+ $255 = (($256) + 1)|0;
+ $257 = (($4) + ($255)|0);
+ $258 = HEAP8[$257>>0]|0;
+ $259 = ($258<<24>>24)==(0);
+ if ($259) {
+ $$4282 = 0;$$4309 = 0;$$5299 = 0;$312 = 0;
+ break L77;
+ }
+ $$pre512 = HEAP32[$14>>2]|0;
+ $250 = $$pre512;
+ }
+ } else {
+ $$3281 = 0;$235 = $147;
+ while(1) {
+ $233 = HEAP32[$13>>2]|0;
+ $234 = ($233>>>0)<($235>>>0);
+ if ($234) {
+ $236 = ((($233)) + 1|0);
+ HEAP32[$13>>2] = $236;
+ $237 = HEAP8[$233>>0]|0;
+ $238 = $237&255;
+ $241 = $238;
+ } else {
+ $239 = (___shgetc($0)|0);
+ $241 = $239;
+ }
+ $240 = (($241) + 1)|0;
+ $242 = (($4) + ($240)|0);
+ $243 = HEAP8[$242>>0]|0;
+ $244 = ($243<<24>>24)==(0);
+ if ($244) {
+ $$4282 = $$3281;$$4309 = $$0293;$$5299 = 0;$312 = 0;
+ break L77;
+ }
+ $245 = $241&255;
+ $246 = (($$3281) + 1)|0;
+ $247 = (($$0293) + ($$3281)|0);
+ HEAP8[$247>>0] = $245;
+ $$pre511 = HEAP32[$14>>2]|0;
+ $$3281 = $246;$235 = $$pre511;
+ }
+ }
+ }
+ } while(0);
+ $260 = HEAP32[$14>>2]|0;
+ $261 = ($260|0)==(0|0);
+ if ($261) {
+ $$pre513 = HEAP32[$13>>2]|0;
+ $268 = $$pre513;
+ } else {
+ $262 = HEAP32[$13>>2]|0;
+ $263 = ((($262)) + -1|0);
+ HEAP32[$13>>2] = $263;
+ $264 = $263;
+ $268 = $264;
+ }
+ $265 = HEAP32[$15>>2]|0;
+ $266 = HEAP32[$16>>2]|0;
+ $267 = (($268) - ($266))|0;
+ $269 = (($267) + ($265))|0;
+ $270 = ($269|0)==(0);
+ if ($270) {
+ $$9314$ph = $$4309;$$ph353 = $312;
+ label = 139;
+ break L6;
+ }
+ $$not = $150 ^ 1;
+ $271 = ($269|0)==($$1267|0);
+ $or$cond318 = $271 | $$not;
+ if (!($or$cond318)) {
+ $$9314$ph = $$4309;$$ph353 = $312;
+ label = 139;
+ break L6;
+ }
+ do {
+ if ($narrow) {
+ if ($182) {
+ HEAP32[$$0293>>2] = $$5299;
+ break;
+ } else {
+ HEAP32[$$0293>>2] = $$4309;
+ break;
+ }
+ }
+ } while(0);
+ if ($150) {
+ $$10 = $$9;$$5310 = $$4309;$310 = $312;
+ } else {
+ $272 = ($$5299|0)==(0|0);
+ if (!($272)) {
+ $273 = (($$5299) + ($$4282<<2)|0);
+ HEAP32[$273>>2] = 0;
+ }
+ $274 = ($$4309|0)==(0|0);
+ if ($274) {
+ $$10 = $$9;$$5310 = 0;$310 = $312;
+ break L55;
+ }
+ $275 = (($$4309) + ($$4282)|0);
+ HEAP8[$275>>0] = 0;
+ $$10 = $$9;$$5310 = $$4309;$310 = $312;
+ }
+ break;
+ }
+ case 120: case 88: case 112: {
+ $$0272 = 16;
+ label = 125;
+ break;
+ }
+ case 111: {
+ $$0272 = 8;
+ label = 125;
+ break;
+ }
+ case 117: case 100: {
+ $$0272 = 10;
+ label = 125;
+ break;
+ }
+ case 105: {
+ $$0272 = 0;
+ label = 125;
+ break;
+ }
+ case 71: case 103: case 70: case 102: case 69: case 101: case 65: case 97: {
+ $285 = (+___floatscan($0,$$$0268,0));
+ $286 = HEAP32[$15>>2]|0;
+ $287 = HEAP32[$13>>2]|0;
+ $288 = HEAP32[$16>>2]|0;
+ $289 = (($288) - ($287))|0;
+ $290 = ($286|0)==($289|0);
+ if ($290) {
+ $$9314$ph = $$$0305;$$ph353 = $$327;
+ label = 139;
+ break L6;
+ }
+ $291 = ($$0293|0)==(0|0);
+ if ($291) {
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ } else {
+ switch ($$$0268|0) {
+ case 0: {
+ $292 = $285;
+ HEAPF32[$$0293>>2] = $292;
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break L55;
+ break;
+ }
+ case 1: {
+ HEAPF64[$$0293>>3] = $285;
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break L55;
+ break;
+ }
+ case 2: {
+ HEAPF64[$$0293>>3] = $285;
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break L55;
+ break;
+ }
+ default: {
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break L55;
+ }
+ }
+ }
+ break;
+ }
+ default: {
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ }
+ }
+ } while(0);
+ do {
+ if ((label|0) == 125) {
+ label = 0;
+ $276 = (___intscan($0,$$0272,0,-1,-1)|0);
+ $277 = tempRet0;
+ $278 = HEAP32[$15>>2]|0;
+ $279 = HEAP32[$13>>2]|0;
+ $280 = HEAP32[$16>>2]|0;
+ $281 = (($280) - ($279))|0;
+ $282 = ($278|0)==($281|0);
+ if ($282) {
+ $$9314$ph = $$$0305;$$ph353 = $$327;
+ label = 139;
+ break L6;
+ }
+ $283 = ($$|0)==(112);
+ $or$cond3 = $100 & $283;
+ if ($or$cond3) {
+ $284 = $276;
+ HEAP32[$$0293>>2] = $284;
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break;
+ } else {
+ _store_int($$0293,$$$0268,$276,$277);
+ $$10 = $$5;$$5310 = $$$0305;$310 = $$327;
+ break;
+ }
+ }
+ } while(0);
+ $293 = HEAP32[$15>>2]|0;
+ $294 = HEAP32[$13>>2]|0;
+ $295 = HEAP32[$16>>2]|0;
+ $296 = (($293) + ($$1284))|0;
+ $297 = (($296) + ($294))|0;
+ $298 = (($297) - ($295))|0;
+ $299 = $100&1;
+ $$0288$ = (($299) + ($$0288425))|0;
+ $$11 = $$10;$$1289 = $$0288$;$$2285 = $298;$$6311 = $$5310;$307 = $310;
+ break L8;
+ }
+ } while(0);
+ $56 = $53&1;
+ $57 = (($$0273429) + ($56)|0);
+ ___shlim($0,0);
+ $58 = HEAP32[$13>>2]|0;
+ $59 = HEAP32[$14>>2]|0;
+ $60 = ($58>>>0)<($59>>>0);
+ if ($60) {
+ $61 = ((($58)) + 1|0);
+ HEAP32[$13>>2] = $61;
+ $62 = HEAP8[$58>>0]|0;
+ $63 = $62&255;
+ $68 = $63;
+ } else {
+ $64 = (___shgetc($0)|0);
+ $68 = $64;
+ }
+ $65 = HEAP8[$57>>0]|0;
+ $66 = $65&255;
+ $67 = ($68|0)==($66|0);
+ if (!($67)) {
+ label = 22;
+ break L6;
+ }
+ $75 = (($$0283428) + 1)|0;
+ $$11 = $57;$$1289 = $$0288425;$$2285 = $75;$$6311 = $$0305423;$307 = $102;
+ } else {
+ $$1274 = $$0273429;
+ while(1) {
+ $27 = ((($$1274)) + 1|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = $28&255;
+ $30 = (_isspace($29)|0);
+ $31 = ($30|0)==(0);
+ if ($31) {
+ break;
+ } else {
+ $$1274 = $27;
+ }
+ }
+ ___shlim($0,0);
+ while(1) {
+ $32 = HEAP32[$13>>2]|0;
+ $33 = HEAP32[$14>>2]|0;
+ $34 = ($32>>>0)<($33>>>0);
+ if ($34) {
+ $35 = ((($32)) + 1|0);
+ HEAP32[$13>>2] = $35;
+ $36 = HEAP8[$32>>0]|0;
+ $37 = $36&255;
+ $39 = $37;
+ } else {
+ $38 = (___shgetc($0)|0);
+ $39 = $38;
+ }
+ $40 = (_isspace($39)|0);
+ $41 = ($40|0)==(0);
+ if ($41) {
+ break;
+ }
+ }
+ $42 = HEAP32[$14>>2]|0;
+ $43 = ($42|0)==(0|0);
+ if ($43) {
+ $$pre = HEAP32[$13>>2]|0;
+ $51 = $$pre;
+ } else {
+ $44 = HEAP32[$13>>2]|0;
+ $45 = ((($44)) + -1|0);
+ HEAP32[$13>>2] = $45;
+ $46 = $45;
+ $51 = $46;
+ }
+ $47 = HEAP32[$15>>2]|0;
+ $48 = HEAP32[$16>>2]|0;
+ $49 = (($47) + ($$0283428))|0;
+ $50 = (($49) + ($51))|0;
+ $52 = (($50) - ($48))|0;
+ $$11 = $$1274;$$1289 = $$0288425;$$2285 = $52;$$6311 = $$0305423;$307 = $102;
+ }
+ } while(0);
+ $300 = ((($$11)) + 1|0);
+ $301 = HEAP8[$300>>0]|0;
+ $302 = ($301<<24>>24)==(0);
+ if ($302) {
+ $$3291 = $$1289;
+ break L4;
+ } else {
+ $$0273429 = $300;$$0283428 = $$2285;$$0288425 = $$1289;$$0305423 = $$6311;$102 = $307;$24 = $301;
+ }
+ }
+ if ((label|0) == 22) {
+ $69 = HEAP32[$14>>2]|0;
+ $70 = ($69|0)==(0|0);
+ if (!($70)) {
+ $71 = HEAP32[$13>>2]|0;
+ $72 = ((($71)) + -1|0);
+ HEAP32[$13>>2] = $72;
+ }
+ $73 = ($68|0)>(-1);
+ $74 = ($$0288425|0)!=(0);
+ $or$cond5 = $74 | $73;
+ if ($or$cond5) {
+ $$3291 = $$0288425;
+ break;
+ } else {
+ $$1271 = 0;$$8313 = $$0305423;$308 = $102;
+ label = 138;
+ }
+ }
+ else if ((label|0) == 137) {
+ $$328$le441 = $narrow469&1;
+ $$old4 = ($$0288425|0)==(0);
+ if ($$old4) {
+ $$1271 = $$328$le441;$$8313 = $$7312;$308 = $309;
+ label = 138;
+ } else {
+ $$2 = $$328$le441;$$2290 = $$0288425;$$9314 = $$7312;$304 = $309;
+ }
+ }
+ else if ((label|0) == 139) {
+ $$328$le439 = $narrow&1;
+ $$2 = $$328$le439;$$2290 = $$0288425;$$9314 = $$9314$ph;$304 = $$ph353;
+ }
+ if ((label|0) == 138) {
+ $$2 = $$1271;$$2290 = -1;$$9314 = $$8313;$304 = $308;
+ }
+ $303 = ($$2|0)==(0);
+ if ($303) {
+ $$3291 = $$2290;
+ } else {
+ _free($$9314);
+ _free($304);
+ $$3291 = $$2290;
+ }
+ }
+ } while(0);
+ $305 = ($306|0)==(0);
+ if (!($305)) {
+ ___unlockfile($0);
+ }
+ STACKTOP = sp;return ($$3291|0);
+}
+function _arg_n($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $arglist_current = 0, $arglist_next = 0, $expanded = 0, $expanded1 = 0, $expanded3 = 0, $expanded4 = 0, $expanded5 = 0, $vacopy_currentptr = 0, label = 0;
+ var sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $2 = sp;
+ $vacopy_currentptr = HEAP32[$0>>2]|0;
+ HEAP32[$2>>2] = $vacopy_currentptr;
+ $$0 = $1;
+ while(1) {
+ $3 = ($$0>>>0)>(1);
+ $arglist_current = HEAP32[$2>>2]|0;
+ $4 = $arglist_current;
+ $5 = ((0) + 4|0);
+ $expanded1 = $5;
+ $expanded = (($expanded1) - 1)|0;
+ $6 = (($4) + ($expanded))|0;
+ $7 = ((0) + 4|0);
+ $expanded5 = $7;
+ $expanded4 = (($expanded5) - 1)|0;
+ $expanded3 = $expanded4 ^ -1;
+ $8 = $6 & $expanded3;
+ $9 = $8;
+ $10 = HEAP32[$9>>2]|0;
+ $arglist_next = ((($9)) + 4|0);
+ HEAP32[$2>>2] = $arglist_next;
+ $11 = (($$0) + -1)|0;
+ if ($3) {
+ $$0 = $11;
+ } else {
+ break;
+ }
+ }
+ STACKTOP = sp;return ($10|0);
+}
+function _store_int($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $10 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = ($0|0)==(0|0);
+ L1: do {
+ if (!($4)) {
+ switch ($1|0) {
+ case -2: {
+ $5 = $2&255;
+ HEAP8[$0>>0] = $5;
+ break L1;
+ break;
+ }
+ case -1: {
+ $6 = $2&65535;
+ HEAP16[$0>>1] = $6;
+ break L1;
+ break;
+ }
+ case 0: {
+ HEAP32[$0>>2] = $2;
+ break L1;
+ break;
+ }
+ case 1: {
+ HEAP32[$0>>2] = $2;
+ break L1;
+ break;
+ }
+ case 3: {
+ $7 = $0;
+ $8 = $7;
+ HEAP32[$8>>2] = $2;
+ $9 = (($7) + 4)|0;
+ $10 = $9;
+ HEAP32[$10>>2] = $3;
+ break L1;
+ break;
+ }
+ default: {
+ break L1;
+ }
+ }
+ }
+ } while(0);
+ return;
+}
+function _mbsinit($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ $5 = 1;
+ } else {
+ $2 = HEAP32[$0>>2]|0;
+ $3 = ($2|0)==(0);
+ $5 = $3;
+ }
+ $4 = $5&1;
+ return ($4|0);
+}
+function _fseek($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = (___fseeko($0,$1,$2)|0);
+ return ($3|0);
+}
+function ___fseeko($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ((($0)) + 76|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = ($4|0)>(-1);
+ if ($5) {
+ $7 = (___lockfile($0)|0);
+ $phitmp = ($7|0)==(0);
+ $8 = (___fseeko_unlocked($0,$1,$2)|0);
+ if ($phitmp) {
+ $9 = $8;
+ } else {
+ ___unlockfile($0);
+ $9 = $8;
+ }
+ } else {
+ $6 = (___fseeko_unlocked($0,$1,$2)|0);
+ $9 = $6;
+ }
+ return ($9|0);
+}
+function ___fseeko_unlocked($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = ($2|0)==(1);
+ if ($3) {
+ $4 = ((($0)) + 8|0);
+ $5 = HEAP32[$4>>2]|0;
+ $6 = ((($0)) + 4|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = (($1) - ($5))|0;
+ $9 = (($8) + ($7))|0;
+ $$019 = $9;
+ } else {
+ $$019 = $1;
+ }
+ $10 = ((($0)) + 20|0);
+ $11 = HEAP32[$10>>2]|0;
+ $12 = ((($0)) + 28|0);
+ $13 = HEAP32[$12>>2]|0;
+ $14 = ($11>>>0)>($13>>>0);
+ if ($14) {
+ $15 = ((($0)) + 36|0);
+ $16 = HEAP32[$15>>2]|0;
+ (FUNCTION_TABLE_iiii[$16 & 15]($0,0,0)|0);
+ $17 = HEAP32[$10>>2]|0;
+ $18 = ($17|0)==(0|0);
+ if ($18) {
+ $$0 = -1;
+ } else {
+ label = 5;
+ }
+ } else {
+ label = 5;
+ }
+ if ((label|0) == 5) {
+ $19 = ((($0)) + 16|0);
+ HEAP32[$19>>2] = 0;
+ HEAP32[$12>>2] = 0;
+ HEAP32[$10>>2] = 0;
+ $20 = ((($0)) + 40|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (FUNCTION_TABLE_iiii[$21 & 15]($0,$$019,$2)|0);
+ $23 = ($22|0)<(0);
+ if ($23) {
+ $$0 = -1;
+ } else {
+ $24 = ((($0)) + 8|0);
+ HEAP32[$24>>2] = 0;
+ $25 = ((($0)) + 4|0);
+ HEAP32[$25>>2] = 0;
+ $26 = HEAP32[$0>>2]|0;
+ $27 = $26 & -17;
+ HEAP32[$0>>2] = $27;
+ $$0 = 0;
+ }
+ }
+ return ($$0|0);
+}
+function _strstr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
+ var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = ($2<<24>>24)==(0);
+ do {
+ if ($3) {
+ $$0 = $0;
+ } else {
+ $4 = $2 << 24 >> 24;
+ $5 = (_strchr($0,$4)|0);
+ $6 = ($5|0)==(0|0);
+ if ($6) {
+ $$0 = 0;
+ } else {
+ $7 = ((($1)) + 1|0);
+ $8 = HEAP8[$7>>0]|0;
+ $9 = ($8<<24>>24)==(0);
+ if ($9) {
+ $$0 = $5;
+ } else {
+ $10 = ((($5)) + 1|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = ($11<<24>>24)==(0);
+ if ($12) {
+ $$0 = 0;
+ } else {
+ $13 = ((($1)) + 2|0);
+ $14 = HEAP8[$13>>0]|0;
+ $15 = ($14<<24>>24)==(0);
+ if ($15) {
+ $16 = (_twobyte_strstr($5,$1)|0);
+ $$0 = $16;
+ break;
+ }
+ $17 = ((($5)) + 2|0);
+ $18 = HEAP8[$17>>0]|0;
+ $19 = ($18<<24>>24)==(0);
+ if ($19) {
+ $$0 = 0;
+ } else {
+ $20 = ((($1)) + 3|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(0);
+ if ($22) {
+ $23 = (_threebyte_strstr($5,$1)|0);
+ $$0 = $23;
+ break;
+ }
+ $24 = ((($5)) + 3|0);
+ $25 = HEAP8[$24>>0]|0;
+ $26 = ($25<<24>>24)==(0);
+ if ($26) {
+ $$0 = 0;
+ } else {
+ $27 = ((($1)) + 4|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = ($28<<24>>24)==(0);
+ if ($29) {
+ $30 = (_fourbyte_strstr($5,$1)|0);
+ $$0 = $30;
+ break;
+ } else {
+ $31 = (_twoway_strstr($5,$1)|0);
+ $$0 = $31;
+ break;
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _twobyte_strstr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$lcssa = 0, $$sink = 0, $$sink$in = 0, $$sink$masked = 0, $$sink17$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
+ var label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = $3 << 8;
+ $5 = ((($1)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6&255;
+ $8 = $4 | $7;
+ $9 = HEAP8[$0>>0]|0;
+ $10 = $9&255;
+ $$sink$in = $10;$$sink17$sink = $0;
+ while(1) {
+ $11 = ((($$sink17$sink)) + 1|0);
+ $12 = HEAP8[$11>>0]|0;
+ $13 = ($12<<24>>24)==(0);
+ if ($13) {
+ $$lcssa = 0;
+ break;
+ }
+ $$sink = $$sink$in << 8;
+ $14 = $12&255;
+ $$sink$masked = $$sink & 65280;
+ $15 = $14 | $$sink$masked;
+ $16 = ($15|0)==($8|0);
+ if ($16) {
+ $$lcssa = $$sink17$sink;
+ break;
+ } else {
+ $$sink$in = $15;$$sink17$sink = $11;
+ }
+ }
+ return ($$lcssa|0);
+}
+function _threebyte_strstr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$016$lcssa = 0, $$01619 = 0, $$020 = 0, $$lcssa = 0, $$not = 0, $$not17 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0;
+ var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = $3 << 24;
+ $5 = ((($1)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6&255;
+ $8 = $7 << 16;
+ $9 = $8 | $4;
+ $10 = ((($1)) + 2|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = $12 << 8;
+ $14 = $9 | $13;
+ $15 = HEAP8[$0>>0]|0;
+ $16 = $15&255;
+ $17 = $16 << 24;
+ $18 = ((($0)) + 1|0);
+ $19 = HEAP8[$18>>0]|0;
+ $20 = $19&255;
+ $21 = $20 << 16;
+ $22 = $21 | $17;
+ $23 = ((($0)) + 2|0);
+ $24 = HEAP8[$23>>0]|0;
+ $25 = $24&255;
+ $26 = $25 << 8;
+ $27 = $22 | $26;
+ $28 = ($24<<24>>24)!=(0);
+ $$not17 = $28 ^ 1;
+ $29 = ($27|0)==($14|0);
+ $or$cond18 = $29 | $$not17;
+ if ($or$cond18) {
+ $$016$lcssa = $23;$$lcssa = $28;
+ } else {
+ $$01619 = $23;$$020 = $27;
+ while(1) {
+ $30 = ((($$01619)) + 1|0);
+ $31 = HEAP8[$30>>0]|0;
+ $32 = $31&255;
+ $33 = $32 | $$020;
+ $34 = $33 << 8;
+ $35 = ($31<<24>>24)!=(0);
+ $$not = $35 ^ 1;
+ $36 = ($34|0)==($14|0);
+ $or$cond = $36 | $$not;
+ if ($or$cond) {
+ $$016$lcssa = $30;$$lcssa = $35;
+ break;
+ } else {
+ $$01619 = $30;$$020 = $34;
+ }
+ }
+ }
+ $37 = ((($$016$lcssa)) + -2|0);
+ $38 = $$lcssa ? $37 : 0;
+ return ($38|0);
+}
+function _fourbyte_strstr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$lcssa = 0, $$not = 0, $$not22 = 0, $$sink21$lcssa = 0, $$sink2124 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond23 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP8[$1>>0]|0;
+ $3 = $2&255;
+ $4 = $3 << 24;
+ $5 = ((($1)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = $6&255;
+ $8 = $7 << 16;
+ $9 = $8 | $4;
+ $10 = ((($1)) + 2|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11&255;
+ $13 = $12 << 8;
+ $14 = $9 | $13;
+ $15 = ((($1)) + 3|0);
+ $16 = HEAP8[$15>>0]|0;
+ $17 = $16&255;
+ $18 = $14 | $17;
+ $19 = HEAP8[$0>>0]|0;
+ $20 = $19&255;
+ $21 = $20 << 24;
+ $22 = ((($0)) + 1|0);
+ $23 = HEAP8[$22>>0]|0;
+ $24 = $23&255;
+ $25 = $24 << 16;
+ $26 = $25 | $21;
+ $27 = ((($0)) + 2|0);
+ $28 = HEAP8[$27>>0]|0;
+ $29 = $28&255;
+ $30 = $29 << 8;
+ $31 = $26 | $30;
+ $32 = ((($0)) + 3|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = $33&255;
+ $35 = $34 | $31;
+ $36 = ($33<<24>>24)!=(0);
+ $$not22 = $36 ^ 1;
+ $37 = ($35|0)==($18|0);
+ $or$cond23 = $37 | $$not22;
+ if ($or$cond23) {
+ $$lcssa = $36;$$sink21$lcssa = $32;
+ } else {
+ $$sink2124 = $32;$39 = $35;
+ while(1) {
+ $38 = $39 << 8;
+ $40 = ((($$sink2124)) + 1|0);
+ $41 = HEAP8[$40>>0]|0;
+ $42 = $41&255;
+ $43 = $42 | $38;
+ $44 = ($41<<24>>24)!=(0);
+ $$not = $44 ^ 1;
+ $45 = ($43|0)==($18|0);
+ $or$cond = $45 | $$not;
+ if ($or$cond) {
+ $$lcssa = $44;$$sink21$lcssa = $40;
+ break;
+ } else {
+ $$sink2124 = $40;$39 = $43;
+ }
+ }
+ }
+ $46 = ((($$sink21$lcssa)) + -3|0);
+ $47 = $$lcssa ? $46 : 0;
+ return ($47|0);
+}
+function _twoway_strstr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0166 = 0, $$0168 = 0, $$0169 = 0, $$0169$be = 0, $$0170 = 0, $$0175$ph$ph$lcssa220 = 0, $$0175$ph$ph$lcssa220323 = 0, $$0175$ph$ph256 = 0, $$0179244 = 0, $$0183$ph200$ph255 = 0, $$0183$ph200250 = 0, $$0183$ph262 = 0, $$0185$ph$lcssa = 0, $$0185$ph$lcssa322 = 0, $$0185$ph261 = 0, $$0187$lcssa320321 = 0, $$0187266 = 0, $$1176$$0175 = 0, $$1176$ph$ph$lcssa211 = 0, $$1176$ph$ph235 = 0;
+ var $$1180224 = 0, $$1184$ph196$ph234 = 0, $$1184$ph196229 = 0, $$1184$ph241 = 0, $$1186$$0185 = 0, $$1186$$0185$ = 0, $$1186$ph$lcssa = 0, $$1186$ph240 = 0, $$2181 = 0, $$2181$sink = 0, $$3 = 0, $$3173 = 0, $$3178 = 0, $$3182223 = 0, $$4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0;
+ var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0;
+ var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
+ var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
+ var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
+ var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
+ var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
+ var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond191 = 0, $cond191222 = 0, $cond265 = 0, $div = 0, $div188 = 0, $or$cond = 0, $or$cond190 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
+ $2 = sp + 1024|0;
+ $3 = sp;
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
+ $4 = HEAP8[$1>>0]|0;
+ $cond265 = ($4<<24>>24)==(0);
+ L1: do {
+ if ($cond265) {
+ $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = 0;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
+ label = 27;
+ } else {
+ $5 = $4&255;
+ $$0187266 = 0;$12 = $4;$20 = $5;
+ while(1) {
+ $8 = (($0) + ($$0187266)|0);
+ $9 = HEAP8[$8>>0]|0;
+ $10 = ($9<<24>>24)==(0);
+ if ($10) {
+ $$3 = 0;
+ break L1;
+ }
+ $11 = $12 & 31;
+ $13 = $11&255;
+ $14 = 1 << $13;
+ $div188 = ($12&255) >>> 5;
+ $15 = $div188&255;
+ $16 = (($2) + ($15<<2)|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = $17 | $14;
+ HEAP32[$16>>2] = $18;
+ $7 = (($$0187266) + 1)|0;
+ $19 = (($3) + ($20<<2)|0);
+ HEAP32[$19>>2] = $7;
+ $21 = (($1) + ($7)|0);
+ $22 = HEAP8[$21>>0]|0;
+ $23 = $22&255;
+ $cond = ($22<<24>>24)==(0);
+ if ($cond) {
+ break;
+ } else {
+ $$0187266 = $7;$12 = $22;$20 = $23;
+ }
+ }
+ $6 = ($7>>>0)>(1);
+ if ($6) {
+ $$0183$ph262 = 0;$$0185$ph261 = -1;$129 = 1;
+ L7: while(1) {
+ $$0175$ph$ph256 = 1;$$0183$ph200$ph255 = $$0183$ph262;$132 = $129;
+ while(1) {
+ $$0183$ph200250 = $$0183$ph200$ph255;$131 = $132;
+ L11: while(1) {
+ $$0179244 = 1;$31 = $131;
+ while(1) {
+ $27 = (($$0179244) + ($$0185$ph261))|0;
+ $28 = (($1) + ($27)|0);
+ $29 = HEAP8[$28>>0]|0;
+ $30 = (($1) + ($31)|0);
+ $32 = HEAP8[$30>>0]|0;
+ $33 = ($29<<24>>24)==($32<<24>>24);
+ if (!($33)) {
+ break L11;
+ }
+ $34 = ($$0179244|0)==($$0175$ph$ph256|0);
+ $25 = (($$0179244) + 1)|0;
+ if ($34) {
+ break;
+ }
+ $24 = (($25) + ($$0183$ph200250))|0;
+ $26 = ($24>>>0)<($7>>>0);
+ if ($26) {
+ $$0179244 = $25;$31 = $24;
+ } else {
+ $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
+ break L7;
+ }
+ }
+ $35 = (($$0175$ph$ph256) + ($$0183$ph200250))|0;
+ $36 = (($35) + 1)|0;
+ $37 = ($36>>>0)<($7>>>0);
+ if ($37) {
+ $$0183$ph200250 = $35;$131 = $36;
+ } else {
+ $$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
+ break L7;
+ }
+ }
+ $38 = ($29&255)>($32&255);
+ $39 = (($31) - ($$0185$ph261))|0;
+ if (!($38)) {
+ break;
+ }
+ $43 = (($31) + 1)|0;
+ $44 = ($43>>>0)<($7>>>0);
+ if ($44) {
+ $$0175$ph$ph256 = $39;$$0183$ph200$ph255 = $31;$132 = $43;
+ } else {
+ $$0175$ph$ph$lcssa220 = $39;$$0185$ph$lcssa = $$0185$ph261;
+ break L7;
+ }
+ }
+ $40 = (($$0183$ph200250) + 1)|0;
+ $41 = (($$0183$ph200250) + 2)|0;
+ $42 = ($41>>>0)<($7>>>0);
+ if ($42) {
+ $$0183$ph262 = $40;$$0185$ph261 = $$0183$ph200250;$129 = $41;
+ } else {
+ $$0175$ph$ph$lcssa220 = 1;$$0185$ph$lcssa = $$0183$ph200250;
+ break;
+ }
+ }
+ if ($6) {
+ $$1184$ph241 = 0;$$1186$ph240 = -1;$130 = 1;
+ while(1) {
+ $$1176$ph$ph235 = 1;$$1184$ph196$ph234 = $$1184$ph241;$134 = $130;
+ while(1) {
+ $$1184$ph196229 = $$1184$ph196$ph234;$133 = $134;
+ L26: while(1) {
+ $$1180224 = 1;$52 = $133;
+ while(1) {
+ $48 = (($$1180224) + ($$1186$ph240))|0;
+ $49 = (($1) + ($48)|0);
+ $50 = HEAP8[$49>>0]|0;
+ $51 = (($1) + ($52)|0);
+ $53 = HEAP8[$51>>0]|0;
+ $54 = ($50<<24>>24)==($53<<24>>24);
+ if (!($54)) {
+ break L26;
+ }
+ $55 = ($$1180224|0)==($$1176$ph$ph235|0);
+ $46 = (($$1180224) + 1)|0;
+ if ($55) {
+ break;
+ }
+ $45 = (($46) + ($$1184$ph196229))|0;
+ $47 = ($45>>>0)<($7>>>0);
+ if ($47) {
+ $$1180224 = $46;$52 = $45;
+ } else {
+ $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
+ label = 27;
+ break L1;
+ }
+ }
+ $56 = (($$1176$ph$ph235) + ($$1184$ph196229))|0;
+ $57 = (($56) + 1)|0;
+ $58 = ($57>>>0)<($7>>>0);
+ if ($58) {
+ $$1184$ph196229 = $56;$133 = $57;
+ } else {
+ $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
+ label = 27;
+ break L1;
+ }
+ }
+ $59 = ($50&255)<($53&255);
+ $60 = (($52) - ($$1186$ph240))|0;
+ if (!($59)) {
+ break;
+ }
+ $64 = (($52) + 1)|0;
+ $65 = ($64>>>0)<($7>>>0);
+ if ($65) {
+ $$1176$ph$ph235 = $60;$$1184$ph196$ph234 = $52;$134 = $64;
+ } else {
+ $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $60;$$1186$ph$lcssa = $$1186$ph240;
+ label = 27;
+ break L1;
+ }
+ }
+ $61 = (($$1184$ph196229) + 1)|0;
+ $62 = (($$1184$ph196229) + 2)|0;
+ $63 = ($62>>>0)<($7>>>0);
+ if ($63) {
+ $$1184$ph241 = $61;$$1186$ph240 = $$1184$ph196229;$130 = $62;
+ } else {
+ $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = $$1184$ph196229;
+ label = 27;
+ break;
+ }
+ }
+ } else {
+ $$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
+ label = 27;
+ }
+ } else {
+ $$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
+ label = 27;
+ }
+ }
+ } while(0);
+ L36: do {
+ if ((label|0) == 27) {
+ $66 = (($$1186$ph$lcssa) + 1)|0;
+ $67 = (($$0185$ph$lcssa322) + 1)|0;
+ $68 = ($66>>>0)>($67>>>0);
+ $$1176$$0175 = $68 ? $$1176$ph$ph$lcssa211 : $$0175$ph$ph$lcssa220323;
+ $$1186$$0185 = $68 ? $$1186$ph$lcssa : $$0185$ph$lcssa322;
+ $69 = (($1) + ($$1176$$0175)|0);
+ $70 = (($$1186$$0185) + 1)|0;
+ $71 = (_memcmp($1,$69,$70)|0);
+ $72 = ($71|0)==(0);
+ if ($72) {
+ $77 = (($$0187$lcssa320321) - ($$1176$$0175))|0;
+ $$0168 = $77;$$3178 = $$1176$$0175;
+ } else {
+ $73 = (($$0187$lcssa320321) - ($$1186$$0185))|0;
+ $74 = (($73) + -1)|0;
+ $75 = ($$1186$$0185>>>0)>($74>>>0);
+ $$1186$$0185$ = $75 ? $$1186$$0185 : $74;
+ $76 = (($$1186$$0185$) + 1)|0;
+ $$0168 = 0;$$3178 = $76;
+ }
+ $78 = $$0187$lcssa320321 | 63;
+ $79 = (($$0187$lcssa320321) + -1)|0;
+ $80 = ($$0168|0)!=(0);
+ $81 = (($$0187$lcssa320321) - ($$3178))|0;
+ $$0166 = $0;$$0169 = 0;$$0170 = $0;
+ while(1) {
+ $82 = $$0170;
+ $83 = $$0166;
+ $84 = (($82) - ($83))|0;
+ $85 = ($84>>>0)<($$0187$lcssa320321>>>0);
+ do {
+ if ($85) {
+ $86 = (_memchr($$0170,0,$78)|0);
+ $87 = ($86|0)==(0|0);
+ if ($87) {
+ $91 = (($$0170) + ($78)|0);
+ $$3173 = $91;
+ break;
+ } else {
+ $88 = $86;
+ $89 = (($88) - ($83))|0;
+ $90 = ($89>>>0)<($$0187$lcssa320321>>>0);
+ if ($90) {
+ $$3 = 0;
+ break L36;
+ } else {
+ $$3173 = $86;
+ break;
+ }
+ }
+ } else {
+ $$3173 = $$0170;
+ }
+ } while(0);
+ $92 = (($$0166) + ($79)|0);
+ $93 = HEAP8[$92>>0]|0;
+ $div = ($93&255) >>> 5;
+ $94 = $div&255;
+ $95 = (($2) + ($94<<2)|0);
+ $96 = HEAP32[$95>>2]|0;
+ $97 = $93 & 31;
+ $98 = $97&255;
+ $99 = 1 << $98;
+ $100 = $99 & $96;
+ $101 = ($100|0)==(0);
+ L50: do {
+ if ($101) {
+ $$0169$be = 0;$$2181$sink = $$0187$lcssa320321;
+ } else {
+ $102 = $93&255;
+ $103 = (($3) + ($102<<2)|0);
+ $104 = HEAP32[$103>>2]|0;
+ $105 = (($$0187$lcssa320321) - ($104))|0;
+ $106 = ($105|0)==(0);
+ if (!($106)) {
+ $107 = ($$0169|0)!=(0);
+ $or$cond = $80 & $107;
+ $108 = ($105>>>0)<($$3178>>>0);
+ $or$cond190 = $or$cond & $108;
+ $$2181 = $or$cond190 ? $81 : $105;
+ $$0169$be = 0;$$2181$sink = $$2181;
+ break;
+ }
+ $110 = ($70>>>0)>($$0169>>>0);
+ $111 = $110 ? $70 : $$0169;
+ $112 = (($1) + ($111)|0);
+ $113 = HEAP8[$112>>0]|0;
+ $cond191222 = ($113<<24>>24)==(0);
+ L55: do {
+ if ($cond191222) {
+ $$4 = $70;
+ } else {
+ $$3182223 = $111;$117 = $113;
+ while(1) {
+ $114 = (($$0166) + ($$3182223)|0);
+ $115 = HEAP8[$114>>0]|0;
+ $116 = ($117<<24>>24)==($115<<24>>24);
+ if (!($116)) {
+ break;
+ }
+ $118 = (($$3182223) + 1)|0;
+ $119 = (($1) + ($118)|0);
+ $120 = HEAP8[$119>>0]|0;
+ $cond191 = ($120<<24>>24)==(0);
+ if ($cond191) {
+ $$4 = $70;
+ break L55;
+ } else {
+ $$3182223 = $118;$117 = $120;
+ }
+ }
+ $121 = (($$3182223) - ($$1186$$0185))|0;
+ $$0169$be = 0;$$2181$sink = $121;
+ break L50;
+ }
+ } while(0);
+ while(1) {
+ $122 = ($$4>>>0)>($$0169>>>0);
+ if (!($122)) {
+ $$3 = $$0166;
+ break L36;
+ }
+ $123 = (($$4) + -1)|0;
+ $124 = (($1) + ($123)|0);
+ $125 = HEAP8[$124>>0]|0;
+ $126 = (($$0166) + ($123)|0);
+ $127 = HEAP8[$126>>0]|0;
+ $128 = ($125<<24>>24)==($127<<24>>24);
+ if ($128) {
+ $$4 = $123;
+ } else {
+ $$0169$be = $$0168;$$2181$sink = $$3178;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $109 = (($$0166) + ($$2181$sink)|0);
+ $$0166 = $109;$$0169 = $$0169$be;$$0170 = $$3173;
+ }
+ }
+ } while(0);
+ STACKTOP = sp;return ($$3|0);
+}
+function _strrchr($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_strlen($0)|0);
+ $3 = (($2) + 1)|0;
+ $4 = (___memrchr($0,$1,$3)|0);
+ return ($4|0);
+}
+function ___memrchr($0,$1,$2) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ var $$0 = 0, $$09 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $3 = $1&255;
+ $$09 = $2;
+ while(1) {
+ $4 = (($$09) + -1)|0;
+ $5 = ($$09|0)==(0);
+ if ($5) {
+ $$0 = 0;
+ break;
+ }
+ $6 = (($0) + ($4)|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = ($7<<24>>24)==($3<<24>>24);
+ if ($8) {
+ $$0 = $6;
+ break;
+ } else {
+ $$09 = $4;
+ }
+ }
+ return ($$0|0);
+}
+function _strspn($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$01925 = 0, $$020 = 0, $$1$lcssa = 0, $$123 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
+ var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0, $div21 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $2 = sp;
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
+ $3 = HEAP8[$1>>0]|0;
+ $4 = ($3<<24>>24)==(0);
+ do {
+ if ($4) {
+ $$0 = 0;
+ } else {
+ $5 = ((($1)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(0);
+ if ($7) {
+ $$020 = $0;
+ while(1) {
+ $8 = HEAP8[$$020>>0]|0;
+ $9 = ($8<<24>>24)==($3<<24>>24);
+ $10 = ((($$020)) + 1|0);
+ if ($9) {
+ $$020 = $10;
+ } else {
+ break;
+ }
+ }
+ $11 = $$020;
+ $12 = $0;
+ $13 = (($11) - ($12))|0;
+ $$0 = $13;
+ break;
+ } else {
+ $$01925 = $1;$17 = $3;
+ }
+ while(1) {
+ $16 = $17 & 31;
+ $18 = $16&255;
+ $19 = 1 << $18;
+ $div21 = ($17&255) >>> 5;
+ $20 = $div21&255;
+ $21 = (($2) + ($20<<2)|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = $22 | $19;
+ HEAP32[$21>>2] = $23;
+ $24 = ((($$01925)) + 1|0);
+ $25 = HEAP8[$24>>0]|0;
+ $26 = ($25<<24>>24)==(0);
+ if ($26) {
+ break;
+ } else {
+ $$01925 = $24;$17 = $25;
+ }
+ }
+ $14 = HEAP8[$0>>0]|0;
+ $15 = ($14<<24>>24)==(0);
+ L10: do {
+ if ($15) {
+ $$1$lcssa = $0;
+ } else {
+ $$123 = $0;$27 = $14;
+ while(1) {
+ $div = ($27&255) >>> 5;
+ $28 = $div&255;
+ $29 = (($2) + ($28<<2)|0);
+ $30 = HEAP32[$29>>2]|0;
+ $31 = $27 & 31;
+ $32 = $31&255;
+ $33 = 1 << $32;
+ $34 = $30 & $33;
+ $35 = ($34|0)==(0);
+ if ($35) {
+ $$1$lcssa = $$123;
+ break L10;
+ }
+ $36 = ((($$123)) + 1|0);
+ $37 = HEAP8[$36>>0]|0;
+ $38 = ($37<<24>>24)==(0);
+ if ($38) {
+ $$1$lcssa = $36;
+ break;
+ } else {
+ $$123 = $36;$27 = $37;
+ }
+ }
+ }
+ } while(0);
+ $39 = $$1$lcssa;
+ $40 = $0;
+ $41 = (($39) - ($40))|0;
+ $$0 = $41;
+ }
+ } while(0);
+ STACKTOP = sp;return ($$0|0);
+}
+function _srand($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (($0) + -1)|0;
+ $2 = 19584;
+ $3 = $2;
+ HEAP32[$3>>2] = $1;
+ $4 = (($2) + 4)|0;
+ $5 = $4;
+ HEAP32[$5>>2] = 0;
+ return;
+}
+function ___ftello($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $5 = (___lockfile($0)|0);
+ $phitmp = ($5|0)==(0);
+ $6 = (___ftello_unlocked($0)|0);
+ if ($phitmp) {
+ $7 = $6;
+ } else {
+ ___unlockfile($0);
+ $7 = $6;
+ }
+ } else {
+ $4 = (___ftello_unlocked($0)|0);
+ $7 = $4;
+ }
+ return ($7|0);
+}
+function ___ftello_unlocked($0) {
+ $0 = $0|0;
+ var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0;
+ var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 40|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = HEAP32[$0>>2]|0;
+ $4 = $3 & 128;
+ $5 = ($4|0)==(0);
+ if ($5) {
+ $11 = 1;
+ } else {
+ $6 = ((($0)) + 20|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ((($0)) + 28|0);
+ $9 = HEAP32[$8>>2]|0;
+ $10 = ($7>>>0)>($9>>>0);
+ $phitmp = $10 ? 2 : 1;
+ $11 = $phitmp;
+ }
+ $12 = (FUNCTION_TABLE_iiii[$2 & 15]($0,0,$11)|0);
+ $13 = ($12|0)<(0);
+ if ($13) {
+ $$0 = $12;
+ } else {
+ $14 = ((($0)) + 8|0);
+ $15 = HEAP32[$14>>2]|0;
+ $16 = ((($0)) + 4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($0)) + 20|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = ((($0)) + 28|0);
+ $21 = HEAP32[$20>>2]|0;
+ $22 = (($12) - ($15))|0;
+ $23 = (($22) + ($17))|0;
+ $24 = (($23) + ($19))|0;
+ $25 = (($24) - ($21))|0;
+ $$0 = $25;
+ }
+ return ($$0|0);
+}
+function _fread($0,$1,$2,$3) {
+ $0 = $0|0;
+ $1 = $1|0;
+ $2 = $2|0;
+ $3 = $3|0;
+ var $$ = 0, $$0 = 0, $$054$ph = 0, $$05460 = 0, $$056$ph = 0, $$05659 = 0, $$57 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
+ var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $4 = Math_imul($2, $1)|0;
+ $5 = ($1|0)==(0);
+ $$ = $5 ? 0 : $2;
+ $6 = ((($3)) + 76|0);
+ $7 = HEAP32[$6>>2]|0;
+ $8 = ($7|0)>(-1);
+ if ($8) {
+ $9 = (___lockfile($3)|0);
+ $36 = $9;
+ } else {
+ $36 = 0;
+ }
+ $10 = ((($3)) + 74|0);
+ $11 = HEAP8[$10>>0]|0;
+ $12 = $11 << 24 >> 24;
+ $13 = (($12) + 255)|0;
+ $14 = $13 | $12;
+ $15 = $14&255;
+ HEAP8[$10>>0] = $15;
+ $16 = ((($3)) + 8|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = ((($3)) + 4|0);
+ $19 = HEAP32[$18>>2]|0;
+ $20 = $19;
+ $21 = (($17) - ($20))|0;
+ $22 = ($21|0)>(0);
+ $23 = ($21>>>0)<($4>>>0);
+ $$57 = $23 ? $21 : $4;
+ if ($22) {
+ $24 = (($4) - ($$57))|0;
+ $25 = (($0) + ($$57)|0);
+ _memcpy(($0|0),($19|0),($$57|0))|0;
+ $26 = (($19) + ($$57)|0);
+ HEAP32[$18>>2] = $26;
+ $$054$ph = $24;$$056$ph = $25;
+ } else {
+ $$054$ph = $4;$$056$ph = $0;
+ }
+ $27 = ($$054$ph|0)==(0);
+ L7: do {
+ if ($27) {
+ label = 13;
+ } else {
+ $28 = ((($3)) + 32|0);
+ $$05460 = $$054$ph;$$05659 = $$056$ph;
+ while(1) {
+ $29 = (___toread($3)|0);
+ $30 = ($29|0)==(0);
+ if (!($30)) {
+ break;
+ }
+ $31 = HEAP32[$28>>2]|0;
+ $32 = (FUNCTION_TABLE_iiii[$31 & 15]($3,$$05659,$$05460)|0);
+ $33 = (($32) + 1)|0;
+ $34 = ($33>>>0)<(2);
+ if ($34) {
+ break;
+ }
+ $39 = (($$05460) - ($32))|0;
+ $40 = (($$05659) + ($32)|0);
+ $41 = ($39|0)==(0);
+ if ($41) {
+ label = 13;
+ break L7;
+ } else {
+ $$05460 = $39;$$05659 = $40;
+ }
+ }
+ $35 = ($36|0)==(0);
+ if (!($35)) {
+ ___unlockfile($3);
+ }
+ $37 = (($4) - ($$05460))|0;
+ $38 = (($37>>>0) / ($1>>>0))&-1;
+ $$0 = $38;
+ }
+ } while(0);
+ if ((label|0) == 13) {
+ $42 = ($36|0)==(0);
+ if ($42) {
+ $$0 = $$;
+ } else {
+ ___unlockfile($3);
+ $$0 = $$;
+ }
+ }
+ return ($$0|0);
+}
+function _ftell($0) {
+ $0 = $0|0;
+ var $1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = (___ftello($0)|0);
+ return ($1|0);
+}
+function _rewind($0) {
+ $0 = $0|0;
+ var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $phitmp = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ((($0)) + 76|0);
+ $2 = HEAP32[$1>>2]|0;
+ $3 = ($2|0)>(-1);
+ if ($3) {
+ $4 = (___lockfile($0)|0);
+ $phitmp = ($4|0)==(0);
+ (___fseeko_unlocked($0,0,0)|0);
+ $5 = HEAP32[$0>>2]|0;
+ $6 = $5 & -33;
+ HEAP32[$0>>2] = $6;
+ if (!($phitmp)) {
+ ___unlockfile($0);
+ }
+ } else {
+ (___fseeko_unlocked($0,0,0)|0);
+ $7 = HEAP32[$0>>2]|0;
+ $8 = $7 & -33;
+ HEAP32[$0>>2] = $8;
+ }
+ return;
+}
+function _vprintf($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = HEAP32[1054]|0;
+ $3 = (_vfprintf($2,$0,$1)|0);
+ return ($3|0);
+}
+function _strcspn($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$01824 = 0, $$019$sink = 0, $$01922 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
+ var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0;
+ var $div20 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
+ $2 = sp;
+ $3 = HEAP8[$1>>0]|0;
+ $4 = ($3<<24>>24)==(0);
+ L1: do {
+ if ($4) {
+ label = 3;
+ } else {
+ $5 = ((($1)) + 1|0);
+ $6 = HEAP8[$5>>0]|0;
+ $7 = ($6<<24>>24)==(0);
+ if ($7) {
+ label = 3;
+ } else {
+ ;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
+ $$01824 = $1;$13 = $3;
+ while(1) {
+ $12 = $13 & 31;
+ $14 = $12&255;
+ $15 = 1 << $14;
+ $div20 = ($13&255) >>> 5;
+ $16 = $div20&255;
+ $17 = (($2) + ($16<<2)|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = $18 | $15;
+ HEAP32[$17>>2] = $19;
+ $20 = ((($$01824)) + 1|0);
+ $21 = HEAP8[$20>>0]|0;
+ $22 = ($21<<24>>24)==(0);
+ if ($22) {
+ break;
+ } else {
+ $$01824 = $20;$13 = $21;
+ }
+ }
+ $10 = HEAP8[$0>>0]|0;
+ $11 = ($10<<24>>24)==(0);
+ if ($11) {
+ $$019$sink = $0;
+ } else {
+ $$01922 = $0;$23 = $10;
+ while(1) {
+ $div = ($23&255) >>> 5;
+ $24 = $div&255;
+ $25 = (($2) + ($24<<2)|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = $23 & 31;
+ $28 = $27&255;
+ $29 = 1 << $28;
+ $30 = $26 & $29;
+ $31 = ($30|0)==(0);
+ if (!($31)) {
+ $$019$sink = $$01922;
+ break L1;
+ }
+ $32 = ((($$01922)) + 1|0);
+ $33 = HEAP8[$32>>0]|0;
+ $34 = ($33<<24>>24)==(0);
+ if ($34) {
+ $$019$sink = $32;
+ break;
+ } else {
+ $$01922 = $32;$23 = $33;
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 3) {
+ $8 = $3 << 24 >> 24;
+ $9 = (___strchrnul($0,$8)|0);
+ $$019$sink = $9;
+ }
+ $35 = $$019$sink;
+ $36 = $0;
+ $37 = (($35) - ($36))|0;
+ STACKTOP = sp;return ($37|0);
+}
+function _strcat($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $2 = 0, $3 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (_strlen($0)|0);
+ $3 = (($0) + ($2)|0);
+ (_strcpy($3,$1)|0);
+ return ($0|0);
+}
+function _strtok($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0 = 0, $$010 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($0|0)==(0|0);
+ if ($2) {
+ $3 = HEAP32[5753]|0;
+ $4 = ($3|0)==(0|0);
+ if ($4) {
+ $$0 = 0;
+ } else {
+ $$010 = $3;
+ label = 3;
+ }
+ } else {
+ $$010 = $0;
+ label = 3;
+ }
+ do {
+ if ((label|0) == 3) {
+ $5 = (_strspn($$010,$1)|0);
+ $6 = (($$010) + ($5)|0);
+ $7 = HEAP8[$6>>0]|0;
+ $8 = ($7<<24>>24)==(0);
+ if ($8) {
+ HEAP32[5753] = 0;
+ $$0 = 0;
+ break;
+ }
+ $9 = (_strcspn($6,$1)|0);
+ $10 = (($6) + ($9)|0);
+ HEAP32[5753] = $10;
+ $11 = HEAP8[$10>>0]|0;
+ $12 = ($11<<24>>24)==(0);
+ if ($12) {
+ HEAP32[5753] = 0;
+ $$0 = $6;
+ break;
+ } else {
+ $13 = ((($10)) + 1|0);
+ HEAP32[5753] = $13;
+ HEAP8[$10>>0] = 0;
+ $$0 = $6;
+ break;
+ }
+ }
+ } while(0);
+ return ($$0|0);
+}
+function _malloc($0) {
+ $0 = $0|0;
+ var $$$0192$i = 0, $$$0193$i = 0, $$$4236$i = 0, $$$4351$i = 0, $$$i = 0, $$0 = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i18$i = 0, $$01$i$i = 0, $$0189$i = 0, $$0192$lcssa$i = 0, $$01928$i = 0, $$0193$lcssa$i = 0, $$01937$i = 0, $$0197 = 0, $$0199 = 0, $$0206$i$i = 0, $$0207$i$i = 0, $$0211$i$i = 0;
+ var $$0212$i$i = 0, $$024371$i = 0, $$0287$i$i = 0, $$0288$i$i = 0, $$0289$i$i = 0, $$0295$i$i = 0, $$0296$i$i = 0, $$0342$i = 0, $$0344$i = 0, $$0345$i = 0, $$0347$i = 0, $$0353$i = 0, $$0358$i = 0, $$0359$$i = 0, $$0359$i = 0, $$0361$i = 0, $$0362$i = 0, $$0368$i = 0, $$1196$i = 0, $$1198$i = 0;
+ var $$124470$i = 0, $$1291$i$i = 0, $$1293$i$i = 0, $$1343$i = 0, $$1348$i = 0, $$1363$i = 0, $$1370$i = 0, $$1374$i = 0, $$2234253237$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2355$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i201 = 0, $$3350$i = 0, $$3372$i = 0, $$4$lcssa$i = 0, $$4$ph$i = 0, $$415$i = 0;
+ var $$4236$i = 0, $$4351$lcssa$i = 0, $$435114$i = 0, $$4357$$4$i = 0, $$4357$ph$i = 0, $$435713$i = 0, $$723948$i = 0, $$749$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i19$i = 0, $$pre$i210 = 0, $$pre$i212 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i20$iZ2D = 0, $$pre$phi$i211Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi11$i$iZ2D = 0, $$pre$phiZ2D = 0;
+ var $$pre10$i$i = 0, $$sink1$i = 0, $$sink1$i$i = 0, $$sink16$i = 0, $$sink2$i = 0, $$sink2$i204 = 0, $$sink3$i = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0, $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0;
+ var $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0, $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0;
+ var $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0, $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0;
+ var $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
+ var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
+ var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
+ var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
+ var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0;
+ var $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0;
+ var $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0;
+ var $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0;
+ var $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0;
+ var $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0;
+ var $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0;
+ var $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0;
+ var $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0;
+ var $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0;
+ var $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0;
+ var $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0;
+ var $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0;
+ var $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0, $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0;
+ var $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0, $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0;
+ var $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0, $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0;
+ var $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0, $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0;
+ var $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0, $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0;
+ var $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0, $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0;
+ var $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0, $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0;
+ var $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0, $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0;
+ var $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0, $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0;
+ var $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0, $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0;
+ var $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0, $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0;
+ var $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0, $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0;
+ var $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0, $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0;
+ var $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0, $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0;
+ var $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0, $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0;
+ var $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0, $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0;
+ var $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0, $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0;
+ var $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0, $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0;
+ var $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0, $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0;
+ var $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0, $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0;
+ var $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0, $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0;
+ var $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0, $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0;
+ var $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0, $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0;
+ var $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0, $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0;
+ var $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0, $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0;
+ var $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0, $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0;
+ var $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0, $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0;
+ var $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0, $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0;
+ var $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0, $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0;
+ var $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0, $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0;
+ var $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0, $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0;
+ var $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0, $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0;
+ var $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0, $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0;
+ var $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $cond$i = 0, $cond$i$i = 0, $cond$i208 = 0, $exitcond$i$i = 0, $not$$i = 0, $not$$i$i = 0, $not$$i17$i = 0, $not$$i209 = 0, $not$$i216 = 0, $not$1$i = 0, $not$1$i203 = 0, $not$5$i = 0, $not$7$i$i = 0, $not$8$i = 0, $not$9$i = 0;
+ var $or$cond$i = 0, $or$cond$i214 = 0, $or$cond1$i = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond11$not$i = 0, $or$cond12$i = 0, $or$cond2$i = 0, $or$cond2$i215 = 0, $or$cond5$i = 0, $or$cond50$i = 0, $or$cond51$i = 0, $or$cond7$i = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
+ $1 = sp;
+ $2 = ($0>>>0)<(245);
+ do {
+ if ($2) {
+ $3 = ($0>>>0)<(11);
+ $4 = (($0) + 11)|0;
+ $5 = $4 & -8;
+ $6 = $3 ? 16 : $5;
+ $7 = $6 >>> 3;
+ $8 = HEAP32[5754]|0;
+ $9 = $8 >>> $7;
+ $10 = $9 & 3;
+ $11 = ($10|0)==(0);
+ if (!($11)) {
+ $12 = $9 & 1;
+ $13 = $12 ^ 1;
+ $14 = (($13) + ($7))|0;
+ $15 = $14 << 1;
+ $16 = (23056 + ($15<<2)|0);
+ $17 = ((($16)) + 8|0);
+ $18 = HEAP32[$17>>2]|0;
+ $19 = ((($18)) + 8|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ($16|0)==($20|0);
+ do {
+ if ($21) {
+ $22 = 1 << $14;
+ $23 = $22 ^ -1;
+ $24 = $8 & $23;
+ HEAP32[5754] = $24;
+ } else {
+ $25 = HEAP32[(23032)>>2]|0;
+ $26 = ($20>>>0)<($25>>>0);
+ if ($26) {
+ _abort();
+ // unreachable;
+ }
+ $27 = ((($20)) + 12|0);
+ $28 = HEAP32[$27>>2]|0;
+ $29 = ($28|0)==($18|0);
+ if ($29) {
+ HEAP32[$27>>2] = $16;
+ HEAP32[$17>>2] = $20;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $30 = $14 << 3;
+ $31 = $30 | 3;
+ $32 = ((($18)) + 4|0);
+ HEAP32[$32>>2] = $31;
+ $33 = (($18) + ($30)|0);
+ $34 = ((($33)) + 4|0);
+ $35 = HEAP32[$34>>2]|0;
+ $36 = $35 | 1;
+ HEAP32[$34>>2] = $36;
+ $$0 = $19;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $37 = HEAP32[(23024)>>2]|0;
+ $38 = ($6>>>0)>($37>>>0);
+ if ($38) {
+ $39 = ($9|0)==(0);
+ if (!($39)) {
+ $40 = $9 << $7;
+ $41 = 2 << $7;
+ $42 = (0 - ($41))|0;
+ $43 = $41 | $42;
+ $44 = $40 & $43;
+ $45 = (0 - ($44))|0;
+ $46 = $44 & $45;
+ $47 = (($46) + -1)|0;
+ $48 = $47 >>> 12;
+ $49 = $48 & 16;
+ $50 = $47 >>> $49;
+ $51 = $50 >>> 5;
+ $52 = $51 & 8;
+ $53 = $52 | $49;
+ $54 = $50 >>> $52;
+ $55 = $54 >>> 2;
+ $56 = $55 & 4;
+ $57 = $53 | $56;
+ $58 = $54 >>> $56;
+ $59 = $58 >>> 1;
+ $60 = $59 & 2;
+ $61 = $57 | $60;
+ $62 = $58 >>> $60;
+ $63 = $62 >>> 1;
+ $64 = $63 & 1;
+ $65 = $61 | $64;
+ $66 = $62 >>> $64;
+ $67 = (($65) + ($66))|0;
+ $68 = $67 << 1;
+ $69 = (23056 + ($68<<2)|0);
+ $70 = ((($69)) + 8|0);
+ $71 = HEAP32[$70>>2]|0;
+ $72 = ((($71)) + 8|0);
+ $73 = HEAP32[$72>>2]|0;
+ $74 = ($69|0)==($73|0);
+ do {
+ if ($74) {
+ $75 = 1 << $67;
+ $76 = $75 ^ -1;
+ $77 = $8 & $76;
+ HEAP32[5754] = $77;
+ $98 = $77;
+ } else {
+ $78 = HEAP32[(23032)>>2]|0;
+ $79 = ($73>>>0)<($78>>>0);
+ if ($79) {
+ _abort();
+ // unreachable;
+ }
+ $80 = ((($73)) + 12|0);
+ $81 = HEAP32[$80>>2]|0;
+ $82 = ($81|0)==($71|0);
+ if ($82) {
+ HEAP32[$80>>2] = $69;
+ HEAP32[$70>>2] = $73;
+ $98 = $8;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $83 = $67 << 3;
+ $84 = (($83) - ($6))|0;
+ $85 = $6 | 3;
+ $86 = ((($71)) + 4|0);
+ HEAP32[$86>>2] = $85;
+ $87 = (($71) + ($6)|0);
+ $88 = $84 | 1;
+ $89 = ((($87)) + 4|0);
+ HEAP32[$89>>2] = $88;
+ $90 = (($87) + ($84)|0);
+ HEAP32[$90>>2] = $84;
+ $91 = ($37|0)==(0);
+ if (!($91)) {
+ $92 = HEAP32[(23036)>>2]|0;
+ $93 = $37 >>> 3;
+ $94 = $93 << 1;
+ $95 = (23056 + ($94<<2)|0);
+ $96 = 1 << $93;
+ $97 = $98 & $96;
+ $99 = ($97|0)==(0);
+ if ($99) {
+ $100 = $98 | $96;
+ HEAP32[5754] = $100;
+ $$pre = ((($95)) + 8|0);
+ $$0199 = $95;$$pre$phiZ2D = $$pre;
+ } else {
+ $101 = ((($95)) + 8|0);
+ $102 = HEAP32[$101>>2]|0;
+ $103 = HEAP32[(23032)>>2]|0;
+ $104 = ($102>>>0)<($103>>>0);
+ if ($104) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0199 = $102;$$pre$phiZ2D = $101;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $92;
+ $105 = ((($$0199)) + 12|0);
+ HEAP32[$105>>2] = $92;
+ $106 = ((($92)) + 8|0);
+ HEAP32[$106>>2] = $$0199;
+ $107 = ((($92)) + 12|0);
+ HEAP32[$107>>2] = $95;
+ }
+ HEAP32[(23024)>>2] = $84;
+ HEAP32[(23036)>>2] = $87;
+ $$0 = $72;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $108 = HEAP32[(23020)>>2]|0;
+ $109 = ($108|0)==(0);
+ if ($109) {
+ $$0197 = $6;
+ } else {
+ $110 = (0 - ($108))|0;
+ $111 = $108 & $110;
+ $112 = (($111) + -1)|0;
+ $113 = $112 >>> 12;
+ $114 = $113 & 16;
+ $115 = $112 >>> $114;
+ $116 = $115 >>> 5;
+ $117 = $116 & 8;
+ $118 = $117 | $114;
+ $119 = $115 >>> $117;
+ $120 = $119 >>> 2;
+ $121 = $120 & 4;
+ $122 = $118 | $121;
+ $123 = $119 >>> $121;
+ $124 = $123 >>> 1;
+ $125 = $124 & 2;
+ $126 = $122 | $125;
+ $127 = $123 >>> $125;
+ $128 = $127 >>> 1;
+ $129 = $128 & 1;
+ $130 = $126 | $129;
+ $131 = $127 >>> $129;
+ $132 = (($130) + ($131))|0;
+ $133 = (23320 + ($132<<2)|0);
+ $134 = HEAP32[$133>>2]|0;
+ $135 = ((($134)) + 4|0);
+ $136 = HEAP32[$135>>2]|0;
+ $137 = $136 & -8;
+ $138 = (($137) - ($6))|0;
+ $139 = ((($134)) + 16|0);
+ $140 = HEAP32[$139>>2]|0;
+ $not$5$i = ($140|0)==(0|0);
+ $$sink16$i = $not$5$i&1;
+ $141 = (((($134)) + 16|0) + ($$sink16$i<<2)|0);
+ $142 = HEAP32[$141>>2]|0;
+ $143 = ($142|0)==(0|0);
+ if ($143) {
+ $$0192$lcssa$i = $134;$$0193$lcssa$i = $138;
+ } else {
+ $$01928$i = $134;$$01937$i = $138;$145 = $142;
+ while(1) {
+ $144 = ((($145)) + 4|0);
+ $146 = HEAP32[$144>>2]|0;
+ $147 = $146 & -8;
+ $148 = (($147) - ($6))|0;
+ $149 = ($148>>>0)<($$01937$i>>>0);
+ $$$0193$i = $149 ? $148 : $$01937$i;
+ $$$0192$i = $149 ? $145 : $$01928$i;
+ $150 = ((($145)) + 16|0);
+ $151 = HEAP32[$150>>2]|0;
+ $not$$i = ($151|0)==(0|0);
+ $$sink1$i = $not$$i&1;
+ $152 = (((($145)) + 16|0) + ($$sink1$i<<2)|0);
+ $153 = HEAP32[$152>>2]|0;
+ $154 = ($153|0)==(0|0);
+ if ($154) {
+ $$0192$lcssa$i = $$$0192$i;$$0193$lcssa$i = $$$0193$i;
+ break;
+ } else {
+ $$01928$i = $$$0192$i;$$01937$i = $$$0193$i;$145 = $153;
+ }
+ }
+ }
+ $155 = HEAP32[(23032)>>2]|0;
+ $156 = ($$0192$lcssa$i>>>0)<($155>>>0);
+ if ($156) {
+ _abort();
+ // unreachable;
+ }
+ $157 = (($$0192$lcssa$i) + ($6)|0);
+ $158 = ($$0192$lcssa$i>>>0)<($157>>>0);
+ if (!($158)) {
+ _abort();
+ // unreachable;
+ }
+ $159 = ((($$0192$lcssa$i)) + 24|0);
+ $160 = HEAP32[$159>>2]|0;
+ $161 = ((($$0192$lcssa$i)) + 12|0);
+ $162 = HEAP32[$161>>2]|0;
+ $163 = ($162|0)==($$0192$lcssa$i|0);
+ do {
+ if ($163) {
+ $173 = ((($$0192$lcssa$i)) + 20|0);
+ $174 = HEAP32[$173>>2]|0;
+ $175 = ($174|0)==(0|0);
+ if ($175) {
+ $176 = ((($$0192$lcssa$i)) + 16|0);
+ $177 = HEAP32[$176>>2]|0;
+ $178 = ($177|0)==(0|0);
+ if ($178) {
+ $$3$i = 0;
+ break;
+ } else {
+ $$1196$i = $177;$$1198$i = $176;
+ }
+ } else {
+ $$1196$i = $174;$$1198$i = $173;
+ }
+ while(1) {
+ $179 = ((($$1196$i)) + 20|0);
+ $180 = HEAP32[$179>>2]|0;
+ $181 = ($180|0)==(0|0);
+ if (!($181)) {
+ $$1196$i = $180;$$1198$i = $179;
+ continue;
+ }
+ $182 = ((($$1196$i)) + 16|0);
+ $183 = HEAP32[$182>>2]|0;
+ $184 = ($183|0)==(0|0);
+ if ($184) {
+ break;
+ } else {
+ $$1196$i = $183;$$1198$i = $182;
+ }
+ }
+ $185 = ($$1198$i>>>0)<($155>>>0);
+ if ($185) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1198$i>>2] = 0;
+ $$3$i = $$1196$i;
+ break;
+ }
+ } else {
+ $164 = ((($$0192$lcssa$i)) + 8|0);
+ $165 = HEAP32[$164>>2]|0;
+ $166 = ($165>>>0)<($155>>>0);
+ if ($166) {
+ _abort();
+ // unreachable;
+ }
+ $167 = ((($165)) + 12|0);
+ $168 = HEAP32[$167>>2]|0;
+ $169 = ($168|0)==($$0192$lcssa$i|0);
+ if (!($169)) {
+ _abort();
+ // unreachable;
+ }
+ $170 = ((($162)) + 8|0);
+ $171 = HEAP32[$170>>2]|0;
+ $172 = ($171|0)==($$0192$lcssa$i|0);
+ if ($172) {
+ HEAP32[$167>>2] = $162;
+ HEAP32[$170>>2] = $165;
+ $$3$i = $162;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $186 = ($160|0)==(0|0);
+ L73: do {
+ if (!($186)) {
+ $187 = ((($$0192$lcssa$i)) + 28|0);
+ $188 = HEAP32[$187>>2]|0;
+ $189 = (23320 + ($188<<2)|0);
+ $190 = HEAP32[$189>>2]|0;
+ $191 = ($$0192$lcssa$i|0)==($190|0);
+ do {
+ if ($191) {
+ HEAP32[$189>>2] = $$3$i;
+ $cond$i = ($$3$i|0)==(0|0);
+ if ($cond$i) {
+ $192 = 1 << $188;
+ $193 = $192 ^ -1;
+ $194 = $108 & $193;
+ HEAP32[(23020)>>2] = $194;
+ break L73;
+ }
+ } else {
+ $195 = HEAP32[(23032)>>2]|0;
+ $196 = ($160>>>0)<($195>>>0);
+ if ($196) {
+ _abort();
+ // unreachable;
+ } else {
+ $197 = ((($160)) + 16|0);
+ $198 = HEAP32[$197>>2]|0;
+ $not$1$i = ($198|0)!=($$0192$lcssa$i|0);
+ $$sink2$i = $not$1$i&1;
+ $199 = (((($160)) + 16|0) + ($$sink2$i<<2)|0);
+ HEAP32[$199>>2] = $$3$i;
+ $200 = ($$3$i|0)==(0|0);
+ if ($200) {
+ break L73;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $201 = HEAP32[(23032)>>2]|0;
+ $202 = ($$3$i>>>0)<($201>>>0);
+ if ($202) {
+ _abort();
+ // unreachable;
+ }
+ $203 = ((($$3$i)) + 24|0);
+ HEAP32[$203>>2] = $160;
+ $204 = ((($$0192$lcssa$i)) + 16|0);
+ $205 = HEAP32[$204>>2]|0;
+ $206 = ($205|0)==(0|0);
+ do {
+ if (!($206)) {
+ $207 = ($205>>>0)<($201>>>0);
+ if ($207) {
+ _abort();
+ // unreachable;
+ } else {
+ $208 = ((($$3$i)) + 16|0);
+ HEAP32[$208>>2] = $205;
+ $209 = ((($205)) + 24|0);
+ HEAP32[$209>>2] = $$3$i;
+ break;
+ }
+ }
+ } while(0);
+ $210 = ((($$0192$lcssa$i)) + 20|0);
+ $211 = HEAP32[$210>>2]|0;
+ $212 = ($211|0)==(0|0);
+ if (!($212)) {
+ $213 = HEAP32[(23032)>>2]|0;
+ $214 = ($211>>>0)<($213>>>0);
+ if ($214) {
+ _abort();
+ // unreachable;
+ } else {
+ $215 = ((($$3$i)) + 20|0);
+ HEAP32[$215>>2] = $211;
+ $216 = ((($211)) + 24|0);
+ HEAP32[$216>>2] = $$3$i;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $217 = ($$0193$lcssa$i>>>0)<(16);
+ if ($217) {
+ $218 = (($$0193$lcssa$i) + ($6))|0;
+ $219 = $218 | 3;
+ $220 = ((($$0192$lcssa$i)) + 4|0);
+ HEAP32[$220>>2] = $219;
+ $221 = (($$0192$lcssa$i) + ($218)|0);
+ $222 = ((($221)) + 4|0);
+ $223 = HEAP32[$222>>2]|0;
+ $224 = $223 | 1;
+ HEAP32[$222>>2] = $224;
+ } else {
+ $225 = $6 | 3;
+ $226 = ((($$0192$lcssa$i)) + 4|0);
+ HEAP32[$226>>2] = $225;
+ $227 = $$0193$lcssa$i | 1;
+ $228 = ((($157)) + 4|0);
+ HEAP32[$228>>2] = $227;
+ $229 = (($157) + ($$0193$lcssa$i)|0);
+ HEAP32[$229>>2] = $$0193$lcssa$i;
+ $230 = ($37|0)==(0);
+ if (!($230)) {
+ $231 = HEAP32[(23036)>>2]|0;
+ $232 = $37 >>> 3;
+ $233 = $232 << 1;
+ $234 = (23056 + ($233<<2)|0);
+ $235 = 1 << $232;
+ $236 = $8 & $235;
+ $237 = ($236|0)==(0);
+ if ($237) {
+ $238 = $8 | $235;
+ HEAP32[5754] = $238;
+ $$pre$i = ((($234)) + 8|0);
+ $$0189$i = $234;$$pre$phi$iZ2D = $$pre$i;
+ } else {
+ $239 = ((($234)) + 8|0);
+ $240 = HEAP32[$239>>2]|0;
+ $241 = HEAP32[(23032)>>2]|0;
+ $242 = ($240>>>0)<($241>>>0);
+ if ($242) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0189$i = $240;$$pre$phi$iZ2D = $239;
+ }
+ }
+ HEAP32[$$pre$phi$iZ2D>>2] = $231;
+ $243 = ((($$0189$i)) + 12|0);
+ HEAP32[$243>>2] = $231;
+ $244 = ((($231)) + 8|0);
+ HEAP32[$244>>2] = $$0189$i;
+ $245 = ((($231)) + 12|0);
+ HEAP32[$245>>2] = $234;
+ }
+ HEAP32[(23024)>>2] = $$0193$lcssa$i;
+ HEAP32[(23036)>>2] = $157;
+ }
+ $246 = ((($$0192$lcssa$i)) + 8|0);
+ $$0 = $246;
+ STACKTOP = sp;return ($$0|0);
+ }
+ } else {
+ $$0197 = $6;
+ }
+ } else {
+ $247 = ($0>>>0)>(4294967231);
+ if ($247) {
+ $$0197 = -1;
+ } else {
+ $248 = (($0) + 11)|0;
+ $249 = $248 & -8;
+ $250 = HEAP32[(23020)>>2]|0;
+ $251 = ($250|0)==(0);
+ if ($251) {
+ $$0197 = $249;
+ } else {
+ $252 = (0 - ($249))|0;
+ $253 = $248 >>> 8;
+ $254 = ($253|0)==(0);
+ if ($254) {
+ $$0358$i = 0;
+ } else {
+ $255 = ($249>>>0)>(16777215);
+ if ($255) {
+ $$0358$i = 31;
+ } else {
+ $256 = (($253) + 1048320)|0;
+ $257 = $256 >>> 16;
+ $258 = $257 & 8;
+ $259 = $253 << $258;
+ $260 = (($259) + 520192)|0;
+ $261 = $260 >>> 16;
+ $262 = $261 & 4;
+ $263 = $262 | $258;
+ $264 = $259 << $262;
+ $265 = (($264) + 245760)|0;
+ $266 = $265 >>> 16;
+ $267 = $266 & 2;
+ $268 = $263 | $267;
+ $269 = (14 - ($268))|0;
+ $270 = $264 << $267;
+ $271 = $270 >>> 15;
+ $272 = (($269) + ($271))|0;
+ $273 = $272 << 1;
+ $274 = (($272) + 7)|0;
+ $275 = $249 >>> $274;
+ $276 = $275 & 1;
+ $277 = $276 | $273;
+ $$0358$i = $277;
+ }
+ }
+ $278 = (23320 + ($$0358$i<<2)|0);
+ $279 = HEAP32[$278>>2]|0;
+ $280 = ($279|0)==(0|0);
+ L117: do {
+ if ($280) {
+ $$2355$i = 0;$$3$i201 = 0;$$3350$i = $252;
+ label = 81;
+ } else {
+ $281 = ($$0358$i|0)==(31);
+ $282 = $$0358$i >>> 1;
+ $283 = (25 - ($282))|0;
+ $284 = $281 ? 0 : $283;
+ $285 = $249 << $284;
+ $$0342$i = 0;$$0347$i = $252;$$0353$i = $279;$$0359$i = $285;$$0362$i = 0;
+ while(1) {
+ $286 = ((($$0353$i)) + 4|0);
+ $287 = HEAP32[$286>>2]|0;
+ $288 = $287 & -8;
+ $289 = (($288) - ($249))|0;
+ $290 = ($289>>>0)<($$0347$i>>>0);
+ if ($290) {
+ $291 = ($289|0)==(0);
+ if ($291) {
+ $$415$i = $$0353$i;$$435114$i = 0;$$435713$i = $$0353$i;
+ label = 85;
+ break L117;
+ } else {
+ $$1343$i = $$0353$i;$$1348$i = $289;
+ }
+ } else {
+ $$1343$i = $$0342$i;$$1348$i = $$0347$i;
+ }
+ $292 = ((($$0353$i)) + 20|0);
+ $293 = HEAP32[$292>>2]|0;
+ $294 = $$0359$i >>> 31;
+ $295 = (((($$0353$i)) + 16|0) + ($294<<2)|0);
+ $296 = HEAP32[$295>>2]|0;
+ $297 = ($293|0)==(0|0);
+ $298 = ($293|0)==($296|0);
+ $or$cond2$i = $297 | $298;
+ $$1363$i = $or$cond2$i ? $$0362$i : $293;
+ $299 = ($296|0)==(0|0);
+ $not$8$i = $299 ^ 1;
+ $300 = $not$8$i&1;
+ $$0359$$i = $$0359$i << $300;
+ if ($299) {
+ $$2355$i = $$1363$i;$$3$i201 = $$1343$i;$$3350$i = $$1348$i;
+ label = 81;
+ break;
+ } else {
+ $$0342$i = $$1343$i;$$0347$i = $$1348$i;$$0353$i = $296;$$0359$i = $$0359$$i;$$0362$i = $$1363$i;
+ }
+ }
+ }
+ } while(0);
+ if ((label|0) == 81) {
+ $301 = ($$2355$i|0)==(0|0);
+ $302 = ($$3$i201|0)==(0|0);
+ $or$cond$i = $301 & $302;
+ if ($or$cond$i) {
+ $303 = 2 << $$0358$i;
+ $304 = (0 - ($303))|0;
+ $305 = $303 | $304;
+ $306 = $250 & $305;
+ $307 = ($306|0)==(0);
+ if ($307) {
+ $$0197 = $249;
+ break;
+ }
+ $308 = (0 - ($306))|0;
+ $309 = $306 & $308;
+ $310 = (($309) + -1)|0;
+ $311 = $310 >>> 12;
+ $312 = $311 & 16;
+ $313 = $310 >>> $312;
+ $314 = $313 >>> 5;
+ $315 = $314 & 8;
+ $316 = $315 | $312;
+ $317 = $313 >>> $315;
+ $318 = $317 >>> 2;
+ $319 = $318 & 4;
+ $320 = $316 | $319;
+ $321 = $317 >>> $319;
+ $322 = $321 >>> 1;
+ $323 = $322 & 2;
+ $324 = $320 | $323;
+ $325 = $321 >>> $323;
+ $326 = $325 >>> 1;
+ $327 = $326 & 1;
+ $328 = $324 | $327;
+ $329 = $325 >>> $327;
+ $330 = (($328) + ($329))|0;
+ $331 = (23320 + ($330<<2)|0);
+ $332 = HEAP32[$331>>2]|0;
+ $$4$ph$i = 0;$$4357$ph$i = $332;
+ } else {
+ $$4$ph$i = $$3$i201;$$4357$ph$i = $$2355$i;
+ }
+ $333 = ($$4357$ph$i|0)==(0|0);
+ if ($333) {
+ $$4$lcssa$i = $$4$ph$i;$$4351$lcssa$i = $$3350$i;
+ } else {
+ $$415$i = $$4$ph$i;$$435114$i = $$3350$i;$$435713$i = $$4357$ph$i;
+ label = 85;
+ }
+ }
+ if ((label|0) == 85) {
+ while(1) {
+ label = 0;
+ $334 = ((($$435713$i)) + 4|0);
+ $335 = HEAP32[$334>>2]|0;
+ $336 = $335 & -8;
+ $337 = (($336) - ($249))|0;
+ $338 = ($337>>>0)<($$435114$i>>>0);
+ $$$4351$i = $338 ? $337 : $$435114$i;
+ $$4357$$4$i = $338 ? $$435713$i : $$415$i;
+ $339 = ((($$435713$i)) + 16|0);
+ $340 = HEAP32[$339>>2]|0;
+ $not$1$i203 = ($340|0)==(0|0);
+ $$sink2$i204 = $not$1$i203&1;
+ $341 = (((($$435713$i)) + 16|0) + ($$sink2$i204<<2)|0);
+ $342 = HEAP32[$341>>2]|0;
+ $343 = ($342|0)==(0|0);
+ if ($343) {
+ $$4$lcssa$i = $$4357$$4$i;$$4351$lcssa$i = $$$4351$i;
+ break;
+ } else {
+ $$415$i = $$4357$$4$i;$$435114$i = $$$4351$i;$$435713$i = $342;
+ label = 85;
+ }
+ }
+ }
+ $344 = ($$4$lcssa$i|0)==(0|0);
+ if ($344) {
+ $$0197 = $249;
+ } else {
+ $345 = HEAP32[(23024)>>2]|0;
+ $346 = (($345) - ($249))|0;
+ $347 = ($$4351$lcssa$i>>>0)<($346>>>0);
+ if ($347) {
+ $348 = HEAP32[(23032)>>2]|0;
+ $349 = ($$4$lcssa$i>>>0)<($348>>>0);
+ if ($349) {
+ _abort();
+ // unreachable;
+ }
+ $350 = (($$4$lcssa$i) + ($249)|0);
+ $351 = ($$4$lcssa$i>>>0)<($350>>>0);
+ if (!($351)) {
+ _abort();
+ // unreachable;
+ }
+ $352 = ((($$4$lcssa$i)) + 24|0);
+ $353 = HEAP32[$352>>2]|0;
+ $354 = ((($$4$lcssa$i)) + 12|0);
+ $355 = HEAP32[$354>>2]|0;
+ $356 = ($355|0)==($$4$lcssa$i|0);
+ do {
+ if ($356) {
+ $366 = ((($$4$lcssa$i)) + 20|0);
+ $367 = HEAP32[$366>>2]|0;
+ $368 = ($367|0)==(0|0);
+ if ($368) {
+ $369 = ((($$4$lcssa$i)) + 16|0);
+ $370 = HEAP32[$369>>2]|0;
+ $371 = ($370|0)==(0|0);
+ if ($371) {
+ $$3372$i = 0;
+ break;
+ } else {
+ $$1370$i = $370;$$1374$i = $369;
+ }
+ } else {
+ $$1370$i = $367;$$1374$i = $366;
+ }
+ while(1) {
+ $372 = ((($$1370$i)) + 20|0);
+ $373 = HEAP32[$372>>2]|0;
+ $374 = ($373|0)==(0|0);
+ if (!($374)) {
+ $$1370$i = $373;$$1374$i = $372;
+ continue;
+ }
+ $375 = ((($$1370$i)) + 16|0);
+ $376 = HEAP32[$375>>2]|0;
+ $377 = ($376|0)==(0|0);
+ if ($377) {
+ break;
+ } else {
+ $$1370$i = $376;$$1374$i = $375;
+ }
+ }
+ $378 = ($$1374$i>>>0)<($348>>>0);
+ if ($378) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1374$i>>2] = 0;
+ $$3372$i = $$1370$i;
+ break;
+ }
+ } else {
+ $357 = ((($$4$lcssa$i)) + 8|0);
+ $358 = HEAP32[$357>>2]|0;
+ $359 = ($358>>>0)<($348>>>0);
+ if ($359) {
+ _abort();
+ // unreachable;
+ }
+ $360 = ((($358)) + 12|0);
+ $361 = HEAP32[$360>>2]|0;
+ $362 = ($361|0)==($$4$lcssa$i|0);
+ if (!($362)) {
+ _abort();
+ // unreachable;
+ }
+ $363 = ((($355)) + 8|0);
+ $364 = HEAP32[$363>>2]|0;
+ $365 = ($364|0)==($$4$lcssa$i|0);
+ if ($365) {
+ HEAP32[$360>>2] = $355;
+ HEAP32[$363>>2] = $358;
+ $$3372$i = $355;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $379 = ($353|0)==(0|0);
+ L164: do {
+ if ($379) {
+ $470 = $250;
+ } else {
+ $380 = ((($$4$lcssa$i)) + 28|0);
+ $381 = HEAP32[$380>>2]|0;
+ $382 = (23320 + ($381<<2)|0);
+ $383 = HEAP32[$382>>2]|0;
+ $384 = ($$4$lcssa$i|0)==($383|0);
+ do {
+ if ($384) {
+ HEAP32[$382>>2] = $$3372$i;
+ $cond$i208 = ($$3372$i|0)==(0|0);
+ if ($cond$i208) {
+ $385 = 1 << $381;
+ $386 = $385 ^ -1;
+ $387 = $250 & $386;
+ HEAP32[(23020)>>2] = $387;
+ $470 = $387;
+ break L164;
+ }
+ } else {
+ $388 = HEAP32[(23032)>>2]|0;
+ $389 = ($353>>>0)<($388>>>0);
+ if ($389) {
+ _abort();
+ // unreachable;
+ } else {
+ $390 = ((($353)) + 16|0);
+ $391 = HEAP32[$390>>2]|0;
+ $not$$i209 = ($391|0)!=($$4$lcssa$i|0);
+ $$sink3$i = $not$$i209&1;
+ $392 = (((($353)) + 16|0) + ($$sink3$i<<2)|0);
+ HEAP32[$392>>2] = $$3372$i;
+ $393 = ($$3372$i|0)==(0|0);
+ if ($393) {
+ $470 = $250;
+ break L164;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $394 = HEAP32[(23032)>>2]|0;
+ $395 = ($$3372$i>>>0)<($394>>>0);
+ if ($395) {
+ _abort();
+ // unreachable;
+ }
+ $396 = ((($$3372$i)) + 24|0);
+ HEAP32[$396>>2] = $353;
+ $397 = ((($$4$lcssa$i)) + 16|0);
+ $398 = HEAP32[$397>>2]|0;
+ $399 = ($398|0)==(0|0);
+ do {
+ if (!($399)) {
+ $400 = ($398>>>0)<($394>>>0);
+ if ($400) {
+ _abort();
+ // unreachable;
+ } else {
+ $401 = ((($$3372$i)) + 16|0);
+ HEAP32[$401>>2] = $398;
+ $402 = ((($398)) + 24|0);
+ HEAP32[$402>>2] = $$3372$i;
+ break;
+ }
+ }
+ } while(0);
+ $403 = ((($$4$lcssa$i)) + 20|0);
+ $404 = HEAP32[$403>>2]|0;
+ $405 = ($404|0)==(0|0);
+ if ($405) {
+ $470 = $250;
+ } else {
+ $406 = HEAP32[(23032)>>2]|0;
+ $407 = ($404>>>0)<($406>>>0);
+ if ($407) {
+ _abort();
+ // unreachable;
+ } else {
+ $408 = ((($$3372$i)) + 20|0);
+ HEAP32[$408>>2] = $404;
+ $409 = ((($404)) + 24|0);
+ HEAP32[$409>>2] = $$3372$i;
+ $470 = $250;
+ break;
+ }
+ }
+ }
+ } while(0);
+ $410 = ($$4351$lcssa$i>>>0)<(16);
+ do {
+ if ($410) {
+ $411 = (($$4351$lcssa$i) + ($249))|0;
+ $412 = $411 | 3;
+ $413 = ((($$4$lcssa$i)) + 4|0);
+ HEAP32[$413>>2] = $412;
+ $414 = (($$4$lcssa$i) + ($411)|0);
+ $415 = ((($414)) + 4|0);
+ $416 = HEAP32[$415>>2]|0;
+ $417 = $416 | 1;
+ HEAP32[$415>>2] = $417;
+ } else {
+ $418 = $249 | 3;
+ $419 = ((($$4$lcssa$i)) + 4|0);
+ HEAP32[$419>>2] = $418;
+ $420 = $$4351$lcssa$i | 1;
+ $421 = ((($350)) + 4|0);
+ HEAP32[$421>>2] = $420;
+ $422 = (($350) + ($$4351$lcssa$i)|0);
+ HEAP32[$422>>2] = $$4351$lcssa$i;
+ $423 = $$4351$lcssa$i >>> 3;
+ $424 = ($$4351$lcssa$i>>>0)<(256);
+ if ($424) {
+ $425 = $423 << 1;
+ $426 = (23056 + ($425<<2)|0);
+ $427 = HEAP32[5754]|0;
+ $428 = 1 << $423;
+ $429 = $427 & $428;
+ $430 = ($429|0)==(0);
+ if ($430) {
+ $431 = $427 | $428;
+ HEAP32[5754] = $431;
+ $$pre$i210 = ((($426)) + 8|0);
+ $$0368$i = $426;$$pre$phi$i211Z2D = $$pre$i210;
+ } else {
+ $432 = ((($426)) + 8|0);
+ $433 = HEAP32[$432>>2]|0;
+ $434 = HEAP32[(23032)>>2]|0;
+ $435 = ($433>>>0)<($434>>>0);
+ if ($435) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0368$i = $433;$$pre$phi$i211Z2D = $432;
+ }
+ }
+ HEAP32[$$pre$phi$i211Z2D>>2] = $350;
+ $436 = ((($$0368$i)) + 12|0);
+ HEAP32[$436>>2] = $350;
+ $437 = ((($350)) + 8|0);
+ HEAP32[$437>>2] = $$0368$i;
+ $438 = ((($350)) + 12|0);
+ HEAP32[$438>>2] = $426;
+ break;
+ }
+ $439 = $$4351$lcssa$i >>> 8;
+ $440 = ($439|0)==(0);
+ if ($440) {
+ $$0361$i = 0;
+ } else {
+ $441 = ($$4351$lcssa$i>>>0)>(16777215);
+ if ($441) {
+ $$0361$i = 31;
+ } else {
+ $442 = (($439) + 1048320)|0;
+ $443 = $442 >>> 16;
+ $444 = $443 & 8;
+ $445 = $439 << $444;
+ $446 = (($445) + 520192)|0;
+ $447 = $446 >>> 16;
+ $448 = $447 & 4;
+ $449 = $448 | $444;
+ $450 = $445 << $448;
+ $451 = (($450) + 245760)|0;
+ $452 = $451 >>> 16;
+ $453 = $452 & 2;
+ $454 = $449 | $453;
+ $455 = (14 - ($454))|0;
+ $456 = $450 << $453;
+ $457 = $456 >>> 15;
+ $458 = (($455) + ($457))|0;
+ $459 = $458 << 1;
+ $460 = (($458) + 7)|0;
+ $461 = $$4351$lcssa$i >>> $460;
+ $462 = $461 & 1;
+ $463 = $462 | $459;
+ $$0361$i = $463;
+ }
+ }
+ $464 = (23320 + ($$0361$i<<2)|0);
+ $465 = ((($350)) + 28|0);
+ HEAP32[$465>>2] = $$0361$i;
+ $466 = ((($350)) + 16|0);
+ $467 = ((($466)) + 4|0);
+ HEAP32[$467>>2] = 0;
+ HEAP32[$466>>2] = 0;
+ $468 = 1 << $$0361$i;
+ $469 = $470 & $468;
+ $471 = ($469|0)==(0);
+ if ($471) {
+ $472 = $470 | $468;
+ HEAP32[(23020)>>2] = $472;
+ HEAP32[$464>>2] = $350;
+ $473 = ((($350)) + 24|0);
+ HEAP32[$473>>2] = $464;
+ $474 = ((($350)) + 12|0);
+ HEAP32[$474>>2] = $350;
+ $475 = ((($350)) + 8|0);
+ HEAP32[$475>>2] = $350;
+ break;
+ }
+ $476 = HEAP32[$464>>2]|0;
+ $477 = ($$0361$i|0)==(31);
+ $478 = $$0361$i >>> 1;
+ $479 = (25 - ($478))|0;
+ $480 = $477 ? 0 : $479;
+ $481 = $$4351$lcssa$i << $480;
+ $$0344$i = $481;$$0345$i = $476;
+ while(1) {
+ $482 = ((($$0345$i)) + 4|0);
+ $483 = HEAP32[$482>>2]|0;
+ $484 = $483 & -8;
+ $485 = ($484|0)==($$4351$lcssa$i|0);
+ if ($485) {
+ label = 139;
+ break;
+ }
+ $486 = $$0344$i >>> 31;
+ $487 = (((($$0345$i)) + 16|0) + ($486<<2)|0);
+ $488 = $$0344$i << 1;
+ $489 = HEAP32[$487>>2]|0;
+ $490 = ($489|0)==(0|0);
+ if ($490) {
+ label = 136;
+ break;
+ } else {
+ $$0344$i = $488;$$0345$i = $489;
+ }
+ }
+ if ((label|0) == 136) {
+ $491 = HEAP32[(23032)>>2]|0;
+ $492 = ($487>>>0)<($491>>>0);
+ if ($492) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$487>>2] = $350;
+ $493 = ((($350)) + 24|0);
+ HEAP32[$493>>2] = $$0345$i;
+ $494 = ((($350)) + 12|0);
+ HEAP32[$494>>2] = $350;
+ $495 = ((($350)) + 8|0);
+ HEAP32[$495>>2] = $350;
+ break;
+ }
+ }
+ else if ((label|0) == 139) {
+ $496 = ((($$0345$i)) + 8|0);
+ $497 = HEAP32[$496>>2]|0;
+ $498 = HEAP32[(23032)>>2]|0;
+ $499 = ($497>>>0)>=($498>>>0);
+ $not$9$i = ($$0345$i>>>0)>=($498>>>0);
+ $500 = $499 & $not$9$i;
+ if ($500) {
+ $501 = ((($497)) + 12|0);
+ HEAP32[$501>>2] = $350;
+ HEAP32[$496>>2] = $350;
+ $502 = ((($350)) + 8|0);
+ HEAP32[$502>>2] = $497;
+ $503 = ((($350)) + 12|0);
+ HEAP32[$503>>2] = $$0345$i;
+ $504 = ((($350)) + 24|0);
+ HEAP32[$504>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ }
+ } while(0);
+ $505 = ((($$4$lcssa$i)) + 8|0);
+ $$0 = $505;
+ STACKTOP = sp;return ($$0|0);
+ } else {
+ $$0197 = $249;
+ }
+ }
+ }
+ }
+ }
+ } while(0);
+ $506 = HEAP32[(23024)>>2]|0;
+ $507 = ($506>>>0)<($$0197>>>0);
+ if (!($507)) {
+ $508 = (($506) - ($$0197))|0;
+ $509 = HEAP32[(23036)>>2]|0;
+ $510 = ($508>>>0)>(15);
+ if ($510) {
+ $511 = (($509) + ($$0197)|0);
+ HEAP32[(23036)>>2] = $511;
+ HEAP32[(23024)>>2] = $508;
+ $512 = $508 | 1;
+ $513 = ((($511)) + 4|0);
+ HEAP32[$513>>2] = $512;
+ $514 = (($511) + ($508)|0);
+ HEAP32[$514>>2] = $508;
+ $515 = $$0197 | 3;
+ $516 = ((($509)) + 4|0);
+ HEAP32[$516>>2] = $515;
+ } else {
+ HEAP32[(23024)>>2] = 0;
+ HEAP32[(23036)>>2] = 0;
+ $517 = $506 | 3;
+ $518 = ((($509)) + 4|0);
+ HEAP32[$518>>2] = $517;
+ $519 = (($509) + ($506)|0);
+ $520 = ((($519)) + 4|0);
+ $521 = HEAP32[$520>>2]|0;
+ $522 = $521 | 1;
+ HEAP32[$520>>2] = $522;
+ }
+ $523 = ((($509)) + 8|0);
+ $$0 = $523;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $524 = HEAP32[(23028)>>2]|0;
+ $525 = ($524>>>0)>($$0197>>>0);
+ if ($525) {
+ $526 = (($524) - ($$0197))|0;
+ HEAP32[(23028)>>2] = $526;
+ $527 = HEAP32[(23040)>>2]|0;
+ $528 = (($527) + ($$0197)|0);
+ HEAP32[(23040)>>2] = $528;
+ $529 = $526 | 1;
+ $530 = ((($528)) + 4|0);
+ HEAP32[$530>>2] = $529;
+ $531 = $$0197 | 3;
+ $532 = ((($527)) + 4|0);
+ HEAP32[$532>>2] = $531;
+ $533 = ((($527)) + 8|0);
+ $$0 = $533;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $534 = HEAP32[5872]|0;
+ $535 = ($534|0)==(0);
+ if ($535) {
+ HEAP32[(23496)>>2] = 4096;
+ HEAP32[(23492)>>2] = 4096;
+ HEAP32[(23500)>>2] = -1;
+ HEAP32[(23504)>>2] = -1;
+ HEAP32[(23508)>>2] = 0;
+ HEAP32[(23460)>>2] = 0;
+ $536 = $1;
+ $537 = $536 & -16;
+ $538 = $537 ^ 1431655768;
+ HEAP32[$1>>2] = $538;
+ HEAP32[5872] = $538;
+ $542 = 4096;
+ } else {
+ $$pre$i212 = HEAP32[(23496)>>2]|0;
+ $542 = $$pre$i212;
+ }
+ $539 = (($$0197) + 48)|0;
+ $540 = (($$0197) + 47)|0;
+ $541 = (($542) + ($540))|0;
+ $543 = (0 - ($542))|0;
+ $544 = $541 & $543;
+ $545 = ($544>>>0)>($$0197>>>0);
+ if (!($545)) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ $546 = HEAP32[(23456)>>2]|0;
+ $547 = ($546|0)==(0);
+ if (!($547)) {
+ $548 = HEAP32[(23448)>>2]|0;
+ $549 = (($548) + ($544))|0;
+ $550 = ($549>>>0)<=($548>>>0);
+ $551 = ($549>>>0)>($546>>>0);
+ $or$cond1$i = $550 | $551;
+ if ($or$cond1$i) {
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $552 = HEAP32[(23460)>>2]|0;
+ $553 = $552 & 4;
+ $554 = ($553|0)==(0);
+ L244: do {
+ if ($554) {
+ $555 = HEAP32[(23040)>>2]|0;
+ $556 = ($555|0)==(0|0);
+ L246: do {
+ if ($556) {
+ label = 163;
+ } else {
+ $$0$i$i = (23464);
+ while(1) {
+ $557 = HEAP32[$$0$i$i>>2]|0;
+ $558 = ($557>>>0)>($555>>>0);
+ if (!($558)) {
+ $559 = ((($$0$i$i)) + 4|0);
+ $560 = HEAP32[$559>>2]|0;
+ $561 = (($557) + ($560)|0);
+ $562 = ($561>>>0)>($555>>>0);
+ if ($562) {
+ break;
+ }
+ }
+ $563 = ((($$0$i$i)) + 8|0);
+ $564 = HEAP32[$563>>2]|0;
+ $565 = ($564|0)==(0|0);
+ if ($565) {
+ label = 163;
+ break L246;
+ } else {
+ $$0$i$i = $564;
+ }
+ }
+ $588 = (($541) - ($524))|0;
+ $589 = $588 & $543;
+ $590 = ($589>>>0)<(2147483647);
+ if ($590) {
+ $591 = (_sbrk(($589|0))|0);
+ $592 = HEAP32[$$0$i$i>>2]|0;
+ $593 = HEAP32[$559>>2]|0;
+ $594 = (($592) + ($593)|0);
+ $595 = ($591|0)==($594|0);
+ if ($595) {
+ $596 = ($591|0)==((-1)|0);
+ if ($596) {
+ $$2234253237$i = $589;
+ } else {
+ $$723948$i = $589;$$749$i = $591;
+ label = 180;
+ break L244;
+ }
+ } else {
+ $$2247$ph$i = $591;$$2253$ph$i = $589;
+ label = 171;
+ }
+ } else {
+ $$2234253237$i = 0;
+ }
+ }
+ } while(0);
+ do {
+ if ((label|0) == 163) {
+ $566 = (_sbrk(0)|0);
+ $567 = ($566|0)==((-1)|0);
+ if ($567) {
+ $$2234253237$i = 0;
+ } else {
+ $568 = $566;
+ $569 = HEAP32[(23492)>>2]|0;
+ $570 = (($569) + -1)|0;
+ $571 = $570 & $568;
+ $572 = ($571|0)==(0);
+ $573 = (($570) + ($568))|0;
+ $574 = (0 - ($569))|0;
+ $575 = $573 & $574;
+ $576 = (($575) - ($568))|0;
+ $577 = $572 ? 0 : $576;
+ $$$i = (($577) + ($544))|0;
+ $578 = HEAP32[(23448)>>2]|0;
+ $579 = (($$$i) + ($578))|0;
+ $580 = ($$$i>>>0)>($$0197>>>0);
+ $581 = ($$$i>>>0)<(2147483647);
+ $or$cond$i214 = $580 & $581;
+ if ($or$cond$i214) {
+ $582 = HEAP32[(23456)>>2]|0;
+ $583 = ($582|0)==(0);
+ if (!($583)) {
+ $584 = ($579>>>0)<=($578>>>0);
+ $585 = ($579>>>0)>($582>>>0);
+ $or$cond2$i215 = $584 | $585;
+ if ($or$cond2$i215) {
+ $$2234253237$i = 0;
+ break;
+ }
+ }
+ $586 = (_sbrk(($$$i|0))|0);
+ $587 = ($586|0)==($566|0);
+ if ($587) {
+ $$723948$i = $$$i;$$749$i = $566;
+ label = 180;
+ break L244;
+ } else {
+ $$2247$ph$i = $586;$$2253$ph$i = $$$i;
+ label = 171;
+ }
+ } else {
+ $$2234253237$i = 0;
+ }
+ }
+ }
+ } while(0);
+ do {
+ if ((label|0) == 171) {
+ $597 = (0 - ($$2253$ph$i))|0;
+ $598 = ($$2247$ph$i|0)!=((-1)|0);
+ $599 = ($$2253$ph$i>>>0)<(2147483647);
+ $or$cond7$i = $599 & $598;
+ $600 = ($539>>>0)>($$2253$ph$i>>>0);
+ $or$cond10$i = $600 & $or$cond7$i;
+ if (!($or$cond10$i)) {
+ $610 = ($$2247$ph$i|0)==((-1)|0);
+ if ($610) {
+ $$2234253237$i = 0;
+ break;
+ } else {
+ $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
+ label = 180;
+ break L244;
+ }
+ }
+ $601 = HEAP32[(23496)>>2]|0;
+ $602 = (($540) - ($$2253$ph$i))|0;
+ $603 = (($602) + ($601))|0;
+ $604 = (0 - ($601))|0;
+ $605 = $603 & $604;
+ $606 = ($605>>>0)<(2147483647);
+ if (!($606)) {
+ $$723948$i = $$2253$ph$i;$$749$i = $$2247$ph$i;
+ label = 180;
+ break L244;
+ }
+ $607 = (_sbrk(($605|0))|0);
+ $608 = ($607|0)==((-1)|0);
+ if ($608) {
+ (_sbrk(($597|0))|0);
+ $$2234253237$i = 0;
+ break;
+ } else {
+ $609 = (($605) + ($$2253$ph$i))|0;
+ $$723948$i = $609;$$749$i = $$2247$ph$i;
+ label = 180;
+ break L244;
+ }
+ }
+ } while(0);
+ $611 = HEAP32[(23460)>>2]|0;
+ $612 = $611 | 4;
+ HEAP32[(23460)>>2] = $612;
+ $$4236$i = $$2234253237$i;
+ label = 178;
+ } else {
+ $$4236$i = 0;
+ label = 178;
+ }
+ } while(0);
+ if ((label|0) == 178) {
+ $613 = ($544>>>0)<(2147483647);
+ if ($613) {
+ $614 = (_sbrk(($544|0))|0);
+ $615 = (_sbrk(0)|0);
+ $616 = ($614|0)!=((-1)|0);
+ $617 = ($615|0)!=((-1)|0);
+ $or$cond5$i = $616 & $617;
+ $618 = ($614>>>0)<($615>>>0);
+ $or$cond11$i = $618 & $or$cond5$i;
+ $619 = $615;
+ $620 = $614;
+ $621 = (($619) - ($620))|0;
+ $622 = (($$0197) + 40)|0;
+ $623 = ($621>>>0)>($622>>>0);
+ $$$4236$i = $623 ? $621 : $$4236$i;
+ $or$cond11$not$i = $or$cond11$i ^ 1;
+ $624 = ($614|0)==((-1)|0);
+ $not$$i216 = $623 ^ 1;
+ $625 = $624 | $not$$i216;
+ $or$cond50$i = $625 | $or$cond11$not$i;
+ if (!($or$cond50$i)) {
+ $$723948$i = $$$4236$i;$$749$i = $614;
+ label = 180;
+ }
+ }
+ }
+ if ((label|0) == 180) {
+ $626 = HEAP32[(23448)>>2]|0;
+ $627 = (($626) + ($$723948$i))|0;
+ HEAP32[(23448)>>2] = $627;
+ $628 = HEAP32[(23452)>>2]|0;
+ $629 = ($627>>>0)>($628>>>0);
+ if ($629) {
+ HEAP32[(23452)>>2] = $627;
+ }
+ $630 = HEAP32[(23040)>>2]|0;
+ $631 = ($630|0)==(0|0);
+ do {
+ if ($631) {
+ $632 = HEAP32[(23032)>>2]|0;
+ $633 = ($632|0)==(0|0);
+ $634 = ($$749$i>>>0)<($632>>>0);
+ $or$cond12$i = $633 | $634;
+ if ($or$cond12$i) {
+ HEAP32[(23032)>>2] = $$749$i;
+ }
+ HEAP32[(23464)>>2] = $$749$i;
+ HEAP32[(23468)>>2] = $$723948$i;
+ HEAP32[(23476)>>2] = 0;
+ $635 = HEAP32[5872]|0;
+ HEAP32[(23052)>>2] = $635;
+ HEAP32[(23048)>>2] = -1;
+ $$01$i$i = 0;
+ while(1) {
+ $636 = $$01$i$i << 1;
+ $637 = (23056 + ($636<<2)|0);
+ $638 = ((($637)) + 12|0);
+ HEAP32[$638>>2] = $637;
+ $639 = ((($637)) + 8|0);
+ HEAP32[$639>>2] = $637;
+ $640 = (($$01$i$i) + 1)|0;
+ $exitcond$i$i = ($640|0)==(32);
+ if ($exitcond$i$i) {
+ break;
+ } else {
+ $$01$i$i = $640;
+ }
+ }
+ $641 = (($$723948$i) + -40)|0;
+ $642 = ((($$749$i)) + 8|0);
+ $643 = $642;
+ $644 = $643 & 7;
+ $645 = ($644|0)==(0);
+ $646 = (0 - ($643))|0;
+ $647 = $646 & 7;
+ $648 = $645 ? 0 : $647;
+ $649 = (($$749$i) + ($648)|0);
+ $650 = (($641) - ($648))|0;
+ HEAP32[(23040)>>2] = $649;
+ HEAP32[(23028)>>2] = $650;
+ $651 = $650 | 1;
+ $652 = ((($649)) + 4|0);
+ HEAP32[$652>>2] = $651;
+ $653 = (($649) + ($650)|0);
+ $654 = ((($653)) + 4|0);
+ HEAP32[$654>>2] = 40;
+ $655 = HEAP32[(23504)>>2]|0;
+ HEAP32[(23044)>>2] = $655;
+ } else {
+ $$024371$i = (23464);
+ while(1) {
+ $656 = HEAP32[$$024371$i>>2]|0;
+ $657 = ((($$024371$i)) + 4|0);
+ $658 = HEAP32[$657>>2]|0;
+ $659 = (($656) + ($658)|0);
+ $660 = ($$749$i|0)==($659|0);
+ if ($660) {
+ label = 190;
+ break;
+ }
+ $661 = ((($$024371$i)) + 8|0);
+ $662 = HEAP32[$661>>2]|0;
+ $663 = ($662|0)==(0|0);
+ if ($663) {
+ break;
+ } else {
+ $$024371$i = $662;
+ }
+ }
+ if ((label|0) == 190) {
+ $664 = ((($$024371$i)) + 12|0);
+ $665 = HEAP32[$664>>2]|0;
+ $666 = $665 & 8;
+ $667 = ($666|0)==(0);
+ if ($667) {
+ $668 = ($630>>>0)>=($656>>>0);
+ $669 = ($630>>>0)<($$749$i>>>0);
+ $or$cond51$i = $669 & $668;
+ if ($or$cond51$i) {
+ $670 = (($658) + ($$723948$i))|0;
+ HEAP32[$657>>2] = $670;
+ $671 = HEAP32[(23028)>>2]|0;
+ $672 = ((($630)) + 8|0);
+ $673 = $672;
+ $674 = $673 & 7;
+ $675 = ($674|0)==(0);
+ $676 = (0 - ($673))|0;
+ $677 = $676 & 7;
+ $678 = $675 ? 0 : $677;
+ $679 = (($630) + ($678)|0);
+ $680 = (($$723948$i) - ($678))|0;
+ $681 = (($671) + ($680))|0;
+ HEAP32[(23040)>>2] = $679;
+ HEAP32[(23028)>>2] = $681;
+ $682 = $681 | 1;
+ $683 = ((($679)) + 4|0);
+ HEAP32[$683>>2] = $682;
+ $684 = (($679) + ($681)|0);
+ $685 = ((($684)) + 4|0);
+ HEAP32[$685>>2] = 40;
+ $686 = HEAP32[(23504)>>2]|0;
+ HEAP32[(23044)>>2] = $686;
+ break;
+ }
+ }
+ }
+ $687 = HEAP32[(23032)>>2]|0;
+ $688 = ($$749$i>>>0)<($687>>>0);
+ if ($688) {
+ HEAP32[(23032)>>2] = $$749$i;
+ $752 = $$749$i;
+ } else {
+ $752 = $687;
+ }
+ $689 = (($$749$i) + ($$723948$i)|0);
+ $$124470$i = (23464);
+ while(1) {
+ $690 = HEAP32[$$124470$i>>2]|0;
+ $691 = ($690|0)==($689|0);
+ if ($691) {
+ label = 198;
+ break;
+ }
+ $692 = ((($$124470$i)) + 8|0);
+ $693 = HEAP32[$692>>2]|0;
+ $694 = ($693|0)==(0|0);
+ if ($694) {
+ break;
+ } else {
+ $$124470$i = $693;
+ }
+ }
+ if ((label|0) == 198) {
+ $695 = ((($$124470$i)) + 12|0);
+ $696 = HEAP32[$695>>2]|0;
+ $697 = $696 & 8;
+ $698 = ($697|0)==(0);
+ if ($698) {
+ HEAP32[$$124470$i>>2] = $$749$i;
+ $699 = ((($$124470$i)) + 4|0);
+ $700 = HEAP32[$699>>2]|0;
+ $701 = (($700) + ($$723948$i))|0;
+ HEAP32[$699>>2] = $701;
+ $702 = ((($$749$i)) + 8|0);
+ $703 = $702;
+ $704 = $703 & 7;
+ $705 = ($704|0)==(0);
+ $706 = (0 - ($703))|0;
+ $707 = $706 & 7;
+ $708 = $705 ? 0 : $707;
+ $709 = (($$749$i) + ($708)|0);
+ $710 = ((($689)) + 8|0);
+ $711 = $710;
+ $712 = $711 & 7;
+ $713 = ($712|0)==(0);
+ $714 = (0 - ($711))|0;
+ $715 = $714 & 7;
+ $716 = $713 ? 0 : $715;
+ $717 = (($689) + ($716)|0);
+ $718 = $717;
+ $719 = $709;
+ $720 = (($718) - ($719))|0;
+ $721 = (($709) + ($$0197)|0);
+ $722 = (($720) - ($$0197))|0;
+ $723 = $$0197 | 3;
+ $724 = ((($709)) + 4|0);
+ HEAP32[$724>>2] = $723;
+ $725 = ($717|0)==($630|0);
+ do {
+ if ($725) {
+ $726 = HEAP32[(23028)>>2]|0;
+ $727 = (($726) + ($722))|0;
+ HEAP32[(23028)>>2] = $727;
+ HEAP32[(23040)>>2] = $721;
+ $728 = $727 | 1;
+ $729 = ((($721)) + 4|0);
+ HEAP32[$729>>2] = $728;
+ } else {
+ $730 = HEAP32[(23036)>>2]|0;
+ $731 = ($717|0)==($730|0);
+ if ($731) {
+ $732 = HEAP32[(23024)>>2]|0;
+ $733 = (($732) + ($722))|0;
+ HEAP32[(23024)>>2] = $733;
+ HEAP32[(23036)>>2] = $721;
+ $734 = $733 | 1;
+ $735 = ((($721)) + 4|0);
+ HEAP32[$735>>2] = $734;
+ $736 = (($721) + ($733)|0);
+ HEAP32[$736>>2] = $733;
+ break;
+ }
+ $737 = ((($717)) + 4|0);
+ $738 = HEAP32[$737>>2]|0;
+ $739 = $738 & 3;
+ $740 = ($739|0)==(1);
+ if ($740) {
+ $741 = $738 & -8;
+ $742 = $738 >>> 3;
+ $743 = ($738>>>0)<(256);
+ L314: do {
+ if ($743) {
+ $744 = ((($717)) + 8|0);
+ $745 = HEAP32[$744>>2]|0;
+ $746 = ((($717)) + 12|0);
+ $747 = HEAP32[$746>>2]|0;
+ $748 = $742 << 1;
+ $749 = (23056 + ($748<<2)|0);
+ $750 = ($745|0)==($749|0);
+ do {
+ if (!($750)) {
+ $751 = ($745>>>0)<($752>>>0);
+ if ($751) {
+ _abort();
+ // unreachable;
+ }
+ $753 = ((($745)) + 12|0);
+ $754 = HEAP32[$753>>2]|0;
+ $755 = ($754|0)==($717|0);
+ if ($755) {
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ $756 = ($747|0)==($745|0);
+ if ($756) {
+ $757 = 1 << $742;
+ $758 = $757 ^ -1;
+ $759 = HEAP32[5754]|0;
+ $760 = $759 & $758;
+ HEAP32[5754] = $760;
+ break;
+ }
+ $761 = ($747|0)==($749|0);
+ do {
+ if ($761) {
+ $$pre10$i$i = ((($747)) + 8|0);
+ $$pre$phi11$i$iZ2D = $$pre10$i$i;
+ } else {
+ $762 = ($747>>>0)<($752>>>0);
+ if ($762) {
+ _abort();
+ // unreachable;
+ }
+ $763 = ((($747)) + 8|0);
+ $764 = HEAP32[$763>>2]|0;
+ $765 = ($764|0)==($717|0);
+ if ($765) {
+ $$pre$phi11$i$iZ2D = $763;
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ $766 = ((($745)) + 12|0);
+ HEAP32[$766>>2] = $747;
+ HEAP32[$$pre$phi11$i$iZ2D>>2] = $745;
+ } else {
+ $767 = ((($717)) + 24|0);
+ $768 = HEAP32[$767>>2]|0;
+ $769 = ((($717)) + 12|0);
+ $770 = HEAP32[$769>>2]|0;
+ $771 = ($770|0)==($717|0);
+ do {
+ if ($771) {
+ $781 = ((($717)) + 16|0);
+ $782 = ((($781)) + 4|0);
+ $783 = HEAP32[$782>>2]|0;
+ $784 = ($783|0)==(0|0);
+ if ($784) {
+ $785 = HEAP32[$781>>2]|0;
+ $786 = ($785|0)==(0|0);
+ if ($786) {
+ $$3$i$i = 0;
+ break;
+ } else {
+ $$1291$i$i = $785;$$1293$i$i = $781;
+ }
+ } else {
+ $$1291$i$i = $783;$$1293$i$i = $782;
+ }
+ while(1) {
+ $787 = ((($$1291$i$i)) + 20|0);
+ $788 = HEAP32[$787>>2]|0;
+ $789 = ($788|0)==(0|0);
+ if (!($789)) {
+ $$1291$i$i = $788;$$1293$i$i = $787;
+ continue;
+ }
+ $790 = ((($$1291$i$i)) + 16|0);
+ $791 = HEAP32[$790>>2]|0;
+ $792 = ($791|0)==(0|0);
+ if ($792) {
+ break;
+ } else {
+ $$1291$i$i = $791;$$1293$i$i = $790;
+ }
+ }
+ $793 = ($$1293$i$i>>>0)<($752>>>0);
+ if ($793) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1293$i$i>>2] = 0;
+ $$3$i$i = $$1291$i$i;
+ break;
+ }
+ } else {
+ $772 = ((($717)) + 8|0);
+ $773 = HEAP32[$772>>2]|0;
+ $774 = ($773>>>0)<($752>>>0);
+ if ($774) {
+ _abort();
+ // unreachable;
+ }
+ $775 = ((($773)) + 12|0);
+ $776 = HEAP32[$775>>2]|0;
+ $777 = ($776|0)==($717|0);
+ if (!($777)) {
+ _abort();
+ // unreachable;
+ }
+ $778 = ((($770)) + 8|0);
+ $779 = HEAP32[$778>>2]|0;
+ $780 = ($779|0)==($717|0);
+ if ($780) {
+ HEAP32[$775>>2] = $770;
+ HEAP32[$778>>2] = $773;
+ $$3$i$i = $770;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $794 = ($768|0)==(0|0);
+ if ($794) {
+ break;
+ }
+ $795 = ((($717)) + 28|0);
+ $796 = HEAP32[$795>>2]|0;
+ $797 = (23320 + ($796<<2)|0);
+ $798 = HEAP32[$797>>2]|0;
+ $799 = ($717|0)==($798|0);
+ do {
+ if ($799) {
+ HEAP32[$797>>2] = $$3$i$i;
+ $cond$i$i = ($$3$i$i|0)==(0|0);
+ if (!($cond$i$i)) {
+ break;
+ }
+ $800 = 1 << $796;
+ $801 = $800 ^ -1;
+ $802 = HEAP32[(23020)>>2]|0;
+ $803 = $802 & $801;
+ HEAP32[(23020)>>2] = $803;
+ break L314;
+ } else {
+ $804 = HEAP32[(23032)>>2]|0;
+ $805 = ($768>>>0)<($804>>>0);
+ if ($805) {
+ _abort();
+ // unreachable;
+ } else {
+ $806 = ((($768)) + 16|0);
+ $807 = HEAP32[$806>>2]|0;
+ $not$$i17$i = ($807|0)!=($717|0);
+ $$sink1$i$i = $not$$i17$i&1;
+ $808 = (((($768)) + 16|0) + ($$sink1$i$i<<2)|0);
+ HEAP32[$808>>2] = $$3$i$i;
+ $809 = ($$3$i$i|0)==(0|0);
+ if ($809) {
+ break L314;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $810 = HEAP32[(23032)>>2]|0;
+ $811 = ($$3$i$i>>>0)<($810>>>0);
+ if ($811) {
+ _abort();
+ // unreachable;
+ }
+ $812 = ((($$3$i$i)) + 24|0);
+ HEAP32[$812>>2] = $768;
+ $813 = ((($717)) + 16|0);
+ $814 = HEAP32[$813>>2]|0;
+ $815 = ($814|0)==(0|0);
+ do {
+ if (!($815)) {
+ $816 = ($814>>>0)<($810>>>0);
+ if ($816) {
+ _abort();
+ // unreachable;
+ } else {
+ $817 = ((($$3$i$i)) + 16|0);
+ HEAP32[$817>>2] = $814;
+ $818 = ((($814)) + 24|0);
+ HEAP32[$818>>2] = $$3$i$i;
+ break;
+ }
+ }
+ } while(0);
+ $819 = ((($813)) + 4|0);
+ $820 = HEAP32[$819>>2]|0;
+ $821 = ($820|0)==(0|0);
+ if ($821) {
+ break;
+ }
+ $822 = HEAP32[(23032)>>2]|0;
+ $823 = ($820>>>0)<($822>>>0);
+ if ($823) {
+ _abort();
+ // unreachable;
+ } else {
+ $824 = ((($$3$i$i)) + 20|0);
+ HEAP32[$824>>2] = $820;
+ $825 = ((($820)) + 24|0);
+ HEAP32[$825>>2] = $$3$i$i;
+ break;
+ }
+ }
+ } while(0);
+ $826 = (($717) + ($741)|0);
+ $827 = (($741) + ($722))|0;
+ $$0$i18$i = $826;$$0287$i$i = $827;
+ } else {
+ $$0$i18$i = $717;$$0287$i$i = $722;
+ }
+ $828 = ((($$0$i18$i)) + 4|0);
+ $829 = HEAP32[$828>>2]|0;
+ $830 = $829 & -2;
+ HEAP32[$828>>2] = $830;
+ $831 = $$0287$i$i | 1;
+ $832 = ((($721)) + 4|0);
+ HEAP32[$832>>2] = $831;
+ $833 = (($721) + ($$0287$i$i)|0);
+ HEAP32[$833>>2] = $$0287$i$i;
+ $834 = $$0287$i$i >>> 3;
+ $835 = ($$0287$i$i>>>0)<(256);
+ if ($835) {
+ $836 = $834 << 1;
+ $837 = (23056 + ($836<<2)|0);
+ $838 = HEAP32[5754]|0;
+ $839 = 1 << $834;
+ $840 = $838 & $839;
+ $841 = ($840|0)==(0);
+ do {
+ if ($841) {
+ $842 = $838 | $839;
+ HEAP32[5754] = $842;
+ $$pre$i19$i = ((($837)) + 8|0);
+ $$0295$i$i = $837;$$pre$phi$i20$iZ2D = $$pre$i19$i;
+ } else {
+ $843 = ((($837)) + 8|0);
+ $844 = HEAP32[$843>>2]|0;
+ $845 = HEAP32[(23032)>>2]|0;
+ $846 = ($844>>>0)<($845>>>0);
+ if (!($846)) {
+ $$0295$i$i = $844;$$pre$phi$i20$iZ2D = $843;
+ break;
+ }
+ _abort();
+ // unreachable;
+ }
+ } while(0);
+ HEAP32[$$pre$phi$i20$iZ2D>>2] = $721;
+ $847 = ((($$0295$i$i)) + 12|0);
+ HEAP32[$847>>2] = $721;
+ $848 = ((($721)) + 8|0);
+ HEAP32[$848>>2] = $$0295$i$i;
+ $849 = ((($721)) + 12|0);
+ HEAP32[$849>>2] = $837;
+ break;
+ }
+ $850 = $$0287$i$i >>> 8;
+ $851 = ($850|0)==(0);
+ do {
+ if ($851) {
+ $$0296$i$i = 0;
+ } else {
+ $852 = ($$0287$i$i>>>0)>(16777215);
+ if ($852) {
+ $$0296$i$i = 31;
+ break;
+ }
+ $853 = (($850) + 1048320)|0;
+ $854 = $853 >>> 16;
+ $855 = $854 & 8;
+ $856 = $850 << $855;
+ $857 = (($856) + 520192)|0;
+ $858 = $857 >>> 16;
+ $859 = $858 & 4;
+ $860 = $859 | $855;
+ $861 = $856 << $859;
+ $862 = (($861) + 245760)|0;
+ $863 = $862 >>> 16;
+ $864 = $863 & 2;
+ $865 = $860 | $864;
+ $866 = (14 - ($865))|0;
+ $867 = $861 << $864;
+ $868 = $867 >>> 15;
+ $869 = (($866) + ($868))|0;
+ $870 = $869 << 1;
+ $871 = (($869) + 7)|0;
+ $872 = $$0287$i$i >>> $871;
+ $873 = $872 & 1;
+ $874 = $873 | $870;
+ $$0296$i$i = $874;
+ }
+ } while(0);
+ $875 = (23320 + ($$0296$i$i<<2)|0);
+ $876 = ((($721)) + 28|0);
+ HEAP32[$876>>2] = $$0296$i$i;
+ $877 = ((($721)) + 16|0);
+ $878 = ((($877)) + 4|0);
+ HEAP32[$878>>2] = 0;
+ HEAP32[$877>>2] = 0;
+ $879 = HEAP32[(23020)>>2]|0;
+ $880 = 1 << $$0296$i$i;
+ $881 = $879 & $880;
+ $882 = ($881|0)==(0);
+ if ($882) {
+ $883 = $879 | $880;
+ HEAP32[(23020)>>2] = $883;
+ HEAP32[$875>>2] = $721;
+ $884 = ((($721)) + 24|0);
+ HEAP32[$884>>2] = $875;
+ $885 = ((($721)) + 12|0);
+ HEAP32[$885>>2] = $721;
+ $886 = ((($721)) + 8|0);
+ HEAP32[$886>>2] = $721;
+ break;
+ }
+ $887 = HEAP32[$875>>2]|0;
+ $888 = ($$0296$i$i|0)==(31);
+ $889 = $$0296$i$i >>> 1;
+ $890 = (25 - ($889))|0;
+ $891 = $888 ? 0 : $890;
+ $892 = $$0287$i$i << $891;
+ $$0288$i$i = $892;$$0289$i$i = $887;
+ while(1) {
+ $893 = ((($$0289$i$i)) + 4|0);
+ $894 = HEAP32[$893>>2]|0;
+ $895 = $894 & -8;
+ $896 = ($895|0)==($$0287$i$i|0);
+ if ($896) {
+ label = 265;
+ break;
+ }
+ $897 = $$0288$i$i >>> 31;
+ $898 = (((($$0289$i$i)) + 16|0) + ($897<<2)|0);
+ $899 = $$0288$i$i << 1;
+ $900 = HEAP32[$898>>2]|0;
+ $901 = ($900|0)==(0|0);
+ if ($901) {
+ label = 262;
+ break;
+ } else {
+ $$0288$i$i = $899;$$0289$i$i = $900;
+ }
+ }
+ if ((label|0) == 262) {
+ $902 = HEAP32[(23032)>>2]|0;
+ $903 = ($898>>>0)<($902>>>0);
+ if ($903) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$898>>2] = $721;
+ $904 = ((($721)) + 24|0);
+ HEAP32[$904>>2] = $$0289$i$i;
+ $905 = ((($721)) + 12|0);
+ HEAP32[$905>>2] = $721;
+ $906 = ((($721)) + 8|0);
+ HEAP32[$906>>2] = $721;
+ break;
+ }
+ }
+ else if ((label|0) == 265) {
+ $907 = ((($$0289$i$i)) + 8|0);
+ $908 = HEAP32[$907>>2]|0;
+ $909 = HEAP32[(23032)>>2]|0;
+ $910 = ($908>>>0)>=($909>>>0);
+ $not$7$i$i = ($$0289$i$i>>>0)>=($909>>>0);
+ $911 = $910 & $not$7$i$i;
+ if ($911) {
+ $912 = ((($908)) + 12|0);
+ HEAP32[$912>>2] = $721;
+ HEAP32[$907>>2] = $721;
+ $913 = ((($721)) + 8|0);
+ HEAP32[$913>>2] = $908;
+ $914 = ((($721)) + 12|0);
+ HEAP32[$914>>2] = $$0289$i$i;
+ $915 = ((($721)) + 24|0);
+ HEAP32[$915>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ }
+ } while(0);
+ $1047 = ((($709)) + 8|0);
+ $$0 = $1047;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $$0$i$i$i = (23464);
+ while(1) {
+ $916 = HEAP32[$$0$i$i$i>>2]|0;
+ $917 = ($916>>>0)>($630>>>0);
+ if (!($917)) {
+ $918 = ((($$0$i$i$i)) + 4|0);
+ $919 = HEAP32[$918>>2]|0;
+ $920 = (($916) + ($919)|0);
+ $921 = ($920>>>0)>($630>>>0);
+ if ($921) {
+ break;
+ }
+ }
+ $922 = ((($$0$i$i$i)) + 8|0);
+ $923 = HEAP32[$922>>2]|0;
+ $$0$i$i$i = $923;
+ }
+ $924 = ((($920)) + -47|0);
+ $925 = ((($924)) + 8|0);
+ $926 = $925;
+ $927 = $926 & 7;
+ $928 = ($927|0)==(0);
+ $929 = (0 - ($926))|0;
+ $930 = $929 & 7;
+ $931 = $928 ? 0 : $930;
+ $932 = (($924) + ($931)|0);
+ $933 = ((($630)) + 16|0);
+ $934 = ($932>>>0)<($933>>>0);
+ $935 = $934 ? $630 : $932;
+ $936 = ((($935)) + 8|0);
+ $937 = ((($935)) + 24|0);
+ $938 = (($$723948$i) + -40)|0;
+ $939 = ((($$749$i)) + 8|0);
+ $940 = $939;
+ $941 = $940 & 7;
+ $942 = ($941|0)==(0);
+ $943 = (0 - ($940))|0;
+ $944 = $943 & 7;
+ $945 = $942 ? 0 : $944;
+ $946 = (($$749$i) + ($945)|0);
+ $947 = (($938) - ($945))|0;
+ HEAP32[(23040)>>2] = $946;
+ HEAP32[(23028)>>2] = $947;
+ $948 = $947 | 1;
+ $949 = ((($946)) + 4|0);
+ HEAP32[$949>>2] = $948;
+ $950 = (($946) + ($947)|0);
+ $951 = ((($950)) + 4|0);
+ HEAP32[$951>>2] = 40;
+ $952 = HEAP32[(23504)>>2]|0;
+ HEAP32[(23044)>>2] = $952;
+ $953 = ((($935)) + 4|0);
+ HEAP32[$953>>2] = 27;
+ ;HEAP32[$936>>2]=HEAP32[(23464)>>2]|0;HEAP32[$936+4>>2]=HEAP32[(23464)+4>>2]|0;HEAP32[$936+8>>2]=HEAP32[(23464)+8>>2]|0;HEAP32[$936+12>>2]=HEAP32[(23464)+12>>2]|0;
+ HEAP32[(23464)>>2] = $$749$i;
+ HEAP32[(23468)>>2] = $$723948$i;
+ HEAP32[(23476)>>2] = 0;
+ HEAP32[(23472)>>2] = $936;
+ $955 = $937;
+ while(1) {
+ $954 = ((($955)) + 4|0);
+ HEAP32[$954>>2] = 7;
+ $956 = ((($955)) + 8|0);
+ $957 = ($956>>>0)<($920>>>0);
+ if ($957) {
+ $955 = $954;
+ } else {
+ break;
+ }
+ }
+ $958 = ($935|0)==($630|0);
+ if (!($958)) {
+ $959 = $935;
+ $960 = $630;
+ $961 = (($959) - ($960))|0;
+ $962 = HEAP32[$953>>2]|0;
+ $963 = $962 & -2;
+ HEAP32[$953>>2] = $963;
+ $964 = $961 | 1;
+ $965 = ((($630)) + 4|0);
+ HEAP32[$965>>2] = $964;
+ HEAP32[$935>>2] = $961;
+ $966 = $961 >>> 3;
+ $967 = ($961>>>0)<(256);
+ if ($967) {
+ $968 = $966 << 1;
+ $969 = (23056 + ($968<<2)|0);
+ $970 = HEAP32[5754]|0;
+ $971 = 1 << $966;
+ $972 = $970 & $971;
+ $973 = ($972|0)==(0);
+ if ($973) {
+ $974 = $970 | $971;
+ HEAP32[5754] = $974;
+ $$pre$i$i = ((($969)) + 8|0);
+ $$0211$i$i = $969;$$pre$phi$i$iZ2D = $$pre$i$i;
+ } else {
+ $975 = ((($969)) + 8|0);
+ $976 = HEAP32[$975>>2]|0;
+ $977 = HEAP32[(23032)>>2]|0;
+ $978 = ($976>>>0)<($977>>>0);
+ if ($978) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0211$i$i = $976;$$pre$phi$i$iZ2D = $975;
+ }
+ }
+ HEAP32[$$pre$phi$i$iZ2D>>2] = $630;
+ $979 = ((($$0211$i$i)) + 12|0);
+ HEAP32[$979>>2] = $630;
+ $980 = ((($630)) + 8|0);
+ HEAP32[$980>>2] = $$0211$i$i;
+ $981 = ((($630)) + 12|0);
+ HEAP32[$981>>2] = $969;
+ break;
+ }
+ $982 = $961 >>> 8;
+ $983 = ($982|0)==(0);
+ if ($983) {
+ $$0212$i$i = 0;
+ } else {
+ $984 = ($961>>>0)>(16777215);
+ if ($984) {
+ $$0212$i$i = 31;
+ } else {
+ $985 = (($982) + 1048320)|0;
+ $986 = $985 >>> 16;
+ $987 = $986 & 8;
+ $988 = $982 << $987;
+ $989 = (($988) + 520192)|0;
+ $990 = $989 >>> 16;
+ $991 = $990 & 4;
+ $992 = $991 | $987;
+ $993 = $988 << $991;
+ $994 = (($993) + 245760)|0;
+ $995 = $994 >>> 16;
+ $996 = $995 & 2;
+ $997 = $992 | $996;
+ $998 = (14 - ($997))|0;
+ $999 = $993 << $996;
+ $1000 = $999 >>> 15;
+ $1001 = (($998) + ($1000))|0;
+ $1002 = $1001 << 1;
+ $1003 = (($1001) + 7)|0;
+ $1004 = $961 >>> $1003;
+ $1005 = $1004 & 1;
+ $1006 = $1005 | $1002;
+ $$0212$i$i = $1006;
+ }
+ }
+ $1007 = (23320 + ($$0212$i$i<<2)|0);
+ $1008 = ((($630)) + 28|0);
+ HEAP32[$1008>>2] = $$0212$i$i;
+ $1009 = ((($630)) + 20|0);
+ HEAP32[$1009>>2] = 0;
+ HEAP32[$933>>2] = 0;
+ $1010 = HEAP32[(23020)>>2]|0;
+ $1011 = 1 << $$0212$i$i;
+ $1012 = $1010 & $1011;
+ $1013 = ($1012|0)==(0);
+ if ($1013) {
+ $1014 = $1010 | $1011;
+ HEAP32[(23020)>>2] = $1014;
+ HEAP32[$1007>>2] = $630;
+ $1015 = ((($630)) + 24|0);
+ HEAP32[$1015>>2] = $1007;
+ $1016 = ((($630)) + 12|0);
+ HEAP32[$1016>>2] = $630;
+ $1017 = ((($630)) + 8|0);
+ HEAP32[$1017>>2] = $630;
+ break;
+ }
+ $1018 = HEAP32[$1007>>2]|0;
+ $1019 = ($$0212$i$i|0)==(31);
+ $1020 = $$0212$i$i >>> 1;
+ $1021 = (25 - ($1020))|0;
+ $1022 = $1019 ? 0 : $1021;
+ $1023 = $961 << $1022;
+ $$0206$i$i = $1023;$$0207$i$i = $1018;
+ while(1) {
+ $1024 = ((($$0207$i$i)) + 4|0);
+ $1025 = HEAP32[$1024>>2]|0;
+ $1026 = $1025 & -8;
+ $1027 = ($1026|0)==($961|0);
+ if ($1027) {
+ label = 292;
+ break;
+ }
+ $1028 = $$0206$i$i >>> 31;
+ $1029 = (((($$0207$i$i)) + 16|0) + ($1028<<2)|0);
+ $1030 = $$0206$i$i << 1;
+ $1031 = HEAP32[$1029>>2]|0;
+ $1032 = ($1031|0)==(0|0);
+ if ($1032) {
+ label = 289;
+ break;
+ } else {
+ $$0206$i$i = $1030;$$0207$i$i = $1031;
+ }
+ }
+ if ((label|0) == 289) {
+ $1033 = HEAP32[(23032)>>2]|0;
+ $1034 = ($1029>>>0)<($1033>>>0);
+ if ($1034) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$1029>>2] = $630;
+ $1035 = ((($630)) + 24|0);
+ HEAP32[$1035>>2] = $$0207$i$i;
+ $1036 = ((($630)) + 12|0);
+ HEAP32[$1036>>2] = $630;
+ $1037 = ((($630)) + 8|0);
+ HEAP32[$1037>>2] = $630;
+ break;
+ }
+ }
+ else if ((label|0) == 292) {
+ $1038 = ((($$0207$i$i)) + 8|0);
+ $1039 = HEAP32[$1038>>2]|0;
+ $1040 = HEAP32[(23032)>>2]|0;
+ $1041 = ($1039>>>0)>=($1040>>>0);
+ $not$$i$i = ($$0207$i$i>>>0)>=($1040>>>0);
+ $1042 = $1041 & $not$$i$i;
+ if ($1042) {
+ $1043 = ((($1039)) + 12|0);
+ HEAP32[$1043>>2] = $630;
+ HEAP32[$1038>>2] = $630;
+ $1044 = ((($630)) + 8|0);
+ HEAP32[$1044>>2] = $1039;
+ $1045 = ((($630)) + 12|0);
+ HEAP32[$1045>>2] = $$0207$i$i;
+ $1046 = ((($630)) + 24|0);
+ HEAP32[$1046>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ }
+ }
+ } while(0);
+ $1048 = HEAP32[(23028)>>2]|0;
+ $1049 = ($1048>>>0)>($$0197>>>0);
+ if ($1049) {
+ $1050 = (($1048) - ($$0197))|0;
+ HEAP32[(23028)>>2] = $1050;
+ $1051 = HEAP32[(23040)>>2]|0;
+ $1052 = (($1051) + ($$0197)|0);
+ HEAP32[(23040)>>2] = $1052;
+ $1053 = $1050 | 1;
+ $1054 = ((($1052)) + 4|0);
+ HEAP32[$1054>>2] = $1053;
+ $1055 = $$0197 | 3;
+ $1056 = ((($1051)) + 4|0);
+ HEAP32[$1056>>2] = $1055;
+ $1057 = ((($1051)) + 8|0);
+ $$0 = $1057;
+ STACKTOP = sp;return ($$0|0);
+ }
+ }
+ $1058 = (___errno_location()|0);
+ HEAP32[$1058>>2] = 12;
+ $$0 = 0;
+ STACKTOP = sp;return ($$0|0);
+}
+function _free($0) {
+ $0 = $0|0;
+ var $$0212$i = 0, $$0212$in$i = 0, $$0383 = 0, $$0384 = 0, $$0396 = 0, $$0403 = 0, $$1 = 0, $$1382 = 0, $$1387 = 0, $$1390 = 0, $$1398 = 0, $$1402 = 0, $$2 = 0, $$3 = 0, $$3400 = 0, $$pre = 0, $$pre$phi443Z2D = 0, $$pre$phi445Z2D = 0, $$pre$phiZ2D = 0, $$pre442 = 0;
+ var $$pre444 = 0, $$sink3 = 0, $$sink5 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
+ var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
+ var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
+ var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
+ var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
+ var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
+ var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
+ var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
+ var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
+ var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
+ var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
+ var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0;
+ var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
+ var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0;
+ var $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0;
+ var $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0;
+ var $99 = 0, $cond421 = 0, $cond422 = 0, $not$ = 0, $not$405 = 0, $not$437 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $1 = ($0|0)==(0|0);
+ if ($1) {
+ return;
+ }
+ $2 = ((($0)) + -8|0);
+ $3 = HEAP32[(23032)>>2]|0;
+ $4 = ($2>>>0)<($3>>>0);
+ if ($4) {
+ _abort();
+ // unreachable;
+ }
+ $5 = ((($0)) + -4|0);
+ $6 = HEAP32[$5>>2]|0;
+ $7 = $6 & 3;
+ $8 = ($7|0)==(1);
+ if ($8) {
+ _abort();
+ // unreachable;
+ }
+ $9 = $6 & -8;
+ $10 = (($2) + ($9)|0);
+ $11 = $6 & 1;
+ $12 = ($11|0)==(0);
+ L10: do {
+ if ($12) {
+ $13 = HEAP32[$2>>2]|0;
+ $14 = ($7|0)==(0);
+ if ($14) {
+ return;
+ }
+ $15 = (0 - ($13))|0;
+ $16 = (($2) + ($15)|0);
+ $17 = (($13) + ($9))|0;
+ $18 = ($16>>>0)<($3>>>0);
+ if ($18) {
+ _abort();
+ // unreachable;
+ }
+ $19 = HEAP32[(23036)>>2]|0;
+ $20 = ($16|0)==($19|0);
+ if ($20) {
+ $104 = ((($10)) + 4|0);
+ $105 = HEAP32[$104>>2]|0;
+ $106 = $105 & 3;
+ $107 = ($106|0)==(3);
+ if (!($107)) {
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break;
+ }
+ $108 = (($16) + ($17)|0);
+ $109 = ((($16)) + 4|0);
+ $110 = $17 | 1;
+ $111 = $105 & -2;
+ HEAP32[(23024)>>2] = $17;
+ HEAP32[$104>>2] = $111;
+ HEAP32[$109>>2] = $110;
+ HEAP32[$108>>2] = $17;
+ return;
+ }
+ $21 = $13 >>> 3;
+ $22 = ($13>>>0)<(256);
+ if ($22) {
+ $23 = ((($16)) + 8|0);
+ $24 = HEAP32[$23>>2]|0;
+ $25 = ((($16)) + 12|0);
+ $26 = HEAP32[$25>>2]|0;
+ $27 = $21 << 1;
+ $28 = (23056 + ($27<<2)|0);
+ $29 = ($24|0)==($28|0);
+ if (!($29)) {
+ $30 = ($24>>>0)<($3>>>0);
+ if ($30) {
+ _abort();
+ // unreachable;
+ }
+ $31 = ((($24)) + 12|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = ($32|0)==($16|0);
+ if (!($33)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $34 = ($26|0)==($24|0);
+ if ($34) {
+ $35 = 1 << $21;
+ $36 = $35 ^ -1;
+ $37 = HEAP32[5754]|0;
+ $38 = $37 & $36;
+ HEAP32[5754] = $38;
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break;
+ }
+ $39 = ($26|0)==($28|0);
+ if ($39) {
+ $$pre444 = ((($26)) + 8|0);
+ $$pre$phi445Z2D = $$pre444;
+ } else {
+ $40 = ($26>>>0)<($3>>>0);
+ if ($40) {
+ _abort();
+ // unreachable;
+ }
+ $41 = ((($26)) + 8|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = ($42|0)==($16|0);
+ if ($43) {
+ $$pre$phi445Z2D = $41;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $44 = ((($24)) + 12|0);
+ HEAP32[$44>>2] = $26;
+ HEAP32[$$pre$phi445Z2D>>2] = $24;
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break;
+ }
+ $45 = ((($16)) + 24|0);
+ $46 = HEAP32[$45>>2]|0;
+ $47 = ((($16)) + 12|0);
+ $48 = HEAP32[$47>>2]|0;
+ $49 = ($48|0)==($16|0);
+ do {
+ if ($49) {
+ $59 = ((($16)) + 16|0);
+ $60 = ((($59)) + 4|0);
+ $61 = HEAP32[$60>>2]|0;
+ $62 = ($61|0)==(0|0);
+ if ($62) {
+ $63 = HEAP32[$59>>2]|0;
+ $64 = ($63|0)==(0|0);
+ if ($64) {
+ $$3 = 0;
+ break;
+ } else {
+ $$1387 = $63;$$1390 = $59;
+ }
+ } else {
+ $$1387 = $61;$$1390 = $60;
+ }
+ while(1) {
+ $65 = ((($$1387)) + 20|0);
+ $66 = HEAP32[$65>>2]|0;
+ $67 = ($66|0)==(0|0);
+ if (!($67)) {
+ $$1387 = $66;$$1390 = $65;
+ continue;
+ }
+ $68 = ((($$1387)) + 16|0);
+ $69 = HEAP32[$68>>2]|0;
+ $70 = ($69|0)==(0|0);
+ if ($70) {
+ break;
+ } else {
+ $$1387 = $69;$$1390 = $68;
+ }
+ }
+ $71 = ($$1390>>>0)<($3>>>0);
+ if ($71) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1390>>2] = 0;
+ $$3 = $$1387;
+ break;
+ }
+ } else {
+ $50 = ((($16)) + 8|0);
+ $51 = HEAP32[$50>>2]|0;
+ $52 = ($51>>>0)<($3>>>0);
+ if ($52) {
+ _abort();
+ // unreachable;
+ }
+ $53 = ((($51)) + 12|0);
+ $54 = HEAP32[$53>>2]|0;
+ $55 = ($54|0)==($16|0);
+ if (!($55)) {
+ _abort();
+ // unreachable;
+ }
+ $56 = ((($48)) + 8|0);
+ $57 = HEAP32[$56>>2]|0;
+ $58 = ($57|0)==($16|0);
+ if ($58) {
+ HEAP32[$53>>2] = $48;
+ HEAP32[$56>>2] = $51;
+ $$3 = $48;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $72 = ($46|0)==(0|0);
+ if ($72) {
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ } else {
+ $73 = ((($16)) + 28|0);
+ $74 = HEAP32[$73>>2]|0;
+ $75 = (23320 + ($74<<2)|0);
+ $76 = HEAP32[$75>>2]|0;
+ $77 = ($16|0)==($76|0);
+ do {
+ if ($77) {
+ HEAP32[$75>>2] = $$3;
+ $cond421 = ($$3|0)==(0|0);
+ if ($cond421) {
+ $78 = 1 << $74;
+ $79 = $78 ^ -1;
+ $80 = HEAP32[(23020)>>2]|0;
+ $81 = $80 & $79;
+ HEAP32[(23020)>>2] = $81;
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break L10;
+ }
+ } else {
+ $82 = HEAP32[(23032)>>2]|0;
+ $83 = ($46>>>0)<($82>>>0);
+ if ($83) {
+ _abort();
+ // unreachable;
+ } else {
+ $84 = ((($46)) + 16|0);
+ $85 = HEAP32[$84>>2]|0;
+ $not$405 = ($85|0)!=($16|0);
+ $$sink3 = $not$405&1;
+ $86 = (((($46)) + 16|0) + ($$sink3<<2)|0);
+ HEAP32[$86>>2] = $$3;
+ $87 = ($$3|0)==(0|0);
+ if ($87) {
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break L10;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $88 = HEAP32[(23032)>>2]|0;
+ $89 = ($$3>>>0)<($88>>>0);
+ if ($89) {
+ _abort();
+ // unreachable;
+ }
+ $90 = ((($$3)) + 24|0);
+ HEAP32[$90>>2] = $46;
+ $91 = ((($16)) + 16|0);
+ $92 = HEAP32[$91>>2]|0;
+ $93 = ($92|0)==(0|0);
+ do {
+ if (!($93)) {
+ $94 = ($92>>>0)<($88>>>0);
+ if ($94) {
+ _abort();
+ // unreachable;
+ } else {
+ $95 = ((($$3)) + 16|0);
+ HEAP32[$95>>2] = $92;
+ $96 = ((($92)) + 24|0);
+ HEAP32[$96>>2] = $$3;
+ break;
+ }
+ }
+ } while(0);
+ $97 = ((($91)) + 4|0);
+ $98 = HEAP32[$97>>2]|0;
+ $99 = ($98|0)==(0|0);
+ if ($99) {
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ } else {
+ $100 = HEAP32[(23032)>>2]|0;
+ $101 = ($98>>>0)<($100>>>0);
+ if ($101) {
+ _abort();
+ // unreachable;
+ } else {
+ $102 = ((($$3)) + 20|0);
+ HEAP32[$102>>2] = $98;
+ $103 = ((($98)) + 24|0);
+ HEAP32[$103>>2] = $$3;
+ $$1 = $16;$$1382 = $17;$113 = $16;
+ break;
+ }
+ }
+ }
+ } else {
+ $$1 = $2;$$1382 = $9;$113 = $2;
+ }
+ } while(0);
+ $112 = ($113>>>0)<($10>>>0);
+ if (!($112)) {
+ _abort();
+ // unreachable;
+ }
+ $114 = ((($10)) + 4|0);
+ $115 = HEAP32[$114>>2]|0;
+ $116 = $115 & 1;
+ $117 = ($116|0)==(0);
+ if ($117) {
+ _abort();
+ // unreachable;
+ }
+ $118 = $115 & 2;
+ $119 = ($118|0)==(0);
+ if ($119) {
+ $120 = HEAP32[(23040)>>2]|0;
+ $121 = ($10|0)==($120|0);
+ $122 = HEAP32[(23036)>>2]|0;
+ if ($121) {
+ $123 = HEAP32[(23028)>>2]|0;
+ $124 = (($123) + ($$1382))|0;
+ HEAP32[(23028)>>2] = $124;
+ HEAP32[(23040)>>2] = $$1;
+ $125 = $124 | 1;
+ $126 = ((($$1)) + 4|0);
+ HEAP32[$126>>2] = $125;
+ $127 = ($$1|0)==($122|0);
+ if (!($127)) {
+ return;
+ }
+ HEAP32[(23036)>>2] = 0;
+ HEAP32[(23024)>>2] = 0;
+ return;
+ }
+ $128 = ($10|0)==($122|0);
+ if ($128) {
+ $129 = HEAP32[(23024)>>2]|0;
+ $130 = (($129) + ($$1382))|0;
+ HEAP32[(23024)>>2] = $130;
+ HEAP32[(23036)>>2] = $113;
+ $131 = $130 | 1;
+ $132 = ((($$1)) + 4|0);
+ HEAP32[$132>>2] = $131;
+ $133 = (($113) + ($130)|0);
+ HEAP32[$133>>2] = $130;
+ return;
+ }
+ $134 = $115 & -8;
+ $135 = (($134) + ($$1382))|0;
+ $136 = $115 >>> 3;
+ $137 = ($115>>>0)<(256);
+ L108: do {
+ if ($137) {
+ $138 = ((($10)) + 8|0);
+ $139 = HEAP32[$138>>2]|0;
+ $140 = ((($10)) + 12|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = $136 << 1;
+ $143 = (23056 + ($142<<2)|0);
+ $144 = ($139|0)==($143|0);
+ if (!($144)) {
+ $145 = HEAP32[(23032)>>2]|0;
+ $146 = ($139>>>0)<($145>>>0);
+ if ($146) {
+ _abort();
+ // unreachable;
+ }
+ $147 = ((($139)) + 12|0);
+ $148 = HEAP32[$147>>2]|0;
+ $149 = ($148|0)==($10|0);
+ if (!($149)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $150 = ($141|0)==($139|0);
+ if ($150) {
+ $151 = 1 << $136;
+ $152 = $151 ^ -1;
+ $153 = HEAP32[5754]|0;
+ $154 = $153 & $152;
+ HEAP32[5754] = $154;
+ break;
+ }
+ $155 = ($141|0)==($143|0);
+ if ($155) {
+ $$pre442 = ((($141)) + 8|0);
+ $$pre$phi443Z2D = $$pre442;
+ } else {
+ $156 = HEAP32[(23032)>>2]|0;
+ $157 = ($141>>>0)<($156>>>0);
+ if ($157) {
+ _abort();
+ // unreachable;
+ }
+ $158 = ((($141)) + 8|0);
+ $159 = HEAP32[$158>>2]|0;
+ $160 = ($159|0)==($10|0);
+ if ($160) {
+ $$pre$phi443Z2D = $158;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $161 = ((($139)) + 12|0);
+ HEAP32[$161>>2] = $141;
+ HEAP32[$$pre$phi443Z2D>>2] = $139;
+ } else {
+ $162 = ((($10)) + 24|0);
+ $163 = HEAP32[$162>>2]|0;
+ $164 = ((($10)) + 12|0);
+ $165 = HEAP32[$164>>2]|0;
+ $166 = ($165|0)==($10|0);
+ do {
+ if ($166) {
+ $177 = ((($10)) + 16|0);
+ $178 = ((($177)) + 4|0);
+ $179 = HEAP32[$178>>2]|0;
+ $180 = ($179|0)==(0|0);
+ if ($180) {
+ $181 = HEAP32[$177>>2]|0;
+ $182 = ($181|0)==(0|0);
+ if ($182) {
+ $$3400 = 0;
+ break;
+ } else {
+ $$1398 = $181;$$1402 = $177;
+ }
+ } else {
+ $$1398 = $179;$$1402 = $178;
+ }
+ while(1) {
+ $183 = ((($$1398)) + 20|0);
+ $184 = HEAP32[$183>>2]|0;
+ $185 = ($184|0)==(0|0);
+ if (!($185)) {
+ $$1398 = $184;$$1402 = $183;
+ continue;
+ }
+ $186 = ((($$1398)) + 16|0);
+ $187 = HEAP32[$186>>2]|0;
+ $188 = ($187|0)==(0|0);
+ if ($188) {
+ break;
+ } else {
+ $$1398 = $187;$$1402 = $186;
+ }
+ }
+ $189 = HEAP32[(23032)>>2]|0;
+ $190 = ($$1402>>>0)<($189>>>0);
+ if ($190) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1402>>2] = 0;
+ $$3400 = $$1398;
+ break;
+ }
+ } else {
+ $167 = ((($10)) + 8|0);
+ $168 = HEAP32[$167>>2]|0;
+ $169 = HEAP32[(23032)>>2]|0;
+ $170 = ($168>>>0)<($169>>>0);
+ if ($170) {
+ _abort();
+ // unreachable;
+ }
+ $171 = ((($168)) + 12|0);
+ $172 = HEAP32[$171>>2]|0;
+ $173 = ($172|0)==($10|0);
+ if (!($173)) {
+ _abort();
+ // unreachable;
+ }
+ $174 = ((($165)) + 8|0);
+ $175 = HEAP32[$174>>2]|0;
+ $176 = ($175|0)==($10|0);
+ if ($176) {
+ HEAP32[$171>>2] = $165;
+ HEAP32[$174>>2] = $168;
+ $$3400 = $165;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $191 = ($163|0)==(0|0);
+ if (!($191)) {
+ $192 = ((($10)) + 28|0);
+ $193 = HEAP32[$192>>2]|0;
+ $194 = (23320 + ($193<<2)|0);
+ $195 = HEAP32[$194>>2]|0;
+ $196 = ($10|0)==($195|0);
+ do {
+ if ($196) {
+ HEAP32[$194>>2] = $$3400;
+ $cond422 = ($$3400|0)==(0|0);
+ if ($cond422) {
+ $197 = 1 << $193;
+ $198 = $197 ^ -1;
+ $199 = HEAP32[(23020)>>2]|0;
+ $200 = $199 & $198;
+ HEAP32[(23020)>>2] = $200;
+ break L108;
+ }
+ } else {
+ $201 = HEAP32[(23032)>>2]|0;
+ $202 = ($163>>>0)<($201>>>0);
+ if ($202) {
+ _abort();
+ // unreachable;
+ } else {
+ $203 = ((($163)) + 16|0);
+ $204 = HEAP32[$203>>2]|0;
+ $not$ = ($204|0)!=($10|0);
+ $$sink5 = $not$&1;
+ $205 = (((($163)) + 16|0) + ($$sink5<<2)|0);
+ HEAP32[$205>>2] = $$3400;
+ $206 = ($$3400|0)==(0|0);
+ if ($206) {
+ break L108;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $207 = HEAP32[(23032)>>2]|0;
+ $208 = ($$3400>>>0)<($207>>>0);
+ if ($208) {
+ _abort();
+ // unreachable;
+ }
+ $209 = ((($$3400)) + 24|0);
+ HEAP32[$209>>2] = $163;
+ $210 = ((($10)) + 16|0);
+ $211 = HEAP32[$210>>2]|0;
+ $212 = ($211|0)==(0|0);
+ do {
+ if (!($212)) {
+ $213 = ($211>>>0)<($207>>>0);
+ if ($213) {
+ _abort();
+ // unreachable;
+ } else {
+ $214 = ((($$3400)) + 16|0);
+ HEAP32[$214>>2] = $211;
+ $215 = ((($211)) + 24|0);
+ HEAP32[$215>>2] = $$3400;
+ break;
+ }
+ }
+ } while(0);
+ $216 = ((($210)) + 4|0);
+ $217 = HEAP32[$216>>2]|0;
+ $218 = ($217|0)==(0|0);
+ if (!($218)) {
+ $219 = HEAP32[(23032)>>2]|0;
+ $220 = ($217>>>0)<($219>>>0);
+ if ($220) {
+ _abort();
+ // unreachable;
+ } else {
+ $221 = ((($$3400)) + 20|0);
+ HEAP32[$221>>2] = $217;
+ $222 = ((($217)) + 24|0);
+ HEAP32[$222>>2] = $$3400;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $223 = $135 | 1;
+ $224 = ((($$1)) + 4|0);
+ HEAP32[$224>>2] = $223;
+ $225 = (($113) + ($135)|0);
+ HEAP32[$225>>2] = $135;
+ $226 = HEAP32[(23036)>>2]|0;
+ $227 = ($$1|0)==($226|0);
+ if ($227) {
+ HEAP32[(23024)>>2] = $135;
+ return;
+ } else {
+ $$2 = $135;
+ }
+ } else {
+ $228 = $115 & -2;
+ HEAP32[$114>>2] = $228;
+ $229 = $$1382 | 1;
+ $230 = ((($$1)) + 4|0);
+ HEAP32[$230>>2] = $229;
+ $231 = (($113) + ($$1382)|0);
+ HEAP32[$231>>2] = $$1382;
+ $$2 = $$1382;
+ }
+ $232 = $$2 >>> 3;
+ $233 = ($$2>>>0)<(256);
+ if ($233) {
+ $234 = $232 << 1;
+ $235 = (23056 + ($234<<2)|0);
+ $236 = HEAP32[5754]|0;
+ $237 = 1 << $232;
+ $238 = $236 & $237;
+ $239 = ($238|0)==(0);
+ if ($239) {
+ $240 = $236 | $237;
+ HEAP32[5754] = $240;
+ $$pre = ((($235)) + 8|0);
+ $$0403 = $235;$$pre$phiZ2D = $$pre;
+ } else {
+ $241 = ((($235)) + 8|0);
+ $242 = HEAP32[$241>>2]|0;
+ $243 = HEAP32[(23032)>>2]|0;
+ $244 = ($242>>>0)<($243>>>0);
+ if ($244) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0403 = $242;$$pre$phiZ2D = $241;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $$1;
+ $245 = ((($$0403)) + 12|0);
+ HEAP32[$245>>2] = $$1;
+ $246 = ((($$1)) + 8|0);
+ HEAP32[$246>>2] = $$0403;
+ $247 = ((($$1)) + 12|0);
+ HEAP32[$247>>2] = $235;
+ return;
+ }
+ $248 = $$2 >>> 8;
+ $249 = ($248|0)==(0);
+ if ($249) {
+ $$0396 = 0;
+ } else {
+ $250 = ($$2>>>0)>(16777215);
+ if ($250) {
+ $$0396 = 31;
+ } else {
+ $251 = (($248) + 1048320)|0;
+ $252 = $251 >>> 16;
+ $253 = $252 & 8;
+ $254 = $248 << $253;
+ $255 = (($254) + 520192)|0;
+ $256 = $255 >>> 16;
+ $257 = $256 & 4;
+ $258 = $257 | $253;
+ $259 = $254 << $257;
+ $260 = (($259) + 245760)|0;
+ $261 = $260 >>> 16;
+ $262 = $261 & 2;
+ $263 = $258 | $262;
+ $264 = (14 - ($263))|0;
+ $265 = $259 << $262;
+ $266 = $265 >>> 15;
+ $267 = (($264) + ($266))|0;
+ $268 = $267 << 1;
+ $269 = (($267) + 7)|0;
+ $270 = $$2 >>> $269;
+ $271 = $270 & 1;
+ $272 = $271 | $268;
+ $$0396 = $272;
+ }
+ }
+ $273 = (23320 + ($$0396<<2)|0);
+ $274 = ((($$1)) + 28|0);
+ HEAP32[$274>>2] = $$0396;
+ $275 = ((($$1)) + 16|0);
+ $276 = ((($$1)) + 20|0);
+ HEAP32[$276>>2] = 0;
+ HEAP32[$275>>2] = 0;
+ $277 = HEAP32[(23020)>>2]|0;
+ $278 = 1 << $$0396;
+ $279 = $277 & $278;
+ $280 = ($279|0)==(0);
+ do {
+ if ($280) {
+ $281 = $277 | $278;
+ HEAP32[(23020)>>2] = $281;
+ HEAP32[$273>>2] = $$1;
+ $282 = ((($$1)) + 24|0);
+ HEAP32[$282>>2] = $273;
+ $283 = ((($$1)) + 12|0);
+ HEAP32[$283>>2] = $$1;
+ $284 = ((($$1)) + 8|0);
+ HEAP32[$284>>2] = $$1;
+ } else {
+ $285 = HEAP32[$273>>2]|0;
+ $286 = ($$0396|0)==(31);
+ $287 = $$0396 >>> 1;
+ $288 = (25 - ($287))|0;
+ $289 = $286 ? 0 : $288;
+ $290 = $$2 << $289;
+ $$0383 = $290;$$0384 = $285;
+ while(1) {
+ $291 = ((($$0384)) + 4|0);
+ $292 = HEAP32[$291>>2]|0;
+ $293 = $292 & -8;
+ $294 = ($293|0)==($$2|0);
+ if ($294) {
+ label = 124;
+ break;
+ }
+ $295 = $$0383 >>> 31;
+ $296 = (((($$0384)) + 16|0) + ($295<<2)|0);
+ $297 = $$0383 << 1;
+ $298 = HEAP32[$296>>2]|0;
+ $299 = ($298|0)==(0|0);
+ if ($299) {
+ label = 121;
+ break;
+ } else {
+ $$0383 = $297;$$0384 = $298;
+ }
+ }
+ if ((label|0) == 121) {
+ $300 = HEAP32[(23032)>>2]|0;
+ $301 = ($296>>>0)<($300>>>0);
+ if ($301) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$296>>2] = $$1;
+ $302 = ((($$1)) + 24|0);
+ HEAP32[$302>>2] = $$0384;
+ $303 = ((($$1)) + 12|0);
+ HEAP32[$303>>2] = $$1;
+ $304 = ((($$1)) + 8|0);
+ HEAP32[$304>>2] = $$1;
+ break;
+ }
+ }
+ else if ((label|0) == 124) {
+ $305 = ((($$0384)) + 8|0);
+ $306 = HEAP32[$305>>2]|0;
+ $307 = HEAP32[(23032)>>2]|0;
+ $308 = ($306>>>0)>=($307>>>0);
+ $not$437 = ($$0384>>>0)>=($307>>>0);
+ $309 = $308 & $not$437;
+ if ($309) {
+ $310 = ((($306)) + 12|0);
+ HEAP32[$310>>2] = $$1;
+ HEAP32[$305>>2] = $$1;
+ $311 = ((($$1)) + 8|0);
+ HEAP32[$311>>2] = $306;
+ $312 = ((($$1)) + 12|0);
+ HEAP32[$312>>2] = $$0384;
+ $313 = ((($$1)) + 24|0);
+ HEAP32[$313>>2] = 0;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ }
+ } while(0);
+ $314 = HEAP32[(23048)>>2]|0;
+ $315 = (($314) + -1)|0;
+ HEAP32[(23048)>>2] = $315;
+ $316 = ($315|0)==(0);
+ if ($316) {
+ $$0212$in$i = (23472);
+ } else {
+ return;
+ }
+ while(1) {
+ $$0212$i = HEAP32[$$0212$in$i>>2]|0;
+ $317 = ($$0212$i|0)==(0|0);
+ $318 = ((($$0212$i)) + 8|0);
+ if ($317) {
+ break;
+ } else {
+ $$0212$in$i = $318;
+ }
+ }
+ HEAP32[(23048)>>2] = -1;
+ return;
+}
+function _realloc($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
+ var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ($0|0)==(0|0);
+ if ($2) {
+ $3 = (_malloc($1)|0);
+ $$1 = $3;
+ return ($$1|0);
+ }
+ $4 = ($1>>>0)>(4294967231);
+ if ($4) {
+ $5 = (___errno_location()|0);
+ HEAP32[$5>>2] = 12;
+ $$1 = 0;
+ return ($$1|0);
+ }
+ $6 = ($1>>>0)<(11);
+ $7 = (($1) + 11)|0;
+ $8 = $7 & -8;
+ $9 = $6 ? 16 : $8;
+ $10 = ((($0)) + -8|0);
+ $11 = (_try_realloc_chunk($10,$9)|0);
+ $12 = ($11|0)==(0|0);
+ if (!($12)) {
+ $13 = ((($11)) + 8|0);
+ $$1 = $13;
+ return ($$1|0);
+ }
+ $14 = (_malloc($1)|0);
+ $15 = ($14|0)==(0|0);
+ if ($15) {
+ $$1 = 0;
+ return ($$1|0);
+ }
+ $16 = ((($0)) + -4|0);
+ $17 = HEAP32[$16>>2]|0;
+ $18 = $17 & -8;
+ $19 = $17 & 3;
+ $20 = ($19|0)==(0);
+ $21 = $20 ? 8 : 4;
+ $22 = (($18) - ($21))|0;
+ $23 = ($22>>>0)<($1>>>0);
+ $24 = $23 ? $22 : $1;
+ _memcpy(($14|0),($0|0),($24|0))|0;
+ _free($0);
+ $$1 = $14;
+ return ($$1|0);
+}
+function _try_realloc_chunk($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$1272 = 0, $$1275 = 0, $$2 = 0, $$3 = 0, $$pre = 0, $$pre$phiZ2D = 0, $$sink1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0;
+ var $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0;
+ var $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0;
+ var $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0;
+ var $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
+ var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
+ var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
+ var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
+ var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
+ var $cond = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond$not = 0, $or$cond3 = 0, $storemerge = 0, $storemerge1 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = ((($0)) + 4|0);
+ $3 = HEAP32[$2>>2]|0;
+ $4 = $3 & -8;
+ $5 = (($0) + ($4)|0);
+ $6 = HEAP32[(23032)>>2]|0;
+ $7 = $3 & 3;
+ $notlhs = ($0>>>0)>=($6>>>0);
+ $notrhs = ($7|0)!=(1);
+ $or$cond$not = $notrhs & $notlhs;
+ $8 = ($0>>>0)<($5>>>0);
+ $or$cond3 = $or$cond$not & $8;
+ if (!($or$cond3)) {
+ _abort();
+ // unreachable;
+ }
+ $9 = ((($5)) + 4|0);
+ $10 = HEAP32[$9>>2]|0;
+ $11 = $10 & 1;
+ $12 = ($11|0)==(0);
+ if ($12) {
+ _abort();
+ // unreachable;
+ }
+ $13 = ($7|0)==(0);
+ if ($13) {
+ $14 = ($1>>>0)<(256);
+ if ($14) {
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $15 = (($1) + 4)|0;
+ $16 = ($4>>>0)<($15>>>0);
+ if (!($16)) {
+ $17 = (($4) - ($1))|0;
+ $18 = HEAP32[(23496)>>2]|0;
+ $19 = $18 << 1;
+ $20 = ($17>>>0)>($19>>>0);
+ if (!($20)) {
+ $$2 = $0;
+ return ($$2|0);
+ }
+ }
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $21 = ($4>>>0)<($1>>>0);
+ if (!($21)) {
+ $22 = (($4) - ($1))|0;
+ $23 = ($22>>>0)>(15);
+ if (!($23)) {
+ $$2 = $0;
+ return ($$2|0);
+ }
+ $24 = (($0) + ($1)|0);
+ $25 = $3 & 1;
+ $26 = $25 | $1;
+ $27 = $26 | 2;
+ HEAP32[$2>>2] = $27;
+ $28 = ((($24)) + 4|0);
+ $29 = $22 | 3;
+ HEAP32[$28>>2] = $29;
+ $30 = (($24) + ($22)|0);
+ $31 = ((($30)) + 4|0);
+ $32 = HEAP32[$31>>2]|0;
+ $33 = $32 | 1;
+ HEAP32[$31>>2] = $33;
+ _dispose_chunk($24,$22);
+ $$2 = $0;
+ return ($$2|0);
+ }
+ $34 = HEAP32[(23040)>>2]|0;
+ $35 = ($5|0)==($34|0);
+ if ($35) {
+ $36 = HEAP32[(23028)>>2]|0;
+ $37 = (($36) + ($4))|0;
+ $38 = ($37>>>0)>($1>>>0);
+ $39 = (($37) - ($1))|0;
+ $40 = (($0) + ($1)|0);
+ if (!($38)) {
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $41 = $39 | 1;
+ $42 = ((($40)) + 4|0);
+ $43 = $3 & 1;
+ $44 = $43 | $1;
+ $45 = $44 | 2;
+ HEAP32[$2>>2] = $45;
+ HEAP32[$42>>2] = $41;
+ HEAP32[(23040)>>2] = $40;
+ HEAP32[(23028)>>2] = $39;
+ $$2 = $0;
+ return ($$2|0);
+ }
+ $46 = HEAP32[(23036)>>2]|0;
+ $47 = ($5|0)==($46|0);
+ if ($47) {
+ $48 = HEAP32[(23024)>>2]|0;
+ $49 = (($48) + ($4))|0;
+ $50 = ($49>>>0)<($1>>>0);
+ if ($50) {
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $51 = (($49) - ($1))|0;
+ $52 = ($51>>>0)>(15);
+ $53 = $3 & 1;
+ if ($52) {
+ $54 = (($0) + ($1)|0);
+ $55 = (($54) + ($51)|0);
+ $56 = $53 | $1;
+ $57 = $56 | 2;
+ HEAP32[$2>>2] = $57;
+ $58 = ((($54)) + 4|0);
+ $59 = $51 | 1;
+ HEAP32[$58>>2] = $59;
+ HEAP32[$55>>2] = $51;
+ $60 = ((($55)) + 4|0);
+ $61 = HEAP32[$60>>2]|0;
+ $62 = $61 & -2;
+ HEAP32[$60>>2] = $62;
+ $storemerge = $54;$storemerge1 = $51;
+ } else {
+ $63 = $53 | $49;
+ $64 = $63 | 2;
+ HEAP32[$2>>2] = $64;
+ $65 = (($0) + ($49)|0);
+ $66 = ((($65)) + 4|0);
+ $67 = HEAP32[$66>>2]|0;
+ $68 = $67 | 1;
+ HEAP32[$66>>2] = $68;
+ $storemerge = 0;$storemerge1 = 0;
+ }
+ HEAP32[(23024)>>2] = $storemerge1;
+ HEAP32[(23036)>>2] = $storemerge;
+ $$2 = $0;
+ return ($$2|0);
+ }
+ $69 = $10 & 2;
+ $70 = ($69|0)==(0);
+ if (!($70)) {
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $71 = $10 & -8;
+ $72 = (($71) + ($4))|0;
+ $73 = ($72>>>0)<($1>>>0);
+ if ($73) {
+ $$2 = 0;
+ return ($$2|0);
+ }
+ $74 = (($72) - ($1))|0;
+ $75 = $10 >>> 3;
+ $76 = ($10>>>0)<(256);
+ L49: do {
+ if ($76) {
+ $77 = ((($5)) + 8|0);
+ $78 = HEAP32[$77>>2]|0;
+ $79 = ((($5)) + 12|0);
+ $80 = HEAP32[$79>>2]|0;
+ $81 = $75 << 1;
+ $82 = (23056 + ($81<<2)|0);
+ $83 = ($78|0)==($82|0);
+ if (!($83)) {
+ $84 = ($78>>>0)<($6>>>0);
+ if ($84) {
+ _abort();
+ // unreachable;
+ }
+ $85 = ((($78)) + 12|0);
+ $86 = HEAP32[$85>>2]|0;
+ $87 = ($86|0)==($5|0);
+ if (!($87)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $88 = ($80|0)==($78|0);
+ if ($88) {
+ $89 = 1 << $75;
+ $90 = $89 ^ -1;
+ $91 = HEAP32[5754]|0;
+ $92 = $91 & $90;
+ HEAP32[5754] = $92;
+ break;
+ }
+ $93 = ($80|0)==($82|0);
+ if ($93) {
+ $$pre = ((($80)) + 8|0);
+ $$pre$phiZ2D = $$pre;
+ } else {
+ $94 = ($80>>>0)<($6>>>0);
+ if ($94) {
+ _abort();
+ // unreachable;
+ }
+ $95 = ((($80)) + 8|0);
+ $96 = HEAP32[$95>>2]|0;
+ $97 = ($96|0)==($5|0);
+ if ($97) {
+ $$pre$phiZ2D = $95;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $98 = ((($78)) + 12|0);
+ HEAP32[$98>>2] = $80;
+ HEAP32[$$pre$phiZ2D>>2] = $78;
+ } else {
+ $99 = ((($5)) + 24|0);
+ $100 = HEAP32[$99>>2]|0;
+ $101 = ((($5)) + 12|0);
+ $102 = HEAP32[$101>>2]|0;
+ $103 = ($102|0)==($5|0);
+ do {
+ if ($103) {
+ $113 = ((($5)) + 16|0);
+ $114 = ((($113)) + 4|0);
+ $115 = HEAP32[$114>>2]|0;
+ $116 = ($115|0)==(0|0);
+ if ($116) {
+ $117 = HEAP32[$113>>2]|0;
+ $118 = ($117|0)==(0|0);
+ if ($118) {
+ $$3 = 0;
+ break;
+ } else {
+ $$1272 = $117;$$1275 = $113;
+ }
+ } else {
+ $$1272 = $115;$$1275 = $114;
+ }
+ while(1) {
+ $119 = ((($$1272)) + 20|0);
+ $120 = HEAP32[$119>>2]|0;
+ $121 = ($120|0)==(0|0);
+ if (!($121)) {
+ $$1272 = $120;$$1275 = $119;
+ continue;
+ }
+ $122 = ((($$1272)) + 16|0);
+ $123 = HEAP32[$122>>2]|0;
+ $124 = ($123|0)==(0|0);
+ if ($124) {
+ break;
+ } else {
+ $$1272 = $123;$$1275 = $122;
+ }
+ }
+ $125 = ($$1275>>>0)<($6>>>0);
+ if ($125) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1275>>2] = 0;
+ $$3 = $$1272;
+ break;
+ }
+ } else {
+ $104 = ((($5)) + 8|0);
+ $105 = HEAP32[$104>>2]|0;
+ $106 = ($105>>>0)<($6>>>0);
+ if ($106) {
+ _abort();
+ // unreachable;
+ }
+ $107 = ((($105)) + 12|0);
+ $108 = HEAP32[$107>>2]|0;
+ $109 = ($108|0)==($5|0);
+ if (!($109)) {
+ _abort();
+ // unreachable;
+ }
+ $110 = ((($102)) + 8|0);
+ $111 = HEAP32[$110>>2]|0;
+ $112 = ($111|0)==($5|0);
+ if ($112) {
+ HEAP32[$107>>2] = $102;
+ HEAP32[$110>>2] = $105;
+ $$3 = $102;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $126 = ($100|0)==(0|0);
+ if (!($126)) {
+ $127 = ((($5)) + 28|0);
+ $128 = HEAP32[$127>>2]|0;
+ $129 = (23320 + ($128<<2)|0);
+ $130 = HEAP32[$129>>2]|0;
+ $131 = ($5|0)==($130|0);
+ do {
+ if ($131) {
+ HEAP32[$129>>2] = $$3;
+ $cond = ($$3|0)==(0|0);
+ if ($cond) {
+ $132 = 1 << $128;
+ $133 = $132 ^ -1;
+ $134 = HEAP32[(23020)>>2]|0;
+ $135 = $134 & $133;
+ HEAP32[(23020)>>2] = $135;
+ break L49;
+ }
+ } else {
+ $136 = HEAP32[(23032)>>2]|0;
+ $137 = ($100>>>0)<($136>>>0);
+ if ($137) {
+ _abort();
+ // unreachable;
+ } else {
+ $138 = ((($100)) + 16|0);
+ $139 = HEAP32[$138>>2]|0;
+ $not$ = ($139|0)!=($5|0);
+ $$sink1 = $not$&1;
+ $140 = (((($100)) + 16|0) + ($$sink1<<2)|0);
+ HEAP32[$140>>2] = $$3;
+ $141 = ($$3|0)==(0|0);
+ if ($141) {
+ break L49;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $142 = HEAP32[(23032)>>2]|0;
+ $143 = ($$3>>>0)<($142>>>0);
+ if ($143) {
+ _abort();
+ // unreachable;
+ }
+ $144 = ((($$3)) + 24|0);
+ HEAP32[$144>>2] = $100;
+ $145 = ((($5)) + 16|0);
+ $146 = HEAP32[$145>>2]|0;
+ $147 = ($146|0)==(0|0);
+ do {
+ if (!($147)) {
+ $148 = ($146>>>0)<($142>>>0);
+ if ($148) {
+ _abort();
+ // unreachable;
+ } else {
+ $149 = ((($$3)) + 16|0);
+ HEAP32[$149>>2] = $146;
+ $150 = ((($146)) + 24|0);
+ HEAP32[$150>>2] = $$3;
+ break;
+ }
+ }
+ } while(0);
+ $151 = ((($145)) + 4|0);
+ $152 = HEAP32[$151>>2]|0;
+ $153 = ($152|0)==(0|0);
+ if (!($153)) {
+ $154 = HEAP32[(23032)>>2]|0;
+ $155 = ($152>>>0)<($154>>>0);
+ if ($155) {
+ _abort();
+ // unreachable;
+ } else {
+ $156 = ((($$3)) + 20|0);
+ HEAP32[$156>>2] = $152;
+ $157 = ((($152)) + 24|0);
+ HEAP32[$157>>2] = $$3;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $158 = ($74>>>0)<(16);
+ $159 = $3 & 1;
+ if ($158) {
+ $160 = $72 | $159;
+ $161 = $160 | 2;
+ HEAP32[$2>>2] = $161;
+ $162 = (($0) + ($72)|0);
+ $163 = ((($162)) + 4|0);
+ $164 = HEAP32[$163>>2]|0;
+ $165 = $164 | 1;
+ HEAP32[$163>>2] = $165;
+ $$2 = $0;
+ return ($$2|0);
+ } else {
+ $166 = (($0) + ($1)|0);
+ $167 = $159 | $1;
+ $168 = $167 | 2;
+ HEAP32[$2>>2] = $168;
+ $169 = ((($166)) + 4|0);
+ $170 = $74 | 3;
+ HEAP32[$169>>2] = $170;
+ $171 = (($166) + ($74)|0);
+ $172 = ((($171)) + 4|0);
+ $173 = HEAP32[$172>>2]|0;
+ $174 = $173 | 1;
+ HEAP32[$172>>2] = $174;
+ _dispose_chunk($166,$74);
+ $$2 = $0;
+ return ($$2|0);
+ }
+ return (0)|0;
+}
+function _dispose_chunk($0,$1) {
+ $0 = $0|0;
+ $1 = $1|0;
+ var $$0419 = 0, $$0420 = 0, $$0431 = 0, $$0438 = 0, $$1 = 0, $$1418 = 0, $$1426 = 0, $$1429 = 0, $$1433 = 0, $$1437 = 0, $$2 = 0, $$3 = 0, $$3435 = 0, $$pre = 0, $$pre$phi24Z2D = 0, $$pre$phi26Z2D = 0, $$pre$phiZ2D = 0, $$pre23 = 0, $$pre25 = 0, $$sink2 = 0;
+ var $$sink4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
+ var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
+ var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
+ var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
+ var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
+ var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
+ var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
+ var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
+ var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
+ var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
+ var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
+ var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
+ var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
+ var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
+ var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
+ var $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond17 = 0, $not$ = 0, $not$1 = 0, $not$19 = 0, label = 0, sp = 0;
+ sp = STACKTOP;
+ $2 = (($0) + ($1)|0);
+ $3 = ((($0)) + 4|0);
+ $4 = HEAP32[$3>>2]|0;
+ $5 = $4 & 1;
+ $6 = ($5|0)==(0);
+ L1: do {
+ if ($6) {
+ $7 = HEAP32[$0>>2]|0;
+ $8 = $4 & 3;
+ $9 = ($8|0)==(0);
+ if ($9) {
+ return;
+ }
+ $10 = (0 - ($7))|0;
+ $11 = (($0) + ($10)|0);
+ $12 = (($7) + ($1))|0;
+ $13 = HEAP32[(23032)>>2]|0;
+ $14 = ($11>>>0)<($13>>>0);
+ if ($14) {
+ _abort();
+ // unreachable;
+ }
+ $15 = HEAP32[(23036)>>2]|0;
+ $16 = ($11|0)==($15|0);
+ if ($16) {
+ $100 = ((($2)) + 4|0);
+ $101 = HEAP32[$100>>2]|0;
+ $102 = $101 & 3;
+ $103 = ($102|0)==(3);
+ if (!($103)) {
+ $$1 = $11;$$1418 = $12;
+ break;
+ }
+ $104 = (($11) + ($12)|0);
+ $105 = ((($11)) + 4|0);
+ $106 = $12 | 1;
+ $107 = $101 & -2;
+ HEAP32[(23024)>>2] = $12;
+ HEAP32[$100>>2] = $107;
+ HEAP32[$105>>2] = $106;
+ HEAP32[$104>>2] = $12;
+ return;
+ }
+ $17 = $7 >>> 3;
+ $18 = ($7>>>0)<(256);
+ if ($18) {
+ $19 = ((($11)) + 8|0);
+ $20 = HEAP32[$19>>2]|0;
+ $21 = ((($11)) + 12|0);
+ $22 = HEAP32[$21>>2]|0;
+ $23 = $17 << 1;
+ $24 = (23056 + ($23<<2)|0);
+ $25 = ($20|0)==($24|0);
+ if (!($25)) {
+ $26 = ($20>>>0)<($13>>>0);
+ if ($26) {
+ _abort();
+ // unreachable;
+ }
+ $27 = ((($20)) + 12|0);
+ $28 = HEAP32[$27>>2]|0;
+ $29 = ($28|0)==($11|0);
+ if (!($29)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $30 = ($22|0)==($20|0);
+ if ($30) {
+ $31 = 1 << $17;
+ $32 = $31 ^ -1;
+ $33 = HEAP32[5754]|0;
+ $34 = $33 & $32;
+ HEAP32[5754] = $34;
+ $$1 = $11;$$1418 = $12;
+ break;
+ }
+ $35 = ($22|0)==($24|0);
+ if ($35) {
+ $$pre25 = ((($22)) + 8|0);
+ $$pre$phi26Z2D = $$pre25;
+ } else {
+ $36 = ($22>>>0)<($13>>>0);
+ if ($36) {
+ _abort();
+ // unreachable;
+ }
+ $37 = ((($22)) + 8|0);
+ $38 = HEAP32[$37>>2]|0;
+ $39 = ($38|0)==($11|0);
+ if ($39) {
+ $$pre$phi26Z2D = $37;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $40 = ((($20)) + 12|0);
+ HEAP32[$40>>2] = $22;
+ HEAP32[$$pre$phi26Z2D>>2] = $20;
+ $$1 = $11;$$1418 = $12;
+ break;
+ }
+ $41 = ((($11)) + 24|0);
+ $42 = HEAP32[$41>>2]|0;
+ $43 = ((($11)) + 12|0);
+ $44 = HEAP32[$43>>2]|0;
+ $45 = ($44|0)==($11|0);
+ do {
+ if ($45) {
+ $55 = ((($11)) + 16|0);
+ $56 = ((($55)) + 4|0);
+ $57 = HEAP32[$56>>2]|0;
+ $58 = ($57|0)==(0|0);
+ if ($58) {
+ $59 = HEAP32[$55>>2]|0;
+ $60 = ($59|0)==(0|0);
+ if ($60) {
+ $$3 = 0;
+ break;
+ } else {
+ $$1426 = $59;$$1429 = $55;
+ }
+ } else {
+ $$1426 = $57;$$1429 = $56;
+ }
+ while(1) {
+ $61 = ((($$1426)) + 20|0);
+ $62 = HEAP32[$61>>2]|0;
+ $63 = ($62|0)==(0|0);
+ if (!($63)) {
+ $$1426 = $62;$$1429 = $61;
+ continue;
+ }
+ $64 = ((($$1426)) + 16|0);
+ $65 = HEAP32[$64>>2]|0;
+ $66 = ($65|0)==(0|0);
+ if ($66) {
+ break;
+ } else {
+ $$1426 = $65;$$1429 = $64;
+ }
+ }
+ $67 = ($$1429>>>0)<($13>>>0);
+ if ($67) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1429>>2] = 0;
+ $$3 = $$1426;
+ break;
+ }
+ } else {
+ $46 = ((($11)) + 8|0);
+ $47 = HEAP32[$46>>2]|0;
+ $48 = ($47>>>0)<($13>>>0);
+ if ($48) {
+ _abort();
+ // unreachable;
+ }
+ $49 = ((($47)) + 12|0);
+ $50 = HEAP32[$49>>2]|0;
+ $51 = ($50|0)==($11|0);
+ if (!($51)) {
+ _abort();
+ // unreachable;
+ }
+ $52 = ((($44)) + 8|0);
+ $53 = HEAP32[$52>>2]|0;
+ $54 = ($53|0)==($11|0);
+ if ($54) {
+ HEAP32[$49>>2] = $44;
+ HEAP32[$52>>2] = $47;
+ $$3 = $44;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $68 = ($42|0)==(0|0);
+ if ($68) {
+ $$1 = $11;$$1418 = $12;
+ } else {
+ $69 = ((($11)) + 28|0);
+ $70 = HEAP32[$69>>2]|0;
+ $71 = (23320 + ($70<<2)|0);
+ $72 = HEAP32[$71>>2]|0;
+ $73 = ($11|0)==($72|0);
+ do {
+ if ($73) {
+ HEAP32[$71>>2] = $$3;
+ $cond = ($$3|0)==(0|0);
+ if ($cond) {
+ $74 = 1 << $70;
+ $75 = $74 ^ -1;
+ $76 = HEAP32[(23020)>>2]|0;
+ $77 = $76 & $75;
+ HEAP32[(23020)>>2] = $77;
+ $$1 = $11;$$1418 = $12;
+ break L1;
+ }
+ } else {
+ $78 = HEAP32[(23032)>>2]|0;
+ $79 = ($42>>>0)<($78>>>0);
+ if ($79) {
+ _abort();
+ // unreachable;
+ } else {
+ $80 = ((($42)) + 16|0);
+ $81 = HEAP32[$80>>2]|0;
+ $not$1 = ($81|0)!=($11|0);
+ $$sink2 = $not$1&1;
+ $82 = (((($42)) + 16|0) + ($$sink2<<2)|0);
+ HEAP32[$82>>2] = $$3;
+ $83 = ($$3|0)==(0|0);
+ if ($83) {
+ $$1 = $11;$$1418 = $12;
+ break L1;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $84 = HEAP32[(23032)>>2]|0;
+ $85 = ($$3>>>0)<($84>>>0);
+ if ($85) {
+ _abort();
+ // unreachable;
+ }
+ $86 = ((($$3)) + 24|0);
+ HEAP32[$86>>2] = $42;
+ $87 = ((($11)) + 16|0);
+ $88 = HEAP32[$87>>2]|0;
+ $89 = ($88|0)==(0|0);
+ do {
+ if (!($89)) {
+ $90 = ($88>>>0)<($84>>>0);
+ if ($90) {
+ _abort();
+ // unreachable;
+ } else {
+ $91 = ((($$3)) + 16|0);
+ HEAP32[$91>>2] = $88;
+ $92 = ((($88)) + 24|0);
+ HEAP32[$92>>2] = $$3;
+ break;
+ }
+ }
+ } while(0);
+ $93 = ((($87)) + 4|0);
+ $94 = HEAP32[$93>>2]|0;
+ $95 = ($94|0)==(0|0);
+ if ($95) {
+ $$1 = $11;$$1418 = $12;
+ } else {
+ $96 = HEAP32[(23032)>>2]|0;
+ $97 = ($94>>>0)<($96>>>0);
+ if ($97) {
+ _abort();
+ // unreachable;
+ } else {
+ $98 = ((($$3)) + 20|0);
+ HEAP32[$98>>2] = $94;
+ $99 = ((($94)) + 24|0);
+ HEAP32[$99>>2] = $$3;
+ $$1 = $11;$$1418 = $12;
+ break;
+ }
+ }
+ }
+ } else {
+ $$1 = $0;$$1418 = $1;
+ }
+ } while(0);
+ $108 = HEAP32[(23032)>>2]|0;
+ $109 = ($2>>>0)<($108>>>0);
+ if ($109) {
+ _abort();
+ // unreachable;
+ }
+ $110 = ((($2)) + 4|0);
+ $111 = HEAP32[$110>>2]|0;
+ $112 = $111 & 2;
+ $113 = ($112|0)==(0);
+ if ($113) {
+ $114 = HEAP32[(23040)>>2]|0;
+ $115 = ($2|0)==($114|0);
+ $116 = HEAP32[(23036)>>2]|0;
+ if ($115) {
+ $117 = HEAP32[(23028)>>2]|0;
+ $118 = (($117) + ($$1418))|0;
+ HEAP32[(23028)>>2] = $118;
+ HEAP32[(23040)>>2] = $$1;
+ $119 = $118 | 1;
+ $120 = ((($$1)) + 4|0);
+ HEAP32[$120>>2] = $119;
+ $121 = ($$1|0)==($116|0);
+ if (!($121)) {
+ return;
+ }
+ HEAP32[(23036)>>2] = 0;
+ HEAP32[(23024)>>2] = 0;
+ return;
+ }
+ $122 = ($2|0)==($116|0);
+ if ($122) {
+ $123 = HEAP32[(23024)>>2]|0;
+ $124 = (($123) + ($$1418))|0;
+ HEAP32[(23024)>>2] = $124;
+ HEAP32[(23036)>>2] = $$1;
+ $125 = $124 | 1;
+ $126 = ((($$1)) + 4|0);
+ HEAP32[$126>>2] = $125;
+ $127 = (($$1) + ($124)|0);
+ HEAP32[$127>>2] = $124;
+ return;
+ }
+ $128 = $111 & -8;
+ $129 = (($128) + ($$1418))|0;
+ $130 = $111 >>> 3;
+ $131 = ($111>>>0)<(256);
+ L96: do {
+ if ($131) {
+ $132 = ((($2)) + 8|0);
+ $133 = HEAP32[$132>>2]|0;
+ $134 = ((($2)) + 12|0);
+ $135 = HEAP32[$134>>2]|0;
+ $136 = $130 << 1;
+ $137 = (23056 + ($136<<2)|0);
+ $138 = ($133|0)==($137|0);
+ if (!($138)) {
+ $139 = ($133>>>0)<($108>>>0);
+ if ($139) {
+ _abort();
+ // unreachable;
+ }
+ $140 = ((($133)) + 12|0);
+ $141 = HEAP32[$140>>2]|0;
+ $142 = ($141|0)==($2|0);
+ if (!($142)) {
+ _abort();
+ // unreachable;
+ }
+ }
+ $143 = ($135|0)==($133|0);
+ if ($143) {
+ $144 = 1 << $130;
+ $145 = $144 ^ -1;
+ $146 = HEAP32[5754]|0;
+ $147 = $146 & $145;
+ HEAP32[5754] = $147;
+ break;
+ }
+ $148 = ($135|0)==($137|0);
+ if ($148) {
+ $$pre23 = ((($135)) + 8|0);
+ $$pre$phi24Z2D = $$pre23;
+ } else {
+ $149 = ($135>>>0)<($108>>>0);
+ if ($149) {
+ _abort();
+ // unreachable;
+ }
+ $150 = ((($135)) + 8|0);
+ $151 = HEAP32[$150>>2]|0;
+ $152 = ($151|0)==($2|0);
+ if ($152) {
+ $$pre$phi24Z2D = $150;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ $153 = ((($133)) + 12|0);
+ HEAP32[$153>>2] = $135;
+ HEAP32[$$pre$phi24Z2D>>2] = $133;
+ } else {
+ $154 = ((($2)) + 24|0);
+ $155 = HEAP32[$154>>2]|0;
+ $156 = ((($2)) + 12|0);
+ $157 = HEAP32[$156>>2]|0;
+ $158 = ($157|0)==($2|0);
+ do {
+ if ($158) {
+ $168 = ((($2)) + 16|0);
+ $169 = ((($168)) + 4|0);
+ $170 = HEAP32[$169>>2]|0;
+ $171 = ($170|0)==(0|0);
+ if ($171) {
+ $172 = HEAP32[$168>>2]|0;
+ $173 = ($172|0)==(0|0);
+ if ($173) {
+ $$3435 = 0;
+ break;
+ } else {
+ $$1433 = $172;$$1437 = $168;
+ }
+ } else {
+ $$1433 = $170;$$1437 = $169;
+ }
+ while(1) {
+ $174 = ((($$1433)) + 20|0);
+ $175 = HEAP32[$174>>2]|0;
+ $176 = ($175|0)==(0|0);
+ if (!($176)) {
+ $$1433 = $175;$$1437 = $174;
+ continue;
+ }
+ $177 = ((($$1433)) + 16|0);
+ $178 = HEAP32[$177>>2]|0;
+ $179 = ($178|0)==(0|0);
+ if ($179) {
+ break;
+ } else {
+ $$1433 = $178;$$1437 = $177;
+ }
+ }
+ $180 = ($$1437>>>0)<($108>>>0);
+ if ($180) {
+ _abort();
+ // unreachable;
+ } else {
+ HEAP32[$$1437>>2] = 0;
+ $$3435 = $$1433;
+ break;
+ }
+ } else {
+ $159 = ((($2)) + 8|0);
+ $160 = HEAP32[$159>>2]|0;
+ $161 = ($160>>>0)<($108>>>0);
+ if ($161) {
+ _abort();
+ // unreachable;
+ }
+ $162 = ((($160)) + 12|0);
+ $163 = HEAP32[$162>>2]|0;
+ $164 = ($163|0)==($2|0);
+ if (!($164)) {
+ _abort();
+ // unreachable;
+ }
+ $165 = ((($157)) + 8|0);
+ $166 = HEAP32[$165>>2]|0;
+ $167 = ($166|0)==($2|0);
+ if ($167) {
+ HEAP32[$162>>2] = $157;
+ HEAP32[$165>>2] = $160;
+ $$3435 = $157;
+ break;
+ } else {
+ _abort();
+ // unreachable;
+ }
+ }
+ } while(0);
+ $181 = ($155|0)==(0|0);
+ if (!($181)) {
+ $182 = ((($2)) + 28|0);
+ $183 = HEAP32[$182>>2]|0;
+ $184 = (23320 + ($183<<2)|0);
+ $185 = HEAP32[$184>>2]|0;
+ $186 = ($2|0)==($185|0);
+ do {
+ if ($186) {
+ HEAP32[$184>>2] = $$3435;
+ $cond17 = ($$3435|0)==(0|0);
+ if ($cond17) {
+ $187 = 1 << $183;
+ $188 = $187 ^ -1;
+ $189 = HEAP32[(23020)>>2]|0;
+ $190 = $189 & $188;
+ HEAP32[(23020)>>2] = $190;
+ break L96;
+ }
+ } else {
+ $191 = HEAP32[(23032)>>2]|0;
+ $192 = ($155>>>0)<($191>>>0);
+ if ($192) {
+ _abort();
+ // unreachable;
+ } else {
+ $193 = ((($155)) + 16|0);
+ $194 = HEAP32[$193>>2]|0;
+ $not$ = ($194|0)!=($2|0);
+ $$sink4 = $not$&1;
+ $195 = (((($155)) + 16|0) + ($$sink4<<2)|0);
+ HEAP32[$195>>2] = $$3435;
+ $196 = ($$3435|0)==(0|0);
+ if ($196) {
+ break L96;
+ } else {
+ break;
+ }
+ }
+ }
+ } while(0);
+ $197 = HEAP32[(23032)>>2]|0;
+ $198 = ($$3435>>>0)<($197>>>0);
+ if ($198) {
+ _abort();
+ // unreachable;
+ }
+ $199 = ((($$3435)) + 24|0);
+ HEAP32[$199>>2] = $155;
+ $200 = ((($2)) + 16|0);
+ $201 = HEAP32[$200>>2]|0;
+ $202 = ($201|0)==(0|0);
+ do {
+ if (!($202)) {
+ $203 = ($201>>>0)<($197>>>0);
+ if ($203) {
+ _abort();
+ // unreachable;
+ } else {
+ $204 = ((($$3435)) + 16|0);
+ HEAP32[$204>>2] = $201;
+ $205 = ((($201)) + 24|0);
+ HEAP32[$205>>2] = $$3435;
+ break;
+ }
+ }
+ } while(0);
+ $206 = ((($200)) + 4|0);
+ $207 = HEAP32[$206>>2]|0;
+ $208 = ($207|0)==(0|0);
+ if (!($208)) {
+ $209 = HEAP32[(23032)>>2]|0;
+ $210 = ($207>>>0)<($209>>>0);
+ if ($210) {
+ _abort();
+ // unreachable;
+ } else {
+ $211 = ((($$3435)) + 20|0);
+ HEAP32[$211>>2] = $207;
+ $212 = ((($207)) + 24|0);
+ HEAP32[$212>>2] = $$3435;
+ break;
+ }
+ }
+ }
+ }
+ } while(0);
+ $213 = $129 | 1;
+ $214 = ((($$1)) + 4|0);
+ HEAP32[$214>>2] = $213;
+ $215 = (($$1) + ($129)|0);
+ HEAP32[$215>>2] = $129;
+ $216 = HEAP32[(23036)>>2]|0;
+ $217 = ($$1|0)==($216|0);
+ if ($217) {
+ HEAP32[(23024)>>2] = $129;
+ return;
+ } else {
+ $$2 = $129;
+ }
+ } else {
+ $218 = $111 & -2;
+ HEAP32[$110>>2] = $218;
+ $219 = $$1418 | 1;
+ $220 = ((($$1)) + 4|0);
+ HEAP32[$220>>2] = $219;
+ $221 = (($$1) + ($$1418)|0);
+ HEAP32[$221>>2] = $$1418;
+ $$2 = $$1418;
+ }
+ $222 = $$2 >>> 3;
+ $223 = ($$2>>>0)<(256);
+ if ($223) {
+ $224 = $222 << 1;
+ $225 = (23056 + ($224<<2)|0);
+ $226 = HEAP32[5754]|0;
+ $227 = 1 << $222;
+ $228 = $226 & $227;
+ $229 = ($228|0)==(0);
+ if ($229) {
+ $230 = $226 | $227;
+ HEAP32[5754] = $230;
+ $$pre = ((($225)) + 8|0);
+ $$0438 = $225;$$pre$phiZ2D = $$pre;
+ } else {
+ $231 = ((($225)) + 8|0);
+ $232 = HEAP32[$231>>2]|0;
+ $233 = HEAP32[(23032)>>2]|0;
+ $234 = ($232>>>0)<($233>>>0);
+ if ($234) {
+ _abort();
+ // unreachable;
+ } else {
+ $$0438 = $232;$$pre$phiZ2D = $231;
+ }
+ }
+ HEAP32[$$pre$phiZ2D>>2] = $$1;
+ $235 = ((($$0438)) + 12|0);
+ HEAP32[$235>>2] = $$1;
+ $236 = ((($$1)) + 8|0);
+ HEAP32[$236>>2] = $$0438;
+ $237 = ((($$1)) + 12|0);
+ HEAP32[$237>>2] = $225;
+ return;
+ }
+ $238 = $$2 >>> 8;
+ $239 = ($238|0)==(0);
+ if ($239) {
+ $$0431 = 0;
+ } else {
+ $240 = ($$2>>>0)>(16777215);
+ if ($240) {
+ $$0431 = 31;
+ } else {
+ $241 = (($238) + 1048320)|0;
+ $242 = $241 >>> 16;
+ $243 = $242 & 8;
+ $244 = $238 << $243;
+ $245 = (($244) + 520192)|0;
+ $246 = $245 >>> 16;
+ $247 = $246 & 4;
+ $248 = $247 | $243;
+ $249 = $244 << $247;
+ $250 = (($249) + 245760)|0;
+ $251 = $250 >>> 16;
+ $252 = $251 & 2;
+ $253 = $248 | $252;
+ $254 = (14 - ($253))|0;
+ $255 = $249 << $252;
+ $256 = $255 >>> 15;
+ $257 = (($254) + ($256))|0;
+ $258 = $257 << 1;
+ $259 = (($257) + 7)|0;
+ $260 = $$2 >>> $259;
+ $261 = $260 & 1;
+ $262 = $261 | $258;
+ $$0431 = $262;
+ }
+ }
+ $263 = (23320 + ($$0431<<2)|0);
+ $264 = ((($$1)) + 28|0);
+ HEAP32[$264>>2] = $$0431;
+ $265 = ((($$1)) + 16|0);
+ $266 = ((($$1)) + 20|0);
+ HEAP32[$266>>2] = 0;
+ HEAP32[$265>>2] = 0;
+ $267 = HEAP32[(23020)>>2]|0;
+ $268 = 1 << $$0431;
+ $269 = $267 & $268;
+ $270 = ($269|0)==(0);
+ if ($270) {
+ $271 = $267 | $268;
+ HEAP32[(23020)>>2] = $271;
+ HEAP32[$263>>2] = $$1;
+ $272 = ((($$1)) + 24|0);
+ HEAP32[$272>>2] = $263;
+ $273 = ((($$1)) + 12|0);
+ HEAP32[$273>>2] = $$1;
+ $274 = ((($$1)) + 8|0);
+ HEAP32[$274>>2] = $$1;
+ return;
+ }
+ $275 = HEAP32[$263>>2]|0;
+ $276 = ($$0431|0)==(31);
+ $277 = $$0431 >>> 1;
+ $278 = (25 - ($277))|0;
+ $279 = $276 ? 0 : $278;
+ $280 = $$2 << $279;
+ $$0419 = $280;$$0420 = $275;
+ while(1) {
+ $281 = ((($$0420)) + 4|0);
+ $282 = HEAP32[$281>>2]|0;
+ $283 = $282 & -8;
+ $284 = ($283|0)==($$2|0);
+ if ($284) {
+ label = 121;
+ break;
+ }
+ $285 = $$0419 >>> 31;
+ $286 = (((($$0420)) + 16|0) + ($285<<2)|0);
+ $287 = $$0419 << 1;
+ $288 = HEAP32[$286>>2]|0;
+ $289 = ($288|0)==(0|0);
+ if ($289) {
+ label = 118;
+ break;
+ } else {
+ $$0419 = $287;$$0420 = $288;
+ }
+ }
+ if ((label|0) == 118) {
+ $290 = HEAP32[(23032)>>2]|0;
+ $291 = ($286>>>0)<($290>>>0);
+ if ($291) {
+ _abort();
+ // unreachable;
+ }
+ HEAP32[$286>>2] = $$1;
+ $292 = ((($$1)) + 24|0);
+ HEAP32[$292>>2] = $$0420;
+ $293 = ((($$1)) + 12|0);
+ HEAP32[$293>>2] = $$1;
+ $294 = ((($$1)) + 8|0);
+ HEAP32[$294>>2] = $$1;
+ return;
+ }
+ else if ((label|0) == 121) {
+ $295 = ((($$0420)) + 8|0);
+ $296 = HEAP32[$295>>2]|0;
+ $297 = HEAP32[(23032)>>2]|0;
+ $298 = ($296>>>0)>=($297>>>0);
+ $not$19 = ($$0420>>>0)>=($297>>>0);
+ $299 = $298 & $not$19;
+ if (!($299)) {
+ _abort();
+ // unreachable;
+ }
+ $300 = ((($296)) + 12|0);
+ HEAP32[$300>>2] = $$1;
+ HEAP32[$295>>2] = $$1;
+ $301 = ((($$1)) + 8|0);
+ HEAP32[$301>>2] = $296;
+ $302 = ((($$1)) + 12|0);
+ HEAP32[$302>>2] = $$0420;
+ $303 = ((($$1)) + 24|0);
+ HEAP32[$303>>2] = 0;
+ return;
+ }
+}
+function runPostSets() {
+}
+function _memset(ptr, value, num) {
+ ptr = ptr|0; value = value|0; num = num|0;
+ var end = 0, aligned_end = 0, block_aligned_end = 0, value4 = 0;
+ end = (ptr + num)|0;
+
+ value = value & 0xff;
+ if ((num|0) >= 67 /* 64 bytes for an unrolled loop + 3 bytes for unaligned head*/) {
+ while ((ptr&3) != 0) {
+ HEAP8[((ptr)>>0)]=value;
+ ptr = (ptr+1)|0;
+ }
+
+ aligned_end = (end & -4)|0;
+ block_aligned_end = (aligned_end - 64)|0;
+ value4 = value | (value << 8) | (value << 16) | (value << 24);
+
+ while((ptr|0) <= (block_aligned_end|0)) {
+ HEAP32[((ptr)>>2)]=value4;
+ HEAP32[(((ptr)+(4))>>2)]=value4;
+ HEAP32[(((ptr)+(8))>>2)]=value4;
+ HEAP32[(((ptr)+(12))>>2)]=value4;
+ HEAP32[(((ptr)+(16))>>2)]=value4;
+ HEAP32[(((ptr)+(20))>>2)]=value4;
+ HEAP32[(((ptr)+(24))>>2)]=value4;
+ HEAP32[(((ptr)+(28))>>2)]=value4;
+ HEAP32[(((ptr)+(32))>>2)]=value4;
+ HEAP32[(((ptr)+(36))>>2)]=value4;
+ HEAP32[(((ptr)+(40))>>2)]=value4;
+ HEAP32[(((ptr)+(44))>>2)]=value4;
+ HEAP32[(((ptr)+(48))>>2)]=value4;
+ HEAP32[(((ptr)+(52))>>2)]=value4;
+ HEAP32[(((ptr)+(56))>>2)]=value4;
+ HEAP32[(((ptr)+(60))>>2)]=value4;
+ ptr = (ptr + 64)|0;
+ }
+
+ while ((ptr|0) < (aligned_end|0) ) {
+ HEAP32[((ptr)>>2)]=value4;
+ ptr = (ptr+4)|0;
+ }
+ }
+ // The remaining bytes.
+ while ((ptr|0) < (end|0)) {
+ HEAP8[((ptr)>>0)]=value;
+ ptr = (ptr+1)|0;
+ }
+ return (end-num)|0;
+}
+function _i64Subtract(a, b, c, d) {
+ a = a|0; b = b|0; c = c|0; d = d|0;
+ var l = 0, h = 0;
+ l = (a - c)>>>0;
+ h = (b - d)>>>0;
+ h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
+ return ((tempRet0 = h,l|0)|0);
+}
+function _i64Add(a, b, c, d) {
+ /*
+ x = a + b*2^32
+ y = c + d*2^32
+ result = l + h*2^32
+ */
+ a = a|0; b = b|0; c = c|0; d = d|0;
+ var l = 0, h = 0;
+ l = (a + c)>>>0;
+ h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
+ return ((tempRet0 = h,l|0)|0);
+}
+function _llvm_cttz_i32(x) {
+ x = x|0;
+ var ret = 0;
+ ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
+ if ((ret|0) < 8) return ret|0;
+ ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
+ if ((ret|0) < 8) return (ret + 8)|0;
+ ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
+ if ((ret|0) < 8) return (ret + 16)|0;
+ return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
+}
+function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ $rem = $rem | 0;
+ var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
+ $n_sroa_0_0_extract_trunc = $a$0;
+ $n_sroa_1_4_extract_shift$0 = $a$1;
+ $n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
+ $d_sroa_0_0_extract_trunc = $b$0;
+ $d_sroa_1_4_extract_shift$0 = $b$1;
+ $d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
+ if (($n_sroa_1_4_extract_trunc | 0) == 0) {
+ $4 = ($rem | 0) != 0;
+ if (($d_sroa_1_4_extract_trunc | 0) == 0) {
+ if ($4) {
+ HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ if (!$4) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ }
+ $17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
+ do {
+ if (($d_sroa_0_0_extract_trunc | 0) == 0) {
+ if ($17) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ if (($n_sroa_0_0_extract_trunc | 0) == 0) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0;
+ HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
+ }
+ $_0$1 = 0;
+ $_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $37 = $d_sroa_1_4_extract_trunc - 1 | 0;
+ if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
+ }
+ $_0$1 = 0;
+ $_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
+ $51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ if ($51 >>> 0 <= 30) {
+ $57 = $51 + 1 | 0;
+ $58 = 31 - $51 | 0;
+ $sr_1_ph = $57;
+ $r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
+ $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
+ $q_sroa_0_1_ph = 0;
+ $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
+ break;
+ }
+ if (($rem | 0) == 0) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ if (!$17) {
+ $117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
+ $119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ if ($119 >>> 0 <= 31) {
+ $125 = $119 + 1 | 0;
+ $126 = 31 - $119 | 0;
+ $130 = $119 - 31 >> 31;
+ $sr_1_ph = $125;
+ $r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
+ $r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
+ $q_sroa_0_1_ph = 0;
+ $q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
+ break;
+ }
+ if (($rem | 0) == 0) {
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ HEAP32[$rem >> 2] = 0 | $a$0 & -1;
+ HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$1 = 0;
+ $_0$0 = 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ $66 = $d_sroa_0_0_extract_trunc - 1 | 0;
+ if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
+ $86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
+ $88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
+ $89 = 64 - $88 | 0;
+ $91 = 32 - $88 | 0;
+ $92 = $91 >> 31;
+ $95 = $88 - 32 | 0;
+ $105 = $95 >> 31;
+ $sr_1_ph = $88;
+ $r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
+ $r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
+ $q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
+ $q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
+ break;
+ }
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
+ HEAP32[$rem + 4 >> 2] = 0;
+ }
+ if (($d_sroa_0_0_extract_trunc | 0) == 1) {
+ $_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
+ $_0$0 = 0 | $a$0 & -1;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ } else {
+ $78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
+ $_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
+ $_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+ }
+ }
+ } while (0);
+ if (($sr_1_ph | 0) == 0) {
+ $q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
+ $q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
+ $r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
+ $r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
+ $carry_0_lcssa$1 = 0;
+ $carry_0_lcssa$0 = 0;
+ } else {
+ $d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
+ $d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
+ $137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
+ $137$1 = tempRet0;
+ $q_sroa_1_1198 = $q_sroa_1_1_ph;
+ $q_sroa_0_1199 = $q_sroa_0_1_ph;
+ $r_sroa_1_1200 = $r_sroa_1_1_ph;
+ $r_sroa_0_1201 = $r_sroa_0_1_ph;
+ $sr_1202 = $sr_1_ph;
+ $carry_0203 = 0;
+ while (1) {
+ $147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
+ $149 = $carry_0203 | $q_sroa_0_1199 << 1;
+ $r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
+ $r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
+ _i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
+ $150$1 = tempRet0;
+ $151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
+ $152 = $151$0 & 1;
+ $154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
+ $r_sroa_0_0_extract_trunc = $154$0;
+ $r_sroa_1_4_extract_trunc = tempRet0;
+ $155 = $sr_1202 - 1 | 0;
+ if (($155 | 0) == 0) {
+ break;
+ } else {
+ $q_sroa_1_1198 = $147;
+ $q_sroa_0_1199 = $149;
+ $r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
+ $r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
+ $sr_1202 = $155;
+ $carry_0203 = $152;
+ }
+ }
+ $q_sroa_1_1_lcssa = $147;
+ $q_sroa_0_1_lcssa = $149;
+ $r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
+ $r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
+ $carry_0_lcssa$1 = 0;
+ $carry_0_lcssa$0 = $152;
+ }
+ $q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
+ $q_sroa_0_0_insert_ext75$1 = 0;
+ $q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
+ if (($rem | 0) != 0) {
+ HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
+ HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
+ }
+ $_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
+ $_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
+ return (tempRet0 = $_0$1, $_0$0) | 0;
+}
+function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $1$0 = 0;
+ $1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
+ return $1$0 | 0;
+}
+function ___muldsi3($a, $b) {
+ $a = $a | 0;
+ $b = $b | 0;
+ var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
+ $1 = $a & 65535;
+ $2 = $b & 65535;
+ $3 = Math_imul($2, $1) | 0;
+ $6 = $a >>> 16;
+ $8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
+ $11 = $b >>> 16;
+ $12 = Math_imul($11, $1) | 0;
+ return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
+}
+function ___muldi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
+ $x_sroa_0_0_extract_trunc = $a$0;
+ $y_sroa_0_0_extract_trunc = $b$0;
+ $1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
+ $1$1 = tempRet0;
+ $2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
+ return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
+}
+function _memcpy(dest, src, num) {
+ dest = dest|0; src = src|0; num = num|0;
+ var ret = 0;
+ var aligned_dest_end = 0;
+ var block_aligned_dest_end = 0;
+ var dest_end = 0;
+ // Test against a benchmarked cutoff limit for when HEAPU8.set() becomes faster to use.
+ if ((num|0) >=
+ 8192
+ ) {
+ return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
+ }
+
+ ret = dest|0;
+ dest_end = (dest + num)|0;
+ if ((dest&3) == (src&3)) {
+ // The initial unaligned < 4-byte front.
+ while (dest & 3) {
+ if ((num|0) == 0) return ret|0;
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ dest = (dest+1)|0;
+ src = (src+1)|0;
+ num = (num-1)|0;
+ }
+ aligned_dest_end = (dest_end & -4)|0;
+ block_aligned_dest_end = (aligned_dest_end - 64)|0;
+ while ((dest|0) <= (block_aligned_dest_end|0) ) {
+ HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
+ HEAP32[(((dest)+(4))>>2)]=((HEAP32[(((src)+(4))>>2)])|0);
+ HEAP32[(((dest)+(8))>>2)]=((HEAP32[(((src)+(8))>>2)])|0);
+ HEAP32[(((dest)+(12))>>2)]=((HEAP32[(((src)+(12))>>2)])|0);
+ HEAP32[(((dest)+(16))>>2)]=((HEAP32[(((src)+(16))>>2)])|0);
+ HEAP32[(((dest)+(20))>>2)]=((HEAP32[(((src)+(20))>>2)])|0);
+ HEAP32[(((dest)+(24))>>2)]=((HEAP32[(((src)+(24))>>2)])|0);
+ HEAP32[(((dest)+(28))>>2)]=((HEAP32[(((src)+(28))>>2)])|0);
+ HEAP32[(((dest)+(32))>>2)]=((HEAP32[(((src)+(32))>>2)])|0);
+ HEAP32[(((dest)+(36))>>2)]=((HEAP32[(((src)+(36))>>2)])|0);
+ HEAP32[(((dest)+(40))>>2)]=((HEAP32[(((src)+(40))>>2)])|0);
+ HEAP32[(((dest)+(44))>>2)]=((HEAP32[(((src)+(44))>>2)])|0);
+ HEAP32[(((dest)+(48))>>2)]=((HEAP32[(((src)+(48))>>2)])|0);
+ HEAP32[(((dest)+(52))>>2)]=((HEAP32[(((src)+(52))>>2)])|0);
+ HEAP32[(((dest)+(56))>>2)]=((HEAP32[(((src)+(56))>>2)])|0);
+ HEAP32[(((dest)+(60))>>2)]=((HEAP32[(((src)+(60))>>2)])|0);
+ dest = (dest+64)|0;
+ src = (src+64)|0;
+ }
+ while ((dest|0) < (aligned_dest_end|0) ) {
+ HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
+ dest = (dest+4)|0;
+ src = (src+4)|0;
+ }
+ } else {
+ // In the unaligned copy case, unroll a bit as well.
+ aligned_dest_end = (dest_end - 4)|0;
+ while ((dest|0) < (aligned_dest_end|0) ) {
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ HEAP8[(((dest)+(1))>>0)]=((HEAP8[(((src)+(1))>>0)])|0);
+ HEAP8[(((dest)+(2))>>0)]=((HEAP8[(((src)+(2))>>0)])|0);
+ HEAP8[(((dest)+(3))>>0)]=((HEAP8[(((src)+(3))>>0)])|0);
+ dest = (dest+4)|0;
+ src = (src+4)|0;
+ }
+ }
+ // The remaining unaligned < 4 byte tail.
+ while ((dest|0) < (dest_end|0)) {
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ dest = (dest+1)|0;
+ src = (src+1)|0;
+ }
+ return ret|0;
+}
+function _memmove(dest, src, num) {
+ dest = dest|0; src = src|0; num = num|0;
+ var ret = 0;
+ if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
+ // Unlikely case: Copy backwards in a safe manner
+ ret = dest;
+ src = (src + num)|0;
+ dest = (dest + num)|0;
+ while ((num|0) > 0) {
+ dest = (dest - 1)|0;
+ src = (src - 1)|0;
+ num = (num - 1)|0;
+ HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
+ }
+ dest = ret;
+ } else {
+ _memcpy(dest, src, num) | 0;
+ }
+ return dest | 0;
+}
+function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
+ $a$0 = $a$0 | 0;
+ $a$1 = $a$1 | 0;
+ $b$0 = $b$0 | 0;
+ $b$1 = $b$1 | 0;
+ var $rem = 0, __stackBase__ = 0;
+ __stackBase__ = STACKTOP;
+ STACKTOP = STACKTOP + 16 | 0;
+ $rem = __stackBase__ | 0;
+ ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
+ STACKTOP = __stackBase__;
+ return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
+}
+function _roundf(f) {
+ f = +f;
+ return f >= +0 ? +Math_floor(f + +0.5) : +Math_ceil(f - +0.5); // TODO: use fround?
+}
+function _bitshift64Lshr(low, high, bits) {
+ low = low|0; high = high|0; bits = bits|0;
+ var ander = 0;
+ if ((bits|0) < 32) {
+ ander = ((1 << bits) - 1)|0;
+ tempRet0 = high >>> bits;
+ return (low >>> bits) | ((high&ander) << (32 - bits));
+ }
+ tempRet0 = 0;
+ return (high >>> (bits - 32))|0;
+}
+function _sbrk(increment) {
+ increment = increment|0;
+ var oldDynamicTop = 0;
+ var oldDynamicTopOnChange = 0;
+ var newDynamicTop = 0;
+ var totalMemory = 0;
+ increment = ((increment + 15) & -16)|0;
+ oldDynamicTop = HEAP32[DYNAMICTOP_PTR>>2]|0;
+ newDynamicTop = oldDynamicTop + increment | 0;
+
+ if (((increment|0) > 0 & (newDynamicTop|0) < (oldDynamicTop|0)) // Detect and fail if we would wrap around signed 32-bit int.
+ | (newDynamicTop|0) < 0) { // Also underflow, sbrk() should be able to be used to subtract.
+ abortOnCannotGrowMemory()|0;
+ ___setErrNo(12);
+ return -1;
+ }
+
+ HEAP32[DYNAMICTOP_PTR>>2] = newDynamicTop;
+ totalMemory = getTotalMemory()|0;
+ if ((newDynamicTop|0) > (totalMemory|0)) {
+ if ((enlargeMemory()|0) == 0) {
+ ___setErrNo(12);
+ HEAP32[DYNAMICTOP_PTR>>2] = oldDynamicTop;
+ return -1;
+ }
+ }
+ return oldDynamicTop|0;
+}
+function _bitshift64Shl(low, high, bits) {
+ low = low|0; high = high|0; bits = bits|0;
+ var ander = 0;
+ if ((bits|0) < 32) {
+ ander = ((1 << bits) - 1)|0;
+ tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
+ return low << bits;
+ }
+ tempRet0 = low << (bits - 32);
+ return 0;
+}
+function _llvm_bswap_i32(x) {
+ x = x|0;
+ return (((x&0xff)<<24) | (((x>>8)&0xff)<<16) | (((x>>16)&0xff)<<8) | (x>>>24))|0;
+}
+
+
+function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
+ FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
+}
+
+
+function dynCall_vd(index,a1) {
+ index = index|0;
+ a1=+a1;
+ FUNCTION_TABLE_vd[index&3](+a1);
+}
+
+
+function dynCall_vid(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=+a2;
+ FUNCTION_TABLE_vid[index&3](a1|0,+a2);
+}
+
+
+function dynCall_vi(index,a1) {
+ index = index|0;
+ a1=a1|0;
+ FUNCTION_TABLE_vi[index&31](a1|0);
+}
+
+
+function dynCall_vii(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=a2|0;
+ FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
+}
+
+
+function dynCall_ii(index,a1) {
+ index = index|0;
+ a1=a1|0;
+ return FUNCTION_TABLE_ii[index&15](a1|0)|0;
+}
+
+
+function dynCall_viddd(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
+ FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
+}
+
+
+function dynCall_vidd(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3;
+ FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
+}
+
+
+function dynCall_iiii(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0;
+ return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
+}
+
+
+function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
+ FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
+}
+
+
+function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
+ FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
+}
+
+
+function dynCall_viii(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0;
+ FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
+}
+
+
+function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
+ index = index|0;
+ a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
+ FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
+}
+
+
+function dynCall_vdi(index,a1,a2) {
+ index = index|0;
+ a1=+a1; a2=a2|0;
+ FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
+}
+
+
+function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
+ FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
+}
+
+
+function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
+ FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
+}
+
+
+function dynCall_iii(index,a1,a2) {
+ index = index|0;
+ a1=a1|0; a2=a2|0;
+ return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0;
+}
+
+
+function dynCall_i(index) {
+ index = index|0;
+
+ return FUNCTION_TABLE_i[index&3]()|0;
+}
+
+
+function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
+ index = index|0;
+ a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
+ FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
+}
+
+
+function dynCall_vdddd(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=+a1; a2=+a2; a3=+a3; a4=+a4;
+ FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
+}
+
+
+function dynCall_vdd(index,a1,a2) {
+ index = index|0;
+ a1=+a1; a2=+a2;
+ FUNCTION_TABLE_vdd[index&3](+a1,+a2);
+}
+
+
+function dynCall_v(index) {
+ index = index|0;
+
+ FUNCTION_TABLE_v[index&7]();
+}
+
+
+function dynCall_viid(index,a1,a2,a3) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=+a3;
+ FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
+}
+
+
+function dynCall_viiii(index,a1,a2,a3,a4) {
+ index = index|0;
+ a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
+ FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
+}
+
+function b0(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; nullFunc_viiiii(0);
+}
+function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
+}
+function b1(p0) {
+ p0 = +p0; nullFunc_vd(1);
+}
+function _emscripten_glClearDepth__wrapper(p0) {
+ p0 = +p0; _emscripten_glClearDepth(+p0);
+}
+function _emscripten_glClearDepthf__wrapper(p0) {
+ p0 = +p0; _emscripten_glClearDepthf(+p0);
+}
+function _emscripten_glLineWidth__wrapper(p0) {
+ p0 = +p0; _emscripten_glLineWidth(+p0);
+}
+function b2(p0,p1) {
+ p0 = p0|0;p1 = +p1; nullFunc_vid(2);
+}
+function _emscripten_glUniform1f__wrapper(p0,p1) {
+ p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
+}
+function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
+ p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
+}
+function b3(p0) {
+ p0 = p0|0; nullFunc_vi(3);
+}
+function _emscripten_glDeleteShader__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteShader(p0|0);
+}
+function _emscripten_glCompileShader__wrapper(p0) {
+ p0 = p0|0; _emscripten_glCompileShader(p0|0);
+}
+function _emscripten_glDeleteProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
+}
+function _emscripten_glLinkProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glLinkProgram(p0|0);
+}
+function _emscripten_glUseProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glUseProgram(p0|0);
+}
+function _emscripten_glValidateProgram__wrapper(p0) {
+ p0 = p0|0; _emscripten_glValidateProgram(p0|0);
+}
+function _emscripten_glDeleteObjectARB__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
+}
+function _emscripten_glEnableClientState__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnableClientState(p0|0);
+}
+function _emscripten_glClientActiveTexture__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
+}
+function _emscripten_glBindVertexArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
+}
+function _emscripten_glMatrixMode__wrapper(p0) {
+ p0 = p0|0; _emscripten_glMatrixMode(p0|0);
+}
+function _emscripten_glLoadMatrixf__wrapper(p0) {
+ p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
+}
+function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
+}
+function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
+}
+function _emscripten_glDepthFunc__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDepthFunc(p0|0);
+}
+function _emscripten_glEnable__wrapper(p0) {
+ p0 = p0|0; _emscripten_glEnable(p0|0);
+}
+function _emscripten_glDisable__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDisable(p0|0);
+}
+function _emscripten_glFrontFace__wrapper(p0) {
+ p0 = p0|0; _emscripten_glFrontFace(p0|0);
+}
+function _emscripten_glCullFace__wrapper(p0) {
+ p0 = p0|0; _emscripten_glCullFace(p0|0);
+}
+function _emscripten_glClear__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClear(p0|0);
+}
+function _emscripten_glClearStencil__wrapper(p0) {
+ p0 = p0|0; _emscripten_glClearStencil(p0|0);
+}
+function _emscripten_glDepthMask__wrapper(p0) {
+ p0 = p0|0; _emscripten_glDepthMask(p0|0);
+}
+function _emscripten_glStencilMask__wrapper(p0) {
+ p0 = p0|0; _emscripten_glStencilMask(p0|0);
+}
+function _emscripten_glGenerateMipmap__wrapper(p0) {
+ p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
+}
+function _emscripten_glActiveTexture__wrapper(p0) {
+ p0 = p0|0; _emscripten_glActiveTexture(p0|0);
+}
+function _emscripten_glBlendEquation__wrapper(p0) {
+ p0 = p0|0; _emscripten_glBlendEquation(p0|0);
+}
+function b4(p0,p1) {
+ p0 = p0|0;p1 = p1|0; nullFunc_vii(4);
+}
+function _emscripten_glPixelStorei__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
+}
+function _emscripten_glGetIntegerv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
+}
+function _emscripten_glGetFloatv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
+}
+function _emscripten_glGetBooleanv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
+}
+function _emscripten_glGenTextures__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
+}
+function _emscripten_glDeleteTextures__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
+}
+function _emscripten_glBindTexture__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
+}
+function _emscripten_glGenBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
+}
+function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
+}
+function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
+}
+function _emscripten_glUniform1i__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
+}
+function _emscripten_glBindBuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
+}
+function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
+}
+function _emscripten_glAttachShader__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
+}
+function _emscripten_glDetachShader__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
+}
+function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
+}
+function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
+}
+function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
+}
+function _emscripten_glBindProgramARB__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
+}
+function _emscripten_glGetPointerv__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
+}
+function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
+}
+function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
+}
+function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
+}
+function _emscripten_glBlendFunc__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
+}
+function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
+}
+function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
+}
+function _emscripten_glHint__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
+}
+function _emscripten_glDrawBuffers__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
+}
+function b5(p0) {
+ p0 = p0|0; nullFunc_ii(5);return 0;
+}
+function _emscripten_glGetString__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
+}
+function _emscripten_glIsTexture__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
+}
+function _emscripten_glIsBuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
+}
+function _emscripten_glIsRenderbuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
+}
+function _emscripten_glCreateShader__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
+}
+function _emscripten_glIsShader__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
+}
+function _emscripten_glIsProgram__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
+}
+function _emscripten_glIsFramebuffer__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
+}
+function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
+}
+function _emscripten_glIsEnabled__wrapper(p0) {
+ p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
+}
+function b6(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_viddd(6);
+}
+function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
+}
+function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
+}
+function b7(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; nullFunc_vidd(7);
+}
+function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
+}
+function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
+}
+function b8(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(8);return 0;
+}
+function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; nullFunc_viiiiiiii(9);
+}
+function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
+}
+function b10(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; nullFunc_viiiiii(10);
+}
+function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
+}
+function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
+}
+function b11(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_viii(11);
+}
+function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
+}
+function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
+}
+function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
+}
+function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
+}
+function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
+}
+function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
+}
+function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
+}
+function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
+}
+function b12(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; nullFunc_vidddd(12);
+}
+function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
+}
+function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
+ p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
+}
+function b13(p0,p1) {
+ p0 = +p0;p1 = p1|0; nullFunc_vdi(13);
+}
+function _emscripten_glSampleCoverage__wrapper(p0,p1) {
+ p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
+}
+function b14(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; nullFunc_viiiiiii(14);
+}
+function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
+}
+function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; nullFunc_viiiiiiiii(15);
+}
+function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
+}
+function b16(p0,p1) {
+ p0 = p0|0;p1 = p1|0; nullFunc_iii(16);return 0;
+}
+function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
+}
+function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
+ p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
+}
+function b17() {
+ ; nullFunc_i(17);return 0;
+}
+function _emscripten_glCreateProgram__wrapper() {
+ ; return _emscripten_glCreateProgram()|0;
+}
+function _emscripten_glGetError__wrapper() {
+ ; return _emscripten_glGetError()|0;
+}
+function b18(p0,p1,p2,p3,p4,p5) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; nullFunc_vdddddd(18);
+}
+function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
+}
+function b19(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_vdddd(19);
+}
+function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
+}
+function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
+}
+function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
+ p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
+}
+function b20(p0,p1) {
+ p0 = +p0;p1 = +p1; nullFunc_vdd(20);
+}
+function _emscripten_glDepthRange__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
+}
+function _emscripten_glDepthRangef__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
+}
+function _emscripten_glPolygonOffset__wrapper(p0,p1) {
+ p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
+}
+function b21() {
+ ; nullFunc_v(21);
+}
+function _emscripten_glLoadIdentity__wrapper() {
+ ; _emscripten_glLoadIdentity();
+}
+function _emscripten_glReleaseShaderCompiler__wrapper() {
+ ; _emscripten_glReleaseShaderCompiler();
+}
+function _emscripten_glFinish__wrapper() {
+ ; _emscripten_glFinish();
+}
+function _emscripten_glFlush__wrapper() {
+ ; _emscripten_glFlush();
+}
+function b22(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = +p2; nullFunc_viid(22);
+}
+function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
+ p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
+}
+function b23(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; nullFunc_viiii(23);
+}
+function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
+ p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
+}
+
+// EMSCRIPTEN_END_FUNCS
+var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
+var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
+var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
+var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,b3,b3
+,b3,b3,b3];
+var FUNCTION_TABLE_vii = [b4,_stbi__stdio_skip,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
+,b4,b4,b4,b4,b4];
+var FUNCTION_TABLE_ii = [b5,_stbi__stdio_eof,___stdio_close,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
+var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
+var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
+var FUNCTION_TABLE_iiii = [b8,_stbi__stdio_read,___stdout_write,___stdio_seek,_sn_write,_EmscriptenFullscreenChangeCallback,_EmscriptenKeyboardCallback,_EmscriptenMouseCallback,_EmscriptenTouchCallback,_EmscriptenGamepadCallback,___stdio_write,___stdio_read,b8,b8,b8,b8];
+var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
+var FUNCTION_TABLE_viiiiii = [b10,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper,b10];
+var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper,b11];
+var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
+var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
+var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
+var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
+var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16];
+var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
+var FUNCTION_TABLE_vdddddd = [b18,_emscripten_glFrustum__wrapper];
+var FUNCTION_TABLE_vdddd = [b19,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
+var FUNCTION_TABLE_vdd = [b20,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
+var FUNCTION_TABLE_v = [b21,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b21,b21];
+var FUNCTION_TABLE_viid = [b22,_emscripten_glTexParameterf__wrapper];
+var FUNCTION_TABLE_viiii = [b23,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b23,b23,b23];
+
+ return { _roundf: _roundf, _main: _main, _memset: _memset, _bitshift64Lshr: _bitshift64Lshr, _bitshift64Shl: _bitshift64Shl, _fflush: _fflush, _llvm_cttz_i32: _llvm_cttz_i32, _sbrk: _sbrk, _memcpy: _memcpy, _llvm_bswap_i32: _llvm_bswap_i32, ___muldi3: ___muldi3, ___uremdi3: ___uremdi3, _i64Subtract: _i64Subtract, ___udivmoddi4: ___udivmoddi4, _i64Add: _i64Add, _emscripten_get_global_libc: _emscripten_get_global_libc, _emscripten_GetProcAddress: _emscripten_GetProcAddress, ___udivdi3: ___udivdi3, ___errno_location: ___errno_location, ___muldsi3: ___muldsi3, _free: _free, _memmove: _memmove, _strstr: _strstr, _malloc: _malloc, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setTempRet0: setTempRet0, getTempRet0: getTempRet0, setThrew: setThrew, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
+})
+// EMSCRIPTEN_END_ASM
+(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
+
+var real__roundf = asm["_roundf"]; asm["_roundf"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__roundf.apply(null, arguments);
+};
+
+var real__main = asm["_main"]; asm["_main"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__main.apply(null, arguments);
+};
+
+var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_stackSave.apply(null, arguments);
+};
+
+var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_getTempRet0.apply(null, arguments);
+};
+
+var real__llvm_cttz_i32 = asm["_llvm_cttz_i32"]; asm["_llvm_cttz_i32"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__llvm_cttz_i32.apply(null, arguments);
+};
+
+var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_setThrew.apply(null, arguments);
+};
+
+var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__bitshift64Lshr.apply(null, arguments);
+};
+
+var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__bitshift64Shl.apply(null, arguments);
+};
+
+var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__fflush.apply(null, arguments);
+};
+
+var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__sbrk.apply(null, arguments);
+};
+
+var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__llvm_bswap_i32.apply(null, arguments);
+};
+
+var real____muldi3 = asm["___muldi3"]; asm["___muldi3"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____muldi3.apply(null, arguments);
+};
+
+var real____uremdi3 = asm["___uremdi3"]; asm["___uremdi3"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____uremdi3.apply(null, arguments);
+};
+
+var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_stackAlloc.apply(null, arguments);
+};
+
+var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__i64Subtract.apply(null, arguments);
+};
+
+var real____udivmoddi4 = asm["___udivmoddi4"]; asm["___udivmoddi4"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____udivmoddi4.apply(null, arguments);
+};
+
+var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_setTempRet0.apply(null, arguments);
+};
+
+var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__i64Add.apply(null, arguments);
+};
+
+var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__emscripten_get_global_libc.apply(null, arguments);
+};
+
+var real__emscripten_GetProcAddress = asm["_emscripten_GetProcAddress"]; asm["_emscripten_GetProcAddress"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__emscripten_GetProcAddress.apply(null, arguments);
+};
+
+var real____udivdi3 = asm["___udivdi3"]; asm["___udivdi3"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____udivdi3.apply(null, arguments);
+};
+
+var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____errno_location.apply(null, arguments);
+};
+
+var real____muldsi3 = asm["___muldsi3"]; asm["___muldsi3"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real____muldsi3.apply(null, arguments);
+};
+
+var real__free = asm["_free"]; asm["_free"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__free.apply(null, arguments);
+};
+
+var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_establishStackSpace.apply(null, arguments);
+};
+
+var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__memmove.apply(null, arguments);
+};
+
+var real__strstr = asm["_strstr"]; asm["_strstr"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__strstr.apply(null, arguments);
+};
+
+var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real_stackRestore.apply(null, arguments);
+};
+
+var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
+assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+return real__malloc.apply(null, arguments);
+};
+var _roundf = Module["_roundf"] = asm["_roundf"];
+var _main = Module["_main"] = asm["_main"];
+var stackSave = Module["stackSave"] = asm["stackSave"];
+var getTempRet0 = Module["getTempRet0"] = asm["getTempRet0"];
+var _llvm_cttz_i32 = Module["_llvm_cttz_i32"] = asm["_llvm_cttz_i32"];
+var setThrew = Module["setThrew"] = asm["setThrew"];
+var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
+var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
+var _fflush = Module["_fflush"] = asm["_fflush"];
+var _memset = Module["_memset"] = asm["_memset"];
+var _sbrk = Module["_sbrk"] = asm["_sbrk"];
+var _memcpy = Module["_memcpy"] = asm["_memcpy"];
+var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = asm["_llvm_bswap_i32"];
+var ___muldi3 = Module["___muldi3"] = asm["___muldi3"];
+var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
+var stackAlloc = Module["stackAlloc"] = asm["stackAlloc"];
+var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
+var ___udivmoddi4 = Module["___udivmoddi4"] = asm["___udivmoddi4"];
+var setTempRet0 = Module["setTempRet0"] = asm["setTempRet0"];
+var _i64Add = Module["_i64Add"] = asm["_i64Add"];
+var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = asm["_emscripten_get_global_libc"];
+var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
+var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
+var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
+var ___muldsi3 = Module["___muldsi3"] = asm["___muldsi3"];
+var _free = Module["_free"] = asm["_free"];
+var runPostSets = Module["runPostSets"] = asm["runPostSets"];
+var establishStackSpace = Module["establishStackSpace"] = asm["establishStackSpace"];
+var _memmove = Module["_memmove"] = asm["_memmove"];
+var _strstr = Module["_strstr"] = asm["_strstr"];
+var stackRestore = Module["stackRestore"] = asm["stackRestore"];
+var _malloc = Module["_malloc"] = asm["_malloc"];
+var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
+var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
+var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
+var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
+var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
+var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
+var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
+var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
+var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
+var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
+var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
+var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
+var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
+var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
+var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
+var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
+var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
+var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
+var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
+var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
+var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
+;
+
+Runtime.stackAlloc = Module['stackAlloc'];
+Runtime.stackSave = Module['stackSave'];
+Runtime.stackRestore = Module['stackRestore'];
+Runtime.establishStackSpace = Module['establishStackSpace'];
+
+Runtime.setTempRet0 = Module['setTempRet0'];
+Runtime.getTempRet0 = Module['getTempRet0'];
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module['asm'] = asm;
+
+
+
+
+
+function ExitStatus(status) {
+ this.name = "ExitStatus";
+ this.message = "Program terminated with exit(" + status + ")";
+ this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var initialStackTop;
+var preloadStartTime = null;
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+ // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+ if (!Module['calledRun']) run();
+ if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+Module['callMain'] = Module.callMain = function callMain(args) {
+ assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
+ assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
+
+ args = args || [];
+
+ ensureInitRuntime();
+
+ var argc = args.length+1;
+ function pad() {
+ for (var i = 0; i < 4-1; i++) {
+ argv.push(0);
+ }
+ }
+ var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
+ pad();
+ for (var i = 0; i < argc-1; i = i + 1) {
+ argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
+ pad();
+ }
+ argv.push(0);
+ argv = allocate(argv, 'i32', ALLOC_NORMAL);
+
+
+ try {
+
+ var ret = Module['_main'](argc, argv, 0);
+
+
+ // if we're not running an evented main loop, it's time to exit
+ exit(ret, /* implicit = */ true);
+ }
+ catch(e) {
+ if (e instanceof ExitStatus) {
+ // exit() throws this once it's done to make sure execution
+ // has been stopped completely
+ return;
+ } else if (e == 'SimulateInfiniteLoop') {
+ // running an evented main loop, don't immediately exit
+ Module['noExitRuntime'] = true;
+ return;
+ } else {
+ var toLog = e;
+ if (e && typeof e === 'object' && e.stack) {
+ toLog = [e, e.stack];
+ }
+ Module.printErr('exception thrown: ' + toLog);
+ Module['quit'](1, e);
+ }
+ } finally {
+ calledMain = true;
+ }
+}
+
+
+
+
+function run(args) {
+ args = args || Module['arguments'];
+
+ if (preloadStartTime === null) preloadStartTime = Date.now();
+
+ if (runDependencies > 0) {
+ Module.printErr('run() called, but dependencies remain, so not running');
+ return;
+ }
+
+ writeStackCookie();
+
+ preRun();
+
+ if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+ if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+ function doRun() {
+ if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+ Module['calledRun'] = true;
+
+ if (ABORT) return;
+
+ ensureInitRuntime();
+
+ preMain();
+
+ if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) {
+ Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms');
+ }
+
+ if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+ if (Module['_main'] && shouldRunNow) Module['callMain'](args);
+
+ postRun();
+ }
+
+ if (Module['setStatus']) {
+ Module['setStatus']('Running...');
+ setTimeout(function() {
+ setTimeout(function() {
+ Module['setStatus']('');
+ }, 1);
+ doRun();
+ }, 1);
+ } else {
+ doRun();
+ }
+ checkStackCookie();
+}
+Module['run'] = Module.run = run;
+
+function exit(status, implicit) {
+ if (implicit && Module['noExitRuntime']) {
+ Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)');
+ return;
+ }
+
+ if (Module['noExitRuntime']) {
+ Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)');
+ } else {
+
+ ABORT = true;
+ EXITSTATUS = status;
+ STACKTOP = initialStackTop;
+
+ exitRuntime();
+
+ if (Module['onExit']) Module['onExit'](status);
+ }
+
+ if (ENVIRONMENT_IS_NODE) {
+ process['exit'](status);
+ }
+ Module['quit'](status, new ExitStatus(status));
+}
+Module['exit'] = Module.exit = exit;
+
+var abortDecorators = [];
+
+function abort(what) {
+ if (what !== undefined) {
+ Module.print(what);
+ Module.printErr(what);
+ what = JSON.stringify(what)
+ } else {
+ what = '';
+ }
+
+ ABORT = true;
+ EXITSTATUS = 1;
+
+ var extra = '';
+
+ var output = 'abort(' + what + ') at ' + stackTrace() + extra;
+ if (abortDecorators) {
+ abortDecorators.forEach(function(decorator) {
+ output = decorator(output, what);
+ });
+ }
+ throw output;
+}
+Module['abort'] = Module.abort = abort;
+
+// {{PRE_RUN_ADDITIONS}}
+
+if (Module['preInit']) {
+ if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+ while (Module['preInit'].length > 0) {
+ Module['preInit'].pop()();
+ }
+}
+
+// shouldRunNow refers to calling main(), not run().
+var shouldRunNow = true;
+if (Module['noInitialRun']) {
+ shouldRunNow = false;
+}
+
+
+run();
+
+// {{POST_RUN_ADDITIONS}}
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+