Recompile with new shell

author: Ray <[email protected]> 2019-05-22 16:23:23 +0200
committer: Ray <[email protected]> 2019-05-22 16:23:23 +0200
commit: 7ebb1f34d2dac05a834528ae63a8ad91b2b94b64 (patch)
tree: d0ef00a4df6169a9f9443495883f0f98c2f6b6b7 /examples
parent: c12d0c359e85476dc2cdc3aa1d41ee41eedaa8db (diff)
download: raylib.com-7ebb1f34d2dac05a834528ae63a8ad91b2b94b64.tar.gz
raylib.com-7ebb1f34d2dac05a834528ae63a8ad91b2b94b64.zip
3 files changed, 10945 insertions, 2 deletions
diff --git a/examples/web/audio/audio_music_stream.html b/examples/web/audio/audio_music_stream.html
index 052b639..d126829 100644
--- a/examples/web/audio/audio_music_stream.html
+++ b/examples/web/audio/audio_music_stream.html
@@ -1 +1,329 @@
-<!doctypehtml><html lang=en-us><head><meta charset=utf-8><meta content="text/html; charset=utf-8"http-equiv=Content-Type><title>raylib HTML5 GAME</title><meta content="raylib HTML5 GAME"name=title><meta content="New HTML5 videogame, developed using raylib videogames library"name=description><meta content="raylib, games, html5, programming, C, C++, library, learn, videogames"name=keywords><meta content="width=device-width"name=viewport><meta content="raylib HTML5 GAME"property=og:title><meta content=image/png property=og:image:type><meta content=https://www.raylib.com/common/img/raylib_logo.png property=og:image><meta content=https://www.raylib.com/common/img/raylib_logo.png property=og:image><meta content=https://www.raylib.com/games property=og:url><meta content=raylib.com property=og:site_name><meta content="New hmtl5 videogame, developed using raylib videogames library"property=og:description><meta content=summary name=twitter:card><meta content=@raysan5 name=twitter:site><meta content="raylib HTML5 GAME"name=twitter:title><meta content="New HTML5 videogame, developed using raylib videogames library"name=twitter:description><meta content=https://www.raylib.com/common/img/raylib_logo.png name=twitter:image><meta content=https://www.raylib.com/common/img/raylib_logo.png name=twitter:url><link href=https://www.raylib.com/favicon.ico rel="shortcut icon"><style>body{font-family:arial;margin:0;padding:none}#header_part{width:100%;height:80px;background-color:#888}#logo{width:64px;height:64px;float:left;position:relative;margin:10px;background-image:url(https://www.raylib.com/common/img/raylib_logo_64x64.png)}.emscripten{padding-right:0;margin-left:auto;margin-right:auto;display:block}div.emscripten{text-align:center}div.emscripten_border{border:1px solid #000}canvas.emscripten{border:0 none;background:#000;width:100%}#emscripten_logo{display:inline-block;margin:0}.spinner{height:30px;width:30px;margin:0;margin-top:20px;margin-left:20px;display:inline-block;vertical-align:top;-webkit-animation:rotation .8s linear infinite;-moz-animation:rotation .8s linear infinite;-o-animation:rotation .8s linear infinite;animation:rotation .8s linear infinite;border-left:5px solid #000;border-right:5px solid #000;border-bottom:5px solid #000;border-top:5px solid red;border-radius:100%;background-color:#f5f5f5}@-webkit-keyframes rotation{from{-webkit-transform:rotate(0)}to{-webkit-transform:rotate(360deg)}}@-moz-keyframes rotation{from{-moz-transform:rotate(0)}to{-moz-transform:rotate(360deg)}}@-o-keyframes rotation{from{-o-transform:rotate(0)}to{-o-transform:rotate(360deg)}}@keyframes rotation{from{transform:rotate(0)}to{transform:rotate(360deg)}}#status{display:inline-block;vertical-align:top;margin-top:30px;margin-left:20px;font-weight:700;color:#282828}#progress{height:20px;width:30px}#controls{display:inline-block;float:right;vertical-align:top;margin-top:30px;margin-right:20px}#output{width:100%;height:140px;margin:0 auto;margin-top:10px;display:block;background-color:#000;color:#25ae26;font-family:'Lucida Console',Monaco,monospace;outline:0}</style></head><body><div id=header_part><a href=https://www.raylib.com id=logo></a><div class=spinner id=spinner></div><div class=emscripten id=status>Downloading...</div><span id=controls><span><input onclick=Module.requestFullscreen(!1,!1) type=button value=Fullscreen></span></span><div class=emscripten><progress hidden id=progress max=100 value=0></progress></div></div><div class=emscripten_border><canvas class=emscripten id=canvas oncontextmenu=event.preventDefault()></canvas></div><textarea id=output rows=8></textarea><script src=https://cdn.jsdelivr.net/gh/eligrey/FileSaver.js/dist/FileSaver.min.js></script><script>function SaveFileFromMEMFSToDisk(e,a){var t,i=/^((?!chrome|android).)*safari/i.test(navigator.userAgent),o=FS.readFile(e);t=i?new Blob([o.buffer],{type:"application/octet-stream"}):new Blob([o.buffer],{type:"application/octet-binary"}),saveAs(t,a)}</script><script>var statusElement=document.querySelector("#status"),progressElement=document.querySelector("#progress"),spinnerElement=document.querySelector("#spinner"),Module={preRun:[],postRun:[],print:function(){var t=document.querySelector("#output");return t&&(t.value=""),function(e){1<arguments.length&&(e=Array.prototype.slice.call(arguments).join(" ")),console.log(e),t&&(t.value+=e+"\n",t.scrollTop=t.scrollHeight)}}(),printErr:function(e){1<arguments.length&&(e=Array.prototype.slice.call(arguments).join(" ")),console.error(e)},canvas:function(){var e=document.querySelector("#canvas");return e.addEventListener("webglcontextlost",function(e){alert("WebGL context lost. You will need to reload the page."),e.preventDefault()},!1),e}(),setStatus:function(e){if(Module.setStatus.last||(Module.setStatus.last={time:Date.now(),text:""}),e!==Module.setStatus.text){var t=e.match(/([^(]+)\((\d+(\.\d+)?)\/(\d+)\)/),n=Date.now();t&&n-Date.now()<30||(t?(e=t[1],progressElement.value=100*parseInt(t[2]),progressElement.max=100*parseInt(t[4]),progressElement.hidden=!1,spinnerElement.hidden=!1):(progressElement.value=null,progressElement.max=null,progressElement.hidden=!0,e||(spinnerElement.style.display="none")),statusElement.innerHTML=e)}},totalDependencies:0,monitorRunDependencies:function(e){this.totalDependencies=Math.max(this.totalDependencies,e),Module.setStatus(e?"Preparing... ("+(this.totalDependencies-e)+"/"+this.totalDependencies+")":"All downloads complete.")}};Module.setStatus("Downloading..."),window.onerror=function(e){Module.setStatus("Exception thrown, see JavaScript console"),spinnerElement.style.display="none",Module.setStatus=function(e){e&&Module.printErr("[post-exception status] "+e)}}</script><script src=audio_music_stream.js async></script></body></html>
-\ No newline at end of file
+<!doctype html>
+<html lang="en-us">
+  <head>
+    <meta charset="utf-8">
+    <meta http-equiv="Content-Type" content="text/html; charset=utf-8">
+    
+    <title>raylib HTML5 GAME</title>
+    
+    <meta name="title" content="raylib HTML5 GAME">
+    <meta name="description" content="New HTML5 videogame, developed using raylib videogames library">
+    <meta name="keywords" content="raylib, games, html5, programming, C, C++, library, learn, videogames">
+    <meta name="viewport" content="width=device-width">
+    
+    <!-- Open Graph metatags for sharing -->
+    <meta property="og:title" content="raylib HTML5 GAME">
+    <meta property="og:image:type" content="image/png">
+    <meta property="og:image" content="https://www.raylib.com/common/img/raylib_logo.png">
+    <meta property="og:site_name" content="raylib.com">
+    <meta property="og:url" content="https://www.raylib.com/games.html">
+    <meta property="og:description" content="New HTML5 videogame, developed using raylib videogames library">
+
+    <!-- Twitter metatags for sharing -->
+    <meta name="twitter:card" content="summary">
+    <meta name="twitter:site" content="@raysan5">
+    <meta name="twitter:title" content="raylib HTML5 GAME">
+    <meta name="twitter:image" content="https://www.raylib.com/common/raylib_logo.png">
+    <meta name="twitter:url" content="https://www.raylib.com/games.html">
+    <meta name="twitter:description" content="New HTML5 videogame, developed using raylib videogames library">
+    
+    <!-- Favicon -->
+    <link rel="shortcut icon" href="https://www.raylib.com/favicon.ico">
+    
+    <style>
+      body { 
+        font-family: arial; 
+        margin: 0; 
+        padding: none;
+      }
+      
+      #header { 
+        width: 100%; 
+        height: 80px; 
+        background-color: #888888; 
+      }
+      
+      /* NOTE: raylib logo is embedded in the page as base64 png image */
+      #logo { 
+        width:64px; 
+        height:64px; 
+        float:left; 
+        position:relative; 
+        margin:10px; 
+        background-image:url('data:image/png;base64,\
+iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAIAAAAlC+aJAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADs\
+MAAA7DAcdvqGQAAAAadEVYdFNvZnR3YXJlAFBhaW50Lk5FVCB2My41LjExR/NCNwAAA7JJREFUaEPtk0FyWzEMQ+37X7fZhxX4\
+YY3AD1OKF1nkzTRlSBCCLeVBnvl/AUdaELOunPno1kts1kixdtEZKVs+xIxebBkZsVknn/L5nFGDLR8T4zVC9fX19S/+tTFijr\
+YK4jUjbPUtqBHpnEE6PkZD7jQZV8n5Recw1XQKciZuPaEtR6UjNs5ENVGMsBVqpPtER0ZMOhpyp8m4YL4OjD9yxsyZxnQycfMJ\
+ETNSzsRE1+dihK3YMiJmpHTW3xpmXPC6BXlCHfqnBlsjY5hxf/6EVEOM2BTEi0fYCX4ONSI6Kq3Blg/prIOMq2CsRur4KQ0x64\
+SdjOufEDEdHZGOhmz5RDHCVqhRuQ86YsVskbc+GXchLiHnFyYH+UigQDVGnImbT8hwFkgLg2qiM8JO6Ylx1FNLa3DmYwqCTsZd\
+4BPqGJG7MwKzpeiWKTKxXkLMVE3MSOmsdwxLH6Rd/wCCLSNDx6djeKfJuArGeoYamRHpaEjnCBYZVy8hZqo2GI36qPjsiOiMsB\
+XGcev4Mx9TLGTchbgEjN/uz6jGrBvDjg+LTNx8Qp2CbG2xMKgmOiPslJ4Yxx+eSnSkzlosZNwFPiHl7FRTkLNRJm4+IeVM0ymI\
+H42wE/wcKalQI4MRl4EW3p6VcRWMua8F6WjIlqZDxvVPiHQ6CjVbYkV9ohhhp/Rk1wiYgpyJ78i4CsZbjkb8Qx+ihvzu3RPaKo\
+gZkY6GlEeMsKdPSOFIC8VoOusg44L5c+T8ouOoGhWbdWJ8tMi4egkxo4hoh2yNTGf3iIyr5Lyic4bRENXo+lvDjAt4C1Hk/OKt\
+UaAj0+n4dMSZ2D+hrYJsaYh2SClG2jV9kJKKzhlGQ1SsW299Mq6C8dYZHTExo8fzieI5ivipYnYy7nwJqGKmOYyRwfiUBXITfh\
+5qSHRGWEkfqJqURgvsdHyWYv7Ko8DnYYegk3EB00cxprdrJRzFd7YQzawu8L1GMTYS/KpPaAFTkIn1EmJmspJSs5xBzSyGhlkB\
+mlxfNFiP5mw4wlbMh4F5Ddxp5jNINBdCEz9zPOC1zD7Q0HBdmXndwv0TMtydEdzlWJT4VZ8Qt9Qn4/onxMIwa5ZYGJU5yufBiC\
+jwE50AGjLCVuS8Yt4H7OgZLKK5EKOsLviEWJSL/+0uMi7gLUSBseYwqEbXvSHCec1CJvZPyHCmYQffaBBfOTCGHM2aEbZi1+gO\
+1XTWVXMnzrhAn5DSOZVsiQlHnSITKzGj6DeTcZWc/3oy7h9//PF4PL4BlvsWrb6RE+oAAAAASUVORK5CYII=');
+      }
+      
+      .emscripten { padding-right: 0; margin-left: auto; margin-right: auto; display: block; }
+      div.emscripten { text-align: center; }      
+      div.emscripten_border { border: 1px solid black; }
+      
+      /* NOTE: Canvas *must not* have any border or padding, or mouse coords will be wrong */
+      canvas.emscripten { 
+        border: 0px none; 
+        background: black; 
+        width: 100% 
+      }
+     
+      .spinner { 
+        height: 30px; 
+        width: 30px; 
+        margin: 0; 
+        margin-top: 20px; 
+        margin-left: 20px;
+        display: inline-block;
+        vertical-align: top;
+        -webkit-animation: rotation .8s linear infinite;
+        -moz-animation: rotation .8s linear infinite;
+        -o-animation: rotation .8s linear infinite;
+        animation: rotation 0.8s linear infinite;
+        border-left: 5px solid black;
+        border-right: 5px solid black;
+        border-bottom: 5px solid black;
+        border-top: 5px solid red;
+        border-radius: 100%;
+        background-color: rgb(245, 245, 245);
+      }
+      @-webkit-keyframes rotation {
+        from {-webkit-transform: rotate(0deg);}
+        to {-webkit-transform: rotate(360deg);}
+      }
+      @-moz-keyframes rotation {
+        from {-moz-transform: rotate(0deg);}
+        to {-moz-transform: rotate(360deg);}
+      }
+      @-o-keyframes rotation {
+        from {-o-transform: rotate(0deg);}
+        to {-o-transform: rotate(360deg);}
+      }
+      @keyframes rotation {
+        from {transform: rotate(0deg);}
+        to {transform: rotate(360deg);}
+      }
+      
+      #status {
+        display: inline-block;
+        vertical-align: top;
+        margin-top: 30px;
+        margin-left: 20px;
+        font-weight: bold;
+        color: rgb(40, 40, 40);
+      }
+      
+      #progress {
+        height: 20px;
+        width: 30px;
+      }
+      
+      #controls {
+        display: inline-block;
+        float: right;
+        vertical-align: top;
+        margin-top: 15px;
+        margin-right: 20px;
+      }
+      
+      #output {
+        width: 100%;
+        height: 140px;
+        margin: 0 auto;
+        margin-top: 10px;
+        display: block;
+        background-color: black;
+        color: rgb(37, 174, 38);
+        font-family: 'Lucida Console', Monaco, monospace;
+        outline: none;
+      }
+      
+      input[type=button] {
+        background-color: lightgray;
+        border: 4px solid darkgray;
+        color: black;
+        text-decoration: none;
+        cursor: pointer;
+        width: 140px;
+        height: 50px;
+      }
+      
+      input[type=button]:hover {
+        background-color: #f5f5f5ff;
+        border-color: black;
+      }
+    </style>
+  </head>
+  <body>
+    <div id="header">
+        <a id="logo" href="https://www.raylib.com"></a>
+        
+        <div class="spinner" id='spinner'></div>
+        <div class="emscripten" id="status">Downloading...</div>
+
+        <span id='controls'>
+          <span><input type="button" value="🖵 FULLSCREEN" onclick="Module.requestFullscreen(false, false)"></span>
+          <span><input type="button" id="btn-audio" value="🔇 SUSPEND" onclick="toggleAudio()"></span>
+        </span>
+
+        <div class="emscripten">
+          <progress value="0" max="100" id="progress" hidden=1></progress>
+        </div>
+    </div>
+    
+    <div class="emscripten_border">
+      <canvas class="emscripten" id="canvas" oncontextmenu="event.preventDefault()" tabindex=-1></canvas>
+    </div>
+    
+    <textarea id="output" rows="8"></textarea>
+
+    <script type='text/javascript' src="https://cdn.jsdelivr.net/gh/eligrey/FileSaver.js/dist/FileSaver.min.js"> </script>
+    <script type='text/javascript'>
+        function saveFileFromMEMFSToDisk(memoryFSname, localFSname)     // This can be called by C/C++ code
+        {
+            var isSafari = /^((?!chrome|android).)*safari/i.test(navigator.userAgent);
+            var data = FS.readFile(memoryFSname);
+            var blob;
+
+            if (isSafari) blob = new Blob([data.buffer], { type: "application/octet-stream" });
+            else blob = new Blob([data.buffer], { type: "application/octet-binary" });
+
+            // NOTE: SaveAsDialog is a browser setting. For example, in Google Chrome,
+            // in Settings/Advanced/Downloads section you have a setting:
+            // 'Ask where to save each file before downloading' - which you can set true/false.
+            // If you enable this setting it would always ask you and bring the SaveAsDialog
+            saveAs(blob, localFSname);
+        }
+    </script>
+    <script type='text/javascript'>
+        var statusElement = document.querySelector('#status');
+        var progressElement = document.querySelector('#progress');
+        var spinnerElement = document.querySelector('#spinner');
+        var Module = {
+            preRun: [],
+            postRun: [],
+            print: (function() {
+                var element = document.querySelector('#output');
+                
+                if (element) element.value = '';    // Clear browser cache
+                
+                return function(text) {
+                    if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' ');
+                    // These replacements are necessary if you render to raw HTML
+                    //text = text.replace(/&/g, "&amp;");
+                    //text = text.replace(/</g, "&lt;");
+                    //text = text.replace(/>/g, "&gt;");
+                    //text = text.replace('\n', '<br>', 'g');
+                    console.log(text);
+                    
+                    if (element) {
+                        element.value += text + "\n";
+                        element.scrollTop = element.scrollHeight; // focus on bottom
+                    }
+                };
+            })(),
+            printErr: function(text) {
+                if (arguments.length > 1) text = Array.prototype.slice.call(arguments).join(' ');
+                
+                console.error(text);
+            },
+            canvas: (function() {
+                var canvas = document.querySelector('#canvas');
+
+                // As a default initial behavior, pop up an alert when webgl context is lost. To make your
+                // application robust, you may want to override this behavior before shipping!
+                // See http://www.khronos.org/registry/webgl/specs/latest/1.0/#5.15.2
+                canvas.addEventListener("webglcontextlost", function(e) { alert('WebGL context lost. You will need to reload the page.'); e.preventDefault(); }, false);
+
+                return canvas;
+            })(),
+            setStatus: function(text) {
+                if (!Module.setStatus.last) Module.setStatus.last = { time: Date.now(), text: '' };
+                if (text === Module.setStatus.last.text) return;
+                
+                var m = text.match(/([^(]+)\((\d+(\.\d+)?)\/(\d+)\)/);
+                var now = Date.now();
+                
+                if (m && now - Module.setStatus.last.time < 30) return; // If this is a progress update, skip it if too soon
+              
+                Module.setStatus.last.time = now;
+                Module.setStatus.last.text = text;
+                
+                if (m) {
+                    text = m[1];
+                    progressElement.value = parseInt(m[2])*100;
+                    progressElement.max = parseInt(m[4])*100;
+                    progressElement.hidden = false;
+                    spinnerElement.hidden = false;
+                } else {
+                    progressElement.value = null;
+                    progressElement.max = null;
+                    progressElement.hidden = true;
+                    if (!text) spinnerElement.style.display = 'none';
+                }
+                
+                statusElement.innerHTML = text;
+            },
+            totalDependencies: 0,
+            monitorRunDependencies: function(left) {
+                this.totalDependencies = Math.max(this.totalDependencies, left);
+                Module.setStatus(left ? 'Preparing... (' + (this.totalDependencies-left) + '/' + this.totalDependencies + ')' : 'All downloads complete.');
+            },
+            //noInitialRun: true
+        };
+        
+        Module.setStatus('Downloading...');
+        
+        window.onerror = function() {
+            Module.setStatus('Exception thrown, see JavaScript console');
+            spinnerElement.style.display = 'none';
+            Module.setStatus = function(text) { if (text) Module.printErr('[post-exception status] ' + text); };
+        };
+    </script>
+    
+    <!-- REF: https://developers.google.com/web/updates/2018/11/web-audio-autoplay -->
+    <script type='text/javascript'>
+        var audioBtn = document.querySelector('#btn-audio');
+        
+        // An array of all contexts to resume on the page
+        const audioContexList = [];
+        (function() {
+            // A proxy object to intercept AudioContexts and 
+            // add them to the array for tracking and resuming later
+            self.AudioContext = new Proxy(self.AudioContext, {
+                construct(target, args) {
+                    const result = new target(...args);
+                    audioContexList.push(result);
+                    if (result.state == "suspended") audioBtn.value = "🔈 RESUME";
+                    return result;
+                }
+            });
+        })();
+
+        function toggleAudio() {
+            var resumed = false;
+            audioContexList.forEach(ctx => {
+                if (ctx.state == "suspended") { ctx.resume(); resumed = true; }
+                else if (ctx.state == "running") ctx.suspend();
+            });
+            
+            if (resumed) audioBtn.value = "🔇 SUSPEND";
+            else audioBtn.value = "🔈 RESUME";
+        }
+    </script>
+    <script async type="text/javascript" src="audio_music_stream.js"></script>
+  </body>
+</html>
+
+
diff --git a/examples/web/audio/audio_music_stream.js b/examples/web/audio/audio_music_stream.js
index bcb6a80..8ba4f01 100644
--- a/examples/web/audio/audio_music_stream.js
+++ b/examples/web/audio/audio_music_stream.js
@@ -1 +1,10616 @@
-var Module=typeof Module!=="undefined"?Module:{};if(!Module.expectedDataFileDownloads){Module.expectedDataFileDownloads=0;Module.finishedDataFileDownloads=0}Module.expectedDataFileDownloads++;(function(){var loadPackage=function(metadata){var PACKAGE_PATH;if(typeof window==="object"){PACKAGE_PATH=window["encodeURIComponent"](window.location.pathname.toString().substring(0,window.location.pathname.toString().lastIndexOf("/"))+"/")}else if(typeof location!=="undefined"){PACKAGE_PATH=encodeURIComponent(location.pathname.toString().substring(0,location.pathname.toString().lastIndexOf("/"))+"/")}else{throw"using preloaded data can only be done on a web page or in a web worker"}var PACKAGE_NAME="audio/audio_music_stream.data";var REMOTE_PACKAGE_BASE="audio_music_stream.data";if(typeof Module["locateFilePackage"]==="function"&&!Module["locateFile"]){Module["locateFile"]=Module["locateFilePackage"];err("warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)")}var REMOTE_PACKAGE_NAME=Module["locateFile"]?Module["locateFile"](REMOTE_PACKAGE_BASE,""):REMOTE_PACKAGE_BASE;var REMOTE_PACKAGE_SIZE=metadata.remote_package_size;var PACKAGE_UUID=metadata.package_uuid;function fetchRemotePackage(packageName,packageSize,callback,errback){var xhr=new XMLHttpRequest;xhr.open("GET",packageName,true);xhr.responseType="arraybuffer";xhr.onprogress=function(event){var url=packageName;var size=packageSize;if(event.total)size=event.total;if(event.loaded){if(!xhr.addedTotal){xhr.addedTotal=true;if(!Module.dataFileDownloads)Module.dataFileDownloads={};Module.dataFileDownloads[url]={loaded:event.loaded,total:size}}else{Module.dataFileDownloads[url].loaded=event.loaded}var total=0;var loaded=0;var num=0;for(var download in Module.dataFileDownloads){var data=Module.dataFileDownloads[download];total+=data.total;loaded+=data.loaded;num++}total=Math.ceil(total*Module.expectedDataFileDownloads/num);if(Module["setStatus"])Module["setStatus"]("Downloading data... ("+loaded+"/"+total+")")}else if(!Module.dataFileDownloads){if(Module["setStatus"])Module["setStatus"]("Downloading data...")}};xhr.onerror=function(event){throw new Error("NetworkError for: "+packageName)};xhr.onload=function(event){if(xhr.status==200||xhr.status==304||xhr.status==206||xhr.status==0&&xhr.response){var packageData=xhr.response;callback(packageData)}else{throw new Error(xhr.statusText+" : "+xhr.responseURL)}};xhr.send(null)}function handleError(error){console.error("package error:",error)}var fetchedCallback=null;var fetched=Module["getPreloadedPackage"]?Module["getPreloadedPackage"](REMOTE_PACKAGE_NAME,REMOTE_PACKAGE_SIZE):null;if(!fetched)fetchRemotePackage(REMOTE_PACKAGE_NAME,REMOTE_PACKAGE_SIZE,function(data){if(fetchedCallback){fetchedCallback(data);fetchedCallback=null}else{fetched=data}},handleError);function runWithFS(){function assert(check,msg){if(!check)throw msg+(new Error).stack}Module["FS_createPath"]("/","resources",true,true);function DataRequest(start,end,audio){this.start=start;this.end=end;this.audio=audio}DataRequest.prototype={requests:{},open:function(mode,name){this.name=name;this.requests[name]=this;Module["addRunDependency"]("fp "+this.name)},send:function(){},onload:function(){var byteArray=this.byteArray.subarray(this.start,this.end);this.finish(byteArray)},finish:function(byteArray){var that=this;Module["FS_createDataFile"](this.name,null,byteArray,true,true,true);Module["removeRunDependency"]("fp "+that.name);this.requests[this.name]=null}};var files=metadata.files;for(var i=0;i<files.length;++i){new DataRequest(files[i].start,files[i].end,files[i].audio).open("GET",files[i].filename)}function processPackageData(arrayBuffer){Module.finishedDataFileDownloads++;assert(arrayBuffer,"Loading data file failed.");assert(arrayBuffer instanceof ArrayBuffer,"bad input to processPackageData");var byteArray=new Uint8Array(arrayBuffer);var ptr=Module["getMemory"](byteArray.length);Module["HEAPU8"].set(byteArray,ptr);DataRequest.prototype.byteArray=Module["HEAPU8"].subarray(ptr,ptr+byteArray.length);var files=metadata.files;for(var i=0;i<files.length;++i){DataRequest.prototype.requests[files[i].filename].onload()}Module["removeRunDependency"]("datafile_audio/audio_music_stream.data")}Module["addRunDependency"]("datafile_audio/audio_music_stream.data");if(!Module.preloadResults)Module.preloadResults={};Module.preloadResults[PACKAGE_NAME]={fromCache:false};if(fetched){processPackageData(fetched);fetched=null}else{fetchedCallback=processPackageData}}if(Module["calledRun"]){runWithFS()}else{if(!Module["preRun"])Module["preRun"]=[];Module["preRun"].push(runWithFS)}};loadPackage({"files":[{"start":0,"audio":1,"end":506938,"filename":"/resources/guitar_noodling.ogg"}],"remote_package_size":506938,"package_uuid":"ebffd3e1-c673-4f15-a42c-e0684b4c8296"})})();var moduleOverrides={};var key;for(key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}Module["arguments"]=[];Module["thisProgram"]="./this.program";Module["quit"]=function(status,toThrow){throw toThrow};Module["preRun"]=[];Module["postRun"]=[];var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_IS_SHELL=false;ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_IS_NODE=typeof process==="object"&&typeof require==="function"&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER;var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}else{return scriptDirectory+path}}if(ENVIRONMENT_IS_NODE){scriptDirectory=__dirname+"/";var nodeFS;var nodePath;Module["read"]=function shell_read(filename,binary){var ret;if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};Module["readBinary"]=function readBinary(filename){var ret=Module["read"](filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};if(process["argv"].length>1){Module["thisProgram"]=process["argv"][1].replace(/\\/g,"/")}Module["arguments"]=process["argv"].slice(2);if(typeof module!=="undefined"){module["exports"]=Module}process["on"]("uncaughtException",function(ex){if(!(ex instanceof ExitStatus)){throw ex}});process["on"]("unhandledRejection",abort);Module["quit"]=function(status){process["exit"](status)};Module["inspect"]=function(){return"[Emscripten Module object]"}}else if(ENVIRONMENT_IS_SHELL){if(typeof read!="undefined"){Module["read"]=function shell_read(f){return read(f)}}Module["readBinary"]=function readBinary(f){var data;if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){Module["arguments"]=scriptArgs}else if(typeof arguments!="undefined"){Module["arguments"]=arguments}if(typeof quit==="function"){Module["quit"]=function(status){quit(status)}}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(document.currentScript){scriptDirectory=document.currentScript.src}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.lastIndexOf("/")+1)}else{scriptDirectory=""}Module["read"]=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){Module["readBinary"]=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}Module["readAsync"]=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)};Module["setWindowTitle"]=function(title){document.title=title}}else{}var out=Module["print"]||(typeof console!=="undefined"?console.log.bind(console):typeof print!=="undefined"?print:null);var err=Module["printErr"]||(typeof printErr!=="undefined"?printErr:typeof console!=="undefined"&&console.warn.bind(console)||out);for(key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=undefined;function dynamicAlloc(size){var ret=HEAP32[DYNAMICTOP_PTR>>2];var end=ret+size+15&-16;if(end<=_emscripten_get_heap_size()){HEAP32[DYNAMICTOP_PTR>>2]=end}else{return 0}return ret}function getNativeTypeSize(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return 4}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0,"getNativeTypeSize invalid bits "+bits+", type "+type);return bits/8}else{return 0}}}}function warnOnce(text){if(!warnOnce.shown)warnOnce.shown={};if(!warnOnce.shown[text]){warnOnce.shown[text]=1;err(text)}}var asm2wasmImports={"f64-rem":function(x,y){return x%y},"debugger":function(){debugger}};var functionPointers=new Array(0);if(typeof WebAssembly!=="object"){err("no native wasm support detected")}var wasmMemory;var wasmTable;var ABORT=false;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];assert(func,"Cannot call unknown function "+ident+", make sure it is exported");return func}function ccall(ident,returnType,argTypes,args,opts){var toC={"string":function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret},"array":function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}};function convertReturnValue(ret){if(returnType==="string")return UTF8ToString(ret);if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;if(args){for(var i=0;i<args.length;i++){var converter=toC[argTypes[i]];if(converter){if(stack===0)stack=stackSave();cArgs[i]=converter(args[i])}else{cArgs[i]=args[i]}}}var ret=func.apply(null,cArgs);ret=convertReturnValue(ret);if(stack!==0)stackRestore(stack);return ret}function setValue(ptr,value,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}var ALLOC_NORMAL=0;var ALLOC_NONE=3;function allocate(slab,types,allocator,ptr){var zeroinit,size;if(typeof slab==="number"){zeroinit=true;size=slab}else{zeroinit=false;size=slab.length}var singleType=typeof types==="string"?types:null;var ret;if(allocator==ALLOC_NONE){ret=ptr}else{ret=[_malloc,stackAlloc,dynamicAlloc][allocator](Math.max(size,singleType?1:types.length))}if(zeroinit){var stop;ptr=ret;assert((ret&3)==0);stop=ret+(size&~3);for(;ptr<stop;ptr+=4){HEAP32[ptr>>2]=0}stop=ret+size;while(ptr<stop){HEAP8[ptr++>>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i<size){var curr=slab[i];type=singleType||types[i];if(type===0){i++;continue}if(type=="i64")type="i32";setValue(ret+i,curr,type);if(previousType!==type){typeSize=getNativeTypeSize(type);previousType=type}i+=typeSize}return ret}function getMemory(size){if(!runtimeInitialized)return dynamicAlloc(size);return _malloc(size)}var UTF8Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf8"):undefined;function UTF8ArrayToString(u8Array,idx,maxBytesToRead){var endIdx=idx+maxBytesToRead;var endPtr=idx;while(u8Array[endPtr]&&!(endPtr>=endIdx))++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var str="";while(idx<endPtr){var u0=u8Array[idx++];if(!(u0&128)){str+=String.fromCharCode(u0);continue}var u1=u8Array[idx++]&63;if((u0&224)==192){str+=String.fromCharCode((u0&31)<<6|u1);continue}var u2=u8Array[idx++]&63;if((u0&240)==224){u0=(u0&15)<<12|u1<<6|u2}else{u0=(u0&7)<<18|u1<<12|u2<<6|u8Array[idx++]&63}if(u0<65536){str+=String.fromCharCode(u0)}else{var ch=u0-65536;str+=String.fromCharCode(55296|ch>>10,56320|ch&1023)}}}return str}function UTF8ToString(ptr,maxBytesToRead){return ptr?UTF8ArrayToString(HEAPU8,ptr,maxBytesToRead):""}function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+3>=endIdx)break;outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}function lengthBytesUTF8(str){var len=0;for(var i=0;i<str.length;++i){var u=str.charCodeAt(i);if(u>=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127)++len;else if(u<=2047)len+=2;else if(u<=65535)len+=3;else len+=4}return len}var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function allocateUTF8OnStack(str){var size=lengthBytesUTF8(str)+1;var ret=stackAlloc(size);stringToUTF8Array(str,HEAP8,ret,size);return ret}function writeArrayToMemory(array,buffer){HEAP8.set(array,buffer)}function demangle(func){return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,function(x){var y=demangle(x);return x===y?x:y+" ["+x+"]"})}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}var WASM_PAGE_SIZE=65536;var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var DYNAMIC_BASE=5391360,DYNAMICTOP_PTR=148448;var TOTAL_STACK=5242880;var INITIAL_TOTAL_MEMORY=Module["TOTAL_MEMORY"]||67108864;if(INITIAL_TOTAL_MEMORY<TOTAL_STACK)err("TOTAL_MEMORY should be larger than TOTAL_STACK, was "+INITIAL_TOTAL_MEMORY+"! (TOTAL_STACK="+TOTAL_STACK+")");if(Module["buffer"]){buffer=Module["buffer"]}else{if(typeof WebAssembly==="object"&&typeof WebAssembly.Memory==="function"){wasmMemory=new WebAssembly.Memory({"initial":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE,"maximum":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE});buffer=wasmMemory.buffer}else{buffer=new ArrayBuffer(INITIAL_TOTAL_MEMORY)}}updateGlobalBufferViews();HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function ensureInitRuntime(){if(runtimeInitialized)return;runtimeInitialized=true;if(!Module["noFSInit"]&&!FS.init.initialized)FS.init();TTY.init();callRuntimeCallbacks(__ATINIT__)}function preMain(){FS.ignorePermissions=false;callRuntimeCallbacks(__ATMAIN__)}function exitRuntime(){runtimeExited=true}function postRun(){if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}var Math_abs=Math.abs;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_min=Math.min;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;function getUniqueRunDependency(id){return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["preloadedImages"]={};Module["preloadedAudios"]={};var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return String.prototype.startsWith?filename.startsWith(dataURIPrefix):filename.indexOf(dataURIPrefix)===0}var wasmBinaryFile="audio_music_stream.wasm";if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}function getBinary(){try{if(Module["wasmBinary"]){return new Uint8Array(Module["wasmBinary"])}if(Module["readBinary"]){return Module["readBinary"](wasmBinaryFile)}else{throw"both async and sync fetching of the wasm failed"}}catch(err){abort(err)}}function getBinaryPromise(){if(!Module["wasmBinary"]&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&typeof fetch==="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}).catch(function(){return getBinary()})}return new Promise(function(resolve,reject){resolve(getBinary())})}function createWasm(env){var info={"env":env,"global":{"NaN":NaN,Infinity:Infinity},"global.Math":Math,"asm2wasm":asm2wasmImports};function receiveInstance(instance,module){var exports=instance.exports;Module["asm"]=exports;removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");if(Module["instantiateWasm"]){try{return Module["instantiateWasm"](info,receiveInstance)}catch(e){err("Module.instantiateWasm callback failed with error: "+e);return false}}function receiveInstantiatedSource(output){receiveInstance(output["instance"])}function instantiateArrayBuffer(receiver){getBinaryPromise().then(function(binary){return WebAssembly.instantiate(binary,info)}).then(receiver,function(reason){err("failed to asynchronously prepare wasm: "+reason);abort(reason)})}if(!Module["wasmBinary"]&&typeof WebAssembly.instantiateStreaming==="function"&&!isDataURI(wasmBinaryFile)&&typeof fetch==="function"){WebAssembly.instantiateStreaming(fetch(wasmBinaryFile,{credentials:"same-origin"}),info).then(receiveInstantiatedSource,function(reason){err("wasm streaming compile failed: "+reason);err("falling back to ArrayBuffer instantiation");instantiateArrayBuffer(receiveInstantiatedSource)})}else{instantiateArrayBuffer(receiveInstantiatedSource)}return{}}Module["asm"]=function(global,env,providedBuffer){env["memory"]=wasmMemory;env["table"]=wasmTable=new WebAssembly.Table({"initial":430,"maximum":430,"element":"anyfunc"});env["__memory_base"]=1024;env["__table_base"]=0;var exports=createWasm(env);return exports};var ASM_CONSTS=[function($0){return navigator.mediaDevices!==undefined&&navigator.mediaDevices.getUserMedia!==undefined},function($0){try{var temp=new(window.AudioContext||window.webkitAudioContext);var sampleRate=temp.sampleRate;temp.close();return sampleRate}catch(e){return 0}},function($0,$1){var device=miniaudio.get_device_by_index($0);if(device.scriptNode!==undefined){device.scriptNode.onaudioprocess=function(e){};device.scriptNode.disconnect();device.scriptNode=undefined}if(device.streamNode!==undefined){device.streamNode.disconnect();device.streamNode=undefined}device.webaudio.close();device.webaudio=undefined;if(device.intermediaryBuffer!==undefined){Module._free(device.intermediaryBuffer);device.intermediaryBuffer=undefined;device.intermediaryBufferView=undefined;device.intermediaryBufferSizeInBytes=undefined}miniaudio.untrack_device_by_index($0)},function($0,$1,$2,$3,$4){var channels=$0;var sampleRate=$1;var bufferSize=$2;var isCapture=$3;var pDevice=$4;if(typeof miniaudio==="undefined"){return-1}var device={};device.webaudio=new(window.AudioContext||window.webkitAudioContext)({sampleRate:sampleRate});device.webaudio.suspend();device.intermediaryBufferSizeInBytes=channels*bufferSize*4;device.intermediaryBuffer=Module._malloc(device.intermediaryBufferSizeInBytes);device.intermediaryBufferView=new Float32Array(Module.HEAPF32.buffer,device.intermediaryBuffer,device.intermediaryBufferSizeInBytes);device.scriptNode=device.webaudio.createScriptProcessor(bufferSize,channels,channels);if(isCapture){device.scriptNode.onaudioprocess=function(e){if(device.intermediaryBuffer===undefined){return}for(var iChannel=0;iChannel<e.outputBuffer.numberOfChannels;++iChannel){e.outputBuffer.getChannelData(iChannel).fill(0)}var sendSilence=false;if(device.streamNode===undefined){sendSilence=true}if(e.inputBuffer.numberOfChannels!=channels){console.log("Capture: Channel count mismatch. "+e.inputBufer.numberOfChannels+" != "+channels+". Sending silence.");sendSilence=true}var totalFramesProcessed=0;while(totalFramesProcessed<e.inputBuffer.length){var framesRemaining=e.inputBuffer.length-totalFramesProcessed;var framesToProcess=framesRemaining;if(framesToProcess>device.intermediaryBufferSizeInBytes/channels/4){framesToProcess=device.intermediaryBufferSizeInBytes/channels/4}if(sendSilence){device.intermediaryBufferView.fill(0)}else{for(var iFrame=0;iFrame<framesToProcess;++iFrame){for(var iChannel=0;iChannel<e.inputBuffer.numberOfChannels;++iChannel){device.intermediaryBufferView[iFrame*channels+iChannel]=e.inputBuffer.getChannelData(iChannel)[totalFramesProcessed+iFrame]}}}ccall("ma_device_process_pcm_frames_capture__webaudio","undefined",["number","number","number"],[pDevice,framesToProcess,device.intermediaryBuffer]);totalFramesProcessed+=framesToProcess}};navigator.mediaDevices.getUserMedia({audio:true,video:false}).then(function(stream){device.streamNode=device.webaudio.createMediaStreamSource(stream);device.streamNode.connect(device.scriptNode);device.scriptNode.connect(device.webaudio.destination)}).catch(function(error){device.scriptNode.connect(device.webaudio.destination)})}else{device.scriptNode.onaudioprocess=function(e){if(device.intermediaryBuffer===undefined){return}var outputSilence=false;if(e.outputBuffer.numberOfChannels!=channels){console.log("Playback: Channel count mismatch. "+e.outputBufer.numberOfChannels+" != "+channels+". Outputting silence.");outputSilence=true;return}var totalFramesProcessed=0;while(totalFramesProcessed<e.outputBuffer.length){var framesRemaining=e.outputBuffer.length-totalFramesProcessed;var framesToProcess=framesRemaining;if(framesToProcess>device.intermediaryBufferSizeInBytes/channels/4){framesToProcess=device.intermediaryBufferSizeInBytes/channels/4}ccall("ma_device_process_pcm_frames_playback__webaudio","undefined",["number","number","number"],[pDevice,framesToProcess,device.intermediaryBuffer]);if(outputSilence){for(var iChannel=0;iChannel<e.outputBuffer.numberOfChannels;++iChannel){e.outputBuffer.getChannelData(iChannel).fill(0)}}else{for(var iChannel=0;iChannel<e.outputBuffer.numberOfChannels;++iChannel){for(var iFrame=0;iFrame<framesToProcess;++iFrame){e.outputBuffer.getChannelData(iChannel)[totalFramesProcessed+iFrame]=device.intermediaryBufferView[iFrame*channels+iChannel]}}}totalFramesProcessed+=framesToProcess}};device.scriptNode.connect(device.webaudio.destination)}return miniaudio.track_device(device)},function($0){return miniaudio.get_device_by_index($0).webaudio.sampleRate},function($0){miniaudio.get_device_by_index($0).webaudio.resume()},function($0){miniaudio.get_device_by_index($0).webaudio.suspend()},function($0){if((window.AudioContext||window.webkitAudioContext)===undefined){return 0}if(typeof miniaudio==="undefined"){miniaudio={};miniaudio.devices=[];miniaudio.track_device=function(device){for(var iDevice=0;iDevice<miniaudio.devices.length;++iDevice){if(miniaudio.devices[iDevice]==null){miniaudio.devices[iDevice]=device;return iDevice}}miniaudio.devices.push(device);return miniaudio.devices.length-1};miniaudio.untrack_device_by_index=function(deviceIndex){miniaudio.devices[deviceIndex]=null;while(miniaudio.devices.length>0){if(miniaudio.devices[miniaudio.devices.length-1]==null){miniaudio.devices.pop()}else{break}}};miniaudio.untrack_device=function(device){for(var iDevice=0;iDevice<miniaudio.devices.length;++iDevice){if(miniaudio.devices[iDevice]==device){return miniaudio.untrack_device_by_index(iDevice)}}};miniaudio.get_device_by_index=function(deviceIndex){return miniaudio.devices[deviceIndex]}}return 1}];function _emscripten_asm_const_ii(code,a0){return ASM_CONSTS[code](a0)}function _emscripten_asm_const_iiiiii(code,a0,a1,a2,a3,a4){return ASM_CONSTS[code](a0,a1,a2,a3,a4)}function _emscripten_asm_const_iii(code,a0,a1){return ASM_CONSTS[code](a0,a1)}function ___assert_fail(condition,filename,line,func){abort("Assertion failed: "+UTF8ToString(condition)+", at: "+[filename?UTF8ToString(filename):"unknown filename",line,func?UTF8ToString(func):"unknown function"])}function ___lock(){}function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;return value}var PATH={splitPath:function(filename){var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)},normalizeArray:function(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts},normalize:function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path},dirname:function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir},basename:function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)},extname:function(path){return PATH.splitPath(path)[3]},join:function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))},join2:function(l,r){return PATH.normalize(l+"/"+r)},resolve:function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter(function(p){return!!p}),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."},relative:function(from,to){from=PATH.resolve(from).substr(1);to=PATH.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=="")break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push("..")}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join("/")}};var TTY={ttys:[],init:function(){},shutdown:function(){},register:function(dev,ops){TTY.ttys[dev]={input:[],output:[],ops:ops};FS.registerDevice(dev,TTY.stream_ops)},stream_ops:{open:function(stream){var tty=TTY.ttys[stream.node.rdev];if(!tty){throw new FS.ErrnoError(19)}stream.tty=tty;stream.seekable=false},close:function(stream){stream.tty.ops.flush(stream.tty)},flush:function(stream){stream.tty.ops.flush(stream.tty)},read:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.get_char){throw new FS.ErrnoError(6)}var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=stream.tty.ops.get_char(stream.tty)}catch(e){throw new FS.ErrnoError(5)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(11)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){if(!stream.tty||!stream.tty.ops.put_char){throw new FS.ErrnoError(6)}try{for(var i=0;i<length;i++){stream.tty.ops.put_char(stream.tty,buffer[offset+i])}}catch(e){throw new FS.ErrnoError(5)}if(length){stream.node.timestamp=Date.now()}return i}},default_tty_ops:{get_char:function(tty){if(!tty.input.length){var result=null;if(ENVIRONMENT_IS_NODE){var BUFSIZE=256;var buf=new Buffer(BUFSIZE);var bytesRead=0;var isPosixPlatform=process.platform!="win32";var fd=process.stdin.fd;if(isPosixPlatform){var usingDevice=false;try{fd=fs.openSync("/dev/stdin","r");usingDevice=true}catch(e){}}try{bytesRead=fs.readSync(fd,buf,0,BUFSIZE,null)}catch(e){if(e.toString().indexOf("EOF")!=-1)bytesRead=0;else throw e}if(usingDevice){fs.closeSync(fd)}if(bytesRead>0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()},put_char:function(tty,val){if(val===null||val===10){out(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){out(UTF8ArrayToString(tty.output,0));tty.output=[]}}},default_tty1_ops:{put_char:function(tty,val){if(val===null||val===10){err(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){err(UTF8ArrayToString(tty.output,0));tty.output=[]}}}};var MEMFS={ops_table:null,mount:function(mount){return MEMFS.createNode(null,"/",16384|511,0)},createNode:function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(1)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node},getFileDataAsRegularArray:function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;i<node.usedBytes;++i)arr.push(node.contents[i]);return arr}return node.contents},getFileDataAsTypedArray:function(node){if(!node.contents)return new Uint8Array;if(node.contents.subarray)return node.contents.subarray(0,node.usedBytes);return new Uint8Array(node.contents)},expandFileStorage:function(node,newCapacity){var prevCapacity=node.contents?node.contents.length:0;if(prevCapacity>=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity<CAPACITY_DOUBLING_MAX?2:1.125)|0);if(prevCapacity!=0)newCapacity=Math.max(newCapacity,256);var oldContents=node.contents;node.contents=new Uint8Array(newCapacity);if(node.usedBytes>0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return},resizeFileStorage:function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0;return}if(!node.contents||node.contents.subarray){var oldContents=node.contents;node.contents=new Uint8Array(new ArrayBuffer(newSize));if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize;return}if(!node.contents)node.contents=[];if(node.contents.length>newSize)node.contents.length=newSize;else while(node.contents.length<newSize)node.contents.push(0);node.usedBytes=newSize},node_ops:{getattr:function(node){var attr={};attr.dev=FS.isChrdev(node.mode)?node.id:1;attr.ino=node.id;attr.mode=node.mode;attr.nlink=1;attr.uid=0;attr.gid=0;attr.rdev=node.rdev;if(FS.isDir(node.mode)){attr.size=4096}else if(FS.isFile(node.mode)){attr.size=node.usedBytes}else if(FS.isLink(node.mode)){attr.size=node.link.length}else{attr.size=0}attr.atime=new Date(node.timestamp);attr.mtime=new Date(node.timestamp);attr.ctime=new Date(node.timestamp);attr.blksize=4096;attr.blocks=Math.ceil(attr.size/attr.blksize);return attr},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}if(attr.size!==undefined){MEMFS.resizeFileStorage(node,attr.size)}},lookup:function(parent,name){throw FS.genericErrors[2]},mknod:function(parent,name,mode,dev){return MEMFS.createNode(parent,name,mode,dev)},rename:function(old_node,new_dir,new_name){if(FS.isDir(old_node.mode)){var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(new_node){for(var i in new_node.contents){throw new FS.ErrnoError(39)}}}delete old_node.parent.contents[old_node.name];old_node.name=new_name;new_dir.contents[new_name]=old_node;old_node.parent=new_dir},unlink:function(parent,name){delete parent.contents[name]},rmdir:function(parent,name){var node=FS.lookupNode(parent,name);for(var i in node.contents){throw new FS.ErrnoError(39)}delete parent.contents[name]},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newname,oldpath){var node=MEMFS.createNode(parent,newname,511|40960,0);node.link=oldpath;return node},readlink:function(node){if(!FS.isLink(node.mode)){throw new FS.ErrnoError(22)}return node.link}},stream_ops:{read:function(stream,buffer,offset,length,position){var contents=stream.node.contents;if(position>=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i<size;i++)buffer[offset+i]=contents[position+i]}return size},write:function(stream,buffer,offset,length,position,canOwn){if(!length)return 0;var node=stream.node;node.timestamp=Date.now();if(buffer.subarray&&(!node.contents||node.contents.subarray)){if(canOwn){node.contents=buffer.subarray(offset,offset+length);node.usedBytes=length;return length}else if(node.usedBytes===0&&position===0){node.contents=new Uint8Array(buffer.subarray(offset,offset+length));node.usedBytes=length;return length}else if(position+length<=node.usedBytes){node.contents.set(buffer.subarray(offset,offset+length),position);return length}}MEMFS.expandFileStorage(node,position+length);if(node.contents.subarray&&buffer.subarray)node.contents.set(buffer.subarray(offset,offset+length),position);else{for(var i=0;i<length;i++){node.contents[position+i]=buffer[offset+i]}}node.usedBytes=Math.max(node.usedBytes,position+length);return length},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.usedBytes}}if(position<0){throw new FS.ErrnoError(22)}return position},allocate:function(stream,offset,length){MEMFS.expandFileStorage(stream.node,offset+length);stream.node.usedBytes=Math.max(stream.node.usedBytes,offset+length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(19)}var ptr;var allocated;var contents=stream.node.contents;if(!(flags&2)&&(contents.buffer===buffer||contents.buffer===buffer.buffer)){allocated=false;ptr=contents.byteOffset}else{if(position>0||position+length<stream.node.usedBytes){if(contents.subarray){contents=contents.subarray(position,position+length)}else{contents=Array.prototype.slice.call(contents,position,position+length)}}allocated=true;ptr=_malloc(length);if(!ptr){throw new FS.ErrnoError(12)}buffer.set(contents,ptr)}return{ptr:ptr,allocated:allocated}},msync:function(stream,buffer,offset,length,mmapFlags){if(!FS.isFile(stream.node.mode)){throw new FS.ErrnoError(19)}if(mmapFlags&2){return 0}var bytesWritten=MEMFS.stream_ops.write(stream,buffer,0,length,offset,false);return 0}}};var IDBFS={dbs:{},indexedDB:function(){if(typeof indexedDB!=="undefined")return indexedDB;var ret=null;if(typeof window==="object")ret=window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB;assert(ret,"IDBFS used, but indexedDB not supported");return ret},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function(mount){return MEMFS.mount.apply(null,arguments)},syncfs:function(mount,populate,callback){IDBFS.getLocalSet(mount,function(err,local){if(err)return callback(err);IDBFS.getRemoteSet(mount,function(err,remote){if(err)return callback(err);var src=populate?remote:local;var dst=populate?local:remote;IDBFS.reconcile(src,dst,callback)})})},getDB:function(name,callback){var db=IDBFS.dbs[name];if(db){return callback(null,db)}var req;try{req=IDBFS.indexedDB().open(name,IDBFS.DB_VERSION)}catch(e){return callback(e)}if(!req){return callback("Unable to connect to IndexedDB")}req.onupgradeneeded=function(e){var db=e.target.result;var transaction=e.target.transaction;var fileStore;if(db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)){fileStore=transaction.objectStore(IDBFS.DB_STORE_NAME)}else{fileStore=db.createObjectStore(IDBFS.DB_STORE_NAME)}if(!fileStore.indexNames.contains("timestamp")){fileStore.createIndex("timestamp","timestamp",{unique:false})}};req.onsuccess=function(){db=req.result;IDBFS.dbs[name]=db;callback(null,db)};req.onerror=function(e){callback(this.error);e.preventDefault()}},getLocalSet:function(mount,callback){var entries={};function isRealDir(p){return p!=="."&&p!==".."}function toAbsolute(root){return function(p){return PATH.join2(root,p)}}var check=FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));while(check.length){var path=check.pop();var stat;try{stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){check.push.apply(check,FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))}entries[path]={timestamp:stat.mtime}}return callback(null,{type:"local",entries:entries})},getRemoteSet:function(mount,callback){var entries={};IDBFS.getDB(mount.mountpoint,function(err,db){if(err)return callback(err);try{var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readonly");transaction.onerror=function(e){callback(this.error);e.preventDefault()};var store=transaction.objectStore(IDBFS.DB_STORE_NAME);var index=store.index("timestamp");index.openKeyCursor().onsuccess=function(event){var cursor=event.target.result;if(!cursor){return callback(null,{type:"remote",db:db,entries:entries})}entries[cursor.primaryKey]={timestamp:cursor.key};cursor.continue()}}catch(e){return callback(e)}})},loadLocalEntry:function(path,callback){var stat,node;try{var lookup=FS.lookupPath(path);node=lookup.node;stat=FS.stat(path)}catch(e){return callback(e)}if(FS.isDir(stat.mode)){return callback(null,{timestamp:stat.mtime,mode:stat.mode})}else if(FS.isFile(stat.mode)){node.contents=MEMFS.getFileDataAsTypedArray(node);return callback(null,{timestamp:stat.mtime,mode:stat.mode,contents:node.contents})}else{return callback(new Error("node type not supported"))}},storeLocalEntry:function(path,entry,callback){try{if(FS.isDir(entry.mode)){FS.mkdir(path,entry.mode)}else if(FS.isFile(entry.mode)){FS.writeFile(path,entry.contents,{canOwn:true})}else{return callback(new Error("node type not supported"))}FS.chmod(path,entry.mode);FS.utime(path,entry.timestamp,entry.timestamp)}catch(e){return callback(e)}callback(null)},removeLocalEntry:function(path,callback){try{var lookup=FS.lookupPath(path);var stat=FS.stat(path);if(FS.isDir(stat.mode)){FS.rmdir(path)}else if(FS.isFile(stat.mode)){FS.unlink(path)}}catch(e){return callback(e)}callback(null)},loadRemoteEntry:function(store,path,callback){var req=store.get(path);req.onsuccess=function(event){callback(null,event.target.result)};req.onerror=function(e){callback(this.error);e.preventDefault()}},storeRemoteEntry:function(store,path,entry,callback){var req=store.put(entry,path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},removeRemoteEntry:function(store,path,callback){var req=store.delete(path);req.onsuccess=function(){callback(null)};req.onerror=function(e){callback(this.error);e.preventDefault()}},reconcile:function(src,dst,callback){var total=0;var create=[];Object.keys(src.entries).forEach(function(key){var e=src.entries[key];var e2=dst.entries[key];if(!e2||e.timestamp>e2.timestamp){create.push(key);total++}});var remove=[];Object.keys(dst.entries).forEach(function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}});if(!total){return callback(null)}var errored=false;var completed=0;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err){if(!done.errored){done.errored=true;return callback(err)}return}if(++completed>=total){return callback(null)}}transaction.onerror=function(e){done(this.error);e.preventDefault()};create.sort().forEach(function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)})}else{IDBFS.loadLocalEntry(path,function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)})}});remove.sort().reverse().forEach(function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}})}};var NODEFS={isWindows:false,staticInit:function(){NODEFS.isWindows=!!process.platform.match(/^win/);var flags=process["binding"]("constants");if(flags["fs"]){flags=flags["fs"]}NODEFS.flagsForNodeMap={1024:flags["O_APPEND"],64:flags["O_CREAT"],128:flags["O_EXCL"],0:flags["O_RDONLY"],2:flags["O_RDWR"],4096:flags["O_SYNC"],512:flags["O_TRUNC"],1:flags["O_WRONLY"]}},bufferFrom:function(arrayBuffer){return Buffer.alloc?Buffer.from(arrayBuffer):new Buffer(arrayBuffer)},mount:function(mount){assert(ENVIRONMENT_IS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)},createNode:function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(22)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node},getMode:function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&292)>>2}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return stat.mode},realPath:function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)},flagsForNode:function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;var newFlags=0;for(var k in NODEFS.flagsForNodeMap){if(flags&k){newFlags|=NODEFS.flagsForNodeMap[k];flags^=k}}if(!flags){return newFlags}else{throw new FS.ErrnoError(22)}},node_ops:{getattr:function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}},setattr:function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},lookup:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)},mknod:function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return node},rename:function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},unlink:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},rmdir:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readdir:function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},symlink:function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readlink:function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}}},stream_ops:{open:function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsForNode(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},close:function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},read:function(stream,buffer,offset,length,position){if(length===0)return 0;try{return fs.readSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},write:function(stream,buffer,offset,length,position){try{return fs.writeSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){try{var stat=fs.fstatSync(stream.nfd);position+=stat.size}catch(e){throw new FS.ErrnoError(-e.errno)}}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function(mount){assert(ENVIRONMENT_IS_WORKER);if(!WORKERFS.reader)WORKERFS.reader=new FileReaderSync;var root=WORKERFS.createNode(null,"/",WORKERFS.DIR_MODE,0);var createdParents={};function ensureParent(path){var parts=path.split("/");var parent=root;for(var i=0;i<parts.length-1;i++){var curr=parts.slice(0,i+1).join("/");if(!createdParents[curr]){createdParents[curr]=WORKERFS.createNode(parent,parts[i],WORKERFS.DIR_MODE,0)}parent=createdParents[curr]}return parent}function base(path){var parts=path.split("/");return parts[parts.length-1]}Array.prototype.forEach.call(mount.opts["files"]||[],function(file){WORKERFS.createNode(ensureParent(file.name),base(file.name),WORKERFS.FILE_MODE,0,file,file.lastModifiedDate)});(mount.opts["blobs"]||[]).forEach(function(obj){WORKERFS.createNode(ensureParent(obj["name"]),base(obj["name"]),WORKERFS.FILE_MODE,0,obj["data"])});(mount.opts["packages"]||[]).forEach(function(pack){pack["metadata"].files.forEach(function(file){var name=file.filename.substr(1);WORKERFS.createNode(ensureParent(name),base(name),WORKERFS.FILE_MODE,0,pack["blob"].slice(file.start,file.end))})});return root},createNode:function(parent,name,mode,dev,contents,mtime){var node=FS.createNode(parent,name,mode);node.mode=mode;node.node_ops=WORKERFS.node_ops;node.stream_ops=WORKERFS.stream_ops;node.timestamp=(mtime||new Date).getTime();assert(WORKERFS.FILE_MODE!==WORKERFS.DIR_MODE);if(mode===WORKERFS.FILE_MODE){node.size=contents.size;node.contents=contents}else{node.size=4096;node.contents={}}if(parent){parent.contents[name]=node}return node},node_ops:{getattr:function(node){return{dev:1,ino:undefined,mode:node.mode,nlink:1,uid:0,gid:0,rdev:undefined,size:node.size,atime:new Date(node.timestamp),mtime:new Date(node.timestamp),ctime:new Date(node.timestamp),blksize:4096,blocks:Math.ceil(node.size/4096)}},setattr:function(node,attr){if(attr.mode!==undefined){node.mode=attr.mode}if(attr.timestamp!==undefined){node.timestamp=attr.timestamp}},lookup:function(parent,name){throw new FS.ErrnoError(2)},mknod:function(parent,name,mode,dev){throw new FS.ErrnoError(1)},rename:function(oldNode,newDir,newName){throw new FS.ErrnoError(1)},unlink:function(parent,name){throw new FS.ErrnoError(1)},rmdir:function(parent,name){throw new FS.ErrnoError(1)},readdir:function(node){var entries=[".",".."];for(var key in node.contents){if(!node.contents.hasOwnProperty(key)){continue}entries.push(key)}return entries},symlink:function(parent,newName,oldPath){throw new FS.ErrnoError(1)},readlink:function(node){throw new FS.ErrnoError(1)}},stream_ops:{read:function(stream,buffer,offset,length,position){if(position>=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size},write:function(stream,buffer,offset,length,position){throw new FS.ErrnoError(5)},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)},lookupPath:function(path,opts){path=PATH.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(40)}var parts=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),false);var current=FS.root;var current_path="/";for(var i=0;i<parts.length;i++){var islast=i===parts.length-1;if(islast&&opts.parent){break}current=FS.lookupNode(current,parts[i]);current_path=PATH.join2(current_path,parts[i]);if(FS.isMountpoint(current)){if(!islast||islast&&opts.follow_mount){current=current.mounted.root}}if(!islast||opts.follow){var count=0;while(FS.isLink(current.mode)){var link=FS.readlink(current_path);current_path=PATH.resolve(PATH.dirname(current_path),link);var lookup=FS.lookupPath(current_path,{recurse_count:opts.recurse_count});current=lookup.node;if(count++>40){throw new FS.ErrnoError(40)}}}}return{path:current_path,node:current}},getPath:function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}},hashName:function(parentid,name){var hash=0;for(var i=0;i<name.length;i++){hash=(hash<<5)-hash+name.charCodeAt(i)|0}return(parentid+hash>>>0)%FS.nameTable.length},hashAddNode:function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node},hashRemoveNode:function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}},lookupNode:function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)},createNode:function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev};FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:function(){return(this.mode&readMode)===readMode},set:function(val){val?this.mode|=readMode:this.mode&=~readMode}},write:{get:function(){return(this.mode&writeMode)===writeMode},set:function(val){val?this.mode|=writeMode:this.mode&=~writeMode}},isFolder:{get:function(){return FS.isDir(this.mode)}},isDevice:{get:function(){return FS.isChrdev(this.mode)}}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node},destroyNode:function(node){FS.hashRemoveNode(node)},isRoot:function(node){return node===node.parent},isMountpoint:function(node){return!!node.mounted},isFile:function(mode){return(mode&61440)===32768},isDir:function(mode){return(mode&61440)===16384},isLink:function(mode){return(mode&61440)===40960},isChrdev:function(mode){return(mode&61440)===8192},isBlkdev:function(mode){return(mode&61440)===24576},isFIFO:function(mode){return(mode&61440)===4096},isSocket:function(mode){return(mode&49152)===49152},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags},flagsToPermissionString:function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms},nodePermissions:function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return 13}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return 13}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return 13}return 0},mayLookup:function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return 13;return 0},mayCreate:function(dir,name){try{var node=FS.lookupNode(dir,name);return 17}catch(e){}return FS.nodePermissions(dir,"wx")},mayDelete:function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return 20}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return 16}}else{if(FS.isDir(node.mode)){return 21}}return 0},mayOpen:function(node,flags){if(!node){return 2}if(FS.isLink(node.mode)){return 40}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return 21}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))},MAX_OPEN_FDS:4096,nextfd:function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(24)},getStream:function(fd){return FS.streams[fd]},createStream:function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=function(){};FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:function(){return this.node},set:function(val){this.node=val}},isRead:{get:function(){return(this.flags&2097155)!==1}},isWrite:{get:function(){return(this.flags&2097155)!==0}},isAppend:{get:function(){return this.flags&1024}}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream},closeStream:function(fd){FS.streams[fd]=null},chrdev_stream_ops:{open:function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}},llseek:function(){throw new FS.ErrnoError(29)}},major:function(dev){return dev>>8},minor:function(dev){return dev&255},makedev:function(ma,mi){return ma<<8|mi},registerDevice:function(dev,ops){FS.devices[dev]={stream_ops:ops}},getDevice:function(dev){return FS.devices[dev]},getMounts:function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts},syncfs:function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach(function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)})},mount:function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(16)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot},unmount:function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(22)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach(function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}});node.mounted=null;var idx=node.mount.mounts.indexOf(mount);node.mount.mounts.splice(idx,1)},lookup:function(parent,name){return parent.node_ops.lookup(parent,name)},mknod:function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(22)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(1)}return parent.node_ops.mknod(parent,name,mode,dev)},create:function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)},mkdir:function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)},mkdirTree:function(path,mode){var dirs=path.split("/");var d="";for(var i=0;i<dirs.length;++i){if(!dirs[i])continue;d+="/"+dirs[i];try{FS.mkdir(d,mode)}catch(e){if(e.errno!=17)throw e}}},mkdev:function(path,mode,dev){if(typeof dev==="undefined"){dev=mode;mode=438}mode|=8192;return FS.mknod(path,mode,dev)},symlink:function(oldpath,newpath){if(!PATH.resolve(oldpath)){throw new FS.ErrnoError(2)}var lookup=FS.lookupPath(newpath,{parent:true});var parent=lookup.node;if(!parent){throw new FS.ErrnoError(2)}var newname=PATH.basename(newpath);var err=FS.mayCreate(parent,newname);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.symlink){throw new FS.ErrnoError(1)}return parent.node_ops.symlink(parent,newname,oldpath)},rename:function(old_path,new_path){var old_dirname=PATH.dirname(old_path);var new_dirname=PATH.dirname(new_path);var old_name=PATH.basename(old_path);var new_name=PATH.basename(new_path);var lookup,old_dir,new_dir;try{lookup=FS.lookupPath(old_path,{parent:true});old_dir=lookup.node;lookup=FS.lookupPath(new_path,{parent:true});new_dir=lookup.node}catch(e){throw new FS.ErrnoError(16)}if(!old_dir||!new_dir)throw new FS.ErrnoError(2);if(old_dir.mount!==new_dir.mount){throw new FS.ErrnoError(18)}var old_node=FS.lookupNode(old_dir,old_name);var relative=PATH.relative(old_path,new_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(22)}relative=PATH.relative(new_path,old_dirname);if(relative.charAt(0)!=="."){throw new FS.ErrnoError(39)}var new_node;try{new_node=FS.lookupNode(new_dir,new_name)}catch(e){}if(old_node===new_node){return}var isdir=FS.isDir(old_node.mode);var err=FS.mayDelete(old_dir,old_name,isdir);if(err){throw new FS.ErrnoError(err)}err=new_node?FS.mayDelete(new_dir,new_name,isdir):FS.mayCreate(new_dir,new_name);if(err){throw new FS.ErrnoError(err)}if(!old_dir.node_ops.rename){throw new FS.ErrnoError(1)}if(FS.isMountpoint(old_node)||new_node&&FS.isMountpoint(new_node)){throw new FS.ErrnoError(16)}if(new_dir!==old_dir){err=FS.nodePermissions(old_dir,"w");if(err){throw new FS.ErrnoError(err)}}try{if(FS.trackingDelegate["willMovePath"]){FS.trackingDelegate["willMovePath"](old_path,new_path)}}catch(e){console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}FS.hashRemoveNode(old_node);try{old_dir.node_ops.rename(old_node,new_dir,new_name)}catch(e){throw e}finally{FS.hashAddNode(old_node)}try{if(FS.trackingDelegate["onMovePath"])FS.trackingDelegate["onMovePath"](old_path,new_path)}catch(e){console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: "+e.message)}},rmdir:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,true);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.rmdir){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.rmdir(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readdir:function(path){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;if(!node.node_ops.readdir){throw new FS.ErrnoError(20)}return node.node_ops.readdir(node)},unlink:function(path){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);var node=FS.lookupNode(parent,name);var err=FS.mayDelete(parent,name,false);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.unlink){throw new FS.ErrnoError(1)}if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}try{if(FS.trackingDelegate["willDeletePath"]){FS.trackingDelegate["willDeletePath"](path)}}catch(e){console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: "+e.message)}parent.node_ops.unlink(parent,name);FS.destroyNode(node);try{if(FS.trackingDelegate["onDeletePath"])FS.trackingDelegate["onDeletePath"](path)}catch(e){console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: "+e.message)}},readlink:function(path){var lookup=FS.lookupPath(path);var link=lookup.node;if(!link){throw new FS.ErrnoError(2)}if(!link.node_ops.readlink){throw new FS.ErrnoError(22)}return PATH.resolve(FS.getPath(link.parent),link.node_ops.readlink(link))},stat:function(path,dontFollow){var lookup=FS.lookupPath(path,{follow:!dontFollow});var node=lookup.node;if(!node){throw new FS.ErrnoError(2)}if(!node.node_ops.getattr){throw new FS.ErrnoError(1)}return node.node_ops.getattr(node)},lstat:function(path){return FS.stat(path,true)},chmod:function(path,mode,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{mode:mode&4095|node.mode&~4095,timestamp:Date.now()})},lchmod:function(path,mode){FS.chmod(path,mode,true)},fchmod:function(fd,mode){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chmod(stream.node,mode)},chown:function(path,uid,gid,dontFollow){var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:!dontFollow});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}node.node_ops.setattr(node,{timestamp:Date.now()})},lchown:function(path,uid,gid){FS.chown(path,uid,gid,true)},fchown:function(fd,uid,gid){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}FS.chown(stream.node,uid,gid)},truncate:function(path,len){if(len<0){throw new FS.ErrnoError(22)}var node;if(typeof path==="string"){var lookup=FS.lookupPath(path,{follow:true});node=lookup.node}else{node=path}if(!node.node_ops.setattr){throw new FS.ErrnoError(1)}if(FS.isDir(node.mode)){throw new FS.ErrnoError(21)}if(!FS.isFile(node.mode)){throw new FS.ErrnoError(22)}var err=FS.nodePermissions(node,"w");if(err){throw new FS.ErrnoError(err)}node.node_ops.setattr(node,{size:len,timestamp:Date.now()})},ftruncate:function(fd,len){var stream=FS.getStream(fd);if(!stream){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(22)}FS.truncate(stream.node,len)},utime:function(path,atime,mtime){var lookup=FS.lookupPath(path,{follow:true});var node=lookup.node;node.node_ops.setattr(node,{timestamp:Math.max(atime,mtime)})},open:function(path,flags,mode,fd_start,fd_end){if(path===""){throw new FS.ErrnoError(2)}flags=typeof flags==="string"?FS.modeStringToFlags(flags):flags;mode=typeof mode==="undefined"?438:mode;if(flags&64){mode=mode&4095|32768}else{mode=0}var node;if(typeof path==="object"){node=path}else{path=PATH.normalize(path);try{var lookup=FS.lookupPath(path,{follow:!(flags&131072)});node=lookup.node}catch(e){}}var created=false;if(flags&64){if(node){if(flags&128){throw new FS.ErrnoError(17)}}else{node=FS.mknod(path,mode,0);created=true}}if(!node){throw new FS.ErrnoError(2)}if(FS.isChrdev(node.mode)){flags&=~512}if(flags&65536&&!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}if(!created){var err=FS.mayOpen(node,flags);if(err){throw new FS.ErrnoError(err)}}if(flags&512){FS.truncate(node,0)}flags&=~(128|512);var stream=FS.createStream({node:node,path:FS.getPath(node),flags:flags,seekable:true,position:0,stream_ops:node.stream_ops,ungotten:[],error:false},fd_start,fd_end);if(stream.stream_ops.open){stream.stream_ops.open(stream)}if(Module["logReadFiles"]&&!(flags&1)){if(!FS.readFiles)FS.readFiles={};if(!(path in FS.readFiles)){FS.readFiles[path]=1;console.log("FS.trackingDelegate error on read file: "+path)}}try{if(FS.trackingDelegate["onOpenFile"]){var trackingFlags=0;if((flags&2097155)!==1){trackingFlags|=FS.tracking.openFlags.READ}if((flags&2097155)!==0){trackingFlags|=FS.tracking.openFlags.WRITE}FS.trackingDelegate["onOpenFile"](path,trackingFlags)}}catch(e){console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: "+e.message)}return stream},close:function(stream){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(stream.getdents)stream.getdents=null;try{if(stream.stream_ops.close){stream.stream_ops.close(stream)}}catch(e){throw e}finally{FS.closeStream(stream.fd)}stream.fd=null},isClosed:function(stream){return stream.fd===null},llseek:function(stream,offset,whence){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(!stream.seekable||!stream.stream_ops.llseek){throw new FS.ErrnoError(29)}if(whence!=0&&whence!=1&&whence!=2){throw new FS.ErrnoError(22)}stream.position=stream.stream_ops.llseek(stream,offset,whence);stream.ungotten=[];return stream.position},read:function(stream,buffer,offset,length,position){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===1){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.read){throw new FS.ErrnoError(22)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesRead=stream.stream_ops.read(stream,buffer,offset,length,position);if(!seeking)stream.position+=bytesRead;return bytesRead},write:function(stream,buffer,offset,length,position,canOwn){if(length<0||position<0){throw new FS.ErrnoError(22)}if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(FS.isDir(stream.node.mode)){throw new FS.ErrnoError(21)}if(!stream.stream_ops.write){throw new FS.ErrnoError(22)}if(stream.flags&1024){FS.llseek(stream,0,2)}var seeking=typeof position!=="undefined";if(!seeking){position=stream.position}else if(!stream.seekable){throw new FS.ErrnoError(29)}var bytesWritten=stream.stream_ops.write(stream,buffer,offset,length,position,canOwn);if(!seeking)stream.position+=bytesWritten;try{if(stream.path&&FS.trackingDelegate["onWriteToFile"])FS.trackingDelegate["onWriteToFile"](stream.path)}catch(e){console.log("FS.trackingDelegate['onWriteToFile']('"+stream.path+"') threw an exception: "+e.message)}return bytesWritten},allocate:function(stream,offset,length){if(FS.isClosed(stream)){throw new FS.ErrnoError(9)}if(offset<0||length<=0){throw new FS.ErrnoError(22)}if((stream.flags&2097155)===0){throw new FS.ErrnoError(9)}if(!FS.isFile(stream.node.mode)&&!FS.isDir(stream.node.mode)){throw new FS.ErrnoError(19)}if(!stream.stream_ops.allocate){throw new FS.ErrnoError(95)}stream.stream_ops.allocate(stream,offset,length)},mmap:function(stream,buffer,offset,length,position,prot,flags){if((stream.flags&2097155)===1){throw new FS.ErrnoError(13)}if(!stream.stream_ops.mmap){throw new FS.ErrnoError(19)}return stream.stream_ops.mmap(stream,buffer,offset,length,position,prot,flags)},msync:function(stream,buffer,offset,length,mmapFlags){if(!stream||!stream.stream_ops.msync){return 0}return stream.stream_ops.msync(stream,buffer,offset,length,mmapFlags)},munmap:function(stream){return 0},ioctl:function(stream,cmd,arg){if(!stream.stream_ops.ioctl){throw new FS.ErrnoError(25)}return stream.stream_ops.ioctl(stream,cmd,arg)},readFile:function(path,opts){opts=opts||{};opts.flags=opts.flags||"r";opts.encoding=opts.encoding||"binary";if(opts.encoding!=="utf8"&&opts.encoding!=="binary"){throw new Error('Invalid encoding type "'+opts.encoding+'"')}var ret;var stream=FS.open(path,opts.flags);var stat=FS.stat(path);var length=stat.size;var buf=new Uint8Array(length);FS.read(stream,buf,0,length,0);if(opts.encoding==="utf8"){ret=UTF8ArrayToString(buf,0)}else if(opts.encoding==="binary"){ret=buf}FS.close(stream);return ret},writeFile:function(path,data,opts){opts=opts||{};opts.flags=opts.flags||"w";var stream=FS.open(path,opts.flags,opts.mode);if(typeof data==="string"){var buf=new Uint8Array(lengthBytesUTF8(data)+1);var actualNumBytes=stringToUTF8Array(data,buf,0,buf.length);FS.write(stream,buf,0,actualNumBytes,undefined,opts.canOwn)}else if(ArrayBuffer.isView(data)){FS.write(stream,data,0,data.byteLength,undefined,opts.canOwn)}else{throw new Error("Unsupported data type")}FS.close(stream)},cwd:function(){return FS.currentPath},chdir:function(path){var lookup=FS.lookupPath(path,{follow:true});if(lookup.node===null){throw new FS.ErrnoError(2)}if(!FS.isDir(lookup.node.mode)){throw new FS.ErrnoError(20)}var err=FS.nodePermissions(lookup.node,"x");if(err){throw new FS.ErrnoError(err)}FS.currentPath=lookup.path},createDefaultDirectories:function(){FS.mkdir("/tmp");FS.mkdir("/home");FS.mkdir("/home/web_user")},createDefaultDevices:function(){FS.mkdir("/dev");FS.registerDevice(FS.makedev(1,3),{read:function(){return 0},write:function(stream,buffer,offset,length,pos){return length}});FS.mkdev("/dev/null",FS.makedev(1,3));TTY.register(FS.makedev(5,0),TTY.default_tty_ops);TTY.register(FS.makedev(6,0),TTY.default_tty1_ops);FS.mkdev("/dev/tty",FS.makedev(5,0));FS.mkdev("/dev/tty1",FS.makedev(6,0));var random_device;if(typeof crypto==="object"&&typeof crypto["getRandomValues"]==="function"){var randomBuffer=new Uint8Array(1);random_device=function(){crypto.getRandomValues(randomBuffer);return randomBuffer[0]}}else if(ENVIRONMENT_IS_NODE){try{var crypto_module=require("crypto");random_device=function(){return crypto_module["randomBytes"](1)[0]}}catch(e){}}else{}if(!random_device){random_device=function(){abort("random_device")}}FS.createDevice("/dev","random",random_device);FS.createDevice("/dev","urandom",random_device);FS.mkdir("/dev/shm");FS.mkdir("/dev/shm/tmp")},createSpecialDirectories:function(){FS.mkdir("/proc");FS.mkdir("/proc/self");FS.mkdir("/proc/self/fd");FS.mount({mount:function(){var node=FS.createNode("/proc/self","fd",16384|511,73);node.node_ops={lookup:function(parent,name){var fd=+name;var stream=FS.getStream(fd);if(!stream)throw new FS.ErrnoError(9);var ret={parent:null,mount:{mountpoint:"fake"},node_ops:{readlink:function(){return stream.path}}};ret.parent=ret;return ret}};return node}},{},"/proc/self/fd")},createStandardStreams:function(){if(Module["stdin"]){FS.createDevice("/dev","stdin",Module["stdin"])}else{FS.symlink("/dev/tty","/dev/stdin")}if(Module["stdout"]){FS.createDevice("/dev","stdout",null,Module["stdout"])}else{FS.symlink("/dev/tty","/dev/stdout")}if(Module["stderr"]){FS.createDevice("/dev","stderr",null,Module["stderr"])}else{FS.symlink("/dev/tty1","/dev/stderr")}var stdin=FS.open("/dev/stdin","r");var stdout=FS.open("/dev/stdout","w");var stderr=FS.open("/dev/stderr","w")},ensureErrnoError:function(){if(FS.ErrnoError)return;FS.ErrnoError=function ErrnoError(errno,node){this.node=node;this.setErrno=function(errno){this.errno=errno};this.setErrno(errno);this.message="FS error";if(this.stack)Object.defineProperty(this,"stack",{value:(new Error).stack,writable:true})};FS.ErrnoError.prototype=new Error;FS.ErrnoError.prototype.constructor=FS.ErrnoError;[2].forEach(function(code){FS.genericErrors[code]=new FS.ErrnoError(code);FS.genericErrors[code].stack="<generic error, no stack>"})},staticInit:function(){FS.ensureErrnoError();FS.nameTable=new Array(4096);FS.mount(MEMFS,{},"/");FS.createDefaultDirectories();FS.createDefaultDevices();FS.createSpecialDirectories();FS.filesystems={"MEMFS":MEMFS,"IDBFS":IDBFS,"NODEFS":NODEFS,"WORKERFS":WORKERFS}},init:function(input,output,error){FS.init.initialized=true;FS.ensureErrnoError();Module["stdin"]=input||Module["stdin"];Module["stdout"]=output||Module["stdout"];Module["stderr"]=error||Module["stderr"];FS.createStandardStreams()},quit:function(){FS.init.initialized=false;var fflush=Module["_fflush"];if(fflush)fflush(0);for(var i=0;i<FS.streams.length;i++){var stream=FS.streams[i];if(!stream){continue}FS.close(stream)}},getMode:function(canRead,canWrite){var mode=0;if(canRead)mode|=292|73;if(canWrite)mode|=146;return mode},joinPath:function(parts,forceRelative){var path=PATH.join.apply(null,parts);if(forceRelative&&path[0]=="/")path=path.substr(1);return path},absolutePath:function(relative,base){return PATH.resolve(base,relative)},standardizePath:function(path){return PATH.normalize(path)},findObject:function(path,dontResolveLastLink){var ret=FS.analyzePath(path,dontResolveLastLink);if(ret.exists){return ret.object}else{___setErrNo(ret.error);return null}},analyzePath:function(path,dontResolveLastLink){try{var lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});path=lookup.path}catch(e){}var ret={isRoot:false,exists:false,error:0,name:null,path:null,object:null,parentExists:false,parentPath:null,parentObject:null};try{var lookup=FS.lookupPath(path,{parent:true});ret.parentExists=true;ret.parentPath=lookup.path;ret.parentObject=lookup.node;ret.name=PATH.basename(path);lookup=FS.lookupPath(path,{follow:!dontResolveLastLink});ret.exists=true;ret.path=lookup.path;ret.object=lookup.node;ret.name=lookup.node.name;ret.isRoot=lookup.path==="/"}catch(e){ret.error=e.errno}return ret},createFolder:function(parent,name,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.mkdir(path,mode)},createPath:function(parent,path,canRead,canWrite){parent=typeof parent==="string"?parent:FS.getPath(parent);var parts=path.split("/").reverse();while(parts.length){var part=parts.pop();if(!part)continue;var current=PATH.join2(parent,part);try{FS.mkdir(current)}catch(e){}parent=current}return current},createFile:function(parent,name,properties,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(canRead,canWrite);return FS.create(path,mode)},createDataFile:function(parent,name,data,canRead,canWrite,canOwn){var path=name?PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name):parent;var mode=FS.getMode(canRead,canWrite);var node=FS.create(path,mode);if(data){if(typeof data==="string"){var arr=new Array(data.length);for(var i=0,len=data.length;i<len;++i)arr[i]=data.charCodeAt(i);data=arr}FS.chmod(node,mode|146);var stream=FS.open(node,"w");FS.write(stream,data,0,data.length,0,canOwn);FS.close(stream);FS.chmod(node,mode)}return node},createDevice:function(parent,name,input,output){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);var mode=FS.getMode(!!input,!!output);if(!FS.createDevice.major)FS.createDevice.major=64;var dev=FS.makedev(FS.createDevice.major++,0);FS.registerDevice(dev,{open:function(stream){stream.seekable=false},close:function(stream){if(output&&output.buffer&&output.buffer.length){output(10)}},read:function(stream,buffer,offset,length,pos){var bytesRead=0;for(var i=0;i<length;i++){var result;try{result=input()}catch(e){throw new FS.ErrnoError(5)}if(result===undefined&&bytesRead===0){throw new FS.ErrnoError(11)}if(result===null||result===undefined)break;bytesRead++;buffer[offset+i]=result}if(bytesRead){stream.node.timestamp=Date.now()}return bytesRead},write:function(stream,buffer,offset,length,pos){for(var i=0;i<length;i++){try{output(buffer[offset+i])}catch(e){throw new FS.ErrnoError(5)}}if(length){stream.node.timestamp=Date.now()}return i}});return FS.mkdev(path,mode,dev)},createLink:function(parent,name,target,canRead,canWrite){var path=PATH.join2(typeof parent==="string"?parent:FS.getPath(parent),name);return FS.symlink(target,path)},forceLoadFile:function(obj){if(obj.isDevice||obj.isFolder||obj.link||obj.contents)return true;var success=true;if(typeof XMLHttpRequest!=="undefined"){throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")}else if(Module["read"]){try{obj.contents=intArrayFromString(Module["read"](obj.url),true);obj.usedBytes=obj.contents.length}catch(e){success=false}}else{throw new Error("Cannot load without read() or XMLHttpRequest.")}if(!success)___setErrNo(5);return success},createLazyFile:function(parent,name,url,canRead,canWrite){function LazyUint8Array(){this.lengthKnown=false;this.chunks=[]}LazyUint8Array.prototype.get=function LazyUint8Array_get(idx){if(idx>this.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}};var lazyArray=this;lazyArray.setDataGetter(function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]});if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._length}},chunkSize:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize}}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:function(){return this.contents.length}}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach(function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}return fn.apply(null,arguments)}});stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);if(contents.slice){for(var i=0;i<size;i++){buffer[offset+i]=contents[position+i]}}else{for(var i=0;i<size;i++){buffer[offset+i]=contents.get(position+i)}}return size};node.stream_ops=stream_ops;return node},createPreloadedFile:function(parent,name,url,canRead,canWrite,onload,onerror,dontCreateFile,canOwn,preFinish){Browser.init();var fullname=name?PATH.resolve(PATH.join2(parent,name)):parent;var dep=getUniqueRunDependency("cp "+fullname);function processData(byteArray){function finish(byteArray){if(preFinish)preFinish();if(!dontCreateFile){FS.createDataFile(parent,name,byteArray,canRead,canWrite,canOwn)}if(onload)onload();removeRunDependency(dep)}var handled=false;Module["preloadPlugins"].forEach(function(plugin){if(handled)return;if(plugin["canHandle"](fullname)){plugin["handle"](byteArray,fullname,finish,function(){if(onerror)onerror();removeRunDependency(dep)});handled=true}});if(!handled)finish(byteArray)}addRunDependency(dep);if(typeof url=="string"){Browser.asyncLoad(url,function(byteArray){processData(byteArray)},onerror)}else{processData(url)}},indexedDB:function(){return window.indexedDB||window.mozIndexedDB||window.webkitIndexedDB||window.msIndexedDB},DB_NAME:function(){return"EM_FS_"+window.location.pathname},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=function openRequest_onupgradeneeded(){console.log("creating db");var db=openRequest.result;db.createObjectStore(FS.DB_STORE_NAME)};openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;var transaction=db.transaction([FS.DB_STORE_NAME],"readwrite");var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var putRequest=files.put(FS.analyzePath(path).object.contents,path);putRequest.onsuccess=function putRequest_onsuccess(){ok++;if(ok+fail==total)finish()};putRequest.onerror=function putRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror},loadFilesFromDB:function(paths,onload,onerror){onload=onload||function(){};onerror=onerror||function(){};var indexedDB=FS.indexedDB();try{var openRequest=indexedDB.open(FS.DB_NAME(),FS.DB_VERSION)}catch(e){return onerror(e)}openRequest.onupgradeneeded=onerror;openRequest.onsuccess=function openRequest_onsuccess(){var db=openRequest.result;try{var transaction=db.transaction([FS.DB_STORE_NAME],"readonly")}catch(e){onerror(e);return}var files=transaction.objectStore(FS.DB_STORE_NAME);var ok=0,fail=0,total=paths.length;function finish(){if(fail==0)onload();else onerror()}paths.forEach(function(path){var getRequest=files.get(path);getRequest.onsuccess=function getRequest_onsuccess(){if(FS.analyzePath(path).exists){FS.unlink(path)}FS.createDataFile(PATH.dirname(path),PATH.basename(path),getRequest.result,true,true,true);ok++;if(ok+fail==total)finish()};getRequest.onerror=function getRequest_onerror(){fail++;if(ok+fail==total)finish()}});transaction.onerror=onerror};openRequest.onerror=onerror}};var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function(dirfd,path){if(path[0]!=="/"){var dir;if(dirfd===-100){dir=FS.cwd()}else{var dirstream=FS.getStream(dirfd);if(!dirstream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);dir=dirstream.path}path=PATH.join2(dir,path)}return path},doStat:function(func,path,buf){try{var stat=func(path)}catch(e){if(e&&e.node&&PATH.normalize(path)!==PATH.normalize(FS.getPath(e.node))){return-ERRNO_CODES.ENOTDIR}throw e}HEAP32[buf>>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;tempI64=[stat.size>>>0,(tempDouble=stat.size,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+40>>2]=tempI64[0],HEAP32[buf+44>>2]=tempI64[1];HEAP32[buf+48>>2]=4096;HEAP32[buf+52>>2]=stat.blocks;HEAP32[buf+56>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+76>>2]=0;tempI64=[stat.ino>>>0,(tempDouble=stat.ino,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+80>>2]=tempI64[0],HEAP32[buf+84>>2]=tempI64[1];return 0},doMsync:function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)},doMkdir:function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0},doMknod:function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-ERRNO_CODES.EINVAL}FS.mknod(path,mode,dev);return 0},doReadlink:function(path,buf,bufsize){if(bufsize<=0)return-ERRNO_CODES.EINVAL;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len},doAccess:function(path,amode){if(amode&~7){return-ERRNO_CODES.EINVAL}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-ERRNO_CODES.EACCES}return 0},doDup:function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd},doReadv:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr<len)break}return ret},doWritev:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i<iovcnt;i++){var ptr=HEAP32[iov+i*8>>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret},varargs:0,get:function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret},getStr:function(){var ret=UTF8ToString(SYSCALLS.get());return ret},getStreamFromFD:function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return stream},getSocketFromFD:function(){var socket=SOCKFS.getSocket(SYSCALLS.get());if(!socket)throw new FS.ErrnoError(ERRNO_CODES.EBADF);return socket},getSocketAddress:function(allowNull){var addrp=SYSCALLS.get(),addrlen=SYSCALLS.get();if(allowNull&&addrp===0)return null;var info=__read_sockaddr(addrp,addrlen);if(info.errno)throw new FS.ErrnoError(info.errno);info.addr=DNS.lookup_addr(info.addr)||info.addr;return info},get64:function(){var low=SYSCALLS.get(),high=SYSCALLS.get();return low},getZero:function(){SYSCALLS.get()}};function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();if(!(offset_high==-1&&offset_low<0)&&!(offset_high==0&&offset_low>=0)){return-ERRNO_CODES.EOVERFLOW}var offset=offset_low;FS.llseek(stream,offset,whence);tempI64=[stream.position>>>0,(tempDouble=stream.position,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[result>>2]=tempI64[0],HEAP32[result+4>>2]=tempI64[1];if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall145(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doReadv(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall221(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),cmd=SYSCALLS.get();switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-ERRNO_CODES.EINVAL}var newStream;newStream=FS.open(stream.path,stream.flags,0,arg);return newStream.fd}case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0}case 12:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0}case 13:case 14:return 0;case 16:case 8:return-ERRNO_CODES.EINVAL;case 9:___setErrNo(ERRNO_CODES.EINVAL);return-1;default:{return-ERRNO_CODES.EINVAL}}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall5(which,varargs){SYSCALLS.varargs=varargs;try{var pathname=SYSCALLS.getStr(),flags=SYSCALLS.get(),mode=SYSCALLS.get();var stream=FS.open(pathname,flags,mode);return stream.fd}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21509:case 21505:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21510:case 21511:case 21512:case 21506:case 21507:case 21508:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21519:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0}case 21520:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return-ERRNO_CODES.EINVAL}case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)}case 21523:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}case 21524:{if(!stream.tty)return-ERRNO_CODES.ENOTTY;return 0}default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___unlock(){}function _emscripten_set_main_loop_timing(mode,value){Browser.mainLoop.timingMode=mode;Browser.mainLoop.timingValue=value;if(!Browser.mainLoop.func){return 1}if(mode==0){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setTimeout(){var timeUntilNextTick=Math.max(0,Browser.mainLoop.tickStartTime+value-_emscripten_get_now())|0;setTimeout(Browser.mainLoop.runner,timeUntilNextTick)};Browser.mainLoop.method="timeout"}else if(mode==1){Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_rAF(){Browser.requestAnimationFrame(Browser.mainLoop.runner)};Browser.mainLoop.method="rAF"}else if(mode==2){if(typeof setImmediate==="undefined"){var setImmediates=[];var emscriptenMainLoopMessageId="setimmediate";var Browser_setImmediate_messageHandler=function(event){if(event.data===emscriptenMainLoopMessageId||event.data.target===emscriptenMainLoopMessageId){event.stopPropagation();setImmediates.shift()()}};addEventListener("message",Browser_setImmediate_messageHandler,true);setImmediate=function Browser_emulated_setImmediate(func){setImmediates.push(func);if(ENVIRONMENT_IS_WORKER){if(Module["setImmediates"]===undefined)Module["setImmediates"]=[];Module["setImmediates"].push(func);postMessage({target:emscriptenMainLoopMessageId})}else postMessage(emscriptenMainLoopMessageId,"*")}}Browser.mainLoop.scheduler=function Browser_mainLoop_scheduler_setImmediate(){setImmediate(Browser.mainLoop.runner)};Browser.mainLoop.method="immediate"}return 0}function _emscripten_get_now(){abort()}function _emscripten_set_main_loop(func,fps,simulateInfiniteLoop,arg,noSetTiming){Module["noExitRuntime"]=true;assert(!Browser.mainLoop.func,"emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.");Browser.mainLoop.func=func;Browser.mainLoop.arg=arg;var browserIterationFunc;if(typeof arg!=="undefined"){browserIterationFunc=function(){Module["dynCall_vi"](func,arg)}}else{browserIterationFunc=function(){Module["dynCall_v"](func)}}var thisMainLoopId=Browser.mainLoop.currentlyRunningMainloop;Browser.mainLoop.runner=function Browser_mainLoop_runner(){if(ABORT)return;if(Browser.mainLoop.queue.length>0){var start=Date.now();var blocker=Browser.mainLoop.queue.shift();blocker.func(blocker.arg);if(Browser.mainLoop.remainingBlockers){var remaining=Browser.mainLoop.remainingBlockers;var next=remaining%1==0?remaining-1:Math.floor(remaining);if(blocker.counted){Browser.mainLoop.remainingBlockers=next}else{next=next+.5;Browser.mainLoop.remainingBlockers=(8*remaining+next)/9}}console.log('main loop blocker "'+blocker.name+'" took '+(Date.now()-start)+" ms");Browser.mainLoop.updateStatus();if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;setTimeout(Browser.mainLoop.runner,0);return}if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;Browser.mainLoop.currentFrameNumber=Browser.mainLoop.currentFrameNumber+1|0;if(Browser.mainLoop.timingMode==1&&Browser.mainLoop.timingValue>1&&Browser.mainLoop.currentFrameNumber%Browser.mainLoop.timingValue!=0){Browser.mainLoop.scheduler();return}else if(Browser.mainLoop.timingMode==0){Browser.mainLoop.tickStartTime=_emscripten_get_now()}if(Browser.mainLoop.method==="timeout"&&Module.ctx){err("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!");Browser.mainLoop.method=""}Browser.mainLoop.runIter(browserIterationFunc);if(thisMainLoopId<Browser.mainLoop.currentlyRunningMainloop)return;if(typeof SDL==="object"&&SDL.audio&&SDL.audio.queueNewAudioData)SDL.audio.queueNewAudioData();Browser.mainLoop.scheduler()};if(!noSetTiming){if(fps&&fps>0)_emscripten_set_main_loop_timing(0,1e3/fps);else _emscripten_set_main_loop_timing(1,1);Browser.mainLoop.scheduler()}if(simulateInfiniteLoop){throw"SimulateInfiniteLoop"}}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function(){Browser.mainLoop.scheduler=null;Browser.mainLoop.currentlyRunningMainloop++},resume:function(){Browser.mainLoop.currentlyRunningMainloop++;var timingMode=Browser.mainLoop.timingMode;var timingValue=Browser.mainLoop.timingValue;var func=Browser.mainLoop.func;Browser.mainLoop.func=null;_emscripten_set_main_loop(func,0,false,Browser.mainLoop.arg,true);_emscripten_set_main_loop_timing(timingMode,timingValue);Browser.mainLoop.scheduler()},updateStatus:function(){if(Module["setStatus"]){var message=Module["statusMessage"]||"Please wait...";var remaining=Browser.mainLoop.remainingBlockers;var expected=Browser.mainLoop.expectedBlockers;if(remaining){if(remaining<expected){Module["setStatus"](message+" ("+(expected-remaining)+"/"+expected+")")}else{Module["setStatus"](message)}}else{Module["setStatus"]("")}}},runIter:function(func){if(ABORT)return;if(Module["preMainLoop"]){var preRet=Module["preMainLoop"]();if(preRet===false){return}}try{func()}catch(e){if(e instanceof ExitStatus){return}else{if(e&&typeof e==="object"&&e.stack)err("exception thrown: "+[e,e.stack]);throw e}}if(Module["postMainLoop"])Module["postMainLoop"]()}},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function(){if(!Module["preloadPlugins"])Module["preloadPlugins"]=[];if(Browser.initted)return;Browser.initted=true;try{new Blob;Browser.hasBlobConstructor=true}catch(e){Browser.hasBlobConstructor=false;console.log("warning: no blob constructor, cannot create blobs with mimetypes")}Browser.BlobBuilder=typeof MozBlobBuilder!="undefined"?MozBlobBuilder:typeof WebKitBlobBuilder!="undefined"?WebKitBlobBuilder:!Browser.hasBlobConstructor?console.log("warning: no BlobBuilder"):null;Browser.URLObject=typeof window!="undefined"?window.URL?window.URL:window.webkitURL:undefined;if(!Module.noImageDecoding&&typeof Browser.URLObject==="undefined"){console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");Module.noImageDecoding=true}var imagePlugin={};imagePlugin["canHandle"]=function imagePlugin_canHandle(name){return!Module.noImageDecoding&&/\.(jpg|jpeg|png|bmp)$/i.test(name)};imagePlugin["handle"]=function imagePlugin_handle(byteArray,name,onload,onerror){var b=null;if(Browser.hasBlobConstructor){try{b=new Blob([byteArray],{type:Browser.getMimetype(name)});if(b.size!==byteArray.length){b=new Blob([new Uint8Array(byteArray).buffer],{type:Browser.getMimetype(name)})}}catch(e){warnOnce("Blob constructor present but fails: "+e+"; falling back to blob builder")}}if(!b){var bb=new Browser.BlobBuilder;bb.append(new Uint8Array(byteArray).buffer);b=bb.getBlob()}var url=Browser.URLObject.createObjectURL(b);var img=new Image;img.onload=function img_onload(){assert(img.complete,"Image "+name+" could not be decoded");var canvas=document.createElement("canvas");canvas.width=img.width;canvas.height=img.height;var ctx=canvas.getContext("2d");ctx.drawImage(img,0,0);Module["preloadedImages"][name]=canvas;Browser.URLObject.revokeObjectURL(url);if(onload)onload(byteArray)};img.onerror=function img_onerror(event){console.log("Image "+url+" could not be decoded");if(onerror)onerror()};img.src=url};Module["preloadPlugins"].push(imagePlugin);var audioPlugin={};audioPlugin["canHandle"]=function audioPlugin_canHandle(name){return!Module.noAudioDecoding&&name.substr(-4)in{".ogg":1,".wav":1,".mp3":1}};audioPlugin["handle"]=function audioPlugin_handle(byteArray,name,onload,onerror){var done=false;function finish(audio){if(done)return;done=true;Module["preloadedAudios"][name]=audio;if(onload)onload(byteArray)}function fail(){if(done)return;done=true;Module["preloadedAudios"][name]=new Audio;if(onerror)onerror()}if(Browser.hasBlobConstructor){try{var b=new Blob([byteArray],{type:Browser.getMimetype(name)})}catch(e){return fail()}var url=Browser.URLObject.createObjectURL(b);var audio=new Audio;audio.addEventListener("canplaythrough",function(){finish(audio)},false);audio.onerror=function audio_onerror(event){if(done)return;console.log("warning: browser could not fully decode audio "+name+", trying slower base64 approach");function encode64(data){var BASE="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";var PAD="=";var ret="";var leftchar=0;var leftbits=0;for(var i=0;i<data.length;i++){leftchar=leftchar<<8|data[i];leftbits+=8;while(leftbits>=6){var curr=leftchar>>leftbits-6&63;leftbits-=6;ret+=BASE[curr]}}if(leftbits==2){ret+=BASE[(leftchar&3)<<4];ret+=PAD+PAD}else if(leftbits==4){ret+=BASE[(leftchar&15)<<2];ret+=PAD}return ret}audio.src="data:audio/x-"+name.substr(-3)+";base64,"+encode64(byteArray);finish(audio)};audio.src=url;Browser.safeSetTimeout(function(){finish(audio)},1e4)}else{return fail()}};Module["preloadPlugins"].push(audioPlugin);function pointerLockChange(){Browser.pointerLock=document["pointerLockElement"]===Module["canvas"]||document["mozPointerLockElement"]===Module["canvas"]||document["webkitPointerLockElement"]===Module["canvas"]||document["msPointerLockElement"]===Module["canvas"]}var canvas=Module["canvas"];if(canvas){canvas.requestPointerLock=canvas["requestPointerLock"]||canvas["mozRequestPointerLock"]||canvas["webkitRequestPointerLock"]||canvas["msRequestPointerLock"]||function(){};canvas.exitPointerLock=document["exitPointerLock"]||document["mozExitPointerLock"]||document["webkitExitPointerLock"]||document["msExitPointerLock"]||function(){};canvas.exitPointerLock=canvas.exitPointerLock.bind(document);document.addEventListener("pointerlockchange",pointerLockChange,false);document.addEventListener("mozpointerlockchange",pointerLockChange,false);document.addEventListener("webkitpointerlockchange",pointerLockChange,false);document.addEventListener("mspointerlockchange",pointerLockChange,false);if(Module["elementPointerLock"]){canvas.addEventListener("click",function(ev){if(!Browser.pointerLock&&Module["canvas"].requestPointerLock){Module["canvas"].requestPointerLock();ev.preventDefault()}},false)}}},createContext:function(canvas,useWebGL,setInModule,webGLContextAttributes){if(useWebGL&&Module.ctx&&canvas==Module.canvas)return Module.ctx;var ctx;var contextHandle;if(useWebGL){var contextAttributes={antialias:false,alpha:false,majorVersion:1};if(webGLContextAttributes){for(var attribute in webGLContextAttributes){contextAttributes[attribute]=webGLContextAttributes[attribute]}}if(typeof GL!=="undefined"){contextHandle=GL.createContext(canvas,contextAttributes);if(contextHandle){ctx=GL.getContext(contextHandle).GLctx}}}else{ctx=canvas.getContext("2d")}if(!ctx)return null;if(setInModule){if(!useWebGL)assert(typeof GLctx==="undefined","cannot set in module if GLctx is used, but we are a non-GL context that would replace it");Module.ctx=ctx;if(useWebGL)GL.makeContextCurrent(contextHandle);Module.useWebGL=useWebGL;Browser.moduleContextCreatedCallbacks.forEach(function(callback){callback()});Browser.init()}return ctx},destroyContext:function(canvas,useWebGL,setInModule){},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function(lockPointer,resizeCanvas,vrDevice){Browser.lockPointer=lockPointer;Browser.resizeCanvas=resizeCanvas;Browser.vrDevice=vrDevice;if(typeof Browser.lockPointer==="undefined")Browser.lockPointer=true;if(typeof Browser.resizeCanvas==="undefined")Browser.resizeCanvas=false;if(typeof Browser.vrDevice==="undefined")Browser.vrDevice=null;var canvas=Module["canvas"];function fullscreenChange(){Browser.isFullscreen=false;var canvasContainer=canvas.parentNode;if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvasContainer){canvas.exitFullscreen=Browser.exitFullscreen;if(Browser.lockPointer)canvas.requestPointerLock();Browser.isFullscreen=true;if(Browser.resizeCanvas){Browser.setFullscreenCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}else{canvasContainer.parentNode.insertBefore(canvas,canvasContainer);canvasContainer.parentNode.removeChild(canvasContainer);if(Browser.resizeCanvas){Browser.setWindowedCanvasSize()}else{Browser.updateCanvasDimensions(canvas)}}if(Module["onFullScreen"])Module["onFullScreen"](Browser.isFullscreen);if(Module["onFullscreen"])Module["onFullscreen"](Browser.isFullscreen)}if(!Browser.fullscreenHandlersInstalled){Browser.fullscreenHandlersInstalled=true;document.addEventListener("fullscreenchange",fullscreenChange,false);document.addEventListener("mozfullscreenchange",fullscreenChange,false);document.addEventListener("webkitfullscreenchange",fullscreenChange,false);document.addEventListener("MSFullscreenChange",fullscreenChange,false)}var canvasContainer=document.createElement("div");canvas.parentNode.insertBefore(canvasContainer,canvas);canvasContainer.appendChild(canvas);canvasContainer.requestFullscreen=canvasContainer["requestFullscreen"]||canvasContainer["mozRequestFullScreen"]||canvasContainer["msRequestFullscreen"]||(canvasContainer["webkitRequestFullscreen"]?function(){canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null)||(canvasContainer["webkitRequestFullScreen"]?function(){canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"])}:null);if(vrDevice){canvasContainer.requestFullscreen({vrDisplay:vrDevice})}else{canvasContainer.requestFullscreen()}},requestFullScreen:function(lockPointer,resizeCanvas,vrDevice){err("Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.");Browser.requestFullScreen=function(lockPointer,resizeCanvas,vrDevice){return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)};return Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)},exitFullscreen:function(){if(!Browser.isFullscreen){return false}var CFS=document["exitFullscreen"]||document["cancelFullScreen"]||document["mozCancelFullScreen"]||document["msExitFullscreen"]||document["webkitCancelFullScreen"]||function(){};CFS.apply(document,[]);return true},nextRAF:0,fakeRequestAnimationFrame:function(func){var now=Date.now();if(Browser.nextRAF===0){Browser.nextRAF=now+1e3/60}else{while(now+2>=Browser.nextRAF){Browser.nextRAF+=1e3/60}}var delay=Math.max(Browser.nextRAF-now,0);setTimeout(func,delay)},requestAnimationFrame:function requestAnimationFrame(func){if(typeof window==="undefined"){Browser.fakeRequestAnimationFrame(func)}else{if(!window.requestAnimationFrame){window.requestAnimationFrame=window["requestAnimationFrame"]||window["mozRequestAnimationFrame"]||window["webkitRequestAnimationFrame"]||window["msRequestAnimationFrame"]||window["oRequestAnimationFrame"]||Browser.fakeRequestAnimationFrame}window.requestAnimationFrame(func)}},safeCallback:function(func){return function(){if(!ABORT)return func.apply(null,arguments)}},allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function(){Browser.allowAsyncCallbacks=false},resumeAsyncCallbacks:function(){Browser.allowAsyncCallbacks=true;if(Browser.queuedAsyncCallbacks.length>0){var callbacks=Browser.queuedAsyncCallbacks;Browser.queuedAsyncCallbacks=[];callbacks.forEach(function(func){func()})}},safeRequestAnimationFrame:function(func){return Browser.requestAnimationFrame(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}})},safeSetTimeout:function(func,timeout){Module["noExitRuntime"]=true;return setTimeout(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}else{Browser.queuedAsyncCallbacks.push(func)}},timeout)},safeSetInterval:function(func,timeout){Module["noExitRuntime"]=true;return setInterval(function(){if(ABORT)return;if(Browser.allowAsyncCallbacks){func()}},timeout)},getMimetype:function(name){return{"jpg":"image/jpeg","jpeg":"image/jpeg","png":"image/png","bmp":"image/bmp","ogg":"audio/ogg","wav":"audio/wav","mp3":"audio/mpeg"}[name.substr(name.lastIndexOf(".")+1)]},getUserMedia:function(func){if(!window.getUserMedia){window.getUserMedia=navigator["getUserMedia"]||navigator["mozGetUserMedia"]}window.getUserMedia(func)},getMovementX:function(event){return event["movementX"]||event["mozMovementX"]||event["webkitMovementX"]||0},getMovementY:function(event){return event["movementY"]||event["mozMovementY"]||event["webkitMovementY"]||0},getMouseWheelDelta:function(event){var delta=0;switch(event.type){case"DOMMouseScroll":delta=event.detail/3;break;case"mousewheel":delta=event.wheelDelta/120;break;case"wheel":delta=event.deltaY;switch(event.deltaMode){case 0:delta/=100;break;case 1:delta/=3;break;case 2:delta*=80;break;default:throw"unrecognized mouse wheel delta mode: "+event.deltaMode}break;default:throw"unrecognized mouse wheel event: "+event.type}return delta},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function(event){if(Browser.pointerLock){if(event.type!="mousemove"&&"mozMovementX"in event){Browser.mouseMovementX=Browser.mouseMovementY=0}else{Browser.mouseMovementX=Browser.getMovementX(event);Browser.mouseMovementY=Browser.getMovementY(event)}if(typeof SDL!="undefined"){Browser.mouseX=SDL.mouseX+Browser.mouseMovementX;Browser.mouseY=SDL.mouseY+Browser.mouseMovementY}else{Browser.mouseX+=Browser.mouseMovementX;Browser.mouseY+=Browser.mouseMovementY}}else{var rect=Module["canvas"].getBoundingClientRect();var cw=Module["canvas"].width;var ch=Module["canvas"].height;var scrollX=typeof window.scrollX!=="undefined"?window.scrollX:window.pageXOffset;var scrollY=typeof window.scrollY!=="undefined"?window.scrollY:window.pageYOffset;if(event.type==="touchstart"||event.type==="touchend"||event.type==="touchmove"){var touch=event.touch;if(touch===undefined){return}var adjustedX=touch.pageX-(scrollX+rect.left);var adjustedY=touch.pageY-(scrollY+rect.top);adjustedX=adjustedX*(cw/rect.width);adjustedY=adjustedY*(ch/rect.height);var coords={x:adjustedX,y:adjustedY};if(event.type==="touchstart"){Browser.lastTouches[touch.identifier]=coords;Browser.touches[touch.identifier]=coords}else if(event.type==="touchend"||event.type==="touchmove"){var last=Browser.touches[touch.identifier];if(!last)last=coords;Browser.lastTouches[touch.identifier]=last;Browser.touches[touch.identifier]=coords}return}var x=event.pageX-(scrollX+rect.left);var y=event.pageY-(scrollY+rect.top);x=x*(cw/rect.width);y=y*(ch/rect.height);Browser.mouseMovementX=x-Browser.mouseX;Browser.mouseMovementY=y-Browser.mouseY;Browser.mouseX=x;Browser.mouseY=y}},asyncLoad:function(url,onload,onerror,noRunDep){var dep=!noRunDep?getUniqueRunDependency("al "+url):"";Module["readAsync"](url,function(arrayBuffer){assert(arrayBuffer,'Loading data file "'+url+'" failed (no arrayBuffer).');onload(new Uint8Array(arrayBuffer));if(dep)removeRunDependency(dep)},function(event){if(onerror){onerror()}else{throw'Loading data file "'+url+'" failed.'}});if(dep)addRunDependency(dep)},resizeListeners:[],updateResizeListeners:function(){var canvas=Module["canvas"];Browser.resizeListeners.forEach(function(listener){listener(canvas.width,canvas.height)})},setCanvasSize:function(width,height,noUpdates){var canvas=Module["canvas"];Browser.updateCanvasDimensions(canvas,width,height);if(!noUpdates)Browser.updateResizeListeners()},windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags|8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},setWindowedCanvasSize:function(){if(typeof SDL!="undefined"){var flags=HEAPU32[SDL.screen>>2];flags=flags&~8388608;HEAP32[SDL.screen>>2]=flags}Browser.updateCanvasDimensions(Module["canvas"]);Browser.updateResizeListeners()},updateCanvasDimensions:function(canvas,wNative,hNative){if(wNative&&hNative){canvas.widthNative=wNative;canvas.heightNative=hNative}else{wNative=canvas.widthNative;hNative=canvas.heightNative}var w=wNative;var h=hNative;if(Module["forcedAspectRatio"]&&Module["forcedAspectRatio"]>0){if(w/h<Module["forcedAspectRatio"]){w=Math.round(h*Module["forcedAspectRatio"])}else{h=Math.round(w/Module["forcedAspectRatio"])}}if((document["fullscreenElement"]||document["mozFullScreenElement"]||document["msFullscreenElement"]||document["webkitFullscreenElement"]||document["webkitCurrentFullScreenElement"])===canvas.parentNode&&typeof screen!="undefined"){var factor=Math.min(screen.width/w,screen.height/h);w=Math.round(w*factor);h=Math.round(h*factor)}if(Browser.resizeCanvas){if(canvas.width!=w)canvas.width=w;if(canvas.height!=h)canvas.height=h;if(typeof canvas.style!="undefined"){canvas.style.removeProperty("width");canvas.style.removeProperty("height")}}else{if(canvas.width!=wNative)canvas.width=wNative;if(canvas.height!=hNative)canvas.height=hNative;if(typeof canvas.style!="undefined"){if(w!=wNative||h!=hNative){canvas.style.setProperty("width",w+"px","important");canvas.style.setProperty("height",h+"px","important")}else{canvas.style.removeProperty("width");canvas.style.removeProperty("height")}}}},wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function(){var handle=Browser.nextWgetRequestHandle;Browser.nextWgetRequestHandle++;return handle}};var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,contextAttributes:{alpha:false,depth:false,stencil:false,antialias:false},stringCache:{},setErrorCode:function(code){EGL.errorCode=code},chooseConfig:function(display,attribList,config,config_size,numConfigs){if(display!=62e3){EGL.setErrorCode(12296);return 0}if(attribList){for(;;){var param=HEAP32[attribList>>2];if(param==12321){var alphaSize=HEAP32[attribList+4>>2];EGL.contextAttributes.alpha=alphaSize>0}else if(param==12325){var depthSize=HEAP32[attribList+4>>2];EGL.contextAttributes.depth=depthSize>0}else if(param==12326){var stencilSize=HEAP32[attribList+4>>2];EGL.contextAttributes.stencil=stencilSize>0}else if(param==12337){var samples=HEAP32[attribList+4>>2];EGL.contextAttributes.antialias=samples>0}else if(param==12338){var samples=HEAP32[attribList+4>>2];EGL.contextAttributes.antialias=samples==1}else if(param==12544){var requestedPriority=HEAP32[attribList+4>>2];EGL.contextAttributes.lowLatency=requestedPriority!=12547}else if(param==12344){break}attribList+=8}}if((!config||!config_size)&&!numConfigs){EGL.setErrorCode(12300);return 0}if(numConfigs){HEAP32[numConfigs>>2]=1}if(config&&config_size>0){HEAP32[config>>2]=62002}EGL.setErrorCode(12288);return 1}};function _eglGetProcAddress(name_){return _emscripten_GetProcAddress(name_)}var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,removeAllEventListeners:function(){for(var i=JSEvents.eventHandlers.length-1;i>=0;--i){JSEvents._removeHandler(i)}JSEvents.eventHandlers=[];JSEvents.deferredCalls=[]},registerRemoveEventListeners:function(){if(!JSEvents.removeEventListenersRegistered){__ATEXIT__.push(JSEvents.removeAllEventListeners);JSEvents.removeEventListenersRegistered=true}},deferredCalls:[],deferCall:function(targetFunction,precedence,argsList){function arraysHaveEqualContent(arrA,arrB){if(arrA.length!=arrB.length)return false;for(var i in arrA){if(arrA[i]!=arrB[i])return false}return true}for(var i in JSEvents.deferredCalls){var call=JSEvents.deferredCalls[i];if(call.targetFunction==targetFunction&&arraysHaveEqualContent(call.argsList,argsList)){return}}JSEvents.deferredCalls.push({targetFunction:targetFunction,precedence:precedence,argsList:argsList});JSEvents.deferredCalls.sort(function(x,y){return x.precedence<y.precedence})},removeDeferredCalls:function(targetFunction){for(var i=0;i<JSEvents.deferredCalls.length;++i){if(JSEvents.deferredCalls[i].targetFunction==targetFunction){JSEvents.deferredCalls.splice(i,1);--i}}},canPerformEventHandlerRequests:function(){return JSEvents.inEventHandler&&JSEvents.currentEventHandler.allowsDeferredCalls},runDeferredCalls:function(){if(!JSEvents.canPerformEventHandlerRequests()){return}for(var i=0;i<JSEvents.deferredCalls.length;++i){var call=JSEvents.deferredCalls[i];JSEvents.deferredCalls.splice(i,1);--i;call.targetFunction.apply(this,call.argsList)}},inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function(){return navigator.userAgent.indexOf("MSIE")!==-1||navigator.appVersion.indexOf("Trident/")>0},removeAllHandlersOnTarget:function(target,eventTypeString){for(var i=0;i<JSEvents.eventHandlers.length;++i){if(JSEvents.eventHandlers[i].target==target&&(!eventTypeString||eventTypeString==JSEvents.eventHandlers[i].eventTypeString)){JSEvents._removeHandler(i--)}}},_removeHandler:function(i){var h=JSEvents.eventHandlers[i];h.target.removeEventListener(h.eventTypeString,h.eventListenerFunc,h.useCapture);JSEvents.eventHandlers.splice(i,1)},registerOrRemoveHandler:function(eventHandler){var jsEventHandler=function jsEventHandler(event){++JSEvents.inEventHandler;JSEvents.currentEventHandler=eventHandler;JSEvents.runDeferredCalls();eventHandler.handlerFunc(event);JSEvents.runDeferredCalls();--JSEvents.inEventHandler};if(eventHandler.callbackfunc){eventHandler.eventListenerFunc=jsEventHandler;eventHandler.target.addEventListener(eventHandler.eventTypeString,jsEventHandler,eventHandler.useCapture);JSEvents.eventHandlers.push(eventHandler);JSEvents.registerRemoveEventListeners()}else{for(var i=0;i<JSEvents.eventHandlers.length;++i){if(JSEvents.eventHandlers[i].target==eventHandler.target&&JSEvents.eventHandlers[i].eventTypeString==eventHandler.eventTypeString){JSEvents._removeHandler(i--)}}}},getBoundingClientRectOrZeros:function(target){return target.getBoundingClientRect?target.getBoundingClientRect():{left:0,top:0}},pageScrollPos:function(){if(window.pageXOffset>0||window.pageYOffset>0){return[window.pageXOffset,window.pageYOffset]}if(typeof document.documentElement.scrollLeft!=="undefined"||typeof document.documentElement.scrollTop!=="undefined"){return[document.documentElement.scrollLeft,document.documentElement.scrollTop]}return[document.body.scrollLeft|0,document.body.scrollTop|0]},getNodeNameForTarget:function(target){if(!target)return"";if(target==window)return"#window";if(target==screen)return"#screen";return target&&target.nodeName?target.nodeName:""},tick:function(){if(window["performance"]&&window["performance"]["now"])return window["performance"]["now"]();else return Date.now()},fullscreenEnabled:function(){return document.fullscreenEnabled||document.mozFullScreenEnabled||document.webkitFullscreenEnabled||document.msFullscreenEnabled}};function __requestPointerLock(target){if(target.requestPointerLock){target.requestPointerLock()}else if(target.mozRequestPointerLock){target.mozRequestPointerLock()}else if(target.webkitRequestPointerLock){target.webkitRequestPointerLock()}else if(target.msRequestPointerLock){target.msRequestPointerLock()}else{if(document.body.requestPointerLock||document.body.mozRequestPointerLock||document.body.webkitRequestPointerLock||document.body.msRequestPointerLock){return-3}else{return-1}}return 0}function _emscripten_exit_pointerlock(){JSEvents.removeDeferredCalls(__requestPointerLock);if(document.exitPointerLock){document.exitPointerLock()}else if(document.msExitPointerLock){document.msExitPointerLock()}else if(document.mozExitPointerLock){document.mozExitPointerLock()}else if(document.webkitExitPointerLock){document.webkitExitPointerLock()}else{return-1}return 0}function __fillGamepadEventData(eventStruct,e){HEAPF64[eventStruct>>3]=e.timestamp;for(var i=0;i<e.axes.length;++i){HEAPF64[eventStruct+i*8+16>>3]=e.axes[i]}for(var i=0;i<e.buttons.length;++i){if(typeof e.buttons[i]==="object"){HEAPF64[eventStruct+i*8+528>>3]=e.buttons[i].value}else{HEAPF64[eventStruct+i*8+528>>3]=e.buttons[i]}}for(var i=0;i<e.buttons.length;++i){if(typeof e.buttons[i]==="object"){HEAP32[eventStruct+i*4+1040>>2]=e.buttons[i].pressed}else{HEAP32[eventStruct+i*4+1040>>2]=e.buttons[i]==1}}HEAP32[eventStruct+1296>>2]=e.connected;HEAP32[eventStruct+1300>>2]=e.index;HEAP32[eventStruct+8>>2]=e.axes.length;HEAP32[eventStruct+12>>2]=e.buttons.length;stringToUTF8(e.id,eventStruct+1304,64);stringToUTF8(e.mapping,eventStruct+1368,64)}function _emscripten_get_gamepad_status(index,gamepadState){if(index<0||index>=JSEvents.lastGamepadState.length)return-5;if(!JSEvents.lastGamepadState[index])return-7;__fillGamepadEventData(gamepadState,JSEvents.lastGamepadState[index]);return 0}function _emscripten_get_heap_size(){return HEAP8.length}function _emscripten_get_num_gamepads(){return JSEvents.lastGamepadState.length}function __fillPointerlockChangeEventData(eventStruct,e){var pointerLockElement=document.pointerLockElement||document.mozPointerLockElement||document.webkitPointerLockElement||document.msPointerLockElement;var isPointerlocked=!!pointerLockElement;HEAP32[eventStruct>>2]=isPointerlocked;var nodeName=JSEvents.getNodeNameForTarget(pointerLockElement);var id=pointerLockElement&&pointerLockElement.id?pointerLockElement.id:"";stringToUTF8(nodeName,eventStruct+4,128);stringToUTF8(id,eventStruct+132,128)}function _emscripten_get_pointerlock_status(pointerlockStatus){if(pointerlockStatus)__fillPointerlockChangeEventData(pointerlockStatus);if(!document.body||!document.body.requestPointerLock&&!document.body.mozRequestPointerLock&&!document.body.webkitRequestPointerLock&&!document.body.msRequestPointerLock){return-1}return 0}var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:{},currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],programInfos:{},stringCache:{},unpackAlignment:4,init:function(){GL.miniTempBuffer=new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);for(var i=0;i<GL.MINI_TEMP_BUFFER_SIZE;i++){GL.miniTempBufferViews[i]=GL.miniTempBuffer.subarray(0,i+1)}},recordError:function recordError(errorCode){if(!GL.lastError){GL.lastError=errorCode}},getNewId:function(table){var ret=GL.counter++;for(var i=table.length;i<ret;i++){table[i]=null}return ret},MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function(shader,count,string,length){var source="";for(var i=0;i<count;++i){var len=length?HEAP32[length+i*4>>2]:-1;source+=UTF8ToString(HEAP32[string+i*4>>2],len<0?undefined:len)}return source},createContext:function(canvas,webGLContextAttributes){var ctx=canvas.getContext("webgl",webGLContextAttributes)||canvas.getContext("experimental-webgl",webGLContextAttributes);return ctx&&GL.registerContext(ctx,webGLContextAttributes)},registerContext:function(ctx,webGLContextAttributes){var handle=_malloc(8);var context={handle:handle,attributes:webGLContextAttributes,version:webGLContextAttributes.majorVersion,GLctx:ctx};if(ctx.canvas)ctx.canvas.GLctxObject=context;GL.contexts[handle]=context;if(typeof webGLContextAttributes.enableExtensionsByDefault==="undefined"||webGLContextAttributes.enableExtensionsByDefault){GL.initExtensions(context)}return handle},makeContextCurrent:function(contextHandle){GL.currentContext=GL.contexts[contextHandle];Module.ctx=GLctx=GL.currentContext&&GL.currentContext.GLctx;return!(contextHandle&&!GLctx)},getContext:function(contextHandle){return GL.contexts[contextHandle]},deleteContext:function(contextHandle){if(GL.currentContext===GL.contexts[contextHandle])GL.currentContext=null;if(typeof JSEvents==="object")JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas);if(GL.contexts[contextHandle]&&GL.contexts[contextHandle].GLctx.canvas)GL.contexts[contextHandle].GLctx.canvas.GLctxObject=undefined;_free(GL.contexts[contextHandle]);GL.contexts[contextHandle]=null},initExtensions:function(context){if(!context)context=GL.currentContext;if(context.initExtensionsDone)return;context.initExtensionsDone=true;var GLctx=context.GLctx;if(context.version<2){var instancedArraysExt=GLctx.getExtension("ANGLE_instanced_arrays");if(instancedArraysExt){GLctx["vertexAttribDivisor"]=function(index,divisor){instancedArraysExt["vertexAttribDivisorANGLE"](index,divisor)};GLctx["drawArraysInstanced"]=function(mode,first,count,primcount){instancedArraysExt["drawArraysInstancedANGLE"](mode,first,count,primcount)};GLctx["drawElementsInstanced"]=function(mode,count,type,indices,primcount){instancedArraysExt["drawElementsInstancedANGLE"](mode,count,type,indices,primcount)}}var vaoExt=GLctx.getExtension("OES_vertex_array_object");if(vaoExt){GLctx["createVertexArray"]=function(){return vaoExt["createVertexArrayOES"]()};GLctx["deleteVertexArray"]=function(vao){vaoExt["deleteVertexArrayOES"](vao)};GLctx["bindVertexArray"]=function(vao){vaoExt["bindVertexArrayOES"](vao)};GLctx["isVertexArray"]=function(vao){return vaoExt["isVertexArrayOES"](vao)}}var drawBuffersExt=GLctx.getExtension("WEBGL_draw_buffers");if(drawBuffersExt){GLctx["drawBuffers"]=function(n,bufs){drawBuffersExt["drawBuffersWEBGL"](n,bufs)}}}GLctx.disjointTimerQueryExt=GLctx.getExtension("EXT_disjoint_timer_query");var automaticallyEnabledExtensions=["OES_texture_float","OES_texture_half_float","OES_standard_derivatives","OES_vertex_array_object","WEBGL_compressed_texture_s3tc","WEBGL_depth_texture","OES_element_index_uint","EXT_texture_filter_anisotropic","EXT_frag_depth","WEBGL_draw_buffers","ANGLE_instanced_arrays","OES_texture_float_linear","OES_texture_half_float_linear","EXT_blend_minmax","EXT_shader_texture_lod","WEBGL_compressed_texture_pvrtc","EXT_color_buffer_half_float","WEBGL_color_buffer_float","EXT_sRGB","WEBGL_compressed_texture_etc1","EXT_disjoint_timer_query","WEBGL_compressed_texture_etc","WEBGL_compressed_texture_astc","EXT_color_buffer_float","WEBGL_compressed_texture_s3tc_srgb","EXT_disjoint_timer_query_webgl2"];var exts=GLctx.getSupportedExtensions();if(exts&&exts.length>0){GLctx.getSupportedExtensions().forEach(function(ext){if(automaticallyEnabledExtensions.indexOf(ext)!=-1){GLctx.getExtension(ext)}})}},populateUniformTable:function(program){var p=GL.programs[program];var ptable=GL.programInfos[program]={uniforms:{},maxUniformLength:0,maxAttributeLength:-1,maxUniformBlockNameLength:-1};var utable=ptable.uniforms;var numUniforms=GLctx.getProgramParameter(p,35718);for(var i=0;i<numUniforms;++i){var u=GLctx.getActiveUniform(p,i);var name=u.name;ptable.maxUniformLength=Math.max(ptable.maxUniformLength,name.length+1);if(name.slice(-1)=="]"){name=name.slice(0,name.lastIndexOf("["))}var loc=GLctx.getUniformLocation(p,name);if(loc){var id=GL.getNewId(GL.uniforms);utable[name]=[u.size,id];GL.uniforms[id]=loc;for(var j=1;j<u.size;++j){var n=name+"["+j+"]";loc=GLctx.getUniformLocation(p,n);id=GL.getNewId(GL.uniforms);GL.uniforms[id]=loc}}}}};function _emscripten_glActiveTexture(x0){GLctx["activeTexture"](x0)}function _emscripten_glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glBeginQueryEXT(target,id){GLctx.disjointTimerQueryExt["beginQueryEXT"](target,GL.timerQueriesEXT[id])}function _emscripten_glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _emscripten_glBindBuffer(target,buffer){GLctx.bindBuffer(target,GL.buffers[buffer])}function _emscripten_glBindFramebuffer(target,framebuffer){GLctx.bindFramebuffer(target,GL.framebuffers[framebuffer])}function _emscripten_glBindRenderbuffer(target,renderbuffer){GLctx.bindRenderbuffer(target,GL.renderbuffers[renderbuffer])}function _emscripten_glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _emscripten_glBindVertexArrayOES(vao){GLctx["bindVertexArray"](GL.vaos[vao])}function _emscripten_glBlendColor(x0,x1,x2,x3){GLctx["blendColor"](x0,x1,x2,x3)}function _emscripten_glBlendEquation(x0){GLctx["blendEquation"](x0)}function _emscripten_glBlendEquationSeparate(x0,x1){GLctx["blendEquationSeparate"](x0,x1)}function _emscripten_glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _emscripten_glBlendFuncSeparate(x0,x1,x2,x3){GLctx["blendFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glBufferData(target,size,data,usage){GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}function _emscripten_glBufferSubData(target,offset,size,data){GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _emscripten_glCheckFramebufferStatus(x0){return GLctx["checkFramebufferStatus"](x0)}function _emscripten_glClear(x0){GLctx["clear"](x0)}function _emscripten_glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _emscripten_glClearDepthf(x0){GLctx["clearDepth"](x0)}function _emscripten_glClearStencil(x0){GLctx["clearStencil"](x0)}function _emscripten_glColorMask(red,green,blue,alpha){GLctx.colorMask(!!red,!!green,!!blue,!!alpha)}function _emscripten_glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _emscripten_glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCompressedTexSubImage2D(target,level,xoffset,yoffset,width,height,format,imageSize,data){GLctx["compressedTexSubImage2D"](target,level,xoffset,yoffset,width,height,format,data?HEAPU8.subarray(data,data+imageSize):null)}function _emscripten_glCopyTexImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCopyTexSubImage2D(x0,x1,x2,x3,x4,x5,x6,x7){GLctx["copyTexSubImage2D"](x0,x1,x2,x3,x4,x5,x6,x7)}function _emscripten_glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;GL.programs[id]=program;return id}function _emscripten_glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _emscripten_glCullFace(x0){GLctx["cullFace"](x0)}function _emscripten_glDeleteBuffers(n,buffers){for(var i=0;i<n;i++){var id=HEAP32[buffers+i*4>>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GL.currArrayBuffer)GL.currArrayBuffer=0;if(id==GL.currElementArrayBuffer)GL.currElementArrayBuffer=0}}function _emscripten_glDeleteFramebuffers(n,framebuffers){for(var i=0;i<n;++i){var id=HEAP32[framebuffers+i*4>>2];var framebuffer=GL.framebuffers[id];if(!framebuffer)continue;GLctx.deleteFramebuffer(framebuffer);framebuffer.name=0;GL.framebuffers[id]=null}}function _emscripten_glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null;GL.programInfos[id]=null}function _emscripten_glDeleteQueriesEXT(n,ids){for(var i=0;i<n;i++){var id=HEAP32[ids+i*4>>2];var query=GL.timerQueriesEXT[id];if(!query)continue;GLctx.disjointTimerQueryExt["deleteQueryEXT"](query);GL.timerQueriesEXT[id]=null}}function _emscripten_glDeleteRenderbuffers(n,renderbuffers){for(var i=0;i<n;i++){var id=HEAP32[renderbuffers+i*4>>2];var renderbuffer=GL.renderbuffers[id];if(!renderbuffer)continue;GLctx.deleteRenderbuffer(renderbuffer);renderbuffer.name=0;GL.renderbuffers[id]=null}}function _emscripten_glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _emscripten_glDeleteTextures(n,textures){for(var i=0;i<n;i++){var id=HEAP32[textures+i*4>>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _emscripten_glDeleteVertexArraysOES(n,vaos){for(var i=0;i<n;i++){var id=HEAP32[vaos+i*4>>2];GLctx["deleteVertexArray"](GL.vaos[id]);GL.vaos[id]=null}}function _emscripten_glDepthFunc(x0){GLctx["depthFunc"](x0)}function _emscripten_glDepthMask(flag){GLctx.depthMask(!!flag)}function _emscripten_glDepthRangef(x0,x1){GLctx["depthRange"](x0,x1)}function _emscripten_glDetachShader(program,shader){GLctx.detachShader(GL.programs[program],GL.shaders[shader])}function _emscripten_glDisable(x0){GLctx["disable"](x0)}function _emscripten_glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _emscripten_glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _emscripten_glDrawArraysInstancedANGLE(mode,first,count,primcount){GLctx["drawArraysInstanced"](mode,first,count,primcount)}var __tempFixedLengthArray=[];function _emscripten_glDrawBuffersWEBGL(n,bufs){var bufArray=__tempFixedLengthArray[n];for(var i=0;i<n;i++){bufArray[i]=HEAP32[bufs+i*4>>2]}GLctx["drawBuffers"](bufArray)}function _emscripten_glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _emscripten_glDrawElementsInstancedANGLE(mode,count,type,indices,primcount){GLctx["drawElementsInstanced"](mode,count,type,indices,primcount)}function _emscripten_glEnable(x0){GLctx["enable"](x0)}function _emscripten_glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _emscripten_glEndQueryEXT(target){GLctx.disjointTimerQueryExt["endQueryEXT"](target)}function _emscripten_glFinish(){GLctx["finish"]()}function _emscripten_glFlush(){GLctx["flush"]()}function _emscripten_glFramebufferRenderbuffer(target,attachment,renderbuffertarget,renderbuffer){GLctx.framebufferRenderbuffer(target,attachment,renderbuffertarget,GL.renderbuffers[renderbuffer])}function _emscripten_glFramebufferTexture2D(target,attachment,textarget,texture,level){GLctx.framebufferTexture2D(target,attachment,textarget,GL.textures[texture],level)}function _emscripten_glFrontFace(x0){GLctx["frontFace"](x0)}function __glGenObject(n,buffers,createFunction,objectTable){for(var i=0;i<n;i++){var buffer=GLctx[createFunction]();var id=buffer&&GL.getNewId(objectTable);if(buffer){buffer.name=id;objectTable[id]=buffer}else{GL.recordError(1282)}HEAP32[buffers+i*4>>2]=id}}function _emscripten_glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _emscripten_glGenFramebuffers(n,ids){__glGenObject(n,ids,"createFramebuffer",GL.framebuffers)}function _emscripten_glGenQueriesEXT(n,ids){for(var i=0;i<n;i++){var query=GLctx.disjointTimerQueryExt["createQueryEXT"]();if(!query){GL.recordError(1282);while(i<n)HEAP32[ids+i++*4>>2]=0;return}var id=GL.getNewId(GL.timerQueriesEXT);query.name=id;GL.timerQueriesEXT[id]=query;HEAP32[ids+i*4>>2]=id}}function _emscripten_glGenRenderbuffers(n,renderbuffers){__glGenObject(n,renderbuffers,"createRenderbuffer",GL.renderbuffers)}function _emscripten_glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _emscripten_glGenVertexArraysOES(n,arrays){__glGenObject(n,arrays,"createVertexArray",GL.vaos)}function _emscripten_glGenerateMipmap(x0){GLctx["generateMipmap"](x0)}function _emscripten_glGetActiveAttrib(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx.getActiveAttrib(program,index);if(!info)return;if(bufSize>0&&name){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetActiveUniform(program,index,bufSize,length,size,type,name){program=GL.programs[program];var info=GLctx.getActiveUniform(program,index);if(!info)return;if(bufSize>0&&name){var numBytesWrittenExclNull=stringToUTF8(info.name,name,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}if(size)HEAP32[size>>2]=info.size;if(type)HEAP32[type>>2]=info.type}function _emscripten_glGetAttachedShaders(program,maxCount,count,shaders){var result=GLctx.getAttachedShaders(GL.programs[program]);var len=result.length;if(len>maxCount){len=maxCount}HEAP32[count>>2]=len;for(var i=0;i<len;++i){var id=GL.shaders.indexOf(result[i]);HEAP32[shaders+i*4>>2]=id}}function _emscripten_glGetAttribLocation(program,name){return GLctx.getAttribLocation(GL.programs[program],UTF8ToString(name))}function emscriptenWebGLGet(name_,p,type){if(!p){GL.recordError(1281);return}var ret=undefined;switch(name_){case 36346:ret=1;break;case 36344:if(type!=="Integer"&&type!=="Integer64"){GL.recordError(1280)}return;case 36345:ret=0;break;case 34466:var formats=GLctx.getParameter(34467);ret=formats?formats.length:0;break}if(ret===undefined){var result=GLctx.getParameter(name_);switch(typeof result){case"number":ret=result;break;case"boolean":ret=result?1:0;break;case"string":GL.recordError(1280);return;case"object":if(result===null){switch(name_){case 34964:case 35725:case 34965:case 36006:case 36007:case 32873:case 34229:case 34068:{ret=0;break}default:{GL.recordError(1280);return}}}else if(result instanceof Float32Array||result instanceof Uint32Array||result instanceof Int32Array||result instanceof Array){for(var i=0;i<result.length;++i){switch(type){case"Integer":HEAP32[p+i*4>>2]=result[i];break;case"Float":HEAPF32[p+i*4>>2]=result[i];break;case"Boolean":HEAP8[p+i>>0]=result[i]?1:0;break;default:throw"internal glGet error, bad type: "+type}}return}else{try{ret=result.name|0}catch(e){GL.recordError(1280);err("GL_INVALID_ENUM in glGet"+type+"v: Unknown object returned from WebGL getParameter("+name_+")! (error: "+e+")");return}}break;default:GL.recordError(1280);return}}switch(type){case"Integer64":tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[p>>2]=tempI64[0],HEAP32[p+4>>2]=tempI64[1];break;case"Integer":HEAP32[p>>2]=ret;break;case"Float":HEAPF32[p>>2]=ret;break;case"Boolean":HEAP8[p>>0]=ret?1:0;break;default:throw"internal glGet error, bad type: "+type}}function _emscripten_glGetBooleanv(name_,p){emscriptenWebGLGet(name_,p,"Boolean")}function _emscripten_glGetBufferParameteriv(target,value,data){if(!data){GL.recordError(1281);return}HEAP32[data>>2]=GLctx.getBufferParameter(target,value)}function _emscripten_glGetError(){if(GL.lastError){var error=GL.lastError;GL.lastError=0;return error}else{return GLctx.getError()}}function _emscripten_glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,"Float")}function _emscripten_glGetFramebufferAttachmentParameteriv(target,attachment,pname,params){var result=GLctx.getFramebufferAttachmentParameter(target,attachment,pname);if(result instanceof WebGLRenderbuffer||result instanceof WebGLTexture){result=result.name|0}HEAP32[params>>2]=result}function _emscripten_glGetIntegerv(name_,p){emscriptenWebGLGet(name_,p,"Integer")}function _emscripten_glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}var ptable=GL.programInfos[program];if(!ptable){GL.recordError(1282);return}if(pname==35716){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){HEAP32[p>>2]=ptable.maxUniformLength}else if(pname==35722){if(ptable.maxAttributeLength==-1){program=GL.programs[program];var numAttribs=GLctx.getProgramParameter(program,35721);ptable.maxAttributeLength=0;for(var i=0;i<numAttribs;++i){var activeAttrib=GLctx.getActiveAttrib(program,i);ptable.maxAttributeLength=Math.max(ptable.maxAttributeLength,activeAttrib.name.length+1)}}HEAP32[p>>2]=ptable.maxAttributeLength}else if(pname==35381){if(ptable.maxUniformBlockNameLength==-1){program=GL.programs[program];var numBlocks=GLctx.getProgramParameter(program,35382);ptable.maxUniformBlockNameLength=0;for(var i=0;i<numBlocks;++i){var activeBlockName=GLctx.getActiveUniformBlockName(program,i);ptable.maxUniformBlockNameLength=Math.max(ptable.maxUniformBlockNameLength,activeBlockName.length+1)}}HEAP32[p>>2]=ptable.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(GL.programs[program],pname)}}function _emscripten_glGetQueryObjecti64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[params>>2]=tempI64[0],HEAP32[params+4>>2]=tempI64[1]}function _emscripten_glGetQueryObjectivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryObjectui64vEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}tempI64=[ret>>>0,(tempDouble=ret,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[params>>2]=tempI64[0],HEAP32[params+4>>2]=tempI64[1]}function _emscripten_glGetQueryObjectuivEXT(id,pname,params){if(!params){GL.recordError(1281);return}var query=GL.timerQueriesEXT[id];var param=GLctx.disjointTimerQueryExt["getQueryObjectEXT"](query,pname);var ret;if(typeof param=="boolean"){ret=param?1:0}else{ret=param}HEAP32[params>>2]=ret}function _emscripten_glGetQueryivEXT(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.disjointTimerQueryExt["getQueryEXT"](target,pname)}function _emscripten_glGetRenderbufferParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getRenderbufferParameter(target,pname)}function _emscripten_glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetShaderPrecisionFormat(shaderType,precisionType,range,precision){var result=GLctx.getShaderPrecisionFormat(shaderType,precisionType);HEAP32[range>>2]=result.rangeMin;HEAP32[range+4>>2]=result.rangeMax;HEAP32[precision>>2]=result.precision}function _emscripten_glGetShaderSource(shader,bufSize,length,source){var result=GLctx.getShaderSource(GL.shaders[shader]);if(!result)return;if(bufSize>0&&source){var numBytesWrittenExclNull=stringToUTF8(result,source,bufSize);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _emscripten_glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source===null||source.length==0?0:source.length+1;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function stringToNewUTF8(jsString){var length=lengthBytesUTF8(jsString)+1;var cString=_malloc(length);stringToUTF8(jsString,cString,length);return cString}function _emscripten_glGetString(name_){if(GL.stringCache[name_])return GL.stringCache[name_];var ret;switch(name_){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(exts[i]);gl_exts.push("GL_"+exts[i])}ret=stringToNewUTF8(gl_exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(GLctx.VERSION);{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280);return 0}GL.stringCache[name_]=ret;return ret}function _emscripten_glGetTexParameterfv(target,pname,params){if(!params){GL.recordError(1281);return}HEAPF32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetTexParameteriv(target,pname,params){if(!params){GL.recordError(1281);return}HEAP32[params>>2]=GLctx.getTexParameter(target,pname)}function _emscripten_glGetUniformLocation(program,name){name=UTF8ToString(name);var arrayIndex=0;if(name[name.length-1]=="]"){var leftBrace=name.lastIndexOf("[");arrayIndex=name[leftBrace+1]!="]"?parseInt(name.slice(leftBrace+1)):0;name=name.slice(0,leftBrace)}var uniformInfo=GL.programInfos[program]&&GL.programInfos[program].uniforms[name];if(uniformInfo&&arrayIndex>=0&&arrayIndex<uniformInfo[0]){return uniformInfo[1]+arrayIndex}else{return-1}}function emscriptenWebGLGetUniform(program,location,params,type){if(!params){GL.recordError(1281);return}var data=GLctx.getUniform(GL.programs[program],GL.uniforms[location]);if(typeof data=="number"||typeof data=="boolean"){switch(type){case"Integer":HEAP32[params>>2]=data;break;case"Float":HEAPF32[params>>2]=data;break;default:throw"internal emscriptenWebGLGetUniform() error, bad type: "+type}}else{for(var i=0;i<data.length;i++){switch(type){case"Integer":HEAP32[params+i*4>>2]=data[i];break;case"Float":HEAPF32[params+i*4>>2]=data[i];break;default:throw"internal emscriptenWebGLGetUniform() error, bad type: "+type}}}}function _emscripten_glGetUniformfv(program,location,params){emscriptenWebGLGetUniform(program,location,params,"Float")}function _emscripten_glGetUniformiv(program,location,params){emscriptenWebGLGetUniform(program,location,params,"Integer")}function _emscripten_glGetVertexAttribPointerv(index,pname,pointer){if(!pointer){GL.recordError(1281);return}HEAP32[pointer>>2]=GLctx.getVertexAttribOffset(index,pname)}function emscriptenWebGLGetVertexAttrib(index,pname,params,type){if(!params){GL.recordError(1281);return}var data=GLctx.getVertexAttrib(index,pname);if(pname==34975){HEAP32[params>>2]=data["name"]}else if(typeof data=="number"||typeof data=="boolean"){switch(type){case"Integer":HEAP32[params>>2]=data;break;case"Float":HEAPF32[params>>2]=data;break;case"FloatToInteger":HEAP32[params>>2]=Math.fround(data);break;default:throw"internal emscriptenWebGLGetVertexAttrib() error, bad type: "+type}}else{for(var i=0;i<data.length;i++){switch(type){case"Integer":HEAP32[params+i*4>>2]=data[i];break;case"Float":HEAPF32[params+i*4>>2]=data[i];break;case"FloatToInteger":HEAP32[params+i*4>>2]=Math.fround(data[i]);break;default:throw"internal emscriptenWebGLGetVertexAttrib() error, bad type: "+type}}}}function _emscripten_glGetVertexAttribfv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"Float")}function _emscripten_glGetVertexAttribiv(index,pname,params){emscriptenWebGLGetVertexAttrib(index,pname,params,"FloatToInteger")}function _emscripten_glHint(x0,x1){GLctx["hint"](x0,x1)}function _emscripten_glIsBuffer(buffer){var b=GL.buffers[buffer];if(!b)return 0;return GLctx.isBuffer(b)}function _emscripten_glIsEnabled(x0){return GLctx["isEnabled"](x0)}function _emscripten_glIsFramebuffer(framebuffer){var fb=GL.framebuffers[framebuffer];if(!fb)return 0;return GLctx.isFramebuffer(fb)}function _emscripten_glIsProgram(program){program=GL.programs[program];if(!program)return 0;return GLctx.isProgram(program)}function _emscripten_glIsQueryEXT(id){var query=GL.timerQueriesEXT[id];if(!query)return 0;return GLctx.disjointTimerQueryExt["isQueryEXT"](query)}function _emscripten_glIsRenderbuffer(renderbuffer){var rb=GL.renderbuffers[renderbuffer];if(!rb)return 0;return GLctx.isRenderbuffer(rb)}function _emscripten_glIsShader(shader){var s=GL.shaders[shader];if(!s)return 0;return GLctx.isShader(s)}function _emscripten_glIsTexture(id){var texture=GL.textures[id];if(!texture)return 0;return GLctx.isTexture(texture)}function _emscripten_glIsVertexArrayOES(array){var vao=GL.vaos[array];if(!vao)return 0;return GLctx["isVertexArray"](vao)}function _emscripten_glLineWidth(x0){GLctx["lineWidth"](x0)}function _emscripten_glLinkProgram(program){GLctx.linkProgram(GL.programs[program]);GL.populateUniformTable(program)}function _emscripten_glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _emscripten_glPolygonOffset(x0,x1){GLctx["polygonOffset"](x0,x1)}function _emscripten_glQueryCounterEXT(id,target){GLctx.disjointTimerQueryExt["queryCounterEXT"](GL.timerQueriesEXT[id],target)}function __computeUnpackAlignedImageSize(width,height,sizePerPixel,alignment){function roundedToNextMultipleOf(x,y){return x+y-1&-y}var plainRowSize=width*sizePerPixel;var alignedRowSize=roundedToNextMultipleOf(plainRowSize,alignment);return height*alignedRowSize}var __colorChannelsInGlTextureFormat={6402:1,6406:1,6407:3,6408:4,6409:1,6410:2,35904:3,35906:4};var __sizeOfGlTextureElementType={5121:1,5123:2,5125:4,5126:4,32819:2,32820:2,33635:2,34042:4,36193:2};function emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat){var sizePerPixel=__colorChannelsInGlTextureFormat[format]*__sizeOfGlTextureElementType[type];if(!sizePerPixel){GL.recordError(1280);return}var bytes=__computeUnpackAlignedImageSize(width,height,sizePerPixel,GL.unpackAlignment);var end=pixels+bytes;switch(type){case 5121:return HEAPU8.subarray(pixels,end);case 5126:return HEAPF32.subarray(pixels>>2,end>>2);case 5125:case 34042:return HEAPU32.subarray(pixels>>2,end>>2);case 5123:case 33635:case 32819:case 32820:case 36193:return HEAPU16.subarray(pixels>>1,end>>1);default:GL.recordError(1280)}}function _emscripten_glReadPixels(x,y,width,height,format,type,pixels){var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _emscripten_glReleaseShaderCompiler(){}function _emscripten_glRenderbufferStorage(x0,x1,x2,x3){GLctx["renderbufferStorage"](x0,x1,x2,x3)}function _emscripten_glSampleCoverage(value,invert){GLctx.sampleCoverage(value,!!invert)}function _emscripten_glScissor(x0,x1,x2,x3){GLctx["scissor"](x0,x1,x2,x3)}function _emscripten_glShaderBinary(){GL.recordError(1280)}function _emscripten_glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _emscripten_glStencilFunc(x0,x1,x2){GLctx["stencilFunc"](x0,x1,x2)}function _emscripten_glStencilFuncSeparate(x0,x1,x2,x3){GLctx["stencilFuncSeparate"](x0,x1,x2,x3)}function _emscripten_glStencilMask(x0){GLctx["stencilMask"](x0)}function _emscripten_glStencilMaskSeparate(x0,x1){GLctx["stencilMaskSeparate"](x0,x1)}function _emscripten_glStencilOp(x0,x1,x2){GLctx["stencilOp"](x0,x1,x2)}function _emscripten_glStencilOpSeparate(x0,x1,x2,x3){GLctx["stencilOpSeparate"](x0,x1,x2,x3)}function _emscripten_glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _emscripten_glTexParameterf(x0,x1,x2){GLctx["texParameterf"](x0,x1,x2)}function _emscripten_glTexParameterfv(target,pname,params){var param=HEAPF32[params>>2];GLctx.texParameterf(target,pname,param)}function _emscripten_glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _emscripten_glTexParameteriv(target,pname,params){var param=HEAP32[params>>2];GLctx.texParameteri(target,pname,param)}function _emscripten_glTexSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixels){var pixelData=null;if(pixels)pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,0);GLctx.texSubImage2D(target,level,xoffset,yoffset,width,height,format,type,pixelData)}function _emscripten_glUniform1f(location,v0){GLctx.uniform1f(GL.uniforms[location],v0)}function _emscripten_glUniform1fv(location,count,value){if(count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[count-1];for(var i=0;i<count;++i){view[i]=HEAPF32[value+4*i>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*4>>2)}GLctx.uniform1fv(GL.uniforms[location],view)}function _emscripten_glUniform1i(location,v0){GLctx.uniform1i(GL.uniforms[location],v0)}function _emscripten_glUniform1iv(location,count,value){GLctx.uniform1iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*4>>2))}function _emscripten_glUniform2f(location,v0,v1){GLctx.uniform2f(GL.uniforms[location],v0,v1)}function _emscripten_glUniform2fv(location,count,value){if(2*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[2*count-1];for(var i=0;i<2*count;i+=2){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*8>>2)}GLctx.uniform2fv(GL.uniforms[location],view)}function _emscripten_glUniform2i(location,v0,v1){GLctx.uniform2i(GL.uniforms[location],v0,v1)}function _emscripten_glUniform2iv(location,count,value){GLctx.uniform2iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*8>>2))}function _emscripten_glUniform3f(location,v0,v1,v2){GLctx.uniform3f(GL.uniforms[location],v0,v1,v2)}function _emscripten_glUniform3fv(location,count,value){if(3*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[3*count-1];for(var i=0;i<3*count;i+=3){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*12>>2)}GLctx.uniform3fv(GL.uniforms[location],view)}function _emscripten_glUniform3i(location,v0,v1,v2){GLctx.uniform3i(GL.uniforms[location],v0,v1,v2)}function _emscripten_glUniform3iv(location,count,value){GLctx.uniform3iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*12>>2))}function _emscripten_glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(GL.uniforms[location],v0,v1,v2,v3)}function _emscripten_glUniform4fv(location,count,value){if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniform4fv(GL.uniforms[location],view)}function _emscripten_glUniform4i(location,v0,v1,v2,v3){GLctx.uniform4i(GL.uniforms[location],v0,v1,v2,v3)}function _emscripten_glUniform4iv(location,count,value){GLctx.uniform4iv(GL.uniforms[location],HEAP32.subarray(value>>2,value+count*16>>2))}function _emscripten_glUniformMatrix2fv(location,count,transpose,value){if(4*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[4*count-1];for(var i=0;i<4*count;i+=4){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*16>>2)}GLctx.uniformMatrix2fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUniformMatrix3fv(location,count,transpose,value){if(9*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[9*count-1];for(var i=0;i<9*count;i+=9){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*36>>2)}GLctx.uniformMatrix3fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUniformMatrix4fv(location,count,transpose,value){if(16*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[16*count-1];for(var i=0;i<16*count;i+=16){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2];view[i+9]=HEAPF32[value+(4*i+36)>>2];view[i+10]=HEAPF32[value+(4*i+40)>>2];view[i+11]=HEAPF32[value+(4*i+44)>>2];view[i+12]=HEAPF32[value+(4*i+48)>>2];view[i+13]=HEAPF32[value+(4*i+52)>>2];view[i+14]=HEAPF32[value+(4*i+56)>>2];view[i+15]=HEAPF32[value+(4*i+60)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,view)}function _emscripten_glUseProgram(program){GLctx.useProgram(GL.programs[program])}function _emscripten_glValidateProgram(program){GLctx.validateProgram(GL.programs[program])}function _emscripten_glVertexAttrib1f(x0,x1){GLctx["vertexAttrib1f"](x0,x1)}function _emscripten_glVertexAttrib1fv(index,v){GLctx.vertexAttrib1f(index,HEAPF32[v>>2])}function _emscripten_glVertexAttrib2f(x0,x1,x2){GLctx["vertexAttrib2f"](x0,x1,x2)}function _emscripten_glVertexAttrib2fv(index,v){GLctx.vertexAttrib2f(index,HEAPF32[v>>2],HEAPF32[v+4>>2])}function _emscripten_glVertexAttrib3f(x0,x1,x2,x3){GLctx["vertexAttrib3f"](x0,x1,x2,x3)}function _emscripten_glVertexAttrib3fv(index,v){GLctx.vertexAttrib3f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2])}function _emscripten_glVertexAttrib4f(x0,x1,x2,x3,x4){GLctx["vertexAttrib4f"](x0,x1,x2,x3,x4)}function _emscripten_glVertexAttrib4fv(index,v){GLctx.vertexAttrib4f(index,HEAPF32[v>>2],HEAPF32[v+4>>2],HEAPF32[v+8>>2],HEAPF32[v+12>>2])}function _emscripten_glVertexAttribDivisorANGLE(index,divisor){GLctx["vertexAttribDivisor"](index,divisor)}function _emscripten_glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _emscripten_glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}var __specialEventTargets=[0,typeof document!=="undefined"?document:0,typeof window!=="undefined"?window:0];function __findEventTarget(target){try{if(!target)return window;if(typeof target==="number")target=__specialEventTargets[target]||UTF8ToString(target);if(target==="#window")return window;else if(target==="#document")return document;else if(target==="#screen")return screen;else if(target==="#canvas")return Module["canvas"];return typeof target==="string"?document.getElementById(target):target}catch(e){return null}}function _emscripten_request_pointerlock(target,deferUntilInEventHandler){if(!target)target="#canvas";target=__findEventTarget(target);if(!target)return-4;if(!target.requestPointerLock&&!target.mozRequestPointerLock&&!target.webkitRequestPointerLock&&!target.msRequestPointerLock){return-1}var canPerformRequests=JSEvents.canPerformEventHandlerRequests();if(!canPerformRequests){if(deferUntilInEventHandler){JSEvents.deferCall(__requestPointerLock,2,[target]);return 1}else{return-2}}return __requestPointerLock(target)}function abortOnCannotGrowMemory(requestedSize){abort("OOM")}function _emscripten_resize_heap(requestedSize){abortOnCannotGrowMemory(requestedSize)}function _emscripten_run_script(ptr){eval(UTF8ToString(ptr))}function _emscripten_sample_gamepad_data(){return(JSEvents.lastGamepadState=navigator.getGamepads?navigator.getGamepads():navigator.webkitGetGamepads?navigator.webkitGetGamepads():null)?0:-1}function __fillMouseEventData(eventStruct,e,target){HEAPF64[eventStruct>>3]=JSEvents.tick();HEAP32[eventStruct+8>>2]=e.screenX;HEAP32[eventStruct+12>>2]=e.screenY;HEAP32[eventStruct+16>>2]=e.clientX;HEAP32[eventStruct+20>>2]=e.clientY;HEAP32[eventStruct+24>>2]=e.ctrlKey;HEAP32[eventStruct+28>>2]=e.shiftKey;HEAP32[eventStruct+32>>2]=e.altKey;HEAP32[eventStruct+36>>2]=e.metaKey;HEAP16[eventStruct+40>>1]=e.button;HEAP16[eventStruct+42>>1]=e.buttons;HEAP32[eventStruct+44>>2]=e["movementX"]||e["mozMovementX"]||e["webkitMovementX"]||e.screenX-JSEvents.previousScreenX;HEAP32[eventStruct+48>>2]=e["movementY"]||e["mozMovementY"]||e["webkitMovementY"]||e.screenY-JSEvents.previousScreenY;if(Module["canvas"]){var rect=Module["canvas"].getBoundingClientRect();HEAP32[eventStruct+60>>2]=e.clientX-rect.left;HEAP32[eventStruct+64>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+60>>2]=0;HEAP32[eventStruct+64>>2]=0}if(target){var rect=JSEvents.getBoundingClientRectOrZeros(target);HEAP32[eventStruct+52>>2]=e.clientX-rect.left;HEAP32[eventStruct+56>>2]=e.clientY-rect.top}else{HEAP32[eventStruct+52>>2]=0;HEAP32[eventStruct+56>>2]=0}if(e.type!=="wheel"&&e.type!=="mousewheel"){JSEvents.previousScreenX=e.screenX;JSEvents.previousScreenY=e.screenY}}function __registerMouseEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.mouseEvent)JSEvents.mouseEvent=_malloc(72);target=__findEventTarget(target);var mouseEventHandlerFunc=function(event){var e=event||window.event;__fillMouseEventData(JSEvents.mouseEvent,e,target);if(dynCall_iiii(callbackfunc,eventTypeId,JSEvents.mouseEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:eventTypeString!="mousemove"&&eventTypeString!="mouseenter"&&eventTypeString!="mouseleave",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:mouseEventHandlerFunc,useCapture:useCapture};if(JSEvents.isInternetExplorer()&&eventTypeString=="mousedown")eventHandler.allowsDeferredCalls=false;JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_click_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerMouseEventCallback(target,userData,useCapture,callbackfunc,4,"click",targetThread);return 0}function __fillFullscreenChangeEventData(eventStruct,e){var fullscreenElement=document.fullscreenElement||document.mozFullScreenElement||document.webkitFullscreenElement||document.msFullscreenElement;var isFullscreen=!!fullscreenElement;HEAP32[eventStruct>>2]=isFullscreen;HEAP32[eventStruct+4>>2]=JSEvents.fullscreenEnabled();var reportedElement=isFullscreen?fullscreenElement:JSEvents.previousFullscreenElement;var nodeName=JSEvents.getNodeNameForTarget(reportedElement);var id=reportedElement&&reportedElement.id?reportedElement.id:"";stringToUTF8(nodeName,eventStruct+8,128);stringToUTF8(id,eventStruct+136,128);HEAP32[eventStruct+264>>2]=reportedElement?reportedElement.clientWidth:0;HEAP32[eventStruct+268>>2]=reportedElement?reportedElement.clientHeight:0;HEAP32[eventStruct+272>>2]=screen.width;HEAP32[eventStruct+276>>2]=screen.height;if(isFullscreen){JSEvents.previousFullscreenElement=fullscreenElement}}function __registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.fullscreenChangeEvent)JSEvents.fullscreenChangeEvent=_malloc(280);var fullscreenChangeEventhandlerFunc=function(event){var e=event||window.event;var fullscreenChangeEvent=JSEvents.fullscreenChangeEvent;__fillFullscreenChangeEventData(fullscreenChangeEvent,e);if(dynCall_iiii(callbackfunc,eventTypeId,fullscreenChangeEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:false,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:fullscreenChangeEventhandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_fullscreenchange_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){if(typeof JSEvents.fullscreenEnabled()==="undefined")return-1;target=target?__findEventTarget(target):__specialEventTargets[1];if(!target)return-4;__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"fullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"mozfullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"webkitfullscreenchange",targetThread);__registerFullscreenChangeEventCallback(target,userData,useCapture,callbackfunc,19,"msfullscreenchange",targetThread);return 0}function __registerGamepadEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.gamepadEvent)JSEvents.gamepadEvent=_malloc(1432);var gamepadEventHandlerFunc=function(event){var e=event||window.event;var gamepadEvent=JSEvents.gamepadEvent;__fillGamepadEventData(gamepadEvent,e.gamepad);if(dynCall_iiii(callbackfunc,eventTypeId,gamepadEvent,userData))e.preventDefault()};var eventHandler={target:__findEventTarget(target),allowsDeferredCalls:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:gamepadEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_gamepadconnected_callback_on_thread(userData,useCapture,callbackfunc,targetThread){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;__registerGamepadEventCallback(2,userData,useCapture,callbackfunc,26,"gamepadconnected",targetThread);return 0}function _emscripten_set_gamepaddisconnected_callback_on_thread(userData,useCapture,callbackfunc,targetThread){if(!navigator.getGamepads&&!navigator.webkitGetGamepads)return-1;__registerGamepadEventCallback(2,userData,useCapture,callbackfunc,27,"gamepaddisconnected",targetThread);return 0}function __registerKeyEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.keyEvent)JSEvents.keyEvent=_malloc(164);var keyEventHandlerFunc=function(event){var e=event||window.event;var keyEventData=JSEvents.keyEvent;stringToUTF8(e.key?e.key:"",keyEventData+0,32);stringToUTF8(e.code?e.code:"",keyEventData+32,32);HEAP32[keyEventData+64>>2]=e.location;HEAP32[keyEventData+68>>2]=e.ctrlKey;HEAP32[keyEventData+72>>2]=e.shiftKey;HEAP32[keyEventData+76>>2]=e.altKey;HEAP32[keyEventData+80>>2]=e.metaKey;HEAP32[keyEventData+84>>2]=e.repeat;stringToUTF8(e.locale?e.locale:"",keyEventData+88,32);stringToUTF8(e.char?e.char:"",keyEventData+120,32);HEAP32[keyEventData+152>>2]=e.charCode;HEAP32[keyEventData+156>>2]=e.keyCode;HEAP32[keyEventData+160>>2]=e.which;if(dynCall_iiii(callbackfunc,eventTypeId,keyEventData,userData))e.preventDefault()};var eventHandler={target:__findEventTarget(target),allowsDeferredCalls:JSEvents.isInternetExplorer()?false:true,eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:keyEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_keypress_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerKeyEventCallback(target,userData,useCapture,callbackfunc,1,"keypress",targetThread);return 0}function __registerTouchEventCallback(target,userData,useCapture,callbackfunc,eventTypeId,eventTypeString,targetThread){if(!JSEvents.touchEvent)JSEvents.touchEvent=_malloc(1684);target=__findEventTarget(target);var touchEventHandlerFunc=function(event){var e=event||window.event;var touches={};for(var i=0;i<e.touches.length;++i){var touch=e.touches[i];touches[touch.identifier]=touch}for(var i=0;i<e.changedTouches.length;++i){var touch=e.changedTouches[i];touches[touch.identifier]=touch;touch.changed=true}for(var i=0;i<e.targetTouches.length;++i){var touch=e.targetTouches[i];touches[touch.identifier].onTarget=true}var touchEvent=JSEvents.touchEvent;var ptr=touchEvent;HEAP32[ptr+4>>2]=e.ctrlKey;HEAP32[ptr+8>>2]=e.shiftKey;HEAP32[ptr+12>>2]=e.altKey;HEAP32[ptr+16>>2]=e.metaKey;ptr+=20;var canvasRect=Module["canvas"]?Module["canvas"].getBoundingClientRect():undefined;var targetRect=JSEvents.getBoundingClientRectOrZeros(target);var numTouches=0;for(var i in touches){var t=touches[i];HEAP32[ptr>>2]=t.identifier;HEAP32[ptr+4>>2]=t.screenX;HEAP32[ptr+8>>2]=t.screenY;HEAP32[ptr+12>>2]=t.clientX;HEAP32[ptr+16>>2]=t.clientY;HEAP32[ptr+20>>2]=t.pageX;HEAP32[ptr+24>>2]=t.pageY;HEAP32[ptr+28>>2]=t.changed;HEAP32[ptr+32>>2]=t.onTarget;if(canvasRect){HEAP32[ptr+44>>2]=t.clientX-canvasRect.left;HEAP32[ptr+48>>2]=t.clientY-canvasRect.top}else{HEAP32[ptr+44>>2]=0;HEAP32[ptr+48>>2]=0}HEAP32[ptr+36>>2]=t.clientX-targetRect.left;HEAP32[ptr+40>>2]=t.clientY-targetRect.top;ptr+=52;if(++numTouches>=32){break}}HEAP32[touchEvent>>2]=numTouches;if(dynCall_iiii(callbackfunc,eventTypeId,touchEvent,userData))e.preventDefault()};var eventHandler={target:target,allowsDeferredCalls:eventTypeString=="touchstart"||eventTypeString=="touchend",eventTypeString:eventTypeString,callbackfunc:callbackfunc,handlerFunc:touchEventHandlerFunc,useCapture:useCapture};JSEvents.registerOrRemoveHandler(eventHandler)}function _emscripten_set_touchcancel_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,25,"touchcancel",targetThread);return 0}function _emscripten_set_touchend_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,23,"touchend",targetThread);return 0}function _emscripten_set_touchmove_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,24,"touchmove",targetThread);return 0}function _emscripten_set_touchstart_callback_on_thread(target,userData,useCapture,callbackfunc,targetThread){__registerTouchEventCallback(target,userData,useCapture,callbackfunc,22,"touchstart",targetThread);return 0}function _exit(status){exit(status)}function _glActiveTexture(x0){GLctx["activeTexture"](x0)}function _glAttachShader(program,shader){GLctx.attachShader(GL.programs[program],GL.shaders[shader])}function _glBindAttribLocation(program,index,name){GLctx.bindAttribLocation(GL.programs[program],index,UTF8ToString(name))}function _glBindBuffer(target,buffer){GLctx.bindBuffer(target,GL.buffers[buffer])}function _glBindTexture(target,texture){GLctx.bindTexture(target,GL.textures[texture])}function _glBlendFunc(x0,x1){GLctx["blendFunc"](x0,x1)}function _glBufferData(target,size,data,usage){GLctx.bufferData(target,data?HEAPU8.subarray(data,data+size):size,usage)}function _glBufferSubData(target,offset,size,data){GLctx.bufferSubData(target,offset,HEAPU8.subarray(data,data+size))}function _glClear(x0){GLctx["clear"](x0)}function _glClearColor(x0,x1,x2,x3){GLctx["clearColor"](x0,x1,x2,x3)}function _glClearDepthf(x0){GLctx["clearDepth"](x0)}function _glCompileShader(shader){GLctx.compileShader(GL.shaders[shader])}function _glCompressedTexImage2D(target,level,internalFormat,width,height,border,imageSize,data){GLctx["compressedTexImage2D"](target,level,internalFormat,width,height,border,data?HEAPU8.subarray(data,data+imageSize):null)}function _glCreateProgram(){var id=GL.getNewId(GL.programs);var program=GLctx.createProgram();program.name=id;GL.programs[id]=program;return id}function _glCreateShader(shaderType){var id=GL.getNewId(GL.shaders);GL.shaders[id]=GLctx.createShader(shaderType);return id}function _glCullFace(x0){GLctx["cullFace"](x0)}function _glDeleteBuffers(n,buffers){for(var i=0;i<n;i++){var id=HEAP32[buffers+i*4>>2];var buffer=GL.buffers[id];if(!buffer)continue;GLctx.deleteBuffer(buffer);buffer.name=0;GL.buffers[id]=null;if(id==GL.currArrayBuffer)GL.currArrayBuffer=0;if(id==GL.currElementArrayBuffer)GL.currElementArrayBuffer=0}}function _glDeleteProgram(id){if(!id)return;var program=GL.programs[id];if(!program){GL.recordError(1281);return}GLctx.deleteProgram(program);program.name=0;GL.programs[id]=null;GL.programInfos[id]=null}function _glDeleteShader(id){if(!id)return;var shader=GL.shaders[id];if(!shader){GL.recordError(1281);return}GLctx.deleteShader(shader);GL.shaders[id]=null}function _glDeleteTextures(n,textures){for(var i=0;i<n;i++){var id=HEAP32[textures+i*4>>2];var texture=GL.textures[id];if(!texture)continue;GLctx.deleteTexture(texture);texture.name=0;GL.textures[id]=null}}function _glDepthFunc(x0){GLctx["depthFunc"](x0)}function _glDetachShader(program,shader){GLctx.detachShader(GL.programs[program],GL.shaders[shader])}function _glDisable(x0){GLctx["disable"](x0)}function _glDisableVertexAttribArray(index){GLctx.disableVertexAttribArray(index)}function _glDrawArrays(mode,first,count){GLctx.drawArrays(mode,first,count)}function _glDrawElements(mode,count,type,indices){GLctx.drawElements(mode,count,type,indices)}function _glEnable(x0){GLctx["enable"](x0)}function _glEnableVertexAttribArray(index){GLctx.enableVertexAttribArray(index)}function _glFrontFace(x0){GLctx["frontFace"](x0)}function _glGenBuffers(n,buffers){__glGenObject(n,buffers,"createBuffer",GL.buffers)}function _glGenTextures(n,textures){__glGenObject(n,textures,"createTexture",GL.textures)}function _glGetAttribLocation(program,name){return GLctx.getAttribLocation(GL.programs[program],UTF8ToString(name))}function _glGetFloatv(name_,p){emscriptenWebGLGet(name_,p,"Float")}function _glGetProgramInfoLog(program,maxLength,length,infoLog){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _glGetProgramiv(program,pname,p){if(!p){GL.recordError(1281);return}if(program>=GL.counter){GL.recordError(1281);return}var ptable=GL.programInfos[program];if(!ptable){GL.recordError(1282);return}if(pname==35716){var log=GLctx.getProgramInfoLog(GL.programs[program]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35719){HEAP32[p>>2]=ptable.maxUniformLength}else if(pname==35722){if(ptable.maxAttributeLength==-1){program=GL.programs[program];var numAttribs=GLctx.getProgramParameter(program,35721);ptable.maxAttributeLength=0;for(var i=0;i<numAttribs;++i){var activeAttrib=GLctx.getActiveAttrib(program,i);ptable.maxAttributeLength=Math.max(ptable.maxAttributeLength,activeAttrib.name.length+1)}}HEAP32[p>>2]=ptable.maxAttributeLength}else if(pname==35381){if(ptable.maxUniformBlockNameLength==-1){program=GL.programs[program];var numBlocks=GLctx.getProgramParameter(program,35382);ptable.maxUniformBlockNameLength=0;for(var i=0;i<numBlocks;++i){var activeBlockName=GLctx.getActiveUniformBlockName(program,i);ptable.maxUniformBlockNameLength=Math.max(ptable.maxUniformBlockNameLength,activeBlockName.length+1)}}HEAP32[p>>2]=ptable.maxUniformBlockNameLength}else{HEAP32[p>>2]=GLctx.getProgramParameter(GL.programs[program],pname)}}function _glGetShaderInfoLog(shader,maxLength,length,infoLog){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";if(maxLength>0&&infoLog){var numBytesWrittenExclNull=stringToUTF8(log,infoLog,maxLength);if(length)HEAP32[length>>2]=numBytesWrittenExclNull}else{if(length)HEAP32[length>>2]=0}}function _glGetShaderiv(shader,pname,p){if(!p){GL.recordError(1281);return}if(pname==35716){var log=GLctx.getShaderInfoLog(GL.shaders[shader]);if(log===null)log="(unknown error)";HEAP32[p>>2]=log.length+1}else if(pname==35720){var source=GLctx.getShaderSource(GL.shaders[shader]);var sourceLength=source===null||source.length==0?0:source.length+1;HEAP32[p>>2]=sourceLength}else{HEAP32[p>>2]=GLctx.getShaderParameter(GL.shaders[shader],pname)}}function _glGetString(name_){if(GL.stringCache[name_])return GL.stringCache[name_];var ret;switch(name_){case 7939:var exts=GLctx.getSupportedExtensions();var gl_exts=[];for(var i=0;i<exts.length;++i){gl_exts.push(exts[i]);gl_exts.push("GL_"+exts[i])}ret=stringToNewUTF8(gl_exts.join(" "));break;case 7936:case 7937:case 37445:case 37446:var s=GLctx.getParameter(name_);if(!s){GL.recordError(1280)}ret=stringToNewUTF8(s);break;case 7938:var glVersion=GLctx.getParameter(GLctx.VERSION);{glVersion="OpenGL ES 2.0 ("+glVersion+")"}ret=stringToNewUTF8(glVersion);break;case 35724:var glslVersion=GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);var ver_re=/^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;var ver_num=glslVersion.match(ver_re);if(ver_num!==null){if(ver_num[1].length==3)ver_num[1]=ver_num[1]+"0";glslVersion="OpenGL ES GLSL ES "+ver_num[1]+" ("+glslVersion+")"}ret=stringToNewUTF8(glslVersion);break;default:GL.recordError(1280);return 0}GL.stringCache[name_]=ret;return ret}function _glGetUniformLocation(program,name){name=UTF8ToString(name);var arrayIndex=0;if(name[name.length-1]=="]"){var leftBrace=name.lastIndexOf("[");arrayIndex=name[leftBrace+1]!="]"?parseInt(name.slice(leftBrace+1)):0;name=name.slice(0,leftBrace)}var uniformInfo=GL.programInfos[program]&&GL.programInfos[program].uniforms[name];if(uniformInfo&&arrayIndex>=0&&arrayIndex<uniformInfo[0]){return uniformInfo[1]+arrayIndex}else{return-1}}function _glLinkProgram(program){GLctx.linkProgram(GL.programs[program]);GL.populateUniformTable(program)}function _glPixelStorei(pname,param){if(pname==3317){GL.unpackAlignment=param}GLctx.pixelStorei(pname,param)}function _glReadPixels(x,y,width,height,format,type,pixels){var pixelData=emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,format);if(!pixelData){GL.recordError(1280);return}GLctx.readPixels(x,y,width,height,format,type,pixelData)}function _glShaderSource(shader,count,string,length){var source=GL.getSource(shader,count,string,length);GLctx.shaderSource(GL.shaders[shader],source)}function _glTexImage2D(target,level,internalFormat,width,height,border,format,type,pixels){GLctx.texImage2D(target,level,internalFormat,width,height,border,format,type,pixels?emscriptenWebGLGetTexPixelData(type,format,width,height,pixels,internalFormat):null)}function _glTexParameteri(x0,x1,x2){GLctx["texParameteri"](x0,x1,x2)}function _glUniform1i(location,v0){GLctx.uniform1i(GL.uniforms[location],v0)}function _glUniform4f(location,v0,v1,v2,v3){GLctx.uniform4f(GL.uniforms[location],v0,v1,v2,v3)}function _glUniformMatrix4fv(location,count,transpose,value){if(16*count<=GL.MINI_TEMP_BUFFER_SIZE){var view=GL.miniTempBufferViews[16*count-1];for(var i=0;i<16*count;i+=16){view[i]=HEAPF32[value+4*i>>2];view[i+1]=HEAPF32[value+(4*i+4)>>2];view[i+2]=HEAPF32[value+(4*i+8)>>2];view[i+3]=HEAPF32[value+(4*i+12)>>2];view[i+4]=HEAPF32[value+(4*i+16)>>2];view[i+5]=HEAPF32[value+(4*i+20)>>2];view[i+6]=HEAPF32[value+(4*i+24)>>2];view[i+7]=HEAPF32[value+(4*i+28)>>2];view[i+8]=HEAPF32[value+(4*i+32)>>2];view[i+9]=HEAPF32[value+(4*i+36)>>2];view[i+10]=HEAPF32[value+(4*i+40)>>2];view[i+11]=HEAPF32[value+(4*i+44)>>2];view[i+12]=HEAPF32[value+(4*i+48)>>2];view[i+13]=HEAPF32[value+(4*i+52)>>2];view[i+14]=HEAPF32[value+(4*i+56)>>2];view[i+15]=HEAPF32[value+(4*i+60)>>2]}}else{var view=HEAPF32.subarray(value>>2,value+count*64>>2)}GLctx.uniformMatrix4fv(GL.uniforms[location],!!transpose,view)}function _glUseProgram(program){GLctx.useProgram(GL.programs[program])}function _glVertexAttribPointer(index,size,type,normalized,stride,ptr){GLctx.vertexAttribPointer(index,size,type,!!normalized,stride,ptr)}function _glViewport(x0,x1,x2,x3){GLctx["viewport"](x0,x1,x2,x3)}var GLFW={Window:function(id,width,height,title,monitor,share){this.id=id;this.x=0;this.y=0;this.fullscreen=false;this.storedX=0;this.storedY=0;this.width=width;this.height=height;this.storedWidth=width;this.storedHeight=height;this.title=title;this.monitor=monitor;this.share=share;this.attributes=GLFW.hints;this.inputModes={208897:212993,208898:0,208899:0};this.buttons=0;this.keys=new Array;this.domKeys=new Array;this.shouldClose=0;this.title=null;this.windowPosFunc=null;this.windowSizeFunc=null;this.windowCloseFunc=null;this.windowRefreshFunc=null;this.windowFocusFunc=null;this.windowIconifyFunc=null;this.framebufferSizeFunc=null;this.mouseButtonFunc=null;this.cursorPosFunc=null;this.cursorEnterFunc=null;this.scrollFunc=null;this.dropFunc=null;this.keyFunc=null;this.charFunc=null;this.userptr=null},WindowFromId:function(id){if(id<=0||!GLFW.windows)return null;return GLFW.windows[id-1]},joystickFunc:null,errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function(keycode){switch(keycode){case 32:return 32;case 222:return 39;case 188:return 44;case 173:return 45;case 189:return 45;case 190:return 46;case 191:return 47;case 48:return 48;case 49:return 49;case 50:return 50;case 51:return 51;case 52:return 52;case 53:return 53;case 54:return 54;case 55:return 55;case 56:return 56;case 57:return 57;case 59:return 59;case 61:return 61;case 187:return 61;case 65:return 65;case 66:return 66;case 67:return 67;case 68:return 68;case 69:return 69;case 70:return 70;case 71:return 71;case 72:return 72;case 73:return 73;case 74:return 74;case 75:return 75;case 76:return 76;case 77:return 77;case 78:return 78;case 79:return 79;case 80:return 80;case 81:return 81;case 82:return 82;case 83:return 83;case 84:return 84;case 85:return 85;case 86:return 86;case 87:return 87;case 88:return 88;case 89:return 89;case 90:return 90;case 219:return 91;case 220:return 92;case 221:return 93;case 192:return 94;case 27:return 256;case 13:return 257;case 9:return 258;case 8:return 259;case 45:return 260;case 46:return 261;case 39:return 262;case 37:return 263;case 40:return 264;case 38:return 265;case 33:return 266;case 34:return 267;case 36:return 268;case 35:return 269;case 20:return 280;case 145:return 281;case 144:return 282;case 44:return 283;case 19:return 284;case 112:return 290;case 113:return 291;case 114:return 292;case 115:return 293;case 116:return 294;case 117:return 295;case 118:return 296;case 119:return 297;case 120:return 298;case 121:return 299;case 122:return 300;case 123:return 301;case 124:return 302;case 125:return 303;case 126:return 304;case 127:return 305;case 128:return 306;case 129:return 307;case 130:return 308;case 131:return 309;case 132:return 310;case 133:return 311;case 134:return 312;case 135:return 313;case 136:return 314;case 96:return 320;case 97:return 321;case 98:return 322;case 99:return 323;case 100:return 324;case 101:return 325;case 102:return 326;case 103:return 327;case 104:return 328;case 105:return 329;case 110:return 330;case 111:return 331;case 106:return 332;case 109:return 333;case 107:return 334;case 16:return 340;case 17:return 341;case 18:return 342;case 91:return 343;case 93:return 348;default:return-1}},getModBits:function(win){var mod=0;if(win.keys[340])mod|=1;if(win.keys[341])mod|=2;if(win.keys[342])mod|=4;if(win.keys[343])mod|=8;return mod},onKeyPress:function(event){if(!GLFW.active||!GLFW.active.charFunc)return;if(event.ctrlKey||event.metaKey)return;var charCode=event.charCode;if(charCode==0||charCode>=0&&charCode<=31)return;dynCall_vii(GLFW.active.charFunc,GLFW.active.id,charCode)},onKeyChanged:function(keyCode,status){if(!GLFW.active)return;var key=GLFW.DOMToGLFWKeyCode(keyCode);if(key==-1)return;var repeat=status&&GLFW.active.keys[key];GLFW.active.keys[key]=status;GLFW.active.domKeys[keyCode]=status;if(!GLFW.active.keyFunc)return;if(repeat)status=2;dynCall_viiiii(GLFW.active.keyFunc,GLFW.active.id,key,keyCode,status,GLFW.getModBits(GLFW.active))},onGamepadConnected:function(event){GLFW.refreshJoysticks()},onGamepadDisconnected:function(event){GLFW.refreshJoysticks()},onKeydown:function(event){GLFW.onKeyChanged(event.keyCode,1);if(event.keyCode===8||event.keyCode===9){event.preventDefault()}},onKeyup:function(event){GLFW.onKeyChanged(event.keyCode,0)},onBlur:function(event){if(!GLFW.active)return;for(var i=0;i<GLFW.active.domKeys.length;++i){if(GLFW.active.domKeys[i]){GLFW.onKeyChanged(i,0)}}},onMousemove:function(event){if(!GLFW.active)return;Browser.calculateMouseEvent(event);if(event.target!=Module["canvas"]||!GLFW.active.cursorPosFunc)return;dynCall_vidd(GLFW.active.cursorPosFunc,GLFW.active.id,Browser.mouseX,Browser.mouseY)},DOMToGLFWMouseButton:function(event){var eventButton=event["button"];if(eventButton>0){if(eventButton==1){eventButton=2}else{eventButton=1}}return eventButton},onMouseenter:function(event){if(!GLFW.active)return;if(event.target!=Module["canvas"]||!GLFW.active.cursorEnterFunc)return;dynCall_vii(GLFW.active.cursorEnterFunc,GLFW.active.id,1)},onMouseleave:function(event){if(!GLFW.active)return;if(event.target!=Module["canvas"]||!GLFW.active.cursorEnterFunc)return;dynCall_vii(GLFW.active.cursorEnterFunc,GLFW.active.id,0)},onMouseButtonChanged:function(event,status){if(!GLFW.active)return;Browser.calculateMouseEvent(event);if(event.target!=Module["canvas"])return;var eventButton=GLFW.DOMToGLFWMouseButton(event);if(status==1){GLFW.active.buttons|=1<<eventButton;try{event.target.setCapture()}catch(e){}}else{GLFW.active.buttons&=~(1<<eventButton)}if(!GLFW.active.mouseButtonFunc)return;dynCall_viiii(GLFW.active.mouseButtonFunc,GLFW.active.id,eventButton,status,GLFW.getModBits(GLFW.active))},onMouseButtonDown:function(event){if(!GLFW.active)return;GLFW.onMouseButtonChanged(event,1)},onMouseButtonUp:function(event){if(!GLFW.active)return;GLFW.onMouseButtonChanged(event,0)},onMouseWheel:function(event){var delta=-Browser.getMouseWheelDelta(event);delta=delta==0?0:delta>0?Math.max(delta,1):Math.min(delta,-1);GLFW.wheelPos+=delta;if(!GLFW.active||!GLFW.active.scrollFunc||event.target!=Module["canvas"])return;var sx=0;var sy=0;if(event.type=="mousewheel"){sx=event.wheelDeltaX;sy=event.wheelDeltaY}else{sx=event.deltaX;sy=event.deltaY}dynCall_vidd(GLFW.active.scrollFunc,GLFW.active.id,sx,sy);event.preventDefault()},onCanvasResize:function(width,height){if(!GLFW.active)return;var resizeNeeded=true;if(document["fullscreen"]||document["fullScreen"]||document["mozFullScreen"]||document["webkitIsFullScreen"]){GLFW.active.storedX=GLFW.active.x;GLFW.active.storedY=GLFW.active.y;GLFW.active.storedWidth=GLFW.active.width;GLFW.active.storedHeight=GLFW.active.height;GLFW.active.x=GLFW.active.y=0;GLFW.active.width=screen.width;GLFW.active.height=screen.height;GLFW.active.fullscreen=true}else if(GLFW.active.fullscreen==true){GLFW.active.x=GLFW.active.storedX;GLFW.active.y=GLFW.active.storedY;GLFW.active.width=GLFW.active.storedWidth;GLFW.active.height=GLFW.active.storedHeight;GLFW.active.fullscreen=false}else if(GLFW.active.width!=width||GLFW.active.height!=height){GLFW.active.width=width;GLFW.active.height=height}else{resizeNeeded=false}if(resizeNeeded){Browser.setCanvasSize(GLFW.active.width,GLFW.active.height,true);GLFW.onWindowSizeChanged();GLFW.onFramebufferSizeChanged()}},onWindowSizeChanged:function(){if(!GLFW.active)return;if(!GLFW.active.windowSizeFunc)return;dynCall_viii(GLFW.active.windowSizeFunc,GLFW.active.id,GLFW.active.width,GLFW.active.height)},onFramebufferSizeChanged:function(){if(!GLFW.active)return;if(!GLFW.active.framebufferSizeFunc)return;dynCall_viii(GLFW.active.framebufferSizeFunc,GLFW.active.id,GLFW.active.width,GLFW.active.height)},requestFullscreen:function(){var RFS=Module["canvas"]["requestFullscreen"]||Module["canvas"]["mozRequestFullScreen"]||Module["canvas"]["webkitRequestFullScreen"]||function(){};RFS.apply(Module["canvas"],[])},requestFullScreen:function(){err("GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.");GLFW.requestFullScreen=function(){return GLFW.requestFullscreen()};return GLFW.requestFullscreen()},exitFullscreen:function(){Browser.exitFullscreen()},cancelFullScreen:function(){err("GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.");GLFW.cancelFullScreen=function(){return GLFW.exitFullscreen()};return GLFW.exitFullscreen()},getTime:function(){return _emscripten_get_now()/1e3},setWindowTitle:function(winid,title){var win=GLFW.WindowFromId(winid);if(!win)return;win.title=UTF8ToString(title);if(GLFW.active.id==win.id){document.title=win.title}},setJoystickCallback:function(cbfun){GLFW.joystickFunc=cbfun;GLFW.refreshJoysticks()},joys:{},lastGamepadState:null,lastGamepadStateFrame:null,refreshJoysticks:function(){if(Browser.mainLoop.currentFrameNumber!==GLFW.lastGamepadStateFrame||!Browser.mainLoop.currentFrameNumber){GLFW.lastGamepadState=navigator.getGamepads?navigator.getGamepads():navigator.webkitGetGamepads?navigator.webkitGetGamepads:null;GLFW.lastGamepadStateFrame=Browser.mainLoop.currentFrameNumber;for(var joy=0;joy<GLFW.lastGamepadState.length;++joy){var gamepad=GLFW.lastGamepadState[joy];if(gamepad){if(!GLFW.joys[joy]){console.log("glfw joystick connected:",joy);GLFW.joys[joy]={id:allocate(intArrayFromString(gamepad.id),"i8",ALLOC_NORMAL),buttonsCount:gamepad.buttons.length,axesCount:gamepad.axes.length,buttons:allocate(new Array(gamepad.buttons.length),"i8",ALLOC_NORMAL),axes:allocate(new Array(gamepad.axes.length*4),"float",ALLOC_NORMAL)};if(GLFW.joystickFunc){dynCall_vii(GLFW.joystickFunc,joy,262145)}}var data=GLFW.joys[joy];for(var i=0;i<gamepad.buttons.length;++i){setValue(data.buttons+i,gamepad.buttons[i].pressed,"i8")}for(var i=0;i<gamepad.axes.length;++i){setValue(data.axes+i*4,gamepad.axes[i],"float")}}else{if(GLFW.joys[joy]){console.log("glfw joystick disconnected",joy);if(GLFW.joystickFunc){dynCall_vii(GLFW.joystickFunc,joy,262146)}_free(GLFW.joys[joy].id);_free(GLFW.joys[joy].buttons);_free(GLFW.joys[joy].axes);delete GLFW.joys[joy]}}}}},setKeyCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.keyFunc=cbfun},setCharCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.charFunc=cbfun},setMouseButtonCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.mouseButtonFunc=cbfun},setCursorPosCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.cursorPosFunc=cbfun},setScrollCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.scrollFunc=cbfun},setDropCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.dropFunc=cbfun},onDrop:function(event){if(!GLFW.active||!GLFW.active.dropFunc)return;if(!event.dataTransfer||!event.dataTransfer.files||event.dataTransfer.files.length==0)return;event.preventDefault();return false},onDragover:function(event){if(!GLFW.active||!GLFW.active.dropFunc)return;event.preventDefault();return false},setWindowSizeCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.windowSizeFunc=cbfun},setWindowCloseCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.windowCloseFunc=cbfun},setWindowRefreshCallback:function(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.windowRefreshFunc=cbfun},onClickRequestPointerLock:function(e){if(!Browser.pointerLock&&Module["canvas"].requestPointerLock){Module["canvas"].requestPointerLock();e.preventDefault()}},setInputMode:function(winid,mode,value){var win=GLFW.WindowFromId(winid);if(!win)return;switch(mode){case 208897:{switch(value){case 212993:{win.inputModes[mode]=value;Module["canvas"].removeEventListener("click",GLFW.onClickRequestPointerLock,true);Module["canvas"].exitPointerLock();break}case 212994:{console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");break}case 212995:{win.inputModes[mode]=value;Module["canvas"].addEventListener("click",GLFW.onClickRequestPointerLock,true);Module["canvas"].requestPointerLock();break}default:{console.log("glfwSetInputMode called with unknown value parameter value: "+value+".");break}}break}case 208898:{console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");break}case 208899:{console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");break}default:{console.log("glfwSetInputMode called with unknown mode parameter value: "+mode+".");break}}},getKey:function(winid,key){var win=GLFW.WindowFromId(winid);if(!win)return 0;return win.keys[key]},getMouseButton:function(winid,button){var win=GLFW.WindowFromId(winid);if(!win)return 0;return(win.buttons&1<<button)>0},getCursorPos:function(winid,x,y){setValue(x,Browser.mouseX,"double");setValue(y,Browser.mouseY,"double")},getMousePos:function(winid,x,y){setValue(x,Browser.mouseX,"i32");setValue(y,Browser.mouseY,"i32")},setCursorPos:function(winid,x,y){},getWindowPos:function(winid,x,y){var wx=0;var wy=0;var win=GLFW.WindowFromId(winid);if(win){wx=win.x;wy=win.y}setValue(x,wx,"i32");setValue(y,wy,"i32")},setWindowPos:function(winid,x,y){var win=GLFW.WindowFromId(winid);if(!win)return;win.x=x;win.y=y},getWindowSize:function(winid,width,height){var ww=0;var wh=0;var win=GLFW.WindowFromId(winid);if(win){ww=win.width;wh=win.height}setValue(width,ww,"i32");setValue(height,wh,"i32")},setWindowSize:function(winid,width,height){var win=GLFW.WindowFromId(winid);if(!win)return;if(GLFW.active.id==win.id){if(width==screen.width&&height==screen.height){GLFW.requestFullscreen()}else{GLFW.exitFullscreen();Browser.setCanvasSize(width,height);win.width=width;win.height=height}}if(!win.windowSizeFunc)return;dynCall_viii(win.windowSizeFunc,win.id,width,height)},createWindow:function(width,height,title,monitor,share){var i,id;for(i=0;i<GLFW.windows.length&&GLFW.windows[i]!==null;i++);if(i>0)throw"glfwCreateWindow only supports one window at time currently";id=i+1;if(width<=0||height<=0)return 0;if(monitor){GLFW.requestFullscreen()}else{Browser.setCanvasSize(width,height)}for(i=0;i<GLFW.windows.length&&GLFW.windows[i]==null;i++);if(i==GLFW.windows.length){var contextAttributes={antialias:GLFW.hints[135181]>1,depth:GLFW.hints[135173]>0,stencil:GLFW.hints[135174]>0,alpha:GLFW.hints[135172]>0};Module.ctx=Browser.createContext(Module["canvas"],true,true,contextAttributes)}if(!Module.ctx)return 0;var win=new GLFW.Window(id,width,height,title,monitor,share);if(id-1==GLFW.windows.length){GLFW.windows.push(win)}else{GLFW.windows[id-1]=win}GLFW.active=win;return win.id},destroyWindow:function(winid){var win=GLFW.WindowFromId(winid);if(!win)return;if(win.windowCloseFunc)dynCall_vi(win.windowCloseFunc,win.id);GLFW.windows[win.id-1]=null;if(GLFW.active.id==win.id)GLFW.active=null;for(var i=0;i<GLFW.windows.length;i++)if(GLFW.windows[i]!==null)return;Module.ctx=Browser.destroyContext(Module["canvas"],true,true)},swapBuffers:function(winid){},GLFW2ParamToGLFW3Param:function(param){var table={196609:0,196610:0,196611:0,196612:0,196613:0,196614:0,131073:0,131074:0,131075:0,131076:0,131077:135169,131078:135170,131079:135171,131080:135172,131081:135173,131082:135174,131083:135183,131084:135175,131085:135176,131086:135177,131087:135178,131088:135179,131089:135180,131090:0,131091:135181,131092:139266,131093:139267,131094:139270,131095:139271,131096:139272};return table[param]}};function _glfwCreateWindow(width,height,title,monitor,share){return GLFW.createWindow(width,height,title,monitor,share)}function _glfwDefaultWindowHints(){GLFW.hints=GLFW.defaultHints}function _glfwDestroyWindow(winid){return GLFW.destroyWindow(winid)}function _glfwGetCursorPos(winid,x,y){GLFW.getCursorPos(winid,x,y)}function _glfwGetTime(){return GLFW.getTime()-GLFW.initialTime}function _glfwInit(){if(GLFW.windows)return 1;GLFW.initialTime=GLFW.getTime();GLFW.hints=GLFW.defaultHints;GLFW.windows=new Array;GLFW.active=null;window.addEventListener("gamepadconnected",GLFW.onGamepadConnected,true);window.addEventListener("gamepaddisconnected",GLFW.onGamepadDisconnected,true);window.addEventListener("keydown",GLFW.onKeydown,true);window.addEventListener("keypress",GLFW.onKeyPress,true);window.addEventListener("keyup",GLFW.onKeyup,true);window.addEventListener("blur",GLFW.onBlur,true);Module["canvas"].addEventListener("mousemove",GLFW.onMousemove,true);Module["canvas"].addEventListener("mousedown",GLFW.onMouseButtonDown,true);Module["canvas"].addEventListener("mouseup",GLFW.onMouseButtonUp,true);Module["canvas"].addEventListener("wheel",GLFW.onMouseWheel,true);Module["canvas"].addEventListener("mousewheel",GLFW.onMouseWheel,true);Module["canvas"].addEventListener("mouseenter",GLFW.onMouseenter,true);Module["canvas"].addEventListener("mouseleave",GLFW.onMouseleave,true);Module["canvas"].addEventListener("drop",GLFW.onDrop,true);Module["canvas"].addEventListener("dragover",GLFW.onDragover,true);Browser.resizeListeners.push(function(width,height){GLFW.onCanvasResize(width,height)});return 1}function _glfwMakeContextCurrent(winid){}function _glfwSetCharCallback(winid,cbfun){GLFW.setCharCallback(winid,cbfun)}function _glfwSetCursorEnterCallback(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.cursorEnterFunc=cbfun}function _glfwSetCursorPosCallback(winid,cbfun){GLFW.setCursorPosCallback(winid,cbfun)}function _glfwSetDropCallback(winid,cbfun){GLFW.setDropCallback(winid,cbfun)}function _glfwSetErrorCallback(cbfun){GLFW.errorFunc=cbfun}function _glfwSetKeyCallback(winid,cbfun){GLFW.setKeyCallback(winid,cbfun)}function _glfwSetMouseButtonCallback(winid,cbfun){GLFW.setMouseButtonCallback(winid,cbfun)}function _glfwSetScrollCallback(winid,cbfun){GLFW.setScrollCallback(winid,cbfun)}function _glfwSetWindowIconifyCallback(winid,cbfun){var win=GLFW.WindowFromId(winid);if(!win)return;win.windowIconifyFunc=cbfun}function _glfwSetWindowShouldClose(winid,value){var win=GLFW.WindowFromId(winid);if(!win)return;win.shouldClose=value}function _glfwSetWindowSizeCallback(winid,cbfun){GLFW.setWindowSizeCallback(winid,cbfun)}function _glfwSwapBuffers(winid){GLFW.swapBuffers(winid)}function _glfwTerminate(){window.removeEventListener("gamepadconnected",GLFW.onGamepadConnected,true);window.removeEventListener("gamepaddisconnected",GLFW.onGamepadDisconnected,true);window.removeEventListener("keydown",GLFW.onKeydown,true);window.removeEventListener("keypress",GLFW.onKeyPress,true);window.removeEventListener("keyup",GLFW.onKeyup,true);window.removeEventListener("blur",GLFW.onBlur,true);Module["canvas"].removeEventListener("mousemove",GLFW.onMousemove,true);Module["canvas"].removeEventListener("mousedown",GLFW.onMouseButtonDown,true);Module["canvas"].removeEventListener("mouseup",GLFW.onMouseButtonUp,true);Module["canvas"].removeEventListener("wheel",GLFW.onMouseWheel,true);Module["canvas"].removeEventListener("mousewheel",GLFW.onMouseWheel,true);Module["canvas"].removeEventListener("mouseenter",GLFW.onMouseenter,true);Module["canvas"].removeEventListener("mouseleave",GLFW.onMouseleave,true);Module["canvas"].removeEventListener("drop",GLFW.onDrop,true);Module["canvas"].removeEventListener("dragover",GLFW.onDragover,true);Module["canvas"].width=Module["canvas"].height=1;GLFW.windows=null;GLFW.active=null}function _glfwWindowHint(target,hint){GLFW.hints[target]=hint}function _llvm_exp2_f32(x){return Math.pow(2,x)}function _llvm_stackrestore(p){var self=_llvm_stacksave;var ret=self.LLVM_SAVEDSTACKS[p];self.LLVM_SAVEDSTACKS.splice(p,1);stackRestore(ret)}function _llvm_stacksave(){var self=_llvm_stacksave;if(!self.LLVM_SAVEDSTACKS){self.LLVM_SAVEDSTACKS=[]}self.LLVM_SAVEDSTACKS.push(stackSave());return self.LLVM_SAVEDSTACKS.length-1}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest)}function _usleep(useconds){var msec=useconds/1e3;if((ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&self["performance"]&&self["performance"]["now"]){var start=self["performance"]["now"]();while(self["performance"]["now"]()-start<msec){}}else{var start=Date.now();while(Date.now()-start<msec){}}return 0}function _nanosleep(rqtp,rmtp){var seconds=HEAP32[rqtp>>2];var nanoseconds=HEAP32[rqtp+4>>2];if(rmtp!==0){HEAP32[rmtp>>2]=0;HEAP32[rmtp+4>>2]=0}return _usleep(seconds*1e6+nanoseconds/1e3)}function _pthread_attr_destroy(attr){return 0}function _pthread_attr_init(attr){return 0}function _pthread_cond_destroy(){return 0}function _pthread_cond_init(){return 0}function _pthread_cond_signal(){return 0}function _pthread_cond_wait(){return 0}function _pthread_create(){return 11}function _pthread_join(){}function _time(ptr){var ret=Date.now()/1e3|0;if(ptr){HEAP32[ptr>>2]=ret}return ret}FS.staticInit();Module["FS_createFolder"]=FS.createFolder;Module["FS_createPath"]=FS.createPath;Module["FS_createDataFile"]=FS.createDataFile;Module["FS_createPreloadedFile"]=FS.createPreloadedFile;Module["FS_createLazyFile"]=FS.createLazyFile;Module["FS_createLink"]=FS.createLink;Module["FS_createDevice"]=FS.createDevice;Module["FS_unlink"]=FS.unlink;if(ENVIRONMENT_IS_NODE){var fs=require("fs");var NODEJS_PATH=require("path");NODEFS.staticInit()}Module["requestFullScreen"]=function Module_requestFullScreen(lockPointer,resizeCanvas,vrDevice){err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead.");Module["requestFullScreen"]=Module["requestFullscreen"];Browser.requestFullScreen(lockPointer,resizeCanvas,vrDevice)};Module["requestFullscreen"]=function Module_requestFullscreen(lockPointer,resizeCanvas,vrDevice){Browser.requestFullscreen(lockPointer,resizeCanvas,vrDevice)};Module["requestAnimationFrame"]=function Module_requestAnimationFrame(func){Browser.requestAnimationFrame(func)};Module["setCanvasSize"]=function Module_setCanvasSize(width,height,noUpdates){Browser.setCanvasSize(width,height,noUpdates)};Module["pauseMainLoop"]=function Module_pauseMainLoop(){Browser.mainLoop.pause()};Module["resumeMainLoop"]=function Module_resumeMainLoop(){Browser.mainLoop.resume()};Module["getUserMedia"]=function Module_getUserMedia(){Browser.getUserMedia()};Module["createContext"]=function Module_createContext(canvas,useWebGL,setInModule,webGLContextAttributes){return Browser.createContext(canvas,useWebGL,setInModule,webGLContextAttributes)};if(ENVIRONMENT_IS_NODE){_emscripten_get_now=function _emscripten_get_now_actual(){var t=process["hrtime"]();return t[0]*1e3+t[1]/1e6}}else if(typeof dateNow!=="undefined"){_emscripten_get_now=dateNow}else if(typeof performance==="object"&&performance&&typeof performance["now"]==="function"){_emscripten_get_now=function(){return performance["now"]()}}else{_emscripten_get_now=Date.now}var GLctx;GL.init();for(var i=0;i<32;i++)__tempFixedLengthArray.push(new Array(i));function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}var asmGlobalArg={};var asmLibraryArg={"c":abort,"b":___assert_fail,"uc":___lock,"A":___setErrNo,"$a":___syscall140,"Qa":___syscall145,"z":___syscall146,"m":___syscall221,"la":___syscall5,"y":___syscall54,"S":___syscall6,"x":___unlock,"w":_eglGetProcAddress,"e":_emscripten_asm_const_ii,"Cd":_emscripten_asm_const_iii,"rd":_emscripten_asm_const_iiiiii,"R":_emscripten_exit_pointerlock,"Yc":_emscripten_get_gamepad_status,"Nc":_emscripten_get_heap_size,"Dc":_emscripten_get_num_gamepads,"N":_emscripten_get_pointerlock_status,"qc":_emscripten_glActiveTexture,"kc":_emscripten_glAttachShader,"ec":_emscripten_glBeginQueryEXT,"Zb":_emscripten_glBindAttribLocation,"Rb":_emscripten_glBindBuffer,"Hb":_emscripten_glBindFramebuffer,"yb":_emscripten_glBindRenderbuffer,"pb":_emscripten_glBindTexture,"kb":_emscripten_glBindVertexArrayOES,"jb":_emscripten_glBlendColor,"ib":_emscripten_glBlendEquation,"hb":_emscripten_glBlendEquationSeparate,"gb":_emscripten_glBlendFunc,"fb":_emscripten_glBlendFuncSeparate,"eb":_emscripten_glBufferData,"db":_emscripten_glBufferSubData,"cb":_emscripten_glCheckFramebufferStatus,"bb":_emscripten_glClear,"ab":_emscripten_glClearColor,"_a":_emscripten_glClearDepthf,"Za":_emscripten_glClearStencil,"Ya":_emscripten_glColorMask,"Xa":_emscripten_glCompileShader,"Wa":_emscripten_glCompressedTexImage2D,"Va":_emscripten_glCompressedTexSubImage2D,"Ua":_emscripten_glCopyTexImage2D,"Ta":_emscripten_glCopyTexSubImage2D,"Sa":_emscripten_glCreateProgram,"Ra":_emscripten_glCreateShader,"Pa":_emscripten_glCullFace,"Oa":_emscripten_glDeleteBuffers,"Na":_emscripten_glDeleteFramebuffers,"Ma":_emscripten_glDeleteProgram,"La":_emscripten_glDeleteQueriesEXT,"Ka":_emscripten_glDeleteRenderbuffers,"Ja":_emscripten_glDeleteShader,"Ia":_emscripten_glDeleteTextures,"Ha":_emscripten_glDeleteVertexArraysOES,"Ga":_emscripten_glDepthFunc,"Fa":_emscripten_glDepthMask,"Ea":_emscripten_glDepthRangef,"Da":_emscripten_glDetachShader,"Ca":_emscripten_glDisable,"Ba":_emscripten_glDisableVertexAttribArray,"Aa":_emscripten_glDrawArrays,"za":_emscripten_glDrawArraysInstancedANGLE,"ya":_emscripten_glDrawBuffersWEBGL,"xa":_emscripten_glDrawElements,"wa":_emscripten_glDrawElementsInstancedANGLE,"va":_emscripten_glEnable,"ua":_emscripten_glEnableVertexAttribArray,"ta":_emscripten_glEndQueryEXT,"sa":_emscripten_glFinish,"ra":_emscripten_glFlush,"qa":_emscripten_glFramebufferRenderbuffer,"pa":_emscripten_glFramebufferTexture2D,"oa":_emscripten_glFrontFace,"na":_emscripten_glGenBuffers,"ma":_emscripten_glGenFramebuffers,"ka":_emscripten_glGenQueriesEXT,"ja":_emscripten_glGenRenderbuffers,"ia":_emscripten_glGenTextures,"ha":_emscripten_glGenVertexArraysOES,"ga":_emscripten_glGenerateMipmap,"fa":_emscripten_glGetActiveAttrib,"ea":_emscripten_glGetActiveUniform,"da":_emscripten_glGetAttachedShaders,"ca":_emscripten_glGetAttribLocation,"ba":_emscripten_glGetBooleanv,"aa":_emscripten_glGetBufferParameteriv,"$":_emscripten_glGetError,"_":_emscripten_glGetFloatv,"Z":_emscripten_glGetFramebufferAttachmentParameteriv,"Y":_emscripten_glGetIntegerv,"X":_emscripten_glGetProgramInfoLog,"W":_emscripten_glGetProgramiv,"V":_emscripten_glGetQueryObjecti64vEXT,"U":_emscripten_glGetQueryObjectivEXT,"T":_emscripten_glGetQueryObjectui64vEXT,"oe":_emscripten_glGetQueryObjectuivEXT,"ne":_emscripten_glGetQueryivEXT,"me":_emscripten_glGetRenderbufferParameteriv,"le":_emscripten_glGetShaderInfoLog,"ke":_emscripten_glGetShaderPrecisionFormat,"je":_emscripten_glGetShaderSource,"ie":_emscripten_glGetShaderiv,"he":_emscripten_glGetString,"ge":_emscripten_glGetTexParameterfv,"fe":_emscripten_glGetTexParameteriv,"ee":_emscripten_glGetUniformLocation,"de":_emscripten_glGetUniformfv,"ce":_emscripten_glGetUniformiv,"be":_emscripten_glGetVertexAttribPointerv,"ae":_emscripten_glGetVertexAttribfv,"$d":_emscripten_glGetVertexAttribiv,"_d":_emscripten_glHint,"Zd":_emscripten_glIsBuffer,"Yd":_emscripten_glIsEnabled,"Xd":_emscripten_glIsFramebuffer,"Wd":_emscripten_glIsProgram,"Vd":_emscripten_glIsQueryEXT,"Ud":_emscripten_glIsRenderbuffer,"Td":_emscripten_glIsShader,"Sd":_emscripten_glIsTexture,"Rd":_emscripten_glIsVertexArrayOES,"Qd":_emscripten_glLineWidth,"Pd":_emscripten_glLinkProgram,"Od":_emscripten_glPixelStorei,"Nd":_emscripten_glPolygonOffset,"Md":_emscripten_glQueryCounterEXT,"Ld":_emscripten_glReadPixels,"Kd":_emscripten_glReleaseShaderCompiler,"Jd":_emscripten_glRenderbufferStorage,"Id":_emscripten_glSampleCoverage,"Hd":_emscripten_glScissor,"Gd":_emscripten_glShaderBinary,"Fd":_emscripten_glShaderSource,"Ed":_emscripten_glStencilFunc,"Dd":_emscripten_glStencilFuncSeparate,"Bd":_emscripten_glStencilMask,"Ad":_emscripten_glStencilMaskSeparate,"zd":_emscripten_glStencilOp,"yd":_emscripten_glStencilOpSeparate,"xd":_emscripten_glTexImage2D,"wd":_emscripten_glTexParameterf,"vd":_emscripten_glTexParameterfv,"ud":_emscripten_glTexParameteri,"td":_emscripten_glTexParameteriv,"sd":_emscripten_glTexSubImage2D,"qd":_emscripten_glUniform1f,"pd":_emscripten_glUniform1fv,"od":_emscripten_glUniform1i,"nd":_emscripten_glUniform1iv,"md":_emscripten_glUniform2f,"ld":_emscripten_glUniform2fv,"kd":_emscripten_glUniform2i,"jd":_emscripten_glUniform2iv,"id":_emscripten_glUniform3f,"hd":_emscripten_glUniform3fv,"gd":_emscripten_glUniform3i,"fd":_emscripten_glUniform3iv,"ed":_emscripten_glUniform4f,"dd":_emscripten_glUniform4fv,"cd":_emscripten_glUniform4i,"bd":_emscripten_glUniform4iv,"ad":_emscripten_glUniformMatrix2fv,"$c":_emscripten_glUniformMatrix3fv,"_c":_emscripten_glUniformMatrix4fv,"Zc":_emscripten_glUseProgram,"Xc":_emscripten_glValidateProgram,"Wc":_emscripten_glVertexAttrib1f,"Vc":_emscripten_glVertexAttrib1fv,"Uc":_emscripten_glVertexAttrib2f,"Tc":_emscripten_glVertexAttrib2fv,"Sc":_emscripten_glVertexAttrib3f,"Rc":_emscripten_glVertexAttrib3fv,"Qc":_emscripten_glVertexAttrib4f,"Pc":_emscripten_glVertexAttrib4fv,"Oc":_emscripten_glVertexAttribDivisorANGLE,"Mc":_emscripten_glVertexAttribPointer,"Lc":_emscripten_glViewport,"Kc":_emscripten_memcpy_big,"Jc":_emscripten_request_pointerlock,"Ic":_emscripten_resize_heap,"Q":_emscripten_run_script,"Hc":_emscripten_sample_gamepad_data,"Gc":_emscripten_set_click_callback_on_thread,"Fc":_emscripten_set_fullscreenchange_callback_on_thread,"Ec":_emscripten_set_gamepadconnected_callback_on_thread,"Cc":_emscripten_set_gamepaddisconnected_callback_on_thread,"Bc":_emscripten_set_keypress_callback_on_thread,"Ac":_emscripten_set_main_loop,"zc":_emscripten_set_touchcancel_callback_on_thread,"yc":_emscripten_set_touchend_callback_on_thread,"xc":_emscripten_set_touchmove_callback_on_thread,"wc":_emscripten_set_touchstart_callback_on_thread,"P":_exit,"vc":_glActiveTexture,"O":_glAttachShader,"j":_glBindAttribLocation,"d":_glBindBuffer,"l":_glBindTexture,"tc":_glBlendFunc,"r":_glBufferData,"v":_glBufferSubData,"M":_glClear,"L":_glClearColor,"sc":_glClearDepthf,"rc":_glCompileShader,"pc":_glCompressedTexImage2D,"oc":_glCreateProgram,"nc":_glCreateShader,"mc":_glCullFace,"q":_glDeleteBuffers,"K":_glDeleteProgram,"J":_glDeleteShader,"I":_glDeleteTextures,"lc":_glDepthFunc,"H":_glDetachShader,"jc":_glDisable,"p":_glDisableVertexAttribArray,"ic":_glDrawArrays,"hc":_glDrawElements,"G":_glEnable,"i":_glEnableVertexAttribArray,"gc":_glFrontFace,"o":_glGenBuffers,"fc":_glGenTextures,"u":_glGetAttribLocation,"dc":_glGetFloatv,"cc":_glGetProgramInfoLog,"F":_glGetProgramiv,"bc":_glGetShaderInfoLog,"E":_glGetShaderiv,"k":_glGetString,"t":_glGetUniformLocation,"ac":_glLinkProgram,"$b":_glPixelStorei,"_b":_glReadPixels,"Yb":_glShaderSource,"Xb":_glTexImage2D,"h":_glTexParameteri,"Wb":_glUniform1i,"Vb":_glUniform4f,"Ub":_glUniformMatrix4fv,"s":_glUseProgram,"g":_glVertexAttribPointer,"Tb":_glViewport,"Sb":_glfwCreateWindow,"Qb":_glfwDefaultWindowHints,"Pb":_glfwDestroyWindow,"Ob":_glfwGetCursorPos,"n":_glfwGetTime,"Nb":_glfwInit,"Mb":_glfwMakeContextCurrent,"Lb":_glfwSetCharCallback,"Kb":_glfwSetCursorEnterCallback,"Jb":_glfwSetCursorPosCallback,"Ib":_glfwSetDropCallback,"Gb":_glfwSetErrorCallback,"Fb":_glfwSetKeyCallback,"Eb":_glfwSetMouseButtonCallback,"Db":_glfwSetScrollCallback,"Cb":_glfwSetWindowIconifyCallback,"Bb":_glfwSetWindowShouldClose,"Ab":_glfwSetWindowSizeCallback,"zb":_glfwSwapBuffers,"D":_glfwTerminate,"f":_glfwWindowHint,"xb":_llvm_exp2_f32,"C":_llvm_stackrestore,"B":_llvm_stacksave,"wb":_nanosleep,"vb":_pthread_attr_destroy,"ub":_pthread_attr_init,"tb":_pthread_cond_destroy,"sb":_pthread_cond_init,"rb":_pthread_cond_signal,"qb":_pthread_cond_wait,"ob":_pthread_create,"nb":_pthread_join,"mb":_time,"lb":abortOnCannotGrowMemory,"a":DYNAMICTOP_PTR};var asm=Module["asm"](asmGlobalArg,asmLibraryArg,buffer);Module["asm"]=asm;var ___errno_location=Module["___errno_location"]=function(){return Module["asm"]["pe"].apply(null,arguments)};var _emscripten_GetProcAddress=Module["_emscripten_GetProcAddress"]=function(){return Module["asm"]["qe"].apply(null,arguments)};var _free=Module["_free"]=function(){return Module["asm"]["re"].apply(null,arguments)};var _ma_device_process_pcm_frames_capture__webaudio=Module["_ma_device_process_pcm_frames_capture__webaudio"]=function(){return Module["asm"]["se"].apply(null,arguments)};var _ma_device_process_pcm_frames_playback__webaudio=Module["_ma_device_process_pcm_frames_playback__webaudio"]=function(){return Module["asm"]["te"].apply(null,arguments)};var _main=Module["_main"]=function(){return Module["asm"]["ue"].apply(null,arguments)};var _malloc=Module["_malloc"]=function(){return Module["asm"]["ve"].apply(null,arguments)};var stackAlloc=Module["stackAlloc"]=function(){return Module["asm"]["Ee"].apply(null,arguments)};var stackRestore=Module["stackRestore"]=function(){return Module["asm"]["Fe"].apply(null,arguments)};var stackSave=Module["stackSave"]=function(){return Module["asm"]["Ge"].apply(null,arguments)};var dynCall_iiii=Module["dynCall_iiii"]=function(){return Module["asm"]["we"].apply(null,arguments)};var dynCall_v=Module["dynCall_v"]=function(){return Module["asm"]["xe"].apply(null,arguments)};var dynCall_vi=Module["dynCall_vi"]=function(){return Module["asm"]["ye"].apply(null,arguments)};var dynCall_vidd=Module["dynCall_vidd"]=function(){return Module["asm"]["ze"].apply(null,arguments)};var dynCall_vii=Module["dynCall_vii"]=function(){return Module["asm"]["Ae"].apply(null,arguments)};var dynCall_viii=Module["dynCall_viii"]=function(){return Module["asm"]["Be"].apply(null,arguments)};var dynCall_viiii=Module["dynCall_viiii"]=function(){return Module["asm"]["Ce"].apply(null,arguments)};var dynCall_viiiii=Module["dynCall_viiiii"]=function(){return Module["asm"]["De"].apply(null,arguments)};Module["asm"]=asm;Module["getMemory"]=getMemory;Module["addRunDependency"]=addRunDependency;Module["removeRunDependency"]=removeRunDependency;Module["FS_createFolder"]=FS.createFolder;Module["FS_createPath"]=FS.createPath;Module["FS_createDataFile"]=FS.createDataFile;Module["FS_createPreloadedFile"]=FS.createPreloadedFile;Module["FS_createLazyFile"]=FS.createLazyFile;Module["FS_createLink"]=FS.createLink;Module["FS_createDevice"]=FS.createDevice;Module["FS_unlink"]=FS.unlink;function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}ExitStatus.prototype=new Error;ExitStatus.prototype.constructor=ExitStatus;var calledMain=false;dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};Module["callMain"]=function callMain(args){args=args||[];ensureInitRuntime();var argc=args.length+1;var argv=stackAlloc((argc+1)*4);HEAP32[argv>>2]=allocateUTF8OnStack(Module["thisProgram"]);for(var i=1;i<argc;i++){HEAP32[(argv>>2)+i]=allocateUTF8OnStack(args[i-1])}HEAP32[(argv>>2)+argc]=0;try{var ret=Module["_main"](argc,argv,0);exit(ret,true)}catch(e){if(e instanceof ExitStatus){return}else if(e=="SimulateInfiniteLoop"){Module["noExitRuntime"]=true;return}else{var toLog=e;if(e&&typeof e==="object"&&e.stack){toLog=[e,e.stack]}err("exception thrown: "+toLog);Module["quit"](1,e)}}finally{calledMain=true}};function run(args){args=args||Module["arguments"];if(runDependencies>0){return}preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;ensureInitRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();if(Module["_main"]&&shouldRunNow)Module["callMain"](args);postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout(function(){setTimeout(function(){Module["setStatus"]("")},1);doRun()},1)}else{doRun()}}Module["run"]=run;function exit(status,implicit){if(implicit&&Module["noExitRuntime"]&&status===0){return}if(Module["noExitRuntime"]){}else{ABORT=true;EXITSTATUS=status;exitRuntime();if(Module["onExit"])Module["onExit"](status)}Module["quit"](status,new ExitStatus(status))}function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}if(what!==undefined){out(what);err(what);what=JSON.stringify(what)}else{what=""}ABORT=true;EXITSTATUS=1;throw"abort("+what+"). Build with -s ASSERTIONS=1 for more info."}Module["abort"]=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}var shouldRunNow=true;if(Module["noInitialRun"]){shouldRunNow=false}Module["noExitRuntime"]=true;run();
+// Copyright 2010 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// The Module object: Our interface to the outside world. We import
+// and export values on it. There are various ways Module can be used:
+// 1. Not defined. We create it here
+// 2. A function parameter, function(Module) { ..generated code.. }
+// 3. pre-run appended it, var Module = {}; ..generated code..
+// 4. External script tag defines var Module.
+// We need to check if Module already exists (e.g. case 3 above).
+// Substitution will be replaced with actual code on later stage of the build,
+// this way Closure Compiler will not mangle it (e.g. case 4. above).
+// Note that if you want to run closure, and also to use Module
+// after the generated code, you will need to define   var Module = {};
+// before the code. Then that object will be used in the code, and you
+// can continue to use Module afterwards as well.
+var Module = typeof Module !== 'undefined' ? Module : {};
+
+// --pre-jses are emitted after the Module integration code, so that they can
+// refer to Module (if they choose; they can also define Module)
+
+if (!Module.expectedDataFileDownloads) {
+  Module.expectedDataFileDownloads = 0;
+  Module.finishedDataFileDownloads = 0;
+}
+Module.expectedDataFileDownloads++;
+(function() {
+ var loadPackage = function(metadata) {
+
+    var PACKAGE_PATH;
+    if (typeof window === 'object') {
+      PACKAGE_PATH = window['encodeURIComponent'](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf('/')) + '/');
+    } else if (typeof location !== 'undefined') {
+      // worker
+      PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf('/')) + '/');
+    } else {
+      throw 'using preloaded data can only be done on a web page or in a web worker';
+    }
+    var PACKAGE_NAME = 'audio/audio_music_stream.data';
+    var REMOTE_PACKAGE_BASE = 'audio_music_stream.data';
+    if (typeof Module['locateFilePackage'] === 'function' && !Module['locateFile']) {
+      Module['locateFile'] = Module['locateFilePackage'];
+      err('warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)');
+    }
+    var REMOTE_PACKAGE_NAME = Module['locateFile'] ? Module['locateFile'](REMOTE_PACKAGE_BASE, '') : REMOTE_PACKAGE_BASE;
+  
+    var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
+    var PACKAGE_UUID = metadata.package_uuid;
+  
+    function fetchRemotePackage(packageName, packageSize, callback, errback) {
+      var xhr = new XMLHttpRequest();
+      xhr.open('GET', packageName, true);
+      xhr.responseType = 'arraybuffer';
+      xhr.onprogress = function(event) {
+        var url = packageName;
+        var size = packageSize;
+        if (event.total) size = event.total;
+        if (event.loaded) {
+          if (!xhr.addedTotal) {
+            xhr.addedTotal = true;
+            if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
+            Module.dataFileDownloads[url] = {
+              loaded: event.loaded,
+              total: size
+            };
+          } else {
+            Module.dataFileDownloads[url].loaded = event.loaded;
+          }
+          var total = 0;
+          var loaded = 0;
+          var num = 0;
+          for (var download in Module.dataFileDownloads) {
+          var data = Module.dataFileDownloads[download];
+            total += data.total;
+            loaded += data.loaded;
+            num++;
+          }
+          total = Math.ceil(total * Module.expectedDataFileDownloads/num);
+          if (Module['setStatus']) Module['setStatus']('Downloading data... (' + loaded + '/' + total + ')');
+        } else if (!Module.dataFileDownloads) {
+          if (Module['setStatus']) Module['setStatus']('Downloading data...');
+        }
+      };
+      xhr.onerror = function(event) {
+        throw new Error("NetworkError for: " + packageName);
+      }
+      xhr.onload = function(event) {
+        if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+          var packageData = xhr.response;
+          callback(packageData);
+        } else {
+          throw new Error(xhr.statusText + " : " + xhr.responseURL);
+        }
+      };
+      xhr.send(null);
+    };
+
+    function handleError(error) {
+      console.error('package error:', error);
+    };
+  
+      var fetchedCallback = null;
+      var fetched = Module['getPreloadedPackage'] ? Module['getPreloadedPackage'](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;
+
+      if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, function(data) {
+        if (fetchedCallback) {
+          fetchedCallback(data);
+          fetchedCallback = null;
+        } else {
+          fetched = data;
+        }
+      }, handleError);
+    
+  function runWithFS() {
+
+    function assert(check, msg) {
+      if (!check) throw msg + new Error().stack;
+    }
+Module['FS_createPath']('/', 'resources', true, true);
+
+    function DataRequest(start, end, audio) {
+      this.start = start;
+      this.end = end;
+      this.audio = audio;
+    }
+    DataRequest.prototype = {
+      requests: {},
+      open: function(mode, name) {
+        this.name = name;
+        this.requests[name] = this;
+        Module['addRunDependency']('fp ' + this.name);
+      },
+      send: function() {},
+      onload: function() {
+        var byteArray = this.byteArray.subarray(this.start, this.end);
+        this.finish(byteArray);
+      },
+      finish: function(byteArray) {
+        var that = this;
+
+        Module['FS_createDataFile'](this.name, null, byteArray, true, true, true); // canOwn this data in the filesystem, it is a slide into the heap that will never change
+        Module['removeRunDependency']('fp ' + that.name);
+
+        this.requests[this.name] = null;
+      }
+    };
+
+        var files = metadata.files;
+        for (var i = 0; i < files.length; ++i) {
+          new DataRequest(files[i].start, files[i].end, files[i].audio).open('GET', files[i].filename);
+        }
+
+  
+    function processPackageData(arrayBuffer) {
+      Module.finishedDataFileDownloads++;
+      assert(arrayBuffer, 'Loading data file failed.');
+      assert(arrayBuffer instanceof ArrayBuffer, 'bad input to processPackageData');
+      var byteArray = new Uint8Array(arrayBuffer);
+      var curr;
+      
+        // copy the entire loaded file into a spot in the heap. Files will refer to slices in that. They cannot be freed though
+        // (we may be allocating before malloc is ready, during startup).
+        var ptr = Module['getMemory'](byteArray.length);
+        Module['HEAPU8'].set(byteArray, ptr);
+        DataRequest.prototype.byteArray = Module['HEAPU8'].subarray(ptr, ptr+byteArray.length);
+  
+          var files = metadata.files;
+          for (var i = 0; i < files.length; ++i) {
+            DataRequest.prototype.requests[files[i].filename].onload();
+          }
+              Module['removeRunDependency']('datafile_audio/audio_music_stream.data');
+
+    };
+    Module['addRunDependency']('datafile_audio/audio_music_stream.data');
+  
+    if (!Module.preloadResults) Module.preloadResults = {};
+  
+      Module.preloadResults[PACKAGE_NAME] = {fromCache: false};
+      if (fetched) {
+        processPackageData(fetched);
+        fetched = null;
+      } else {
+        fetchedCallback = processPackageData;
+      }
+    
+  }
+  if (Module['calledRun']) {
+    runWithFS();
+  } else {
+    if (!Module['preRun']) Module['preRun'] = [];
+    Module["preRun"].push(runWithFS); // FS is not initialized yet, wait for it
+  }
+
+ }
+ loadPackage({"files": [{"start": 0, "audio": 1, "end": 506938, "filename": "/resources/guitar_noodling.ogg"}], "remote_package_size": 506938, "package_uuid": "98e7fe38-8bc6-46aa-835a-9efc4f3a2a67"});
+
+})();
+
+
+
+// Sometimes an existing Module object exists with properties
+// meant to overwrite the default module functionality. Here
+// we collect those properties and reapply _after_ we configure
+// the current environment's defaults to avoid having to be so
+// defensive during initialization.
+var moduleOverrides = {};
+var key;
+for (key in Module) {
+  if (Module.hasOwnProperty(key)) {
+    moduleOverrides[key] = Module[key];
+  }
+}
+
+Module['arguments'] = [];
+Module['thisProgram'] = './this.program';
+Module['quit'] = function(status, toThrow) {
+  throw toThrow;
+};
+Module['preRun'] = [];
+Module['postRun'] = [];
+
+// Determine the runtime environment we are in. You can customize this by
+// setting the ENVIRONMENT setting at compile time (see settings.js).
+
+var ENVIRONMENT_IS_WEB = false;
+var ENVIRONMENT_IS_WORKER = false;
+var ENVIRONMENT_IS_NODE = false;
+var ENVIRONMENT_IS_SHELL = false;
+ENVIRONMENT_IS_WEB = typeof window === 'object';
+ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
+ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
+ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
+
+if (Module['ENVIRONMENT']) {
+  throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)');
+}
+
+
+// Three configurations we can be running in:
+// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
+// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
+// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
+
+
+
+
+// `/` should be present at the end if `scriptDirectory` is not empty
+var scriptDirectory = '';
+function locateFile(path) {
+  if (Module['locateFile']) {
+    return Module['locateFile'](path, scriptDirectory);
+  } else {
+    return scriptDirectory + path;
+  }
+}
+
+if (ENVIRONMENT_IS_NODE) {
+  scriptDirectory = __dirname + '/';
+
+  // Expose functionality in the same simple way that the shells work
+  // Note that we pollute the global namespace here, otherwise we break in node
+  var nodeFS;
+  var nodePath;
+
+  Module['read'] = function shell_read(filename, binary) {
+    var ret;
+      if (!nodeFS) nodeFS = require('fs');
+      if (!nodePath) nodePath = require('path');
+      filename = nodePath['normalize'](filename);
+      ret = nodeFS['readFileSync'](filename);
+    return binary ? ret : ret.toString();
+  };
+
+  Module['readBinary'] = function readBinary(filename) {
+    var ret = Module['read'](filename, true);
+    if (!ret.buffer) {
+      ret = new Uint8Array(ret);
+    }
+    assert(ret.buffer);
+    return ret;
+  };
+
+  if (process['argv'].length > 1) {
+    Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
+  }
+
+  Module['arguments'] = process['argv'].slice(2);
+
+  if (typeof module !== 'undefined') {
+    module['exports'] = Module;
+  }
+
+  process['on']('uncaughtException', function(ex) {
+    // suppress ExitStatus exceptions from showing an error
+    if (!(ex instanceof ExitStatus)) {
+      throw ex;
+    }
+  });
+  // Currently node will swallow unhandled rejections, but this behavior is
+  // deprecated, and in the future it will exit with error status.
+  process['on']('unhandledRejection', abort);
+
+  Module['quit'] = function(status) {
+    process['exit'](status);
+  };
+
+  Module['inspect'] = function () { return '[Emscripten Module object]'; };
+} else
+if (ENVIRONMENT_IS_SHELL) {
+
+
+  if (typeof read != 'undefined') {
+    Module['read'] = function shell_read(f) {
+      return read(f);
+    };
+  }
+
+  Module['readBinary'] = function readBinary(f) {
+    var data;
+    if (typeof readbuffer === 'function') {
+      return new Uint8Array(readbuffer(f));
+    }
+    data = read(f, 'binary');
+    assert(typeof data === 'object');
+    return data;
+  };
+
+  if (typeof scriptArgs != 'undefined') {
+    Module['arguments'] = scriptArgs;
+  } else if (typeof arguments != 'undefined') {
+    Module['arguments'] = arguments;
+  }
+
+  if (typeof quit === 'function') {
+    Module['quit'] = function(status) {
+      quit(status);
+    }
+  }
+} else
+if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
+  if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled
+    scriptDirectory = self.location.href;
+  } else if (document.currentScript) { // web
+    scriptDirectory = document.currentScript.src;
+  }
+  // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them.
+  // otherwise, slice off the final part of the url to find the script directory.
+  // if scriptDirectory does not contain a slash, lastIndexOf will return -1,
+  // and scriptDirectory will correctly be replaced with an empty string.
+  if (scriptDirectory.indexOf('blob:') !== 0) {
+    scriptDirectory = scriptDirectory.substr(0, scriptDirectory.lastIndexOf('/')+1);
+  } else {
+    scriptDirectory = '';
+  }
+
+
+  Module['read'] = function shell_read(url) {
+      var xhr = new XMLHttpRequest();
+      xhr.open('GET', url, false);
+      xhr.send(null);
+      return xhr.responseText;
+  };
+
+  if (ENVIRONMENT_IS_WORKER) {
+    Module['readBinary'] = function readBinary(url) {
+        var xhr = new XMLHttpRequest();
+        xhr.open('GET', url, false);
+        xhr.responseType = 'arraybuffer';
+        xhr.send(null);
+        return new Uint8Array(xhr.response);
+    };
+  }
+
+  Module['readAsync'] = function readAsync(url, onload, onerror) {
+    var xhr = new XMLHttpRequest();
+    xhr.open('GET', url, true);
+    xhr.responseType = 'arraybuffer';
+    xhr.onload = function xhr_onload() {
+      if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
+        onload(xhr.response);
+        return;
+      }
+      onerror();
+    };
+    xhr.onerror = onerror;
+    xhr.send(null);
+  };
+
+  Module['setWindowTitle'] = function(title) { document.title = title };
+} else
+{
+  throw new Error('environment detection error');
+}
+
+// Set up the out() and err() hooks, which are how we can print to stdout or
+// stderr, respectively.
+// If the user provided Module.print or printErr, use that. Otherwise,
+// console.log is checked first, as 'print' on the web will open a print dialogue
+// printErr is preferable to console.warn (works better in shells)
+// bind(console) is necessary to fix IE/Edge closed dev tools panel behavior.
+var out = Module['print'] || (typeof console !== 'undefined' ? console.log.bind(console) : (typeof print !== 'undefined' ? print : null));
+var err = Module['printErr'] || (typeof printErr !== 'undefined' ? printErr : ((typeof console !== 'undefined' && console.warn.bind(console)) || out));
+
+// Merge back in the overrides
+for (key in moduleOverrides) {
+  if (moduleOverrides.hasOwnProperty(key)) {
+    Module[key] = moduleOverrides[key];
+  }
+}
+// Free the object hierarchy contained in the overrides, this lets the GC
+// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
+moduleOverrides = undefined;
+
+// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message
+assert(typeof Module['memoryInitializerPrefixURL'] === 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['pthreadMainPrefixURL'] === 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['cdInitializerPrefixURL'] === 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead');
+assert(typeof Module['filePackagePrefixURL'] === 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead');
+
+
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// {{PREAMBLE_ADDITIONS}}
+
+var STACK_ALIGN = 16;
+
+// stack management, and other functionality that is provided by the compiled code,
+// should not be used before it is ready
+stackSave = stackRestore = stackAlloc = function() {
+  abort('cannot use the stack before compiled code is ready to run, and has provided stack access');
+};
+
+function staticAlloc(size) {
+  abort('staticAlloc is no longer available at runtime; instead, perform static allocations at compile time (using makeStaticAlloc)');
+}
+
+function dynamicAlloc(size) {
+  assert(DYNAMICTOP_PTR);
+  var ret = HEAP32[DYNAMICTOP_PTR>>2];
+  var end = (ret + size + 15) & -16;
+  if (end <= _emscripten_get_heap_size()) {
+    HEAP32[DYNAMICTOP_PTR>>2] = end;
+  } else {
+    return 0;
+  }
+  return ret;
+}
+
+function alignMemory(size, factor) {
+  if (!factor) factor = STACK_ALIGN; // stack alignment (16-byte) by default
+  return Math.ceil(size / factor) * factor;
+}
+
+function getNativeTypeSize(type) {
+  switch (type) {
+    case 'i1': case 'i8': return 1;
+    case 'i16': return 2;
+    case 'i32': return 4;
+    case 'i64': return 8;
+    case 'float': return 4;
+    case 'double': return 8;
+    default: {
+      if (type[type.length-1] === '*') {
+        return 4; // A pointer
+      } else if (type[0] === 'i') {
+        var bits = parseInt(type.substr(1));
+        assert(bits % 8 === 0, 'getNativeTypeSize invalid bits ' + bits + ', type ' + type);
+        return bits / 8;
+      } else {
+        return 0;
+      }
+    }
+  }
+}
+
+function warnOnce(text) {
+  if (!warnOnce.shown) warnOnce.shown = {};
+  if (!warnOnce.shown[text]) {
+    warnOnce.shown[text] = 1;
+    err(text);
+  }
+}
+
+var asm2wasmImports = { // special asm2wasm imports
+    "f64-rem": function(x, y) {
+        return x % y;
+    },
+    "debugger": function() {
+        debugger;
+    }
+};
+
+
+
+var jsCallStartIndex = 1;
+var functionPointers = new Array(0);
+
+// Wraps a JS function as a wasm function with a given signature.
+// In the future, we may get a WebAssembly.Function constructor. Until then,
+// we create a wasm module that takes the JS function as an import with a given
+// signature, and re-exports that as a wasm function.
+function convertJsFunctionToWasm(func, sig) {
+  // The module is static, with the exception of the type section, which is
+  // generated based on the signature passed in.
+  var typeSection = [
+    0x01, // id: section,
+    0x00, // length: 0 (placeholder)
+    0x01, // count: 1
+    0x60, // form: func
+  ];
+  var sigRet = sig.slice(0, 1);
+  var sigParam = sig.slice(1);
+  var typeCodes = {
+    'i': 0x7f, // i32
+    'j': 0x7e, // i64
+    'f': 0x7d, // f32
+    'd': 0x7c, // f64
+  };
+
+  // Parameters, length + signatures
+  typeSection.push(sigParam.length);
+  for (var i = 0; i < sigParam.length; ++i) {
+    typeSection.push(typeCodes[sigParam[i]]);
+  }
+
+  // Return values, length + signatures
+  // With no multi-return in MVP, either 0 (void) or 1 (anything else)
+  if (sigRet == 'v') {
+    typeSection.push(0x00);
+  } else {
+    typeSection = typeSection.concat([0x01, typeCodes[sigRet]]);
+  }
+
+  // Write the overall length of the type section back into the section header
+  // (excepting the 2 bytes for the section id and length)
+  typeSection[1] = typeSection.length - 2;
+
+  // Rest of the module is static
+  var bytes = new Uint8Array([
+    0x00, 0x61, 0x73, 0x6d, // magic ("\0asm")
+    0x01, 0x00, 0x00, 0x00, // version: 1
+  ].concat(typeSection, [
+    0x02, 0x07, // import section
+      // (import "e" "f" (func 0 (type 0)))
+      0x01, 0x01, 0x65, 0x01, 0x66, 0x00, 0x00,
+    0x07, 0x05, // export section
+      // (export "f" (func 0 (type 0)))
+      0x01, 0x01, 0x66, 0x00, 0x00,
+  ]));
+
+   // We can compile this wasm module synchronously because it is very small.
+  // This accepts an import (at "e.f"), that it reroutes to an export (at "f")
+  var module = new WebAssembly.Module(bytes);
+  var instance = new WebAssembly.Instance(module, {
+    e: {
+      f: func
+    }
+  });
+  var wrappedFunc = instance.exports.f;
+  return wrappedFunc;
+}
+
+// Add a wasm function to the table.
+function addFunctionWasm(func, sig) {
+  var table = wasmTable;
+  var ret = table.length;
+
+  // Grow the table
+  try {
+    table.grow(1);
+  } catch (err) {
+    if (!err instanceof RangeError) {
+      throw err;
+    }
+    throw 'Unable to grow wasm table. Use a higher value for RESERVED_FUNCTION_POINTERS or set ALLOW_TABLE_GROWTH.';
+  }
+
+  // Insert new element
+  try {
+    // Attempting to call this with JS function will cause of table.set() to fail
+    table.set(ret, func);
+  } catch (err) {
+    if (!err instanceof TypeError) {
+      throw err;
+    }
+    assert(typeof sig !== 'undefined', 'Missing signature argument to addFunction');
+    var wrapped = convertJsFunctionToWasm(func, sig);
+    table.set(ret, wrapped);
+  }
+
+  return ret;
+}
+
+function removeFunctionWasm(index) {
+  // TODO(sbc): Look into implementing this to allow re-using of table slots
+}
+
+// 'sig' parameter is required for the llvm backend but only when func is not
+// already a WebAssembly function.
+function addFunction(func, sig) {
+
+
+  var base = 0;
+  for (var i = base; i < base + 0; i++) {
+    if (!functionPointers[i]) {
+      functionPointers[i] = func;
+      return jsCallStartIndex + i;
+    }
+  }
+  throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
+
+}
+
+function removeFunction(index) {
+
+  functionPointers[index-jsCallStartIndex] = null;
+}
+
+var funcWrappers = {};
+
+function getFuncWrapper(func, sig) {
+  if (!func) return; // on null pointer, return undefined
+  assert(sig);
+  if (!funcWrappers[sig]) {
+    funcWrappers[sig] = {};
+  }
+  var sigCache = funcWrappers[sig];
+  if (!sigCache[func]) {
+    // optimize away arguments usage in common cases
+    if (sig.length === 1) {
+      sigCache[func] = function dynCall_wrapper() {
+        return dynCall(sig, func);
+      };
+    } else if (sig.length === 2) {
+      sigCache[func] = function dynCall_wrapper(arg) {
+        return dynCall(sig, func, [arg]);
+      };
+    } else {
+      // general case
+      sigCache[func] = function dynCall_wrapper() {
+        return dynCall(sig, func, Array.prototype.slice.call(arguments));
+      };
+    }
+  }
+  return sigCache[func];
+}
+
+
+function makeBigInt(low, high, unsigned) {
+  return unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0));
+}
+
+function dynCall(sig, ptr, args) {
+  if (args && args.length) {
+    assert(args.length == sig.length-1);
+    assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+    return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
+  } else {
+    assert(sig.length == 1);
+    assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
+    return Module['dynCall_' + sig].call(null, ptr);
+  }
+}
+
+var tempRet0 = 0;
+
+var setTempRet0 = function(value) {
+  tempRet0 = value;
+}
+
+var getTempRet0 = function() {
+  return tempRet0;
+}
+
+function getCompilerSetting(name) {
+  throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for getCompilerSetting or emscripten_get_compiler_setting to work';
+}
+
+var Runtime = {
+  // helpful errors
+  getTempRet0: function() { abort('getTempRet0() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+  staticAlloc: function() { abort('staticAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+  stackAlloc: function() { abort('stackAlloc() is now a top-level function, after removing the Runtime object. Remove "Runtime."') },
+};
+
+// The address globals begin at. Very low in memory, for code size and optimization opportunities.
+// Above 0 is static memory, starting with globals.
+// Then the stack.
+// Then 'dynamic' memory for sbrk.
+var GLOBAL_BASE = 1024;
+
+
+
+
+// === Preamble library stuff ===
+
+// Documentation for the public APIs defined in this file must be updated in:
+//    site/source/docs/api_reference/preamble.js.rst
+// A prebuilt local version of the documentation is available at:
+//    site/build/text/docs/api_reference/preamble.js.txt
+// You can also build docs locally as HTML or other formats in site/
+// An online HTML version (which may be of a different version of Emscripten)
+//    is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
+
+
+if (typeof WebAssembly !== 'object') {
+  abort('No WebAssembly support found. Build with -s WASM=0 to target JavaScript instead.');
+}
+
+
+/** @type {function(number, string, boolean=)} */
+function getValue(ptr, type, noSafe) {
+  type = type || 'i8';
+  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+    switch(type) {
+      case 'i1': return HEAP8[((ptr)>>0)];
+      case 'i8': return HEAP8[((ptr)>>0)];
+      case 'i16': return HEAP16[((ptr)>>1)];
+      case 'i32': return HEAP32[((ptr)>>2)];
+      case 'i64': return HEAP32[((ptr)>>2)];
+      case 'float': return HEAPF32[((ptr)>>2)];
+      case 'double': return HEAPF64[((ptr)>>3)];
+      default: abort('invalid type for getValue: ' + type);
+    }
+  return null;
+}
+
+
+
+
+// Wasm globals
+
+var wasmMemory;
+
+// Potentially used for direct table calls.
+var wasmTable;
+
+
+//========================================
+// Runtime essentials
+//========================================
+
+// whether we are quitting the application. no code should run after this.
+// set in exit() and abort()
+var ABORT = false;
+
+// set by exit() and abort().  Passed to 'onExit' handler.
+// NOTE: This is also used as the process return code code in shell environments
+// but only when noExitRuntime is false.
+var EXITSTATUS = 0;
+
+/** @type {function(*, string=)} */
+function assert(condition, text) {
+  if (!condition) {
+    abort('Assertion failed: ' + text);
+  }
+}
+
+// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
+function getCFunc(ident) {
+  var func = Module['_' + ident]; // closure exported function
+  assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported');
+  return func;
+}
+
+// C calling interface.
+function ccall(ident, returnType, argTypes, args, opts) {
+  // For fast lookup of conversion functions
+  var toC = {
+    'string': function(str) {
+      var ret = 0;
+      if (str !== null && str !== undefined && str !== 0) { // null string
+        // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
+        var len = (str.length << 2) + 1;
+        ret = stackAlloc(len);
+        stringToUTF8(str, ret, len);
+      }
+      return ret;
+    },
+    'array': function(arr) {
+      var ret = stackAlloc(arr.length);
+      writeArrayToMemory(arr, ret);
+      return ret;
+    }
+  };
+
+  function convertReturnValue(ret) {
+    if (returnType === 'string') return UTF8ToString(ret);
+    if (returnType === 'boolean') return Boolean(ret);
+    return ret;
+  }
+
+  var func = getCFunc(ident);
+  var cArgs = [];
+  var stack = 0;
+  assert(returnType !== 'array', 'Return type should not be "array".');
+  if (args) {
+    for (var i = 0; i < args.length; i++) {
+      var converter = toC[argTypes[i]];
+      if (converter) {
+        if (stack === 0) stack = stackSave();
+        cArgs[i] = converter(args[i]);
+      } else {
+        cArgs[i] = args[i];
+      }
+    }
+  }
+  var ret = func.apply(null, cArgs);
+  ret = convertReturnValue(ret);
+  if (stack !== 0) stackRestore(stack);
+  return ret;
+}
+
+function cwrap(ident, returnType, argTypes, opts) {
+  return function() {
+    return ccall(ident, returnType, argTypes, arguments, opts);
+  }
+}
+
+/** @type {function(number, number, string, boolean=)} */
+function setValue(ptr, value, type, noSafe) {
+  type = type || 'i8';
+  if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
+    switch(type) {
+      case 'i1': HEAP8[((ptr)>>0)]=value; break;
+      case 'i8': HEAP8[((ptr)>>0)]=value; break;
+      case 'i16': HEAP16[((ptr)>>1)]=value; break;
+      case 'i32': HEAP32[((ptr)>>2)]=value; break;
+      case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
+      case 'float': HEAPF32[((ptr)>>2)]=value; break;
+      case 'double': HEAPF64[((ptr)>>3)]=value; break;
+      default: abort('invalid type for setValue: ' + type);
+    }
+}
+
+var ALLOC_NORMAL = 0; // Tries to use _malloc()
+var ALLOC_STACK = 1; // Lives for the duration of the current function call
+var ALLOC_DYNAMIC = 2; // Cannot be freed except through sbrk
+var ALLOC_NONE = 3; // Do not allocate
+
+// allocate(): This is for internal use. You can use it yourself as well, but the interface
+//             is a little tricky (see docs right below). The reason is that it is optimized
+//             for multiple syntaxes to save space in generated code. So you should
+//             normally not use allocate(), and instead allocate memory using _malloc(),
+//             initialize it with setValue(), and so forth.
+// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
+//        in *bytes* (note that this is sometimes confusing: the next parameter does not
+//        affect this!)
+// @types: Either an array of types, one for each byte (or 0 if no type at that position),
+//         or a single type which is used for the entire block. This only matters if there
+//         is initial data - if @slab is a number, then this does not matter at all and is
+//         ignored.
+// @allocator: How to allocate memory, see ALLOC_*
+/** @type {function((TypedArray|Array<number>|number), string, number, number=)} */
+function allocate(slab, types, allocator, ptr) {
+  var zeroinit, size;
+  if (typeof slab === 'number') {
+    zeroinit = true;
+    size = slab;
+  } else {
+    zeroinit = false;
+    size = slab.length;
+  }
+
+  var singleType = typeof types === 'string' ? types : null;
+
+  var ret;
+  if (allocator == ALLOC_NONE) {
+    ret = ptr;
+  } else {
+    ret = [_malloc,
+    stackAlloc,
+    dynamicAlloc][allocator](Math.max(size, singleType ? 1 : types.length));
+  }
+
+  if (zeroinit) {
+    var stop;
+    ptr = ret;
+    assert((ret & 3) == 0);
+    stop = ret + (size & ~3);
+    for (; ptr < stop; ptr += 4) {
+      HEAP32[((ptr)>>2)]=0;
+    }
+    stop = ret + size;
+    while (ptr < stop) {
+      HEAP8[((ptr++)>>0)]=0;
+    }
+    return ret;
+  }
+
+  if (singleType === 'i8') {
+    if (slab.subarray || slab.slice) {
+      HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret);
+    } else {
+      HEAPU8.set(new Uint8Array(slab), ret);
+    }
+    return ret;
+  }
+
+  var i = 0, type, typeSize, previousType;
+  while (i < size) {
+    var curr = slab[i];
+
+    type = singleType || types[i];
+    if (type === 0) {
+      i++;
+      continue;
+    }
+    assert(type, 'Must know what type to store in allocate!');
+
+    if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
+
+    setValue(ret+i, curr, type);
+
+    // no need to look up size unless type changes, so cache it
+    if (previousType !== type) {
+      typeSize = getNativeTypeSize(type);
+      previousType = type;
+    }
+    i += typeSize;
+  }
+
+  return ret;
+}
+
+// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
+function getMemory(size) {
+  if (!runtimeInitialized) return dynamicAlloc(size);
+  return _malloc(size);
+}
+
+
+
+
+/** @type {function(number, number=)} */
+function Pointer_stringify(ptr, length) {
+  abort("this function has been removed - you should use UTF8ToString(ptr, maxBytesToRead) instead!");
+}
+
+// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+function AsciiToString(ptr) {
+  var str = '';
+  while (1) {
+    var ch = HEAPU8[((ptr++)>>0)];
+    if (!ch) return str;
+    str += String.fromCharCode(ch);
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
+
+function stringToAscii(str, outPtr) {
+  return writeAsciiToMemory(str, outPtr, false);
+}
+
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
+// a copy of that string as a Javascript String object.
+
+var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
+
+/**
+ * @param {number} idx
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+function UTF8ArrayToString(u8Array, idx, maxBytesToRead) {
+  var endIdx = idx + maxBytesToRead;
+  var endPtr = idx;
+  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+  // (As a tiny code save trick, compare endPtr against endIdx using a negation, so that undefined means Infinity)
+  while (u8Array[endPtr] && !(endPtr >= endIdx)) ++endPtr;
+
+  if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
+    return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
+  } else {
+    var str = '';
+    // If building with TextDecoder, we have already computed the string length above, so test loop end condition against that
+    while (idx < endPtr) {
+      // For UTF8 byte structure, see:
+      // http://en.wikipedia.org/wiki/UTF-8#Description
+      // https://www.ietf.org/rfc/rfc2279.txt
+      // https://tools.ietf.org/html/rfc3629
+      var u0 = u8Array[idx++];
+      if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
+      var u1 = u8Array[idx++] & 63;
+      if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
+      var u2 = u8Array[idx++] & 63;
+      if ((u0 & 0xF0) == 0xE0) {
+        u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
+      } else {
+        if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte 0x' + u0.toString(16) + ' encountered when deserializing a UTF-8 string on the asm.js/wasm heap to a JS string!');
+        u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (u8Array[idx++] & 63);
+      }
+
+      if (u0 < 0x10000) {
+        str += String.fromCharCode(u0);
+      } else {
+        var ch = u0 - 0x10000;
+        str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+      }
+    }
+  }
+  return str;
+}
+
+// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns a
+// copy of that string as a Javascript String object.
+// maxBytesToRead: an optional length that specifies the maximum number of bytes to read. You can omit
+//                 this parameter to scan the string until the first \0 byte. If maxBytesToRead is
+//                 passed, and the string at [ptr, ptr+maxBytesToReadr[ contains a null byte in the
+//                 middle, then the string will cut short at that byte index (i.e. maxBytesToRead will
+//                 not produce a string of exact length [ptr, ptr+maxBytesToRead[)
+//                 N.B. mixing frequent uses of UTF8ToString() with and without maxBytesToRead may
+//                 throw JS JIT optimizations off, so it is worth to consider consistently using one
+//                 style or the other.
+/**
+ * @param {number} ptr
+ * @param {number=} maxBytesToRead
+ * @return {string}
+ */
+function UTF8ToString(ptr, maxBytesToRead) {
+  return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : '';
+}
+
+// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
+// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
+//   outIdx: The starting offset in the array to begin the copying.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array.
+//                    This count should include the null terminator,
+//                    i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
+  if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
+    return 0;
+
+  var startIdx = outIdx;
+  var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
+    var u = str.charCodeAt(i); // possibly a lead surrogate
+    if (u >= 0xD800 && u <= 0xDFFF) {
+      var u1 = str.charCodeAt(++i);
+      u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF);
+    }
+    if (u <= 0x7F) {
+      if (outIdx >= endIdx) break;
+      outU8Array[outIdx++] = u;
+    } else if (u <= 0x7FF) {
+      if (outIdx + 1 >= endIdx) break;
+      outU8Array[outIdx++] = 0xC0 | (u >> 6);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else if (u <= 0xFFFF) {
+      if (outIdx + 2 >= endIdx) break;
+      outU8Array[outIdx++] = 0xE0 | (u >> 12);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    } else {
+      if (outIdx + 3 >= endIdx) break;
+      if (u >= 0x200000) warnOnce('Invalid Unicode code point 0x' + u.toString(16) + ' encountered when serializing a JS string to an UTF-8 string on the asm.js/wasm heap! (Valid unicode code points should be in range 0-0x1FFFFF).');
+      outU8Array[outIdx++] = 0xF0 | (u >> 18);
+      outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
+      outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
+      outU8Array[outIdx++] = 0x80 | (u & 63);
+    }
+  }
+  // Null-terminate the pointer to the buffer.
+  outU8Array[outIdx] = 0;
+  return outIdx - startIdx;
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
+// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF8(str, outPtr, maxBytesToWrite) {
+  assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+  return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
+function lengthBytesUTF8(str) {
+  var len = 0;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var u = str.charCodeAt(i); // possibly a lead surrogate
+    if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
+    if (u <= 0x7F) ++len;
+    else if (u <= 0x7FF) len += 2;
+    else if (u <= 0xFFFF) len += 3;
+    else len += 4;
+  }
+  return len;
+}
+
+
+// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
+// a copy of that string as a Javascript String object.
+
+var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
+function UTF16ToString(ptr) {
+  assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
+  var endPtr = ptr;
+  // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
+  // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
+  var idx = endPtr >> 1;
+  while (HEAP16[idx]) ++idx;
+  endPtr = idx << 1;
+
+  if (endPtr - ptr > 32 && UTF16Decoder) {
+    return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
+  } else {
+    var i = 0;
+
+    var str = '';
+    while (1) {
+      var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
+      if (codeUnit == 0) return str;
+      ++i;
+      // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
+      str += String.fromCharCode(codeUnit);
+    }
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
+// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outPtr: Byte address in Emscripten HEAP where to write the string to.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+//                    terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF16(str, outPtr, maxBytesToWrite) {
+  assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
+  assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+  if (maxBytesToWrite === undefined) {
+    maxBytesToWrite = 0x7FFFFFFF;
+  }
+  if (maxBytesToWrite < 2) return 0;
+  maxBytesToWrite -= 2; // Null terminator.
+  var startPtr = outPtr;
+  var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
+  for (var i = 0; i < numCharsToWrite; ++i) {
+    // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
+    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+    HEAP16[((outPtr)>>1)]=codeUnit;
+    outPtr += 2;
+  }
+  // Null-terminate the pointer to the HEAP.
+  HEAP16[((outPtr)>>1)]=0;
+  return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF16(str) {
+  return str.length*2;
+}
+
+function UTF32ToString(ptr) {
+  assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
+  var i = 0;
+
+  var str = '';
+  while (1) {
+    var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
+    if (utf32 == 0)
+      return str;
+    ++i;
+    // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    if (utf32 >= 0x10000) {
+      var ch = utf32 - 0x10000;
+      str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
+    } else {
+      str += String.fromCharCode(utf32);
+    }
+  }
+}
+
+// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
+// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
+// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
+// Parameters:
+//   str: the Javascript string to copy.
+//   outPtr: Byte address in Emscripten HEAP where to write the string to.
+//   maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
+//                    terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
+//                    maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
+// Returns the number of bytes written, EXCLUDING the null terminator.
+
+function stringToUTF32(str, outPtr, maxBytesToWrite) {
+  assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
+  assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
+  // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
+  if (maxBytesToWrite === undefined) {
+    maxBytesToWrite = 0x7FFFFFFF;
+  }
+  if (maxBytesToWrite < 4) return 0;
+  var startPtr = outPtr;
+  var endPtr = startPtr + maxBytesToWrite - 4;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
+    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
+      var trailSurrogate = str.charCodeAt(++i);
+      codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
+    }
+    HEAP32[((outPtr)>>2)]=codeUnit;
+    outPtr += 4;
+    if (outPtr + 4 > endPtr) break;
+  }
+  // Null-terminate the pointer to the HEAP.
+  HEAP32[((outPtr)>>2)]=0;
+  return outPtr - startPtr;
+}
+
+// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
+
+function lengthBytesUTF32(str) {
+  var len = 0;
+  for (var i = 0; i < str.length; ++i) {
+    // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
+    // See http://unicode.org/faq/utf_bom.html#utf16-3
+    var codeUnit = str.charCodeAt(i);
+    if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
+    len += 4;
+  }
+
+  return len;
+}
+
+// Allocate heap space for a JS string, and write it there.
+// It is the responsibility of the caller to free() that memory.
+function allocateUTF8(str) {
+  var size = lengthBytesUTF8(str) + 1;
+  var ret = _malloc(size);
+  if (ret) stringToUTF8Array(str, HEAP8, ret, size);
+  return ret;
+}
+
+// Allocate stack space for a JS string, and write it there.
+function allocateUTF8OnStack(str) {
+  var size = lengthBytesUTF8(str) + 1;
+  var ret = stackAlloc(size);
+  stringToUTF8Array(str, HEAP8, ret, size);
+  return ret;
+}
+
+// Deprecated: This function should not be called because it is unsafe and does not provide
+// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
+// function stringToUTF8Array() instead, which takes in a maximum length that can be used
+// to be secure from out of bounds writes.
+/** @deprecated */
+function writeStringToMemory(string, buffer, dontAddNull) {
+  warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
+
+  var /** @type {number} */ lastChar, /** @type {number} */ end;
+  if (dontAddNull) {
+    // stringToUTF8Array always appends null. If we don't want to do that, remember the
+    // character that existed at the location where the null will be placed, and restore
+    // that after the write (below).
+    end = buffer + lengthBytesUTF8(string);
+    lastChar = HEAP8[end];
+  }
+  stringToUTF8(string, buffer, Infinity);
+  if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
+}
+
+function writeArrayToMemory(array, buffer) {
+  assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
+  HEAP8.set(array, buffer);
+}
+
+function writeAsciiToMemory(str, buffer, dontAddNull) {
+  for (var i = 0; i < str.length; ++i) {
+    assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
+    HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
+  }
+  // Null-terminate the pointer to the HEAP.
+  if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
+}
+
+
+
+
+
+function demangle(func) {
+  warnOnce('warning: build with  -s DEMANGLE_SUPPORT=1  to link in libcxxabi demangling');
+  return func;
+}
+
+function demangleAll(text) {
+  var regex =
+    /__Z[\w\d_]+/g;
+  return text.replace(regex,
+    function(x) {
+      var y = demangle(x);
+      return x === y ? x : (y + ' [' + x + ']');
+    });
+}
+
+function jsStackTrace() {
+  var err = new Error();
+  if (!err.stack) {
+    // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
+    // so try that as a special-case.
+    try {
+      throw new Error(0);
+    } catch(e) {
+      err = e;
+    }
+    if (!err.stack) {
+      return '(no stack trace available)';
+    }
+  }
+  return err.stack.toString();
+}
+
+function stackTrace() {
+  var js = jsStackTrace();
+  if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
+  return demangleAll(js);
+}
+
+
+
+// Memory management
+
+var PAGE_SIZE = 16384;
+var WASM_PAGE_SIZE = 65536;
+var ASMJS_PAGE_SIZE = 16777216;
+
+function alignUp(x, multiple) {
+  if (x % multiple > 0) {
+    x += multiple - (x % multiple);
+  }
+  return x;
+}
+
+var HEAP,
+/** @type {ArrayBuffer} */
+  buffer,
+/** @type {Int8Array} */
+  HEAP8,
+/** @type {Uint8Array} */
+  HEAPU8,
+/** @type {Int16Array} */
+  HEAP16,
+/** @type {Uint16Array} */
+  HEAPU16,
+/** @type {Int32Array} */
+  HEAP32,
+/** @type {Uint32Array} */
+  HEAPU32,
+/** @type {Float32Array} */
+  HEAPF32,
+/** @type {Float64Array} */
+  HEAPF64;
+
+function updateGlobalBufferViews() {
+  Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
+  Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
+  Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
+  Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
+  Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
+  Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
+  Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
+  Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
+}
+
+
+var STATIC_BASE = 1024,
+    STACK_BASE = 148480,
+    STACKTOP = STACK_BASE,
+    STACK_MAX = 5391360,
+    DYNAMIC_BASE = 5391360,
+    DYNAMICTOP_PTR = 148448;
+
+assert(STACK_BASE % 16 === 0, 'stack must start aligned');
+assert(DYNAMIC_BASE % 16 === 0, 'heap must start aligned');
+
+
+
+var TOTAL_STACK = 5242880;
+if (Module['TOTAL_STACK']) assert(TOTAL_STACK === Module['TOTAL_STACK'], 'the stack size can no longer be determined at runtime')
+
+var INITIAL_TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 67108864;
+if (INITIAL_TOTAL_MEMORY < TOTAL_STACK) err('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + INITIAL_TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
+
+// Initialize the runtime's memory
+// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
+assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined,
+       'JS engine does not provide full typed array support');
+
+
+
+
+
+
+
+// Use a provided buffer, if there is one, or else allocate a new one
+if (Module['buffer']) {
+  buffer = Module['buffer'];
+  assert(buffer.byteLength === INITIAL_TOTAL_MEMORY, 'provided buffer should be ' + INITIAL_TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength);
+} else {
+  // Use a WebAssembly memory where available
+  if (typeof WebAssembly === 'object' && typeof WebAssembly.Memory === 'function') {
+    assert(INITIAL_TOTAL_MEMORY % WASM_PAGE_SIZE === 0);
+    wasmMemory = new WebAssembly.Memory({ 'initial': INITIAL_TOTAL_MEMORY / WASM_PAGE_SIZE, 'maximum': INITIAL_TOTAL_MEMORY / WASM_PAGE_SIZE });
+    buffer = wasmMemory.buffer;
+  } else
+  {
+    buffer = new ArrayBuffer(INITIAL_TOTAL_MEMORY);
+  }
+  assert(buffer.byteLength === INITIAL_TOTAL_MEMORY);
+}
+updateGlobalBufferViews();
+
+
+HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
+
+
+// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
+function writeStackCookie() {
+  assert((STACK_MAX & 3) == 0);
+  HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
+  HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
+}
+
+function checkStackCookie() {
+  if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
+    abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
+  }
+  // Also test the global address 0 for integrity.
+  if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
+}
+
+function abortStackOverflow(allocSize) {
+  abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - stackSave() + allocSize) + ' bytes available!');
+}
+
+
+  HEAP32[0] = 0x63736d65; /* 'emsc' */
+
+
+
+// Endianness check (note: assumes compiler arch was little-endian)
+HEAP16[1] = 0x6373;
+if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
+
+function callRuntimeCallbacks(callbacks) {
+  while(callbacks.length > 0) {
+    var callback = callbacks.shift();
+    if (typeof callback == 'function') {
+      callback();
+      continue;
+    }
+    var func = callback.func;
+    if (typeof func === 'number') {
+      if (callback.arg === undefined) {
+        Module['dynCall_v'](func);
+      } else {
+        Module['dynCall_vi'](func, callback.arg);
+      }
+    } else {
+      func(callback.arg === undefined ? null : callback.arg);
+    }
+  }
+}
+
+var __ATPRERUN__  = []; // functions called before the runtime is initialized
+var __ATINIT__    = []; // functions called during startup
+var __ATMAIN__    = []; // functions called when main() is to be run
+var __ATEXIT__    = []; // functions called during shutdown
+var __ATPOSTRUN__ = []; // functions called after the main() is called
+
+var runtimeInitialized = false;
+var runtimeExited = false;
+
+
+function preRun() {
+  // compatibility - merge in anything from Module['preRun'] at this time
+  if (Module['preRun']) {
+    if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
+    while (Module['preRun'].length) {
+      addOnPreRun(Module['preRun'].shift());
+    }
+  }
+  callRuntimeCallbacks(__ATPRERUN__);
+}
+
+function ensureInitRuntime() {
+  checkStackCookie();
+  if (runtimeInitialized) return;
+  runtimeInitialized = true;
+  if (!Module["noFSInit"] && !FS.init.initialized) FS.init();
+TTY.init();
+  callRuntimeCallbacks(__ATINIT__);
+}
+
+function preMain() {
+  checkStackCookie();
+  FS.ignorePermissions = false;
+  callRuntimeCallbacks(__ATMAIN__);
+}
+
+function exitRuntime() {
+  checkStackCookie();
+  runtimeExited = true;
+}
+
+function postRun() {
+  checkStackCookie();
+  // compatibility - merge in anything from Module['postRun'] at this time
+  if (Module['postRun']) {
+    if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
+    while (Module['postRun'].length) {
+      addOnPostRun(Module['postRun'].shift());
+    }
+  }
+  callRuntimeCallbacks(__ATPOSTRUN__);
+}
+
+function addOnPreRun(cb) {
+  __ATPRERUN__.unshift(cb);
+}
+
+function addOnInit(cb) {
+  __ATINIT__.unshift(cb);
+}
+
+function addOnPreMain(cb) {
+  __ATMAIN__.unshift(cb);
+}
+
+function addOnExit(cb) {
+}
+
+function addOnPostRun(cb) {
+  __ATPOSTRUN__.unshift(cb);
+}
+
+function unSign(value, bits, ignore) {
+  if (value >= 0) {
+    return value;
+  }
+  return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
+                    : Math.pow(2, bits)         + value;
+}
+function reSign(value, bits, ignore) {
+  if (value <= 0) {
+    return value;
+  }
+  var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
+                        : Math.pow(2, bits-1);
+  if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
+                                                       // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
+                                                       // TODO: In i64 mode 1, resign the two parts separately and safely
+    value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
+  }
+  return value;
+}
+
+
+assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill');
+
+var Math_abs = Math.abs;
+var Math_cos = Math.cos;
+var Math_sin = Math.sin;
+var Math_tan = Math.tan;
+var Math_acos = Math.acos;
+var Math_asin = Math.asin;
+var Math_atan = Math.atan;
+var Math_atan2 = Math.atan2;
+var Math_exp = Math.exp;
+var Math_log = Math.log;
+var Math_sqrt = Math.sqrt;
+var Math_ceil = Math.ceil;
+var Math_floor = Math.floor;
+var Math_pow = Math.pow;
+var Math_imul = Math.imul;
+var Math_fround = Math.fround;
+var Math_round = Math.round;
+var Math_min = Math.min;
+var Math_max = Math.max;
+var Math_clz32 = Math.clz32;
+var Math_trunc = Math.trunc;
+
+
+
+// A counter of dependencies for calling run(). If we need to
+// do asynchronous work before running, increment this and
+// decrement it. Incrementing must happen in a place like
+// Module.preRun (used by emcc to add file preloading).
+// Note that you can add dependencies in preRun, even though
+// it happens right before run - run will be postponed until
+// the dependencies are met.
+var runDependencies = 0;
+var runDependencyWatcher = null;
+var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
+var runDependencyTracking = {};
+
+function getUniqueRunDependency(id) {
+  var orig = id;
+  while (1) {
+    if (!runDependencyTracking[id]) return id;
+    id = orig + Math.random();
+  }
+  return id;
+}
+
+function addRunDependency(id) {
+  runDependencies++;
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+  if (id) {
+    assert(!runDependencyTracking[id]);
+    runDependencyTracking[id] = 1;
+    if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
+      // Check for missing dependencies every few seconds
+      runDependencyWatcher = setInterval(function() {
+        if (ABORT) {
+          clearInterval(runDependencyWatcher);
+          runDependencyWatcher = null;
+          return;
+        }
+        var shown = false;
+        for (var dep in runDependencyTracking) {
+          if (!shown) {
+            shown = true;
+            err('still waiting on run dependencies:');
+          }
+          err('dependency: ' + dep);
+        }
+        if (shown) {
+          err('(end of list)');
+        }
+      }, 10000);
+    }
+  } else {
+    err('warning: run dependency added without ID');
+  }
+}
+
+function removeRunDependency(id) {
+  runDependencies--;
+  if (Module['monitorRunDependencies']) {
+    Module['monitorRunDependencies'](runDependencies);
+  }
+  if (id) {
+    assert(runDependencyTracking[id]);
+    delete runDependencyTracking[id];
+  } else {
+    err('warning: run dependency removed without ID');
+  }
+  if (runDependencies == 0) {
+    if (runDependencyWatcher !== null) {
+      clearInterval(runDependencyWatcher);
+      runDependencyWatcher = null;
+    }
+    if (dependenciesFulfilled) {
+      var callback = dependenciesFulfilled;
+      dependenciesFulfilled = null;
+      callback(); // can add another dependenciesFulfilled
+    }
+  }
+}
+
+Module["preloadedImages"] = {}; // maps url to image data
+Module["preloadedAudios"] = {}; // maps url to audio data
+
+
+var memoryInitializer = null;
+
+
+
+
+
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+// Prefix of data URIs emitted by SINGLE_FILE and related options.
+var dataURIPrefix = 'data:application/octet-stream;base64,';
+
+// Indicates whether filename is a base64 data URI.
+function isDataURI(filename) {
+  return String.prototype.startsWith ?
+      filename.startsWith(dataURIPrefix) :
+      filename.indexOf(dataURIPrefix) === 0;
+}
+
+
+
+
+var wasmBinaryFile = 'audio_music_stream.wasm';
+if (!isDataURI(wasmBinaryFile)) {
+  wasmBinaryFile = locateFile(wasmBinaryFile);
+}
+
+function getBinary() {
+  try {
+    if (Module['wasmBinary']) {
+      return new Uint8Array(Module['wasmBinary']);
+    }
+    if (Module['readBinary']) {
+      return Module['readBinary'](wasmBinaryFile);
+    } else {
+      throw "both async and sync fetching of the wasm failed";
+    }
+  }
+  catch (err) {
+    abort(err);
+  }
+}
+
+function getBinaryPromise() {
+  // if we don't have the binary yet, and have the Fetch api, use that
+  // in some environments, like Electron's render process, Fetch api may be present, but have a different context than expected, let's only use it on the Web
+  if (!Module['wasmBinary'] && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && typeof fetch === 'function') {
+    return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) {
+      if (!response['ok']) {
+        throw "failed to load wasm binary file at '" + wasmBinaryFile + "'";
+      }
+      return response['arrayBuffer']();
+    }).catch(function () {
+      return getBinary();
+    });
+  }
+  // Otherwise, getBinary should be able to get it synchronously
+  return new Promise(function(resolve, reject) {
+    resolve(getBinary());
+  });
+}
+
+// Create the wasm instance.
+// Receives the wasm imports, returns the exports.
+function createWasm(env) {
+  // prepare imports
+  var info = {
+    'env': env
+    ,
+    'global': {
+      'NaN': NaN,
+      'Infinity': Infinity
+    },
+    'global.Math': Math,
+    'asm2wasm': asm2wasmImports
+  };
+  // Load the wasm module and create an instance of using native support in the JS engine.
+  // handle a generated wasm instance, receiving its exports and
+  // performing other necessary setup
+  function receiveInstance(instance, module) {
+    var exports = instance.exports;
+    Module['asm'] = exports;
+    removeRunDependency('wasm-instantiate');
+  }
+  addRunDependency('wasm-instantiate');
+
+  // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback
+  // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel
+  // to any other async startup actions they are performing.
+  if (Module['instantiateWasm']) {
+    try {
+      return Module['instantiateWasm'](info, receiveInstance);
+    } catch(e) {
+      err('Module.instantiateWasm callback failed with error: ' + e);
+      return false;
+    }
+  }
+
+  // Async compilation can be confusing when an error on the page overwrites Module
+  // (for example, if the order of elements is wrong, and the one defining Module is
+  // later), so we save Module and check it later.
+  var trueModule = Module;
+  function receiveInstantiatedSource(output) {
+    // 'output' is a WebAssemblyInstantiatedSource object which has both the module and instance.
+    // receiveInstance() will swap in the exports (to Module.asm) so they can be called
+    assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?');
+    trueModule = null;
+      // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line.
+      // When the regression is fixed, can restore the above USE_PTHREADS-enabled path.
+    receiveInstance(output['instance']);
+  }
+  function instantiateArrayBuffer(receiver) {
+    getBinaryPromise().then(function(binary) {
+      return WebAssembly.instantiate(binary, info);
+    }).then(receiver, function(reason) {
+      err('failed to asynchronously prepare wasm: ' + reason);
+      abort(reason);
+    });
+  }
+  // Prefer streaming instantiation if available.
+  if (!Module['wasmBinary'] &&
+      typeof WebAssembly.instantiateStreaming === 'function' &&
+      !isDataURI(wasmBinaryFile) &&
+      typeof fetch === 'function') {
+    WebAssembly.instantiateStreaming(fetch(wasmBinaryFile, { credentials: 'same-origin' }), info)
+      .then(receiveInstantiatedSource, function(reason) {
+        // We expect the most common failure cause to be a bad MIME type for the binary,
+        // in which case falling back to ArrayBuffer instantiation should work.
+        err('wasm streaming compile failed: ' + reason);
+        err('falling back to ArrayBuffer instantiation');
+        instantiateArrayBuffer(receiveInstantiatedSource);
+      });
+  } else {
+    instantiateArrayBuffer(receiveInstantiatedSource);
+  }
+  return {}; // no exports yet; we'll fill them in later
+}
+
+// Provide an "asm.js function" for the application, called to "link" the asm.js module. We instantiate
+// the wasm module at that time, and it receives imports and provides exports and so forth, the app
+// doesn't need to care that it is wasm or asm.js.
+
+Module['asm'] = function(global, env, providedBuffer) {
+  // memory was already allocated (so js could use the buffer)
+  env['memory'] = wasmMemory
+  ;
+  // import table
+  env['table'] = wasmTable = new WebAssembly.Table({
+    'initial': 8584,
+    'maximum': 8584,
+    'element': 'anyfunc'
+  });
+  // With the wasm backend __memory_base and __table_base and only needed for
+  // relocatable output.
+  env['__memory_base'] = 1024; // tell the memory segments where to place themselves
+  // table starts at 0 by default (even in dynamic linking, for the main module)
+  env['__table_base'] = 0;
+
+  var exports = createWasm(env);
+  assert(exports, 'binaryen setup failed (no wasm support?)');
+  return exports;
+};
+
+// === Body ===
+
+var ASM_CONSTS = [function($0) { return (navigator.mediaDevices !== undefined && navigator.mediaDevices.getUserMedia !== undefined); },
+ function($0) { try { var temp = new (window.AudioContext || window.webkitAudioContext)(); var sampleRate = temp.sampleRate; temp.close(); return sampleRate; } catch(e) { return 0; } },
+ function($0, $1) { var device = miniaudio.get_device_by_index($0); if (device.scriptNode !== undefined) { device.scriptNode.onaudioprocess = function(e) {}; device.scriptNode.disconnect(); device.scriptNode = undefined; } if (device.streamNode !== undefined) { device.streamNode.disconnect(); device.streamNode = undefined; } device.webaudio.close(); device.webaudio = undefined; if (device.intermediaryBuffer !== undefined) { Module._free(device.intermediaryBuffer); device.intermediaryBuffer = undefined; device.intermediaryBufferView = undefined; device.intermediaryBufferSizeInBytes = undefined; } miniaudio.untrack_device_by_index($0); },
+ function($0, $1, $2, $3, $4) { var channels = $0; var sampleRate = $1; var bufferSize = $2; var isCapture = $3; var pDevice = $4; if (typeof(miniaudio) === 'undefined') { return -1; } var device = {}; device.webaudio = new (window.AudioContext || window.webkitAudioContext)({sampleRate:sampleRate}); device.webaudio.suspend(); device.intermediaryBufferSizeInBytes = channels * bufferSize * 4; device.intermediaryBuffer = Module._malloc(device.intermediaryBufferSizeInBytes); device.intermediaryBufferView = new Float32Array(Module.HEAPF32.buffer, device.intermediaryBuffer, device.intermediaryBufferSizeInBytes); device.scriptNode = device.webaudio.createScriptProcessor(bufferSize, channels, channels); if (isCapture) { device.scriptNode.onaudioprocess = function(e) { if (device.intermediaryBuffer === undefined) { return; } for (var iChannel = 0; iChannel < e.outputBuffer.numberOfChannels; ++iChannel) { e.outputBuffer.getChannelData(iChannel).fill(0.0); } var sendSilence = false; if (device.streamNode === undefined) { sendSilence = true; } if (e.inputBuffer.numberOfChannels != channels) { console.log("Capture: Channel count mismatch. " + e.inputBufer.numberOfChannels + " != " + channels + ". Sending silence."); sendSilence = true; } var totalFramesProcessed = 0; while (totalFramesProcessed < e.inputBuffer.length) { var framesRemaining = e.inputBuffer.length - totalFramesProcessed; var framesToProcess = framesRemaining; if (framesToProcess > (device.intermediaryBufferSizeInBytes/channels/4)) { framesToProcess = (device.intermediaryBufferSizeInBytes/channels/4); } if (sendSilence) { device.intermediaryBufferView.fill(0.0); } else { for (var iFrame = 0; iFrame < framesToProcess; ++iFrame) { for (var iChannel = 0; iChannel < e.inputBuffer.numberOfChannels; ++iChannel) { device.intermediaryBufferView[iFrame*channels + iChannel] = e.inputBuffer.getChannelData(iChannel)[totalFramesProcessed + iFrame]; } } } ccall("ma_device_process_pcm_frames_capture__webaudio", "undefined", ["number", "number", "number"], [pDevice, framesToProcess, device.intermediaryBuffer]); totalFramesProcessed += framesToProcess; } }; navigator.mediaDevices.getUserMedia({audio:true, video:false}) .then(function(stream) { device.streamNode = device.webaudio.createMediaStreamSource(stream); device.streamNode.connect(device.scriptNode); device.scriptNode.connect(device.webaudio.destination); }) .catch(function(error) { device.scriptNode.connect(device.webaudio.destination); }); } else { device.scriptNode.onaudioprocess = function(e) { if (device.intermediaryBuffer === undefined) { return; } var outputSilence = false; if (e.outputBuffer.numberOfChannels != channels) { console.log("Playback: Channel count mismatch. " + e.outputBufer.numberOfChannels + " != " + channels + ". Outputting silence."); outputSilence = true; return; } var totalFramesProcessed = 0; while (totalFramesProcessed < e.outputBuffer.length) { var framesRemaining = e.outputBuffer.length - totalFramesProcessed; var framesToProcess = framesRemaining; if (framesToProcess > (device.intermediaryBufferSizeInBytes/channels/4)) { framesToProcess = (device.intermediaryBufferSizeInBytes/channels/4); } ccall("ma_device_process_pcm_frames_playback__webaudio", "undefined", ["number", "number", "number"], [pDevice, framesToProcess, device.intermediaryBuffer]); if (outputSilence) { for (var iChannel = 0; iChannel < e.outputBuffer.numberOfChannels; ++iChannel) { e.outputBuffer.getChannelData(iChannel).fill(0.0); } } else { for (var iChannel = 0; iChannel < e.outputBuffer.numberOfChannels; ++iChannel) { for (var iFrame = 0; iFrame < framesToProcess; ++iFrame) { e.outputBuffer.getChannelData(iChannel)[totalFramesProcessed + iFrame] = device.intermediaryBufferView[iFrame*channels + iChannel]; } } } totalFramesProcessed += framesToProcess; } }; device.scriptNode.connect(device.webaudio.destination); } return miniaudio.track_device(device); },
+ function($0) { return miniaudio.get_device_by_index($0).webaudio.sampleRate; },
+ function($0) { miniaudio.get_device_by_index($0).webaudio.resume(); },
+ function($0) { miniaudio.get_device_by_index($0).webaudio.suspend(); },
+ function($0) { if ((window.AudioContext || window.webkitAudioContext) === undefined) { return 0; } if (typeof(miniaudio) === 'undefined') { miniaudio = {}; miniaudio.devices = []; miniaudio.track_device = function(device) { for (var iDevice = 0; iDevice < miniaudio.devices.length; ++iDevice) { if (miniaudio.devices[iDevice] == null) { miniaudio.devices[iDevice] = device; return iDevice; } } miniaudio.devices.push(device); return miniaudio.devices.length - 1; }; miniaudio.untrack_device_by_index = function(deviceIndex) { miniaudio.devices[deviceIndex] = null; while (miniaudio.devices.length > 0) { if (miniaudio.devices[miniaudio.devices.length-1] == null) { miniaudio.devices.pop(); } else { break; } } }; miniaudio.untrack_device = function(device) { for (var iDevice = 0; iDevice < miniaudio.devices.length; ++iDevice) { if (miniaudio.devices[iDevice] == device) { return miniaudio.untrack_device_by_index(iDevice); } } }; miniaudio.get_device_by_index = function(deviceIndex) { return miniaudio.devices[deviceIndex]; }; } return 1; }];
+
+function _emscripten_asm_const_ii(code, a0) {
+  return ASM_CONSTS[code](a0);
+}
+
+function _emscripten_asm_const_iiiiii(code, a0, a1, a2, a3, a4) {
+  return ASM_CONSTS[code](a0, a1, a2, a3, a4);
+}
+
+function _emscripten_asm_const_iii(code, a0, a1) {
+  return ASM_CONSTS[code](a0, a1);
+}
+
+
+
+
+// STATICTOP = STATIC_BASE + 147456;
+/* global initializers */ /*__ATINIT__.push();*/
+
+
+
+
+
+
+
+
+/* no memory initializer */
+var tempDoublePtr = 148464
+assert(tempDoublePtr % 8 == 0);
+
+function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
+  HEAP8[tempDoublePtr] = HEAP8[ptr];
+  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+}
+
+function copyTempDouble(ptr) {
+  HEAP8[tempDoublePtr] = HEAP8[ptr];
+  HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
+  HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
+  HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
+  HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
+  HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
+  HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
+  HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
+}
+
+// {{PRE_LIBRARY}}
+
+
+  function ___assert_fail(condition, filename, line, func) {
+      abort('Assertion failed: ' + UTF8ToString(condition) + ', at: ' + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']);
+    }
+
+  function ___lock() {}
+
+  
+  
+  
+  function ___setErrNo(value) {
+      if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
+      else err('failed to set errno from JS');
+      return value;
+    }
+  
+  var PATH={splitPath:function (filename) {
+        var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
+        return splitPathRe.exec(filename).slice(1);
+      },normalizeArray:function (parts, allowAboveRoot) {
+        // if the path tries to go above the root, `up` ends up > 0
+        var up = 0;
+        for (var i = parts.length - 1; i >= 0; i--) {
+          var last = parts[i];
+          if (last === '.') {
+            parts.splice(i, 1);
+          } else if (last === '..') {
+            parts.splice(i, 1);
+            up++;
+          } else if (up) {
+            parts.splice(i, 1);
+            up--;
+          }
+        }
+        // if the path is allowed to go above the root, restore leading ..s
+        if (allowAboveRoot) {
+          for (; up; up--) {
+            parts.unshift('..');
+          }
+        }
+        return parts;
+      },normalize:function (path) {
+        var isAbsolute = path.charAt(0) === '/',
+            trailingSlash = path.substr(-1) === '/';
+        // Normalize the path
+        path = PATH.normalizeArray(path.split('/').filter(function(p) {
+          return !!p;
+        }), !isAbsolute).join('/');
+        if (!path && !isAbsolute) {
+          path = '.';
+        }
+        if (path && trailingSlash) {
+          path += '/';
+        }
+        return (isAbsolute ? '/' : '') + path;
+      },dirname:function (path) {
+        var result = PATH.splitPath(path),
+            root = result[0],
+            dir = result[1];
+        if (!root && !dir) {
+          // No dirname whatsoever
+          return '.';
+        }
+        if (dir) {
+          // It has a dirname, strip trailing slash
+          dir = dir.substr(0, dir.length - 1);
+        }
+        return root + dir;
+      },basename:function (path) {
+        // EMSCRIPTEN return '/'' for '/', not an empty string
+        if (path === '/') return '/';
+        var lastSlash = path.lastIndexOf('/');
+        if (lastSlash === -1) return path;
+        return path.substr(lastSlash+1);
+      },extname:function (path) {
+        return PATH.splitPath(path)[3];
+      },join:function () {
+        var paths = Array.prototype.slice.call(arguments, 0);
+        return PATH.normalize(paths.join('/'));
+      },join2:function (l, r) {
+        return PATH.normalize(l + '/' + r);
+      },resolve:function () {
+        var resolvedPath = '',
+          resolvedAbsolute = false;
+        for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
+          var path = (i >= 0) ? arguments[i] : FS.cwd();
+          // Skip empty and invalid entries
+          if (typeof path !== 'string') {
+            throw new TypeError('Arguments to path.resolve must be strings');
+          } else if (!path) {
+            return ''; // an invalid portion invalidates the whole thing
+          }
+          resolvedPath = path + '/' + resolvedPath;
+          resolvedAbsolute = path.charAt(0) === '/';
+        }
+        // At this point the path should be resolved to a full absolute path, but
+        // handle relative paths to be safe (might happen when process.cwd() fails)
+        resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
+          return !!p;
+        }), !resolvedAbsolute).join('/');
+        return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
+      },relative:function (from, to) {
+        from = PATH.resolve(from).substr(1);
+        to = PATH.resolve(to).substr(1);
+        function trim(arr) {
+          var start = 0;
+          for (; start < arr.length; start++) {
+            if (arr[start] !== '') break;
+          }
+          var end = arr.length - 1;
+          for (; end >= 0; end--) {
+            if (arr[end] !== '') break;
+          }
+          if (start > end) return [];
+          return arr.slice(start, end - start + 1);
+        }
+        var fromParts = trim(from.split('/'));
+        var toParts = trim(to.split('/'));
+        var length = Math.min(fromParts.length, toParts.length);
+        var samePartsLength = length;
+        for (var i = 0; i < length; i++) {
+          if (fromParts[i] !== toParts[i]) {
+            samePartsLength = i;
+            break;
+          }
+        }
+        var outputParts = [];
+        for (var i = samePartsLength; i < fromParts.length; i++) {
+          outputParts.push('..');
+        }
+        outputParts = outputParts.concat(toParts.slice(samePartsLength));
+        return outputParts.join('/');
+      }};
+  
+  var TTY={ttys:[],init:function () {
+        // https://github.com/emscripten-core/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // currently, FS.init does not distinguish if process.stdin is a file or TTY
+        //   // device, it always assumes it's a TTY device. because of this, we're forcing
+        //   // process.stdin to UTF8 encoding to at least make stdin reading compatible
+        //   // with text files until FS.init can be refactored.
+        //   process['stdin']['setEncoding']('utf8');
+        // }
+      },shutdown:function () {
+        // https://github.com/emscripten-core/emscripten/pull/1555
+        // if (ENVIRONMENT_IS_NODE) {
+        //   // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
+        //   // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
+        //   // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
+        //   // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
+        //   // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
+        //   process['stdin']['pause']();
+        // }
+      },register:function (dev, ops) {
+        TTY.ttys[dev] = { input: [], output: [], ops: ops };
+        FS.registerDevice(dev, TTY.stream_ops);
+      },stream_ops:{open:function (stream) {
+          var tty = TTY.ttys[stream.node.rdev];
+          if (!tty) {
+            throw new FS.ErrnoError(19);
+          }
+          stream.tty = tty;
+          stream.seekable = false;
+        },close:function (stream) {
+          // flush any pending line data
+          stream.tty.ops.flush(stream.tty);
+        },flush:function (stream) {
+          stream.tty.ops.flush(stream.tty);
+        },read:function (stream, buffer, offset, length, pos /* ignored */) {
+          if (!stream.tty || !stream.tty.ops.get_char) {
+            throw new FS.ErrnoError(6);
+          }
+          var bytesRead = 0;
+          for (var i = 0; i < length; i++) {
+            var result;
+            try {
+              result = stream.tty.ops.get_char(stream.tty);
+            } catch (e) {
+              throw new FS.ErrnoError(5);
+            }
+            if (result === undefined && bytesRead === 0) {
+              throw new FS.ErrnoError(11);
+            }
+            if (result === null || result === undefined) break;
+            bytesRead++;
+            buffer[offset+i] = result;
+          }
+          if (bytesRead) {
+            stream.node.timestamp = Date.now();
+          }
+          return bytesRead;
+        },write:function (stream, buffer, offset, length, pos) {
+          if (!stream.tty || !stream.tty.ops.put_char) {
+            throw new FS.ErrnoError(6);
+          }
+          try {
+            for (var i = 0; i < length; i++) {
+              stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
+            }
+          } catch (e) {
+            throw new FS.ErrnoError(5);
+          }
+          if (length) {
+            stream.node.timestamp = Date.now();
+          }
+          return i;
+        }},default_tty_ops:{get_char:function (tty) {
+          if (!tty.input.length) {
+            var result = null;
+            if (ENVIRONMENT_IS_NODE) {
+              // we will read data by chunks of BUFSIZE
+              var BUFSIZE = 256;
+              var buf = new Buffer(BUFSIZE);
+              var bytesRead = 0;
+  
+              var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
+  
+              var fd = process.stdin.fd;
+              if (isPosixPlatform) {
+                // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
+                var usingDevice = false;
+                try {
+                  fd = fs.openSync('/dev/stdin', 'r');
+                  usingDevice = true;
+                } catch (e) {}
+              }
+  
+              try {
+                bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
+              } catch(e) {
+                // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
+                // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
+                if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
+                else throw e;
+              }
+  
+              if (usingDevice) { fs.closeSync(fd); }
+              if (bytesRead > 0) {
+                result = buf.slice(0, bytesRead).toString('utf-8');
+              } else {
+                result = null;
+              }
+            } else
+            if (typeof window != 'undefined' &&
+              typeof window.prompt == 'function') {
+              // Browser.
+              result = window.prompt('Input: ');  // returns null on cancel
+              if (result !== null) {
+                result += '\n';
+              }
+            } else if (typeof readline == 'function') {
+              // Command line.
+              result = readline();
+              if (result !== null) {
+                result += '\n';
+              }
+            }
+            if (!result) {
+              return null;
+            }
+            tty.input = intArrayFromString(result, true);
+          }
+          return tty.input.shift();
+        },put_char:function (tty, val) {
+          if (val === null || val === 10) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
+          }
+        },flush:function (tty) {
+          if (tty.output && tty.output.length > 0) {
+            out(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        }},default_tty1_ops:{put_char:function (tty, val) {
+          if (val === null || val === 10) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          } else {
+            if (val != 0) tty.output.push(val);
+          }
+        },flush:function (tty) {
+          if (tty.output && tty.output.length > 0) {
+            err(UTF8ArrayToString(tty.output, 0));
+            tty.output = [];
+          }
+        }}};
+  
+  var MEMFS={ops_table:null,mount:function (mount) {
+        return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
+      },createNode:function (parent, name, mode, dev) {
+        if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
+          // no supported
+          throw new FS.ErrnoError(1);
+        }
+        if (!MEMFS.ops_table) {
+          MEMFS.ops_table = {
+            dir: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                lookup: MEMFS.node_ops.lookup,
+                mknod: MEMFS.node_ops.mknod,
+                rename: MEMFS.node_ops.rename,
+                unlink: MEMFS.node_ops.unlink,
+                rmdir: MEMFS.node_ops.rmdir,
+                readdir: MEMFS.node_ops.readdir,
+                symlink: MEMFS.node_ops.symlink
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek
+              }
+            },
+            file: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: {
+                llseek: MEMFS.stream_ops.llseek,
+                read: MEMFS.stream_ops.read,
+                write: MEMFS.stream_ops.write,
+                allocate: MEMFS.stream_ops.allocate,
+                mmap: MEMFS.stream_ops.mmap,
+                msync: MEMFS.stream_ops.msync
+              }
+            },
+            link: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr,
+                readlink: MEMFS.node_ops.readlink
+              },
+              stream: {}
+            },
+            chrdev: {
+              node: {
+                getattr: MEMFS.node_ops.getattr,
+                setattr: MEMFS.node_ops.setattr
+              },
+              stream: FS.chrdev_stream_ops
+            }
+          };
+        }
+        var node = FS.createNode(parent, name, mode, dev);
+        if (FS.isDir(node.mode)) {
+          node.node_ops = MEMFS.ops_table.dir.node;
+          node.stream_ops = MEMFS.ops_table.dir.stream;
+          node.contents = {};
+        } else if (FS.isFile(node.mode)) {
+          node.node_ops = MEMFS.ops_table.file.node;
+          node.stream_ops = MEMFS.ops_table.file.stream;
+          node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
+          // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
+          // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
+          // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
+          node.contents = null; 
+        } else if (FS.isLink(node.mode)) {
+          node.node_ops = MEMFS.ops_table.link.node;
+          node.stream_ops = MEMFS.ops_table.link.stream;
+        } else if (FS.isChrdev(node.mode)) {
+          node.node_ops = MEMFS.ops_table.chrdev.node;
+          node.stream_ops = MEMFS.ops_table.chrdev.stream;
+        }
+        node.timestamp = Date.now();
+        // add the new node to the parent
+        if (parent) {
+          parent.contents[name] = node;
+        }
+        return node;
+      },getFileDataAsRegularArray:function (node) {
+        if (node.contents && node.contents.subarray) {
+          var arr = [];
+          for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
+          return arr; // Returns a copy of the original data.
+        }
+        return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
+      },getFileDataAsTypedArray:function (node) {
+        if (!node.contents) return new Uint8Array;
+        if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
+        return new Uint8Array(node.contents);
+      },expandFileStorage:function (node, newCapacity) {
+        var prevCapacity = node.contents ? node.contents.length : 0;
+        if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
+        // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
+        // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
+        // avoid overshooting the allocation cap by a very large margin.
+        var CAPACITY_DOUBLING_MAX = 1024 * 1024;
+        newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
+        if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
+        var oldContents = node.contents;
+        node.contents = new Uint8Array(newCapacity); // Allocate new storage.
+        if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
+        return;
+      },resizeFileStorage:function (node, newSize) {
+        if (node.usedBytes == newSize) return;
+        if (newSize == 0) {
+          node.contents = null; // Fully decommit when requesting a resize to zero.
+          node.usedBytes = 0;
+          return;
+        }
+        if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
+          var oldContents = node.contents;
+          node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
+          if (oldContents) {
+            node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
+          }
+          node.usedBytes = newSize;
+          return;
+        }
+        // Backing with a JS array.
+        if (!node.contents) node.contents = [];
+        if (node.contents.length > newSize) node.contents.length = newSize;
+        else while (node.contents.length < newSize) node.contents.push(0);
+        node.usedBytes = newSize;
+      },node_ops:{getattr:function (node) {
+          var attr = {};
+          // device numbers reuse inode numbers.
+          attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
+          attr.ino = node.id;
+          attr.mode = node.mode;
+          attr.nlink = 1;
+          attr.uid = 0;
+          attr.gid = 0;
+          attr.rdev = node.rdev;
+          if (FS.isDir(node.mode)) {
+            attr.size = 4096;
+          } else if (FS.isFile(node.mode)) {
+            attr.size = node.usedBytes;
+          } else if (FS.isLink(node.mode)) {
+            attr.size = node.link.length;
+          } else {
+            attr.size = 0;
+          }
+          attr.atime = new Date(node.timestamp);
+          attr.mtime = new Date(node.timestamp);
+          attr.ctime = new Date(node.timestamp);
+          // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
+          //       but this is not required by the standard.
+          attr.blksize = 4096;
+          attr.blocks = Math.ceil(attr.size / attr.blksize);
+          return attr;
+        },setattr:function (node, attr) {
+          if (attr.mode !== undefined) {
+            node.mode = attr.mode;
+          }
+          if (attr.timestamp !== undefined) {
+            node.timestamp = attr.timestamp;
+          }
+          if (attr.size !== undefined) {
+            MEMFS.resizeFileStorage(node, attr.size);
+          }
+        },lookup:function (parent, name) {
+          throw FS.genericErrors[2];
+        },mknod:function (parent, name, mode, dev) {
+          return MEMFS.createNode(parent, name, mode, dev);
+        },rename:function (old_node, new_dir, new_name) {
+          // if we're overwriting a directory at new_name, make sure it's empty.
+          if (FS.isDir(old_node.mode)) {
+            var new_node;
+            try {
+              new_node = FS.lookupNode(new_dir, new_name);
+            } catch (e) {
+            }
+            if (new_node) {
+              for (var i in new_node.contents) {
+                throw new FS.ErrnoError(39);
+              }
+            }
+          }
+          // do the internal rewiring
+          delete old_node.parent.contents[old_node.name];
+          old_node.name = new_name;
+          new_dir.contents[new_name] = old_node;
+          old_node.parent = new_dir;
+        },unlink:function (parent, name) {
+          delete parent.contents[name];
+        },rmdir:function (parent, name) {
+          var node = FS.lookupNode(parent, name);
+          for (var i in node.contents) {
+            throw new FS.ErrnoError(39);
+          }
+          delete parent.contents[name];
+        },readdir:function (node) {
+          var entries = ['.', '..']
+          for (var key in node.contents) {
+            if (!node.contents.hasOwnProperty(key)) {
+              continue;
+            }
+            entries.push(key);
+          }
+          return entries;
+        },symlink:function (parent, newname, oldpath) {
+          var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
+          node.link = oldpath;
+          return node;
+        },readlink:function (node) {
+          if (!FS.isLink(node.mode)) {
+            throw new FS.ErrnoError(22);
+          }
+          return node.link;
+        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+          var contents = stream.node.contents;
+          if (position >= stream.node.usedBytes) return 0;
+          var size = Math.min(stream.node.usedBytes - position, length);
+          assert(size >= 0);
+          if (size > 8 && contents.subarray) { // non-trivial, and typed array
+            buffer.set(contents.subarray(position, position + size), offset);
+          } else {
+            for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
+          }
+          return size;
+        },write:function (stream, buffer, offset, length, position, canOwn) {
+  
+          if (!length) return 0;
+          var node = stream.node;
+          node.timestamp = Date.now();
+  
+          if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
+            if (canOwn) {
+              assert(position === 0, 'canOwn must imply no weird position inside the file');
+              node.contents = buffer.subarray(offset, offset + length);
+              node.usedBytes = length;
+              return length;
+            } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
+              node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
+              node.usedBytes = length;
+              return length;
+            } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
+              node.contents.set(buffer.subarray(offset, offset + length), position);
+              return length;
+            }
+          }
+  
+          // Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
+          MEMFS.expandFileStorage(node, position+length);
+          if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
+          else {
+            for (var i = 0; i < length; i++) {
+             node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
+            }
+          }
+          node.usedBytes = Math.max(node.usedBytes, position+length);
+          return length;
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              position += stream.node.usedBytes;
+            }
+          }
+          if (position < 0) {
+            throw new FS.ErrnoError(22);
+          }
+          return position;
+        },allocate:function (stream, offset, length) {
+          MEMFS.expandFileStorage(stream.node, offset + length);
+          stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
+        },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+          if (!FS.isFile(stream.node.mode)) {
+            throw new FS.ErrnoError(19);
+          }
+          var ptr;
+          var allocated;
+          var contents = stream.node.contents;
+          // Only make a new copy when MAP_PRIVATE is specified.
+          if ( !(flags & 2) &&
+                (contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
+            // We can't emulate MAP_SHARED when the file is not backed by the buffer
+            // we're mapping to (e.g. the HEAP buffer).
+            allocated = false;
+            ptr = contents.byteOffset;
+          } else {
+            // Try to avoid unnecessary slices.
+            if (position > 0 || position + length < stream.node.usedBytes) {
+              if (contents.subarray) {
+                contents = contents.subarray(position, position + length);
+              } else {
+                contents = Array.prototype.slice.call(contents, position, position + length);
+              }
+            }
+            allocated = true;
+            ptr = _malloc(length);
+            if (!ptr) {
+              throw new FS.ErrnoError(12);
+            }
+            buffer.set(contents, ptr);
+          }
+          return { ptr: ptr, allocated: allocated };
+        },msync:function (stream, buffer, offset, length, mmapFlags) {
+          if (!FS.isFile(stream.node.mode)) {
+            throw new FS.ErrnoError(19);
+          }
+          if (mmapFlags & 2) {
+            // MAP_PRIVATE calls need not to be synced back to underlying fs
+            return 0;
+          }
+  
+          var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
+          // should we check if bytesWritten and length are the same?
+          return 0;
+        }}};
+  
+  var IDBFS={dbs:{},indexedDB:function () {
+        if (typeof indexedDB !== 'undefined') return indexedDB;
+        var ret = null;
+        if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+        assert(ret, 'IDBFS used, but indexedDB not supported');
+        return ret;
+      },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
+        // reuse all of the core MEMFS functionality
+        return MEMFS.mount.apply(null, arguments);
+      },syncfs:function (mount, populate, callback) {
+        IDBFS.getLocalSet(mount, function(err, local) {
+          if (err) return callback(err);
+  
+          IDBFS.getRemoteSet(mount, function(err, remote) {
+            if (err) return callback(err);
+  
+            var src = populate ? remote : local;
+            var dst = populate ? local : remote;
+  
+            IDBFS.reconcile(src, dst, callback);
+          });
+        });
+      },getDB:function (name, callback) {
+        // check the cache first
+        var db = IDBFS.dbs[name];
+        if (db) {
+          return callback(null, db);
+        }
+  
+        var req;
+        try {
+          req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
+        } catch (e) {
+          return callback(e);
+        }
+        if (!req) {
+          return callback("Unable to connect to IndexedDB");
+        }
+        req.onupgradeneeded = function(e) {
+          var db = e.target.result;
+          var transaction = e.target.transaction;
+  
+          var fileStore;
+  
+          if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
+            fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
+          } else {
+            fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
+          }
+  
+          if (!fileStore.indexNames.contains('timestamp')) {
+            fileStore.createIndex('timestamp', 'timestamp', { unique: false });
+          }
+        };
+        req.onsuccess = function() {
+          db = req.result;
+  
+          // add to the cache
+          IDBFS.dbs[name] = db;
+          callback(null, db);
+        };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },getLocalSet:function (mount, callback) {
+        var entries = {};
+  
+        function isRealDir(p) {
+          return p !== '.' && p !== '..';
+        };
+        function toAbsolute(root) {
+          return function(p) {
+            return PATH.join2(root, p);
+          }
+        };
+  
+        var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
+  
+        while (check.length) {
+          var path = check.pop();
+          var stat;
+  
+          try {
+            stat = FS.stat(path);
+          } catch (e) {
+            return callback(e);
+          }
+  
+          if (FS.isDir(stat.mode)) {
+            check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
+          }
+  
+          entries[path] = { timestamp: stat.mtime };
+        }
+  
+        return callback(null, { type: 'local', entries: entries });
+      },getRemoteSet:function (mount, callback) {
+        var entries = {};
+  
+        IDBFS.getDB(mount.mountpoint, function(err, db) {
+          if (err) return callback(err);
+  
+          try {
+            var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
+            transaction.onerror = function(e) {
+              callback(this.error);
+              e.preventDefault();
+            };
+  
+            var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+            var index = store.index('timestamp');
+  
+            index.openKeyCursor().onsuccess = function(event) {
+              var cursor = event.target.result;
+  
+              if (!cursor) {
+                return callback(null, { type: 'remote', db: db, entries: entries });
+              }
+  
+              entries[cursor.primaryKey] = { timestamp: cursor.key };
+  
+              cursor.continue();
+            };
+          } catch (e) {
+            return callback(e);
+          }
+        });
+      },loadLocalEntry:function (path, callback) {
+        var stat, node;
+  
+        try {
+          var lookup = FS.lookupPath(path);
+          node = lookup.node;
+          stat = FS.stat(path);
+        } catch (e) {
+          return callback(e);
+        }
+  
+        if (FS.isDir(stat.mode)) {
+          return callback(null, { timestamp: stat.mtime, mode: stat.mode });
+        } else if (FS.isFile(stat.mode)) {
+          // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
+          // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
+          node.contents = MEMFS.getFileDataAsTypedArray(node);
+          return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
+        } else {
+          return callback(new Error('node type not supported'));
+        }
+      },storeLocalEntry:function (path, entry, callback) {
+        try {
+          if (FS.isDir(entry.mode)) {
+            FS.mkdir(path, entry.mode);
+          } else if (FS.isFile(entry.mode)) {
+            FS.writeFile(path, entry.contents, { canOwn: true });
+          } else {
+            return callback(new Error('node type not supported'));
+          }
+  
+          FS.chmod(path, entry.mode);
+          FS.utime(path, entry.timestamp, entry.timestamp);
+        } catch (e) {
+          return callback(e);
+        }
+  
+        callback(null);
+      },removeLocalEntry:function (path, callback) {
+        try {
+          var lookup = FS.lookupPath(path);
+          var stat = FS.stat(path);
+  
+          if (FS.isDir(stat.mode)) {
+            FS.rmdir(path);
+          } else if (FS.isFile(stat.mode)) {
+            FS.unlink(path);
+          }
+        } catch (e) {
+          return callback(e);
+        }
+  
+        callback(null);
+      },loadRemoteEntry:function (store, path, callback) {
+        var req = store.get(path);
+        req.onsuccess = function(event) { callback(null, event.target.result); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },storeRemoteEntry:function (store, path, entry, callback) {
+        var req = store.put(entry, path);
+        req.onsuccess = function() { callback(null); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },removeRemoteEntry:function (store, path, callback) {
+        var req = store.delete(path);
+        req.onsuccess = function() { callback(null); };
+        req.onerror = function(e) {
+          callback(this.error);
+          e.preventDefault();
+        };
+      },reconcile:function (src, dst, callback) {
+        var total = 0;
+  
+        var create = [];
+        Object.keys(src.entries).forEach(function (key) {
+          var e = src.entries[key];
+          var e2 = dst.entries[key];
+          if (!e2 || e.timestamp > e2.timestamp) {
+            create.push(key);
+            total++;
+          }
+        });
+  
+        var remove = [];
+        Object.keys(dst.entries).forEach(function (key) {
+          var e = dst.entries[key];
+          var e2 = src.entries[key];
+          if (!e2) {
+            remove.push(key);
+            total++;
+          }
+        });
+  
+        if (!total) {
+          return callback(null);
+        }
+  
+        var errored = false;
+        var completed = 0;
+        var db = src.type === 'remote' ? src.db : dst.db;
+        var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
+        var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
+  
+        function done(err) {
+          if (err) {
+            if (!done.errored) {
+              done.errored = true;
+              return callback(err);
+            }
+            return;
+          }
+          if (++completed >= total) {
+            return callback(null);
+          }
+        };
+  
+        transaction.onerror = function(e) {
+          done(this.error);
+          e.preventDefault();
+        };
+  
+        // sort paths in ascending order so directory entries are created
+        // before the files inside them
+        create.sort().forEach(function (path) {
+          if (dst.type === 'local') {
+            IDBFS.loadRemoteEntry(store, path, function (err, entry) {
+              if (err) return done(err);
+              IDBFS.storeLocalEntry(path, entry, done);
+            });
+          } else {
+            IDBFS.loadLocalEntry(path, function (err, entry) {
+              if (err) return done(err);
+              IDBFS.storeRemoteEntry(store, path, entry, done);
+            });
+          }
+        });
+  
+        // sort paths in descending order so files are deleted before their
+        // parent directories
+        remove.sort().reverse().forEach(function(path) {
+          if (dst.type === 'local') {
+            IDBFS.removeLocalEntry(path, done);
+          } else {
+            IDBFS.removeRemoteEntry(store, path, done);
+          }
+        });
+      }};
+  
+  var NODEFS={isWindows:false,staticInit:function () {
+        NODEFS.isWindows = !!process.platform.match(/^win/);
+        var flags = process["binding"]("constants");
+        // Node.js 4 compatibility: it has no namespaces for constants
+        if (flags["fs"]) {
+          flags = flags["fs"];
+        }
+        NODEFS.flagsForNodeMap = {
+          "1024": flags["O_APPEND"],
+          "64": flags["O_CREAT"],
+          "128": flags["O_EXCL"],
+          "0": flags["O_RDONLY"],
+          "2": flags["O_RDWR"],
+          "4096": flags["O_SYNC"],
+          "512": flags["O_TRUNC"],
+          "1": flags["O_WRONLY"]
+        };
+      },bufferFrom:function (arrayBuffer) {
+        // Node.js < 4.5 compatibility: Buffer.from does not support ArrayBuffer
+        // Buffer.from before 4.5 was just a method inherited from Uint8Array
+        // Buffer.alloc has been added with Buffer.from together, so check it instead
+        return Buffer.alloc ? Buffer.from(arrayBuffer) : new Buffer(arrayBuffer);
+      },mount:function (mount) {
+        assert(ENVIRONMENT_IS_NODE);
+        return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
+      },createNode:function (parent, name, mode, dev) {
+        if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
+          throw new FS.ErrnoError(22);
+        }
+        var node = FS.createNode(parent, name, mode);
+        node.node_ops = NODEFS.node_ops;
+        node.stream_ops = NODEFS.stream_ops;
+        return node;
+      },getMode:function (path) {
+        var stat;
+        try {
+          stat = fs.lstatSync(path);
+          if (NODEFS.isWindows) {
+            // Node.js on Windows never represents permission bit 'x', so
+            // propagate read bits to execute bits
+            stat.mode = stat.mode | ((stat.mode & 292) >> 2);
+          }
+        } catch (e) {
+          if (!e.code) throw e;
+          throw new FS.ErrnoError(-e.errno); // syscall errnos are negated, node's are not
+        }
+        return stat.mode;
+      },realPath:function (node) {
+        var parts = [];
+        while (node.parent !== node) {
+          parts.push(node.name);
+          node = node.parent;
+        }
+        parts.push(node.mount.opts.root);
+        parts.reverse();
+        return PATH.join.apply(null, parts);
+      },flagsForNode:function (flags) {
+        flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
+        flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
+        var newFlags = 0;
+        for (var k in NODEFS.flagsForNodeMap) {
+          if (flags & k) {
+            newFlags |= NODEFS.flagsForNodeMap[k];
+            flags ^= k;
+          }
+        }
+  
+        if (!flags) {
+          return newFlags;
+        } else {
+          throw new FS.ErrnoError(22);
+        }
+      },node_ops:{getattr:function (node) {
+          var path = NODEFS.realPath(node);
+          var stat;
+          try {
+            stat = fs.lstatSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+          // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
+          // See http://support.microsoft.com/kb/140365
+          if (NODEFS.isWindows && !stat.blksize) {
+            stat.blksize = 4096;
+          }
+          if (NODEFS.isWindows && !stat.blocks) {
+            stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
+          }
+          return {
+            dev: stat.dev,
+            ino: stat.ino,
+            mode: stat.mode,
+            nlink: stat.nlink,
+            uid: stat.uid,
+            gid: stat.gid,
+            rdev: stat.rdev,
+            size: stat.size,
+            atime: stat.atime,
+            mtime: stat.mtime,
+            ctime: stat.ctime,
+            blksize: stat.blksize,
+            blocks: stat.blocks
+          };
+        },setattr:function (node, attr) {
+          var path = NODEFS.realPath(node);
+          try {
+            if (attr.mode !== undefined) {
+              fs.chmodSync(path, attr.mode);
+              // update the common node structure mode as well
+              node.mode = attr.mode;
+            }
+            if (attr.timestamp !== undefined) {
+              var date = new Date(attr.timestamp);
+              fs.utimesSync(path, date, date);
+            }
+            if (attr.size !== undefined) {
+              fs.truncateSync(path, attr.size);
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },lookup:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          var mode = NODEFS.getMode(path);
+          return NODEFS.createNode(parent, name, mode);
+        },mknod:function (parent, name, mode, dev) {
+          var node = NODEFS.createNode(parent, name, mode, dev);
+          // create the backing node for this in the fs root as well
+          var path = NODEFS.realPath(node);
+          try {
+            if (FS.isDir(node.mode)) {
+              fs.mkdirSync(path, node.mode);
+            } else {
+              fs.writeFileSync(path, '', { mode: node.mode });
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+          return node;
+        },rename:function (oldNode, newDir, newName) {
+          var oldPath = NODEFS.realPath(oldNode);
+          var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
+          try {
+            fs.renameSync(oldPath, newPath);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },unlink:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          try {
+            fs.unlinkSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },rmdir:function (parent, name) {
+          var path = PATH.join2(NODEFS.realPath(parent), name);
+          try {
+            fs.rmdirSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },readdir:function (node) {
+          var path = NODEFS.realPath(node);
+          try {
+            return fs.readdirSync(path);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },symlink:function (parent, newName, oldPath) {
+          var newPath = PATH.join2(NODEFS.realPath(parent), newName);
+          try {
+            fs.symlinkSync(oldPath, newPath);
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },readlink:function (node) {
+          var path = NODEFS.realPath(node);
+          try {
+            path = fs.readlinkSync(path);
+            path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
+            return path;
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        }},stream_ops:{open:function (stream) {
+          var path = NODEFS.realPath(stream.node);
+          try {
+            if (FS.isFile(stream.node.mode)) {
+              stream.nfd = fs.openSync(path, NODEFS.flagsForNode(stream.flags));
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },close:function (stream) {
+          try {
+            if (FS.isFile(stream.node.mode) && stream.nfd) {
+              fs.closeSync(stream.nfd);
+            }
+          } catch (e) {
+            if (!e.code) throw e;
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },read:function (stream, buffer, offset, length, position) {
+          // Node.js < 6 compatibility: node errors on 0 length reads
+          if (length === 0) return 0;
+          try {
+            return fs.readSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+          } catch (e) {
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },write:function (stream, buffer, offset, length, position) {
+          try {
+            return fs.writeSync(stream.nfd, NODEFS.bufferFrom(buffer.buffer), offset, length, position);
+          } catch (e) {
+            throw new FS.ErrnoError(-e.errno);
+          }
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              try {
+                var stat = fs.fstatSync(stream.nfd);
+                position += stat.size;
+              } catch (e) {
+                throw new FS.ErrnoError(-e.errno);
+              }
+            }
+          }
+  
+          if (position < 0) {
+            throw new FS.ErrnoError(22);
+          }
+  
+          return position;
+        }}};
+  
+  var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
+        assert(ENVIRONMENT_IS_WORKER);
+        if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
+        var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
+        var createdParents = {};
+        function ensureParent(path) {
+          // return the parent node, creating subdirs as necessary
+          var parts = path.split('/');
+          var parent = root;
+          for (var i = 0; i < parts.length-1; i++) {
+            var curr = parts.slice(0, i+1).join('/');
+            // Issue 4254: Using curr as a node name will prevent the node
+            // from being found in FS.nameTable when FS.open is called on
+            // a path which holds a child of this node,
+            // given that all FS functions assume node names
+            // are just their corresponding parts within their given path,
+            // rather than incremental aggregates which include their parent's
+            // directories.
+            if (!createdParents[curr]) {
+              createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
+            }
+            parent = createdParents[curr];
+          }
+          return parent;
+        }
+        function base(path) {
+          var parts = path.split('/');
+          return parts[parts.length-1];
+        }
+        // We also accept FileList here, by using Array.prototype
+        Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
+          WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
+        });
+        (mount.opts["blobs"] || []).forEach(function(obj) {
+          WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
+        });
+        (mount.opts["packages"] || []).forEach(function(pack) {
+          pack['metadata'].files.forEach(function(file) {
+            var name = file.filename.substr(1); // remove initial slash
+            WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
+          });
+        });
+        return root;
+      },createNode:function (parent, name, mode, dev, contents, mtime) {
+        var node = FS.createNode(parent, name, mode);
+        node.mode = mode;
+        node.node_ops = WORKERFS.node_ops;
+        node.stream_ops = WORKERFS.stream_ops;
+        node.timestamp = (mtime || new Date).getTime();
+        assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
+        if (mode === WORKERFS.FILE_MODE) {
+          node.size = contents.size;
+          node.contents = contents;
+        } else {
+          node.size = 4096;
+          node.contents = {};
+        }
+        if (parent) {
+          parent.contents[name] = node;
+        }
+        return node;
+      },node_ops:{getattr:function (node) {
+          return {
+            dev: 1,
+            ino: undefined,
+            mode: node.mode,
+            nlink: 1,
+            uid: 0,
+            gid: 0,
+            rdev: undefined,
+            size: node.size,
+            atime: new Date(node.timestamp),
+            mtime: new Date(node.timestamp),
+            ctime: new Date(node.timestamp),
+            blksize: 4096,
+            blocks: Math.ceil(node.size / 4096),
+          };
+        },setattr:function (node, attr) {
+          if (attr.mode !== undefined) {
+            node.mode = attr.mode;
+          }
+          if (attr.timestamp !== undefined) {
+            node.timestamp = attr.timestamp;
+          }
+        },lookup:function (parent, name) {
+          throw new FS.ErrnoError(2);
+        },mknod:function (parent, name, mode, dev) {
+          throw new FS.ErrnoError(1);
+        },rename:function (oldNode, newDir, newName) {
+          throw new FS.ErrnoError(1);
+        },unlink:function (parent, name) {
+          throw new FS.ErrnoError(1);
+        },rmdir:function (parent, name) {
+          throw new FS.ErrnoError(1);
+        },readdir:function (node) {
+          var entries = ['.', '..'];
+          for (var key in node.contents) {
+            if (!node.contents.hasOwnProperty(key)) {
+              continue;
+            }
+            entries.push(key);
+          }
+          return entries;
+        },symlink:function (parent, newName, oldPath) {
+          throw new FS.ErrnoError(1);
+        },readlink:function (node) {
+          throw new FS.ErrnoError(1);
+        }},stream_ops:{read:function (stream, buffer, offset, length, position) {
+          if (position >= stream.node.size) return 0;
+          var chunk = stream.node.contents.slice(position, position + length);
+          var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
+          buffer.set(new Uint8Array(ab), offset);
+          return chunk.size;
+        },write:function (stream, buffer, offset, length, position) {
+          throw new FS.ErrnoError(5);
+        },llseek:function (stream, offset, whence) {
+          var position = offset;
+          if (whence === 1) {  // SEEK_CUR.
+            position += stream.position;
+          } else if (whence === 2) {  // SEEK_END.
+            if (FS.isFile(stream.node.mode)) {
+              position += stream.node.size;
+            }
+          }
+          if (position < 0) {
+            throw new FS.ErrnoError(22);
+          }
+          return position;
+        }}};
+  
+  var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can   access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
+  
+  var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
+        if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
+        return ___setErrNo(e.errno);
+      },lookupPath:function (path, opts) {
+        path = PATH.resolve(FS.cwd(), path);
+        opts = opts || {};
+  
+        if (!path) return { path: '', node: null };
+  
+        var defaults = {
+          follow_mount: true,
+          recurse_count: 0
+        };
+        for (var key in defaults) {
+          if (opts[key] === undefined) {
+            opts[key] = defaults[key];
+          }
+        }
+  
+        if (opts.recurse_count > 8) {  // max recursive lookup of 8
+          throw new FS.ErrnoError(40);
+        }
+  
+        // split the path
+        var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
+          return !!p;
+        }), false);
+  
+        // start at the root
+        var current = FS.root;
+        var current_path = '/';
+  
+        for (var i = 0; i < parts.length; i++) {
+          var islast = (i === parts.length-1);
+          if (islast && opts.parent) {
+            // stop resolving
+            break;
+          }
+  
+          current = FS.lookupNode(current, parts[i]);
+          current_path = PATH.join2(current_path, parts[i]);
+  
+          // jump to the mount's root node if this is a mountpoint
+          if (FS.isMountpoint(current)) {
+            if (!islast || (islast && opts.follow_mount)) {
+              current = current.mounted.root;
+            }
+          }
+  
+          // by default, lookupPath will not follow a symlink if it is the final path component.
+          // setting opts.follow = true will override this behavior.
+          if (!islast || opts.follow) {
+            var count = 0;
+            while (FS.isLink(current.mode)) {
+              var link = FS.readlink(current_path);
+              current_path = PATH.resolve(PATH.dirname(current_path), link);
+  
+              var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
+              current = lookup.node;
+  
+              if (count++ > 40) {  // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
+                throw new FS.ErrnoError(40);
+              }
+            }
+          }
+        }
+  
+        return { path: current_path, node: current };
+      },getPath:function (node) {
+        var path;
+        while (true) {
+          if (FS.isRoot(node)) {
+            var mount = node.mount.mountpoint;
+            if (!path) return mount;
+            return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
+          }
+          path = path ? node.name + '/' + path : node.name;
+          node = node.parent;
+        }
+      },hashName:function (parentid, name) {
+        var hash = 0;
+  
+  
+        for (var i = 0; i < name.length; i++) {
+          hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
+        }
+        return ((parentid + hash) >>> 0) % FS.nameTable.length;
+      },hashAddNode:function (node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        node.name_next = FS.nameTable[hash];
+        FS.nameTable[hash] = node;
+      },hashRemoveNode:function (node) {
+        var hash = FS.hashName(node.parent.id, node.name);
+        if (FS.nameTable[hash] === node) {
+          FS.nameTable[hash] = node.name_next;
+        } else {
+          var current = FS.nameTable[hash];
+          while (current) {
+            if (current.name_next === node) {
+              current.name_next = node.name_next;
+              break;
+            }
+            current = current.name_next;
+          }
+        }
+      },lookupNode:function (parent, name) {
+        var err = FS.mayLookup(parent);
+        if (err) {
+          throw new FS.ErrnoError(err, parent);
+        }
+        var hash = FS.hashName(parent.id, name);
+        for (var node = FS.nameTable[hash]; node; node = node.name_next) {
+          var nodeName = node.name;
+          if (node.parent.id === parent.id && nodeName === name) {
+            return node;
+          }
+        }
+        // if we failed to find it in the cache, call into the VFS
+        return FS.lookup(parent, name);
+      },createNode:function (parent, name, mode, rdev) {
+        if (!FS.FSNode) {
+          FS.FSNode = function(parent, name, mode, rdev) {
+            if (!parent) {
+              parent = this;  // root node sets parent to itself
+            }
+            this.parent = parent;
+            this.mount = parent.mount;
+            this.mounted = null;
+            this.id = FS.nextInode++;
+            this.name = name;
+            this.mode = mode;
+            this.node_ops = {};
+            this.stream_ops = {};
+            this.rdev = rdev;
+          };
+  
+          FS.FSNode.prototype = {};
+  
+          // compatibility
+          var readMode = 292 | 73;
+          var writeMode = 146;
+  
+          // NOTE we must use Object.defineProperties instead of individual calls to
+          // Object.defineProperty in order to make closure compiler happy
+          Object.defineProperties(FS.FSNode.prototype, {
+            read: {
+              get: function() { return (this.mode & readMode) === readMode; },
+              set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
+            },
+            write: {
+              get: function() { return (this.mode & writeMode) === writeMode; },
+              set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
+            },
+            isFolder: {
+              get: function() { return FS.isDir(this.mode); }
+            },
+            isDevice: {
+              get: function() { return FS.isChrdev(this.mode); }
+            }
+          });
+        }
+  
+        var node = new FS.FSNode(parent, name, mode, rdev);
+  
+        FS.hashAddNode(node);
+  
+        return node;
+      },destroyNode:function (node) {
+        FS.hashRemoveNode(node);
+      },isRoot:function (node) {
+        return node === node.parent;
+      },isMountpoint:function (node) {
+        return !!node.mounted;
+      },isFile:function (mode) {
+        return (mode & 61440) === 32768;
+      },isDir:function (mode) {
+        return (mode & 61440) === 16384;
+      },isLink:function (mode) {
+        return (mode & 61440) === 40960;
+      },isChrdev:function (mode) {
+        return (mode & 61440) === 8192;
+      },isBlkdev:function (mode) {
+        return (mode & 61440) === 24576;
+      },isFIFO:function (mode) {
+        return (mode & 61440) === 4096;
+      },isSocket:function (mode) {
+        return (mode & 49152) === 49152;
+      },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
+        var flags = FS.flagModes[str];
+        if (typeof flags === 'undefined') {
+          throw new Error('Unknown file open mode: ' + str);
+        }
+        return flags;
+      },flagsToPermissionString:function (flag) {
+        var perms = ['r', 'w', 'rw'][flag & 3];
+        if ((flag & 512)) {
+          perms += 'w';
+        }
+        return perms;
+      },nodePermissions:function (node, perms) {
+        if (FS.ignorePermissions) {
+          return 0;
+        }
+        // return 0 if any user, group or owner bits are set.
+        if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
+          return 13;
+        } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
+          return 13;
+        } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
+          return 13;
+        }
+        return 0;
+      },mayLookup:function (dir) {
+        var err = FS.nodePermissions(dir, 'x');
+        if (err) return err;
+        if (!dir.node_ops.lookup) return 13;
+        return 0;
+      },mayCreate:function (dir, name) {
+        try {
+          var node = FS.lookupNode(dir, name);
+          return 17;
+        } catch (e) {
+        }
+        return FS.nodePermissions(dir, 'wx');
+      },mayDelete:function (dir, name, isdir) {
+        var node;
+        try {
+          node = FS.lookupNode(dir, name);
+        } catch (e) {
+          return e.errno;
+        }
+        var err = FS.nodePermissions(dir, 'wx');
+        if (err) {
+          return err;
+        }
+        if (isdir) {
+          if (!FS.isDir(node.mode)) {
+            return 20;
+          }
+          if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
+            return 16;
+          }
+        } else {
+          if (FS.isDir(node.mode)) {
+            return 21;
+          }
+        }
+        return 0;
+      },mayOpen:function (node, flags) {
+        if (!node) {
+          return 2;
+        }
+        if (FS.isLink(node.mode)) {
+          return 40;
+        } else if (FS.isDir(node.mode)) {
+          if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
+              (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
+            return 21;
+          }
+        }
+        return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
+      },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
+        fd_start = fd_start || 0;
+        fd_end = fd_end || FS.MAX_OPEN_FDS;
+        for (var fd = fd_start; fd <= fd_end; fd++) {
+          if (!FS.streams[fd]) {
+            return fd;
+          }
+        }
+        throw new FS.ErrnoError(24);
+      },getStream:function (fd) {
+        return FS.streams[fd];
+      },createStream:function (stream, fd_start, fd_end) {
+        if (!FS.FSStream) {
+          FS.FSStream = function(){};
+          FS.FSStream.prototype = {};
+          // compatibility
+          Object.defineProperties(FS.FSStream.prototype, {
+            object: {
+              get: function() { return this.node; },
+              set: function(val) { this.node = val; }
+            },
+            isRead: {
+              get: function() { return (this.flags & 2097155) !== 1; }
+            },
+            isWrite: {
+              get: function() { return (this.flags & 2097155) !== 0; }
+            },
+            isAppend: {
+              get: function() { return (this.flags & 1024); }
+            }
+          });
+        }
+        // clone it, so we can return an instance of FSStream
+        var newStream = new FS.FSStream();
+        for (var p in stream) {
+          newStream[p] = stream[p];
+        }
+        stream = newStream;
+        var fd = FS.nextfd(fd_start, fd_end);
+        stream.fd = fd;
+        FS.streams[fd] = stream;
+        return stream;
+      },closeStream:function (fd) {
+        FS.streams[fd] = null;
+      },chrdev_stream_ops:{open:function (stream) {
+          var device = FS.getDevice(stream.node.rdev);
+          // override node's stream ops with the device's
+          stream.stream_ops = device.stream_ops;
+          // forward the open call
+          if (stream.stream_ops.open) {
+            stream.stream_ops.open(stream);
+          }
+        },llseek:function () {
+          throw new FS.ErrnoError(29);
+        }},major:function (dev) {
+        return ((dev) >> 8);
+      },minor:function (dev) {
+        return ((dev) & 0xff);
+      },makedev:function (ma, mi) {
+        return ((ma) << 8 | (mi));
+      },registerDevice:function (dev, ops) {
+        FS.devices[dev] = { stream_ops: ops };
+      },getDevice:function (dev) {
+        return FS.devices[dev];
+      },getMounts:function (mount) {
+        var mounts = [];
+        var check = [mount];
+  
+        while (check.length) {
+          var m = check.pop();
+  
+          mounts.push(m);
+  
+          check.push.apply(check, m.mounts);
+        }
+  
+        return mounts;
+      },syncfs:function (populate, callback) {
+        if (typeof(populate) === 'function') {
+          callback = populate;
+          populate = false;
+        }
+  
+        FS.syncFSRequests++;
+  
+        if (FS.syncFSRequests > 1) {
+          console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
+        }
+  
+        var mounts = FS.getMounts(FS.root.mount);
+        var completed = 0;
+  
+        function doCallback(err) {
+          assert(FS.syncFSRequests > 0);
+          FS.syncFSRequests--;
+          return callback(err);
+        }
+  
+        function done(err) {
+          if (err) {
+            if (!done.errored) {
+              done.errored = true;
+              return doCallback(err);
+            }
+            return;
+          }
+          if (++completed >= mounts.length) {
+            doCallback(null);
+          }
+        };
+  
+        // sync all mounts
+        mounts.forEach(function (mount) {
+          if (!mount.type.syncfs) {
+            return done(null);
+          }
+          mount.type.syncfs(mount, populate, done);
+        });
+      },mount:function (type, opts, mountpoint) {
+        var root = mountpoint === '/';
+        var pseudo = !mountpoint;
+        var node;
+  
+        if (root && FS.root) {
+          throw new FS.ErrnoError(16);
+        } else if (!root && !pseudo) {
+          var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+          mountpoint = lookup.path;  // use the absolute path
+          node = lookup.node;
+  
+          if (FS.isMountpoint(node)) {
+            throw new FS.ErrnoError(16);
+          }
+  
+          if (!FS.isDir(node.mode)) {
+            throw new FS.ErrnoError(20);
+          }
+        }
+  
+        var mount = {
+          type: type,
+          opts: opts,
+          mountpoint: mountpoint,
+          mounts: []
+        };
+  
+        // create a root node for the fs
+        var mountRoot = type.mount(mount);
+        mountRoot.mount = mount;
+        mount.root = mountRoot;
+  
+        if (root) {
+          FS.root = mountRoot;
+        } else if (node) {
+          // set as a mountpoint
+          node.mounted = mount;
+  
+          // add the new mount to the current mount's children
+          if (node.mount) {
+            node.mount.mounts.push(mount);
+          }
+        }
+  
+        return mountRoot;
+      },unmount:function (mountpoint) {
+        var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
+  
+        if (!FS.isMountpoint(lookup.node)) {
+          throw new FS.ErrnoError(22);
+        }
+  
+        // destroy the nodes for this mount, and all its child mounts
+        var node = lookup.node;
+        var mount = node.mounted;
+        var mounts = FS.getMounts(mount);
+  
+        Object.keys(FS.nameTable).forEach(function (hash) {
+          var current = FS.nameTable[hash];
+  
+          while (current) {
+            var next = current.name_next;
+  
+            if (mounts.indexOf(current.mount) !== -1) {
+              FS.destroyNode(current);
+            }
+  
+            current = next;
+          }
+        });
+  
+        // no longer a mountpoint
+        node.mounted = null;
+  
+        // remove this mount from the child mounts
+        var idx = node.mount.mounts.indexOf(mount);
+        assert(idx !== -1);
+        node.mount.mounts.splice(idx, 1);
+      },lookup:function (parent, name) {
+        return parent.node_ops.lookup(parent, name);
+      },mknod:function (path, mode, dev) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        if (!name || name === '.' || name === '..') {
+          throw new FS.ErrnoError(22);
+        }
+        var err = FS.mayCreate(parent, name);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.mknod) {
+          throw new FS.ErrnoError(1);
+        }
+        return parent.node_ops.mknod(parent, name, mode, dev);
+      },create:function (path, mode) {
+        mode = mode !== undefined ? mode : 438 /* 0666 */;
+        mode &= 4095;
+        mode |= 32768;
+        return FS.mknod(path, mode, 0);
+      },mkdir:function (path, mode) {
+        mode = mode !== undefined ? mode : 511 /* 0777 */;
+        mode &= 511 | 512;
+        mode |= 16384;
+        return FS.mknod(path, mode, 0);
+      },mkdirTree:function (path, mode) {
+        var dirs = path.split('/');
+        var d = '';
+        for (var i = 0; i < dirs.length; ++i) {
+          if (!dirs[i]) continue;
+          d += '/' + dirs[i];
+          try {
+            FS.mkdir(d, mode);
+          } catch(e) {
+            if (e.errno != 17) throw e;
+          }
+        }
+      },mkdev:function (path, mode, dev) {
+        if (typeof(dev) === 'undefined') {
+          dev = mode;
+          mode = 438 /* 0666 */;
+        }
+        mode |= 8192;
+        return FS.mknod(path, mode, dev);
+      },symlink:function (oldpath, newpath) {
+        if (!PATH.resolve(oldpath)) {
+          throw new FS.ErrnoError(2);
+        }
+        var lookup = FS.lookupPath(newpath, { parent: true });
+        var parent = lookup.node;
+        if (!parent) {
+          throw new FS.ErrnoError(2);
+        }
+        var newname = PATH.basename(newpath);
+        var err = FS.mayCreate(parent, newname);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.symlink) {
+          throw new FS.ErrnoError(1);
+        }
+        return parent.node_ops.symlink(parent, newname, oldpath);
+      },rename:function (old_path, new_path) {
+        var old_dirname = PATH.dirname(old_path);
+        var new_dirname = PATH.dirname(new_path);
+        var old_name = PATH.basename(old_path);
+        var new_name = PATH.basename(new_path);
+        // parents must exist
+        var lookup, old_dir, new_dir;
+        try {
+          lookup = FS.lookupPath(old_path, { parent: true });
+          old_dir = lookup.node;
+          lookup = FS.lookupPath(new_path, { parent: true });
+          new_dir = lookup.node;
+        } catch (e) {
+          throw new FS.ErrnoError(16);
+        }
+        if (!old_dir || !new_dir) throw new FS.ErrnoError(2);
+        // need to be part of the same mount
+        if (old_dir.mount !== new_dir.mount) {
+          throw new FS.ErrnoError(18);
+        }
+        // source must exist
+        var old_node = FS.lookupNode(old_dir, old_name);
+        // old path should not be an ancestor of the new path
+        var relative = PATH.relative(old_path, new_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(22);
+        }
+        // new path should not be an ancestor of the old path
+        relative = PATH.relative(new_path, old_dirname);
+        if (relative.charAt(0) !== '.') {
+          throw new FS.ErrnoError(39);
+        }
+        // see if the new path already exists
+        var new_node;
+        try {
+          new_node = FS.lookupNode(new_dir, new_name);
+        } catch (e) {
+          // not fatal
+        }
+        // early out if nothing needs to change
+        if (old_node === new_node) {
+          return;
+        }
+        // we'll need to delete the old entry
+        var isdir = FS.isDir(old_node.mode);
+        var err = FS.mayDelete(old_dir, old_name, isdir);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        // need delete permissions if we'll be overwriting.
+        // need create permissions if new doesn't already exist.
+        err = new_node ?
+          FS.mayDelete(new_dir, new_name, isdir) :
+          FS.mayCreate(new_dir, new_name);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!old_dir.node_ops.rename) {
+          throw new FS.ErrnoError(1);
+        }
+        if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
+          throw new FS.ErrnoError(16);
+        }
+        // if we are going to change the parent, check write permissions
+        if (new_dir !== old_dir) {
+          err = FS.nodePermissions(old_dir, 'w');
+          if (err) {
+            throw new FS.ErrnoError(err);
+          }
+        }
+        try {
+          if (FS.trackingDelegate['willMovePath']) {
+            FS.trackingDelegate['willMovePath'](old_path, new_path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+        }
+        // remove the node from the lookup hash
+        FS.hashRemoveNode(old_node);
+        // do the underlying fs rename
+        try {
+          old_dir.node_ops.rename(old_node, new_dir, new_name);
+        } catch (e) {
+          throw e;
+        } finally {
+          // add the node back to the hash (in case node_ops.rename
+          // changed its name)
+          FS.hashAddNode(old_node);
+        }
+        try {
+          if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
+        }
+      },rmdir:function (path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var err = FS.mayDelete(parent, name, true);
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.rmdir) {
+          throw new FS.ErrnoError(1);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(16);
+        }
+        try {
+          if (FS.trackingDelegate['willDeletePath']) {
+            FS.trackingDelegate['willDeletePath'](path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+        parent.node_ops.rmdir(parent, name);
+        FS.destroyNode(node);
+        try {
+          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+      },readdir:function (path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        if (!node.node_ops.readdir) {
+          throw new FS.ErrnoError(20);
+        }
+        return node.node_ops.readdir(node);
+      },unlink:function (path) {
+        var lookup = FS.lookupPath(path, { parent: true });
+        var parent = lookup.node;
+        var name = PATH.basename(path);
+        var node = FS.lookupNode(parent, name);
+        var err = FS.mayDelete(parent, name, false);
+        if (err) {
+          // According to POSIX, we should map EISDIR to EPERM, but
+          // we instead do what Linux does (and we must, as we use
+          // the musl linux libc).
+          throw new FS.ErrnoError(err);
+        }
+        if (!parent.node_ops.unlink) {
+          throw new FS.ErrnoError(1);
+        }
+        if (FS.isMountpoint(node)) {
+          throw new FS.ErrnoError(16);
+        }
+        try {
+          if (FS.trackingDelegate['willDeletePath']) {
+            FS.trackingDelegate['willDeletePath'](path);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+        parent.node_ops.unlink(parent, name);
+        FS.destroyNode(node);
+        try {
+          if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
+        }
+      },readlink:function (path) {
+        var lookup = FS.lookupPath(path);
+        var link = lookup.node;
+        if (!link) {
+          throw new FS.ErrnoError(2);
+        }
+        if (!link.node_ops.readlink) {
+          throw new FS.ErrnoError(22);
+        }
+        return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
+      },stat:function (path, dontFollow) {
+        var lookup = FS.lookupPath(path, { follow: !dontFollow });
+        var node = lookup.node;
+        if (!node) {
+          throw new FS.ErrnoError(2);
+        }
+        if (!node.node_ops.getattr) {
+          throw new FS.ErrnoError(1);
+        }
+        return node.node_ops.getattr(node);
+      },lstat:function (path) {
+        return FS.stat(path, true);
+      },chmod:function (path, mode, dontFollow) {
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(1);
+        }
+        node.node_ops.setattr(node, {
+          mode: (mode & 4095) | (node.mode & ~4095),
+          timestamp: Date.now()
+        });
+      },lchmod:function (path, mode) {
+        FS.chmod(path, mode, true);
+      },fchmod:function (fd, mode) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(9);
+        }
+        FS.chmod(stream.node, mode);
+      },chown:function (path, uid, gid, dontFollow) {
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: !dontFollow });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(1);
+        }
+        node.node_ops.setattr(node, {
+          timestamp: Date.now()
+          // we ignore the uid / gid for now
+        });
+      },lchown:function (path, uid, gid) {
+        FS.chown(path, uid, gid, true);
+      },fchown:function (fd, uid, gid) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(9);
+        }
+        FS.chown(stream.node, uid, gid);
+      },truncate:function (path, len) {
+        if (len < 0) {
+          throw new FS.ErrnoError(22);
+        }
+        var node;
+        if (typeof path === 'string') {
+          var lookup = FS.lookupPath(path, { follow: true });
+          node = lookup.node;
+        } else {
+          node = path;
+        }
+        if (!node.node_ops.setattr) {
+          throw new FS.ErrnoError(1);
+        }
+        if (FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(21);
+        }
+        if (!FS.isFile(node.mode)) {
+          throw new FS.ErrnoError(22);
+        }
+        var err = FS.nodePermissions(node, 'w');
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        node.node_ops.setattr(node, {
+          size: len,
+          timestamp: Date.now()
+        });
+      },ftruncate:function (fd, len) {
+        var stream = FS.getStream(fd);
+        if (!stream) {
+          throw new FS.ErrnoError(9);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(22);
+        }
+        FS.truncate(stream.node, len);
+      },utime:function (path, atime, mtime) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        var node = lookup.node;
+        node.node_ops.setattr(node, {
+          timestamp: Math.max(atime, mtime)
+        });
+      },open:function (path, flags, mode, fd_start, fd_end) {
+        if (path === "") {
+          throw new FS.ErrnoError(2);
+        }
+        flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
+        mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
+        if ((flags & 64)) {
+          mode = (mode & 4095) | 32768;
+        } else {
+          mode = 0;
+        }
+        var node;
+        if (typeof path === 'object') {
+          node = path;
+        } else {
+          path = PATH.normalize(path);
+          try {
+            var lookup = FS.lookupPath(path, {
+              follow: !(flags & 131072)
+            });
+            node = lookup.node;
+          } catch (e) {
+            // ignore
+          }
+        }
+        // perhaps we need to create the node
+        var created = false;
+        if ((flags & 64)) {
+          if (node) {
+            // if O_CREAT and O_EXCL are set, error out if the node already exists
+            if ((flags & 128)) {
+              throw new FS.ErrnoError(17);
+            }
+          } else {
+            // node doesn't exist, try to create it
+            node = FS.mknod(path, mode, 0);
+            created = true;
+          }
+        }
+        if (!node) {
+          throw new FS.ErrnoError(2);
+        }
+        // can't truncate a device
+        if (FS.isChrdev(node.mode)) {
+          flags &= ~512;
+        }
+        // if asked only for a directory, then this must be one
+        if ((flags & 65536) && !FS.isDir(node.mode)) {
+          throw new FS.ErrnoError(20);
+        }
+        // check permissions, if this is not a file we just created now (it is ok to
+        // create and write to a file with read-only permissions; it is read-only
+        // for later use)
+        if (!created) {
+          var err = FS.mayOpen(node, flags);
+          if (err) {
+            throw new FS.ErrnoError(err);
+          }
+        }
+        // do truncation if necessary
+        if ((flags & 512)) {
+          FS.truncate(node, 0);
+        }
+        // we've already handled these, don't pass down to the underlying vfs
+        flags &= ~(128 | 512);
+  
+        // register the stream with the filesystem
+        var stream = FS.createStream({
+          node: node,
+          path: FS.getPath(node),  // we want the absolute path to the node
+          flags: flags,
+          seekable: true,
+          position: 0,
+          stream_ops: node.stream_ops,
+          // used by the file family libc calls (fopen, fwrite, ferror, etc.)
+          ungotten: [],
+          error: false
+        }, fd_start, fd_end);
+        // call the new stream's open function
+        if (stream.stream_ops.open) {
+          stream.stream_ops.open(stream);
+        }
+        if (Module['logReadFiles'] && !(flags & 1)) {
+          if (!FS.readFiles) FS.readFiles = {};
+          if (!(path in FS.readFiles)) {
+            FS.readFiles[path] = 1;
+            console.log("FS.trackingDelegate error on read file: " + path);
+          }
+        }
+        try {
+          if (FS.trackingDelegate['onOpenFile']) {
+            var trackingFlags = 0;
+            if ((flags & 2097155) !== 1) {
+              trackingFlags |= FS.tracking.openFlags.READ;
+            }
+            if ((flags & 2097155) !== 0) {
+              trackingFlags |= FS.tracking.openFlags.WRITE;
+            }
+            FS.trackingDelegate['onOpenFile'](path, trackingFlags);
+          }
+        } catch(e) {
+          console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
+        }
+        return stream;
+      },close:function (stream) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(9);
+        }
+        if (stream.getdents) stream.getdents = null; // free readdir state
+        try {
+          if (stream.stream_ops.close) {
+            stream.stream_ops.close(stream);
+          }
+        } catch (e) {
+          throw e;
+        } finally {
+          FS.closeStream(stream.fd);
+        }
+        stream.fd = null;
+      },isClosed:function (stream) {
+        return stream.fd === null;
+      },llseek:function (stream, offset, whence) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(9);
+        }
+        if (!stream.seekable || !stream.stream_ops.llseek) {
+          throw new FS.ErrnoError(29);
+        }
+        if (whence != 0 /* SEEK_SET */ && whence != 1 /* SEEK_CUR */ && whence != 2 /* SEEK_END */) {
+          throw new FS.ErrnoError(22);
+        }
+        stream.position = stream.stream_ops.llseek(stream, offset, whence);
+        stream.ungotten = [];
+        return stream.position;
+      },read:function (stream, buffer, offset, length, position) {
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(22);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(9);
+        }
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(9);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(21);
+        }
+        if (!stream.stream_ops.read) {
+          throw new FS.ErrnoError(22);
+        }
+        var seeking = typeof position !== 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(29);
+        }
+        var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
+        if (!seeking) stream.position += bytesRead;
+        return bytesRead;
+      },write:function (stream, buffer, offset, length, position, canOwn) {
+        if (length < 0 || position < 0) {
+          throw new FS.ErrnoError(22);
+        }
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(9);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(9);
+        }
+        if (FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(21);
+        }
+        if (!stream.stream_ops.write) {
+          throw new FS.ErrnoError(22);
+        }
+        if (stream.flags & 1024) {
+          // seek to the end before writing in append mode
+          FS.llseek(stream, 0, 2);
+        }
+        var seeking = typeof position !== 'undefined';
+        if (!seeking) {
+          position = stream.position;
+        } else if (!stream.seekable) {
+          throw new FS.ErrnoError(29);
+        }
+        var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
+        if (!seeking) stream.position += bytesWritten;
+        try {
+          if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
+        } catch(e) {
+          console.log("FS.trackingDelegate['onWriteToFile']('"+stream.path+"') threw an exception: " + e.message);
+        }
+        return bytesWritten;
+      },allocate:function (stream, offset, length) {
+        if (FS.isClosed(stream)) {
+          throw new FS.ErrnoError(9);
+        }
+        if (offset < 0 || length <= 0) {
+          throw new FS.ErrnoError(22);
+        }
+        if ((stream.flags & 2097155) === 0) {
+          throw new FS.ErrnoError(9);
+        }
+        if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) {
+          throw new FS.ErrnoError(19);
+        }
+        if (!stream.stream_ops.allocate) {
+          throw new FS.ErrnoError(95);
+        }
+        stream.stream_ops.allocate(stream, offset, length);
+      },mmap:function (stream, buffer, offset, length, position, prot, flags) {
+        // TODO if PROT is PROT_WRITE, make sure we have write access
+        if ((stream.flags & 2097155) === 1) {
+          throw new FS.ErrnoError(13);
+        }
+        if (!stream.stream_ops.mmap) {
+          throw new FS.ErrnoError(19);
+        }
+        return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
+      },msync:function (stream, buffer, offset, length, mmapFlags) {
+        if (!stream || !stream.stream_ops.msync) {
+          return 0;
+        }
+        return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
+      },munmap:function (stream) {
+        return 0;
+      },ioctl:function (stream, cmd, arg) {
+        if (!stream.stream_ops.ioctl) {
+          throw new FS.ErrnoError(25);
+        }
+        return stream.stream_ops.ioctl(stream, cmd, arg);
+      },readFile:function (path, opts) {
+        opts = opts || {};
+        opts.flags = opts.flags || 'r';
+        opts.encoding = opts.encoding || 'binary';
+        if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
+          throw new Error('Invalid encoding type "' + opts.encoding + '"');
+        }
+        var ret;
+        var stream = FS.open(path, opts.flags);
+        var stat = FS.stat(path);
+        var length = stat.size;
+        var buf = new Uint8Array(length);
+        FS.read(stream, buf, 0, length, 0);
+        if (opts.encoding === 'utf8') {
+          ret = UTF8ArrayToString(buf, 0);
+        } else if (opts.encoding === 'binary') {
+          ret = buf;
+        }
+        FS.close(stream);
+        return ret;
+      },writeFile:function (path, data, opts) {
+        opts = opts || {};
+        opts.flags = opts.flags || 'w';
+        var stream = FS.open(path, opts.flags, opts.mode);
+        if (typeof data === 'string') {
+          var buf = new Uint8Array(lengthBytesUTF8(data)+1);
+          var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
+          FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn);
+        } else if (ArrayBuffer.isView(data)) {
+          FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn);
+        } else {
+          throw new Error('Unsupported data type');
+        }
+        FS.close(stream);
+      },cwd:function () {
+        return FS.currentPath;
+      },chdir:function (path) {
+        var lookup = FS.lookupPath(path, { follow: true });
+        if (lookup.node === null) {
+          throw new FS.ErrnoError(2);
+        }
+        if (!FS.isDir(lookup.node.mode)) {
+          throw new FS.ErrnoError(20);
+        }
+        var err = FS.nodePermissions(lookup.node, 'x');
+        if (err) {
+          throw new FS.ErrnoError(err);
+        }
+        FS.currentPath = lookup.path;
+      },createDefaultDirectories:function () {
+        FS.mkdir('/tmp');
+        FS.mkdir('/home');
+        FS.mkdir('/home/web_user');
+      },createDefaultDevices:function () {
+        // create /dev
+        FS.mkdir('/dev');
+        // setup /dev/null
+        FS.registerDevice(FS.makedev(1, 3), {
+          read: function() { return 0; },
+          write: function(stream, buffer, offset, length, pos) { return length; }
+        });
+        FS.mkdev('/dev/null', FS.makedev(1, 3));
+        // setup /dev/tty and /dev/tty1
+        // stderr needs to print output using Module['printErr']
+        // so we register a second tty just for it.
+        TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
+        TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
+        FS.mkdev('/dev/tty', FS.makedev(5, 0));
+        FS.mkdev('/dev/tty1', FS.makedev(6, 0));
+        // setup /dev/[u]random
+        var random_device;
+        if (typeof crypto === 'object' && typeof crypto['getRandomValues'] === 'function') {
+          // for modern web browsers
+          var randomBuffer = new Uint8Array(1);
+          random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
+        } else
+        if (ENVIRONMENT_IS_NODE) {
+          // for nodejs with or without crypto support included
+          try {
+            var crypto_module = require('crypto');
+            // nodejs has crypto support
+            random_device = function() { return crypto_module['randomBytes'](1)[0]; };
+          } catch (e) {
+            // nodejs doesn't have crypto support
+          }
+        } else
+        {}
+        if (!random_device) {
+          // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096
+          random_device = function() { abort("no cryptographic support found for random_device. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); };
+        }
+        FS.createDevice('/dev', 'random', random_device);
+        FS.createDevice('/dev', 'urandom', random_device);
+        // we're not going to emulate the actual shm device,
+        // just create the tmp dirs that reside in it commonly
+        FS.mkdir('/dev/shm');
+        FS.mkdir('/dev/shm/tmp');
+      },createSpecialDirectories:function () {
+        // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
+        FS.mkdir('/proc');
+        FS.mkdir('/proc/self');
+        FS.mkdir('/proc/self/fd');
+        FS.mount({
+          mount: function() {
+            var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
+            node.node_ops = {
+              lookup: function(parent, name) {
+                var fd = +name;
+                var stream = FS.getStream(fd);
+                if (!stream) throw new FS.ErrnoError(9);
+                var ret = {
+                  parent: null,
+                  mount: { mountpoint: 'fake' },
+                  node_ops: { readlink: function() { return stream.path } }
+                };
+                ret.parent = ret; // make it look like a simple root node
+                return ret;
+              }
+            };
+            return node;
+          }
+        }, {}, '/proc/self/fd');
+      },createStandardStreams:function () {
+        // TODO deprecate the old functionality of a single
+        // input / output callback and that utilizes FS.createDevice
+        // and instead require a unique set of stream ops
+  
+        // by default, we symlink the standard streams to the
+        // default tty devices. however, if the standard streams
+        // have been overwritten we create a unique device for
+        // them instead.
+        if (Module['stdin']) {
+          FS.createDevice('/dev', 'stdin', Module['stdin']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdin');
+        }
+        if (Module['stdout']) {
+          FS.createDevice('/dev', 'stdout', null, Module['stdout']);
+        } else {
+          FS.symlink('/dev/tty', '/dev/stdout');
+        }
+        if (Module['stderr']) {
+          FS.createDevice('/dev', 'stderr', null, Module['stderr']);
+        } else {
+          FS.symlink('/dev/tty1', '/dev/stderr');
+        }
+  
+        // open default streams for the stdin, stdout and stderr devices
+        var stdin = FS.open('/dev/stdin', 'r');
+        var stdout = FS.open('/dev/stdout', 'w');
+        var stderr = FS.open('/dev/stderr', 'w');
+        assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
+        assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
+        assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
+      },ensureErrnoError:function () {
+        if (FS.ErrnoError) return;
+        FS.ErrnoError = function ErrnoError(errno, node) {
+          this.node = node;
+          this.setErrno = function(errno) {
+            this.errno = errno;
+            for (var key in ERRNO_CODES) {
+              if (ERRNO_CODES[key] === errno) {
+                this.code = key;
+                break;
+              }
+            }
+          };
+          this.setErrno(errno);
+          this.message = ERRNO_MESSAGES[errno];
+          // Node.js compatibility: assigning on this.stack fails on Node 4 (but fixed on Node 8)
+          if (this.stack) Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true });
+          if (this.stack) this.stack = demangleAll(this.stack);
+        };
+        FS.ErrnoError.prototype = new Error();
+        FS.ErrnoError.prototype.constructor = FS.ErrnoError;
+        // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
+        [2].forEach(function(code) {
+          FS.genericErrors[code] = new FS.ErrnoError(code);
+          FS.genericErrors[code].stack = '<generic error, no stack>';
+        });
+      },staticInit:function () {
+        FS.ensureErrnoError();
+  
+        FS.nameTable = new Array(4096);
+  
+        FS.mount(MEMFS, {}, '/');
+  
+        FS.createDefaultDirectories();
+        FS.createDefaultDevices();
+        FS.createSpecialDirectories();
+  
+        FS.filesystems = {
+          'MEMFS': MEMFS,
+          'IDBFS': IDBFS,
+          'NODEFS': NODEFS,
+          'WORKERFS': WORKERFS,
+        };
+      },init:function (input, output, error) {
+        assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
+        FS.init.initialized = true;
+  
+        FS.ensureErrnoError();
+  
+        // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
+        Module['stdin'] = input || Module['stdin'];
+        Module['stdout'] = output || Module['stdout'];
+        Module['stderr'] = error || Module['stderr'];
+  
+        FS.createStandardStreams();
+      },quit:function () {
+        FS.init.initialized = false;
+        // force-flush all streams, so we get musl std streams printed out
+        var fflush = Module['_fflush'];
+        if (fflush) fflush(0);
+        // close all of our streams
+        for (var i = 0; i < FS.streams.length; i++) {
+          var stream = FS.streams[i];
+          if (!stream) {
+            continue;
+          }
+          FS.close(stream);
+        }
+      },getMode:function (canRead, canWrite) {
+        var mode = 0;
+        if (canRead) mode |= 292 | 73;
+        if (canWrite) mode |= 146;
+        return mode;
+      },joinPath:function (parts, forceRelative) {
+        var path = PATH.join.apply(null, parts);
+        if (forceRelative && path[0] == '/') path = path.substr(1);
+        return path;
+      },absolutePath:function (relative, base) {
+        return PATH.resolve(base, relative);
+      },standardizePath:function (path) {
+        return PATH.normalize(path);
+      },findObject:function (path, dontResolveLastLink) {
+        var ret = FS.analyzePath(path, dontResolveLastLink);
+        if (ret.exists) {
+          return ret.object;
+        } else {
+          ___setErrNo(ret.error);
+          return null;
+        }
+      },analyzePath:function (path, dontResolveLastLink) {
+        // operate from within the context of the symlink's target
+        try {
+          var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          path = lookup.path;
+        } catch (e) {
+        }
+        var ret = {
+          isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
+          parentExists: false, parentPath: null, parentObject: null
+        };
+        try {
+          var lookup = FS.lookupPath(path, { parent: true });
+          ret.parentExists = true;
+          ret.parentPath = lookup.path;
+          ret.parentObject = lookup.node;
+          ret.name = PATH.basename(path);
+          lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
+          ret.exists = true;
+          ret.path = lookup.path;
+          ret.object = lookup.node;
+          ret.name = lookup.node.name;
+          ret.isRoot = lookup.path === '/';
+        } catch (e) {
+          ret.error = e.errno;
+        };
+        return ret;
+      },createFolder:function (parent, name, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(canRead, canWrite);
+        return FS.mkdir(path, mode);
+      },createPath:function (parent, path, canRead, canWrite) {
+        parent = typeof parent === 'string' ? parent : FS.getPath(parent);
+        var parts = path.split('/').reverse();
+        while (parts.length) {
+          var part = parts.pop();
+          if (!part) continue;
+          var current = PATH.join2(parent, part);
+          try {
+            FS.mkdir(current);
+          } catch (e) {
+            // ignore EEXIST
+          }
+          parent = current;
+        }
+        return current;
+      },createFile:function (parent, name, properties, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(canRead, canWrite);
+        return FS.create(path, mode);
+      },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
+        var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
+        var mode = FS.getMode(canRead, canWrite);
+        var node = FS.create(path, mode);
+        if (data) {
+          if (typeof data === 'string') {
+            var arr = new Array(data.length);
+            for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
+            data = arr;
+          }
+          // make sure we can write to the file
+          FS.chmod(node, mode | 146);
+          var stream = FS.open(node, 'w');
+          FS.write(stream, data, 0, data.length, 0, canOwn);
+          FS.close(stream);
+          FS.chmod(node, mode);
+        }
+        return node;
+      },createDevice:function (parent, name, input, output) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        var mode = FS.getMode(!!input, !!output);
+        if (!FS.createDevice.major) FS.createDevice.major = 64;
+        var dev = FS.makedev(FS.createDevice.major++, 0);
+        // Create a fake device that a set of stream ops to emulate
+        // the old behavior.
+        FS.registerDevice(dev, {
+          open: function(stream) {
+            stream.seekable = false;
+          },
+          close: function(stream) {
+            // flush any pending line data
+            if (output && output.buffer && output.buffer.length) {
+              output(10);
+            }
+          },
+          read: function(stream, buffer, offset, length, pos /* ignored */) {
+            var bytesRead = 0;
+            for (var i = 0; i < length; i++) {
+              var result;
+              try {
+                result = input();
+              } catch (e) {
+                throw new FS.ErrnoError(5);
+              }
+              if (result === undefined && bytesRead === 0) {
+                throw new FS.ErrnoError(11);
+              }
+              if (result === null || result === undefined) break;
+              bytesRead++;
+              buffer[offset+i] = result;
+            }
+            if (bytesRead) {
+              stream.node.timestamp = Date.now();
+            }
+            return bytesRead;
+          },
+          write: function(stream, buffer, offset, length, pos) {
+            for (var i = 0; i < length; i++) {
+              try {
+                output(buffer[offset+i]);
+              } catch (e) {
+                throw new FS.ErrnoError(5);
+              }
+            }
+            if (length) {
+              stream.node.timestamp = Date.now();
+            }
+            return i;
+          }
+        });
+        return FS.mkdev(path, mode, dev);
+      },createLink:function (parent, name, target, canRead, canWrite) {
+        var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
+        return FS.symlink(target, path);
+      },forceLoadFile:function (obj) {
+        if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
+        var success = true;
+        if (typeof XMLHttpRequest !== 'undefined') {
+          throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
+        } else if (Module['read']) {
+          // Command-line.
+          try {
+            // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
+            //          read() will try to parse UTF8.
+            obj.contents = intArrayFromString(Module['read'](obj.url), true);
+            obj.usedBytes = obj.contents.length;
+          } catch (e) {
+            success = false;
+          }
+        } else {
+          throw new Error('Cannot load without read() or XMLHttpRequest.');
+        }
+        if (!success) ___setErrNo(5);
+        return success;
+      },createLazyFile:function (parent, name, url, canRead, canWrite) {
+        // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
+        function LazyUint8Array() {
+          this.lengthKnown = false;
+          this.chunks = []; // Loaded chunks. Index is the chunk number
+        }
+        LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
+          if (idx > this.length-1 || idx < 0) {
+            return undefined;
+          }
+          var chunkOffset = idx % this.chunkSize;
+          var chunkNum = (idx / this.chunkSize)|0;
+          return this.getter(chunkNum)[chunkOffset];
+        }
+        LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
+          this.getter = getter;
+        }
+        LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
+          // Find length
+          var xhr = new XMLHttpRequest();
+          xhr.open('HEAD', url, false);
+          xhr.send(null);
+          if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+          var datalength = Number(xhr.getResponseHeader("Content-length"));
+          var header;
+          var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
+          var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
+  
+          var chunkSize = 1024*1024; // Chunk size in bytes
+  
+          if (!hasByteServing) chunkSize = datalength;
+  
+          // Function to get a range from the remote URL.
+          var doXHR = (function(from, to) {
+            if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
+            if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
+  
+            // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
+            var xhr = new XMLHttpRequest();
+            xhr.open('GET', url, false);
+            if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
+  
+            // Some hints to the browser that we want binary data.
+            if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
+            if (xhr.overrideMimeType) {
+              xhr.overrideMimeType('text/plain; charset=x-user-defined');
+            }
+  
+            xhr.send(null);
+            if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
+            if (xhr.response !== undefined) {
+              return new Uint8Array(xhr.response || []);
+            } else {
+              return intArrayFromString(xhr.responseText || '', true);
+            }
+          });
+          var lazyArray = this;
+          lazyArray.setDataGetter(function(chunkNum) {
+            var start = chunkNum * chunkSize;
+            var end = (chunkNum+1) * chunkSize - 1; // including this byte
+            end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
+            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
+              lazyArray.chunks[chunkNum] = doXHR(start, end);
+            }
+            if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
+            return lazyArray.chunks[chunkNum];
+          });
+  
+          if (usesGzip || !datalength) {
+            // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
+            chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
+            datalength = this.getter(0).length;
+            chunkSize = datalength;
+            console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
+          }
+  
+          this._length = datalength;
+          this._chunkSize = chunkSize;
+          this.lengthKnown = true;
+        }
+        if (typeof XMLHttpRequest !== 'undefined') {
+          if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
+          var lazyArray = new LazyUint8Array();
+          Object.defineProperties(lazyArray, {
+            length: {
+              get: function() {
+                if(!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._length;
+              }
+            },
+            chunkSize: {
+              get: function() {
+                if(!this.lengthKnown) {
+                  this.cacheLength();
+                }
+                return this._chunkSize;
+              }
+            }
+          });
+  
+          var properties = { isDevice: false, contents: lazyArray };
+        } else {
+          var properties = { isDevice: false, url: url };
+        }
+  
+        var node = FS.createFile(parent, name, properties, canRead, canWrite);
+        // This is a total hack, but I want to get this lazy file code out of the
+        // core of MEMFS. If we want to keep this lazy file concept I feel it should
+        // be its own thin LAZYFS proxying calls to MEMFS.
+        if (properties.contents) {
+          node.contents = properties.contents;
+        } else if (properties.url) {
+          node.contents = null;
+          node.url = properties.url;
+        }
+        // Add a function that defers querying the file size until it is asked the first time.
+        Object.defineProperties(node, {
+          usedBytes: {
+            get: function() { return this.contents.length; }
+          }
+        });
+        // override each stream op with one that tries to force load the lazy file first
+        var stream_ops = {};
+        var keys = Object.keys(node.stream_ops);
+        keys.forEach(function(key) {
+          var fn = node.stream_ops[key];
+          stream_ops[key] = function forceLoadLazyFile() {
+            if (!FS.forceLoadFile(node)) {
+              throw new FS.ErrnoError(5);
+            }
+            return fn.apply(null, arguments);
+          };
+        });
+        // use a custom read function
+        stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
+          if (!FS.forceLoadFile(node)) {
+            throw new FS.ErrnoError(5);
+          }
+          var contents = stream.node.contents;
+          if (position >= contents.length)
+            return 0;
+          var size = Math.min(contents.length - position, length);
+          assert(size >= 0);
+          if (contents.slice) { // normal array
+            for (var i = 0; i < size; i++) {
+              buffer[offset + i] = contents[position + i];
+            }
+          } else {
+            for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
+              buffer[offset + i] = contents.get(position + i);
+            }
+          }
+          return size;
+        };
+        node.stream_ops = stream_ops;
+        return node;
+      },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
+        Browser.init(); // XXX perhaps this method should move onto Browser?
+        // TODO we should allow people to just pass in a complete filename instead
+        // of parent and name being that we just join them anyways
+        var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
+        var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
+        function processData(byteArray) {
+          function finish(byteArray) {
+            if (preFinish) preFinish();
+            if (!dontCreateFile) {
+              FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
+            }
+            if (onload) onload();
+            removeRunDependency(dep);
+          }
+          var handled = false;
+          Module['preloadPlugins'].forEach(function(plugin) {
+            if (handled) return;
+            if (plugin['canHandle'](fullname)) {
+              plugin['handle'](byteArray, fullname, finish, function() {
+                if (onerror) onerror();
+                removeRunDependency(dep);
+              });
+              handled = true;
+            }
+          });
+          if (!handled) finish(byteArray);
+        }
+        addRunDependency(dep);
+        if (typeof url == 'string') {
+          Browser.asyncLoad(url, function(byteArray) {
+            processData(byteArray);
+          }, onerror);
+        } else {
+          processData(url);
+        }
+      },indexedDB:function () {
+        return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
+      },DB_NAME:function () {
+        return 'EM_FS_' + window.location.pathname;
+      },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
+        onload = onload || function(){};
+        onerror = onerror || function(){};
+        var indexedDB = FS.indexedDB();
+        try {
+          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+        } catch (e) {
+          return onerror(e);
+        }
+        openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
+          console.log('creating db');
+          var db = openRequest.result;
+          db.createObjectStore(FS.DB_STORE_NAME);
+        };
+        openRequest.onsuccess = function openRequest_onsuccess() {
+          var db = openRequest.result;
+          var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
+          var files = transaction.objectStore(FS.DB_STORE_NAME);
+          var ok = 0, fail = 0, total = paths.length;
+          function finish() {
+            if (fail == 0) onload(); else onerror();
+          }
+          paths.forEach(function(path) {
+            var putRequest = files.put(FS.analyzePath(path).object.contents, path);
+            putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
+            putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
+          });
+          transaction.onerror = onerror;
+        };
+        openRequest.onerror = onerror;
+      },loadFilesFromDB:function (paths, onload, onerror) {
+        onload = onload || function(){};
+        onerror = onerror || function(){};
+        var indexedDB = FS.indexedDB();
+        try {
+          var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
+        } catch (e) {
+          return onerror(e);
+        }
+        openRequest.onupgradeneeded = onerror; // no database to load from
+        openRequest.onsuccess = function openRequest_onsuccess() {
+          var db = openRequest.result;
+          try {
+            var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
+          } catch(e) {
+            onerror(e);
+            return;
+          }
+          var files = transaction.objectStore(FS.DB_STORE_NAME);
+          var ok = 0, fail = 0, total = paths.length;
+          function finish() {
+            if (fail == 0) onload(); else onerror();
+          }
+          paths.forEach(function(path) {
+            var getRequest = files.get(path);
+            getRequest.onsuccess = function getRequest_onsuccess() {
+              if (FS.analyzePath(path).exists) {
+                FS.unlink(path);
+              }
+              FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
+              ok++;
+              if (ok + fail == total) finish();
+            };
+            getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
+          });
+          transaction.onerror = onerror;
+        };
+        openRequest.onerror = onerror;
+      }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
+        if (path[0] !== '/') {
+          // relative path
+          var dir;
+          if (dirfd === -100) {
+            dir = FS.cwd();
+          } else {
+            var dirstream = FS.getStream(dirfd);
+            if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+            dir = dirstream.path;
+          }
+          path = PATH.join2(dir, path);
+        }
+        return path;
+      },doStat:function (func, path, buf) {
+        try {
+          var stat = func(path);
+        } catch (e) {
+          if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
+            // an error occurred while trying to look up the path; we should just report ENOTDIR
+            return -ERRNO_CODES.ENOTDIR;
+          }
+          throw e;
+        }
+        HEAP32[((buf)>>2)]=stat.dev;
+        HEAP32[(((buf)+(4))>>2)]=0;
+        HEAP32[(((buf)+(8))>>2)]=stat.ino;
+        HEAP32[(((buf)+(12))>>2)]=stat.mode;
+        HEAP32[(((buf)+(16))>>2)]=stat.nlink;
+        HEAP32[(((buf)+(20))>>2)]=stat.uid;
+        HEAP32[(((buf)+(24))>>2)]=stat.gid;
+        HEAP32[(((buf)+(28))>>2)]=stat.rdev;
+        HEAP32[(((buf)+(32))>>2)]=0;
+        (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(40))>>2)]=tempI64[0],HEAP32[(((buf)+(44))>>2)]=tempI64[1]);
+        HEAP32[(((buf)+(48))>>2)]=4096;
+        HEAP32[(((buf)+(52))>>2)]=stat.blocks;
+        HEAP32[(((buf)+(56))>>2)]=(stat.atime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(60))>>2)]=0;
+        HEAP32[(((buf)+(64))>>2)]=(stat.mtime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(68))>>2)]=0;
+        HEAP32[(((buf)+(72))>>2)]=(stat.ctime.getTime() / 1000)|0;
+        HEAP32[(((buf)+(76))>>2)]=0;
+        (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(80))>>2)]=tempI64[0],HEAP32[(((buf)+(84))>>2)]=tempI64[1]);
+        return 0;
+      },doMsync:function (addr, stream, len, flags) {
+        var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
+        FS.msync(stream, buffer, 0, len, flags);
+      },doMkdir:function (path, mode) {
+        // remove a trailing slash, if one - /a/b/ has basename of '', but
+        // we want to create b in the context of this function
+        path = PATH.normalize(path);
+        if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
+        FS.mkdir(path, mode, 0);
+        return 0;
+      },doMknod:function (path, mode, dev) {
+        // we don't want this in the JS API as it uses mknod to create all nodes.
+        switch (mode & 61440) {
+          case 32768:
+          case 8192:
+          case 24576:
+          case 4096:
+          case 49152:
+            break;
+          default: return -ERRNO_CODES.EINVAL;
+        }
+        FS.mknod(path, mode, dev);
+        return 0;
+      },doReadlink:function (path, buf, bufsize) {
+        if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
+        var ret = FS.readlink(path);
+  
+        var len = Math.min(bufsize, lengthBytesUTF8(ret));
+        var endChar = HEAP8[buf+len];
+        stringToUTF8(ret, buf, bufsize+1);
+        // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
+        // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
+        HEAP8[buf+len] = endChar;
+  
+        return len;
+      },doAccess:function (path, amode) {
+        if (amode & ~7) {
+          // need a valid mode
+          return -ERRNO_CODES.EINVAL;
+        }
+        var node;
+        var lookup = FS.lookupPath(path, { follow: true });
+        node = lookup.node;
+        var perms = '';
+        if (amode & 4) perms += 'r';
+        if (amode & 2) perms += 'w';
+        if (amode & 1) perms += 'x';
+        if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
+          return -ERRNO_CODES.EACCES;
+        }
+        return 0;
+      },doDup:function (path, flags, suggestFD) {
+        var suggest = FS.getStream(suggestFD);
+        if (suggest) FS.close(suggest);
+        return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
+      },doReadv:function (stream, iov, iovcnt, offset) {
+        var ret = 0;
+        for (var i = 0; i < iovcnt; i++) {
+          var ptr = HEAP32[(((iov)+(i*8))>>2)];
+          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+          var curr = FS.read(stream, HEAP8,ptr, len, offset);
+          if (curr < 0) return -1;
+          ret += curr;
+          if (curr < len) break; // nothing more to read
+        }
+        return ret;
+      },doWritev:function (stream, iov, iovcnt, offset) {
+        var ret = 0;
+        for (var i = 0; i < iovcnt; i++) {
+          var ptr = HEAP32[(((iov)+(i*8))>>2)];
+          var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
+          var curr = FS.write(stream, HEAP8,ptr, len, offset);
+          if (curr < 0) return -1;
+          ret += curr;
+        }
+        return ret;
+      },varargs:0,get:function (varargs) {
+        SYSCALLS.varargs += 4;
+        var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
+        return ret;
+      },getStr:function () {
+        var ret = UTF8ToString(SYSCALLS.get());
+        return ret;
+      },getStreamFromFD:function () {
+        var stream = FS.getStream(SYSCALLS.get());
+        if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        return stream;
+      },getSocketFromFD:function () {
+        var socket = SOCKFS.getSocket(SYSCALLS.get());
+        if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
+        return socket;
+      },getSocketAddress:function (allowNull) {
+        var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
+        if (allowNull && addrp === 0) return null;
+        var info = __read_sockaddr(addrp, addrlen);
+        if (info.errno) throw new FS.ErrnoError(info.errno);
+        info.addr = DNS.lookup_addr(info.addr) || info.addr;
+        return info;
+      },get64:function () {
+        var low = SYSCALLS.get(), high = SYSCALLS.get();
+        if (low >= 0) assert(high === 0);
+        else assert(high === -1);
+        return low;
+      },getZero:function () {
+        assert(SYSCALLS.get() === 0);
+      }};function ___syscall140(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // llseek
+      var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
+      // Can't handle 64-bit integers
+      if (!(offset_high == -1 && offset_low < 0) &&
+          !(offset_high == 0 && offset_low >= 0)) {
+        return -ERRNO_CODES.EOVERFLOW;
+      }
+      var offset = offset_low;
+      FS.llseek(stream, offset, whence);
+      (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((result)>>2)]=tempI64[0],HEAP32[(((result)+(4))>>2)]=tempI64[1]);
+      if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
+      return 0;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall145(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // readv
+      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+      return SYSCALLS.doReadv(stream, iov, iovcnt);
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall146(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // writev
+      var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
+      return SYSCALLS.doWritev(stream, iov, iovcnt);
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall221(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // fcntl64
+      var stream = SYSCALLS.getStreamFromFD(), cmd = SYSCALLS.get();
+      switch (cmd) {
+        case 0: {
+          var arg = SYSCALLS.get();
+          if (arg < 0) {
+            return -ERRNO_CODES.EINVAL;
+          }
+          var newStream;
+          newStream = FS.open(stream.path, stream.flags, 0, arg);
+          return newStream.fd;
+        }
+        case 1:
+        case 2:
+          return 0;  // FD_CLOEXEC makes no sense for a single process.
+        case 3:
+          return stream.flags;
+        case 4: {
+          var arg = SYSCALLS.get();
+          stream.flags |= arg;
+          return 0;
+        }
+        case 12:
+        /* case 12: Currently in musl F_GETLK64 has same value as F_GETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ {
+          
+          var arg = SYSCALLS.get();
+          var offset = 0;
+          // We're always unlocked.
+          HEAP16[(((arg)+(offset))>>1)]=2;
+          return 0;
+        }
+        case 13:
+        case 14:
+        /* case 13: Currently in musl F_SETLK64 has same value as F_SETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */
+        /* case 14: Currently in musl F_SETLKW64 has same value as F_SETLKW, so omitted to avoid duplicate case blocks. If that changes, uncomment this */
+          
+          
+          return 0; // Pretend that the locking is successful.
+        case 16:
+        case 8:
+          return -ERRNO_CODES.EINVAL; // These are for sockets. We don't have them fully implemented yet.
+        case 9:
+          // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves.
+          ___setErrNo(ERRNO_CODES.EINVAL);
+          return -1;
+        default: {
+          return -ERRNO_CODES.EINVAL;
+        }
+      }
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall5(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // open
+      var pathname = SYSCALLS.getStr(), flags = SYSCALLS.get(), mode = SYSCALLS.get() // optional TODO
+      var stream = FS.open(pathname, flags, mode);
+      return stream.fd;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // ioctl
+      var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
+      switch (op) {
+        case 21509:
+        case 21505: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        case 21510:
+        case 21511:
+        case 21512:
+        case 21506:
+        case 21507:
+        case 21508: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0; // no-op, not actually adjusting terminal settings
+        }
+        case 21519: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          var argp = SYSCALLS.get();
+          HEAP32[((argp)>>2)]=0;
+          return 0;
+        }
+        case 21520: {
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return -ERRNO_CODES.EINVAL; // not supported
+        }
+        case 21531: {
+          var argp = SYSCALLS.get();
+          return FS.ioctl(stream, op, argp);
+        }
+        case 21523: {
+          // TODO: in theory we should write to the winsize struct that gets
+          // passed in, but for now musl doesn't read anything on it
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        case 21524: {
+          // TODO: technically, this ioctl call should change the window size.
+          // but, since emscripten doesn't have any concept of a terminal window
+          // yet, we'll just silently throw it away as we do TIOCGWINSZ
+          if (!stream.tty) return -ERRNO_CODES.ENOTTY;
+          return 0;
+        }
+        default: abort('bad ioctl syscall ' + op);
+      }
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___syscall6(which, varargs) {SYSCALLS.varargs = varargs;
+  try {
+   // close
+      var stream = SYSCALLS.getStreamFromFD();
+      FS.close(stream);
+      return 0;
+    } catch (e) {
+    if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
+    return -e.errno;
+  }
+  }
+
+  function ___unlock() {}
+
+  
+  
+  
+  
+  function _emscripten_set_main_loop_timing(mode, value) {
+      Browser.mainLoop.timingMode = mode;
+      Browser.mainLoop.timingValue = value;
+  
+      if (!Browser.mainLoop.func) {
+        console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
+        return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
+      }
+  
+      if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
+          var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
+          setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
+        };
+        Browser.mainLoop.method = 'timeout';
+      } else if (mode == 1 /*EM_TIMING_RAF*/) {
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
+          Browser.requestAnimationFrame(Browser.mainLoop.runner);
+        };
+        Browser.mainLoop.method = 'rAF';
+      } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
+        if (typeof setImmediate === 'undefined') {
+          // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
+          var setImmediates = [];
+          var emscriptenMainLoopMessageId = 'setimmediate';
+          var Browser_setImmediate_messageHandler = function(event) {
+            // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events,
+            // so check for both cases.
+            if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) {
+              event.stopPropagation();
+              setImmediates.shift()();
+            }
+          }
+          addEventListener("message", Browser_setImmediate_messageHandler, true);
+          setImmediate = function Browser_emulated_setImmediate(func) {
+            setImmediates.push(func);
+            if (ENVIRONMENT_IS_WORKER) {
+              if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
+              Module['setImmediates'].push(func);
+              postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
+            } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
+          }
+        }
+        Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
+          setImmediate(Browser.mainLoop.runner);
+        };
+        Browser.mainLoop.method = 'immediate';
+      }
+      return 0;
+    }
+  
+  function _emscripten_get_now() { abort() }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
+      Module['noExitRuntime'] = true;
+  
+      assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
+  
+      Browser.mainLoop.func = func;
+      Browser.mainLoop.arg = arg;
+  
+      var browserIterationFunc;
+      if (typeof arg !== 'undefined') {
+        browserIterationFunc = function() {
+          Module['dynCall_vi'](func, arg);
+        };
+      } else {
+        browserIterationFunc = function() {
+          Module['dynCall_v'](func);
+        };
+      }
+  
+      var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
+  
+      Browser.mainLoop.runner = function Browser_mainLoop_runner() {
+        if (ABORT) return;
+        if (Browser.mainLoop.queue.length > 0) {
+          var start = Date.now();
+          var blocker = Browser.mainLoop.queue.shift();
+          blocker.func(blocker.arg);
+          if (Browser.mainLoop.remainingBlockers) {
+            var remaining = Browser.mainLoop.remainingBlockers;
+            var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
+            if (blocker.counted) {
+              Browser.mainLoop.remainingBlockers = next;
+            } else {
+              // not counted, but move the progress along a tiny bit
+              next = next + 0.5; // do not steal all the next one's progress
+              Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
+            }
+          }
+          console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
+          Browser.mainLoop.updateStatus();
+  
+          // catches pause/resume main loop from blocker execution
+          if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+          setTimeout(Browser.mainLoop.runner, 0);
+          return;
+        }
+  
+        // catch pauses from non-main loop sources
+        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+        // Implement very basic swap interval control
+        Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
+        if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
+          // Not the scheduled time to render this frame - skip.
+          Browser.mainLoop.scheduler();
+          return;
+        } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
+          Browser.mainLoop.tickStartTime = _emscripten_get_now();
+        }
+  
+        // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
+        // VBO double-buffering and reduce GPU stalls.
+  
+  
+  
+        if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
+          err('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
+          Browser.mainLoop.method = ''; // just warn once per call to set main loop
+        }
+  
+        Browser.mainLoop.runIter(browserIterationFunc);
+  
+        checkStackCookie();
+  
+        // catch pauses from the main loop itself
+        if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
+  
+        // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
+        // to queue the newest produced audio samples.
+        // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
+        //       do not need to be hardcoded into this function, but can be more generic.
+        if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
+  
+        Browser.mainLoop.scheduler();
+      }
+  
+      if (!noSetTiming) {
+        if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
+        else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
+  
+        Browser.mainLoop.scheduler();
+      }
+  
+      if (simulateInfiniteLoop) {
+        throw 'SimulateInfiniteLoop';
+      }
+    }var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
+          Browser.mainLoop.scheduler = null;
+          Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
+        },resume:function () {
+          Browser.mainLoop.currentlyRunningMainloop++;
+          var timingMode = Browser.mainLoop.timingMode;
+          var timingValue = Browser.mainLoop.timingValue;
+          var func = Browser.mainLoop.func;
+          Browser.mainLoop.func = null;
+          _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
+          _emscripten_set_main_loop_timing(timingMode, timingValue);
+          Browser.mainLoop.scheduler();
+        },updateStatus:function () {
+          if (Module['setStatus']) {
+            var message = Module['statusMessage'] || 'Please wait...';
+            var remaining = Browser.mainLoop.remainingBlockers;
+            var expected = Browser.mainLoop.expectedBlockers;
+            if (remaining) {
+              if (remaining < expected) {
+                Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
+              } else {
+                Module['setStatus'](message);
+              }
+            } else {
+              Module['setStatus']('');
+            }
+          }
+        },runIter:function (func) {
+          if (ABORT) return;
+          if (Module['preMainLoop']) {
+            var preRet = Module['preMainLoop']();
+            if (preRet === false) {
+              return; // |return false| skips a frame
+            }
+          }
+          try {
+            func();
+          } catch (e) {
+            if (e instanceof ExitStatus) {
+              return;
+            } else {
+              if (e && typeof e === 'object' && e.stack) err('exception thrown: ' + [e, e.stack]);
+              throw e;
+            }
+          }
+          if (Module['postMainLoop']) Module['postMainLoop']();
+        }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
+        if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
+  
+        if (Browser.initted) return;
+        Browser.initted = true;
+  
+        try {
+          new Blob();
+          Browser.hasBlobConstructor = true;
+        } catch(e) {
+          Browser.hasBlobConstructor = false;
+          console.log("warning: no blob constructor, cannot create blobs with mimetypes");
+        }
+        Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
+        Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
+        if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
+          console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
+          Module.noImageDecoding = true;
+        }
+  
+        // Support for plugins that can process preloaded files. You can add more of these to
+        // your app by creating and appending to Module.preloadPlugins.
+        //
+        // Each plugin is asked if it can handle a file based on the file's name. If it can,
+        // it is given the file's raw data. When it is done, it calls a callback with the file's
+        // (possibly modified) data. For example, a plugin might decompress a file, or it
+        // might create some side data structure for use later (like an Image element, etc.).
+  
+        var imagePlugin = {};
+        imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
+          return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
+        };
+        imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
+          var b = null;
+          if (Browser.hasBlobConstructor) {
+            try {
+              b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+              if (b.size !== byteArray.length) { // Safari bug #118630
+                // Safari's Blob can only take an ArrayBuffer
+                b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
+              }
+            } catch(e) {
+              warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
+            }
+          }
+          if (!b) {
+            var bb = new Browser.BlobBuilder();
+            bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
+            b = bb.getBlob();
+          }
+          var url = Browser.URLObject.createObjectURL(b);
+          assert(typeof url == 'string', 'createObjectURL must return a url as a string');
+          var img = new Image();
+          img.onload = function img_onload() {
+            assert(img.complete, 'Image ' + name + ' could not be decoded');
+            var canvas = document.createElement('canvas');
+            canvas.width = img.width;
+            canvas.height = img.height;
+            var ctx = canvas.getContext('2d');
+            ctx.drawImage(img, 0, 0);
+            Module["preloadedImages"][name] = canvas;
+            Browser.URLObject.revokeObjectURL(url);
+            if (onload) onload(byteArray);
+          };
+          img.onerror = function img_onerror(event) {
+            console.log('Image ' + url + ' could not be decoded');
+            if (onerror) onerror();
+          };
+          img.src = url;
+        };
+        Module['preloadPlugins'].push(imagePlugin);
+  
+        var audioPlugin = {};
+        audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
+          return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
+        };
+        audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
+          var done = false;
+          function finish(audio) {
+            if (done) return;
+            done = true;
+            Module["preloadedAudios"][name] = audio;
+            if (onload) onload(byteArray);
+          }
+          function fail() {
+            if (done) return;
+            done = true;
+            Module["preloadedAudios"][name] = new Audio(); // empty shim
+            if (onerror) onerror();
+          }
+          if (Browser.hasBlobConstructor) {
+            try {
+              var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
+            } catch(e) {
+              return fail();
+            }
+            var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
+            assert(typeof url == 'string', 'createObjectURL must return a url as a string');
+            var audio = new Audio();
+            audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
+            audio.onerror = function audio_onerror(event) {
+              if (done) return;
+              console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
+              function encode64(data) {
+                var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
+                var PAD = '=';
+                var ret = '';
+                var leftchar = 0;
+                var leftbits = 0;
+                for (var i = 0; i < data.length; i++) {
+                  leftchar = (leftchar << 8) | data[i];
+                  leftbits += 8;
+                  while (leftbits >= 6) {
+                    var curr = (leftchar >> (leftbits-6)) & 0x3f;
+                    leftbits -= 6;
+                    ret += BASE[curr];
+                  }
+                }
+                if (leftbits == 2) {
+                  ret += BASE[(leftchar&3) << 4];
+                  ret += PAD + PAD;
+                } else if (leftbits == 4) {
+                  ret += BASE[(leftchar&0xf) << 2];
+                  ret += PAD;
+                }
+                return ret;
+              }
+              audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
+              finish(audio); // we don't wait for confirmation this worked - but it's worth trying
+            };
+            audio.src = url;
+            // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
+            Browser.safeSetTimeout(function() {
+              finish(audio); // try to use it even though it is not necessarily ready to play
+            }, 10000);
+          } else {
+            return fail();
+          }
+        };
+        Module['preloadPlugins'].push(audioPlugin);
+  
+  
+        // Canvas event setup
+  
+        function pointerLockChange() {
+          Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
+                                document['mozPointerLockElement'] === Module['canvas'] ||
+                                document['webkitPointerLockElement'] === Module['canvas'] ||
+                                document['msPointerLockElement'] === Module['canvas'];
+        }
+        var canvas = Module['canvas'];
+        if (canvas) {
+          // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
+          // Module['forcedAspectRatio'] = 4 / 3;
+  
+          canvas.requestPointerLock = canvas['requestPointerLock'] ||
+                                      canvas['mozRequestPointerLock'] ||
+                                      canvas['webkitRequestPointerLock'] ||
+                                      canvas['msRequestPointerLock'] ||
+                                      function(){};
+          canvas.exitPointerLock = document['exitPointerLock'] ||
+                                   document['mozExitPointerLock'] ||
+                                   document['webkitExitPointerLock'] ||
+                                   document['msExitPointerLock'] ||
+                                   function(){}; // no-op if function does not exist
+          canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
+  
+          document.addEventListener('pointerlockchange', pointerLockChange, false);
+          document.addEventListener('mozpointerlockchange', pointerLockChange, false);
+          document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
+          document.addEventListener('mspointerlockchange', pointerLockChange, false);
+  
+          if (Module['elementPointerLock']) {
+            canvas.addEventListener("click", function(ev) {
+              if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+                Module['canvas'].requestPointerLock();
+                ev.preventDefault();
+              }
+            }, false);
+          }
+        }
+      },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
+        if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
+  
+        var ctx;
+        var contextHandle;
+        if (useWebGL) {
+          // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
+          var contextAttributes = {
+            antialias: false,
+            alpha: false,
+            majorVersion: 1,
+          };
+  
+          if (webGLContextAttributes) {
+            for (var attribute in webGLContextAttributes) {
+              contextAttributes[attribute] = webGLContextAttributes[attribute];
+            }
+          }
+  
+          // This check of existence of GL is here to satisfy Closure compiler, which yells if variable GL is referenced below but GL object is not
+          // actually compiled in because application is not doing any GL operations. TODO: Ideally if GL is not being used, this function
+          // Browser.createContext() should not even be emitted.
+          if (typeof GL !== 'undefined') {
+            contextHandle = GL.createContext(canvas, contextAttributes);
+            if (contextHandle) {
+              ctx = GL.getContext(contextHandle).GLctx;
+            }
+          }
+        } else {
+          ctx = canvas.getContext('2d');
+        }
+  
+        if (!ctx) return null;
+  
+        if (setInModule) {
+          if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
+  
+          Module.ctx = ctx;
+          if (useWebGL) GL.makeContextCurrent(contextHandle);
+          Module.useWebGL = useWebGL;
+          Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
+          Browser.init();
+        }
+        return ctx;
+      },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
+        Browser.lockPointer = lockPointer;
+        Browser.resizeCanvas = resizeCanvas;
+        Browser.vrDevice = vrDevice;
+        if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
+        if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
+        if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
+  
+        var canvas = Module['canvas'];
+        function fullscreenChange() {
+          Browser.isFullscreen = false;
+          var canvasContainer = canvas.parentNode;
+          if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+               document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+               document['webkitCurrentFullScreenElement']) === canvasContainer) {
+            canvas.exitFullscreen = Browser.exitFullscreen;
+            if (Browser.lockPointer) canvas.requestPointerLock();
+            Browser.isFullscreen = true;
+            if (Browser.resizeCanvas) {
+              Browser.setFullscreenCanvasSize();
+            } else {
+              Browser.updateCanvasDimensions(canvas);
+            }
+          } else {
+            // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
+            canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
+            canvasContainer.parentNode.removeChild(canvasContainer);
+  
+            if (Browser.resizeCanvas) {
+              Browser.setWindowedCanvasSize();
+            } else {
+              Browser.updateCanvasDimensions(canvas);
+            }
+          }
+          if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
+          if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
+        }
+  
+        if (!Browser.fullscreenHandlersInstalled) {
+          Browser.fullscreenHandlersInstalled = true;
+          document.addEventListener('fullscreenchange', fullscreenChange, false);
+          document.addEventListener('mozfullscreenchange', fullscreenChange, false);
+          document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
+          document.addEventListener('MSFullscreenChange', fullscreenChange, false);
+        }
+  
+        // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
+        var canvasContainer = document.createElement("div");
+        canvas.parentNode.insertBefore(canvasContainer, canvas);
+        canvasContainer.appendChild(canvas);
+  
+        // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
+        canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
+                                            canvasContainer['mozRequestFullScreen'] ||
+                                            canvasContainer['msRequestFullscreen'] ||
+                                           (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
+                                           (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
+  
+        if (vrDevice) {
+          canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
+        } else {
+          canvasContainer.requestFullscreen();
+        }
+      },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
+          err('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
+          Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
+            return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+          }
+          return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
+      },exitFullscreen:function () {
+        // This is workaround for chrome. Trying to exit from fullscreen
+        // not in fullscreen state will cause "TypeError: Document not active"
+        // in chrome. See https://github.com/emscripten-core/emscripten/pull/8236
+        if (!Browser.isFullscreen) {
+          return false;
+        }
+  
+        var CFS = document['exitFullscreen'] ||
+                  document['cancelFullScreen'] ||
+                  document['mozCancelFullScreen'] ||
+                  document['msExitFullscreen'] ||
+                  document['webkitCancelFullScreen'] ||
+            (function() {});
+        CFS.apply(document, []);
+        return true;
+      },nextRAF:0,fakeRequestAnimationFrame:function (func) {
+        // try to keep 60fps between calls to here
+        var now = Date.now();
+        if (Browser.nextRAF === 0) {
+          Browser.nextRAF = now + 1000/60;
+        } else {
+          while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
+            Browser.nextRAF += 1000/60;
+          }
+        }
+        var delay = Math.max(Browser.nextRAF - now, 0);
+        setTimeout(func, delay);
+      },requestAnimationFrame:function requestAnimationFrame(func) {
+        if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
+          Browser.fakeRequestAnimationFrame(func);
+        } else {
+          if (!window.requestAnimationFrame) {
+            window.requestAnimationFrame = window['requestAnimationFrame'] ||
+                                           window['mozRequestAnimationFrame'] ||
+                                           window['webkitRequestAnimationFrame'] ||
+                                           window['msRequestAnimationFrame'] ||
+                                           window['oRequestAnimationFrame'] ||
+                                           Browser.fakeRequestAnimationFrame;
+          }
+          window.requestAnimationFrame(func);
+        }
+      },safeCallback:function (func) {
+        return function() {
+          if (!ABORT) return func.apply(null, arguments);
+        };
+      },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
+        Browser.allowAsyncCallbacks = false;
+      },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
+        Browser.allowAsyncCallbacks = true;
+        if (Browser.queuedAsyncCallbacks.length > 0) {
+          var callbacks = Browser.queuedAsyncCallbacks;
+          Browser.queuedAsyncCallbacks = [];
+          callbacks.forEach(function(func) {
+            func();
+          });
+        }
+      },safeRequestAnimationFrame:function (func) {
+        return Browser.requestAnimationFrame(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } else {
+            Browser.queuedAsyncCallbacks.push(func);
+          }
+        });
+      },safeSetTimeout:function (func, timeout) {
+        Module['noExitRuntime'] = true;
+        return setTimeout(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } else {
+            Browser.queuedAsyncCallbacks.push(func);
+          }
+        }, timeout);
+      },safeSetInterval:function (func, timeout) {
+        Module['noExitRuntime'] = true;
+        return setInterval(function() {
+          if (ABORT) return;
+          if (Browser.allowAsyncCallbacks) {
+            func();
+          } // drop it on the floor otherwise, next interval will kick in
+        }, timeout);
+      },getMimetype:function (name) {
+        return {
+          'jpg': 'image/jpeg',
+          'jpeg': 'image/jpeg',
+          'png': 'image/png',
+          'bmp': 'image/bmp',
+          'ogg': 'audio/ogg',
+          'wav': 'audio/wav',
+          'mp3': 'audio/mpeg'
+        }[name.substr(name.lastIndexOf('.')+1)];
+      },getUserMedia:function (func) {
+        if(!window.getUserMedia) {
+          window.getUserMedia = navigator['getUserMedia'] ||
+                                navigator['mozGetUserMedia'];
+        }
+        window.getUserMedia(func);
+      },getMovementX:function (event) {
+        return event['movementX'] ||
+               event['mozMovementX'] ||
+               event['webkitMovementX'] ||
+               0;
+      },getMovementY:function (event) {
+        return event['movementY'] ||
+               event['mozMovementY'] ||
+               event['webkitMovementY'] ||
+               0;
+      },getMouseWheelDelta:function (event) {
+        var delta = 0;
+        switch (event.type) {
+          case 'DOMMouseScroll':
+            // 3 lines make up a step
+            delta = event.detail / 3;
+            break;
+          case 'mousewheel':
+            // 120 units make up a step
+            delta = event.wheelDelta / 120;
+            break;
+          case 'wheel':
+            delta = event.deltaY
+            switch(event.deltaMode) {
+              case 0:
+                // DOM_DELTA_PIXEL: 100 pixels make up a step
+                delta /= 100;
+                break;
+              case 1:
+                // DOM_DELTA_LINE: 3 lines make up a step
+                delta /= 3;
+                break;
+              case 2:
+                // DOM_DELTA_PAGE: A page makes up 80 steps
+                delta *= 80;
+                break;
+              default:
+                throw 'unrecognized mouse wheel delta mode: ' + event.deltaMode;
+            }
+            break;
+          default:
+            throw 'unrecognized mouse wheel event: ' + event.type;
+        }
+        return delta;
+      },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
+        if (Browser.pointerLock) {
+          // When the pointer is locked, calculate the coordinates
+          // based on the movement of the mouse.
+          // Workaround for Firefox bug 764498
+          if (event.type != 'mousemove' &&
+              ('mozMovementX' in event)) {
+            Browser.mouseMovementX = Browser.mouseMovementY = 0;
+          } else {
+            Browser.mouseMovementX = Browser.getMovementX(event);
+            Browser.mouseMovementY = Browser.getMovementY(event);
+          }
+  
+          // check if SDL is available
+          if (typeof SDL != "undefined") {
+            Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
+            Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
+          } else {
+            // just add the mouse delta to the current absolut mouse position
+            // FIXME: ideally this should be clamped against the canvas size and zero
+            Browser.mouseX += Browser.mouseMovementX;
+            Browser.mouseY += Browser.mouseMovementY;
+          }
+        } else {
+          // Otherwise, calculate the movement based on the changes
+          // in the coordinates.
+          var rect = Module["canvas"].getBoundingClientRect();
+          var cw = Module["canvas"].width;
+          var ch = Module["canvas"].height;
+  
+          // Neither .scrollX or .pageXOffset are defined in a spec, but
+          // we prefer .scrollX because it is currently in a spec draft.
+          // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
+          var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
+          var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
+          // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
+          // and we have no viable fallback.
+          assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
+  
+          if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
+            var touch = event.touch;
+            if (touch === undefined) {
+              return; // the "touch" property is only defined in SDL
+  
+            }
+            var adjustedX = touch.pageX - (scrollX + rect.left);
+            var adjustedY = touch.pageY - (scrollY + rect.top);
+  
+            adjustedX = adjustedX * (cw / rect.width);
+            adjustedY = adjustedY * (ch / rect.height);
+  
+            var coords = { x: adjustedX, y: adjustedY };
+  
+            if (event.type === 'touchstart') {
+              Browser.lastTouches[touch.identifier] = coords;
+              Browser.touches[touch.identifier] = coords;
+            } else if (event.type === 'touchend' || event.type === 'touchmove') {
+              var last = Browser.touches[touch.identifier];
+              if (!last) last = coords;
+              Browser.lastTouches[touch.identifier] = last;
+              Browser.touches[touch.identifier] = coords;
+            }
+            return;
+          }
+  
+          var x = event.pageX - (scrollX + rect.left);
+          var y = event.pageY - (scrollY + rect.top);
+  
+          // the canvas might be CSS-scaled compared to its backbuffer;
+          // SDL-using content will want mouse coordinates in terms
+          // of backbuffer units.
+          x = x * (cw / rect.width);
+          y = y * (ch / rect.height);
+  
+          Browser.mouseMovementX = x - Browser.mouseX;
+          Browser.mouseMovementY = y - Browser.mouseY;
+          Browser.mouseX = x;
+          Browser.mouseY = y;
+        }
+      },asyncLoad:function (url, onload, onerror, noRunDep) {
+        var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
+        Module['readAsync'](url, function(arrayBuffer) {
+          assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
+          onload(new Uint8Array(arrayBuffer));
+          if (dep) removeRunDependency(dep);
+        }, function(event) {
+          if (onerror) {
+            onerror();
+          } else {
+            throw 'Loading data file "' + url + '" failed.';
+          }
+        });
+        if (dep) addRunDependency(dep);
+      },resizeListeners:[],updateResizeListeners:function () {
+        var canvas = Module['canvas'];
+        Browser.resizeListeners.forEach(function(listener) {
+          listener(canvas.width, canvas.height);
+        });
+      },setCanvasSize:function (width, height, noUpdates) {
+        var canvas = Module['canvas'];
+        Browser.updateCanvasDimensions(canvas, width, height);
+        if (!noUpdates) Browser.updateResizeListeners();
+      },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
+        // check if SDL is available
+        if (typeof SDL != "undefined") {
+          var flags = HEAPU32[((SDL.screen)>>2)];
+          flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
+          HEAP32[((SDL.screen)>>2)]=flags
+        }
+        Browser.updateCanvasDimensions(Module['canvas']);
+        Browser.updateResizeListeners();
+      },setWindowedCanvasSize:function () {
+        // check if SDL is available
+        if (typeof SDL != "undefined") {
+          var flags = HEAPU32[((SDL.screen)>>2)];
+          flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
+          HEAP32[((SDL.screen)>>2)]=flags
+        }
+        Browser.updateCanvasDimensions(Module['canvas']);
+        Browser.updateResizeListeners();
+      },updateCanvasDimensions:function (canvas, wNative, hNative) {
+        if (wNative && hNative) {
+          canvas.widthNative = wNative;
+          canvas.heightNative = hNative;
+        } else {
+          wNative = canvas.widthNative;
+          hNative = canvas.heightNative;
+        }
+        var w = wNative;
+        var h = hNative;
+        if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
+          if (w/h < Module['forcedAspectRatio']) {
+            w = Math.round(h * Module['forcedAspectRatio']);
+          } else {
+            h = Math.round(w / Module['forcedAspectRatio']);
+          }
+        }
+        if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
+             document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
+             document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
+           var factor = Math.min(screen.width / w, screen.height / h);
+           w = Math.round(w * factor);
+           h = Math.round(h * factor);
+        }
+        if (Browser.resizeCanvas) {
+          if (canvas.width  != w) canvas.width  = w;
+          if (canvas.height != h) canvas.height = h;
+          if (typeof canvas.style != 'undefined') {
+            canvas.style.removeProperty( "width");
+            canvas.style.removeProperty("height");
+          }
+        } else {
+          if (canvas.width  != wNative) canvas.width  = wNative;
+          if (canvas.height != hNative) canvas.height = hNative;
+          if (typeof canvas.style != 'undefined') {
+            if (w != wNative || h != hNative) {
+              canvas.style.setProperty( "width", w + "px", "important");
+              canvas.style.setProperty("height", h + "px", "important");
+            } else {
+              canvas.style.removeProperty( "width");
+              canvas.style.removeProperty("height");
+            }
+          }
+        }
+      },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
+        var handle = Browser.nextWgetRequestHandle;
+        Browser.nextWgetRequestHandle++;
+        return handle;
+      }};var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,contextAttributes:{alpha:false,depth:false,stencil:false,antialias:false},stringCache:{},setErrorCode:function (code) {
+        EGL.errorCode = code;
+      },chooseConfig:function (display, attribList, config, config_size, numConfigs) {
+        if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
+          EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
+          return 0;
+        }
+  
+        if (attribList) {
+          // read attribList if it is non-null
+          for(;;) {
+            var param = HEAP32[((attribList)>>2)];
+            if (param == 0x3021 /*EGL_ALPHA_SIZE*/) {
+              var alphaSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.alpha = (alphaSize > 0);
+            } else if (param == 0x3025 /*EGL_DEPTH_SIZE*/) {
+              var depthSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.depth = (depthSize > 0);
+            } else if (param == 0x3026 /*EGL_STENCIL_SIZE*/) {
+              var stencilSize = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.stencil = (stencilSize > 0);
+            } else if (param == 0x3031 /*EGL_SAMPLES*/) {
+              var samples = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.antialias = (samples > 0);
+            } else if (param == 0x3032 /*EGL_SAMPLE_BUFFERS*/) {
+              var samples = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.antialias = (samples == 1);
+            } else if (param == 0x3100 /*EGL_CONTEXT_PRIORITY_LEVEL_IMG*/) {
+              var requestedPriority = HEAP32[(((attribList)+(4))>>2)];
+              EGL.contextAttributes.lowLatency = (requestedPriority != 0x3103 /*EGL_CONTEXT_PRIORITY_LOW_IMG*/);
+            } else if (param == 0x3038 /*EGL_NONE*/) {
+                break;
+            }
+            attribList += 8;
+          }
+        }
+  
+        if ((!config || !config_size) && !numConfigs) {
+          EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
+          return 0;
+        }
+        if (numConfigs) {
+          HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
+        }
+        if (config && config_size > 0) {
+          HEAP32[((config)>>2)]=62002;
+        }
+  
+        EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
+        return 1;
+      }};function _eglGetProcAddress(name_) {
+      return _emscripten_GetProcAddress(name_);
+    }
+
+  var _emscripten_asm_const_int=true;
+
+  
+  var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,removeAllEventListeners:function () {
+        for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
+          JSEvents._removeHandler(i);
+        }
+        JSEvents.eventHandlers = [];
+        JSEvents.deferredCalls = [];
+      },registerRemoveEventListeners:function () {
+        if (!JSEvents.removeEventListenersRegistered) {
+          __ATEXIT__.push(JSEvents.removeAllEventListeners);
+          JSEvents.removeEventListenersRegistered = true;
+        }
+      },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
+        function arraysHaveEqualContent(arrA, arrB) {
+          if (arrA.length != arrB.length) return false;
+  
+          for(var i in arrA) {
+            if (arrA[i] != arrB[i]) return false;
+          }
+          return true;
+        }
+        // Test if the given call was already queued, and if so, don't add it again.
+        for(var i in JSEvents.deferredCalls) {
+          var call = JSEvents.deferredCalls[i];
+          if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
+            return;
+          }
+        }
+        JSEvents.deferredCalls.push({
+          targetFunction: targetFunction,
+          precedence: precedence,
+          argsList: argsList
+        });
+  
+        JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
+      },removeDeferredCalls:function (targetFunction) {
+        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+          if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
+            JSEvents.deferredCalls.splice(i, 1);
+            --i;
+          }
+        }
+      },canPerformEventHandlerRequests:function () {
+        return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
+      },runDeferredCalls:function () {
+        if (!JSEvents.canPerformEventHandlerRequests()) {
+          return;
+        }
+        for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
+          var call = JSEvents.deferredCalls[i];
+          JSEvents.deferredCalls.splice(i, 1);
+          --i;
+          call.targetFunction.apply(this, call.argsList);
+        }
+      },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
+        for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+          if (JSEvents.eventHandlers[i].target == target && 
+            (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
+             JSEvents._removeHandler(i--);
+           }
+        }
+      },_removeHandler:function (i) {
+        var h = JSEvents.eventHandlers[i];
+        h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
+        JSEvents.eventHandlers.splice(i, 1);
+      },registerOrRemoveHandler:function (eventHandler) {
+        var jsEventHandler = function jsEventHandler(event) {
+          // Increment nesting count for the event handler.
+          ++JSEvents.inEventHandler;
+          JSEvents.currentEventHandler = eventHandler;
+          // Process any old deferred calls the user has placed.
+          JSEvents.runDeferredCalls();
+          // Process the actual event, calls back to user C code handler.
+          eventHandler.handlerFunc(event);
+          // Process any new deferred calls that were placed right now from this event handler.
+          JSEvents.runDeferredCalls();
+          // Out of event handler - restore nesting count.
+          --JSEvents.inEventHandler;
+        }
+        
+        if (eventHandler.callbackfunc) {
+          eventHandler.eventListenerFunc = jsEventHandler;
+          eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
+          JSEvents.eventHandlers.push(eventHandler);
+          JSEvents.registerRemoveEventListeners();
+        } else {
+          for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
+            if (JSEvents.eventHandlers[i].target == eventHandler.target
+             && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
+               JSEvents._removeHandler(i--);
+             }
+          }
+        }
+      },getBoundingClientRectOrZeros:function (target) {
+        return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
+      },pageScrollPos:function () {
+        if (window.pageXOffset > 0 || window.pageYOffset > 0) {
+          return [window.pageXOffset, window.pageYOffset];
+        }
+        if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
+          return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
+        }
+        return [document.body.scrollLeft|0, document.body.scrollTop|0];
+      },getNodeNameForTarget:function (target) {
+        if (!target) return '';
+        if (target == window) return '#window';
+        if (target == screen) return '#screen';
+        return (target && target.nodeName) ? target.nodeName : '';
+      },tick:function () {
+        if (window['performance'] && window['performance']['now']) return window['performance']['now']();
+        else return Date.now();
+      },fullscreenEnabled:function () {
+        return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
+      }};
+  
+  function __requestPointerLock(target) {
+      if (target.requestPointerLock) {
+        target.requestPointerLock();
+      } else if (target.mozRequestPointerLock) {
+        target.mozRequestPointerLock();
+      } else if (target.webkitRequestPointerLock) {
+        target.webkitRequestPointerLock();
+      } else if (target.msRequestPointerLock) {
+        target.msRequestPointerLock();
+      } else {
+        // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
+        // or if the whole browser just doesn't support the feature.
+        if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
+          return -3;
+        } else {
+          return -1;
+        }
+      }
+      return 0;
+    }function _emscripten_exit_pointerlock() {
+      // Make sure no queued up calls will fire after this.
+      JSEvents.removeDeferredCalls(__requestPointerLock);
+  
+      if (document.exitPointerLock) {
+        document.exitPointerLock();
+      } else if (document.msExitPointerLock) {
+        document.msExitPointerLock();
+      } else if (document.mozExitPointerLock) {
+        document.mozExitPointerLock();
+      } else if (document.webkitExitPointerLock) {
+        document.webkitExitPointerLock();
+      } else {
+        return -1;
+      }
+      return 0;
+    }
+
+  
+  function __fillGamepadEventData(eventStruct, e) {
+      HEAPF64[((eventStruct)>>3)]=e.timestamp;
+      for(var i = 0; i < e.axes.length; ++i) {
+        HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
+      }
+      for(var i = 0; i < e.buttons.length; ++i) {
+        if (typeof(e.buttons[i]) === 'object') {
+          HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
+        } else {
+          HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
+        }
+      }
+      for(var i = 0; i < e.buttons.length; ++i) {
+        if (typeof(e.buttons[i]) === 'object') {
+          HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
+        } else {
+          HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
+        }
+      }
+      HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
+      HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
+      HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
+      HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
+      stringToUTF8(e.id, eventStruct + 1304, 64);
+      stringToUTF8(e.mapping, eventStruct + 1368, 64);
+    }function _emscripten_get_gamepad_status(index, gamepadState) {
+      if (!JSEvents.lastGamepadState) throw 'emscripten_get_gamepad_status() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!';
+  
+      // INVALID_PARAM is returned on a Gamepad index that never was there.
+      if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
+  
+      // NO_DATA is returned on a Gamepad index that was removed.
+      // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
+      // This is because gamepads must keep their original position in the array.
+      // For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
+      if (!JSEvents.lastGamepadState[index]) return -7;
+  
+      __fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
+      return 0;
+    }
+
+  function _emscripten_get_heap_size() {
+      return HEAP8.length;
+    }
+
+  function _emscripten_get_num_gamepads() {
+      if (!JSEvents.lastGamepadState) throw 'emscripten_get_num_gamepads() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!';
+      // N.B. Do not call emscripten_get_num_gamepads() unless having first called emscripten_sample_gamepad_data(), and that has returned EMSCRIPTEN_RESULT_SUCCESS.
+      // Otherwise the following line will throw an exception.
+      return JSEvents.lastGamepadState.length;
+    }
+
+  
+  function __fillPointerlockChangeEventData(eventStruct, e) {
+      var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
+      var isPointerlocked = !!pointerLockElement;
+      HEAP32[((eventStruct)>>2)]=isPointerlocked;
+      var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
+      var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
+      stringToUTF8(nodeName, eventStruct + 4, 128);
+      stringToUTF8(id, eventStruct + 132, 128);
+    }function _emscripten_get_pointerlock_status(pointerlockStatus) {
+      if (pointerlockStatus) __fillPointerlockChangeEventData(pointerlockStatus);
+      if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
+        return -1;
+      }
+      return 0;
+    }
+
+  
+  var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:{},currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],programInfos:{},stringCache:{},unpackAlignment:4,init:function () {
+        GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
+        for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
+          GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
+        }
+      },recordError:function recordError(errorCode) {
+        if (!GL.lastError) {
+          GL.lastError = errorCode;
+        }
+      },getNewId:function (table) {
+        var ret = GL.counter++;
+        for (var i = table.length; i < ret; i++) {
+          table[i] = null;
+        }
+        return ret;
+      },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
+        var source = '';
+        for (var i = 0; i < count; ++i) {
+          var len = length ? HEAP32[(((length)+(i*4))>>2)] : -1;
+          source += UTF8ToString(HEAP32[(((string)+(i*4))>>2)], len < 0 ? undefined : len);
+        }
+        return source;
+      },createContext:function (canvas, webGLContextAttributes) {
+  
+  
+  
+  
+        var ctx = 
+          (canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes));
+  
+  
+        return ctx && GL.registerContext(ctx, webGLContextAttributes);
+      },registerContext:function (ctx, webGLContextAttributes) {
+        var handle = _malloc(8); // Make space on the heap to store GL context attributes that need to be accessible as shared between threads.
+        var context = {
+          handle: handle,
+          attributes: webGLContextAttributes,
+          version: webGLContextAttributes.majorVersion,
+          GLctx: ctx
+        };
+  
+  
+  
+        // Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
+        if (ctx.canvas) ctx.canvas.GLctxObject = context;
+        GL.contexts[handle] = context;
+        if (typeof webGLContextAttributes.enableExtensionsByDefault === 'undefined' || webGLContextAttributes.enableExtensionsByDefault) {
+          GL.initExtensions(context);
+        }
+  
+  
+  
+  
+        return handle;
+      },makeContextCurrent:function (contextHandle) {
+  
+        GL.currentContext = GL.contexts[contextHandle]; // Active Emscripten GL layer context object.
+        Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; // Active WebGL context object.
+        return !(contextHandle && !GLctx);
+      },getContext:function (contextHandle) {
+        return GL.contexts[contextHandle];
+      },deleteContext:function (contextHandle) {
+        if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
+        if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
+        if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
+        _free(GL.contexts[contextHandle]);
+        GL.contexts[contextHandle] = null;
+      },initExtensions:function (context) {
+        // If this function is called without a specific context object, init the extensions of the currently active context.
+        if (!context) context = GL.currentContext;
+  
+        if (context.initExtensionsDone) return;
+        context.initExtensionsDone = true;
+  
+        var GLctx = context.GLctx;
+  
+        // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
+  
+        if (context.version < 2) {
+          // Extension available from Firefox 26 and Google Chrome 30
+          var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
+          if (instancedArraysExt) {
+            GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
+            GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
+            GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
+          }
+  
+          // Extension available from Firefox 25 and WebKit
+          var vaoExt = GLctx.getExtension('OES_vertex_array_object');
+          if (vaoExt) {
+            GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
+            GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
+            GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
+            GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
+          }
+  
+          var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
+          if (drawBuffersExt) {
+            GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
+          }
+        }
+  
+        GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
+  
+        // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
+        // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
+        // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
+        // here, as long as they don't produce a performance impact for users that might not be using those extensions.
+        // E.g. debugging-related extensions should probably be off by default.
+        var automaticallyEnabledExtensions = [ // Khronos ratified WebGL extensions ordered by number (no debug extensions):
+                                               "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
+                                               "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
+                                               "OES_element_index_uint", "EXT_texture_filter_anisotropic", "EXT_frag_depth",
+                                               "WEBGL_draw_buffers", "ANGLE_instanced_arrays", "OES_texture_float_linear",
+                                               "OES_texture_half_float_linear", "EXT_blend_minmax", "EXT_shader_texture_lod",
+                                               // Community approved WebGL extensions ordered by number:
+                                               "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
+                                               "EXT_sRGB", "WEBGL_compressed_texture_etc1", "EXT_disjoint_timer_query",
+                                               "WEBGL_compressed_texture_etc", "WEBGL_compressed_texture_astc", "EXT_color_buffer_float",
+                                               "WEBGL_compressed_texture_s3tc_srgb", "EXT_disjoint_timer_query_webgl2"];
+  
+        function shouldEnableAutomatically(extension) {
+          var ret = false;
+          automaticallyEnabledExtensions.forEach(function(include) {
+            if (extension.indexOf(include) != -1) {
+              ret = true;
+            }
+          });
+          return ret;
+        }
+  
+        var exts = GLctx.getSupportedExtensions();
+        if (exts && exts.length > 0) {
+          GLctx.getSupportedExtensions().forEach(function(ext) {
+            if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
+              GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
+            }
+          });
+        }
+      },populateUniformTable:function (program) {
+        var p = GL.programs[program];
+        var ptable = GL.programInfos[program] = {
+          uniforms: {},
+          maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
+          maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
+          maxUniformBlockNameLength: -1 // Lazily computed as well
+        };
+  
+        var utable = ptable.uniforms;
+        // A program's uniform table maps the string name of an uniform to an integer location of that uniform.
+        // The global GL.uniforms map maps integer locations to WebGLUniformLocations.
+        var numUniforms = GLctx.getProgramParameter(p, 0x8B86/*GL_ACTIVE_UNIFORMS*/);
+        for (var i = 0; i < numUniforms; ++i) {
+          var u = GLctx.getActiveUniform(p, i);
+  
+          var name = u.name;
+          ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
+  
+          // If we are dealing with an array, e.g. vec4 foo[3], strip off the array index part to canonicalize that "foo", "foo[]",
+          // and "foo[0]" will mean the same. Loop below will populate foo[1] and foo[2].
+          if (name.slice(-1) == ']') {
+            name = name.slice(0, name.lastIndexOf('['));
+          }
+  
+          // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
+          // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
+          // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
+          var loc = GLctx.getUniformLocation(p, name);
+          if (loc) {
+            var id = GL.getNewId(GL.uniforms);
+            utable[name] = [u.size, id];
+            GL.uniforms[id] = loc;
+  
+            for (var j = 1; j < u.size; ++j) {
+              var n = name + '['+j+']';
+              loc = GLctx.getUniformLocation(p, n);
+              id = GL.getNewId(GL.uniforms);
+  
+              GL.uniforms[id] = loc;
+            }
+          }
+        }
+      }};function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+  function _emscripten_glAttachShader(program, shader) {
+      GLctx.attachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _emscripten_glBeginQueryEXT(target, id) {
+      GLctx.disjointTimerQueryExt['beginQueryEXT'](target, GL.timerQueriesEXT[id]);
+    }
+
+  function _emscripten_glBindAttribLocation(program, index, name) {
+      GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name));
+    }
+
+  function _emscripten_glBindBuffer(target, buffer) {
+  
+      GLctx.bindBuffer(target, GL.buffers[buffer]);
+    }
+
+  function _emscripten_glBindFramebuffer(target, framebuffer) {
+  
+      GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]);
+  
+    }
+
+  function _emscripten_glBindRenderbuffer(target, renderbuffer) {
+      GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]);
+    }
+
+  function _emscripten_glBindTexture(target, texture) {
+      GLctx.bindTexture(target, GL.textures[texture]);
+    }
+
+  function _emscripten_glBindVertexArrayOES(vao) {
+      GLctx['bindVertexArray'](GL.vaos[vao]);
+    }
+
+  function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
+
+  function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
+
+  function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
+
+  function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+  function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glBufferData(target, size, data, usage) {
+        // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid
+        // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues.
+        GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage);
+    }
+
+  function _emscripten_glBufferSubData(target, offset, size, data) {
+      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+    }
+
+  function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
+
+  function _emscripten_glClear(x0) { GLctx['clear'](x0) }
+
+  function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+  function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+  function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
+
+  function _emscripten_glColorMask(red, green, blue, alpha) {
+      GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
+    }
+
+  function _emscripten_glCompileShader(shader) {
+      GLctx.compileShader(GL.shaders[shader]);
+    }
+
+  function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
+      GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+  function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
+
+  function _emscripten_glCreateProgram() {
+      var id = GL.getNewId(GL.programs);
+      var program = GLctx.createProgram();
+      program.name = id;
+      GL.programs[id] = program;
+      return id;
+    }
+
+  function _emscripten_glCreateShader(shaderType) {
+      var id = GL.getNewId(GL.shaders);
+      GL.shaders[id] = GLctx.createShader(shaderType);
+      return id;
+    }
+
+  function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
+
+  function _emscripten_glDeleteBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((buffers)+(i*4))>>2)];
+        var buffer = GL.buffers[id];
+  
+        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+        // correspond to existing buffer objects."
+        if (!buffer) continue;
+  
+        GLctx.deleteBuffer(buffer);
+        buffer.name = 0;
+        GL.buffers[id] = null;
+  
+        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+      }
+    }
+
+  function _emscripten_glDeleteFramebuffers(n, framebuffers) {
+      for (var i = 0; i < n; ++i) {
+        var id = HEAP32[(((framebuffers)+(i*4))>>2)];
+        var framebuffer = GL.framebuffers[id];
+        if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
+        GLctx.deleteFramebuffer(framebuffer);
+        framebuffer.name = 0;
+        GL.framebuffers[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteProgram(id) {
+      if (!id) return;
+      var program = GL.programs[id];
+      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteProgram(program);
+      program.name = 0;
+      GL.programs[id] = null;
+      GL.programInfos[id] = null;
+    }
+
+  function _emscripten_glDeleteQueriesEXT(n, ids) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((ids)+(i*4))>>2)];
+        var query = GL.timerQueriesEXT[id];
+        if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero."
+        GLctx.disjointTimerQueryExt['deleteQueryEXT'](query);
+        GL.timerQueriesEXT[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
+        var renderbuffer = GL.renderbuffers[id];
+        if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
+        GLctx.deleteRenderbuffer(renderbuffer);
+        renderbuffer.name = 0;
+        GL.renderbuffers[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteShader(id) {
+      if (!id) return;
+      var shader = GL.shaders[id];
+      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteShader(shader);
+      GL.shaders[id] = null;
+    }
+
+  function _emscripten_glDeleteTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((textures)+(i*4))>>2)];
+        var texture = GL.textures[id];
+        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+        GLctx.deleteTexture(texture);
+        texture.name = 0;
+        GL.textures[id] = null;
+      }
+    }
+
+  function _emscripten_glDeleteVertexArraysOES(n, vaos) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((vaos)+(i*4))>>2)];
+        GLctx['deleteVertexArray'](GL.vaos[id]);
+        GL.vaos[id] = null;
+      }
+    }
+
+  function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+  function _emscripten_glDepthMask(flag) {
+      GLctx.depthMask(!!flag);
+    }
+
+  function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
+
+  function _emscripten_glDetachShader(program, shader) {
+      GLctx.detachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
+
+  function _emscripten_glDisableVertexAttribArray(index) {
+      GLctx.disableVertexAttribArray(index);
+    }
+
+  function _emscripten_glDrawArrays(mode, first, count) {
+  
+      GLctx.drawArrays(mode, first, count);
+  
+    }
+
+  function _emscripten_glDrawArraysInstancedANGLE(mode, first, count, primcount) {
+      GLctx['drawArraysInstanced'](mode, first, count, primcount);
+    }
+
+  
+  var __tempFixedLengthArray=[];function _emscripten_glDrawBuffersWEBGL(n, bufs) {
+  
+      var bufArray = __tempFixedLengthArray[n];
+      for (var i = 0; i < n; i++) {
+        bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
+      }
+  
+      GLctx['drawBuffers'](bufArray);
+    }
+
+  function _emscripten_glDrawElements(mode, count, type, indices) {
+  
+      GLctx.drawElements(mode, count, type, indices);
+  
+    }
+
+  function _emscripten_glDrawElementsInstancedANGLE(mode, count, type, indices, primcount) {
+      GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
+    }
+
+  function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
+
+  function _emscripten_glEnableVertexAttribArray(index) {
+      GLctx.enableVertexAttribArray(index);
+    }
+
+  function _emscripten_glEndQueryEXT(target) {
+      GLctx.disjointTimerQueryExt['endQueryEXT'](target);
+    }
+
+  function _emscripten_glFinish() { GLctx['finish']() }
+
+  function _emscripten_glFlush() { GLctx['flush']() }
+
+  function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
+      GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
+                                         GL.renderbuffers[renderbuffer]);
+    }
+
+  function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
+      GLctx.framebufferTexture2D(target, attachment, textarget,
+                                      GL.textures[texture], level);
+    }
+
+  function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+  
+  function __glGenObject(n, buffers, createFunction, objectTable
+      ) {
+      for (var i = 0; i < n; i++) {
+        var buffer = GLctx[createFunction]();
+        var id = buffer && GL.getNewId(objectTable);
+        if (buffer) {
+          buffer.name = id;
+          objectTable[id] = buffer;
+        } else {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+        }
+        HEAP32[(((buffers)+(i*4))>>2)]=id;
+      }
+    }function _emscripten_glGenBuffers(n, buffers) {
+      __glGenObject(n, buffers, 'createBuffer', GL.buffers
+        );
+    }
+
+  function _emscripten_glGenFramebuffers(n, ids) {
+      __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers
+        );
+    }
+
+  function _emscripten_glGenQueriesEXT(n, ids) {
+      for (var i = 0; i < n; i++) {
+        var query = GLctx.disjointTimerQueryExt['createQueryEXT']();
+        if (!query) {
+          GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+          while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
+          return;
+        }
+        var id = GL.getNewId(GL.timerQueriesEXT);
+        query.name = id;
+        GL.timerQueriesEXT[id] = query;
+        HEAP32[(((ids)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGenRenderbuffers(n, renderbuffers) {
+      __glGenObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers
+        );
+    }
+
+  function _emscripten_glGenTextures(n, textures) {
+      __glGenObject(n, textures, 'createTexture', GL.textures
+        );
+    }
+
+  function _emscripten_glGenVertexArraysOES(n, arrays) {
+      __glGenObject(n, arrays, 'createVertexArray', GL.vaos
+        );
+    }
+
+  function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
+
+  function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
+      program = GL.programs[program];
+      var info = GLctx.getActiveAttrib(program, index);
+      if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
+  
+      if (bufSize > 0 && name) {
+        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+  
+      if (size) HEAP32[((size)>>2)]=info.size;
+      if (type) HEAP32[((type)>>2)]=info.type;
+    }
+
+  function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
+      program = GL.programs[program];
+      var info = GLctx.getActiveUniform(program, index);
+      if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
+  
+      if (bufSize > 0 && name) {
+        var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+  
+      if (size) HEAP32[((size)>>2)]=info.size;
+      if (type) HEAP32[((type)>>2)]=info.type;
+    }
+
+  function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
+      var result = GLctx.getAttachedShaders(GL.programs[program]);
+      var len = result.length;
+      if (len > maxCount) {
+        len = maxCount;
+      }
+      HEAP32[((count)>>2)]=len;
+      for (var i = 0; i < len; ++i) {
+        var id = GL.shaders.indexOf(result[i]);
+        HEAP32[(((shaders)+(i*4))>>2)]=id;
+      }
+    }
+
+  function _emscripten_glGetAttribLocation(program, name) {
+      return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name));
+    }
+
+  
+  function emscriptenWebGLGet(name_, p, type) {
+      // Guard against user passing a null pointer.
+      // Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
+      // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
+      // better to report an error instead of doing anything random.
+      if (!p) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var ret = undefined;
+      switch(name_) { // Handle a few trivial GLES values
+        case 0x8DFA: // GL_SHADER_COMPILER
+          ret = 1;
+          break;
+        case 0x8DF8: // GL_SHADER_BINARY_FORMATS
+          if (type !== 'Integer' && type !== 'Integer64') {
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+          }
+          return; // Do not write anything to the out pointer, since no binary formats are supported.
+        case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
+          ret = 0;
+          break;
+        case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
+          // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
+          // so implement it ourselves to allow C++ GLES2 code get the length.
+          var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
+          ret = formats ? formats.length : 0;
+          break;
+      }
+  
+      if (ret === undefined) {
+        var result = GLctx.getParameter(name_);
+        switch (typeof(result)) {
+          case "number":
+            ret = result;
+            break;
+          case "boolean":
+            ret = result ? 1 : 0;
+            break;
+          case "string":
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+            return;
+          case "object":
+            if (result === null) {
+              // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
+              // can mean an invalid name_, which we need to report as an error
+              switch(name_) {
+                case 0x8894: // ARRAY_BUFFER_BINDING
+                case 0x8B8D: // CURRENT_PROGRAM
+                case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
+                case 0x8CA6: // FRAMEBUFFER_BINDING
+                case 0x8CA7: // RENDERBUFFER_BINDING
+                case 0x8069: // TEXTURE_BINDING_2D
+                case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES
+                case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
+                  ret = 0;
+                  break;
+                }
+                default: {
+                  GL.recordError(0x0500); // GL_INVALID_ENUM
+                  return;
+                }
+              }
+            } else if (result instanceof Float32Array ||
+                       result instanceof Uint32Array ||
+                       result instanceof Int32Array ||
+                       result instanceof Array) {
+              for (var i = 0; i < result.length; ++i) {
+                switch (type) {
+                  case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i];   break;
+                  case 'Float':   HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
+                  case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0;    break;
+                  default: throw 'internal glGet error, bad type: ' + type;
+                }
+              }
+              return;
+            } else {
+              try {
+                ret = result.name | 0;
+              } catch(e) {
+                GL.recordError(0x0500); // GL_INVALID_ENUM
+                err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')');
+                return;
+              }
+            }
+            break;
+          default:
+            GL.recordError(0x0500); // GL_INVALID_ENUM
+            return;
+        }
+      }
+  
+      switch (type) {
+        case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]);    break;
+        case 'Integer': HEAP32[((p)>>2)]=ret;    break;
+        case 'Float':   HEAPF32[((p)>>2)]=ret;  break;
+        case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
+        default: throw 'internal glGet error, bad type: ' + type;
+      }
+    }function _emscripten_glGetBooleanv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Boolean');
+    }
+
+  function _emscripten_glGetBufferParameteriv(target, value, data) {
+      if (!data) {
+        // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
+        // if data == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
+    }
+
+  function _emscripten_glGetError() {
+      // First return any GL error generated by the emscripten library_webgl.js interop layer.
+      if (GL.lastError) {
+        var error = GL.lastError;
+        GL.lastError = 0/*GL_NO_ERROR*/;
+        return error;
+      } else
+      { // If there were none, return the GL error from the browser GL context.
+        return GLctx.getError();
+      }
+    }
+
+  function _emscripten_glGetFloatv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Float');
+    }
+
+  function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
+      var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
+      if (result instanceof WebGLRenderbuffer ||
+          result instanceof WebGLTexture) {
+        result = result.name | 0;
+      }
+      HEAP32[((params)>>2)]=result;
+    }
+
+  function _emscripten_glGetIntegerv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Integer');
+    }
+
+  function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
+      var log = GLctx.getProgramInfoLog(GL.programs[program]);
+      if (log === null) log = '(unknown error)';
+  
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetProgramiv(program, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      if (program >= GL.counter) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+        return;
+      }
+  
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getProgramInfoLog(GL.programs[program]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+        HEAP32[((p)>>2)]=ptable.maxUniformLength;
+      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+        if (ptable.maxAttributeLength == -1) {
+          program = GL.programs[program];
+          var numAttribs = GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/);
+          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+          for (var i = 0; i < numAttribs; ++i) {
+            var activeAttrib = GLctx.getActiveAttrib(program, i);
+            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+        if (ptable.maxUniformBlockNameLength == -1) {
+          program = GL.programs[program];
+          var numBlocks = GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/);
+          ptable.maxUniformBlockNameLength = 0;
+          for (var i = 0; i < numBlocks; ++i) {
+            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+      }
+    }
+
+  function _emscripten_glGetQueryObjecti64vEXT(id, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var query = GL.timerQueriesEXT[id];
+      var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+      var ret;
+      if (typeof param == 'boolean') {
+        ret = param ? 1 : 0;
+      } else {
+        ret = param;
+      }
+      (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((params)>>2)]=tempI64[0],HEAP32[(((params)+(4))>>2)]=tempI64[1]);
+    }
+
+  function _emscripten_glGetQueryObjectivEXT(id, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var query = GL.timerQueriesEXT[id];
+      var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+      var ret;
+      if (typeof param == 'boolean') {
+        ret = param ? 1 : 0;
+      } else {
+        ret = param;
+      }
+      HEAP32[((params)>>2)]=ret;
+    }
+
+  function _emscripten_glGetQueryObjectui64vEXT(id, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var query = GL.timerQueriesEXT[id];
+      var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+      var ret;
+      if (typeof param == 'boolean') {
+        ret = param ? 1 : 0;
+      } else {
+        ret = param;
+      }
+      (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((params)>>2)]=tempI64[0],HEAP32[(((params)+(4))>>2)]=tempI64[1]);
+    }
+
+  function _emscripten_glGetQueryObjectuivEXT(id, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var query = GL.timerQueriesEXT[id];
+      var param = GLctx.disjointTimerQueryExt['getQueryObjectEXT'](query, pname);
+      var ret;
+      if (typeof param == 'boolean') {
+        ret = param ? 1 : 0;
+      } else {
+        ret = param;
+      }
+      HEAP32[((params)>>2)]=ret;
+    }
+
+  function _emscripten_glGetQueryivEXT(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((params)>>2)]=GLctx.disjointTimerQueryExt['getQueryEXT'](target, pname);
+    }
+
+  function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
+    }
+
+  function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+      if (log === null) log = '(unknown error)';
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
+      var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
+      HEAP32[((range)>>2)]=result.rangeMin;
+      HEAP32[(((range)+(4))>>2)]=result.rangeMax;
+      HEAP32[((precision)>>2)]=result.precision;
+    }
+
+  function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
+      var result = GLctx.getShaderSource(GL.shaders[shader]);
+      if (!result) return; // If an error occurs, nothing will be written to length or source.
+      if (bufSize > 0 && source) {
+        var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _emscripten_glGetShaderiv(shader, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
+        var source = GLctx.getShaderSource(GL.shaders[shader]);
+        var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1;
+        HEAP32[((p)>>2)]=sourceLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+      }
+    }
+
+  
+  function stringToNewUTF8(jsString) {
+      var length = lengthBytesUTF8(jsString)+1;
+      var cString = _malloc(length);
+      stringToUTF8(jsString, cString, length);
+      return cString;
+    }function _emscripten_glGetString(name_) {
+      if (GL.stringCache[name_]) return GL.stringCache[name_];
+      var ret;
+      switch(name_) {
+        case 0x1F03 /* GL_EXTENSIONS */:
+          var exts = GLctx.getSupportedExtensions();
+          var gl_exts = [];
+          for (var i = 0; i < exts.length; ++i) {
+            gl_exts.push(exts[i]);
+            gl_exts.push("GL_" + exts[i]);
+          }
+          ret = stringToNewUTF8(gl_exts.join(' '));
+          break;
+        case 0x1F00 /* GL_VENDOR */:
+        case 0x1F01 /* GL_RENDERER */:
+        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+          var s = GLctx.getParameter(name_);
+          if (!s) {
+            GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          }
+          ret = stringToNewUTF8(s);
+          break;
+  
+        case 0x1F02 /* GL_VERSION */:
+          var glVersion = GLctx.getParameter(GLctx.VERSION);
+          // return GLES version string corresponding to the version of the WebGL context
+          {
+            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+          }
+          ret = stringToNewUTF8(glVersion);
+          break;
+        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+          var ver_num = glslVersion.match(ver_re);
+          if (ver_num !== null) {
+            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+          }
+          ret = stringToNewUTF8(glslVersion);
+          break;
+        default:
+          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          return 0;
+      }
+      GL.stringCache[name_] = ret;
+      return ret;
+    }
+
+  function _emscripten_glGetTexParameterfv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+    }
+
+  function _emscripten_glGetTexParameteriv(target, pname, params) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
+    }
+
+  function _emscripten_glGetUniformLocation(program, name) {
+      name = UTF8ToString(name);
+  
+      var arrayIndex = 0;
+      // If user passed an array accessor "[index]", parse the array index off the accessor.
+      if (name[name.length - 1] == ']') {
+        var leftBrace = name.lastIndexOf('[');
+        arrayIndex = name[leftBrace+1] != ']' ? parseInt(name.slice(leftBrace + 1)) : 0; // "index]", parseInt will ignore the ']' at the end; but treat "foo[]" as "foo[0]"
+        name = name.slice(0, leftBrace);
+      }
+  
+      var uniformInfo = GL.programInfos[program] && GL.programInfos[program].uniforms[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+      if (uniformInfo && arrayIndex >= 0 && arrayIndex < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+        return uniformInfo[1] + arrayIndex;
+      } else {
+        return -1;
+      }
+    }
+
+  
+  function emscriptenWebGLGetUniform(program, location, params, type) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
+      if (typeof data == 'number' || typeof data == 'boolean') {
+        switch (type) {
+          case 'Integer': HEAP32[((params)>>2)]=data; break;
+          case 'Float': HEAPF32[((params)>>2)]=data; break;
+          default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+        }
+      } else {
+        for (var i = 0; i < data.length; i++) {
+          switch (type) {
+            case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break;
+            default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
+          }
+        }
+      }
+    }function _emscripten_glGetUniformfv(program, location, params) {
+      emscriptenWebGLGetUniform(program, location, params, 'Float');
+    }
+
+  function _emscripten_glGetUniformiv(program, location, params) {
+      emscriptenWebGLGetUniform(program, location, params, 'Integer');
+    }
+
+  function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
+      if (!pointer) {
+        // GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
+        // if pointer == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
+    }
+
+  
+  function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
+      if (!params) {
+        // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
+        // if params == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      var data = GLctx.getVertexAttrib(index, pname);
+      if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
+        HEAP32[((params)>>2)]=data["name"];
+      } else if (typeof data == 'number' || typeof data == 'boolean') {
+        switch (type) {
+          case 'Integer': HEAP32[((params)>>2)]=data; break;
+          case 'Float': HEAPF32[((params)>>2)]=data; break;
+          case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
+          default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+        }
+      } else {
+        for (var i = 0; i < data.length; i++) {
+          switch (type) {
+            case 'Integer': HEAP32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'Float': HEAPF32[(((params)+(i*4))>>2)]=data[i]; break;
+            case 'FloatToInteger': HEAP32[(((params)+(i*4))>>2)]=Math.fround(data[i]); break;
+            default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
+          }
+        }
+      }
+    }function _emscripten_glGetVertexAttribfv(index, pname, params) {
+      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+      // otherwise the results are undefined. (GLES3 spec 6.1.12)
+      emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
+    }
+
+  function _emscripten_glGetVertexAttribiv(index, pname, params) {
+      // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
+      // otherwise the results are undefined. (GLES3 spec 6.1.12)
+      emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
+    }
+
+  function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
+
+  function _emscripten_glIsBuffer(buffer) {
+      var b = GL.buffers[buffer];
+      if (!b) return 0;
+      return GLctx.isBuffer(b);
+    }
+
+  function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
+
+  function _emscripten_glIsFramebuffer(framebuffer) {
+      var fb = GL.framebuffers[framebuffer];
+      if (!fb) return 0;
+      return GLctx.isFramebuffer(fb);
+    }
+
+  function _emscripten_glIsProgram(program) {
+      program = GL.programs[program];
+      if (!program) return 0;
+      return GLctx.isProgram(program);
+    }
+
+  function _emscripten_glIsQueryEXT(id) {
+      var query = GL.timerQueriesEXT[id];
+      if (!query) return 0;
+      return GLctx.disjointTimerQueryExt['isQueryEXT'](query);
+    }
+
+  function _emscripten_glIsRenderbuffer(renderbuffer) {
+      var rb = GL.renderbuffers[renderbuffer];
+      if (!rb) return 0;
+      return GLctx.isRenderbuffer(rb);
+    }
+
+  function _emscripten_glIsShader(shader) {
+      var s = GL.shaders[shader];
+      if (!s) return 0;
+      return GLctx.isShader(s);
+    }
+
+  function _emscripten_glIsTexture(id) {
+      var texture = GL.textures[id];
+      if (!texture) return 0;
+      return GLctx.isTexture(texture);
+    }
+
+  function _emscripten_glIsVertexArrayOES(array) {
+  
+      var vao = GL.vaos[array];
+      if (!vao) return 0;
+      return GLctx['isVertexArray'](vao);
+    }
+
+  function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
+
+  function _emscripten_glLinkProgram(program) {
+      GLctx.linkProgram(GL.programs[program]);
+      GL.populateUniformTable(program);
+    }
+
+  function _emscripten_glPixelStorei(pname, param) {
+      if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+        GL.unpackAlignment = param;
+      }
+      GLctx.pixelStorei(pname, param);
+    }
+
+  function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
+
+  function _emscripten_glQueryCounterEXT(id, target) {
+      GLctx.disjointTimerQueryExt['queryCounterEXT'](GL.timerQueriesEXT[id], target);
+    }
+
+  
+  
+  function __computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) {
+      function roundedToNextMultipleOf(x, y) {
+        return (x + y - 1) & -y;
+      }
+      var plainRowSize = width * sizePerPixel;
+      var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
+      return height * alignedRowSize;
+    }
+  
+  var __colorChannelsInGlTextureFormat={6402:1,6406:1,6407:3,6408:4,6409:1,6410:2,35904:3,35906:4};
+  
+  var __sizeOfGlTextureElementType={5121:1,5123:2,5125:4,5126:4,32819:2,32820:2,33635:2,34042:4,36193:2};function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
+      var sizePerPixel = __colorChannelsInGlTextureFormat[format] * __sizeOfGlTextureElementType[type];
+      if (!sizePerPixel) {
+        GL.recordError(0x0500); // GL_INVALID_ENUM
+        return;
+      }
+      var bytes = __computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment);
+      var end = pixels + bytes;
+      switch(type) {
+        case 0x1401 /* GL_UNSIGNED_BYTE */:
+          return HEAPU8.subarray(pixels, end);
+        case 0x1406 /* GL_FLOAT */:
+          return HEAPF32.subarray(pixels>>2, end>>2);
+        case 0x1405 /* GL_UNSIGNED_INT */:
+        case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
+          return HEAPU32.subarray(pixels>>2, end>>2);
+        case 0x1403 /* GL_UNSIGNED_SHORT */:
+        case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
+        case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
+        case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
+        case 0x8D61 /* GL_HALF_FLOAT_OES */:
+          return HEAPU16.subarray(pixels>>1, end>>1);
+        default:
+          GL.recordError(0x0500); // GL_INVALID_ENUM
+      }
+    }function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
+      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+      if (!pixelData) {
+        GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+        return;
+      }
+      GLctx.readPixels(x, y, width, height, format, type, pixelData);
+    }
+
+  function _emscripten_glReleaseShaderCompiler() {
+      // NOP (as allowed by GLES 2.0 spec)
+    }
+
+  function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
+
+  function _emscripten_glSampleCoverage(value, invert) {
+      GLctx.sampleCoverage(value, !!invert);
+    }
+
+  function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
+
+  function _emscripten_glShaderBinary() {
+      GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+    }
+
+  function _emscripten_glShaderSource(shader, count, string, length) {
+      var source = GL.getSource(shader, count, string, length);
+  
+  
+      GLctx.shaderSource(GL.shaders[shader], source);
+    }
+
+  function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
+
+  function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
+
+  function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
+
+  function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
+
+  function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
+
+  function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null);
+    }
+
+  function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
+
+  function _emscripten_glTexParameterfv(target, pname, params) {
+      var param = HEAPF32[((params)>>2)];
+      GLctx.texParameterf(target, pname, param);
+    }
+
+  function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+  function _emscripten_glTexParameteriv(target, pname, params) {
+      var param = HEAP32[((params)>>2)];
+      GLctx.texParameteri(target, pname, param);
+    }
+
+  function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
+      var pixelData = null;
+      if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
+      GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
+    }
+
+  function _emscripten_glUniform1f(location, v0) {
+      GLctx.uniform1f(GL.uniforms[location], v0);
+    }
+
+  function _emscripten_glUniform1fv(location, count, value) {
+  
+  
+      if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[count-1];
+        for (var i = 0; i < count; ++i) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
+      }
+      GLctx.uniform1fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform1i(location, v0) {
+      GLctx.uniform1i(GL.uniforms[location], v0);
+    }
+
+  function _emscripten_glUniform1iv(location, count, value) {
+  
+  
+      GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
+    }
+
+  function _emscripten_glUniform2f(location, v0, v1) {
+      GLctx.uniform2f(GL.uniforms[location], v0, v1);
+    }
+
+  function _emscripten_glUniform2fv(location, count, value) {
+  
+  
+      if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[2*count-1];
+        for (var i = 0; i < 2*count; i += 2) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
+      }
+      GLctx.uniform2fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform2i(location, v0, v1) {
+      GLctx.uniform2i(GL.uniforms[location], v0, v1);
+    }
+
+  function _emscripten_glUniform2iv(location, count, value) {
+  
+  
+      GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
+    }
+
+  function _emscripten_glUniform3f(location, v0, v1, v2) {
+      GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
+    }
+
+  function _emscripten_glUniform3fv(location, count, value) {
+  
+  
+      if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[3*count-1];
+        for (var i = 0; i < 3*count; i += 3) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
+      }
+      GLctx.uniform3fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform3i(location, v0, v1, v2) {
+      GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
+    }
+
+  function _emscripten_glUniform3iv(location, count, value) {
+  
+  
+      GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
+    }
+
+  function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
+      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _emscripten_glUniform4fv(location, count, value) {
+  
+  
+      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[4*count-1];
+        for (var i = 0; i < 4*count; i += 4) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+      }
+      GLctx.uniform4fv(GL.uniforms[location], view);
+    }
+
+  function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
+      GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _emscripten_glUniform4iv(location, count, value) {
+  
+  
+      GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
+    }
+
+  function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
+  
+  
+      if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[4*count-1];
+        for (var i = 0; i < 4*count; i += 4) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
+      }
+      GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
+  
+  
+      if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[9*count-1];
+        for (var i = 0; i < 9*count; i += 9) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
+      }
+      GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
+  
+  
+      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[16*count-1];
+        for (var i = 0; i < 16*count; i += 16) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+      }
+      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _emscripten_glUseProgram(program) {
+      GLctx.useProgram(GL.programs[program]);
+    }
+
+  function _emscripten_glValidateProgram(program) {
+      GLctx.validateProgram(GL.programs[program]);
+    }
+
+  function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
+
+  function _emscripten_glVertexAttrib1fv(index, v) {
+  
+      GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
+    }
+
+  function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
+
+  function _emscripten_glVertexAttrib2fv(index, v) {
+  
+      GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
+    }
+
+  function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
+
+  function _emscripten_glVertexAttrib3fv(index, v) {
+  
+      GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
+    }
+
+  function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
+
+  function _emscripten_glVertexAttrib4fv(index, v) {
+  
+      GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
+    }
+
+  function _emscripten_glVertexAttribDivisorANGLE(index, divisor) {
+      GLctx['vertexAttribDivisor'](index, divisor);
+    }
+
+  function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+    }
+
+  function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+  
+  
+  var __specialEventTargets=[0, typeof document !== 'undefined' ? document : 0, typeof window !== 'undefined' ? window : 0];function __findEventTarget(target) {
+      warnOnce('Rules for selecting event targets in HTML5 API are changing: instead of using document.getElementById() that only can refer to elements by their DOM ID, new event target selection mechanism uses the more flexible function document.querySelector() that can look up element names, classes, and complex CSS selectors. Build with -s DISABLE_DEPRECATED_FIND_EVENT_TARGET_BEHAVIOR=1 to change to the new lookup rules. See https://github.com/emscripten-core/emscripten/pull/7977 for more details.');
+      try {
+        // The sensible "default" target varies between events, but use window as the default
+        // since DOM events mostly can default to that. Specific callback registrations
+        // override their own defaults.
+        if (!target) return window;
+        if (typeof target === "number") target = __specialEventTargets[target] || UTF8ToString(target);
+        if (target === '#window') return window;
+        else if (target === '#document') return document;
+        else if (target === '#screen') return screen;
+        else if (target === '#canvas') return Module['canvas'];
+        return (typeof target === 'string') ? document.getElementById(target) : target;
+      } catch(e) {
+        // In Web Workers, some objects above, such as '#document' do not exist. Gracefully
+        // return null for them.
+        return null;
+      }
+    }function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
+      if (!target) target = '#canvas';
+      target = __findEventTarget(target);
+      if (!target) return -4;
+      if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
+        return -1;
+      }
+  
+      var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
+  
+      // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
+      if (!canPerformRequests) {
+        if (deferUntilInEventHandler) {
+          JSEvents.deferCall(__requestPointerLock, 2 /* priority below fullscreen */, [target]);
+          return 1;
+        } else {
+          return -2;
+        }
+      }
+  
+      return __requestPointerLock(target);
+    }
+
+  
+  function abortOnCannotGrowMemory(requestedSize) {
+      abort('Cannot enlarge memory arrays to size ' + requestedSize + ' bytes (OOM). Either (1) compile with  -s TOTAL_MEMORY=X  with X higher than the current value ' + HEAP8.length + ', (2) compile with  -s ALLOW_MEMORY_GROWTH=1  which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with  -s ABORTING_MALLOC=0 ');
+    }function _emscripten_resize_heap(requestedSize) {
+      abortOnCannotGrowMemory(requestedSize);
+    }
+
+  function _emscripten_run_script(ptr) {
+      eval(UTF8ToString(ptr));
+    }
+
+  function _emscripten_sample_gamepad_data() {
+      return (JSEvents.lastGamepadState = (navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null)))
+        ? 0 : -1;
+    }
+
+  
+  
+  function __fillMouseEventData(eventStruct, e, target) {
+      HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
+      HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
+      HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
+      HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
+      HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
+      HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
+      HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
+      HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
+      HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
+      HEAP16[(((eventStruct)+(40))>>1)]=e.button;
+      HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
+      HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
+      HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
+  
+      if (Module['canvas']) {
+        var rect = Module['canvas'].getBoundingClientRect();
+        HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
+        HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
+      } else { // Canvas is not initialized, return 0.
+        HEAP32[(((eventStruct)+(60))>>2)]=0;
+        HEAP32[(((eventStruct)+(64))>>2)]=0;
+      }
+      if (target) {
+        var rect = JSEvents.getBoundingClientRectOrZeros(target);
+        HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
+        HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
+      } else { // No specific target passed, return 0.
+        HEAP32[(((eventStruct)+(52))>>2)]=0;
+        HEAP32[(((eventStruct)+(56))>>2)]=0;
+      }
+      // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
+        // https://github.com/emscripten-core/emscripten/pull/4997
+      // https://bugs.chromium.org/p/chromium/issues/detail?id=699956
+      if (e.type !== 'wheel' && e.type !== 'mousewheel') {
+        JSEvents.previousScreenX = e.screenX;
+        JSEvents.previousScreenY = e.screenY;
+      }
+    }function __registerMouseEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+      if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 72 );
+      target = __findEventTarget(target);
+  
+      var mouseEventHandlerFunc = function(event) {
+        var e = event || window.event;
+  
+        // TODO: Make this access thread safe, or this could update live while app is reading it.
+        __fillMouseEventData(JSEvents.mouseEvent, e, target);
+  
+        if (dynCall_iiii(callbackfunc, eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault();
+      };
+  
+      var eventHandler = {
+        target: target,
+        allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
+        eventTypeString: eventTypeString,
+        callbackfunc: callbackfunc,
+        handlerFunc: mouseEventHandlerFunc,
+        useCapture: useCapture
+      };
+      // In IE, mousedown events don't either allow deferred calls to be run!
+      if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
+      JSEvents.registerOrRemoveHandler(eventHandler);
+    }function _emscripten_set_click_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click", targetThread);
+      return 0;
+    }
+
+  
+  
+  function __fillFullscreenChangeEventData(eventStruct, e) {
+      var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
+      var isFullscreen = !!fullscreenElement;
+      HEAP32[((eventStruct)>>2)]=isFullscreen;
+      HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
+      // If transitioning to fullscreen, report info about the element that is now fullscreen.
+      // If transitioning to windowed mode, report info about the element that just was fullscreen.
+      var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
+      var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
+      var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
+      stringToUTF8(nodeName, eventStruct + 8, 128);
+      stringToUTF8(id, eventStruct + 136, 128);
+      HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
+      HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
+      HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
+      HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
+      if (isFullscreen) {
+        JSEvents.previousFullscreenElement = fullscreenElement;
+      }
+    }function __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+      if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 );
+  
+      var fullscreenChangeEventhandlerFunc = function(event) {
+        var e = event || window.event;
+  
+        var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent;
+  
+        __fillFullscreenChangeEventData(fullscreenChangeEvent, e);
+  
+        if (dynCall_iiii(callbackfunc, eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault();
+      };
+  
+      var eventHandler = {
+        target: target,
+        allowsDeferredCalls: false,
+        eventTypeString: eventTypeString,
+        callbackfunc: callbackfunc,
+        handlerFunc: fullscreenChangeEventhandlerFunc,
+        useCapture: useCapture
+      };
+      JSEvents.registerOrRemoveHandler(eventHandler);
+    }function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
+      target = target ? __findEventTarget(target) : __specialEventTargets[1];
+      if (!target) return -4;
+      __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread);
+      __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange", targetThread);
+      __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread);
+      __registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange", targetThread);
+      return 0;
+    }
+
+  
+  function __registerGamepadEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+      if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 );
+  
+      var gamepadEventHandlerFunc = function(event) {
+        var e = event || window.event;
+  
+        var gamepadEvent = JSEvents.gamepadEvent;
+        __fillGamepadEventData(gamepadEvent, e.gamepad);
+  
+        if (dynCall_iiii(callbackfunc, eventTypeId, gamepadEvent, userData)) e.preventDefault();
+      };
+  
+      var eventHandler = {
+        target: __findEventTarget(target),
+        allowsDeferredCalls: true,
+        eventTypeString: eventTypeString,
+        callbackfunc: callbackfunc,
+        handlerFunc: gamepadEventHandlerFunc,
+        useCapture: useCapture
+      };
+      JSEvents.registerOrRemoveHandler(eventHandler);
+    }function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
+      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+      __registerGamepadEventCallback(2, userData, useCapture, callbackfunc, 26, "gamepadconnected", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) {
+      if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
+      __registerGamepadEventCallback(2, userData, useCapture, callbackfunc, 27, "gamepaddisconnected", targetThread);
+      return 0;
+    }
+
+  
+  function __registerKeyEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+      if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 164 );
+  
+      var keyEventHandlerFunc = function(event) {
+        var e = event || window.event;
+  
+        var keyEventData = JSEvents.keyEvent;
+        stringToUTF8(e.key ? e.key : "", keyEventData + 0, 32);
+        stringToUTF8(e.code ? e.code : "", keyEventData + 32, 32);
+        HEAP32[(((keyEventData)+(64))>>2)]=e.location;
+        HEAP32[(((keyEventData)+(68))>>2)]=e.ctrlKey;
+        HEAP32[(((keyEventData)+(72))>>2)]=e.shiftKey;
+        HEAP32[(((keyEventData)+(76))>>2)]=e.altKey;
+        HEAP32[(((keyEventData)+(80))>>2)]=e.metaKey;
+        HEAP32[(((keyEventData)+(84))>>2)]=e.repeat;
+        stringToUTF8(e.locale ? e.locale : "", keyEventData + 88, 32);
+        stringToUTF8(e.char ? e.char : "", keyEventData + 120, 32);
+        HEAP32[(((keyEventData)+(152))>>2)]=e.charCode;
+        HEAP32[(((keyEventData)+(156))>>2)]=e.keyCode;
+        HEAP32[(((keyEventData)+(160))>>2)]=e.which;
+  
+        if (dynCall_iiii(callbackfunc, eventTypeId, keyEventData, userData)) e.preventDefault();
+      };
+  
+      var eventHandler = {
+        target: __findEventTarget(target),
+        allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
+        eventTypeString: eventTypeString,
+        callbackfunc: callbackfunc,
+        handlerFunc: keyEventHandlerFunc,
+        useCapture: useCapture
+      };
+      JSEvents.registerOrRemoveHandler(eventHandler);
+    }function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread);
+      return 0;
+    }
+
+
+  
+  function __registerTouchEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) {
+      if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1684 );
+  
+      target = __findEventTarget(target);
+  
+      var touchEventHandlerFunc = function(event) {
+        var e = event || window.event;
+  
+        var touches = {};
+        for(var i = 0; i < e.touches.length; ++i) {
+          var touch = e.touches[i];
+          touches[touch.identifier] = touch;
+        }
+        for(var i = 0; i < e.changedTouches.length; ++i) {
+          var touch = e.changedTouches[i];
+          touches[touch.identifier] = touch;
+          touch.changed = true;
+        }
+        for(var i = 0; i < e.targetTouches.length; ++i) {
+          var touch = e.targetTouches[i];
+          touches[touch.identifier].onTarget = true;
+        }
+  
+        var touchEvent = JSEvents.touchEvent;
+        var ptr = touchEvent;
+        HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
+        HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
+        HEAP32[(((ptr)+(12))>>2)]=e.altKey;
+        HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
+        ptr += 20; // Advance to the start of the touch array.
+        var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
+        var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
+        var numTouches = 0;
+        for(var i in touches) {
+          var t = touches[i];
+          HEAP32[((ptr)>>2)]=t.identifier;
+          HEAP32[(((ptr)+(4))>>2)]=t.screenX;
+          HEAP32[(((ptr)+(8))>>2)]=t.screenY;
+          HEAP32[(((ptr)+(12))>>2)]=t.clientX;
+          HEAP32[(((ptr)+(16))>>2)]=t.clientY;
+          HEAP32[(((ptr)+(20))>>2)]=t.pageX;
+          HEAP32[(((ptr)+(24))>>2)]=t.pageY;
+          HEAP32[(((ptr)+(28))>>2)]=t.changed;
+          HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
+          if (canvasRect) {
+            HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
+            HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
+          } else {
+            HEAP32[(((ptr)+(44))>>2)]=0;
+            HEAP32[(((ptr)+(48))>>2)]=0;            
+          }
+          HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
+          HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
+  
+          ptr += 52;
+  
+          if (++numTouches >= 32) {
+            break;
+          }
+        }
+        HEAP32[((touchEvent)>>2)]=numTouches;
+  
+        if (dynCall_iiii(callbackfunc, eventTypeId, touchEvent, userData)) e.preventDefault();
+      };
+  
+      var eventHandler = {
+        target: target,
+        allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend',
+        eventTypeString: eventTypeString,
+        callbackfunc: callbackfunc,
+        handlerFunc: touchEventHandlerFunc,
+        useCapture: useCapture
+      };
+      JSEvents.registerOrRemoveHandler(eventHandler);
+    }function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread);
+      return 0;
+    }
+
+  function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) {
+      __registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread);
+      return 0;
+    }
+
+  function _exit(status) {
+      // void _exit(int status);
+      // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
+      exit(status);
+    }
+
+  function _glActiveTexture(x0) { GLctx['activeTexture'](x0) }
+
+  function _glAttachShader(program, shader) {
+      GLctx.attachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _glBindAttribLocation(program, index, name) {
+      GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name));
+    }
+
+  function _glBindBuffer(target, buffer) {
+  
+      GLctx.bindBuffer(target, GL.buffers[buffer]);
+    }
+
+  function _glBindTexture(target, texture) {
+      GLctx.bindTexture(target, GL.textures[texture]);
+    }
+
+  function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
+
+  function _glBufferData(target, size, data, usage) {
+        // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid
+        // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues.
+        GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage);
+    }
+
+  function _glBufferSubData(target, offset, size, data) {
+      GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
+    }
+
+  function _glClear(x0) { GLctx['clear'](x0) }
+
+  function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
+
+  function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }
+
+  function _glCompileShader(shader) {
+      GLctx.compileShader(GL.shaders[shader]);
+    }
+
+  function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
+      GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
+    }
+
+  function _glCreateProgram() {
+      var id = GL.getNewId(GL.programs);
+      var program = GLctx.createProgram();
+      program.name = id;
+      GL.programs[id] = program;
+      return id;
+    }
+
+  function _glCreateShader(shaderType) {
+      var id = GL.getNewId(GL.shaders);
+      GL.shaders[id] = GLctx.createShader(shaderType);
+      return id;
+    }
+
+  function _glCullFace(x0) { GLctx['cullFace'](x0) }
+
+  function _glDeleteBuffers(n, buffers) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((buffers)+(i*4))>>2)];
+        var buffer = GL.buffers[id];
+  
+        // From spec: "glDeleteBuffers silently ignores 0's and names that do not
+        // correspond to existing buffer objects."
+        if (!buffer) continue;
+  
+        GLctx.deleteBuffer(buffer);
+        buffer.name = 0;
+        GL.buffers[id] = null;
+  
+        if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
+        if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
+      }
+    }
+
+  function _glDeleteProgram(id) {
+      if (!id) return;
+      var program = GL.programs[id];
+      if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteProgram(program);
+      program.name = 0;
+      GL.programs[id] = null;
+      GL.programInfos[id] = null;
+    }
+
+  function _glDeleteShader(id) {
+      if (!id) return;
+      var shader = GL.shaders[id];
+      if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      GLctx.deleteShader(shader);
+      GL.shaders[id] = null;
+    }
+
+  function _glDeleteTextures(n, textures) {
+      for (var i = 0; i < n; i++) {
+        var id = HEAP32[(((textures)+(i*4))>>2)];
+        var texture = GL.textures[id];
+        if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
+        GLctx.deleteTexture(texture);
+        texture.name = 0;
+        GL.textures[id] = null;
+      }
+    }
+
+  function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }
+
+  function _glDetachShader(program, shader) {
+      GLctx.detachShader(GL.programs[program],
+                              GL.shaders[shader]);
+    }
+
+  function _glDisable(x0) { GLctx['disable'](x0) }
+
+  function _glDisableVertexAttribArray(index) {
+      GLctx.disableVertexAttribArray(index);
+    }
+
+  function _glDrawArrays(mode, first, count) {
+  
+      GLctx.drawArrays(mode, first, count);
+  
+    }
+
+  function _glDrawElements(mode, count, type, indices) {
+  
+      GLctx.drawElements(mode, count, type, indices);
+  
+    }
+
+  function _glEnable(x0) { GLctx['enable'](x0) }
+
+  function _glEnableVertexAttribArray(index) {
+      GLctx.enableVertexAttribArray(index);
+    }
+
+  function _glFrontFace(x0) { GLctx['frontFace'](x0) }
+
+  function _glGenBuffers(n, buffers) {
+      __glGenObject(n, buffers, 'createBuffer', GL.buffers
+        );
+    }
+
+  function _glGenTextures(n, textures) {
+      __glGenObject(n, textures, 'createTexture', GL.textures
+        );
+    }
+
+  function _glGetAttribLocation(program, name) {
+      return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name));
+    }
+
+  function _glGetFloatv(name_, p) {
+      emscriptenWebGLGet(name_, p, 'Float');
+    }
+
+  function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
+      var log = GLctx.getProgramInfoLog(GL.programs[program]);
+      if (log === null) log = '(unknown error)';
+  
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _glGetProgramiv(program, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      if (program >= GL.counter) {
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+  
+      var ptable = GL.programInfos[program];
+      if (!ptable) {
+        GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
+        return;
+      }
+  
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getProgramInfoLog(GL.programs[program]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
+        HEAP32[((p)>>2)]=ptable.maxUniformLength;
+      } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
+        if (ptable.maxAttributeLength == -1) {
+          program = GL.programs[program];
+          var numAttribs = GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/);
+          ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
+          for (var i = 0; i < numAttribs; ++i) {
+            var activeAttrib = GLctx.getActiveAttrib(program, i);
+            ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxAttributeLength;
+      } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
+        if (ptable.maxUniformBlockNameLength == -1) {
+          program = GL.programs[program];
+          var numBlocks = GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/);
+          ptable.maxUniformBlockNameLength = 0;
+          for (var i = 0; i < numBlocks; ++i) {
+            var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
+            ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
+          }
+        }
+        HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
+      }
+    }
+
+  function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
+      var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+      if (log === null) log = '(unknown error)';
+      if (maxLength > 0 && infoLog) {
+        var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
+        if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
+      } else {
+        if (length) HEAP32[((length)>>2)]=0;
+      }
+    }
+
+  function _glGetShaderiv(shader, pname, p) {
+      if (!p) {
+        // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
+        // if p == null, issue a GL error to notify user about it.
+        GL.recordError(0x0501 /* GL_INVALID_VALUE */);
+        return;
+      }
+      if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
+        var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
+        if (log === null) log = '(unknown error)';
+        HEAP32[((p)>>2)]=log.length + 1;
+      } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH
+        var source = GLctx.getShaderSource(GL.shaders[shader]);
+        var sourceLength = (source === null || source.length == 0) ? 0 : source.length + 1;
+        HEAP32[((p)>>2)]=sourceLength;
+      } else {
+        HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
+      }
+    }
+
+  function _glGetString(name_) {
+      if (GL.stringCache[name_]) return GL.stringCache[name_];
+      var ret;
+      switch(name_) {
+        case 0x1F03 /* GL_EXTENSIONS */:
+          var exts = GLctx.getSupportedExtensions();
+          var gl_exts = [];
+          for (var i = 0; i < exts.length; ++i) {
+            gl_exts.push(exts[i]);
+            gl_exts.push("GL_" + exts[i]);
+          }
+          ret = stringToNewUTF8(gl_exts.join(' '));
+          break;
+        case 0x1F00 /* GL_VENDOR */:
+        case 0x1F01 /* GL_RENDERER */:
+        case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
+        case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
+          var s = GLctx.getParameter(name_);
+          if (!s) {
+            GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          }
+          ret = stringToNewUTF8(s);
+          break;
+  
+        case 0x1F02 /* GL_VERSION */:
+          var glVersion = GLctx.getParameter(GLctx.VERSION);
+          // return GLES version string corresponding to the version of the WebGL context
+          {
+            glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
+          }
+          ret = stringToNewUTF8(glVersion);
+          break;
+        case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
+          var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
+          // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
+          var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
+          var ver_num = glslVersion.match(ver_re);
+          if (ver_num !== null) {
+            if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
+            glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
+          }
+          ret = stringToNewUTF8(glslVersion);
+          break;
+        default:
+          GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+          return 0;
+      }
+      GL.stringCache[name_] = ret;
+      return ret;
+    }
+
+  function _glGetUniformLocation(program, name) {
+      name = UTF8ToString(name);
+  
+      var arrayIndex = 0;
+      // If user passed an array accessor "[index]", parse the array index off the accessor.
+      if (name[name.length - 1] == ']') {
+        var leftBrace = name.lastIndexOf('[');
+        arrayIndex = name[leftBrace+1] != ']' ? parseInt(name.slice(leftBrace + 1)) : 0; // "index]", parseInt will ignore the ']' at the end; but treat "foo[]" as "foo[0]"
+        name = name.slice(0, leftBrace);
+      }
+  
+      var uniformInfo = GL.programInfos[program] && GL.programInfos[program].uniforms[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
+      if (uniformInfo && arrayIndex >= 0 && arrayIndex < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
+        return uniformInfo[1] + arrayIndex;
+      } else {
+        return -1;
+      }
+    }
+
+  function _glLinkProgram(program) {
+      GLctx.linkProgram(GL.programs[program]);
+      GL.populateUniformTable(program);
+    }
+
+  function _glPixelStorei(pname, param) {
+      if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
+        GL.unpackAlignment = param;
+      }
+      GLctx.pixelStorei(pname, param);
+    }
+
+  function _glReadPixels(x, y, width, height, format, type, pixels) {
+      var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
+      if (!pixelData) {
+        GL.recordError(0x0500/*GL_INVALID_ENUM*/);
+        return;
+      }
+      GLctx.readPixels(x, y, width, height, format, type, pixelData);
+    }
+
+  function _glShaderSource(shader, count, string, length) {
+      var source = GL.getSource(shader, count, string, length);
+  
+  
+      GLctx.shaderSource(GL.shaders[shader], source);
+    }
+
+  function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
+      GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null);
+    }
+
+  function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
+
+  function _glUniform1i(location, v0) {
+      GLctx.uniform1i(GL.uniforms[location], v0);
+    }
+
+  function _glUniform4f(location, v0, v1, v2, v3) {
+      GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
+    }
+
+  function _glUniformMatrix4fv(location, count, transpose, value) {
+  
+  
+      if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
+        // avoid allocation when uploading few enough uniforms
+        var view = GL.miniTempBufferViews[16*count-1];
+        for (var i = 0; i < 16*count; i += 16) {
+          view[i] = HEAPF32[(((value)+(4*i))>>2)];
+          view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
+          view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
+          view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
+          view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
+          view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
+          view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
+          view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
+          view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
+          view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
+          view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
+          view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
+          view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
+          view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
+          view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
+          view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
+        }
+      } else
+      {
+        var view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
+      }
+      GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
+    }
+
+  function _glUseProgram(program) {
+      GLctx.useProgram(GL.programs[program]);
+    }
+
+  function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
+      GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
+    }
+
+  function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
+
+  
+  var GLFW={Window:function (id, width, height, title, monitor, share) {
+        this.id = id;
+        this.x = 0;
+        this.y = 0;
+        this.fullscreen = false; // Used to determine if app in fullscreen mode
+        this.storedX = 0; // Used to store X before fullscreen
+        this.storedY = 0; // Used to store Y before fullscreen
+        this.width = width;
+        this.height = height;
+        this.storedWidth = width; // Used to store width before fullscreen
+        this.storedHeight = height; // Used to store height before fullscreen
+        this.title = title;
+        this.monitor = monitor;
+        this.share = share;
+        this.attributes = GLFW.hints;
+        this.inputModes = {
+          0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
+          0x00033002:0, // GLFW_STICKY_KEYS
+          0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
+        };
+        this.buttons = 0;
+        this.keys = new Array();
+        this.domKeys = new Array();
+        this.shouldClose = 0;
+        this.title = null;
+        this.windowPosFunc = null; // GLFWwindowposfun
+        this.windowSizeFunc = null; // GLFWwindowsizefun
+        this.windowCloseFunc = null; // GLFWwindowclosefun
+        this.windowRefreshFunc = null; // GLFWwindowrefreshfun
+        this.windowFocusFunc = null; // GLFWwindowfocusfun
+        this.windowIconifyFunc = null; // GLFWwindowiconifyfun
+        this.framebufferSizeFunc = null; // GLFWframebuffersizefun
+        this.mouseButtonFunc = null; // GLFWmousebuttonfun
+        this.cursorPosFunc = null; // GLFWcursorposfun
+        this.cursorEnterFunc = null; // GLFWcursorenterfun
+        this.scrollFunc = null; // GLFWscrollfun
+        this.dropFunc = null; // GLFWdropfun
+        this.keyFunc = null; // GLFWkeyfun
+        this.charFunc = null; // GLFWcharfun
+        this.userptr = null;
+      },WindowFromId:function (id) {
+        if (id <= 0 || !GLFW.windows) return null;
+        return GLFW.windows[id - 1];
+      },joystickFunc:null,errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
+        switch (keycode) {
+          // these keycodes are only defined for GLFW3, assume they are the same for GLFW2
+          case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
+          case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
+          case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
+          case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
+          case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
+          case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
+          case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
+          case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
+          case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
+          case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
+          case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
+          case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
+          case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
+          case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
+          case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
+          case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
+          case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
+          case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
+          case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+          case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
+          case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
+          case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
+          case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
+          case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
+          case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
+          case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
+          case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
+          case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
+          case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
+          case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
+          case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
+          case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
+          case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
+          case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
+          case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
+          case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
+          case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
+          case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
+          case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
+          case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
+          case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
+          case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
+          case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
+          case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
+          case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
+          case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
+          case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
+          case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
+          case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
+          case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
+          
+  
+          case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
+          case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
+          case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
+          case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
+          case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
+          case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
+          case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
+          case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
+          case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
+          case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
+          case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
+          case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
+          case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
+          case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
+          case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
+          case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
+          case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
+          case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
+          case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
+          case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
+          case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
+          case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
+          case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
+          case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
+          case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
+          case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
+          case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
+          case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
+          case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
+          case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
+          case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
+          case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
+          case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
+          case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
+          case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
+          case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
+          case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
+          case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
+          case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
+          case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
+          case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
+          case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
+          case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
+          case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
+          case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
+          case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
+          case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
+          case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
+          case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
+          case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
+          case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
+          case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
+          case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
+          case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
+          case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
+          case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
+          case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
+          case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
+          case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
+          // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
+          // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
+          case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
+          case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
+          case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
+          case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
+          // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
+          // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
+          // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
+          // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
+          case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
+          // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
+          default:return -1; // GLFW_KEY_UNKNOWN
+        };
+      },getModBits:function (win) {
+        var mod = 0;
+        if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
+        if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
+        if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
+        if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
+        return mod;
+      },onKeyPress:function (event) {
+        if (!GLFW.active || !GLFW.active.charFunc) return;
+        if (event.ctrlKey || event.metaKey) return;
+  
+        // correct unicode charCode is only available with onKeyPress event
+        var charCode = event.charCode;
+        if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
+  
+  
+        dynCall_vii(GLFW.active.charFunc, GLFW.active.id, charCode);
+      },onKeyChanged:function (keyCode, status) {
+        if (!GLFW.active) return;
+  
+        var key = GLFW.DOMToGLFWKeyCode(keyCode);
+        if (key == -1) return;
+  
+        var repeat = status && GLFW.active.keys[key];
+        GLFW.active.keys[key] = status;
+        GLFW.active.domKeys[keyCode] = status;
+        if (!GLFW.active.keyFunc) return;
+  
+  
+        if (repeat) status = 2; // GLFW_REPEAT
+        dynCall_viiiii(GLFW.active.keyFunc, GLFW.active.id, key, keyCode, status, GLFW.getModBits(GLFW.active));
+      },onGamepadConnected:function (event) {
+        GLFW.refreshJoysticks();
+      },onGamepadDisconnected:function (event) {
+        GLFW.refreshJoysticks();
+      },onKeydown:function (event) {
+        GLFW.onKeyChanged(event.keyCode, 1); // GLFW_PRESS or GLFW_REPEAT
+  
+        // This logic comes directly from the sdl implementation. We cannot
+        // call preventDefault on all keydown events otherwise onKeyPress will
+        // not get called
+        if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
+          event.preventDefault();
+        }
+      },onKeyup:function (event) {
+        GLFW.onKeyChanged(event.keyCode, 0); // GLFW_RELEASE
+      },onBlur:function (event) {
+        if (!GLFW.active) return;
+  
+        for (var i = 0; i < GLFW.active.domKeys.length; ++i) {
+          if (GLFW.active.domKeys[i]) {
+            GLFW.onKeyChanged(i, 0); // GLFW_RELEASE
+          }
+        }
+      },onMousemove:function (event) {
+        if (!GLFW.active) return;
+  
+        Browser.calculateMouseEvent(event);
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
+  
+  
+        dynCall_vidd(GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
+      },DOMToGLFWMouseButton:function (event) {
+        // DOM and glfw have different button codes.
+        // See http://www.w3schools.com/jsref/event_button.asp.
+        var eventButton = event['button'];
+        if (eventButton > 0) {
+          if (eventButton == 1) {
+            eventButton = 2;
+          } else {
+            eventButton = 1;
+          }
+        }
+        return eventButton;
+      },onMouseenter:function (event) {
+        if (!GLFW.active) return;
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+  
+        dynCall_vii(GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
+      },onMouseleave:function (event) {
+        if (!GLFW.active) return;
+  
+        if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
+  
+        dynCall_vii(GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
+      },onMouseButtonChanged:function (event, status) {
+        if (!GLFW.active) return;
+  
+        Browser.calculateMouseEvent(event);
+  
+        if (event.target != Module["canvas"]) return;
+  
+        var eventButton = GLFW.DOMToGLFWMouseButton(event);
+  
+        if (status == 1) { // GLFW_PRESS
+          GLFW.active.buttons |= (1 << eventButton);
+          try {
+            event.target.setCapture();
+          } catch (e) {}
+        } else {  // GLFW_RELEASE
+          GLFW.active.buttons &= ~(1 << eventButton);
+        }
+  
+        if (!GLFW.active.mouseButtonFunc) return;
+  
+  
+        dynCall_viiii(GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
+      },onMouseButtonDown:function (event) {
+        if (!GLFW.active) return;
+        GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
+      },onMouseButtonUp:function (event) {
+        if (!GLFW.active) return;
+        GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
+      },onMouseWheel:function (event) {
+        // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
+        var delta = -Browser.getMouseWheelDelta(event);
+        delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
+        GLFW.wheelPos += delta;
+  
+        if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
+  
+  
+        var sx = 0;
+        var sy = 0;
+        if (event.type == 'mousewheel') {
+          sx = event.wheelDeltaX;
+          sy = event.wheelDeltaY;
+        } else {
+          sx = event.deltaX;
+          sy = event.deltaY;
+        }
+  
+        dynCall_vidd(GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
+  
+        event.preventDefault();
+      },onCanvasResize:function (width, height) {
+        if (!GLFW.active) return;
+  
+        var resizeNeeded = true;
+  
+        // If the client is requesting fullscreen mode
+        if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
+          GLFW.active.storedX = GLFW.active.x;
+          GLFW.active.storedY = GLFW.active.y;
+          GLFW.active.storedWidth = GLFW.active.width;
+          GLFW.active.storedHeight = GLFW.active.height;
+          GLFW.active.x = GLFW.active.y = 0;
+          GLFW.active.width = screen.width;
+          GLFW.active.height = screen.height;
+          GLFW.active.fullscreen = true;
+  
+        // If the client is reverting from fullscreen mode
+        } else if (GLFW.active.fullscreen == true) {
+          GLFW.active.x = GLFW.active.storedX;
+          GLFW.active.y = GLFW.active.storedY;
+          GLFW.active.width = GLFW.active.storedWidth;
+          GLFW.active.height = GLFW.active.storedHeight;
+          GLFW.active.fullscreen = false;
+  
+        // If the width/height values do not match current active window sizes
+        } else if (GLFW.active.width != width || GLFW.active.height != height) {
+            GLFW.active.width = width;
+            GLFW.active.height = height;
+        } else {
+          resizeNeeded = false;
+        }
+  
+        // If any of the above conditions were true, we need to resize the canvas
+        if (resizeNeeded) {
+          // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
+          Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
+          // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
+          // the canvas should drive window and framebuffer size respectfully.
+          GLFW.onWindowSizeChanged();
+          GLFW.onFramebufferSizeChanged();
+        }
+      },onWindowSizeChanged:function () {
+        if (!GLFW.active) return;
+  
+        if (!GLFW.active.windowSizeFunc) return;
+  
+  
+        dynCall_viii(GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+      },onFramebufferSizeChanged:function () {
+        if (!GLFW.active) return;
+  
+        if (!GLFW.active.framebufferSizeFunc) return;
+  
+        dynCall_viii(GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
+      },requestFullscreen:function () {
+        var RFS = Module["canvas"]['requestFullscreen'] ||
+                  Module["canvas"]['mozRequestFullScreen'] ||
+                  Module["canvas"]['webkitRequestFullScreen'] ||
+                  (function() {});
+        RFS.apply(Module["canvas"], []);
+      },requestFullScreen:function () {
+        err('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
+        GLFW.requestFullScreen = function() {
+          return GLFW.requestFullscreen();
+        }
+        return GLFW.requestFullscreen();
+      },exitFullscreen:function () {
+        Browser.exitFullscreen();
+      },cancelFullScreen:function () {
+        err('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
+        GLFW.cancelFullScreen = function() {
+          return GLFW.exitFullscreen();
+        }
+        return GLFW.exitFullscreen();
+      },getTime:function () {
+        return _emscripten_get_now() / 1000;
+      },setWindowTitle:function (winid, title) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        win.title = UTF8ToString(title);
+        if (GLFW.active.id == win.id) {
+          document.title = win.title;
+        }
+      },setJoystickCallback:function (cbfun) {
+        GLFW.joystickFunc = cbfun;
+        GLFW.refreshJoysticks();
+      },joys:{},lastGamepadState:null,lastGamepadStateFrame:null,refreshJoysticks:function () {
+        // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
+        if (Browser.mainLoop.currentFrameNumber !== GLFW.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
+          GLFW.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
+          GLFW.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
+  
+          for (var joy = 0; joy < GLFW.lastGamepadState.length; ++joy) {
+            var gamepad = GLFW.lastGamepadState[joy];
+  
+            if (gamepad) {
+              if (!GLFW.joys[joy]) {
+                console.log('glfw joystick connected:',joy);
+                GLFW.joys[joy] = {
+                  id: allocate(intArrayFromString(gamepad.id), 'i8', ALLOC_NORMAL),
+                  buttonsCount: gamepad.buttons.length,
+                  axesCount: gamepad.axes.length,
+                  buttons: allocate(new Array(gamepad.buttons.length), 'i8', ALLOC_NORMAL),
+                  axes: allocate(new Array(gamepad.axes.length*4), 'float', ALLOC_NORMAL)
+                };
+  
+                if (GLFW.joystickFunc) {
+                  dynCall_vii(GLFW.joystickFunc, joy, 0x00040001); // GLFW_CONNECTED
+                }
+              }
+  
+              var data = GLFW.joys[joy];
+  
+              for (var i = 0; i < gamepad.buttons.length;  ++i) {
+                setValue(data.buttons + i, gamepad.buttons[i].pressed, 'i8');
+              }
+  
+              for (var i = 0; i < gamepad.axes.length; ++i) {
+                setValue(data.axes + i*4, gamepad.axes[i], 'float');
+              }
+            } else {
+              if (GLFW.joys[joy]) {
+                console.log('glfw joystick disconnected',joy);
+  
+                if (GLFW.joystickFunc) {
+                  dynCall_vii(GLFW.joystickFunc, joy, 0x00040002); // GLFW_DISCONNECTED
+                }
+  
+                _free(GLFW.joys[joy].id);
+                _free(GLFW.joys[joy].buttons);
+                _free(GLFW.joys[joy].axes);
+  
+                delete GLFW.joys[joy];
+              }
+            }
+          }
+        }
+      },setKeyCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.keyFunc = cbfun;
+      },setCharCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.charFunc = cbfun;
+      },setMouseButtonCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.mouseButtonFunc = cbfun;
+      },setCursorPosCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.cursorPosFunc = cbfun;
+      },setScrollCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.scrollFunc = cbfun;
+      },setDropCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.dropFunc = cbfun;
+      },onDrop:function (event) {
+        if (!GLFW.active || !GLFW.active.dropFunc) return;
+        if (!event.dataTransfer || !event.dataTransfer.files || event.dataTransfer.files.length == 0) return;
+  
+        event.preventDefault();
+  
+  
+        return false;
+      },onDragover:function (event) {
+        if (!GLFW.active || !GLFW.active.dropFunc) return;
+  
+        event.preventDefault();
+        return false;
+      },setWindowSizeCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowSizeFunc = cbfun;
+       
+      },setWindowCloseCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowCloseFunc = cbfun;
+      },setWindowRefreshCallback:function (winid, cbfun) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.windowRefreshFunc = cbfun;
+      },onClickRequestPointerLock:function (e) {
+        if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
+          Module['canvas'].requestPointerLock();
+          e.preventDefault();
+        }
+      },setInputMode:function (winid, mode, value) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        switch(mode) {
+          case 0x00033001: { // GLFW_CURSOR
+            switch(value) {
+              case 0x00034001: { // GLFW_CURSOR_NORMAL
+                win.inputModes[mode] = value;
+                Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
+                Module['canvas'].exitPointerLock();
+                break;
+              }
+              case 0x00034002: { // GLFW_CURSOR_HIDDEN
+                console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
+                break;
+              }
+              case 0x00034003: { // GLFW_CURSOR_DISABLED
+                win.inputModes[mode] = value;
+                Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
+                Module['canvas'].requestPointerLock();
+                break;
+              }
+              default: {
+                console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
+                break;
+              }
+            }
+            break;
+          }
+          case 0x00033002: { // GLFW_STICKY_KEYS
+            console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
+            break;
+          }
+          case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
+            console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
+            break;
+          }
+          default: {
+            console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
+            break;
+          }
+        }
+      },getKey:function (winid, key) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return 0;
+        return win.keys[key];
+      },getMouseButton:function (winid, button) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return 0;
+        return (win.buttons & (1 << button)) > 0;
+      },getCursorPos:function (winid, x, y) {
+        setValue(x, Browser.mouseX, 'double');
+        setValue(y, Browser.mouseY, 'double');
+      },getMousePos:function (winid, x, y) {
+        setValue(x, Browser.mouseX, 'i32');
+        setValue(y, Browser.mouseY, 'i32');
+      },setCursorPos:function (winid, x, y) {
+      },getWindowPos:function (winid, x, y) {
+        var wx = 0;
+        var wy = 0;
+  
+        var win = GLFW.WindowFromId(winid);
+        if (win) {
+          wx = win.x;
+          wy = win.y;
+        }
+  
+        setValue(x, wx, 'i32');
+        setValue(y, wy, 'i32');
+      },setWindowPos:function (winid, x, y) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+        win.x = x;
+        win.y = y;
+      },getWindowSize:function (winid, width, height) {
+        var ww = 0;
+        var wh = 0;
+  
+        var win = GLFW.WindowFromId(winid);
+        if (win) {
+          ww = win.width;
+          wh = win.height;
+        }
+  
+        setValue(width, ww, 'i32');
+        setValue(height, wh, 'i32');
+      },setWindowSize:function (winid, width, height) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        if (GLFW.active.id == win.id) {
+          if (width == screen.width && height == screen.height) {
+            GLFW.requestFullscreen();
+          } else {
+            GLFW.exitFullscreen();
+            Browser.setCanvasSize(width, height);
+            win.width = width;
+            win.height = height;
+          }
+        }
+  
+        if (!win.windowSizeFunc) return;
+  
+  
+        dynCall_viii(win.windowSizeFunc, win.id, width, height);
+      },createWindow:function (width, height, title, monitor, share) {
+        var i, id;
+        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
+        if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
+  
+        // id for window
+        id = i + 1;
+  
+        // not valid
+        if (width <= 0 || height <= 0) return 0;
+  
+        if (monitor) {
+          GLFW.requestFullscreen();
+        } else {
+          Browser.setCanvasSize(width, height);
+        }
+  
+        // Create context when there are no existing alive windows
+        for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
+        if (i == GLFW.windows.length) {
+          var contextAttributes = {
+            antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
+            depth: (GLFW.hints[0x00021005] > 0),     // GLFW_DEPTH_BITS
+            stencil: (GLFW.hints[0x00021006] > 0),   // GLFW_STENCIL_BITS
+            alpha: (GLFW.hints[0x00021004] > 0)      // GLFW_ALPHA_BITS 
+          }
+          Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
+        }
+  
+        // If context creation failed, do not return a valid window
+        if (!Module.ctx) return 0;
+  
+        // Get non alive id
+        var win = new GLFW.Window(id, width, height, title, monitor, share);
+  
+        // Set window to array
+        if (id - 1 == GLFW.windows.length) {
+          GLFW.windows.push(win);
+        } else {
+          GLFW.windows[id - 1] = win;
+        }
+  
+        GLFW.active = win;
+        return win.id;
+      },destroyWindow:function (winid) {
+        var win = GLFW.WindowFromId(winid);
+        if (!win) return;
+  
+        if (win.windowCloseFunc)
+          dynCall_vi(win.windowCloseFunc, win.id);
+  
+        GLFW.windows[win.id - 1] = null;
+        if (GLFW.active.id == win.id)
+          GLFW.active = null;
+  
+        // Destroy context when no alive windows
+        for (var i = 0; i < GLFW.windows.length; i++)
+          if (GLFW.windows[i] !== null) return;
+  
+        Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
+      },swapBuffers:function (winid) {
+      },GLFW2ParamToGLFW3Param:function (param) {
+        var table = {
+          0x00030001:0, // GLFW_MOUSE_CURSOR
+          0x00030002:0, // GLFW_STICKY_KEYS
+          0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
+          0x00030004:0, // GLFW_SYSTEM_KEYS
+          0x00030005:0, // GLFW_KEY_REPEAT
+          0x00030006:0, // GLFW_AUTO_POLL_EVENTS
+          0x00020001:0, // GLFW_OPENED
+          0x00020002:0, // GLFW_ACTIVE
+          0x00020003:0, // GLFW_ICONIFIED
+          0x00020004:0, // GLFW_ACCELERATED
+          0x00020005:0x00021001, // GLFW_RED_BITS
+          0x00020006:0x00021002, // GLFW_GREEN_BITS
+          0x00020007:0x00021003, // GLFW_BLUE_BITS
+          0x00020008:0x00021004, // GLFW_ALPHA_BITS
+          0x00020009:0x00021005, // GLFW_DEPTH_BITS
+          0x0002000A:0x00021006, // GLFW_STENCIL_BITS
+          0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
+          0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
+          0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
+          0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
+          0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
+          0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
+          0x00020011:0x0002100C, // GLFW_STEREO
+          0x00020012:0, // GLFW_WINDOW_NO_RESIZE
+          0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
+          0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
+          0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
+          0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
+          0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
+          0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
+        };
+        return table[param];
+      }};function _glfwCreateWindow(width, height, title, monitor, share) {
+      return GLFW.createWindow(width, height, title, monitor, share);
+    }
+
+  function _glfwDefaultWindowHints() {
+      GLFW.hints = GLFW.defaultHints;
+    }
+
+  function _glfwDestroyWindow(winid) {
+      return GLFW.destroyWindow(winid);
+    }
+
+  function _glfwGetCursorPos(winid, x, y) {
+      GLFW.getCursorPos(winid, x, y);
+    }
+
+  function _glfwGetPrimaryMonitor() {
+      return 1;
+    }
+
+  function _glfwGetTime() {
+      return GLFW.getTime() - GLFW.initialTime;
+    }
+
+  function _glfwGetVideoModes(monitor, count) {
+      setValue(count, 0, 'i32');
+      return 0;
+    }
+
+  function _glfwInit() {
+      if (GLFW.windows) return 1; // GL_TRUE
+  
+      GLFW.initialTime = GLFW.getTime();
+      GLFW.hints = GLFW.defaultHints;
+      GLFW.windows = new Array()
+      GLFW.active = null;
+  
+      window.addEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+      window.addEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+      window.addEventListener("keydown", GLFW.onKeydown, true);
+      window.addEventListener("keypress", GLFW.onKeyPress, true);
+      window.addEventListener("keyup", GLFW.onKeyup, true);
+      window.addEventListener("blur", GLFW.onBlur, true);
+      Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
+      Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
+      Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
+      Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
+      Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
+      Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
+      Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
+      Module["canvas"].addEventListener('drop', GLFW.onDrop, true);
+      Module["canvas"].addEventListener('dragover', GLFW.onDragover, true);
+  
+      Browser.resizeListeners.push(function(width, height) {
+         GLFW.onCanvasResize(width, height);
+      });
+      return 1; // GL_TRUE
+    }
+
+  function _glfwMakeContextCurrent(winid) {}
+
+  function _glfwSetCharCallback(winid, cbfun) {
+      GLFW.setCharCallback(winid, cbfun);
+    }
+
+  function _glfwSetCursorEnterCallback(winid, cbfun) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.cursorEnterFunc = cbfun;
+    }
+
+  function _glfwSetCursorPosCallback(winid, cbfun) {
+      GLFW.setCursorPosCallback(winid, cbfun);
+    }
+
+  function _glfwSetDropCallback(winid, cbfun) {
+      GLFW.setDropCallback(winid, cbfun);
+    }
+
+  function _glfwSetErrorCallback(cbfun) {
+      GLFW.errorFunc = cbfun;
+    }
+
+  function _glfwSetKeyCallback(winid, cbfun) {
+      GLFW.setKeyCallback(winid, cbfun);
+    }
+
+  function _glfwSetMouseButtonCallback(winid, cbfun) {
+      GLFW.setMouseButtonCallback(winid, cbfun);
+    }
+
+  function _glfwSetScrollCallback(winid, cbfun) {
+      GLFW.setScrollCallback(winid, cbfun);
+    }
+
+  function _glfwSetWindowIconifyCallback(winid, cbfun) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.windowIconifyFunc = cbfun;
+    }
+
+  function _glfwSetWindowShouldClose(winid, value) {
+      var win = GLFW.WindowFromId(winid);
+      if (!win) return;
+      win.shouldClose = value;
+    }
+
+  function _glfwSetWindowSizeCallback(winid, cbfun) {
+      GLFW.setWindowSizeCallback(winid, cbfun);
+    }
+
+  function _glfwSwapBuffers(winid) {
+      GLFW.swapBuffers(winid);
+    }
+
+  function _glfwSwapInterval(interval) {
+      interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
+      if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
+      else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
+    }
+
+  function _glfwTerminate() {
+      window.removeEventListener("gamepadconnected", GLFW.onGamepadConnected, true);
+      window.removeEventListener("gamepaddisconnected", GLFW.onGamepadDisconnected, true);
+      window.removeEventListener("keydown", GLFW.onKeydown, true);
+      window.removeEventListener("keypress", GLFW.onKeyPress, true);
+      window.removeEventListener("keyup", GLFW.onKeyup, true);
+      window.removeEventListener("blur", GLFW.onBlur, true);
+      Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
+      Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
+      Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
+      Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
+      Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
+      Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
+      Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
+      Module["canvas"].removeEventListener('drop', GLFW.onDrop, true);
+      Module["canvas"].removeEventListener('dragover', GLFW.onDragover, true);
+  
+  
+      Module["canvas"].width = Module["canvas"].height = 1;
+      GLFW.windows = null;
+      GLFW.active = null;
+    }
+
+  function _glfwWindowHint(target, hint) {
+      GLFW.hints[target] = hint;
+    }
+
+  function _llvm_exp2_f32(x) {
+      return Math.pow(2, x);
+    }
+
+  
+   
+
+  function _llvm_stackrestore(p) {
+      var self = _llvm_stacksave;
+      var ret = self.LLVM_SAVEDSTACKS[p];
+      self.LLVM_SAVEDSTACKS.splice(p, 1);
+      stackRestore(ret);
+    }
+
+  function _llvm_stacksave() {
+      var self = _llvm_stacksave;
+      if (!self.LLVM_SAVEDSTACKS) {
+        self.LLVM_SAVEDSTACKS = [];
+      }
+      self.LLVM_SAVEDSTACKS.push(stackSave());
+      return self.LLVM_SAVEDSTACKS.length-1;
+    }
+
+  
+  function _emscripten_memcpy_big(dest, src, num) {
+      HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
+    }
+  
+   
+
+   
+
+   
+
+  
+  function _usleep(useconds) {
+      // int usleep(useconds_t useconds);
+      // http://pubs.opengroup.org/onlinepubs/000095399/functions/usleep.html
+      // We're single-threaded, so use a busy loop. Super-ugly.
+      var msec = useconds / 1000;
+      if ((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']) {
+        var start = self['performance']['now']();
+        while (self['performance']['now']() - start < msec) {
+          // Do nothing.
+        }
+      } else {
+        var start = Date.now();
+        while (Date.now() - start < msec) {
+          // Do nothing.
+        }
+      }
+      return 0;
+    }function _nanosleep(rqtp, rmtp) {
+      // int nanosleep(const struct timespec  *rqtp, struct timespec *rmtp);
+      var seconds = HEAP32[((rqtp)>>2)];
+      var nanoseconds = HEAP32[(((rqtp)+(4))>>2)];
+      if (rmtp !== 0) {
+        HEAP32[((rmtp)>>2)]=0;
+        HEAP32[(((rmtp)+(4))>>2)]=0;
+      }
+      return _usleep((seconds * 1e6) + (nanoseconds / 1000));
+    }
+
+  function _pthread_attr_destroy(attr) {
+      /* int pthread_attr_destroy(pthread_attr_t *attr); */
+      //FIXME: should destroy the pthread_attr_t struct
+      return 0;
+    }
+
+  function _pthread_attr_init(attr) {
+      /* int pthread_attr_init(pthread_attr_t *attr); */
+      //FIXME: should allocate a pthread_attr_t
+      return 0;
+    }
+
+  function _pthread_cond_destroy() { return 0; }
+
+  function _pthread_cond_init() { return 0; }
+
+  function _pthread_cond_signal() { return 0; }
+
+  function _pthread_cond_wait() { return 0; }
+
+  function _pthread_create() {
+      return 11;
+    }
+
+  function _pthread_join() {}
+
+   
+
+  function _time(ptr) {
+      var ret = (Date.now()/1000)|0;
+      if (ptr) {
+        HEAP32[((ptr)>>2)]=ret;
+      }
+      return ret;
+    }
+
+FS.staticInit();Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
+if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
+Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { err("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
+  Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
+  Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
+  Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
+  Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
+  Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
+  Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
+  Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
+if (ENVIRONMENT_IS_NODE) {
+    _emscripten_get_now = function _emscripten_get_now_actual() {
+      var t = process['hrtime']();
+      return t[0] * 1e3 + t[1] / 1e6;
+    };
+  } else if (typeof dateNow !== 'undefined') {
+    _emscripten_get_now = dateNow;
+  } else if (typeof performance === 'object' && performance && typeof performance['now'] === 'function') {
+    _emscripten_get_now = function() { return performance['now'](); };
+  } else {
+    _emscripten_get_now = Date.now;
+  };
+var GLctx; GL.init();
+for (var i = 0; i < 32; i++) __tempFixedLengthArray.push(new Array(i));;
+var ASSERTIONS = true;
+
+// Copyright 2017 The Emscripten Authors.  All rights reserved.
+// Emscripten is available under two separate licenses, the MIT license and the
+// University of Illinois/NCSA Open Source License.  Both these licenses can be
+// found in the LICENSE file.
+
+/** @type {function(string, boolean=, number=)} */
+function intArrayFromString(stringy, dontAddNull, length) {
+  var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
+  var u8array = new Array(len);
+  var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
+  if (dontAddNull) u8array.length = numBytesWritten;
+  return u8array;
+}
+
+function intArrayToString(array) {
+  var ret = [];
+  for (var i = 0; i < array.length; i++) {
+    var chr = array[i];
+    if (chr > 0xFF) {
+      if (ASSERTIONS) {
+        assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ')  at offset ' + i + ' not in 0x00-0xFF.');
+      }
+      chr &= 0xFF;
+    }
+    ret.push(String.fromCharCode(chr));
+  }
+  return ret.join('');
+}
+
+
+// ASM_LIBRARY EXTERN PRIMITIVES: Math_floor,Math_ceil,Int8Array,Int32Array
+
+
+function nullFunc_ff(x) { err("Invalid function pointer called with signature 'ff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_fff(x) { err("Invalid function pointer called with signature 'fff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_i(x) { err("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_ii(x) { err("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iidiiii(x) { err("Invalid function pointer called with signature 'iidiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iii(x) { err("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiii(x) { err("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiii(x) { err("Invalid function pointer called with signature 'iiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_iiiiii(x) { err("Invalid function pointer called with signature 'iiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_jiji(x) { err("Invalid function pointer called with signature 'jiji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_jijii(x) { err("Invalid function pointer called with signature 'jijii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_v(x) { err("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vf(x) { err("Invalid function pointer called with signature 'vf'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vff(x) { err("Invalid function pointer called with signature 'vff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vffff(x) { err("Invalid function pointer called with signature 'vffff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vfi(x) { err("Invalid function pointer called with signature 'vfi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vi(x) { err("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vidd(x) { err("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vif(x) { err("Invalid function pointer called with signature 'vif'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viff(x) { err("Invalid function pointer called with signature 'viff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vifff(x) { err("Invalid function pointer called with signature 'vifff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viffff(x) { err("Invalid function pointer called with signature 'viffff'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_vii(x) { err("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viif(x) { err("Invalid function pointer called with signature 'viif'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viii(x) { err("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiii(x) { err("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiii(x) { err("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiii(x) { err("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiiiiiiii(x) { err("Invalid function pointer called with signature 'viiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+function nullFunc_viiji(x) { err("Invalid function pointer called with signature 'viiji'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)");  err("Build with ASSERTIONS=2 for more info.");abort(x) }
+
+var asmGlobalArg = {}
+
+var asmLibraryArg = {
+  "abort": abort,
+  "setTempRet0": setTempRet0,
+  "getTempRet0": getTempRet0,
+  "abortStackOverflow": abortStackOverflow,
+  "nullFunc_ff": nullFunc_ff,
+  "nullFunc_fff": nullFunc_fff,
+  "nullFunc_i": nullFunc_i,
+  "nullFunc_ii": nullFunc_ii,
+  "nullFunc_iidiiii": nullFunc_iidiiii,
+  "nullFunc_iii": nullFunc_iii,
+  "nullFunc_iiii": nullFunc_iiii,
+  "nullFunc_iiiii": nullFunc_iiiii,
+  "nullFunc_iiiiii": nullFunc_iiiiii,
+  "nullFunc_jiji": nullFunc_jiji,
+  "nullFunc_jijii": nullFunc_jijii,
+  "nullFunc_v": nullFunc_v,
+  "nullFunc_vf": nullFunc_vf,
+  "nullFunc_vff": nullFunc_vff,
+  "nullFunc_vffff": nullFunc_vffff,
+  "nullFunc_vfi": nullFunc_vfi,
+  "nullFunc_vi": nullFunc_vi,
+  "nullFunc_vidd": nullFunc_vidd,
+  "nullFunc_vif": nullFunc_vif,
+  "nullFunc_viff": nullFunc_viff,
+  "nullFunc_vifff": nullFunc_vifff,
+  "nullFunc_viffff": nullFunc_viffff,
+  "nullFunc_vii": nullFunc_vii,
+  "nullFunc_viif": nullFunc_viif,
+  "nullFunc_viii": nullFunc_viii,
+  "nullFunc_viiii": nullFunc_viiii,
+  "nullFunc_viiiii": nullFunc_viiiii,
+  "nullFunc_viiiiii": nullFunc_viiiiii,
+  "nullFunc_viiiiiii": nullFunc_viiiiiii,
+  "nullFunc_viiiiiiii": nullFunc_viiiiiiii,
+  "nullFunc_viiiiiiiii": nullFunc_viiiiiiiii,
+  "nullFunc_viiji": nullFunc_viiji,
+  "___assert_fail": ___assert_fail,
+  "___lock": ___lock,
+  "___setErrNo": ___setErrNo,
+  "___syscall140": ___syscall140,
+  "___syscall145": ___syscall145,
+  "___syscall146": ___syscall146,
+  "___syscall221": ___syscall221,
+  "___syscall5": ___syscall5,
+  "___syscall54": ___syscall54,
+  "___syscall6": ___syscall6,
+  "___unlock": ___unlock,
+  "__computeUnpackAlignedImageSize": __computeUnpackAlignedImageSize,
+  "__fillFullscreenChangeEventData": __fillFullscreenChangeEventData,
+  "__fillGamepadEventData": __fillGamepadEventData,
+  "__fillMouseEventData": __fillMouseEventData,
+  "__fillPointerlockChangeEventData": __fillPointerlockChangeEventData,
+  "__findEventTarget": __findEventTarget,
+  "__glGenObject": __glGenObject,
+  "__registerFullscreenChangeEventCallback": __registerFullscreenChangeEventCallback,
+  "__registerGamepadEventCallback": __registerGamepadEventCallback,
+  "__registerKeyEventCallback": __registerKeyEventCallback,
+  "__registerMouseEventCallback": __registerMouseEventCallback,
+  "__registerTouchEventCallback": __registerTouchEventCallback,
+  "__requestPointerLock": __requestPointerLock,
+  "_eglGetProcAddress": _eglGetProcAddress,
+  "_emscripten_asm_const_ii": _emscripten_asm_const_ii,
+  "_emscripten_asm_const_iii": _emscripten_asm_const_iii,
+  "_emscripten_asm_const_iiiiii": _emscripten_asm_const_iiiiii,
+  "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock,
+  "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status,
+  "_emscripten_get_heap_size": _emscripten_get_heap_size,
+  "_emscripten_get_now": _emscripten_get_now,
+  "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads,
+  "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status,
+  "_emscripten_glActiveTexture": _emscripten_glActiveTexture,
+  "_emscripten_glAttachShader": _emscripten_glAttachShader,
+  "_emscripten_glBeginQueryEXT": _emscripten_glBeginQueryEXT,
+  "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation,
+  "_emscripten_glBindBuffer": _emscripten_glBindBuffer,
+  "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer,
+  "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer,
+  "_emscripten_glBindTexture": _emscripten_glBindTexture,
+  "_emscripten_glBindVertexArrayOES": _emscripten_glBindVertexArrayOES,
+  "_emscripten_glBlendColor": _emscripten_glBlendColor,
+  "_emscripten_glBlendEquation": _emscripten_glBlendEquation,
+  "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate,
+  "_emscripten_glBlendFunc": _emscripten_glBlendFunc,
+  "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate,
+  "_emscripten_glBufferData": _emscripten_glBufferData,
+  "_emscripten_glBufferSubData": _emscripten_glBufferSubData,
+  "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus,
+  "_emscripten_glClear": _emscripten_glClear,
+  "_emscripten_glClearColor": _emscripten_glClearColor,
+  "_emscripten_glClearDepthf": _emscripten_glClearDepthf,
+  "_emscripten_glClearStencil": _emscripten_glClearStencil,
+  "_emscripten_glColorMask": _emscripten_glColorMask,
+  "_emscripten_glCompileShader": _emscripten_glCompileShader,
+  "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D,
+  "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D,
+  "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D,
+  "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D,
+  "_emscripten_glCreateProgram": _emscripten_glCreateProgram,
+  "_emscripten_glCreateShader": _emscripten_glCreateShader,
+  "_emscripten_glCullFace": _emscripten_glCullFace,
+  "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers,
+  "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers,
+  "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram,
+  "_emscripten_glDeleteQueriesEXT": _emscripten_glDeleteQueriesEXT,
+  "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers,
+  "_emscripten_glDeleteShader": _emscripten_glDeleteShader,
+  "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures,
+  "_emscripten_glDeleteVertexArraysOES": _emscripten_glDeleteVertexArraysOES,
+  "_emscripten_glDepthFunc": _emscripten_glDepthFunc,
+  "_emscripten_glDepthMask": _emscripten_glDepthMask,
+  "_emscripten_glDepthRangef": _emscripten_glDepthRangef,
+  "_emscripten_glDetachShader": _emscripten_glDetachShader,
+  "_emscripten_glDisable": _emscripten_glDisable,
+  "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray,
+  "_emscripten_glDrawArrays": _emscripten_glDrawArrays,
+  "_emscripten_glDrawArraysInstancedANGLE": _emscripten_glDrawArraysInstancedANGLE,
+  "_emscripten_glDrawBuffersWEBGL": _emscripten_glDrawBuffersWEBGL,
+  "_emscripten_glDrawElements": _emscripten_glDrawElements,
+  "_emscripten_glDrawElementsInstancedANGLE": _emscripten_glDrawElementsInstancedANGLE,
+  "_emscripten_glEnable": _emscripten_glEnable,
+  "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray,
+  "_emscripten_glEndQueryEXT": _emscripten_glEndQueryEXT,
+  "_emscripten_glFinish": _emscripten_glFinish,
+  "_emscripten_glFlush": _emscripten_glFlush,
+  "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer,
+  "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D,
+  "_emscripten_glFrontFace": _emscripten_glFrontFace,
+  "_emscripten_glGenBuffers": _emscripten_glGenBuffers,
+  "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers,
+  "_emscripten_glGenQueriesEXT": _emscripten_glGenQueriesEXT,
+  "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers,
+  "_emscripten_glGenTextures": _emscripten_glGenTextures,
+  "_emscripten_glGenVertexArraysOES": _emscripten_glGenVertexArraysOES,
+  "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap,
+  "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib,
+  "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform,
+  "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders,
+  "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation,
+  "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv,
+  "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv,
+  "_emscripten_glGetError": _emscripten_glGetError,
+  "_emscripten_glGetFloatv": _emscripten_glGetFloatv,
+  "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv,
+  "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv,
+  "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog,
+  "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv,
+  "_emscripten_glGetQueryObjecti64vEXT": _emscripten_glGetQueryObjecti64vEXT,
+  "_emscripten_glGetQueryObjectivEXT": _emscripten_glGetQueryObjectivEXT,
+  "_emscripten_glGetQueryObjectui64vEXT": _emscripten_glGetQueryObjectui64vEXT,
+  "_emscripten_glGetQueryObjectuivEXT": _emscripten_glGetQueryObjectuivEXT,
+  "_emscripten_glGetQueryivEXT": _emscripten_glGetQueryivEXT,
+  "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv,
+  "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog,
+  "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat,
+  "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource,
+  "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv,
+  "_emscripten_glGetString": _emscripten_glGetString,
+  "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv,
+  "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv,
+  "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation,
+  "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv,
+  "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv,
+  "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv,
+  "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv,
+  "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv,
+  "_emscripten_glHint": _emscripten_glHint,
+  "_emscripten_glIsBuffer": _emscripten_glIsBuffer,
+  "_emscripten_glIsEnabled": _emscripten_glIsEnabled,
+  "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer,
+  "_emscripten_glIsProgram": _emscripten_glIsProgram,
+  "_emscripten_glIsQueryEXT": _emscripten_glIsQueryEXT,
+  "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer,
+  "_emscripten_glIsShader": _emscripten_glIsShader,
+  "_emscripten_glIsTexture": _emscripten_glIsTexture,
+  "_emscripten_glIsVertexArrayOES": _emscripten_glIsVertexArrayOES,
+  "_emscripten_glLineWidth": _emscripten_glLineWidth,
+  "_emscripten_glLinkProgram": _emscripten_glLinkProgram,
+  "_emscripten_glPixelStorei": _emscripten_glPixelStorei,
+  "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset,
+  "_emscripten_glQueryCounterEXT": _emscripten_glQueryCounterEXT,
+  "_emscripten_glReadPixels": _emscripten_glReadPixels,
+  "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler,
+  "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage,
+  "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage,
+  "_emscripten_glScissor": _emscripten_glScissor,
+  "_emscripten_glShaderBinary": _emscripten_glShaderBinary,
+  "_emscripten_glShaderSource": _emscripten_glShaderSource,
+  "_emscripten_glStencilFunc": _emscripten_glStencilFunc,
+  "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate,
+  "_emscripten_glStencilMask": _emscripten_glStencilMask,
+  "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate,
+  "_emscripten_glStencilOp": _emscripten_glStencilOp,
+  "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate,
+  "_emscripten_glTexImage2D": _emscripten_glTexImage2D,
+  "_emscripten_glTexParameterf": _emscripten_glTexParameterf,
+  "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv,
+  "_emscripten_glTexParameteri": _emscripten_glTexParameteri,
+  "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv,
+  "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D,
+  "_emscripten_glUniform1f": _emscripten_glUniform1f,
+  "_emscripten_glUniform1fv": _emscripten_glUniform1fv,
+  "_emscripten_glUniform1i": _emscripten_glUniform1i,
+  "_emscripten_glUniform1iv": _emscripten_glUniform1iv,
+  "_emscripten_glUniform2f": _emscripten_glUniform2f,
+  "_emscripten_glUniform2fv": _emscripten_glUniform2fv,
+  "_emscripten_glUniform2i": _emscripten_glUniform2i,
+  "_emscripten_glUniform2iv": _emscripten_glUniform2iv,
+  "_emscripten_glUniform3f": _emscripten_glUniform3f,
+  "_emscripten_glUniform3fv": _emscripten_glUniform3fv,
+  "_emscripten_glUniform3i": _emscripten_glUniform3i,
+  "_emscripten_glUniform3iv": _emscripten_glUniform3iv,
+  "_emscripten_glUniform4f": _emscripten_glUniform4f,
+  "_emscripten_glUniform4fv": _emscripten_glUniform4fv,
+  "_emscripten_glUniform4i": _emscripten_glUniform4i,
+  "_emscripten_glUniform4iv": _emscripten_glUniform4iv,
+  "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv,
+  "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv,
+  "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv,
+  "_emscripten_glUseProgram": _emscripten_glUseProgram,
+  "_emscripten_glValidateProgram": _emscripten_glValidateProgram,
+  "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f,
+  "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv,
+  "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f,
+  "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv,
+  "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f,
+  "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv,
+  "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f,
+  "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv,
+  "_emscripten_glVertexAttribDivisorANGLE": _emscripten_glVertexAttribDivisorANGLE,
+  "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer,
+  "_emscripten_glViewport": _emscripten_glViewport,
+  "_emscripten_memcpy_big": _emscripten_memcpy_big,
+  "_emscripten_request_pointerlock": _emscripten_request_pointerlock,
+  "_emscripten_resize_heap": _emscripten_resize_heap,
+  "_emscripten_run_script": _emscripten_run_script,
+  "_emscripten_sample_gamepad_data": _emscripten_sample_gamepad_data,
+  "_emscripten_set_click_callback_on_thread": _emscripten_set_click_callback_on_thread,
+  "_emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread,
+  "_emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread,
+  "_emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread,
+  "_emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread,
+  "_emscripten_set_main_loop": _emscripten_set_main_loop,
+  "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing,
+  "_emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread,
+  "_emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread,
+  "_emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread,
+  "_emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread,
+  "_exit": _exit,
+  "_glActiveTexture": _glActiveTexture,
+  "_glAttachShader": _glAttachShader,
+  "_glBindAttribLocation": _glBindAttribLocation,
+  "_glBindBuffer": _glBindBuffer,
+  "_glBindTexture": _glBindTexture,
+  "_glBlendFunc": _glBlendFunc,
+  "_glBufferData": _glBufferData,
+  "_glBufferSubData": _glBufferSubData,
+  "_glClear": _glClear,
+  "_glClearColor": _glClearColor,
+  "_glClearDepthf": _glClearDepthf,
+  "_glCompileShader": _glCompileShader,
+  "_glCompressedTexImage2D": _glCompressedTexImage2D,
+  "_glCreateProgram": _glCreateProgram,
+  "_glCreateShader": _glCreateShader,
+  "_glCullFace": _glCullFace,
+  "_glDeleteBuffers": _glDeleteBuffers,
+  "_glDeleteProgram": _glDeleteProgram,
+  "_glDeleteShader": _glDeleteShader,
+  "_glDeleteTextures": _glDeleteTextures,
+  "_glDepthFunc": _glDepthFunc,
+  "_glDetachShader": _glDetachShader,
+  "_glDisable": _glDisable,
+  "_glDisableVertexAttribArray": _glDisableVertexAttribArray,
+  "_glDrawArrays": _glDrawArrays,
+  "_glDrawElements": _glDrawElements,
+  "_glEnable": _glEnable,
+  "_glEnableVertexAttribArray": _glEnableVertexAttribArray,
+  "_glFrontFace": _glFrontFace,
+  "_glGenBuffers": _glGenBuffers,
+  "_glGenTextures": _glGenTextures,
+  "_glGetAttribLocation": _glGetAttribLocation,
+  "_glGetFloatv": _glGetFloatv,
+  "_glGetProgramInfoLog": _glGetProgramInfoLog,
+  "_glGetProgramiv": _glGetProgramiv,
+  "_glGetShaderInfoLog": _glGetShaderInfoLog,
+  "_glGetShaderiv": _glGetShaderiv,
+  "_glGetString": _glGetString,
+  "_glGetUniformLocation": _glGetUniformLocation,
+  "_glLinkProgram": _glLinkProgram,
+  "_glPixelStorei": _glPixelStorei,
+  "_glReadPixels": _glReadPixels,
+  "_glShaderSource": _glShaderSource,
+  "_glTexImage2D": _glTexImage2D,
+  "_glTexParameteri": _glTexParameteri,
+  "_glUniform1i": _glUniform1i,
+  "_glUniform4f": _glUniform4f,
+  "_glUniformMatrix4fv": _glUniformMatrix4fv,
+  "_glUseProgram": _glUseProgram,
+  "_glVertexAttribPointer": _glVertexAttribPointer,
+  "_glViewport": _glViewport,
+  "_glfwCreateWindow": _glfwCreateWindow,
+  "_glfwDefaultWindowHints": _glfwDefaultWindowHints,
+  "_glfwDestroyWindow": _glfwDestroyWindow,
+  "_glfwGetCursorPos": _glfwGetCursorPos,
+  "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor,
+  "_glfwGetTime": _glfwGetTime,
+  "_glfwGetVideoModes": _glfwGetVideoModes,
+  "_glfwInit": _glfwInit,
+  "_glfwMakeContextCurrent": _glfwMakeContextCurrent,
+  "_glfwSetCharCallback": _glfwSetCharCallback,
+  "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback,
+  "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback,
+  "_glfwSetDropCallback": _glfwSetDropCallback,
+  "_glfwSetErrorCallback": _glfwSetErrorCallback,
+  "_glfwSetKeyCallback": _glfwSetKeyCallback,
+  "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback,
+  "_glfwSetScrollCallback": _glfwSetScrollCallback,
+  "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback,
+  "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose,
+  "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback,
+  "_glfwSwapBuffers": _glfwSwapBuffers,
+  "_glfwSwapInterval": _glfwSwapInterval,
+  "_glfwTerminate": _glfwTerminate,
+  "_glfwWindowHint": _glfwWindowHint,
+  "_llvm_exp2_f32": _llvm_exp2_f32,
+  "_llvm_stackrestore": _llvm_stackrestore,
+  "_llvm_stacksave": _llvm_stacksave,
+  "_nanosleep": _nanosleep,
+  "_pthread_attr_destroy": _pthread_attr_destroy,
+  "_pthread_attr_init": _pthread_attr_init,
+  "_pthread_cond_destroy": _pthread_cond_destroy,
+  "_pthread_cond_init": _pthread_cond_init,
+  "_pthread_cond_signal": _pthread_cond_signal,
+  "_pthread_cond_wait": _pthread_cond_wait,
+  "_pthread_create": _pthread_create,
+  "_pthread_join": _pthread_join,
+  "_time": _time,
+  "_usleep": _usleep,
+  "abortOnCannotGrowMemory": abortOnCannotGrowMemory,
+  "emscriptenWebGLGet": emscriptenWebGLGet,
+  "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData,
+  "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform,
+  "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib,
+  "stringToNewUTF8": stringToNewUTF8,
+  "tempDoublePtr": tempDoublePtr,
+  "DYNAMICTOP_PTR": DYNAMICTOP_PTR
+}
+// EMSCRIPTEN_START_ASM
+var asm =Module["asm"]// EMSCRIPTEN_END_ASM
+(asmGlobalArg, asmLibraryArg, buffer);
+
+var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real____errno_location.apply(null, arguments);
+};
+
+var real__emscripten_GetProcAddress = asm["_emscripten_GetProcAddress"]; asm["_emscripten_GetProcAddress"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__emscripten_GetProcAddress.apply(null, arguments);
+};
+
+var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__fflush.apply(null, arguments);
+};
+
+var real__free = asm["_free"]; asm["_free"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__free.apply(null, arguments);
+};
+
+var real__llvm_round_f32 = asm["_llvm_round_f32"]; asm["_llvm_round_f32"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__llvm_round_f32.apply(null, arguments);
+};
+
+var real__ma_device_process_pcm_frames_capture__webaudio = asm["_ma_device_process_pcm_frames_capture__webaudio"]; asm["_ma_device_process_pcm_frames_capture__webaudio"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__ma_device_process_pcm_frames_capture__webaudio.apply(null, arguments);
+};
+
+var real__ma_device_process_pcm_frames_playback__webaudio = asm["_ma_device_process_pcm_frames_playback__webaudio"]; asm["_ma_device_process_pcm_frames_playback__webaudio"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__ma_device_process_pcm_frames_playback__webaudio.apply(null, arguments);
+};
+
+var real__main = asm["_main"]; asm["_main"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__main.apply(null, arguments);
+};
+
+var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__malloc.apply(null, arguments);
+};
+
+var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__memmove.apply(null, arguments);
+};
+
+var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__sbrk.apply(null, arguments);
+};
+
+var real__strstr = asm["_strstr"]; asm["_strstr"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real__strstr.apply(null, arguments);
+};
+
+var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real_establishStackSpace.apply(null, arguments);
+};
+
+var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real_stackAlloc.apply(null, arguments);
+};
+
+var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real_stackRestore.apply(null, arguments);
+};
+
+var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return real_stackSave.apply(null, arguments);
+};
+Module["asm"] = asm;
+var ___errno_location = Module["___errno_location"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["___errno_location"].apply(null, arguments) };
+var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_emscripten_GetProcAddress"].apply(null, arguments) };
+var _fflush = Module["_fflush"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_fflush"].apply(null, arguments) };
+var _free = Module["_free"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_free"].apply(null, arguments) };
+var _llvm_round_f32 = Module["_llvm_round_f32"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_llvm_round_f32"].apply(null, arguments) };
+var _ma_device_process_pcm_frames_capture__webaudio = Module["_ma_device_process_pcm_frames_capture__webaudio"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_ma_device_process_pcm_frames_capture__webaudio"].apply(null, arguments) };
+var _ma_device_process_pcm_frames_playback__webaudio = Module["_ma_device_process_pcm_frames_playback__webaudio"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_ma_device_process_pcm_frames_playback__webaudio"].apply(null, arguments) };
+var _main = Module["_main"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_main"].apply(null, arguments) };
+var _malloc = Module["_malloc"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_malloc"].apply(null, arguments) };
+var _memcpy = Module["_memcpy"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_memcpy"].apply(null, arguments) };
+var _memmove = Module["_memmove"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_memmove"].apply(null, arguments) };
+var _memset = Module["_memset"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_memset"].apply(null, arguments) };
+var _sbrk = Module["_sbrk"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_sbrk"].apply(null, arguments) };
+var _strstr = Module["_strstr"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["_strstr"].apply(null, arguments) };
+var establishStackSpace = Module["establishStackSpace"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["establishStackSpace"].apply(null, arguments) };
+var stackAlloc = Module["stackAlloc"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["stackAlloc"].apply(null, arguments) };
+var stackRestore = Module["stackRestore"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["stackRestore"].apply(null, arguments) };
+var stackSave = Module["stackSave"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["stackSave"].apply(null, arguments) };
+var dynCall_ff = Module["dynCall_ff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_ff"].apply(null, arguments) };
+var dynCall_fff = Module["dynCall_fff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_fff"].apply(null, arguments) };
+var dynCall_i = Module["dynCall_i"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_i"].apply(null, arguments) };
+var dynCall_ii = Module["dynCall_ii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_ii"].apply(null, arguments) };
+var dynCall_iidiiii = Module["dynCall_iidiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_iidiiii"].apply(null, arguments) };
+var dynCall_iii = Module["dynCall_iii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_iii"].apply(null, arguments) };
+var dynCall_iiii = Module["dynCall_iiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_iiii"].apply(null, arguments) };
+var dynCall_iiiii = Module["dynCall_iiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_iiiii"].apply(null, arguments) };
+var dynCall_iiiiii = Module["dynCall_iiiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_iiiiii"].apply(null, arguments) };
+var dynCall_jiji = Module["dynCall_jiji"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_jiji"].apply(null, arguments) };
+var dynCall_jijii = Module["dynCall_jijii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_jijii"].apply(null, arguments) };
+var dynCall_v = Module["dynCall_v"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_v"].apply(null, arguments) };
+var dynCall_vf = Module["dynCall_vf"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vf"].apply(null, arguments) };
+var dynCall_vff = Module["dynCall_vff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vff"].apply(null, arguments) };
+var dynCall_vffff = Module["dynCall_vffff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vffff"].apply(null, arguments) };
+var dynCall_vfi = Module["dynCall_vfi"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vfi"].apply(null, arguments) };
+var dynCall_vi = Module["dynCall_vi"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vi"].apply(null, arguments) };
+var dynCall_vidd = Module["dynCall_vidd"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vidd"].apply(null, arguments) };
+var dynCall_vif = Module["dynCall_vif"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vif"].apply(null, arguments) };
+var dynCall_viff = Module["dynCall_viff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viff"].apply(null, arguments) };
+var dynCall_vifff = Module["dynCall_vifff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vifff"].apply(null, arguments) };
+var dynCall_viffff = Module["dynCall_viffff"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viffff"].apply(null, arguments) };
+var dynCall_vii = Module["dynCall_vii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_vii"].apply(null, arguments) };
+var dynCall_viif = Module["dynCall_viif"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viif"].apply(null, arguments) };
+var dynCall_viii = Module["dynCall_viii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viii"].apply(null, arguments) };
+var dynCall_viiii = Module["dynCall_viiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiii"].apply(null, arguments) };
+var dynCall_viiiii = Module["dynCall_viiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiiii"].apply(null, arguments) };
+var dynCall_viiiiii = Module["dynCall_viiiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiiiii"].apply(null, arguments) };
+var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments) };
+var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments) };
+var dynCall_viiji = Module["dynCall_viiji"] = function() {
+  assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
+  assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
+  return Module["asm"]["dynCall_viiji"].apply(null, arguments) };
+;
+
+
+
+// === Auto-generated postamble setup entry stuff ===
+
+Module['asm'] = asm;
+
+if (!Module["intArrayFromString"]) Module["intArrayFromString"] = function() { abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["intArrayToString"]) Module["intArrayToString"] = function() { abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["ccall"]) Module["ccall"] = function() { abort("'ccall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["cwrap"]) Module["cwrap"] = function() { abort("'cwrap' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["setValue"]) Module["setValue"] = function() { abort("'setValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getValue"]) Module["getValue"] = function() { abort("'getValue' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["allocate"]) Module["allocate"] = function() { abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["getMemory"] = getMemory;
+if (!Module["AsciiToString"]) Module["AsciiToString"] = function() { abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToAscii"]) Module["stringToAscii"] = function() { abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF8ArrayToString"]) Module["UTF8ArrayToString"] = function() { abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF8ToString"]) Module["UTF8ToString"] = function() { abort("'UTF8ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF8Array"]) Module["stringToUTF8Array"] = function() { abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF8"]) Module["stringToUTF8"] = function() { abort("'stringToUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF8"]) Module["lengthBytesUTF8"] = function() { abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF16ToString"]) Module["UTF16ToString"] = function() { abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF16"]) Module["stringToUTF16"] = function() { abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF16"]) Module["lengthBytesUTF16"] = function() { abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["UTF32ToString"]) Module["UTF32ToString"] = function() { abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stringToUTF32"]) Module["stringToUTF32"] = function() { abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["lengthBytesUTF32"]) Module["lengthBytesUTF32"] = function() { abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["allocateUTF8"]) Module["allocateUTF8"] = function() { abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackTrace"]) Module["stackTrace"] = function() { abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPreRun"]) Module["addOnPreRun"] = function() { abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnInit"]) Module["addOnInit"] = function() { abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPreMain"]) Module["addOnPreMain"] = function() { abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnExit"]) Module["addOnExit"] = function() { abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addOnPostRun"]) Module["addOnPostRun"] = function() { abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeStringToMemory"]) Module["writeStringToMemory"] = function() { abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeArrayToMemory"]) Module["writeArrayToMemory"] = function() { abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["writeAsciiToMemory"]) Module["writeAsciiToMemory"] = function() { abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["addRunDependency"] = addRunDependency;
+Module["removeRunDependency"] = removeRunDependency;
+if (!Module["ENV"]) Module["ENV"] = function() { abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["FS"]) Module["FS"] = function() { abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+Module["FS_createFolder"] = FS.createFolder;
+Module["FS_createPath"] = FS.createPath;
+Module["FS_createDataFile"] = FS.createDataFile;
+Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
+Module["FS_createLazyFile"] = FS.createLazyFile;
+Module["FS_createLink"] = FS.createLink;
+Module["FS_createDevice"] = FS.createDevice;
+Module["FS_unlink"] = FS.unlink;
+if (!Module["GL"]) Module["GL"] = function() { abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["dynamicAlloc"]) Module["dynamicAlloc"] = function() { abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["warnOnce"]) Module["warnOnce"] = function() { abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["loadDynamicLibrary"]) Module["loadDynamicLibrary"] = function() { abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["loadWebAssemblyModule"]) Module["loadWebAssemblyModule"] = function() { abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getLEB"]) Module["getLEB"] = function() { abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getFunctionTables"]) Module["getFunctionTables"] = function() { abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["alignFunctionTables"]) Module["alignFunctionTables"] = function() { abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["registerFunctions"]) Module["registerFunctions"] = function() { abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["addFunction"]) Module["addFunction"] = function() { abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["removeFunction"]) Module["removeFunction"] = function() { abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getFuncWrapper"]) Module["getFuncWrapper"] = function() { abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["prettyPrint"]) Module["prettyPrint"] = function() { abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["makeBigInt"]) Module["makeBigInt"] = function() { abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["dynCall"]) Module["dynCall"] = function() { abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getCompilerSetting"]) Module["getCompilerSetting"] = function() { abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackSave"]) Module["stackSave"] = function() { abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackRestore"]) Module["stackRestore"] = function() { abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["stackAlloc"]) Module["stackAlloc"] = function() { abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["establishStackSpace"]) Module["establishStackSpace"] = function() { abort("'establishStackSpace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["print"]) Module["print"] = function() { abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["printErr"]) Module["printErr"] = function() { abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["getTempRet0"]) Module["getTempRet0"] = function() { abort("'getTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["setTempRet0"]) Module["setTempRet0"] = function() { abort("'setTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };
+if (!Module["Pointer_stringify"]) Module["Pointer_stringify"] = function() { abort("'Pointer_stringify' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") };if (!Module["ALLOC_NORMAL"]) Object.defineProperty(Module, "ALLOC_NORMAL", { get: function() { abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_STACK"]) Object.defineProperty(Module, "ALLOC_STACK", { get: function() { abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_DYNAMIC"]) Object.defineProperty(Module, "ALLOC_DYNAMIC", { get: function() { abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+if (!Module["ALLOC_NONE"]) Object.defineProperty(Module, "ALLOC_NONE", { get: function() { abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)") } });
+
+
+
+
+/**
+ * @constructor
+ * @extends {Error}
+ * @this {ExitStatus}
+ */
+function ExitStatus(status) {
+  this.name = "ExitStatus";
+  this.message = "Program terminated with exit(" + status + ")";
+  this.status = status;
+};
+ExitStatus.prototype = new Error();
+ExitStatus.prototype.constructor = ExitStatus;
+
+var calledMain = false;
+
+dependenciesFulfilled = function runCaller() {
+  // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
+  if (!Module['calledRun']) run();
+  if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
+}
+
+Module['callMain'] = function callMain(args) {
+  assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])');
+  assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
+
+  args = args || [];
+
+  ensureInitRuntime();
+
+  var argc = args.length+1;
+  var argv = stackAlloc((argc + 1) * 4);
+  HEAP32[argv >> 2] = allocateUTF8OnStack(Module['thisProgram']);
+  for (var i = 1; i < argc; i++) {
+    HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]);
+  }
+  HEAP32[(argv >> 2) + argc] = 0;
+
+
+  try {
+
+    var ret = Module['_main'](argc, argv, 0);
+
+
+    // if we're not running an evented main loop, it's time to exit
+      exit(ret, /* implicit = */ true);
+  }
+  catch(e) {
+    if (e instanceof ExitStatus) {
+      // exit() throws this once it's done to make sure execution
+      // has been stopped completely
+      return;
+    } else if (e == 'SimulateInfiniteLoop') {
+      // running an evented main loop, don't immediately exit
+      Module['noExitRuntime'] = true;
+      return;
+    } else {
+      var toLog = e;
+      if (e && typeof e === 'object' && e.stack) {
+        toLog = [e, e.stack];
+      }
+      err('exception thrown: ' + toLog);
+      Module['quit'](1, e);
+    }
+  } finally {
+    calledMain = true;
+  }
+}
+
+
+
+
+/** @type {function(Array=)} */
+function run(args) {
+  args = args || Module['arguments'];
+
+  if (runDependencies > 0) {
+    return;
+  }
+
+  writeStackCookie();
+
+  preRun();
+
+  if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
+  if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
+
+  function doRun() {
+    if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
+    Module['calledRun'] = true;
+
+    if (ABORT) return;
+
+    ensureInitRuntime();
+
+    preMain();
+
+    if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
+
+    if (Module['_main'] && shouldRunNow) Module['callMain'](args);
+
+    postRun();
+  }
+
+  if (Module['setStatus']) {
+    Module['setStatus']('Running...');
+    setTimeout(function() {
+      setTimeout(function() {
+        Module['setStatus']('');
+      }, 1);
+      doRun();
+    }, 1);
+  } else {
+    doRun();
+  }
+  checkStackCookie();
+}
+Module['run'] = run;
+
+function checkUnflushedContent() {
+  // Compiler settings do not allow exiting the runtime, so flushing
+  // the streams is not possible. but in ASSERTIONS mode we check
+  // if there was something to flush, and if so tell the user they
+  // should request that the runtime be exitable.
+  // Normally we would not even include flush() at all, but in ASSERTIONS
+  // builds we do so just for this check, and here we see if there is any
+  // content to flush, that is, we check if there would have been
+  // something a non-ASSERTIONS build would have not seen.
+  // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0
+  // mode (which has its own special function for this; otherwise, all
+  // the code is inside libc)
+  var print = out;
+  var printErr = err;
+  var has = false;
+  out = err = function(x) {
+    has = true;
+  }
+  try { // it doesn't matter if it fails
+    var flush = Module['_fflush'];
+    if (flush) flush(0);
+    // also flush in the JS FS layer
+    ['stdout', 'stderr'].forEach(function(name) {
+      var info = FS.analyzePath('/dev/' + name);
+      if (!info) return;
+      var stream = info.object;
+      var rdev = stream.rdev;
+      var tty = TTY.ttys[rdev];
+      if (tty && tty.output && tty.output.length) {
+        has = true;
+      }
+    });
+  } catch(e) {}
+  out = print;
+  err = printErr;
+  if (has) {
+    warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the FAQ), or make sure to emit a newline when you printf etc.');
+  }
+}
+
+function exit(status, implicit) {
+  checkUnflushedContent();
+
+  // if this is just main exit-ing implicitly, and the status is 0, then we
+  // don't need to do anything here and can just leave. if the status is
+  // non-zero, though, then we need to report it.
+  // (we may have warned about this earlier, if a situation justifies doing so)
+  if (implicit && Module['noExitRuntime'] && status === 0) {
+    return;
+  }
+
+  if (Module['noExitRuntime']) {
+    // if exit() was called, we may warn the user if the runtime isn't actually being shut down
+    if (!implicit) {
+      err('exit(' + status + ') called, but EXIT_RUNTIME is not set, so halting execution but not exiting the runtime or preventing further async execution (build with EXIT_RUNTIME=1, if you want a true shutdown)');
+    }
+  } else {
+
+    ABORT = true;
+    EXITSTATUS = status;
+
+    exitRuntime();
+
+    if (Module['onExit']) Module['onExit'](status);
+  }
+
+  Module['quit'](status, new ExitStatus(status));
+}
+
+var abortDecorators = [];
+
+function abort(what) {
+  if (Module['onAbort']) {
+    Module['onAbort'](what);
+  }
+
+  if (what !== undefined) {
+    out(what);
+    err(what);
+    what = JSON.stringify(what)
+  } else {
+    what = '';
+  }
+
+  ABORT = true;
+  EXITSTATUS = 1;
+
+  var extra = '';
+  var output = 'abort(' + what + ') at ' + stackTrace() + extra;
+  if (abortDecorators) {
+    abortDecorators.forEach(function(decorator) {
+      output = decorator(output, what);
+    });
+  }
+  throw output;
+}
+Module['abort'] = abort;
+
+if (Module['preInit']) {
+  if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
+  while (Module['preInit'].length > 0) {
+    Module['preInit'].pop()();
+  }
+}
+
+// shouldRunNow refers to calling main(), not run().
+var shouldRunNow = true;
+if (Module['noInitialRun']) {
+  shouldRunNow = false;
+}
+
+  Module["noExitRuntime"] = true;
+
+run();
+
+
+
+
+
+// {{MODULE_ADDITIONS}}
+
+
+
diff --git a/examples/web/audio/audio_music_stream.wasm b/examples/web/audio/audio_music_stream.wasm
index 35fc535..36e94a7 100644
--- a/examples/web/audio/audio_music_stream.wasm
+++ b/examples/web/audio/audio_music_stream.wasm
author	Ray <[email protected]>	2019-05-22 16:23:23 +0200
committer	Ray <[email protected]>	2019-05-22 16:23:23 +0200
commit	7ebb1f34d2dac05a834528ae63a8ad91b2b94b64 (patch)
tree	d0ef00a4df6169a9f9443495883f0f98c2f6b6b7 /examples
parent	c12d0c359e85476dc2cdc3aa1d41ee41eedaa8db (diff)
download	raylib.com-7ebb1f34d2dac05a834528ae63a8ad91b2b94b64.tar.gz raylib.com-7ebb1f34d2dac05a834528ae63a8ad91b2b94b64.zip